diff --git a/examples/port_datasets/openx_rlds.py b/examples/port_datasets/openx_rlds.py new file mode 100644 index 000000000..4ac2791cd --- /dev/null +++ b/examples/port_datasets/openx_rlds.py @@ -0,0 +1,308 @@ +#!/usr/bin/env python + +# Copyright 2024 The HuggingFace Inc. team. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. +""" +For all datasets in the RLDS format. +For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets. + +NOTE: You need to install tensorflow and tensorflow_datsets before running this script. + +Example: + python openx_rlds.py \ + --raw-dir /path/to/bridge_orig/1.0.0 \ + --local-dir /path/to/local_dir \ + --repo-id your_id \ + --use-videos \ + --push-to-hub +""" + +import argparse +import os +import re +import shutil +import sys +from functools import partial +from pathlib import Path + +import numpy as np +import tensorflow as tf +import tensorflow_datasets as tfds + +from lerobot.common.datasets.lerobot_dataset import LEROBOT_HOME, LeRobotDataset + +current_dir = os.path.dirname(os.path.abspath(__file__)) +oxe_utils_dir = os.path.join(current_dir, "oxe_utils") +sys.path.append(oxe_utils_dir) + +from oxe_utils.configs import OXE_DATASET_CONFIGS, StateEncoding +from oxe_utils.transforms import OXE_STANDARDIZATION_TRANSFORMS + +np.set_printoptions(precision=2) + + +def transform_raw_dataset(episode, dataset_name): + traj = next(iter(episode["steps"].batch(episode["steps"].cardinality()))) + + if dataset_name in OXE_STANDARDIZATION_TRANSFORMS: + traj = OXE_STANDARDIZATION_TRANSFORMS[dataset_name](traj) + + if dataset_name in OXE_DATASET_CONFIGS: + state_obs_keys = OXE_DATASET_CONFIGS[dataset_name]["state_obs_keys"] + else: + state_obs_keys = [None for _ in range(8)] + + proprio = tf.concat( + [ + ( + tf.zeros((tf.shape(traj["action"])[0], 1), dtype=tf.float32) # padding + if key is None + else tf.cast(traj["observation"][key], tf.float32) + ) + for key in state_obs_keys + ], + axis=1, + ) + + traj.update( + { + "proprio": proprio, + "task": traj.pop("language_instruction"), + "action": tf.cast(traj["action"], tf.float32), + } + ) + + episode["steps"] = traj + return episode + + +def generate_features_from_raw(builder: tfds.core.DatasetBuilder, use_videos: bool = True): + dataset_name = builder.name + + state_names = [f"motor_{i}" for i in range(8)] + if dataset_name in OXE_DATASET_CONFIGS: + state_encoding = OXE_DATASET_CONFIGS[dataset_name]["state_encoding"] + if state_encoding == StateEncoding.POS_EULER: + state_names = ["x", "y", "z", "roll", "pitch", "yaw", "pad", "gripper"] + if "libero" in dataset_name: + state_names = ["x", "y", "z", "roll", "pitch", "yaw", "gripper", "gripper"] # 2D gripper state + elif state_encoding == StateEncoding.POS_QUAT: + state_names = ["x", "y", "z", "rx", "ry", "rz", "rw", "gripper"] + + DEFAULT_FEATURES = { + "observation.state": { + "dtype": "float32", + "shape": (8,), + "names": {"motors": state_names}, + }, + "action": { + "dtype": "float32", + "shape": (7,), + "names": {"motors": ["x", "y", "z", "roll", "pitch", "yaw", "gripper"]}, + }, + } + + obs = builder.info.features["steps"]["observation"] + features = { + f"observation.images.{key}": { + "dtype": "video" if use_videos else "image", + "shape": value.shape, + "names": ["height", "width", "rgb"], + } + for key, value in obs.items() + if "depth" not in key and any(x in key for x in ["image", "rgb"]) + } + return {**features, **DEFAULT_FEATURES} + + +def save_as_lerobot_dataset(lerobot_dataset: LeRobotDataset, raw_dataset: tf.data.Dataset, **kwargs): + for episode in raw_dataset.as_numpy_iterator(): + traj = episode["steps"] + for i in range(traj["action"].shape[0]): + image_dict = { + f"observation.images.{key}": value[i] + for key, value in traj["observation"].items() + if "depth" not in key and any(x in key for x in ["image", "rgb"]) + } + lerobot_dataset.add_frame( + { + **image_dict, + "observation.state": traj["proprio"][i], + "action": traj["action"][i], + } + ) + lerobot_dataset.save_episode(task=traj["task"][0].decode()) + + lerobot_dataset.consolidate( + run_compute_stats=True, + keep_image_files=kwargs["keep_images"], + stat_kwargs={"batch_size": kwargs["batch_size"], "num_workers": kwargs["num_workers"]}, + ) + + +def create_lerobot_dataset( + raw_dir: Path, + repo_id: str = None, + local_dir: Path = None, + push_to_hub: bool = False, + fps: int = None, + robot_type: str = None, + use_videos: bool = True, + batch_size: int = 32, + num_workers: int = 8, + image_writer_process: int = 5, + image_writer_threads: int = 10, + keep_images: bool = True, +): + last_part = raw_dir.name + if re.match(r"^\d+\.\d+\.\d+$", last_part): + version = last_part + dataset_name = raw_dir.parent.name + data_dir = raw_dir.parent.parent + else: + version = "" + dataset_name = last_part + data_dir = raw_dir.parent + + if local_dir is None: + local_dir = Path(LEROBOT_HOME) + local_dir /= f"{dataset_name}_{version}_lerobot" + if local_dir.exists(): + shutil.rmtree(local_dir) + + builder = tfds.builder(dataset_name, data_dir=data_dir, version=version) + features = generate_features_from_raw(builder, use_videos) + raw_dataset = builder.as_dataset(split="train").map(partial(transform_raw_dataset, dataset_name=dataset_name)) + + if fps is None: + if dataset_name in OXE_DATASET_CONFIGS: + fps = OXE_DATASET_CONFIGS[dataset_name]["control_frequency"] + else: + fps = 10 + + if robot_type is None: + if dataset_name in OXE_DATASET_CONFIGS: + robot_type = OXE_DATASET_CONFIGS[dataset_name]["robot_type"] + robot_type = robot_type.lower().replace(" ", "_").replace("-", "_") + else: + robot_type = "unknown" + + lerobot_dataset = LeRobotDataset.create( + repo_id=repo_id, + robot_type=robot_type, + root=local_dir, + fps=fps, + use_videos=use_videos, + features=features, + image_writer_threads=image_writer_threads, + image_writer_processes=image_writer_process, + ) + + save_as_lerobot_dataset( + lerobot_dataset, raw_dataset, keep_images=keep_images, batch_size=batch_size, num_workers=num_workers + ) + + if push_to_hub: + assert repo_id is not None + tags = ["LeRobot", dataset_name, "rlds"] + if dataset_name in OXE_DATASET_CONFIGS: + tags.append("openx") + if robot_type != "unknown": + tags.append(robot_type) + lerobot_dataset.push_to_hub( + tags=tags, + private=False, + push_videos=True, + license="apache-2.0", + ) + + +def main(): + parser = argparse.ArgumentParser() + + parser.add_argument( + "--raw-dir", + type=Path, + required=True, + help="Directory containing input raw datasets (e.g. `path/to/dataset` or `path/to/dataset/version).", + ) + parser.add_argument( + "--local-dir", + type=Path, + required=True, + help="When provided, writes the dataset converted to LeRobotDataset format in this directory (e.g. `data/lerobot/aloha_mobile_chair`).", + ) + parser.add_argument( + "--repo-id", + type=str, + help="Repositery identifier on Hugging Face: a community or a user name `/` the name of the dataset, required when push-to-hub is True", + ) + parser.add_argument( + "--push-to-hub", + action="store_true", + help="Upload to hub.", + ) + parser.add_argument( + "--robot-type", + type=str, + default=None, + help="Robot type of this dataset.", + ) + parser.add_argument( + "--fps", + type=int, + default=None, + help="Frame rate used to collect videos. Default fps equals to the control frequency of the robot.", + ) + parser.add_argument( + "--use-videos", + action="store_true", + help="Convert each episode of the raw dataset to an mp4 video. This option allows 60 times lower disk space consumption and 25 faster loading time during training.", + ) + parser.add_argument( + "--batch-size", + type=int, + default=32, + help="Batch size loaded by DataLoader for computing the dataset statistics.", + ) + parser.add_argument( + "--num-workers", + type=int, + default=8, + help="Number of processes of Dataloader for computing the dataset statistics.", + ) + parser.add_argument( + "--image-writer-process", + type=int, + default=5, + help="Number of processes of image writer for saving images.", + ) + parser.add_argument( + "--image-writer-threads", + type=int, + default=10, + help="Number of threads per process of image writer for saving images.", + ) + parser.add_argument( + "--keep-images", + action="store_true", + help="Whether to keep the cached images.", + ) + + args = parser.parse_args() + create_lerobot_dataset(**vars(args)) + + +if __name__ == "__main__": + main() diff --git a/examples/port_datasets/oxe_utils/configs.py b/examples/port_datasets/oxe_utils/configs.py new file mode 100644 index 000000000..02522f811 --- /dev/null +++ b/examples/port_datasets/oxe_utils/configs.py @@ -0,0 +1,848 @@ +""" +Adapt from https://github.com/openvla/openvla/blob/main/prismatic/vla/datasets/rlds/oxe/configs.py +configs.py + +Defines per-dataset configuration (kwargs) for each dataset in Open-X Embodiment. + +Configuration adopts the following structure: + image_obs_keys: + primary: primary external RGB + secondary: secondary external RGB + wrist: wrist RGB + + depth_obs_keys: + primary: primary external depth + secondary: secondary external depth + wrist: wrist depth + + # Always 8-dim =>> changes based on `StateEncoding` + state_obs_keys: + StateEncoding.POS_EULER: EEF XYZ (3) + Roll-Pitch-Yaw (3) + (1) + Gripper Open/Close (1) + StateEncoding.POS_QUAT: EEF XYZ (3) + Quaternion (4) + Gripper Open/Close (1) + StateEncoding.JOINT: Joint Angles (7, if fewer) + Gripper Open/Close (1) + + state_encoding: Type of `StateEncoding` + action_encoding: Type of action encoding (e.g., EEF Position vs. Joint Position) +""" + +from enum import IntEnum +from typing import Dict + +import tensorflow as tf + + +def zero_action_filter(traj: Dict) -> bool: + """ + Filters transitions whose actions are all-0 (only relative actions, no gripper action). + Note: this filter is applied *after* action normalization, so need to compare to "normalized 0". + """ + DROID_Q01 = tf.convert_to_tensor( + [ + -0.7776297926902771, + -0.5803514122962952, + -0.5795090794563293, + -0.6464047729969025, + -0.7041108310222626, + -0.8895104378461838, + ] + ) + DROID_Q99 = tf.convert_to_tensor( + [ + 0.7597932070493698, + 0.5726242214441299, + 0.7351000607013702, + 0.6705610305070877, + 0.6464948207139969, + 0.8897542208433151, + ] + ) + DROID_NORM_0_ACT = 2 * (tf.zeros_like(traj["action"][:, :6]) - DROID_Q01) / (DROID_Q99 - DROID_Q01 + 1e-8) - 1 + + return tf.reduce_any(tf.math.abs(traj["action"][:, :6] - DROID_NORM_0_ACT) > 1e-5) + + +# Defines Proprioceptive State Encoding Schemes +class StateEncoding(IntEnum): + # fmt: off + NONE = -1 # No Proprioceptive State + POS_EULER = 1 # EEF XYZ (3) + Roll-Pitch-Yaw (3) + (1) + Gripper Open/Close (1) + POS_QUAT = 2 # EEF XYZ (3) + Quaternion (4) + Gripper Open/Close (1) + JOINT = 3 # Joint Angles (7, if fewer) + Gripper Open/Close (1) + JOINT_BIMANUAL = 4 # Joint Angles (2 x [ Joint Angles (6) + Gripper Open/Close (1) ]) + # fmt: on + + +# Defines Action Encoding Schemes +class ActionEncoding(IntEnum): + # fmt: off + EEF_POS = 1 # EEF Delta XYZ (3) + Roll-Pitch-Yaw (3) + Gripper Open/Close (1) + JOINT_POS = 2 # Joint Delta Position (7) + Gripper Open/Close (1) + JOINT_POS_BIMANUAL = 3 # Joint Delta Position (2 x [ Joint Delta Position (6) + Gripper Open/Close (1) ]) + EEF_R6 = 4 # EEF Delta XYZ (3) + R6 (6) + Gripper Open/Close (1) + # fmt: on + + +# === Individual Dataset Configs === +OXE_DATASET_CONFIGS = { + "fractal20220817_data": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["base_pose_tool_reached", "gripper_closed"], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 3, + "robot_type": "Google Robot", + }, + "kuka": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": [ + "clip_function_input/base_pose_tool_reached", + "gripper_closed", + ], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Kuka iiwa", + }, + "bridge_oxe": { # Version of Bridge V2 in Open X-Embodiment mixture + "image_obs_keys": {"primary": "image", "secondary": "image_1", "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "WidowX", + }, + "bridge_orig": { # Original version of Bridge V2 from project website + "image_obs_keys": {"primary": "image_0", "secondary": "image_1", "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "WidowX", + }, + "bridge_dataset": { # Original version of Bridge V2 from project website + "image_obs_keys": {"primary": "image_0", "secondary": "image_1", "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "WidowX", + }, + "taco_play": { + "image_obs_keys": { + "primary": "rgb_static", + "secondary": None, + "wrist": "rgb_gripper", + }, + "depth_obs_keys": { + "primary": "depth_static", + "secondary": None, + "wrist": "depth_gripper", + }, + "state_obs_keys": ["state_eef", None, "state_gripper"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 15, + "robot_type": "Franka", + }, + "jaco_play": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "image_wrist", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state_eef", None, "state_gripper"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Jaco 2", + }, + "berkeley_cable_routing": { + "image_obs_keys": { + "primary": "image", + "secondary": "top_image", + "wrist": "wrist45_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["robot_state", None], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Franka", + }, + "roboturk": { + "image_obs_keys": {"primary": "front_rgb", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": [None, None, None, None, None, None, None, None], + "state_encoding": StateEncoding.NONE, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Sawyer", + }, + "nyu_door_opening_surprising_effectiveness": { + "image_obs_keys": {"primary": None, "secondary": None, "wrist": "image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": [None, None, None, None, None, None, None, None], + "state_encoding": StateEncoding.NONE, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 3, + "robot_type": "Hello Stretch", + }, + "viola": { + "image_obs_keys": { + "primary": "agentview_rgb", + "secondary": None, + "wrist": "eye_in_hand_rgb", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["joint_states", "gripper_states"], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "berkeley_autolab_ur5": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "hand_image", + }, + "depth_obs_keys": {"primary": "depth", "secondary": None, "wrist": None}, + "state_obs_keys": ["state"], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "UR5", + }, + "toto": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 30, + "robot_type": "Franka", + }, + "language_table": { + "image_obs_keys": {"primary": "rgb", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["effector_translation", None, None, None, None, None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "xArm", + }, + "columbia_cairlab_pusht_real": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["robot_state", None, None, None, None, None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "UR5", + }, + "stanford_kuka_multimodal_dataset_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": "depth_image", "secondary": None, "wrist": None}, + "state_obs_keys": ["ee_position", "ee_orientation", None], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Kuka iiwa", + }, + "nyu_rot_dataset_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 3, + "robot_type": "xArm", + }, + "stanford_hydra_dataset_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Franka", + }, + "austin_buds_dataset_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state"], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "nyu_franka_play_dataset_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": "image_additional_view", + "wrist": None, + }, + "depth_obs_keys": { + "primary": "depth", + "secondary": "depth_additional_view", + "wrist": None, + }, + "state_obs_keys": ["eef_state", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 3, + "robot_type": "Franka", + }, + "maniskill_dataset_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": { + "primary": "depth", + "secondary": None, + "wrist": "wrist_depth", + }, + "state_obs_keys": ["tcp_pose", "gripper_state"], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "furniture_bench_dataset_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state"], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Franka", + }, + "cmu_franka_exploration_dataset_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "highres_image", + "secondary": None, + "wrist": None, + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": [None, None, None, None, None, None, None, None], + "state_encoding": StateEncoding.NONE, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Franka", + }, + "ucsd_kitchen_dataset_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["joint_state", None], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 2, + "robot_type": "xArm", + }, + "ucsd_pick_and_place_dataset_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 3, + "robot_type": "xArm", + }, + "austin_sailor_dataset_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state"], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "austin_sirius_dataset_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state"], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "bc_z": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": [ + "present/xyz", + "present/axis_angle", + None, + "present/sensed_close", + ], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Google Robot", + }, + "utokyo_pr2_opening_fridge_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "PR2", + }, + "utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "PR2", + }, + "utokyo_xarm_pick_and_place_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": "image2", + "wrist": "hand_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["end_effector_pose", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "xArm", + }, + "utokyo_xarm_bimanual_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["pose_r", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "xArm Bimanual", + }, + "robo_net": { + "image_obs_keys": {"primary": "image", "secondary": "image1", "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 1, + "robot_type": "Multi-Robot", + }, + "berkeley_mvp_converted_externally_to_rlds": { + "image_obs_keys": {"primary": None, "secondary": None, "wrist": "hand_image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["pose", "gripper"], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.JOINT_POS, + "control_frequency": 5, + "robot_type": "xArm", + }, + "berkeley_rpt_converted_externally_to_rlds": { + "image_obs_keys": {"primary": None, "secondary": None, "wrist": "hand_image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["joint_pos", "gripper"], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.JOINT_POS, + "control_frequency": 30, + "robot_type": "Franka", + }, + "kaist_nonprehensile_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Franka", + }, + "stanford_mask_vit_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": None, + "robot_type": "Sawyer", + }, + "tokyo_u_lsmo_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Cobotta", + }, + "dlr_sara_pour_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "DLR SARA", + }, + "dlr_sara_grid_clamp_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "DLR SARA", + }, + "dlr_edan_shared_control_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "DLR EDAN", + }, + "asu_table_top_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 12.5, + "robot_type": "UR5", + }, + "stanford_robocook_converted_externally_to_rlds": { + "image_obs_keys": {"primary": "image_1", "secondary": "image_2", "wrist": None}, + "depth_obs_keys": {"primary": "depth_1", "secondary": "depth_2", "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + "imperialcollege_sawyer_wrist_cam": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": [None, None, None, None, None, None, None, "state"], + "state_encoding": StateEncoding.NONE, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Sawyer", + }, + "iamlab_cmu_pickup_insert_converted_externally_to_rlds": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["joint_state", "gripper_state"], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "uiuc_d3field": { + "image_obs_keys": {"primary": "image_1", "secondary": "image_2", "wrist": None}, + "depth_obs_keys": {"primary": "depth_1", "secondary": "depth_2", "wrist": None}, + "state_obs_keys": [None, None, None, None, None, None, None, None], + "state_encoding": StateEncoding.NONE, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 1, + "robot_type": "Kinova Gen3", + }, + "utaustin_mutex": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state"], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "berkeley_fanuc_manipulation": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "wrist_image", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["joint_state", None, "gripper_state"], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Fanuc Mate", + }, + "cmu_playing_with_food": { + "image_obs_keys": { + "primary": "image", + "secondary": None, + "wrist": "finger_vision_1", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Franka", + }, + "cmu_play_fusion": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state"], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + "cmu_stretch": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["eef_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Hello Stretch", + }, + "berkeley_gnm_recon": { + "image_obs_keys": {"primary": None, "secondary": None, "wrist": "image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 3, + "robot_type": "Jackal", + }, + "berkeley_gnm_cory_hall": { + "image_obs_keys": {"primary": None, "secondary": None, "wrist": "image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "RC Car", + }, + "berkeley_gnm_sac_son": { + "image_obs_keys": {"primary": None, "secondary": None, "wrist": "image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["state", None, None], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "TurtleBot 2", + }, + # NOTE: modified + "droid": { + "image_obs_keys": { + "primary": "exterior_image_1_left", + "secondary": "exterior_image_2_left", + "wrist": "wrist_image_left", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_QUAT, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 15, + "robot_type": "Franka", + "aux_kwargs": { + "dataset_frame_transform_kwargs": { + "chunk_filter_fn": zero_action_filter, + }, + }, + }, + "fmb_dataset": { + "image_obs_keys": { + "primary": "image_side_1", + "secondary": "image_side_2", + "wrist": "image_wrist_1", + }, + "depth_obs_keys": { + "primary": "image_side_1_depth", + "secondary": "image_side_2_depth", + "wrist": "image_wrist_1_depth", + }, + "state_obs_keys": ["proprio"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Franka", + }, + # NOTE: modified + "dobbe": { + "image_obs_keys": {"primary": "wrist_image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 3.75, + "robot_type": "Hello Stretch", + }, + "roboset": { + "image_obs_keys": { + "primary": "image_left", + "secondary": "image_right", + "wrist": "image_wrist", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["proprio"], + "state_encoding": StateEncoding.JOINT, + "action_encoding": ActionEncoding.JOINT_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + "rh20t": { + "image_obs_keys": { + "primary": "image_front", + "secondary": "image_side_right", + "wrist": "image_wrist", + }, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["proprio"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 10, + "robot_type": "Flexiv", + }, + ### T-DROID datasets + "tdroid_carrot_in_bowl": { # "put carrot in bowl" task, 50 demos @ 5 Hz control + "image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + "tdroid_pour_corn_in_pot": { # "pour corn from red bonawl into steel pot" task, 50 demos @ 5 Hz control + "image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + "tdroid_flip_pot_upright": { # "flip pot upright" task, 10 demos @ 5 Hz control + "image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + "tdroid_move_object_onto_plate": { # "move onto plate" task, 150 demos @ 5 Hz control + "image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + "tdroid_knock_object_over": { # "knock over" task, 70 demos @ 5 Hz control + "image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + "tdroid_cover_object_with_towel": { # "cover with towel" task, 45 demos @ 5 Hz control + "image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None}, + "depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", None, "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 5, + "robot_type": "Franka", + }, + ### DROID Finetuning datasets + "droid_wipe": { + "image_obs_keys": {"primary": "exterior_image_2_left", "secondary": None, "wrist": "wrist_image_left"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["proprio"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 15, + "robot_type": "Franka", + }, + # NOTE: modified + ### LIBERO datasets (modified versions) + "libero_spatial_no_noops": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": "wrist_image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "libero_object_no_noops": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": "wrist_image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "libero_goal_no_noops": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": "wrist_image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, + "libero_10_no_noops": { + "image_obs_keys": {"primary": "image", "secondary": None, "wrist": "wrist_image"}, + "depth_obs_keys": {"primary": None, "secondary": None, "wrist": None}, + "state_obs_keys": ["EEF_state", "gripper_state"], + "state_encoding": StateEncoding.POS_EULER, + "action_encoding": ActionEncoding.EEF_POS, + "control_frequency": 20, + "robot_type": "Franka", + }, +} diff --git a/examples/port_datasets/oxe_utils/transform_utils.py b/examples/port_datasets/oxe_utils/transform_utils.py new file mode 100644 index 000000000..ca250ca6e --- /dev/null +++ b/examples/port_datasets/oxe_utils/transform_utils.py @@ -0,0 +1,76 @@ +""" +Copied from https://github.com/openvla/openvla/blob/main/prismatic/vla/datasets/rlds/utils/data_utils.py +""" + + +from typing import Any, Dict + +import tensorflow as tf + + +def binarize_gripper_actions(actions: tf.Tensor) -> tf.Tensor: + """ + Converts gripper actions from continuous to binary values (0 and 1). + + We exploit that fact that most of the time, the gripper is fully open (near 1.0) or fully closed (near 0.0). As it + transitions between the two, it sometimes passes through a few intermediate values. We relabel those intermediate + values based on the state that is reached _after_ those intermediate values. + + In the edge case that the trajectory ends with an intermediate value, we give up on binarizing and relabel that + chunk of intermediate values as the last action in the trajectory. + + The `scan_fn` implements the following logic: + new_actions = np.empty_like(actions) + carry = actions[-1] + for i in reversed(range(actions.shape[0])): + if in_between_mask[i]: + carry = carry + else: + carry = float(open_mask[i]) + new_actions[i] = carry + """ + open_mask, closed_mask = actions > 0.95, actions < 0.05 + in_between_mask = tf.logical_not(tf.logical_or(open_mask, closed_mask)) + is_open_float = tf.cast(open_mask, tf.float32) + + def scan_fn(carry, i): + return tf.cond(in_between_mask[i], lambda: tf.cast(carry, tf.float32), lambda: is_open_float[i]) + + return tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), actions[-1], reverse=True) + + +def invert_gripper_actions(actions: tf.Tensor) -> tf.Tensor: + return 1 - actions + + +def rel2abs_gripper_actions(actions: tf.Tensor) -> tf.Tensor: + """ + Converts relative gripper actions (+1 for closing, -1 for opening) to absolute actions (0 = closed; 1 = open). + + Assumes that the first relative gripper is not redundant (i.e. close when already closed)! + """ + # Note =>> -1 for closing, 1 for opening, 0 for no change + opening_mask, closing_mask = actions < -0.1, actions > 0.1 + thresholded_actions = tf.where(opening_mask, 1, tf.where(closing_mask, -1, 0)) + + def scan_fn(carry, i): + return tf.cond(thresholded_actions[i] == 0, lambda: carry, lambda: thresholded_actions[i]) + + # If no relative grasp, assumes open for whole trajectory + start = -1 * thresholded_actions[tf.argmax(thresholded_actions != 0, axis=0)] + start = tf.cond(start == 0, lambda: 1, lambda: start) + + # Note =>> -1 for closed, 1 for open + new_actions = tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), start) + new_actions = tf.cast(new_actions, tf.float32) / 2 + 0.5 + + return new_actions + +# === Bridge-V2 =>> Dataset-Specific Transform === +def relabel_bridge_actions(traj: Dict[str, Any]) -> Dict[str, Any]: + """Relabels actions to use reached proprioceptive state; discards last timestep (no-action).""" + movement_actions = traj["observation"]["state"][1:, :6] - traj["observation"]["state"][:-1, :6] + traj_truncated = tf.nest.map_structure(lambda x: x[:-1], traj) + traj_truncated["action"] = tf.concat([movement_actions, traj["action"][:-1, -1:]], axis=1) + + return traj_truncated diff --git a/examples/port_datasets/oxe_utils/transforms.py b/examples/port_datasets/oxe_utils/transforms.py new file mode 100644 index 000000000..6eaa496c9 --- /dev/null +++ b/examples/port_datasets/oxe_utils/transforms.py @@ -0,0 +1,985 @@ +""" +Adapt from https://github.com/openvla/openvla/blob/main/prismatic/vla/datasets/rlds/oxe/transforms.py +transforms.py + +Defines a registry of per-dataset standardization transforms for each dataset in Open-X Embodiment. + +Transforms adopt the following structure: + Input: Dictionary of *batched* features (i.e., has leading time dimension) + Output: Dictionary `step` =>> { + "observation": { + + State (in chosen state representation) + }, + "action": Action (in chosen action representation), + "language_instruction": str + } +""" + +from typing import Any, Dict + +import tensorflow as tf +from oxe_utils.transform_utils import ( + binarize_gripper_actions, + invert_gripper_actions, + rel2abs_gripper_actions, + relabel_bridge_actions, +) + + +def droid_baseact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + DROID dataset transformation for actions expressed in *base* frame of the robot. + """ + def rand_swap_exterior_images(img1, img2): + """ + Randomly swaps the two exterior images (for training with single exterior input). + """ + return tf.cond(tf.random.uniform(shape=[]) > 0.5, lambda: (img1, img2), lambda: (img2, img1)) + + dt = trajectory["action_dict"]["cartesian_velocity"][:, :3] + dR = trajectory["action_dict"]["cartesian_velocity"][:, 3:6] + + trajectory["action"] = tf.concat( + ( + dt, + dR, + 1 - trajectory["action_dict"]["gripper_position"], + ), + axis=-1, + ) + trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = ( + rand_swap_exterior_images( + trajectory["observation"]["exterior_image_1_left"], + trajectory["observation"]["exterior_image_2_left"], + ) + ) + # trajectory["observation"]["proprio"] = tf.concat( + # ( + # trajectory["observation"]["cartesian_position"], + # trajectory["observation"]["gripper_position"], + # ), + # axis=-1, + # ) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"] + return trajectory + + +def droid_finetuning_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + DROID dataset transformation for actions expressed in *base* frame of the robot. + """ + dt = trajectory["action_dict"]["cartesian_velocity"][:, :3] + dR = trajectory["action_dict"]["cartesian_velocity"][:, 3:6] + trajectory["action"] = tf.concat( + ( + dt, + dR, + 1 - trajectory["action_dict"]["gripper_position"], + ), + axis=-1, + ) + trajectory["observation"]["proprio"] = tf.concat( + ( + trajectory["observation"]["cartesian_position"], + trajectory["observation"]["gripper_position"], + ), + axis=-1, + ) + return trajectory + + +def bridge_oxe_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + Applies to version of Bridge V2 in Open X-Embodiment mixture. + + Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it! + """ + for key in trajectory.keys(): + if key == "traj_metadata": + continue + elif key in ["observation", "action"]: + for key2 in trajectory[key]: + trajectory[key][key2] = trajectory[key][key2][1:] + else: + trajectory[key] = trajectory[key][1:] + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32), + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + trajectory = relabel_bridge_actions(trajectory) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def bridge_orig_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + Applies to original version of Bridge V2 from the official project website. + + Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it! + """ + for key in trajectory.keys(): + if key == "traj_metadata": + continue + elif key == "observation": + for key2 in trajectory[key]: + trajectory[key][key2] = trajectory[key][key2][1:] + else: + trajectory[key] = trajectory[key][1:] + + trajectory["action"] = tf.concat( + [ + trajectory["action"][:, :6], + binarize_gripper_actions(trajectory["action"][:, -1])[:, None], + ], + axis=1, + ) + trajectory = relabel_bridge_actions(trajectory) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def ppgm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + [ + trajectory["action"][:, :6], + binarize_gripper_actions(trajectory["action"][:, -1])[:, None], + ], + axis=1, + ) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"][:, -1:] + return trajectory + + +def rt1_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action[:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def kuka_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action[:, None], + ), + axis=-1, + ) + # decode compressed state + eef_value = tf.io.decode_compressed( + trajectory["observation"]["clip_function_input/base_pose_tool_reached"], + compression_type="ZLIB", + ) + eef_value = tf.io.decode_raw(eef_value, tf.float32) + trajectory["observation"]["clip_function_input/base_pose_tool_reached"] = tf.reshape(eef_value, (-1, 7)) + gripper_value = tf.io.decode_compressed(trajectory["observation"]["gripper_closed"], compression_type="ZLIB") + gripper_value = tf.io.decode_raw(gripper_value, tf.float32) + trajectory["observation"]["gripper_closed"] = tf.reshape(gripper_value, (-1, 1)) + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["observation"]["natural_language_instruction"]), "" + # ) # delete uninformative language instruction + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def taco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state_eef"] = trajectory["observation"]["robot_obs"][:, :6] + trajectory["observation"]["state_gripper"] = trajectory["observation"]["robot_obs"][:, 7:8] + trajectory["action"] = trajectory["action"]["rel_actions_world"] + + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + tf.clip_by_value(trajectory["action"][:, -1:], 0, 1), + ), + axis=-1, + ) + + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def jaco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state_eef"] = trajectory["observation"]["end_effector_cartesian_pos"][:, :6] + trajectory["observation"]["state_gripper"] = trajectory["observation"]["end_effector_cartesian_pos"][:, -1:] + + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + tf.zeros_like(trajectory["action"]["world_vector"]), + gripper_action[:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def berkeley_cable_routing_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + tf.zeros_like(trajectory["action"]["world_vector"][:, :1]), + ), + axis=-1, + ) + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["observation"]["natural_language_instruction"]), "" + # ) # delete uninformative language instruction + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def roboturk_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert absolute gripper action, +1 = open, 0 = close + gripper_action = invert_gripper_actions(tf.clip_by_value(trajectory["action"]["gripper_closedness_action"], 0, 1)) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action, + ), + axis=-1, + ) + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["observation"]["natural_language_instruction"]), "" + # ) # delete uninformative language instruction + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def nyu_door_opening_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action[:, None], + ), + axis=-1, + ) + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["observation"]["natural_language_instruction"]), "" + # ) # delete uninformative language instruction + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def viola_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # make gripper action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, None] + gripper_action = tf.clip_by_value(gripper_action, 0, 1) + gripper_action = invert_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action, + ), + axis=-1, + ) + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["observation"]["natural_language_instruction"]), "" + # ) # delete uninformative language instruction + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def berkeley_autolab_ur5_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = trajectory["observation"]["robot_state"][:, 6:14] + trajectory["observation"]["depth"] = trajectory["observation"].pop("image_with_depth") + + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action[:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def toto_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32), + ), + axis=-1, + ) + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["observation"]["natural_language_instruction"]), "" + # ) # delete uninformative language instruction + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def language_table_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # default to "open" gripper + trajectory["action"] = tf.concat( + ( + trajectory["action"], + tf.zeros_like(trajectory["action"]), + tf.zeros_like(trajectory["action"]), + tf.ones_like(trajectory["action"][:, :1]), + ), + axis=-1, + ) + + # decode language instruction + instruction_bytes = trajectory["observation"]["instruction"] + instruction_encoded = tf.strings.unicode_encode(instruction_bytes, output_encoding="UTF-8") + # Remove trailing padding --> convert RaggedTensor to regular Tensor. + trajectory["language_instruction"] = tf.strings.split(instruction_encoded, "\x00")[:, :1].to_tensor()[:, 0] + return trajectory + + +def pusht_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + trajectory["action"]["gripper_closedness_action"][:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def stanford_kuka_multimodal_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["depth_image"] = trajectory["observation"]["depth_image"][..., 0] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tf.zeros_like(trajectory["action"][:, :3]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def nyu_rot_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][..., :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., -1:] + trajectory["action"] = trajectory["action"][..., :7] + return trajectory + + +def stanford_hydra_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(trajectory["action"][:, -1:]), + ), + axis=-1, + ) + + trajectory["observation"]["eef_state"] = tf.concat( + ( + trajectory["observation"]["state"][:, :3], + trajectory["observation"]["state"][:, 7:10], + ), + axis=-1, + ) + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -3:-2] + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["language_instruction"]), "" + # ) # delete uninformative language instruction + return trajectory + + +def austin_buds_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + + trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8] + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["language_instruction"]), "" + # ) # delete uninformative language instruction + return trajectory + + +def nyu_franka_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["depth"] = tf.cast(trajectory["observation"]["depth"][..., 0], tf.float32) + trajectory["observation"]["depth_additional_view"] = tf.cast( + trajectory["observation"]["depth_additional_view"][..., 0], tf.float32 + ) + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, -6:] + + # clip gripper action, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, -8:-2], + tf.clip_by_value(trajectory["action"][:, -2:-1], 0, 1), + ), + axis=-1, + ) + + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["language_instruction"]), "" + # ) # delete uninformative language instruction + return trajectory + + +def maniskill_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., 7:8] + return trajectory + + +def furniture_bench_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + import tensorflow_graphics.geometry.transformation as tft + + trajectory["observation"]["state"] = tf.concat( + ( + trajectory["observation"]["state"][:, :7], + trajectory["observation"]["state"][:, -1:], + ), + axis=-1, + ) + + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tft.euler.from_quaternion(trajectory["action"][:, 3:7]), + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + return trajectory + + +def cmu_franka_exploration_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def ucsd_kitchen_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7] + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def ucsd_pick_place_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tf.zeros_like(trajectory["action"][:, :3]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def austin_sailor_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["language_instruction"]), "" + # ) # delete uninformative language instruction + return trajectory + + +def austin_sirius_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["language_instruction"]), "" + # ) # delete uninformative language instruction + return trajectory + + +def bc_z_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["future/xyz_residual"][:, :3], + trajectory["action"]["future/axis_angle_residual"][:, :3], + invert_gripper_actions(tf.cast(trajectory["action"]["future/target_close"][:, :1], tf.float32)), + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def tokyo_pr2_opening_fridge_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def tokyo_pr2_tabletop_manipulation_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def utokyo_xarm_pick_place_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + return trajectory + + +def utokyo_xarm_bimanual_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = trajectory["action"][..., -7:] + return trajectory + + +def robo_net_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = tf.concat( + ( + trajectory["observation"]["state"][:, :4], + tf.zeros_like(trajectory["observation"]["state"][:, :2]), + ), + axis=-1, + ) + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :4], + tf.zeros_like(trajectory["action"][:, :2]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def berkeley_mvp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + return trajectory + + +def berkeley_rpt_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + return trajectory + + +def kaist_nonprehensible_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = trajectory["observation"]["state"][:, -7:] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + tf.zeros_like(trajectory["action"][:, :1]), + ), + axis=-1, + ) + return trajectory + + +def stanford_mask_vit_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = tf.concat( + ( + trajectory["observation"]["end_effector_pose"][:, :4], + tf.zeros_like(trajectory["observation"]["end_effector_pose"][:, :2]), + ), + axis=-1, + ) + trajectory["observation"]["gripper_state"] = trajectory["observation"]["end_effector_pose"][:, -1:] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :4], + tf.zeros_like(trajectory["action"][:, :2]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def tokyo_lsmo_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def dlr_sara_pour_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + return trajectory + + +def dlr_sara_grid_clamp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :6] + return trajectory + + +def dlr_edan_shared_control_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(trajectory["action"][:, -1:]), + ), + axis=-1, + ) + return trajectory + + +def asu_table_top_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["ground_truth_states"]["EE"] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def robocook_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def imperial_wristcam_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def iamlab_pick_insert_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + import tensorflow_graphics.geometry.transformation as tft + + trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 7:8] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tft.euler.from_quaternion(trajectory["action"][:, 3:7]), + trajectory["action"][:, 7:8], + ), + axis=-1, + ) + return trajectory + + +def uiuc_d3field_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"], + tf.zeros_like(trajectory["action"]), + tf.zeros_like(trajectory["action"][:, :1]), + ), + axis=-1, + ) + return trajectory + + +def utaustin_mutex_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8] + + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + + # trajectory["language_instruction"] = tf.fill( + # tf.shape(trajectory["language_instruction"]), "" + # ) # delete uninformative language instruction + return trajectory + + +def berkeley_fanuc_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 6:7] + + # dataset does not store gripper actions, so use gripper state info, invert so +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"], + invert_gripper_actions(trajectory["observation"]["gripper_state"]), + ), + axis=-1, + ) + return trajectory + + +def cmu_playing_with_food_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + import tensorflow_graphics.geometry.transformation as tft + + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tft.euler.from_quaternion(trajectory["action"][:, 3:7]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def playfusion_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + trajectory["action"][:, -4:], + ), + axis=-1, + ) + return trajectory + + +def cmu_stretch_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = tf.concat( + ( + trajectory["observation"]["state"][:, :3], + tf.zeros_like(trajectory["observation"]["state"][:, :3]), + ), + axis=-1, + ) + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def gnm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = tf.concat( + ( + trajectory["observation"]["position"], + tf.zeros_like(trajectory["observation"]["state"][:, :3]), + trajectory["observation"]["yaw"], + ), + axis=-1, + ) + trajectory["action"] = tf.concat( + ( + trajectory["action"], + tf.zeros_like(trajectory["action"]), + tf.zeros_like(trajectory["action"]), + tf.zeros_like(trajectory["action"][:, :1]), + ), + axis=-1, + ) + return trajectory + + +def fmb_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # every input feature is batched, ie has leading batch dimension + trajectory["observation"]["proprio"] = tf.concat( + ( + trajectory["observation"]["eef_pose"], + trajectory["observation"]["state_gripper_pose"][..., None], + ), + axis=-1, + ) + return trajectory + + +def dobbe_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # every input feature is batched, ie has leading batch dimension + trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def roboset_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # every input feature is batched, ie has leading batch dimension + trajectory["observation"]["proprio"] = trajectory["observation"]["state"] + + # gripper action is in -1...1 --> clip to 0...1, flip + gripper_action = trajectory["action"][:, -1:] + gripper_action = invert_gripper_actions(tf.clip_by_value(gripper_action, 0, 1)) + + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :7], + gripper_action, + ), + axis=-1, + ) + return trajectory + + +def rh20t_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["tcp_base"], + tf.cast(trajectory["action"]["gripper"][:, None], tf.float32), + ), + axis=-1, + ) + trajectory["observation"]["proprio"] = tf.concat( + ( + trajectory["observation"]["tcp_base"], + trajectory["observation"]["gripper_width"][..., None], + ), + axis=-1, + ) + return trajectory + + +def tdroid_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + [ + trajectory["action"][:, :6], + binarize_gripper_actions(trajectory["action"][:, -1])[:, None], + ], + axis=1, + ) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"][:, -1:] + return trajectory + + +def libero_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # gripper action is in -1 (open)...1 (close) --> clip to 0...1, flip --> +1 = open, 0 = close + gripper_action = trajectory["action"][:, -1:] + gripper_action = invert_gripper_actions(tf.clip_by_value(gripper_action, 0, 1)) + + trajectory["action"] = tf.concat( + [ + trajectory["action"][:, :6], + gripper_action, + ], + axis=1, + ) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -2:] # 2D gripper state + return trajectory + + +# === Registry === +OXE_STANDARDIZATION_TRANSFORMS = { + "bridge_oxe": bridge_oxe_dataset_transform, + "bridge_orig": bridge_orig_dataset_transform, + "bridge_dataset": bridge_orig_dataset_transform, + "ppgm": ppgm_dataset_transform, + "ppgm_static": ppgm_dataset_transform, + "ppgm_wrist": ppgm_dataset_transform, + "fractal20220817_data": rt1_dataset_transform, + "kuka": kuka_dataset_transform, + "taco_play": taco_play_dataset_transform, + "jaco_play": jaco_play_dataset_transform, + "berkeley_cable_routing": berkeley_cable_routing_dataset_transform, + "roboturk": roboturk_dataset_transform, + "nyu_door_opening_surprising_effectiveness": nyu_door_opening_dataset_transform, + "viola": viola_dataset_transform, + "berkeley_autolab_ur5": berkeley_autolab_ur5_dataset_transform, + "toto": toto_dataset_transform, + "language_table": language_table_dataset_transform, + "columbia_cairlab_pusht_real": pusht_dataset_transform, + "stanford_kuka_multimodal_dataset_converted_externally_to_rlds": stanford_kuka_multimodal_dataset_transform, + "nyu_rot_dataset_converted_externally_to_rlds": nyu_rot_dataset_transform, + "stanford_hydra_dataset_converted_externally_to_rlds": stanford_hydra_dataset_transform, + "austin_buds_dataset_converted_externally_to_rlds": austin_buds_dataset_transform, + "nyu_franka_play_dataset_converted_externally_to_rlds": nyu_franka_play_dataset_transform, + "maniskill_dataset_converted_externally_to_rlds": maniskill_dataset_transform, + "furniture_bench_dataset_converted_externally_to_rlds": furniture_bench_dataset_transform, + "cmu_franka_exploration_dataset_converted_externally_to_rlds": cmu_franka_exploration_dataset_transform, + "ucsd_kitchen_dataset_converted_externally_to_rlds": ucsd_kitchen_dataset_transform, + "ucsd_pick_and_place_dataset_converted_externally_to_rlds": ucsd_pick_place_dataset_transform, + "austin_sailor_dataset_converted_externally_to_rlds": austin_sailor_dataset_transform, + "austin_sirius_dataset_converted_externally_to_rlds": austin_sirius_dataset_transform, + "bc_z": bc_z_dataset_transform, + "utokyo_pr2_opening_fridge_converted_externally_to_rlds": tokyo_pr2_opening_fridge_dataset_transform, + "utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds": tokyo_pr2_tabletop_manipulation_dataset_transform, + "utokyo_xarm_pick_and_place_converted_externally_to_rlds": utokyo_xarm_pick_place_dataset_transform, + "utokyo_xarm_bimanual_converted_externally_to_rlds": utokyo_xarm_bimanual_dataset_transform, + "robo_net": robo_net_dataset_transform, + "berkeley_mvp_converted_externally_to_rlds": berkeley_mvp_dataset_transform, + "berkeley_rpt_converted_externally_to_rlds": berkeley_rpt_dataset_transform, + "kaist_nonprehensile_converted_externally_to_rlds": kaist_nonprehensible_dataset_transform, + "stanford_mask_vit_converted_externally_to_rlds": stanford_mask_vit_dataset_transform, + "tokyo_u_lsmo_converted_externally_to_rlds": tokyo_lsmo_dataset_transform, + "dlr_sara_pour_converted_externally_to_rlds": dlr_sara_pour_dataset_transform, + "dlr_sara_grid_clamp_converted_externally_to_rlds": dlr_sara_grid_clamp_dataset_transform, + "dlr_edan_shared_control_converted_externally_to_rlds": dlr_edan_shared_control_dataset_transform, + "asu_table_top_converted_externally_to_rlds": asu_table_top_dataset_transform, + "stanford_robocook_converted_externally_to_rlds": robocook_dataset_transform, + "imperialcollege_sawyer_wrist_cam": imperial_wristcam_dataset_transform, + "iamlab_cmu_pickup_insert_converted_externally_to_rlds": iamlab_pick_insert_dataset_transform, + "uiuc_d3field": uiuc_d3field_dataset_transform, + "utaustin_mutex": utaustin_mutex_dataset_transform, + "berkeley_fanuc_manipulation": berkeley_fanuc_dataset_transform, + "cmu_playing_with_food": cmu_playing_with_food_dataset_transform, + "cmu_play_fusion": playfusion_dataset_transform, + "cmu_stretch": cmu_stretch_dataset_transform, + "berkeley_gnm_recon": gnm_dataset_transform, + "berkeley_gnm_cory_hall": gnm_dataset_transform, + "berkeley_gnm_sac_son": gnm_dataset_transform, + "droid": droid_baseact_transform, + "fmb_dataset": fmb_dataset_transform, + "dobbe": dobbe_dataset_transform, + "roboset": roboset_dataset_transform, + "rh20t_rlds": rh20t_dataset_transform, + ### T-DROID datasets + "tdroid_carrot_in_bowl": tdroid_dataset_transform, + "tdroid_pour_corn_in_pot": tdroid_dataset_transform, + "tdroid_flip_pot_upright": tdroid_dataset_transform, + "tdroid_move_object_onto_plate": tdroid_dataset_transform, + "tdroid_knock_object_over": tdroid_dataset_transform, + "tdroid_cover_object_with_towel": tdroid_dataset_transform, + ### DROID Finetuning datasets + "droid_wipe": droid_finetuning_transform, + ### LIBERO datasets (modified versions) + "libero_spatial_no_noops": libero_dataset_transform, + "libero_object_no_noops": libero_dataset_transform, + "libero_goal_no_noops": libero_dataset_transform, + "libero_10_no_noops": libero_dataset_transform, +}