diff --git a/README.md b/README.md index 9b847484d..703e64881 100644 --- a/README.md +++ b/README.md @@ -23,7 +23,7 @@

-

Hot News: New tutorial: Getting starting with Real-World Robots

+

Hot new tutorial: Getting started with real-world robots

@@ -31,11 +31,13 @@

We just dropped an in-depth tutorial on how to build your own robot!

Teach it new skills by showing it a few moves with just a laptop.

Then watch your homemade robot act autonomously 🤯

+

For more info, see our thread on X or our tutorial page.

+

-

State-of-the-art Machine Learning for real-world robotics

+

LeRobot: State-of-the-art AI for real-world robotics

--- @@ -265,13 +267,20 @@ checkpoints │ └── training_state.pth # optimizer/scheduler/rng state and training step ``` +To resume training from a checkpoint, you can add these to the `train.py` python command: +```bash + hydra.run.dir=your/original/experiment/dir resume=true +``` + +It will load the pretrained model, optimizer and scheduler states for training. For more information please see our tutorial on training resumption [here](https://github.com/huggingface/lerobot/blob/main/examples/5_resume_training.md). + To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding: ```bash wandb.enable=true ``` -A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser: +A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser. Please also check [here](https://github.com/huggingface/lerobot/blob/main/examples/4_train_policy_with_script.md#typical-logs-and-metrics) for the explaination of some commonly used metrics in logs. ![](media/wandb.png) diff --git a/examples/4_train_policy_with_script.md b/examples/4_train_policy_with_script.md index db9840a79..05c865dc3 100644 --- a/examples/4_train_policy_with_script.md +++ b/examples/4_train_policy_with_script.md @@ -170,6 +170,36 @@ python lerobot/scripts/train.py --config-dir outputs/train/my_experiment/checkpo Note that you may still use the regular syntax for config parameter overrides (eg: by adding `training.offline_steps=200000`). +## Typical logs and metrics + +When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint. + +After that, you will see training log like this one: + +``` +INFO 2024-08-14 13:35:12 ts/train.py:192 step:0 smpl:64 ep:1 epch:0.00 loss:1.112 grdn:15.387 lr:2.0e-07 updt_s:1.738 data_s:4.774 +``` + +or evaluation log like: + +``` +INFO 2024-08-14 13:38:45 ts/train.py:226 step:100 smpl:6K ep:52 epch:0.25 ∑rwrd:20.693 success:0.0% eval_s:120.266 +``` + +These logs will also be saved in wandb if `wandb.enable` is set to `true`. Here are the meaning of some abbreviations: + +- `smpl`: number of samples seen during training. +- `ep`: number of episodes seen during training. An episode contains multiple samples in a complete manipulation task. +- `epch`: number of time all unique samples are seen (epoch). +- `grdn`: gradient norm. +- `∑rwrd`: compute the sum of rewards in every evaluation episode and then take an average of them. +- `success`: average success rate of eval episodes. Reward and success are usually different except for the sparsing reward setting, where reward=1 only when the task is completed successfully. +- `eval_s`: time to evaluate the policy in the environment, in second. +- `updt_s`: time to update the network parameters, in second. +- `data_s`: time to load a batch of data, in second. + +Some metrics are useful for initial performance profiling. For example, if you find the current GPU utilization is low via the `nvidia-smi` command and `data_s` sometimes is too high, you may need to modify batch size or number of dataloading workers to accelerate dataloading. We also recommend [pytorch profiler](https://github.com/huggingface/lerobot?tab=readme-ov-file#improve-your-code-with-profiling) for detailed performance probing. + --- So far we've seen how to train Diffusion Policy for PushT and ACT for ALOHA. Now, what if we want to train ACT for PushT? Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch): diff --git a/examples/7_get_started_with_real_robot.md b/examples/7_get_started_with_real_robot.md index 3a4b59bb9..f738ec29a 100644 --- a/examples/7_get_started_with_real_robot.md +++ b/examples/7_get_started_with_real_robot.md @@ -13,9 +13,9 @@ By following these steps, you'll be able to replicate tasks like picking up a Le Although this tutorial is general and can be easily adapted to various types of robots by changing the configuration, it is specifically based on the [Koch v1.1](https://github.com/jess-moss/koch-v1-1), an affordable robot. The Koch v1.1 consists of a leader arm and a follower arm, each with 6 motors. It can work with one or several cameras to record the scene, which serve as visual sensors for the robot. -During the data collection phase, you'll control the follower arm by moving the leader arm, a process known as "teleoperation." This technique is used to collect robot trajectories. Afterward, you'll train a neural network to imitate these trajectories and deploy the network to enable your robot to operate autonomously. +During the data collection phase, you will control the follower arm by moving the leader arm. This process is known as "teleoperation." This technique is used to collect robot trajectories. Afterward, you'll train a neural network to imitate these trajectories and deploy the network to enable your robot to operate autonomously. -If you encounter any issues at any step of the tutorial, feel free to seek help on [Discord](https://discord.com/invite/s3KuuzsPFb). +If you encounter any issues at any step of the tutorial, feel free to seek help on [Discord](https://discord.com/invite/s3KuuzsPFb) or don't hesitate to iterate with us on the tutorial by creating issues or pull requests. Thanks! ## 1. Order and Assemble your Koch v1.1 @@ -25,9 +25,9 @@ Follow the sourcing and assembling instructions provided on the [Koch v1.1 Githu Koch v1.1 leader and follower arms -For a visual walkthrough of the assembly process, you can refer to [this video tutorial](https://youtu.be/5mdxvMlxoos). +For a visual walkthrough of the assembly process, you can refer to [this video tutorial](https://youtu.be/8nQIg9BwwTk). -## 2. Configure motors, Calibrate arms, Teleoperate your Koch v1.1 +## 2. Configure motors, calibrate arms, teleoperate your Koch v1.1 First, install the additional dependencies required for Koch v1.1 by running one of the following commands. @@ -49,7 +49,7 @@ Finally, connect both arms to your computer via USB. Note that the USB doesn't p *Copy pasting python code* -In the upcoming sections, you'll learn about our classes and functions by running some python code, in an interactive session, or by copy-pasting it in a python file. If it's your first time using the tutorial, we highly recommend going through these steps to get deeper intuition about how things work. Once you're more familiar, you can streamline the process by directly running the teleoperate script (which is detailed further in the tutorial): +In the upcoming sections, you'll learn about our classes and functions by running some python code, in an interactive session, or by copy-pasting it in a python file. If this is your first time using the tutorial., we highly recommend going through these steps to get deeper intuition about how things work. Once you're more familiar, you can streamline the process by directly running the teleoperate script (which is detailed further in the tutorial): ```bash python lerobot/scripts/control_robot.py teleoperate \ --robot-path lerobot/configs/robot/koch.yaml \ @@ -57,7 +57,7 @@ python lerobot/scripts/control_robot.py teleoperate \ ``` It will automatically: -1. Detect and help you correct any motor configurations issue. +1. Detect and help you correct any motor configuration issues. 2. Identify any missing calibrations and initiate the calibration procedure. 3. Connect the robot and start teleoperation. @@ -67,7 +67,7 @@ You can use the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dy **Instantiate the DynamixelMotorsBus** -To begin, you'll need to create two instances of the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dynamixel.py), one for each arm, using their corresponding USB ports (e.g. `DynamixelMotorsBus(port="/dev/tty.usbmodem575E0031751"`). +To begin, create two instances of the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dynamixel.py), one for each arm, using their corresponding USB ports (e.g. `DynamixelMotorsBus(port="/dev/tty.usbmodem575E0031751"`). To find the correct ports for each arm, run the utility script twice: ```bash @@ -144,7 +144,7 @@ follower_arm = DynamixelMotorsBus( *Updating the YAML Configuration File* -Then, update the port values in the YAML configuration file for the Koch robot at [`lerobot/configs/robot/koch.yaml`](../lerobot/configs/robot/koch.yaml) with the ports you've identified: +Next, update the port values in the YAML configuration file for the Koch robot at [`lerobot/configs/robot/koch.yaml`](../lerobot/configs/robot/koch.yaml) with the ports you've identified: ```yaml [...] leader_arms: @@ -192,7 +192,7 @@ When you connect the leader arm for the first time, you might see an output simi Read failed due to communication error on port /dev/tty.usbmodem575E0032081 for group_key ID_shoulder_pan_shoulder_lift_elbow_flex_wrist_flex_wrist_roll_gripper: [TxRxResult] There is no status packet! /!\ A configuration issue has been detected with your motors: -If it's the first time that you use these motors, press enter to configure your motors... but before verify that all the cables are connected the proper way. If you find an issue, before making a modification, kill the python process, unplug the power cord to not damage the motors, rewire correctly, then plug the power again and relaunch the script. +If this is the first time you are using these motors, press enter to configure your motors... but before verify that all the cables are connected the proper way. If you find an issue, before making a modification, kill the python process, unplug the power cord to not damage the motors, rewire correctly, then plug the power again and relaunch the script. Motor indices detected: {9600: [1]} @@ -327,37 +327,15 @@ When you connect your robot for the first time, the [`KochRobot`](../lerobot/com Here are the positions you'll move the follower arm to: -
-
- Koch v1.1 follower arm zero position -

1. Zero position

-
-
- Koch v1.1 follower arm rotated position -

2. Rotated position

-
-
- Koch v1.1 follower arm rest position -

3. Rest position

-
-
+| 1. Zero position | 2. Rotated position | 3. Rest position | +|---|---|---| +| Koch v1.1 follower arm zero position | Koch v1.1 follower arm rotated position | Koch v1.1 follower arm rest position | And here are the corresponding positions for the leader arm: -
-
- Koch v1.1 leader arm zero position -

1. Zero position

-
-
- Koch v1.1 leader arm rotated position -

2. Rotated position

-
-
- Koch v1.1 leader arm rest position -

3. Rest position

-
-
+| 1. Zero position | 2. Rotated position | 3. Rest position | +|---|---|---| +| Koch v1.1 leader arm zero position | Koch v1.1 leader arm rotated position | Koch v1.1 leader arm rest position | You can watch a [video tutorial of the calibration procedure](https://youtu.be/8drnU9uRY24) for more details. @@ -774,7 +752,7 @@ Before trying `record`, if you want to push your dataset to the hub, make sure y ```bash huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential ``` -Also, store your Hugging Face repositery name in a variable (e.g. `cadene` or `lerobot`). For instance, run this to use your Hugging Face user name as repositery: +Also, store your Hugging Face repository name in a variable (e.g. `cadene` or `lerobot`). For instance, run this to use your Hugging Face user name as repository: ```bash HF_USER=$(huggingface-cli whoami | head -n 1) echo $HF_USER diff --git a/lerobot/__init__.py b/lerobot/__init__.py index 8e06435c3..65998e8b3 100644 --- a/lerobot/__init__.py +++ b/lerobot/__init__.py @@ -129,6 +129,53 @@ available_real_world_datasets = [ "lerobot/unitreeh1_rearrange_objects", "lerobot/unitreeh1_two_robot_greeting", "lerobot/unitreeh1_warehouse", + "lerobot/nyu_rot_dataset", + "lerobot/utokyo_saytap", + "lerobot/imperialcollege_sawyer_wrist_cam", + "lerobot/utokyo_xarm_bimanual", + "lerobot/tokyo_u_lsmo", + "lerobot/utokyo_pr2_opening_fridge", + "lerobot/cmu_franka_exploration_dataset", + "lerobot/cmu_stretch", + "lerobot/asu_table_top", + "lerobot/utokyo_pr2_tabletop_manipulation", + "lerobot/utokyo_xarm_pick_and_place", + "lerobot/ucsd_kitchen_dataset", + "lerobot/austin_buds_dataset", + "lerobot/dlr_sara_grid_clamp", + "lerobot/conq_hose_manipulation", + "lerobot/columbia_cairlab_pusht_real", + "lerobot/dlr_sara_pour", + "lerobot/dlr_edan_shared_control", + "lerobot/ucsd_pick_and_place_dataset", + "lerobot/berkeley_cable_routing", + "lerobot/nyu_franka_play_dataset", + "lerobot/austin_sirius_dataset", + "lerobot/cmu_play_fusion", + "lerobot/berkeley_gnm_sac_son", + "lerobot/nyu_door_opening_surprising_effectiveness", + "lerobot/berkeley_fanuc_manipulation", + "lerobot/jaco_play", + "lerobot/viola", + "lerobot/kaist_nonprehensile", + "lerobot/berkeley_mvp", + "lerobot/uiuc_d3field", + "lerobot/berkeley_gnm_recon", + "lerobot/austin_sailor_dataset", + "lerobot/utaustin_mutex", + "lerobot/roboturk", + "lerobot/stanford_hydra_dataset", + "lerobot/berkeley_autolab_ur5", + "lerobot/stanford_robocook", + "lerobot/toto", + "lerobot/fmb", + "lerobot/droid_100", + "lerobot/berkeley_rpt", + "lerobot/stanford_kuka_multimodal_dataset", + "lerobot/iamlab_cmu_pickup_insert", + "lerobot/taco_play", + "lerobot/berkeley_gnm_cory_hall", + "lerobot/usc_cloth_sim", ] available_datasets = list( diff --git a/lerobot/common/datasets/compute_stats.py b/lerobot/common/datasets/compute_stats.py index a69bc5734..208284465 100644 --- a/lerobot/common/datasets/compute_stats.py +++ b/lerobot/common/datasets/compute_stats.py @@ -40,6 +40,10 @@ def get_stats_einops_patterns(dataset, num_workers=0): stats_patterns = {} for key, feats_type in dataset.features.items(): + # NOTE: skip language_instruction embedding in stats computation + if key == "language_instruction": + continue + # sanity check that tensors are not float64 assert batch[key].dtype != torch.float64 diff --git a/lerobot/common/datasets/push_dataset_to_hub/_download_raw.py b/lerobot/common/datasets/push_dataset_to_hub/_download_raw.py index 36474dd1f..edeaf0933 100644 --- a/lerobot/common/datasets/push_dataset_to_hub/_download_raw.py +++ b/lerobot/common/datasets/push_dataset_to_hub/_download_raw.py @@ -60,8 +60,8 @@ AVAILABLE_RAW_REPO_IDS = { "lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5", "lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5", "lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5", - "lerobot-raw/pusht_raw": "pusht_zarr", "lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr", + "lerobot-raw/pusht_raw": "pusht_zarr", "lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5", "lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5", "lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5", @@ -70,6 +70,74 @@ AVAILABLE_RAW_REPO_IDS = { "lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl", "lerobot-raw/xarm_push_medium_raw": "xarm_pkl", "lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl", + "lerobot-raw/fractal20220817_data_raw": "openx_rlds.fractal20220817_data", + "lerobot-raw/kuka_raw": "openx_rlds.kuka", + "lerobot-raw/bridge_openx_raw": "openx_rlds.bridge_openx", + "lerobot-raw/taco_play_raw": "openx_rlds.taco_play", + "lerobot-raw/jaco_play_raw": "openx_rlds.jaco_play", + "lerobot-raw/berkeley_cable_routing_raw": "openx_rlds.berkeley_cable_routing", + "lerobot-raw/roboturk_raw": "openx_rlds.roboturk", + "lerobot-raw/nyu_door_opening_surprising_effectiveness_raw": "openx_rlds.nyu_door_opening_surprising_effectiveness", + "lerobot-raw/viola_raw": "openx_rlds.viola", + "lerobot-raw/berkeley_autolab_ur5_raw": "openx_rlds.berkeley_autolab_ur5", + "lerobot-raw/toto_raw": "openx_rlds.toto", + "lerobot-raw/language_table_raw": "openx_rlds.language_table", + "lerobot-raw/columbia_cairlab_pusht_real_raw": "openx_rlds.columbia_cairlab_pusht_real", + "lerobot-raw/stanford_kuka_multimodal_dataset_raw": "openx_rlds.stanford_kuka_multimodal_dataset", + "lerobot-raw/nyu_rot_dataset_raw": "openx_rlds.nyu_rot_dataset", + "lerobot-raw/io_ai_tech_raw": "openx_rlds.io_ai_tech", + "lerobot-raw/stanford_hydra_dataset_raw": "openx_rlds.stanford_hydra_dataset", + "lerobot-raw/austin_buds_dataset_raw": "openx_rlds.austin_buds_dataset", + "lerobot-raw/nyu_franka_play_dataset_raw": "openx_rlds.nyu_franka_play_dataset", + "lerobot-raw/maniskill_dataset_raw": "openx_rlds.maniskill_dataset", + "lerobot-raw/furniture_bench_dataset_raw": "openx_rlds.furniture_bench_dataset", + "lerobot-raw/cmu_franka_exploration_dataset_raw": "openx_rlds.cmu_franka_exploration_dataset", + "lerobot-raw/ucsd_kitchen_dataset_raw": "openx_rlds.ucsd_kitchen_dataset", + "lerobot-raw/ucsd_pick_and_place_dataset_raw": "openx_rlds.ucsd_pick_and_place_dataset", + "lerobot-raw/spoc_raw": "openx_rlds.spoc", + "lerobot-raw/austin_sailor_dataset_raw": "openx_rlds.austin_sailor_dataset", + "lerobot-raw/austin_sirius_dataset_raw": "openx_rlds.austin_sirius_dataset", + "lerobot-raw/bc_z_raw": "openx_rlds.bc_z", + "lerobot-raw/utokyo_pr2_opening_fridge_raw": "openx_rlds.utokyo_pr2_opening_fridge", + "lerobot-raw/utokyo_pr2_tabletop_manipulation_raw": "openx_rlds.utokyo_pr2_tabletop_manipulation", + "lerobot-raw/utokyo_xarm_pick_and_place_raw": "openx_rlds.utokyo_xarm_pick_and_place", + "lerobot-raw/utokyo_xarm_bimanual_raw": "openx_rlds.utokyo_xarm_bimanual", + "lerobot-raw/utokyo_saytap_raw": "openx_rlds.utokyo_saytap", + "lerobot-raw/robo_net_raw": "openx_rlds.robo_net", + "lerobot-raw/robo_set_raw": "openx_rlds.robo_set", + "lerobot-raw/berkeley_mvp_raw": "openx_rlds.berkeley_mvp", + "lerobot-raw/berkeley_rpt_raw": "openx_rlds.berkeley_rpt", + "lerobot-raw/kaist_nonprehensile_raw": "openx_rlds.kaist_nonprehensile", + "lerobot-raw/stanford_mask_vit_raw": "openx_rlds.stanford_mask_vit", + "lerobot-raw/tokyo_u_lsmo_raw": "openx_rlds.tokyo_u_lsmo", + "lerobot-raw/dlr_sara_pour_raw": "openx_rlds.dlr_sara_pour", + "lerobot-raw/dlr_sara_grid_clamp_raw": "openx_rlds.dlr_sara_grid_clamp", + "lerobot-raw/dlr_edan_shared_control_raw": "openx_rlds.dlr_edan_shared_control", + "lerobot-raw/asu_table_top_raw": "openx_rlds.asu_table_top", + "lerobot-raw/stanford_robocook_raw": "openx_rlds.stanford_robocook", + "lerobot-raw/imperialcollege_sawyer_wrist_cam_raw": "openx_rlds.imperialcollege_sawyer_wrist_cam", + "lerobot-raw/iamlab_cmu_pickup_insert_raw": "openx_rlds.iamlab_cmu_pickup_insert", + "lerobot-raw/uiuc_d3field_raw": "openx_rlds.uiuc_d3field", + "lerobot-raw/utaustin_mutex_raw": "openx_rlds.utaustin_mutex", + "lerobot-raw/berkeley_fanuc_manipulation_raw": "openx_rlds.berkeley_fanuc_manipulation", + "lerobot-raw/cmu_playing_with_food_raw": "openx_rlds.cmu_playing_with_food", + "lerobot-raw/cmu_play_fusion_raw": "openx_rlds.cmu_play_fusion", + "lerobot-raw/cmu_stretch_raw": "openx_rlds.cmu_stretch", + "lerobot-raw/berkeley_gnm_recon_raw": "openx_rlds.berkeley_gnm_recon", + "lerobot-raw/berkeley_gnm_cory_hall_raw": "openx_rlds.berkeley_gnm_cory_hall", + "lerobot-raw/berkeley_gnm_sac_son_raw": "openx_rlds.berkeley_gnm_sac_son", + "lerobot-raw/droid_raw": "openx_rlds.droid", + "lerobot-raw/droid_100_raw": "openx_rlds.droid100", + "lerobot-raw/fmb_raw": "openx_rlds.fmb", + "lerobot-raw/dobbe_raw": "openx_rlds.dobbe", + "lerobot-raw/usc_cloth_sim_raw": "openx_rlds.usc_cloth_sim", + "lerobot-raw/plex_robosuite_raw": "openx_rlds.plex_robosuite", + "lerobot-raw/conq_hose_manipulation_raw": "openx_rlds.conq_hose_manipulation", + "lerobot-raw/vima_raw": "openx_rlds.vima", + "lerobot-raw/robot_vqa_raw": "openx_rlds.robot_vqa", + "lerobot-raw/mimic_play_raw": "openx_rlds.mimic_play", + "lerobot-raw/tidybot_raw": "openx_rlds.tidybot", + "lerobot-raw/eth_agent_affordances_raw": "openx_rlds.eth_agent_affordances", } @@ -110,7 +178,7 @@ def download_all_raw_datasets(data_dir: Path | None = None): def main(): parser = argparse.ArgumentParser( description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a - non exhaustive list of available repositories to use in `--repo-id`: {AVAILABLE_RAW_REPO_IDS}""", + non exhaustive list of available repositories to use in `--repo-id`: {list(AVAILABLE_RAW_REPO_IDS.keys())}""", ) parser.add_argument( diff --git a/lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml b/lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml new file mode 100644 index 000000000..9bbc46499 --- /dev/null +++ b/lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml @@ -0,0 +1,640 @@ +OPENX_DATASET_CONFIGS: + fractal20220817_data: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - base_pose_tool_reached + - gripper_closed + fps: 3 + + kuka: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - clip_function_input/base_pose_tool_reached + - gripper_closed + fps: 10 + + bridge_openx: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - EEF_state + - gripper_state + fps: 5 + + taco_play: + image_obs_keys: + - rgb_static + - rgb_gripper + depth_obs_keys: + - depth_static + - depth_gripper + state_obs_keys: + - state_eef + - state_gripper + fps: 15 + + jaco_play: + image_obs_keys: + - image + - image_wrist + depth_obs_keys: + - null + state_obs_keys: + - state_eef + - state_gripper + fps: 10 + + berkeley_cable_routing: + image_obs_keys: + - image + - top_image + - wrist45_image + - wrist225_image + depth_obs_keys: + - null + state_obs_keys: + - robot_state + fps: 10 + + roboturk: + image_obs_keys: + - front_rgb + depth_obs_keys: + - null + state_obs_keys: + - null + fps: 10 + + nyu_door_opening_surprising_effectiveness: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - null + fps: 3 + + viola: + image_obs_keys: + - agentview_rgb + - eye_in_hand_rgb + depth_obs_keys: + - null + state_obs_keys: + - joint_states + - gripper_states + fps: 20 + + berkeley_autolab_ur5: + image_obs_keys: + - image + - hand_image + depth_obs_keys: + - image_with_depth + state_obs_keys: + - state + fps: 5 + + toto: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 30 + + language_table: + image_obs_keys: + - rgb + depth_obs_keys: + - null + state_obs_keys: + - effector_translation + fps: 10 + + columbia_cairlab_pusht_real: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - robot_state + fps: 10 + + stanford_kuka_multimodal_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - depth_image + state_obs_keys: + - ee_position + - ee_orientation + fps: 20 + + nyu_rot_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 3 + + io_ai_tech: + image_obs_keys: + - image + - image_fisheye + - image_left_side + - image_right_side + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 3 + + stanford_hydra_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 10 + + austin_buds_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 20 + + nyu_franka_play_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + - image_additional_view + depth_obs_keys: + - depth + - depth_additional_view + state_obs_keys: + - eef_state + fps: 3 + + maniskill_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - depth + - wrist_depth + state_obs_keys: + - tcp_pose + - gripper_state + fps: 20 + + furniture_bench_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 10 + + cmu_franka_exploration_dataset_converted_externally_to_rlds: + image_obs_keys: + - highres_image + depth_obs_keys: + - null + state_obs_keys: + - null + fps: 10 + + ucsd_kitchen_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - joint_state + fps: 2 + + ucsd_pick_and_place_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 3 + + spoc: + image_obs_keys: + - image + - image_manipulation + depth_obs_keys: + - null + state_obs_keys: + - null + fps: 3 + + austin_sailor_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 20 + + austin_sirius_dataset_converted_externally_to_rlds: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 20 + + bc_z: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - present/xyz + - present/axis_angle + - present/sensed_close + fps: 10 + + utokyo_pr2_opening_fridge_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 10 + + utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 10 + + utokyo_xarm_pick_and_place_converted_externally_to_rlds: + image_obs_keys: + - image + - image2 + - hand_image + depth_obs_keys: + - null + state_obs_keys: + - end_effector_pose + fps: 10 + + utokyo_xarm_bimanual_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - pose_r + fps: 10 + + robo_net: + image_obs_keys: + - image + - image1 + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 1 + + robo_set: + image_obs_keys: + - image_left + - image_right + - image_wrist + depth_obs_keys: + - null + state_obs_keys: + - state + - state_velocity + fps: 5 + + berkeley_mvp_converted_externally_to_rlds: + image_obs_keys: + - hand_image + depth_obs_keys: + - null + state_obs_keys: + - gripper + - pose + - joint_pos + fps: 5 + + berkeley_rpt_converted_externally_to_rlds: + image_obs_keys: + - hand_image + depth_obs_keys: + - null + state_obs_keys: + - joint_pos + - gripper + fps: 30 + + kaist_nonprehensile_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 10 + + stanford_mask_vit_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + + tokyo_u_lsmo_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 10 + + dlr_sara_pour_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 10 + + dlr_sara_grid_clamp_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 10 + + dlr_edan_shared_control_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 5 + + asu_table_top_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 12.5 + + stanford_robocook_converted_externally_to_rlds: + image_obs_keys: + - image_1 + - image_2 + depth_obs_keys: + - depth_1 + - depth_2 + state_obs_keys: + - eef_state + - gripper_state + fps: 5 + + imperialcollege_sawyer_wrist_cam: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 10 + + iamlab_cmu_pickup_insert_converted_externally_to_rlds: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - joint_state + - gripper_state + fps: 20 + + uiuc_d3field: + image_obs_keys: + - image_1 + - image_2 + depth_obs_keys: + - depth_1 + - depth_2 + state_obs_keys: + - null + fps: 1 + + utaustin_mutex: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 20 + + berkeley_fanuc_manipulation: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - joint_state + - gripper_state + fps: 10 + + cmu_playing_with_food: + image_obs_keys: + - image + - finger_vision_1 + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 10 + + cmu_play_fusion: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 5 + + cmu_stretch: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - eef_state + - gripper_state + fps: 10 + + berkeley_gnm_recon: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + - position + - yaw + fps: 3 + + berkeley_gnm_cory_hall: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + - position + - yaw + fps: 5 + + berkeley_gnm_sac_son: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - state + - position + - yaw + fps: 10 + + droid: + image_obs_keys: + - exterior_image_1_left + - exterior_image_2_left + - wrist_image_left + depth_obs_keys: + - null + state_obs_keys: + - proprio + fps: 15 + + droid_100: + image_obs_keys: + - exterior_image_1_left + - exterior_image_2_left + - wrist_image_left + depth_obs_keys: + - null + state_obs_keys: + - proprio + fps: 15 + + fmb: + image_obs_keys: + - image_side_1 + - image_side_2 + - image_wrist_1 + - image_wrist_2 + depth_obs_keys: + - image_side_1_depth + - image_side_2_depth + - image_wrist_1_depth + - image_wrist_2_depth + state_obs_keys: + - proprio + fps: 10 + + dobbe: + image_obs_keys: + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - proprio + fps: 3.75 + + usc_cloth_sim_converted_externally_to_rlds: + image_obs_keys: + - image + depth_obs_keys: + - null + state_obs_keys: + - null + fps: 10 + + plex_robosuite: + image_obs_keys: + - image + - wrist_image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 20 + + conq_hose_manipulation: + image_obs_keys: + - frontleft_fisheye_image + - frontright_fisheye_image + - hand_color_image + depth_obs_keys: + - null + state_obs_keys: + - state + fps: 30 + \ No newline at end of file diff --git a/lerobot/common/datasets/push_dataset_to_hub/openx/data_utils.py b/lerobot/common/datasets/push_dataset_to_hub/openx/data_utils.py new file mode 100644 index 000000000..1582c67c2 --- /dev/null +++ b/lerobot/common/datasets/push_dataset_to_hub/openx/data_utils.py @@ -0,0 +1,106 @@ +#!/usr/bin/env python + +# Copyright 2024 The HuggingFace Inc. team. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the Licens e. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. +""" +NOTE(YL): Adapted from: + Octo: https://github.com/octo-models/octo/blob/main/octo/data/utils/data_utils.py + +data_utils.py + +Additional utils for data processing. +""" + +from typing import Any, Dict, List + +import tensorflow as tf + + +def binarize_gripper_actions(actions: tf.Tensor) -> tf.Tensor: + """ + Converts gripper actions from continuous to binary values (0 and 1). + + We exploit that fact that most of the time, the gripper is fully open (near 1.0) or fully closed (near 0.0). As it + transitions between the two, it sometimes passes through a few intermediate values. We relabel those intermediate + values based on the state that is reached _after_ those intermediate values. + + In the edge case that the trajectory ends with an intermediate value, we give up on binarizing and relabel that + chunk of intermediate values as the last action in the trajectory. + + The `scan_fn` implements the following logic: + new_actions = np.empty_like(actions) + carry = actions[-1] + for i in reversed(range(actions.shape[0])): + if in_between_mask[i]: + carry = carry + else: + carry = float(open_mask[i]) + new_actions[i] = carry + """ + open_mask, closed_mask = actions > 0.95, actions < 0.05 + in_between_mask = tf.logical_not(tf.logical_or(open_mask, closed_mask)) + is_open_float = tf.cast(open_mask, tf.float32) + + def scan_fn(carry, i): + return tf.cond(in_between_mask[i], lambda: tf.cast(carry, tf.float32), lambda: is_open_float[i]) + + return tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), actions[-1], reverse=True) + + +def invert_gripper_actions(actions: tf.Tensor) -> tf.Tensor: + return 1 - actions + + +def rel2abs_gripper_actions(actions: tf.Tensor) -> tf.Tensor: + """ + Converts relative gripper actions (+1 for closing, -1 for opening) to absolute actions (0 = closed; 1 = open). + + Assumes that the first relative gripper is not redundant (i.e. close when already closed)! + """ + # Note =>> -1 for closing, 1 for opening, 0 for no change + opening_mask, closing_mask = actions < -0.1, actions > 0.1 + thresholded_actions = tf.where(opening_mask, 1, tf.where(closing_mask, -1, 0)) + + def scan_fn(carry, i): + return tf.cond(thresholded_actions[i] == 0, lambda: carry, lambda: thresholded_actions[i]) + + # If no relative grasp, assumes open for whole trajectory + start = -1 * thresholded_actions[tf.argmax(thresholded_actions != 0, axis=0)] + start = tf.cond(start == 0, lambda: 1, lambda: start) + + # Note =>> -1 for closed, 1 for open + new_actions = tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), start) + new_actions = tf.cast(new_actions, tf.float32) / 2 + 0.5 + + return new_actions + + +# === Bridge-V2 =>> Dataset-Specific Transform === +def relabel_bridge_actions(traj: Dict[str, Any]) -> Dict[str, Any]: + """Relabels actions to use reached proprioceptive state; discards last timestep (no-action).""" + movement_actions = traj["observation"]["state"][1:, :6] - traj["observation"]["state"][:-1, :6] + traj_truncated = tf.nest.map_structure(lambda x: x[:-1], traj) + traj_truncated["action"] = tf.concat([movement_actions, traj["action"][:-1, -1:]], axis=1) + + return traj_truncated + + +# === RLDS Dataset Initialization Utilities === +def pprint_data_mixture(dataset_kwargs_list: List[Dict[str, Any]], dataset_weights: List[int]) -> None: + print("\n######################################################################################") + print(f"# Loading the following {len(dataset_kwargs_list)} datasets (incl. sampling weight):{'': >24} #") + for dataset_kwargs, weight in zip(dataset_kwargs_list, dataset_weights, strict=False): + pad = 80 - len(dataset_kwargs["name"]) + print(f"# {dataset_kwargs['name']}: {weight:=>{pad}f} #") + print("######################################################################################\n") diff --git a/lerobot/common/datasets/push_dataset_to_hub/openx/droid_utils.py b/lerobot/common/datasets/push_dataset_to_hub/openx/droid_utils.py new file mode 100644 index 000000000..22ac4d9e3 --- /dev/null +++ b/lerobot/common/datasets/push_dataset_to_hub/openx/droid_utils.py @@ -0,0 +1,200 @@ +#!/usr/bin/env python + +# Copyright 2024 The HuggingFace Inc. team. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. +""" +NOTE(YL): Adapted from: + OpenVLA: https://github.com/openvla/openvla + +Episode transforms for DROID dataset. +""" + +from typing import Any, Dict + +import tensorflow as tf +import tensorflow_graphics.geometry.transformation as tfg + + +def rmat_to_euler(rot_mat): + return tfg.euler.from_rotation_matrix(rot_mat) + + +def euler_to_rmat(euler): + return tfg.rotation_matrix_3d.from_euler(euler) + + +def invert_rmat(rot_mat): + return tfg.rotation_matrix_3d.inverse(rot_mat) + + +def rotmat_to_rot6d(mat): + """ + Converts rotation matrix to R6 rotation representation (first two rows in rotation matrix). + Args: + mat: rotation matrix + + Returns: 6d vector (first two rows of rotation matrix) + + """ + r6 = mat[..., :2, :] + r6_0, r6_1 = r6[..., 0, :], r6[..., 1, :] + r6_flat = tf.concat([r6_0, r6_1], axis=-1) + return r6_flat + + +def velocity_act_to_wrist_frame(velocity, wrist_in_robot_frame): + """ + Translates velocity actions (translation + rotation) from base frame of the robot to wrist frame. + Args: + velocity: 6d velocity action (3 x translation, 3 x rotation) + wrist_in_robot_frame: 6d pose of the end-effector in robot base frame + + Returns: 9d velocity action in robot wrist frame (3 x translation, 6 x rotation as R6) + + """ + r_frame = euler_to_rmat(wrist_in_robot_frame[:, 3:6]) + r_frame_inv = invert_rmat(r_frame) + + # world to wrist: dT_pi = R^-1 dT_rbt + vel_t = (r_frame_inv @ velocity[:, :3][..., None])[..., 0] + + # world to wrist: dR_pi = R^-1 dR_rbt R + dr_ = euler_to_rmat(velocity[:, 3:6]) + dr_ = r_frame_inv @ (dr_ @ r_frame) + dr_r6 = rotmat_to_rot6d(dr_) + return tf.concat([vel_t, dr_r6], axis=-1) + + +def rand_swap_exterior_images(img1, img2): + """ + Randomly swaps the two exterior images (for training with single exterior input). + """ + return tf.cond(tf.random.uniform(shape=[]) > 0.5, lambda: (img1, img2), lambda: (img2, img1)) + + +def droid_baseact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + DROID dataset transformation for actions expressed in *base* frame of the robot. + """ + dt = trajectory["action_dict"]["cartesian_velocity"][:, :3] + dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6] + + trajectory["action"] = tf.concat( + ( + dt, + dr_, + 1 - trajectory["action_dict"]["gripper_position"], + ), + axis=-1, + ) + trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = ( + rand_swap_exterior_images( + trajectory["observation"]["exterior_image_1_left"], + trajectory["observation"]["exterior_image_2_left"], + ) + ) + trajectory["observation"]["proprio"] = tf.concat( + ( + trajectory["observation"]["cartesian_position"], + trajectory["observation"]["gripper_position"], + ), + axis=-1, + ) + return trajectory + + +def droid_wristact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + DROID dataset transformation for actions expressed in *wrist* frame of the robot. + """ + wrist_act = velocity_act_to_wrist_frame( + trajectory["action_dict"]["cartesian_velocity"], trajectory["observation"]["cartesian_position"] + ) + trajectory["action"] = tf.concat( + ( + wrist_act, + trajectory["action_dict"]["gripper_position"], + ), + axis=-1, + ) + trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = ( + rand_swap_exterior_images( + trajectory["observation"]["exterior_image_1_left"], + trajectory["observation"]["exterior_image_2_left"], + ) + ) + trajectory["observation"]["proprio"] = tf.concat( + ( + trajectory["observation"]["cartesian_position"], + trajectory["observation"]["gripper_position"], + ), + axis=-1, + ) + return trajectory + + +def droid_finetuning_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + DROID dataset transformation for actions expressed in *base* frame of the robot. + """ + dt = trajectory["action_dict"]["cartesian_velocity"][:, :3] + dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6] + trajectory["action"] = tf.concat( + ( + dt, + dr_, + 1 - trajectory["action_dict"]["gripper_position"], + ), + axis=-1, + ) + trajectory["observation"]["proprio"] = tf.concat( + ( + trajectory["observation"]["cartesian_position"], + trajectory["observation"]["gripper_position"], + ), + axis=-1, + ) + return trajectory + + +def zero_action_filter(traj: Dict) -> bool: + """ + Filters transitions whose actions are all-0 (only relative actions, no gripper action). + Note: this filter is applied *after* action normalization, so need to compare to "normalized 0". + """ + droid_q01 = tf.convert_to_tensor( + [ + -0.7776297926902771, + -0.5803514122962952, + -0.5795090794563293, + -0.6464047729969025, + -0.7041108310222626, + -0.8895104378461838, + ] + ) + droid_q99 = tf.convert_to_tensor( + [ + 0.7597932070493698, + 0.5726242214441299, + 0.7351000607013702, + 0.6705610305070877, + 0.6464948207139969, + 0.8897542208433151, + ] + ) + droid_norm_0_act = ( + 2 * (tf.zeros_like(traj["action"][:, :6]) - droid_q01) / (droid_q99 - droid_q01 + 1e-8) - 1 + ) + + return tf.reduce_any(tf.math.abs(traj["action"][:, :6] - droid_norm_0_act) > 1e-5) diff --git a/lerobot/common/datasets/push_dataset_to_hub/openx/transforms.py b/lerobot/common/datasets/push_dataset_to_hub/openx/transforms.py new file mode 100644 index 000000000..a0c1e30f6 --- /dev/null +++ b/lerobot/common/datasets/push_dataset_to_hub/openx/transforms.py @@ -0,0 +1,859 @@ +#!/usr/bin/env python + +# Copyright 2024 The HuggingFace Inc. team. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. +""" +NOTE(YL): Adapted from: + OpenVLA: https://github.com/openvla/openvla + Octo: https://github.com/octo-models/octo + +transforms.py + +Defines a registry of per-dataset standardization transforms for each dataset in Open-X Embodiment. + +Transforms adopt the following structure: + Input: Dictionary of *batched* features (i.e., has leading time dimension) + Output: Dictionary `step` =>> { + "observation": { + + State (in chosen state representation) + }, + "action": Action (in chosen action representation), + "language_instruction": str + } +""" + +from typing import Any, Dict + +import tensorflow as tf + +from lerobot.common.datasets.push_dataset_to_hub.openx.data_utils import ( + binarize_gripper_actions, + invert_gripper_actions, + rel2abs_gripper_actions, + relabel_bridge_actions, +) + + +def droid_baseact_transform_fn(): + from lerobot.common.datasets.push_dataset_to_hub.openx.droid_utils import droid_baseact_transform + + return droid_baseact_transform + + +def bridge_openx_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + Applies to version of Bridge V2 in Open X-Embodiment mixture. + + Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it! + """ + for key in trajectory: + if key == "traj_metadata": + continue + elif key in ["observation", "action"]: + for key2 in trajectory[key]: + trajectory[key][key2] = trajectory[key][key2][1:] + else: + trajectory[key] = trajectory[key][1:] + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32), + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + trajectory = relabel_bridge_actions(trajectory) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def bridge_orig_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + Applies to original version of Bridge V2 from the official project website. + + Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it! + """ + for key in trajectory: + if key == "traj_metadata": + continue + elif key == "observation": + for key2 in trajectory[key]: + trajectory[key][key2] = trajectory[key][key2][1:] + else: + trajectory[key] = trajectory[key][1:] + + trajectory["action"] = tf.concat( + [ + trajectory["action"][:, :6], + binarize_gripper_actions(trajectory["action"][:, -1])[:, None], + ], + axis=1, + ) + trajectory = relabel_bridge_actions(trajectory) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def ppgm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + [ + trajectory["action"][:, :6], + binarize_gripper_actions(trajectory["action"][:, -1])[:, None], + ], + axis=1, + ) + trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"][:, -1:] + return trajectory + + +def rt1_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action[:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def kuka_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action[:, None], + ), + axis=-1, + ) + # decode compressed state + eef_value = tf.io.decode_compressed( + trajectory["observation"]["clip_function_input/base_pose_tool_reached"], + compression_type="ZLIB", + ) + eef_value = tf.io.decode_raw(eef_value, tf.float32) + trajectory["observation"]["clip_function_input/base_pose_tool_reached"] = tf.reshape(eef_value, (-1, 7)) + gripper_value = tf.io.decode_compressed( + trajectory["observation"]["gripper_closed"], compression_type="ZLIB" + ) + gripper_value = tf.io.decode_raw(gripper_value, tf.float32) + trajectory["observation"]["gripper_closed"] = tf.reshape(gripper_value, (-1, 1)) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def taco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state_eef"] = trajectory["observation"]["robot_obs"][:, :6] + trajectory["observation"]["state_gripper"] = trajectory["observation"]["robot_obs"][:, 7:8] + trajectory["action"] = trajectory["action"]["rel_actions_world"] + + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + tf.clip_by_value(trajectory["action"][:, -1:], 0, 1), + ), + axis=-1, + ) + + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def jaco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state_eef"] = trajectory["observation"]["end_effector_cartesian_pos"][:, :6] + trajectory["observation"]["state_gripper"] = trajectory["observation"]["end_effector_cartesian_pos"][ + :, -1: + ] + + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + tf.zeros_like(trajectory["action"]["world_vector"]), + gripper_action[:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def berkeley_cable_routing_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + tf.zeros_like(trajectory["action"]["world_vector"][:, :1]), + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def roboturk_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert absolute gripper action, +1 = open, 0 = close + gripper_action = invert_gripper_actions( + tf.clip_by_value(trajectory["action"]["gripper_closedness_action"], 0, 1) + ) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action, + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + trajectory["language_embedding"] = trajectory["observation"]["natural_language_embedding"] + return trajectory + + +def nyu_door_opening_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action[:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def viola_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # make gripper action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"][:, None] + gripper_action = tf.clip_by_value(gripper_action, 0, 1) + gripper_action = invert_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action, + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def berkeley_autolab_ur5_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = trajectory["observation"]["robot_state"][:, 6:14] + + # make gripper action absolute action, +1 = open, 0 = close + gripper_action = trajectory["action"]["gripper_closedness_action"] + gripper_action = rel2abs_gripper_actions(gripper_action) + + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + gripper_action[:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def toto_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32), + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def language_table_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # default to "open" gripper + trajectory["action"] = tf.concat( + ( + trajectory["action"], + tf.zeros_like(trajectory["action"]), + tf.zeros_like(trajectory["action"]), + tf.ones_like(trajectory["action"][:, :1]), + ), + axis=-1, + ) + + # decode language instruction + instruction_bytes = trajectory["observation"]["instruction"] + instruction_encoded = tf.strings.unicode_encode(instruction_bytes, output_encoding="UTF-8") + # Remove trailing padding --> convert RaggedTensor to regular Tensor. + trajectory["language_instruction"] = tf.strings.split(instruction_encoded, "\x00")[:, :1].to_tensor()[ + :, 0 + ] + return trajectory + + +def pusht_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["world_vector"], + trajectory["action"]["rotation_delta"], + trajectory["action"]["gripper_closedness_action"][:, None], + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def stanford_kuka_multimodal_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["depth_image"] = trajectory["observation"]["depth_image"][..., 0] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tf.zeros_like(trajectory["action"][:, :3]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def nyu_rot_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][..., :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., -1:] + trajectory["action"] = trajectory["action"][..., :7] + return trajectory + + +def stanford_hydra_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(trajectory["action"][:, -1:]), + ), + axis=-1, + ) + + trajectory["observation"]["eef_state"] = tf.concat( + ( + trajectory["observation"]["state"][:, :3], + trajectory["observation"]["state"][:, 7:10], + ), + axis=-1, + ) + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -3:-2] + return trajectory + + +def austin_buds_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + + trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8] + return trajectory + + +def nyu_franka_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["depth"] = tf.cast(trajectory["observation"]["depth"][..., 0], tf.float32) + trajectory["observation"]["depth_additional_view"] = tf.cast( + trajectory["observation"]["depth_additional_view"][..., 0], tf.float32 + ) + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, -6:] + + # clip gripper action, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, -8:-2], + tf.clip_by_value(trajectory["action"][:, -2:-1], 0, 1), + ), + axis=-1, + ) + return trajectory + + +def maniskill_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., 7:8] + return trajectory + + +def furniture_bench_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + import tensorflow_graphics.geometry.transformation as tft + + trajectory["observation"]["state"] = tf.concat( + ( + trajectory["observation"]["state"][:, :7], + trajectory["observation"]["state"][:, -1:], + ), + axis=-1, + ) + + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tft.euler.from_quaternion(trajectory["action"][:, 3:7]), + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + return trajectory + + +def cmu_franka_exploration_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def ucsd_kitchen_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7] + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def ucsd_pick_place_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tf.zeros_like(trajectory["action"][:, :3]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def austin_sailor_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + return trajectory + + +def austin_sirius_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + return trajectory + + +def bc_z_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"]["future/xyz_residual"][:, :3], + trajectory["action"]["future/axis_angle_residual"][:, :3], + invert_gripper_actions(tf.cast(trajectory["action"]["future/target_close"][:, :1], tf.float32)), + ), + axis=-1, + ) + trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"] + return trajectory + + +def tokyo_pr2_opening_fridge_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def tokyo_pr2_tabletop_manipulation_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def utokyo_xarm_bimanual_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = trajectory["action"][..., -7:] + return trajectory + + +def robo_net_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = tf.concat( + ( + trajectory["observation"]["state"][:, :4], + tf.zeros_like(trajectory["observation"]["state"][:, :2]), + ), + axis=-1, + ) + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :4], + tf.zeros_like(trajectory["action"][:, :2]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def berkeley_mvp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + """ + trajectory["observation"]["state"] = tf.concat(( + tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32), + trajectory["observation"]["pose"], + trajectory["observation"]["joint_pos"],), + axis=-1,) + """ + trajectory["observation"]["gripper"] = tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32) + return trajectory + + +def berkeley_rpt_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["gripper"] = tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32) + return trajectory + + +def kaist_nonprehensible_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = trajectory["observation"]["state"][:, -7:] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + tf.zeros_like(trajectory["action"][:, :1]), + ), + axis=-1, + ) + return trajectory + + +def stanford_mask_vit_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = tf.concat( + ( + trajectory["observation"]["end_effector_pose"][:, :4], + tf.zeros_like(trajectory["observation"]["end_effector_pose"][:, :2]), + ), + axis=-1, + ) + trajectory["observation"]["gripper_state"] = trajectory["observation"]["end_effector_pose"][:, -1:] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :4], + tf.zeros_like(trajectory["action"][:, :2]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def tokyo_lsmo_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def dlr_sara_grid_clamp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :6] + return trajectory + + +def dlr_edan_shared_control_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # invert gripper action, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(trajectory["action"][:, -1:]), + ), + axis=-1, + ) + return trajectory + + +def asu_table_top_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["ground_truth_states"]["EE"] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def robocook_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + return trajectory + + +def imperial_wristcam_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def iamlab_pick_insert_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + import tensorflow_graphics.geometry.transformation as tft + + trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 7:8] + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tft.euler.from_quaternion(trajectory["action"][:, 3:7]), + trajectory["action"][:, 7:8], + ), + axis=-1, + ) + return trajectory + + +def uiuc_d3field_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"], + tf.zeros_like(trajectory["action"]), + tf.zeros_like(trajectory["action"][:, :1]), + ), + axis=-1, + ) + return trajectory + + +def utaustin_mutex_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8] + + # invert gripper action + clip, +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :6], + invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)), + ), + axis=-1, + ) + return trajectory + + +def berkeley_fanuc_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :6] + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 6:7] + + # dataset does not store gripper actions, so use gripper state info, invert so +1 = open, 0 = close + trajectory["action"] = tf.concat( + ( + trajectory["action"], + invert_gripper_actions(trajectory["observation"]["gripper_state"]), + ), + axis=-1, + ) + return trajectory + + +def cmu_playing_with_food_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + import tensorflow_graphics.geometry.transformation as tft + + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + tft.euler.from_quaternion(trajectory["action"][:, 3:7]), + trajectory["action"][:, -1:], + ), + axis=-1, + ) + return trajectory + + +def playfusion_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :3], + trajectory["action"][:, -4:], + ), + axis=-1, + ) + return trajectory + + +def cmu_stretch_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["eef_state"] = tf.concat( + ( + trajectory["observation"]["state"][:, :3], + tf.zeros_like(trajectory["observation"]["state"][:, :3]), + ), + axis=-1, + ) + trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:] + trajectory["action"] = trajectory["action"][..., :-1] + return trajectory + + +def gnm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + trajectory["observation"]["state"] = tf.concat( + ( + trajectory["observation"]["position"], + tf.zeros_like(trajectory["observation"]["state"][:, :3]), + trajectory["observation"]["yaw"], + ), + axis=-1, + ) + trajectory["action"] = tf.concat( + ( + trajectory["action"], + tf.zeros_like(trajectory["action"]), + tf.zeros_like(trajectory["action"]), + tf.zeros_like(trajectory["action"][:, :1]), + ), + axis=-1, + ) + return trajectory + + +def fmb_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # every input feature is batched, ie has leading batch dimension + trajectory["observation"]["proprio"] = tf.concat( + ( + trajectory["observation"]["eef_pose"], + trajectory["observation"]["state_gripper_pose"][..., None], + ), + axis=-1, + ) + return trajectory + + +def dobbe_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # every input feature is batched, ie has leading batch dimension + trajectory["observation"]["proprio"] = trajectory["observation"]["state"] + return trajectory + + +def robo_set_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + # gripper action is in -1...1 --> clip to 0...1, flip + gripper_action = trajectory["action"][:, -1:] + gripper_action = invert_gripper_actions(tf.clip_by_value(gripper_action, 0, 1)) + + trajectory["action"] = tf.concat( + ( + trajectory["action"][:, :7], + gripper_action, + ), + axis=-1, + ) + return trajectory + + +def identity_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]: + return trajectory + + +# === Registry === +OPENX_STANDARDIZATION_TRANSFORMS = { + "bridge_openx": bridge_openx_dataset_transform, + "bridge_orig": bridge_orig_dataset_transform, + "bridge_dataset": bridge_orig_dataset_transform, + "ppgm": ppgm_dataset_transform, + "ppgm_static": ppgm_dataset_transform, + "ppgm_wrist": ppgm_dataset_transform, + "fractal20220817_data": rt1_dataset_transform, + "kuka": kuka_dataset_transform, + "taco_play": taco_play_dataset_transform, + "jaco_play": jaco_play_dataset_transform, + "berkeley_cable_routing": berkeley_cable_routing_dataset_transform, + "roboturk": roboturk_dataset_transform, + "nyu_door_opening_surprising_effectiveness": nyu_door_opening_dataset_transform, + "viola": viola_dataset_transform, + "berkeley_autolab_ur5": berkeley_autolab_ur5_dataset_transform, + "toto": toto_dataset_transform, + "language_table": language_table_dataset_transform, + "columbia_cairlab_pusht_real": pusht_dataset_transform, + "stanford_kuka_multimodal_dataset_converted_externally_to_rlds": stanford_kuka_multimodal_dataset_transform, + "nyu_rot_dataset_converted_externally_to_rlds": nyu_rot_dataset_transform, + "stanford_hydra_dataset_converted_externally_to_rlds": stanford_hydra_dataset_transform, + "austin_buds_dataset_converted_externally_to_rlds": austin_buds_dataset_transform, + "nyu_franka_play_dataset_converted_externally_to_rlds": nyu_franka_play_dataset_transform, + "maniskill_dataset_converted_externally_to_rlds": maniskill_dataset_transform, + "furniture_bench_dataset_converted_externally_to_rlds": furniture_bench_dataset_transform, + "cmu_franka_exploration_dataset_converted_externally_to_rlds": cmu_franka_exploration_dataset_transform, + "ucsd_kitchen_dataset_converted_externally_to_rlds": ucsd_kitchen_dataset_transform, + "ucsd_pick_and_place_dataset_converted_externally_to_rlds": ucsd_pick_place_dataset_transform, + "austin_sailor_dataset_converted_externally_to_rlds": austin_sailor_dataset_transform, + "austin_sirius_dataset_converted_externally_to_rlds": austin_sirius_dataset_transform, + "bc_z": bc_z_dataset_transform, + "utokyo_pr2_opening_fridge_converted_externally_to_rlds": tokyo_pr2_opening_fridge_dataset_transform, + "utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds": tokyo_pr2_tabletop_manipulation_dataset_transform, + "utokyo_xarm_pick_and_place_converted_externally_to_rlds": identity_transform, + "utokyo_xarm_bimanual_converted_externally_to_rlds": utokyo_xarm_bimanual_dataset_transform, + "robo_net": robo_net_dataset_transform, + "berkeley_mvp_converted_externally_to_rlds": berkeley_mvp_dataset_transform, + "berkeley_rpt_converted_externally_to_rlds": berkeley_rpt_dataset_transform, + "kaist_nonprehensile_converted_externally_to_rlds": kaist_nonprehensible_dataset_transform, + "stanford_mask_vit_converted_externally_to_rlds": stanford_mask_vit_dataset_transform, + "tokyo_u_lsmo_converted_externally_to_rlds": tokyo_lsmo_dataset_transform, + "dlr_sara_pour_converted_externally_to_rlds": identity_transform, + "dlr_sara_grid_clamp_converted_externally_to_rlds": dlr_sara_grid_clamp_dataset_transform, + "dlr_edan_shared_control_converted_externally_to_rlds": dlr_edan_shared_control_dataset_transform, + "asu_table_top_converted_externally_to_rlds": asu_table_top_dataset_transform, + "stanford_robocook_converted_externally_to_rlds": robocook_dataset_transform, + "imperialcollege_sawyer_wrist_cam": imperial_wristcam_dataset_transform, + "iamlab_cmu_pickup_insert_converted_externally_to_rlds": iamlab_pick_insert_dataset_transform, + "uiuc_d3field": uiuc_d3field_dataset_transform, + "utaustin_mutex": utaustin_mutex_dataset_transform, + "berkeley_fanuc_manipulation": berkeley_fanuc_dataset_transform, + "cmu_playing_with_food": cmu_playing_with_food_dataset_transform, + "cmu_play_fusion": playfusion_dataset_transform, + "cmu_stretch": cmu_stretch_dataset_transform, + "berkeley_gnm_recon": gnm_dataset_transform, + "berkeley_gnm_cory_hall": gnm_dataset_transform, + "berkeley_gnm_sac_son": gnm_dataset_transform, + "droid": droid_baseact_transform_fn(), + "droid_100": droid_baseact_transform_fn(), # first 100 episodes of droid + "fmb": fmb_transform, + "dobbe": dobbe_dataset_transform, + "robo_set": robo_set_dataset_transform, + "usc_cloth_sim_converted_externally_to_rlds": identity_transform, + "plex_robosuite": identity_transform, + "conq_hose_manipulation": identity_transform, + "io_ai_tech": identity_transform, + "spoc": identity_transform, +} diff --git a/lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py b/lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py new file mode 100644 index 000000000..b925fedd5 --- /dev/null +++ b/lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py @@ -0,0 +1,359 @@ +#!/usr/bin/env python + +# Copyright 2024 The HuggingFace Inc. team. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. +""" +For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets. + +Example: + python lerobot/scripts/push_dataset_to_hub.py \ + --raw-dir /hdd/tensorflow_datasets/bridge_dataset/1.0.0/ \ + --repo-id youliangtan/sampled_bridge_data_v2 \ + --raw-format openx_rlds.bridge_orig \ + --episodes 3 4 5 8 9 + +Exact dataset fps defined in openx/config.py, obtained from: + https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R +""" + +import shutil +from pathlib import Path + +import numpy as np +import tensorflow as tf +import tensorflow_datasets as tfds +import torch +import tqdm +import yaml +from datasets import Dataset, Features, Image, Sequence, Value +from PIL import Image as PILImage + +from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION +from lerobot.common.datasets.push_dataset_to_hub.openx.transforms import OPENX_STANDARDIZATION_TRANSFORMS +from lerobot.common.datasets.push_dataset_to_hub.utils import ( + concatenate_episodes, + get_default_encoding, + save_images_concurrently, +) +from lerobot.common.datasets.utils import ( + calculate_episode_data_index, + hf_transform_to_torch, +) +from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames + +with open("lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml", "r") as f: + _openx_list = yaml.safe_load(f) + +OPENX_DATASET_CONFIGS = _openx_list["OPENX_DATASET_CONFIGS"] + +np.set_printoptions(precision=2) + + +def tf_to_torch(data): + return torch.from_numpy(data.numpy()) + + +def tf_img_convert(img): + if img.dtype == tf.string: + img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8) + elif img.dtype != tf.uint8: + raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}") + return img.numpy() + + +def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict: + """ + In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps" + entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the + trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`. + + NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/ + """ + steps = traj.pop("steps") + + traj_len = tf.shape(tf.nest.flatten(steps)[0])[0] + + # broadcast metadata to the length of the trajectory + metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj) + + # put steps back in + assert "traj_metadata" not in steps + traj = {**steps, "traj_metadata": metadata} + + assert "_len" not in traj + assert "_traj_index" not in traj + assert "_frame_index" not in traj + traj["_len"] = tf.repeat(traj_len, traj_len) + traj["_traj_index"] = tf.repeat(i, traj_len) + traj["_frame_index"] = tf.range(traj_len) + + return traj + + +def load_from_raw( + raw_dir: Path, + videos_dir: Path, + fps: int, + video: bool, + episodes: list[int] | None = None, + encoding: dict | None = None, + openx_dataset_name: str | None = None, +): + """ + Args: + raw_dir (Path): _description_ + videos_dir (Path): _description_ + fps (int): _description_ + video (bool): _description_ + episodes (list[int] | None, optional): _description_. Defaults to None. + """ + ds_builder = tfds.builder_from_directory(str(raw_dir)) + dataset = ds_builder.as_dataset( + split="all", + decoders={"steps": tfds.decode.SkipDecoding()}, + ) + + dataset_info = ds_builder.info + print("dataset_info: ", dataset_info) + + ds_length = len(dataset) + dataset = dataset.take(ds_length) + # "flatten" the dataset as such we can apply trajectory level map() easily + # each [obs][key] has a shape of (frame_size, ...) + dataset = dataset.enumerate().map(_broadcast_metadata_rlds) + + # we will apply the standardization transform if the dataset_name is provided + # if the dataset name is not provided and the goal is to convert any rlds formatted dataset + # search for 'image' keys in the observations + if openx_dataset_name is not None: + print(" - applying standardization transform for dataset: ", openx_dataset_name) + assert openx_dataset_name in OPENX_STANDARDIZATION_TRANSFORMS + transform_fn = OPENX_STANDARDIZATION_TRANSFORMS[openx_dataset_name] + dataset = dataset.map(transform_fn) + + image_keys = OPENX_DATASET_CONFIGS[openx_dataset_name]["image_obs_keys"] + else: + obs_keys = dataset_info.features["steps"]["observation"].keys() + image_keys = [key for key in obs_keys if "image" in key] + + lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None + + print(" - image_keys: ", image_keys) + print(" - lang_key: ", lang_key) + + it = iter(dataset) + + ep_dicts = [] + # Init temp path to save ep_dicts in case of crash + tmp_ep_dicts_dir = videos_dir.parent.joinpath("ep_dicts") + tmp_ep_dicts_dir.mkdir(parents=True, exist_ok=True) + + # check if ep_dicts have already been saved in /tmp + starting_ep_idx = 0 + saved_ep_dicts = [ep.__str__() for ep in tmp_ep_dicts_dir.iterdir()] + if len(saved_ep_dicts) > 0: + saved_ep_dicts.sort() + # get last ep_idx number + starting_ep_idx = int(saved_ep_dicts[-1][-13:-3]) + 1 + for i in range(starting_ep_idx): + episode = next(it) + ep_dicts.append(torch.load(saved_ep_dicts[i])) + + # if we user specified episodes, skip the ones not in the list + if episodes is not None: + if ds_length == 0: + raise ValueError("No episodes found.") + # convert episodes index to sorted list + episodes = sorted(episodes) + + for ep_idx in tqdm.tqdm(range(starting_ep_idx, ds_length)): + episode = next(it) + + # if user specified episodes, skip the ones not in the list + if episodes is not None: + if len(episodes) == 0: + break + if ep_idx == episodes[0]: + # process this episode + print(" selecting episode idx: ", ep_idx) + episodes.pop(0) + else: + continue # skip + + num_frames = episode["action"].shape[0] + + ########################################################### + # Handle the episodic data + + # last step of demonstration is considered done + done = torch.zeros(num_frames, dtype=torch.bool) + done[-1] = True + ep_dict = {} + langs = [] # TODO: might be located in "observation" + + image_array_dict = {key: [] for key in image_keys} + + # We will create the state observation tensor by stacking the state + # obs keys defined in the openx/configs.py + if openx_dataset_name is not None: + state_obs_keys = OPENX_DATASET_CONFIGS[openx_dataset_name]["state_obs_keys"] + # stack the state observations, if is None, pad with zeros + states = [] + for key in state_obs_keys: + if key in episode["observation"]: + states.append(tf_to_torch(episode["observation"][key])) + else: + states.append(torch.zeros(num_frames, 1)) # pad with zeros + states = torch.cat(states, dim=1) + # assert states.shape == (num_frames, 8), f"states shape: {states.shape}" + else: + states = tf_to_torch(episode["observation"]["state"]) + + actions = tf_to_torch(episode["action"]) + rewards = tf_to_torch(episode["reward"]).float() + + # If lang_key is present, convert the entire tensor at once + if lang_key is not None: + langs = [str(x) for x in episode[lang_key]] + + for im_key in image_keys: + imgs = episode["observation"][im_key] + image_array_dict[im_key] = [tf_img_convert(img) for img in imgs] + + # simple assertions + for item in [states, actions, rewards, done]: + assert len(item) == num_frames + + ########################################################### + + # loop through all cameras + for im_key in image_keys: + img_key = f"observation.images.{im_key}" + imgs_array = image_array_dict[im_key] + imgs_array = np.array(imgs_array) + if video: + # save png images in temporary directory + tmp_imgs_dir = videos_dir / "tmp_images" + save_images_concurrently(imgs_array, tmp_imgs_dir) + + # encode images to a mp4 video + fname = f"{img_key}_episode_{ep_idx:06d}.mp4" + video_path = videos_dir / fname + encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {})) + + # clean temporary images directory + shutil.rmtree(tmp_imgs_dir) + + # store the reference to the video frame + ep_dict[img_key] = [ + {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames) + ] + else: + ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array] + + if lang_key is not None: + ep_dict["language_instruction"] = langs + + ep_dict["observation.state"] = states + ep_dict["action"] = actions + ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps + ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames) + ep_dict["frame_index"] = torch.arange(0, num_frames, 1) + ep_dict["next.reward"] = rewards + ep_dict["next.done"] = done + + path_ep_dict = tmp_ep_dicts_dir.joinpath( + "ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt" + ) + torch.save(ep_dict, path_ep_dict) + + ep_dicts.append(ep_dict) + + data_dict = concatenate_episodes(ep_dicts) + + total_frames = data_dict["frame_index"].shape[0] + data_dict["index"] = torch.arange(0, total_frames, 1) + return data_dict + + +def to_hf_dataset(data_dict, video) -> Dataset: + features = {} + + keys = [key for key in data_dict if "observation.images." in key] + for key in keys: + if video: + features[key] = VideoFrame() + else: + features[key] = Image() + + features["observation.state"] = Sequence( + length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None) + ) + if "observation.velocity" in data_dict: + features["observation.velocity"] = Sequence( + length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None) + ) + if "observation.effort" in data_dict: + features["observation.effort"] = Sequence( + length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None) + ) + if "language_instruction" in data_dict: + features["language_instruction"] = Value(dtype="string", id=None) + + features["action"] = Sequence( + length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None) + ) + features["episode_index"] = Value(dtype="int64", id=None) + features["frame_index"] = Value(dtype="int64", id=None) + features["timestamp"] = Value(dtype="float32", id=None) + features["next.reward"] = Value(dtype="float32", id=None) + features["next.done"] = Value(dtype="bool", id=None) + features["index"] = Value(dtype="int64", id=None) + + hf_dataset = Dataset.from_dict(data_dict, features=Features(features)) + hf_dataset.set_transform(hf_transform_to_torch) + return hf_dataset + + +def from_raw_to_lerobot_format( + raw_dir: Path, + videos_dir: Path, + fps: int | None = None, + video: bool = True, + episodes: list[int] | None = None, + encoding: dict | None = None, + openx_dataset_name: str | None = None, +): + """This is a test impl for rlds conversion""" + if openx_dataset_name is None: + # set a default rlds frame rate if the dataset is not from openx + fps = 30 + elif "fps" not in OPENX_DATASET_CONFIGS[openx_dataset_name]: + raise ValueError( + "fps for this dataset is not specified in openx/configs.py yet," "means it is not yet tested" + ) + fps = OPENX_DATASET_CONFIGS[openx_dataset_name]["fps"] + + data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding, openx_dataset_name) + hf_dataset = to_hf_dataset(data_dict, video) + episode_data_index = calculate_episode_data_index(hf_dataset) + info = { + "codebase_version": CODEBASE_VERSION, + "fps": fps, + "video": video, + } + if video: + info["encoding"] = get_default_encoding() + + return hf_dataset, episode_data_index, info diff --git a/lerobot/common/datasets/utils.py b/lerobot/common/datasets/utils.py index bbad161a3..ef97231df 100644 --- a/lerobot/common/datasets/utils.py +++ b/lerobot/common/datasets/utils.py @@ -80,6 +80,11 @@ def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]): if isinstance(first_item, PILImage.Image): to_tensor = transforms.ToTensor() items_dict[key] = [to_tensor(img) for img in items_dict[key]] + elif isinstance(first_item, str): + # TODO (michel-aractingi): add str2embedding via language tokenizer + # For now we leave this part up to the user to choose how to address + # language conditioned tasks + pass elif isinstance(first_item, dict) and "path" in first_item and "timestamp" in first_item: # video frame will be processed downstream pass diff --git a/lerobot/common/robot_devices/robots/koch.py b/lerobot/common/robot_devices/robots/koch.py index f5966999a..cdd81250e 100644 --- a/lerobot/common/robot_devices/robots/koch.py +++ b/lerobot/common/robot_devices/robots/koch.py @@ -1,7 +1,9 @@ +import logging import pickle import time from dataclasses import dataclass, field, replace from pathlib import Path +from typing import Sequence import numpy as np import torch @@ -26,7 +28,6 @@ URL_TEMPLATE = ( # In nominal degree range ]-180, +180[ ZERO_POSITION_DEGREE = 0 ROTATED_POSITION_DEGREE = 90 -GRIPPER_OPEN_DEGREE = 35.156 def assert_drive_mode(drive_mode): @@ -165,6 +166,30 @@ class KochRobotConfig: follower_arms: dict[str, MotorsBus] = field(default_factory=lambda: {}) cameras: dict[str, Camera] = field(default_factory=lambda: {}) + # Optionally limit the magnitude of the relative positional target vector for safety purposes. + # Set this to a positive scalar to have the same value for all motors, or a list that is the same length + # as the number of motors in your follower arms (assumes all follower arms have the same number of + # motors). + max_relative_target: list[float] | float | None = None + + # Optionally set the leader arm in torque mode with the gripper motor set to this angle. This makes it + # possible to squeeze the gripper and have it spring back to an open position on its own. If None, the + # gripper is not put in torque mode. + gripper_open_degree: float | None = None + + def __setattr__(self, prop: str, val): + if prop == "max_relative_target" and val is not None and isinstance(val, Sequence): + for name in self.follower_arms: + if len(self.follower_arms[name].motors) != len(val): + raise ValueError( + f"len(max_relative_target)={len(val)} but the follower arm with name {name} has " + f"{len(self.follower_arms[name].motors)} motors. Please make sure that the " + f"`max_relative_target` list has as many parameters as there are motors per arm. " + "Note: This feature does not yet work with robots where different follower arms have " + "different numbers of motors." + ) + super().__setattr__(prop, val) + class KochRobot: # TODO(rcadene): Implement force feedback @@ -206,7 +231,10 @@ class KochRobot: }, ), } - robot = KochRobot(leader_arms, follower_arms) + robot = KochRobot( + leader_arms=leader_arms, + follower_arms=follower_arms, + ) # Connect motors buses and cameras if any (Required) robot.connect() @@ -218,7 +246,10 @@ class KochRobot: Example of highest frequency data collection without camera: ```python # Assumes leader and follower arms have been instantiated already (see first example) - robot = KochRobot(leader_arms, follower_arms) + robot = KochRobot( + leader_arms=leader_arms, + follower_arms=follower_arms, + ) robot.connect() while True: observation, action = robot.teleop_step(record_data=True) @@ -236,7 +267,11 @@ class KochRobot: } # Assumes leader and follower arms have been instantiated already (see first example) - robot = KochRobot(leader_arms, follower_arms, cameras) + robot = KochRobot( + leader_arms=leader_arms, + follower_arms=follower_arms, + cameras=cameras, + ) robot.connect() while True: observation, action = robot.teleop_step(record_data=True) @@ -245,7 +280,11 @@ class KochRobot: Example of controlling the robot with a policy (without running multiple policies in parallel to ensure highest frequency): ```python # Assumes leader and follower arms + cameras have been instantiated already (see previous example) - robot = KochRobot(leader_arms, follower_arms, cameras) + robot = KochRobot( + leader_arms=leader_arms, + follower_arms=follower_arms, + cameras=cameras, + ) robot.connect() while True: # Uses the follower arms and cameras to capture an observation @@ -339,11 +378,12 @@ class KochRobot: print(f"Activating torque on {name} follower arm.") self.follower_arms[name].write("Torque_Enable", 1) - # Enable torque on the gripper of the leader arms, and move it to 45 degrees, - # so that we can use it as a trigger to close the gripper of the follower arms. - for name in self.leader_arms: - self.leader_arms[name].write("Torque_Enable", 1, "gripper") - self.leader_arms[name].write("Goal_Position", GRIPPER_OPEN_DEGREE, "gripper") + if self.config.gripper_open_degree is not None: + # Set the leader arm in torque mode with the gripper motor set to an angle. This makes it possible + # to squeeze the gripper and have it spring back to an open position on its own. + for name in self.leader_arms: + self.leader_arms[name].write("Torque_Enable", 1, "gripper") + self.leader_arms[name].write("Goal_Position", self.config.gripper_open_degree, "gripper") # Connect the cameras for name in self.cameras: @@ -392,7 +432,7 @@ class KochRobot: # Send action for name in self.follower_arms: before_fwrite_t = time.perf_counter() - self.follower_arms[name].write("Goal_Position", follower_goal_pos[name]) + self.send_action(torch.tensor(follower_goal_pos[name]), [name]) self.logs[f"write_follower_{name}_goal_pos_dt_s"] = time.perf_counter() - before_fwrite_t # Early exit when recording data is not requested @@ -474,21 +514,55 @@ class KochRobot: obs_dict[f"observation.images.{name}"] = torch.from_numpy(images[name]) return obs_dict - def send_action(self, action: torch.Tensor): - """The provided action is expected to be a vector.""" + def send_action(self, action: torch.Tensor, follower_names: list[str] | None = None): + """Command the follower arms to move to a target joint configuration. + + The relative action magnitude may be clipped depending on the configuration parameter + `max_relative_target`. + + Args: + action: tensor containing the concatenated joint positions for the follower arms. + follower_names: Pass follower arm names to only control a subset of all the follower arms. + """ if not self.is_connected: raise RobotDeviceNotConnectedError( "KochRobot is not connected. You need to run `robot.connect()`." ) + if follower_names is None: + follower_names = list(self.follower_arms) + elif not set(follower_names).issubset(self.follower_arms): + raise ValueError( + f"You provided {follower_names=} but only the following arms are registered: " + f"{list(self.follower_arms)}" + ) + from_idx = 0 to_idx = 0 follower_goal_pos = {} - for name in self.follower_arms: - if name in self.follower_arms: - to_idx += len(self.follower_arms[name].motor_names) - follower_goal_pos[name] = action[from_idx:to_idx].numpy() - from_idx = to_idx + for name in follower_names: + to_idx += len(self.follower_arms[name].motor_names) + this_action = action[from_idx:to_idx] + + if self.config.max_relative_target is not None: + if not isinstance(self.config.max_relative_target, list): + max_relative_target = [self.config.max_relative_target for _ in range(from_idx, to_idx)] + max_relative_target = torch.tensor(self.config.max_relative_target) + # Cap relative action target magnitude for safety. + current_pos = torch.tensor(self.follower_arms[name].read("Present_Position")) + diff = this_action - current_pos + safe_diff = torch.minimum(diff, max_relative_target) + safe_diff = torch.maximum(safe_diff, -max_relative_target) + safe_action = current_pos + safe_diff + if not torch.allclose(safe_action, action): + logging.warning( + "Relative action magnitude had to be clamped to be safe.\n" + f" requested relative action target: {diff}\n" + f" clamped relative action target: {safe_diff}" + ) + + follower_goal_pos[name] = safe_action.numpy() + from_idx = to_idx for name in self.follower_arms: self.follower_arms[name].write("Goal_Position", follower_goal_pos[name].astype(np.int32)) diff --git a/lerobot/common/utils/utils.py b/lerobot/common/utils/utils.py index ef5e83750..1aa0bc2d4 100644 --- a/lerobot/common/utils/utils.py +++ b/lerobot/common/utils/utils.py @@ -14,6 +14,7 @@ # See the License for the specific language governing permissions and # limitations under the License. import logging +import os import os.path as osp import random from contextlib import contextmanager @@ -27,6 +28,12 @@ import torch from omegaconf import DictConfig +def inside_slurm(): + """Check whether the python process was launched through slurm""" + # TODO(rcadene): return False for interactive mode `--pty bash` + return "SLURM_JOB_ID" in os.environ + + def get_safe_torch_device(cfg_device: str, log: bool = False) -> torch.device: """Given a string, return a torch.device with checks on whether the device is available.""" match cfg_device: @@ -158,7 +165,6 @@ def init_hydra_config(config_path: str, overrides: list[str] | None = None) -> D version_base="1.2", ) cfg = hydra.compose(Path(config_path).stem, overrides) - return cfg diff --git a/lerobot/configs/default.yaml b/lerobot/configs/default.yaml index a3ff1d41b..7945513ae 100644 --- a/lerobot/configs/default.yaml +++ b/lerobot/configs/default.yaml @@ -120,7 +120,7 @@ eval: # `batch_size` specifies the number of environments to use in a gym.vector.VectorEnv. batch_size: 1 # `use_async_envs` specifies whether to use asynchronous environments (multiprocessing). - use_async_envs: false + use_async_envs: true wandb: enable: false diff --git a/lerobot/configs/env/aloha.yaml b/lerobot/configs/env/aloha.yaml index 296a4481c..6ea3cceda 100644 --- a/lerobot/configs/env/aloha.yaml +++ b/lerobot/configs/env/aloha.yaml @@ -2,6 +2,11 @@ fps: 50 +eval: + # `use_async_envs` specifies whether to use asynchronous environments (multiprocessing). + # set it to false to avoid some problems of the aloha env + use_async_envs: false + env: name: aloha task: AlohaInsertion-v0 diff --git a/lerobot/configs/env/xarm.yaml b/lerobot/configs/env/xarm.yaml index 4320379ae..8e3d9c51c 100644 --- a/lerobot/configs/env/xarm.yaml +++ b/lerobot/configs/env/xarm.yaml @@ -2,6 +2,11 @@ fps: 15 +eval: + # `use_async_envs` specifies whether to use asynchronous environments (multiprocessing). + # set it to false to avoid some problems of the aloha env + use_async_envs: false + env: name: xarm task: XarmLift-v0 diff --git a/lerobot/configs/robot/koch.yaml b/lerobot/configs/robot/koch.yaml index 224040ab2..d40d5ff38 100644 --- a/lerobot/configs/robot/koch.yaml +++ b/lerobot/configs/robot/koch.yaml @@ -37,3 +37,10 @@ cameras: fps: 30 width: 640 height: 480 +# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes. +# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as +# the number of motors in your follower arms. +max_relative_target: null +# Sets the leader arm in torque mode with the gripper motor set to this angle. This makes it possible +# to squeeze the gripper and have it spring back to an open position on its own. +gripper_open_degree: 35.156 diff --git a/lerobot/configs/robot/koch_bimanual.yaml b/lerobot/configs/robot/koch_bimanual.yaml new file mode 100644 index 000000000..4a803d265 --- /dev/null +++ b/lerobot/configs/robot/koch_bimanual.yaml @@ -0,0 +1,68 @@ +_target_: lerobot.common.robot_devices.robots.koch.KochRobot +calibration_path: .cache/calibration/koch_bimanual.pkl +leader_arms: + left: + _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus + port: /dev/tty.usbmodem585A0085511 + motors: + # name: (index, model) + shoulder_pan: [1, "xl330-m077"] + shoulder_lift: [2, "xl330-m077"] + elbow_flex: [3, "xl330-m077"] + wrist_flex: [4, "xl330-m077"] + wrist_roll: [5, "xl330-m077"] + gripper: [6, "xl330-m077"] + right: + _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus + port: /dev/tty.usbmodem575E0031751 + motors: + # name: (index, model) + shoulder_pan: [1, "xl330-m077"] + shoulder_lift: [2, "xl330-m077"] + elbow_flex: [3, "xl330-m077"] + wrist_flex: [4, "xl330-m077"] + wrist_roll: [5, "xl330-m077"] + gripper: [6, "xl330-m077"] +follower_arms: + left: + _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus + port: /dev/tty.usbmodem585A0076891 + motors: + # name: (index, model) + shoulder_pan: [1, "xl430-w250"] + shoulder_lift: [2, "xl430-w250"] + elbow_flex: [3, "xl330-m288"] + wrist_flex: [4, "xl330-m288"] + wrist_roll: [5, "xl330-m288"] + gripper: [6, "xl330-m288"] + right: + _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus + port: /dev/tty.usbmodem575E0032081 + motors: + # name: (index, model) + shoulder_pan: [1, "xl430-w250"] + shoulder_lift: [2, "xl430-w250"] + elbow_flex: [3, "xl330-m288"] + wrist_flex: [4, "xl330-m288"] + wrist_roll: [5, "xl330-m288"] + gripper: [6, "xl330-m288"] +cameras: + laptop: + _target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera + camera_index: 0 + fps: 30 + width: 640 + height: 480 + phone: + _target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera + camera_index: 1 + fps: 30 + width: 640 + height: 480 +# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes. +# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as +# the number of motors in your follower arms. +max_relative_target: null +# Sets the leader arm in torque mode with the gripper motor set to this angle. This makes it possible +# to squeeze the gripper and have it spring back to an open position on its own. +gripper_open_degree: 35.156 diff --git a/lerobot/scripts/eval.py b/lerobot/scripts/eval.py index a07f35304..482af786f 100644 --- a/lerobot/scripts/eval.py +++ b/lerobot/scripts/eval.py @@ -70,7 +70,13 @@ from lerobot.common.policies.factory import make_policy from lerobot.common.policies.policy_protocol import Policy from lerobot.common.policies.utils import get_device_from_parameters from lerobot.common.utils.io_utils import write_video -from lerobot.common.utils.utils import get_safe_torch_device, init_hydra_config, init_logging, set_global_seed +from lerobot.common.utils.utils import ( + get_safe_torch_device, + init_hydra_config, + init_logging, + inside_slurm, + set_global_seed, +) def rollout( @@ -79,7 +85,6 @@ def rollout( seeds: list[int] | None = None, return_observations: bool = False, render_callback: Callable[[gym.vector.VectorEnv], None] | None = None, - enable_progbar: bool = False, ) -> dict: """Run a batched policy rollout once through a batch of environments. @@ -109,7 +114,6 @@ def rollout( are returned optionally because they typically take more memory to cache. Defaults to False. render_callback: Optional rendering callback to be used after the environments are reset, and after every step. - enable_progbar: Enable a progress bar over rollout steps. Returns: The dictionary described above. """ @@ -136,7 +140,7 @@ def rollout( progbar = trange( max_steps, desc=f"Running rollout with at most {max_steps} steps", - disable=not enable_progbar, + disable=inside_slurm(), # we dont want progress bar when we use slurm, since it clutters the logs leave=False, ) while not np.all(done): @@ -210,8 +214,6 @@ def eval_policy( videos_dir: Path | None = None, return_episode_data: bool = False, start_seed: int | None = None, - enable_progbar: bool = False, - enable_inner_progbar: bool = False, ) -> dict: """ Args: @@ -224,8 +226,6 @@ def eval_policy( the "episodes" key of the returned dictionary. start_seed: The first seed to use for the first individual rollout. For all subsequent rollouts the seed is incremented by 1. If not provided, the environments are not manually seeded. - enable_progbar: Enable progress bar over batches. - enable_inner_progbar: Enable progress bar over steps in each batch. Returns: Dictionary with metrics and data regarding the rollouts. """ @@ -266,7 +266,8 @@ def eval_policy( if return_episode_data: episode_data: dict | None = None - progbar = trange(n_batches, desc="Stepping through eval batches", disable=not enable_progbar) + # we dont want progress bar when we use slurm, since it clutters the logs + progbar = trange(n_batches, desc="Stepping through eval batches", disable=inside_slurm()) for batch_ix in progbar: # Cache frames for rendering videos. Each item will be (b, h, w, c), and the list indexes the rollout # step. @@ -285,7 +286,6 @@ def eval_policy( seeds=list(seeds) if seeds else None, return_observations=return_episode_data, render_callback=render_frame if max_episodes_rendered > 0 else None, - enable_progbar=enable_inner_progbar, ) # Figure out where in each rollout sequence the first done condition was encountered (results after @@ -454,6 +454,16 @@ def main( else: hydra_cfg = init_hydra_config(hydra_cfg_path, config_overrides) + if hydra_cfg.eval.batch_size > hydra_cfg.eval.n_episodes: + raise ValueError( + "The eval batch size is greater than the number of eval episodes " + f"({hydra_cfg.eval.batch_size} > {hydra_cfg.eval.n_episodes}). As a result, {hydra_cfg.eval.batch_size} " + f"eval environments will be instantiated, but only {hydra_cfg.eval.n_episodes} will be used. " + "This might significantly slow down evaluation. To fix this, you should update your command " + f"to increase the number of episodes to match the batch size (e.g. `eval.n_episodes={hydra_cfg.eval.batch_size}`), " + f"or lower the batch size (e.g. `eval.batch_size={hydra_cfg.eval.n_episodes}`)." + ) + if out_dir is None: out_dir = f"outputs/eval/{dt.now().strftime('%Y-%m-%d/%H-%M-%S')}_{hydra_cfg.env.name}_{hydra_cfg.policy.name}" @@ -487,8 +497,6 @@ def main( max_episodes_rendered=10, videos_dir=Path(out_dir) / "videos", start_seed=hydra_cfg.seed, - enable_progbar=True, - enable_inner_progbar=True, ) print(info["aggregated"]) diff --git a/lerobot/scripts/push_dataset_to_hub.py b/lerobot/scripts/push_dataset_to_hub.py index 632315484..adc4c72ad 100644 --- a/lerobot/scripts/push_dataset_to_hub.py +++ b/lerobot/scripts/push_dataset_to_hub.py @@ -66,6 +66,8 @@ def get_from_raw_to_lerobot_format_fn(raw_format: str): from lerobot.common.datasets.push_dataset_to_hub.umi_zarr_format import from_raw_to_lerobot_format elif raw_format == "aloha_hdf5": from lerobot.common.datasets.push_dataset_to_hub.aloha_hdf5_format import from_raw_to_lerobot_format + elif "openx_rlds" in raw_format: + from lerobot.common.datasets.push_dataset_to_hub.openx_rlds_format import from_raw_to_lerobot_format elif raw_format == "dora_parquet": from lerobot.common.datasets.push_dataset_to_hub.dora_parquet_format import from_raw_to_lerobot_format elif raw_format == "xarm_pkl": @@ -197,9 +199,25 @@ def push_dataset_to_hub( # convert dataset from original raw format to LeRobot format from_raw_to_lerobot_format = get_from_raw_to_lerobot_format_fn(raw_format) - hf_dataset, episode_data_index, info = from_raw_to_lerobot_format( - raw_dir, videos_dir, fps, video, episodes, encoding - ) + + fmt_kwgs = { + "raw_dir": raw_dir, + "videos_dir": videos_dir, + "fps": fps, + "video": video, + "episodes": episodes, + "encoding": encoding, + } + + if "openx_rlds." in raw_format: + # Support for official OXE dataset name inside `raw_format`. + # For instance, `raw_format="oxe_rlds"` uses the default formating (TODO what does that mean?), + # and `raw_format="oxe_rlds.bridge_orig"` uses the brdige_orig formating + _, openx_dataset_name = raw_format.split(".") + print(f"Converting dataset [{openx_dataset_name}] from 'openx_rlds' to LeRobot format.") + fmt_kwgs["openx_dataset_name"] = openx_dataset_name + + hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(**fmt_kwgs) lerobot_dataset = LeRobotDataset.from_preloaded( repo_id=repo_id, @@ -268,7 +286,7 @@ def main(): "--raw-format", type=str, required=True, - help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`).", + help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`, `openx_rlds`).", ) parser.add_argument( "--repo-id", @@ -328,6 +346,13 @@ def main(): default=0, help="When set to 1, resumes a previous run.", ) + parser.add_argument( + "--cache-dir", + type=Path, + required=False, + default="/tmp", + help="Directory to store the temporary videos and images generated while creating the dataset.", + ) parser.add_argument( "--tests-data-dir", type=Path, diff --git a/lerobot/scripts/train.py b/lerobot/scripts/train.py index d8fdfc1f0..45807503f 100644 --- a/lerobot/scripts/train.py +++ b/lerobot/scripts/train.py @@ -241,6 +241,7 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No raise NotImplementedError() init_logging() + logging.info(pformat(OmegaConf.to_container(cfg))) if cfg.training.online_steps > 0 and isinstance(cfg.dataset_repo_id, ListConfig): raise NotImplementedError("Online training with LeRobotMultiDataset is not implemented.") @@ -287,6 +288,16 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No "you meant to resume training, please use `resume=true` in your command or yaml configuration." ) + if cfg.eval.batch_size > cfg.eval.n_episodes: + raise ValueError( + "The eval batch size is greater than the number of eval episodes " + f"({cfg.eval.batch_size} > {cfg.eval.n_episodes}). As a result, {cfg.eval.batch_size} " + f"eval environments will be instantiated, but only {cfg.eval.n_episodes} will be used. " + "This might significantly slow down evaluation. To fix this, you should update your command " + f"to increase the number of episodes to match the batch size (e.g. `eval.n_episodes={cfg.eval.batch_size}`), " + f"or lower the batch size (e.g. `eval.batch_size={cfg.eval.n_episodes}`)." + ) + # log metrics to terminal and wandb logger = Logger(cfg, out_dir, wandb_job_name=job_name) diff --git a/lerobot/scripts/visualize_dataset_html.py b/lerobot/scripts/visualize_dataset_html.py index 2531fbd02..7048e7a90 100644 --- a/lerobot/scripts/visualize_dataset_html.py +++ b/lerobot/scripts/visualize_dataset_html.py @@ -112,10 +112,14 @@ def run_server( "fps": dataset.fps, } video_paths = get_episode_video_paths(dataset, episode_id) + language_instruction = get_episode_language_instruction(dataset, episode_id) videos_info = [ {"url": url_for("static", filename=video_path), "filename": Path(video_path).name} for video_path in video_paths ] + if language_instruction: + videos_info[0]["language_instruction"] = language_instruction + ep_csv_url = url_for("static", filename=get_ep_csv_fname(episode_id)) return render_template( "visualize_dataset_template.html", @@ -186,6 +190,20 @@ def get_episode_video_paths(dataset: LeRobotDataset, ep_index: int) -> list[str] ] +def get_episode_language_instruction(dataset: LeRobotDataset, ep_index: int) -> list[str]: + # check if the dataset has language instructions + if "language_instruction" not in dataset.hf_dataset.features: + return None + + # get first frame index + first_frame_idx = dataset.episode_data_index["from"][ep_index].item() + + language_instruction = dataset.hf_dataset[first_frame_idx]["language_instruction"] + # TODO (michel-aractingi) hack to get the sentence, some strings in openx are badly stored + # with the tf.tensor appearing in the string + return language_instruction.removeprefix("tf.Tensor(b'").removesuffix("', shape=(), dtype=string)") + + def visualize_dataset_html( repo_id: str, root: Path | None = None, diff --git a/lerobot/templates/visualize_dataset_template.html b/lerobot/templates/visualize_dataset_template.html index 16ca0fa3f..0e7625684 100644 --- a/lerobot/templates/visualize_dataset_template.html +++ b/lerobot/templates/visualize_dataset_template.html @@ -75,7 +75,7 @@ {% for video_info in videos_info %}

{{ video_info.filename }}

-