Compare commits
76 Commits
Cadene-pat
...
temp_branc
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
def42ff487 | ||
|
|
c9af8e36a7 | ||
|
|
ed66c92383 | ||
|
|
668d493bf9 | ||
|
|
67f4d7ea7a | ||
|
|
4b0c88ff8e | ||
|
|
b19fef9d18 | ||
|
|
1612e00e63 | ||
|
|
c3bc136420 | ||
|
|
1020bc3108 | ||
|
|
7fcf638c0d | ||
|
|
e35546f58e | ||
|
|
1aa8d4ac91 | ||
|
|
66f8736598 | ||
|
|
4c41f6fcc6 | ||
|
|
44f9b21e74 | ||
|
|
03f49ceaf0 | ||
|
|
8e7d6970ea | ||
|
|
286bca37cc | ||
|
|
a2c181992a | ||
|
|
32eb0cec8f | ||
|
|
96c7052777 | ||
|
|
975c1c25c3 | ||
|
|
20f466768e | ||
|
|
8af693548e | ||
|
|
963738d983 | ||
|
|
e0df56de62 | ||
|
|
538455a965 | ||
|
|
172809a502 | ||
|
|
55e4ff6742 | ||
|
|
07e8716315 | ||
|
|
114870d703 | ||
|
|
2efee45ef1 | ||
|
|
c351e1fff9 | ||
|
|
cd0fc261c0 | ||
|
|
77478d50e5 | ||
|
|
97b1feb0b3 | ||
|
|
c29e70e5a1 | ||
|
|
d5b669634a | ||
|
|
1a343c3591 | ||
|
|
26f97cfd17 | ||
|
|
72f402d44b | ||
|
|
92573486a8 | ||
|
|
c712d68f6a | ||
|
|
f431a08efa | ||
|
|
beaa427504 | ||
|
|
a88dd602d9 | ||
|
|
6c0324f467 | ||
|
|
a60d27b132 | ||
|
|
9c463661c1 | ||
|
|
4255655618 | ||
|
|
f17d9a2ba1 | ||
|
|
9ff829a3a1 | ||
|
|
d6516f0e03 | ||
|
|
b0b8612eff | ||
|
|
1072a055db | ||
|
|
9c9f5cac90 | ||
|
|
9d0c6fe419 | ||
|
|
54ac25cfc9 | ||
|
|
150a292795 | ||
|
|
429a463aff | ||
|
|
27ba2951d1 | ||
|
|
b2896d38f5 | ||
|
|
c0da806232 | ||
|
|
114e09f570 | ||
|
|
04a995e7d1 | ||
|
|
4806336816 | ||
|
|
1ce418e4a1 | ||
|
|
eb4c505cff | ||
|
|
aad59e6b6b | ||
|
|
9ce98bb93c | ||
|
|
97086cdcdf | ||
|
|
9c7649f140 | ||
|
|
a2592a5563 | ||
|
|
b5ad79a7d3 | ||
|
|
996468bcce |
68
.cache/calibration/aloha_default/left_follower.json
Normal file
68
.cache/calibration/aloha_default/left_follower.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2015,
|
||||||
|
3058,
|
||||||
|
3061,
|
||||||
|
1071,
|
||||||
|
1071,
|
||||||
|
2035,
|
||||||
|
2152,
|
||||||
|
2029,
|
||||||
|
2499
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1008,
|
||||||
|
-1963,
|
||||||
|
-1966,
|
||||||
|
2141,
|
||||||
|
2143,
|
||||||
|
-971,
|
||||||
|
3043,
|
||||||
|
-1077,
|
||||||
|
3144
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/left_leader.json
Normal file
68
.cache/calibration/aloha_default/left_leader.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-1024
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2035,
|
||||||
|
3024,
|
||||||
|
3019,
|
||||||
|
979,
|
||||||
|
981,
|
||||||
|
1982,
|
||||||
|
2166,
|
||||||
|
2124,
|
||||||
|
1968
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-990,
|
||||||
|
-2017,
|
||||||
|
-2015,
|
||||||
|
2078,
|
||||||
|
2076,
|
||||||
|
-1030,
|
||||||
|
3117,
|
||||||
|
-1016,
|
||||||
|
2556
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/right_follower.json
Normal file
68
.cache/calibration/aloha_default/right_follower.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2056,
|
||||||
|
2895,
|
||||||
|
2896,
|
||||||
|
1191,
|
||||||
|
1190,
|
||||||
|
2018,
|
||||||
|
2051,
|
||||||
|
2056,
|
||||||
|
2509
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1040,
|
||||||
|
-2004,
|
||||||
|
-2006,
|
||||||
|
2126,
|
||||||
|
2127,
|
||||||
|
-1010,
|
||||||
|
3050,
|
||||||
|
-1117,
|
||||||
|
3143
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/right_leader.json
Normal file
68
.cache/calibration/aloha_default/right_leader.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2068,
|
||||||
|
3034,
|
||||||
|
3030,
|
||||||
|
1038,
|
||||||
|
1041,
|
||||||
|
1991,
|
||||||
|
1948,
|
||||||
|
2090,
|
||||||
|
1985
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1025,
|
||||||
|
-2014,
|
||||||
|
-2015,
|
||||||
|
2058,
|
||||||
|
2060,
|
||||||
|
-955,
|
||||||
|
3091,
|
||||||
|
-940,
|
||||||
|
2576
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
@@ -65,7 +65,6 @@ htmlcov/
|
|||||||
.nox/
|
.nox/
|
||||||
.coverage
|
.coverage
|
||||||
.coverage.*
|
.coverage.*
|
||||||
.cache
|
|
||||||
nosetests.xml
|
nosetests.xml
|
||||||
coverage.xml
|
coverage.xml
|
||||||
*.cover
|
*.cover
|
||||||
@@ -73,6 +72,11 @@ coverage.xml
|
|||||||
.hypothesis/
|
.hypothesis/
|
||||||
.pytest_cache/
|
.pytest_cache/
|
||||||
|
|
||||||
|
# Ignore .cache except calibration
|
||||||
|
.cache/*
|
||||||
|
!.cache/calibration/
|
||||||
|
!.cache/calibration/**
|
||||||
|
|
||||||
# Translations
|
# Translations
|
||||||
*.mo
|
*.mo
|
||||||
*.pot
|
*.pot
|
||||||
|
|||||||
2
.gitattributes
vendored
2
.gitattributes
vendored
@@ -3,4 +3,4 @@
|
|||||||
*.safetensors filter=lfs diff=lfs merge=lfs -text
|
*.safetensors filter=lfs diff=lfs merge=lfs -text
|
||||||
*.mp4 filter=lfs diff=lfs merge=lfs -text
|
*.mp4 filter=lfs diff=lfs merge=lfs -text
|
||||||
*.arrow filter=lfs diff=lfs merge=lfs -text
|
*.arrow filter=lfs diff=lfs merge=lfs -text
|
||||||
*.json filter=lfs diff=lfs merge=lfs -text
|
*.json !text !filter !merge !diff
|
||||||
|
|||||||
2
.github/PULL_REQUEST_TEMPLATE.md
vendored
2
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -21,7 +21,7 @@ Provide a simple way for the reviewer to try out your changes.
|
|||||||
|
|
||||||
Examples:
|
Examples:
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR=tests/data pytest -sx tests/test_stuff.py::test_something
|
pytest -sx tests/test_stuff.py::test_something
|
||||||
```
|
```
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py --some.option=true
|
python lerobot/scripts/train.py --some.option=true
|
||||||
|
|||||||
8
.github/workflows/nightly-tests.yml
vendored
8
.github/workflows/nightly-tests.yml
vendored
@@ -7,10 +7,8 @@ on:
|
|||||||
schedule:
|
schedule:
|
||||||
- cron: "0 2 * * *"
|
- cron: "0 2 * * *"
|
||||||
|
|
||||||
env:
|
# env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
# SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
|
# SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
run_all_tests_cpu:
|
run_all_tests_cpu:
|
||||||
name: CPU
|
name: CPU
|
||||||
@@ -30,13 +28,9 @@ jobs:
|
|||||||
working-directory: /lerobot
|
working-directory: /lerobot
|
||||||
steps:
|
steps:
|
||||||
- name: Tests
|
- name: Tests
|
||||||
env:
|
|
||||||
DATA_DIR: tests/data
|
|
||||||
run: pytest -v --cov=./lerobot --disable-warnings tests
|
run: pytest -v --cov=./lerobot --disable-warnings tests
|
||||||
|
|
||||||
- name: Tests end-to-end
|
- name: Tests end-to-end
|
||||||
env:
|
|
||||||
DATA_DIR: tests/data
|
|
||||||
run: make test-end-to-end
|
run: make test-end-to-end
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
72
.github/workflows/test.yml
vendored
72
.github/workflows/test.yml
vendored
@@ -11,6 +11,7 @@ on:
|
|||||||
- ".github/**"
|
- ".github/**"
|
||||||
- "poetry.lock"
|
- "poetry.lock"
|
||||||
- "Makefile"
|
- "Makefile"
|
||||||
|
- ".cache/**"
|
||||||
push:
|
push:
|
||||||
branches:
|
branches:
|
||||||
- main
|
- main
|
||||||
@@ -21,13 +22,13 @@ on:
|
|||||||
- ".github/**"
|
- ".github/**"
|
||||||
- "poetry.lock"
|
- "poetry.lock"
|
||||||
- "Makefile"
|
- "Makefile"
|
||||||
|
- ".cache/**"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
pytest:
|
pytest:
|
||||||
name: Pytest
|
name: Pytest
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
env:
|
env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
MUJOCO_GL: egl
|
MUJOCO_GL: egl
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v4
|
- uses: actions/checkout@v4
|
||||||
@@ -35,13 +36,17 @@ jobs:
|
|||||||
lfs: true # Ensure LFS files are pulled
|
lfs: true # Ensure LFS files are pulled
|
||||||
|
|
||||||
- name: Install apt dependencies
|
- name: Install apt dependencies
|
||||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev ffmpeg
|
# portaudio19-dev is needed to install pyaudio
|
||||||
|
run: |
|
||||||
|
sudo apt-get update && \
|
||||||
|
sudo apt-get install -y libegl1-mesa-dev ffmpeg portaudio19-dev
|
||||||
|
|
||||||
- name: Install poetry
|
- name: Install poetry
|
||||||
run: |
|
run: |
|
||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
pipx install poetry && poetry config virtualenvs.in-project true
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||||
|
|
||||||
|
# TODO(rcadene, aliberts): python 3.12 seems to be used in the tests, not python 3.10
|
||||||
- name: Set up Python 3.10
|
- name: Set up Python 3.10
|
||||||
uses: actions/setup-python@v5
|
uses: actions/setup-python@v5
|
||||||
with:
|
with:
|
||||||
@@ -60,12 +65,10 @@ jobs:
|
|||||||
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
||||||
&& rm -rf tests/outputs outputs
|
&& rm -rf tests/outputs outputs
|
||||||
|
|
||||||
|
|
||||||
pytest-minimal:
|
pytest-minimal:
|
||||||
name: Pytest (minimal install)
|
name: Pytest (minimal install)
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
env:
|
env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
MUJOCO_GL: egl
|
MUJOCO_GL: egl
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v4
|
- uses: actions/checkout@v4
|
||||||
@@ -80,6 +83,7 @@ jobs:
|
|||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
pipx install poetry && poetry config virtualenvs.in-project true
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||||
|
|
||||||
|
# TODO(rcadene, aliberts): python 3.12 seems to be used in the tests, not python 3.10
|
||||||
- name: Set up Python 3.10
|
- name: Set up Python 3.10
|
||||||
uses: actions/setup-python@v5
|
uses: actions/setup-python@v5
|
||||||
with:
|
with:
|
||||||
@@ -97,37 +101,39 @@ jobs:
|
|||||||
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
||||||
&& rm -rf tests/outputs outputs
|
&& rm -rf tests/outputs outputs
|
||||||
|
|
||||||
|
# TODO(aliberts, rcadene): redesign after v2 migration / removing hydra
|
||||||
|
# end-to-end:
|
||||||
|
# name: End-to-end
|
||||||
|
# runs-on: ubuntu-latest
|
||||||
|
# env:
|
||||||
|
# MUJOCO_GL: egl
|
||||||
|
# steps:
|
||||||
|
# - uses: actions/checkout@v4
|
||||||
|
# with:
|
||||||
|
# lfs: true # Ensure LFS files are pulled
|
||||||
|
|
||||||
end-to-end:
|
# - name: Install apt dependencies
|
||||||
name: End-to-end
|
# # portaudio19-dev is needed to install pyaudio
|
||||||
runs-on: ubuntu-latest
|
# run: |
|
||||||
env:
|
# sudo apt-get update && \
|
||||||
DATA_DIR: tests/data
|
# sudo apt-get install -y libegl1-mesa-dev portaudio19-dev
|
||||||
MUJOCO_GL: egl
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@v4
|
|
||||||
with:
|
|
||||||
lfs: true # Ensure LFS files are pulled
|
|
||||||
|
|
||||||
- name: Install apt dependencies
|
# - name: Install poetry
|
||||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
|
# run: |
|
||||||
|
# pipx install poetry && poetry config virtualenvs.in-project true
|
||||||
|
# echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||||
|
|
||||||
- name: Install poetry
|
# - name: Set up Python 3.10
|
||||||
run: |
|
# uses: actions/setup-python@v5
|
||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
# with:
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
# python-version: "3.10"
|
||||||
|
# cache: "poetry"
|
||||||
|
|
||||||
- name: Set up Python 3.10
|
# - name: Install poetry dependencies
|
||||||
uses: actions/setup-python@v5
|
# run: |
|
||||||
with:
|
# poetry install --all-extras
|
||||||
python-version: "3.10"
|
|
||||||
cache: "poetry"
|
|
||||||
|
|
||||||
- name: Install poetry dependencies
|
# - name: Test end-to-end
|
||||||
run: |
|
# run: |
|
||||||
poetry install --all-extras
|
# make test-end-to-end \
|
||||||
|
# && rm -rf outputs
|
||||||
- name: Test end-to-end
|
|
||||||
run: |
|
|
||||||
make test-end-to-end \
|
|
||||||
&& rm -rf outputs
|
|
||||||
|
|||||||
6
.gitignore
vendored
6
.gitignore
vendored
@@ -66,7 +66,6 @@ htmlcov/
|
|||||||
.nox/
|
.nox/
|
||||||
.coverage
|
.coverage
|
||||||
.coverage.*
|
.coverage.*
|
||||||
.cache
|
|
||||||
nosetests.xml
|
nosetests.xml
|
||||||
coverage.xml
|
coverage.xml
|
||||||
*.cover
|
*.cover
|
||||||
@@ -74,6 +73,11 @@ coverage.xml
|
|||||||
.hypothesis/
|
.hypothesis/
|
||||||
.pytest_cache/
|
.pytest_cache/
|
||||||
|
|
||||||
|
# Ignore .cache except calibration
|
||||||
|
.cache/*
|
||||||
|
!.cache/calibration/
|
||||||
|
!.cache/calibration/**
|
||||||
|
|
||||||
# Translations
|
# Translations
|
||||||
*.mo
|
*.mo
|
||||||
*.pot
|
*.pot
|
||||||
|
|||||||
@@ -3,7 +3,7 @@ default_language_version:
|
|||||||
python: python3.10
|
python: python3.10
|
||||||
repos:
|
repos:
|
||||||
- repo: https://github.com/pre-commit/pre-commit-hooks
|
- repo: https://github.com/pre-commit/pre-commit-hooks
|
||||||
rev: v4.6.0
|
rev: v5.0.0
|
||||||
hooks:
|
hooks:
|
||||||
- id: check-added-large-files
|
- id: check-added-large-files
|
||||||
- id: debug-statements
|
- id: debug-statements
|
||||||
@@ -14,11 +14,11 @@ repos:
|
|||||||
- id: end-of-file-fixer
|
- id: end-of-file-fixer
|
||||||
- id: trailing-whitespace
|
- id: trailing-whitespace
|
||||||
- repo: https://github.com/asottile/pyupgrade
|
- repo: https://github.com/asottile/pyupgrade
|
||||||
rev: v3.16.0
|
rev: v3.19.0
|
||||||
hooks:
|
hooks:
|
||||||
- id: pyupgrade
|
- id: pyupgrade
|
||||||
- repo: https://github.com/astral-sh/ruff-pre-commit
|
- repo: https://github.com/astral-sh/ruff-pre-commit
|
||||||
rev: v0.5.2
|
rev: v0.8.2
|
||||||
hooks:
|
hooks:
|
||||||
- id: ruff
|
- id: ruff
|
||||||
args: [--fix]
|
args: [--fix]
|
||||||
@@ -32,6 +32,6 @@ repos:
|
|||||||
- "--check"
|
- "--check"
|
||||||
- "--no-update"
|
- "--no-update"
|
||||||
- repo: https://github.com/gitleaks/gitleaks
|
- repo: https://github.com/gitleaks/gitleaks
|
||||||
rev: v8.18.4
|
rev: v8.21.2
|
||||||
hooks:
|
hooks:
|
||||||
- id: gitleaks
|
- id: gitleaks
|
||||||
|
|||||||
@@ -20,7 +20,7 @@ Some of the ways you can contribute to 🤗 LeRobot:
|
|||||||
* Contributing to the examples or to the documentation.
|
* Contributing to the examples or to the documentation.
|
||||||
* Submitting issues related to bugs or desired new features.
|
* Submitting issues related to bugs or desired new features.
|
||||||
|
|
||||||
Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](remi.cadene@huggingface.co).
|
Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](mailto:remi.cadene@huggingface.co).
|
||||||
|
|
||||||
If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/orgs/huggingface/projects/46)
|
If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/orgs/huggingface/projects/46)
|
||||||
|
|
||||||
@@ -267,7 +267,7 @@ We use `pytest` in order to run the tests. From the root of the
|
|||||||
repository, here's how to run tests with `pytest` for the library:
|
repository, here's how to run tests with `pytest` for the library:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR="tests/data" python -m pytest -sv ./tests
|
python -m pytest -sv ./tests
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
42
README.md
42
README.md
@@ -23,20 +23,21 @@
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<h2 align="center">
|
<h2 align="center">
|
||||||
<p><a href="https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md">Hot new tutorial: Getting started with real-world robots</a></p>
|
<p><a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">New robot in town: SO-100</a></p>
|
||||||
</h2>
|
</h2>
|
||||||
|
|
||||||
<div align="center">
|
<div align="center">
|
||||||
<img src="media/tutorial/koch_v1_1_leader_follower.webp?raw=true" alt="Koch v1.1 leader and follower arms" title="Koch v1.1 leader and follower arms" width="50%">
|
<img src="media/so100/leader_follower.webp?raw=true" alt="SO-100 leader and follower arms" title="SO-100 leader and follower arms" width="50%">
|
||||||
<p>We just dropped an in-depth tutorial on how to build your own robot!</p>
|
<p>We just added a new tutorial on how to build a more affordable robot, at the price of $110 per arm!</p>
|
||||||
<p>Teach it new skills by showing it a few moves with just a laptop.</p>
|
<p>Teach it new skills by showing it a few moves with just a laptop.</p>
|
||||||
<p>Then watch your homemade robot act autonomously 🤯</p>
|
<p>Then watch your homemade robot act autonomously 🤯</p>
|
||||||
<p>For more info, see <a href="https://x.com/RemiCadene/status/1825455895561859185">our thread on X</a> or <a href="https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md">our tutorial page</a>.</p>
|
<p>Follow the link to the <a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">full tutorial for SO-100</a>.</p>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<br/>
|
||||||
|
|
||||||
<h3 align="center">
|
<h3 align="center">
|
||||||
<p>State-of-the-art AI for real-world robotics</p>
|
<p>LeRobot: State-of-the-art AI for real-world robotics</p>
|
||||||
</h3>
|
</h3>
|
||||||
|
|
||||||
---
|
---
|
||||||
@@ -54,9 +55,9 @@
|
|||||||
|
|
||||||
<table>
|
<table>
|
||||||
<tr>
|
<tr>
|
||||||
<td><img src="http://remicadene.com/assets/gif/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
|
<td><img src="media/gym/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
|
||||||
<td><img src="http://remicadene.com/assets/gif/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
|
<td><img src="media/gym/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
|
||||||
<td><img src="http://remicadene.com/assets/gif/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
|
<td><img src="media/gym/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td align="center">ACT policy on ALOHA env</td>
|
<td align="center">ACT policy on ALOHA env</td>
|
||||||
@@ -143,7 +144,7 @@ wandb login
|
|||||||
|
|
||||||
### Visualize datasets
|
### Visualize datasets
|
||||||
|
|
||||||
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically download data from the Hugging Face hub.
|
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically downloads data from the Hugging Face hub.
|
||||||
|
|
||||||
You can also locally visualize episodes from a dataset on the hub by executing our script from the command line:
|
You can also locally visualize episodes from a dataset on the hub by executing our script from the command line:
|
||||||
```bash
|
```bash
|
||||||
@@ -152,10 +153,12 @@ python lerobot/scripts/visualize_dataset.py \
|
|||||||
--episode-index 0
|
--episode-index 0
|
||||||
```
|
```
|
||||||
|
|
||||||
or from a dataset in a local folder with the root `DATA_DIR` environment variable (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
|
or from a dataset in a local folder with the `root` option and the `--local-files-only` (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR='./my_local_data_dir' python lerobot/scripts/visualize_dataset.py \
|
python lerobot/scripts/visualize_dataset.py \
|
||||||
--repo-id lerobot/pusht \
|
--repo-id lerobot/pusht \
|
||||||
|
--root ./my_local_data_dir \
|
||||||
|
--local-files-only 1 \
|
||||||
--episode-index 0
|
--episode-index 0
|
||||||
```
|
```
|
||||||
|
|
||||||
@@ -207,12 +210,10 @@ dataset attributes:
|
|||||||
|
|
||||||
A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
|
A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
|
||||||
- hf_dataset stored using Hugging Face datasets library serialization to parquet
|
- hf_dataset stored using Hugging Face datasets library serialization to parquet
|
||||||
- videos are stored in mp4 format to save space or png files
|
- videos are stored in mp4 format to save space
|
||||||
- episode_data_index saved using `safetensor` tensor serialization format
|
- metadata are stored in plain json/jsonl files
|
||||||
- stats saved using `safetensor` tensor serialization format
|
|
||||||
- info are saved using JSON
|
|
||||||
|
|
||||||
Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can set the `DATA_DIR` environment variable to your root dataset folder as illustrated in the above section on dataset visualization.
|
Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can use the `local_files_only` argument and specify its location with the `root` argument if it's not in the default `~/.cache/huggingface/lerobot` location.
|
||||||
|
|
||||||
### Evaluate a pretrained policy
|
### Evaluate a pretrained policy
|
||||||
|
|
||||||
@@ -266,13 +267,20 @@ checkpoints
|
|||||||
│ └── training_state.pth # optimizer/scheduler/rng state and training step
|
│ └── training_state.pth # optimizer/scheduler/rng state and training step
|
||||||
```
|
```
|
||||||
|
|
||||||
|
To resume training from a checkpoint, you can add these to the `train.py` python command:
|
||||||
|
```bash
|
||||||
|
hydra.run.dir=your/original/experiment/dir resume=true
|
||||||
|
```
|
||||||
|
|
||||||
|
It will load the pretrained model, optimizer and scheduler states for training. For more information please see our tutorial on training resumption [here](https://github.com/huggingface/lerobot/blob/main/examples/5_resume_training.md).
|
||||||
|
|
||||||
To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding:
|
To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
wandb.enable=true
|
wandb.enable=true
|
||||||
```
|
```
|
||||||
|
|
||||||
A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser:
|
A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser. Please also check [here](https://github.com/huggingface/lerobot/blob/main/examples/4_train_policy_with_script.md#typical-logs-and-metrics) for the explanation of some commonly used metrics in logs.
|
||||||
|
|
||||||

|

|
||||||
|
|
||||||
|
|||||||
@@ -266,7 +266,7 @@ def benchmark_encoding_decoding(
|
|||||||
)
|
)
|
||||||
|
|
||||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||||
width, height = tuple(dataset[0][dataset.camera_keys[0]].shape[-2:])
|
width, height = tuple(dataset[0][dataset.meta.camera_keys[0]].shape[-2:])
|
||||||
num_pixels = width * height
|
num_pixels = width * height
|
||||||
video_size_bytes = video_path.stat().st_size
|
video_size_bytes = video_path.stat().st_size
|
||||||
images_size_bytes = get_directory_size(imgs_dir)
|
images_size_bytes = get_directory_size(imgs_dir)
|
||||||
|
|||||||
@@ -22,7 +22,7 @@ RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
|||||||
COPY . /lerobot
|
COPY . /lerobot
|
||||||
WORKDIR /lerobot
|
WORKDIR /lerobot
|
||||||
RUN pip install --upgrade --no-cache-dir pip
|
RUN pip install --upgrade --no-cache-dir pip
|
||||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, koch]" \
|
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]" \
|
||||||
--extra-index-url https://download.pytorch.org/whl/cpu
|
--extra-index-url https://download.pytorch.org/whl/cpu
|
||||||
|
|
||||||
# Set EGL as the rendering backend for MuJoCo
|
# Set EGL as the rendering backend for MuJoCo
|
||||||
|
|||||||
@@ -24,7 +24,7 @@ RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
|||||||
COPY . /lerobot
|
COPY . /lerobot
|
||||||
WORKDIR /lerobot
|
WORKDIR /lerobot
|
||||||
RUN pip install --upgrade --no-cache-dir pip
|
RUN pip install --upgrade --no-cache-dir pip
|
||||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, koch]"
|
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]"
|
||||||
|
|
||||||
# Set EGL as the rendering backend for MuJoCo
|
# Set EGL as the rendering backend for MuJoCo
|
||||||
ENV MUJOCO_GL="egl"
|
ENV MUJOCO_GL="egl"
|
||||||
|
|||||||
275
examples/10_use_so100.md
Normal file
275
examples/10_use_so100.md
Normal file
@@ -0,0 +1,275 @@
|
|||||||
|
This tutorial explains how to use [SO-100](https://github.com/TheRobotStudio/SO-ARM100) with LeRobot.
|
||||||
|
|
||||||
|
## Source the parts
|
||||||
|
|
||||||
|
Follow this [README](https://github.com/TheRobotStudio/SO-ARM100). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
|
||||||
|
|
||||||
|
**Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
|
||||||
|
|
||||||
|
## Install LeRobot
|
||||||
|
|
||||||
|
On your computer:
|
||||||
|
|
||||||
|
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||||
|
```bash
|
||||||
|
mkdir -p ~/miniconda3
|
||||||
|
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||||
|
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||||
|
rm ~/miniconda3/miniconda.sh
|
||||||
|
~/miniconda3/bin/conda init bash
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Restart shell or `source ~/.bashrc`
|
||||||
|
|
||||||
|
3. Create and activate a fresh conda environment for lerobot
|
||||||
|
```bash
|
||||||
|
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
4. Clone LeRobot:
|
||||||
|
```bash
|
||||||
|
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
5. Install LeRobot with dependencies for the feetech motors:
|
||||||
|
```bash
|
||||||
|
cd ~/lerobot && pip install -e ".[feetech]"
|
||||||
|
```
|
||||||
|
|
||||||
|
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||||
|
```bash
|
||||||
|
conda install -y -c conda-forge ffmpeg
|
||||||
|
pip uninstall -y opencv-python
|
||||||
|
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
## Configure the motors
|
||||||
|
|
||||||
|
Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the use of our scripts below.
|
||||||
|
|
||||||
|
**Find USB ports associated to your arms**
|
||||||
|
To find the correct ports for each arm, run the utility script twice:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
```
|
||||||
|
|
||||||
|
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
||||||
|
```
|
||||||
|
Finding all available ports for the MotorBus.
|
||||||
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
|
[...Disconnect leader arm and press Enter...]
|
||||||
|
|
||||||
|
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
|
||||||
|
Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
||||||
|
```
|
||||||
|
Finding all available ports for the MotorBus.
|
||||||
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
|
[...Disconnect follower arm and press Enter...]
|
||||||
|
|
||||||
|
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
|
||||||
|
Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Troubleshooting: On Linux, you might need to give access to the USB ports by running:
|
||||||
|
```bash
|
||||||
|
sudo chmod 666 /dev/ttyACM0
|
||||||
|
sudo chmod 666 /dev/ttyACM1
|
||||||
|
```
|
||||||
|
|
||||||
|
**Configure your motors**
|
||||||
|
Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 1
|
||||||
|
```
|
||||||
|
|
||||||
|
Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).
|
||||||
|
|
||||||
|
Then unplug your motor and plug the second motor and set its ID to 2.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 2
|
||||||
|
```
|
||||||
|
|
||||||
|
Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
|
||||||
|
|
||||||
|
**Remove the gears of the 6 leader motors**
|
||||||
|
Follow step 2 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
|
||||||
|
|
||||||
|
**Add motor horn to the motors**
|
||||||
|
Follow step 3 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). For SO-100, you need to align the holes on the motor horn to the motor spline to be approximately 1:30, 4:30, 7:30 and 10:30.
|
||||||
|
Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
|
||||||
|
|
||||||
|
## Assemble the arms
|
||||||
|
|
||||||
|
Follow step 4 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
|
||||||
|
|
||||||
|
## Calibrate
|
||||||
|
|
||||||
|
Next, you'll need to calibrate your SO-100 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one SO-100 robot to work on another.
|
||||||
|
|
||||||
|
**Manual calibration of follower arm**
|
||||||
|
/!\ Contrarily to step 6 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the auto calibration, we will actually do manual calibration of follower for now.
|
||||||
|
|
||||||
|
You will need to move the follower arm to these positions sequentially:
|
||||||
|
|
||||||
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|
|---|---|---|
|
||||||
|
| <img src="../media/so100/follower_zero.webp?raw=true" alt="SO-100 follower arm zero position" title="SO-100 follower arm zero position" style="width:100%;"> | <img src="../media/so100/follower_rotated.webp?raw=true" alt="SO-100 follower arm rotated position" title="SO-100 follower arm rotated position" style="width:100%;"> | <img src="../media/so100/follower_rest.webp?raw=true" alt="SO-100 follower arm rest position" title="SO-100 follower arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
|
Make sure both arms are connected and run this script to launch manual calibration:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--robot-overrides '~cameras' --arms main_follower
|
||||||
|
```
|
||||||
|
|
||||||
|
**Manual calibration of leader arm**
|
||||||
|
Follow step 6 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
|
||||||
|
|
||||||
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|
|---|---|---|
|
||||||
|
| <img src="../media/so100/leader_zero.webp?raw=true" alt="SO-100 leader arm zero position" title="SO-100 leader arm zero position" style="width:100%;"> | <img src="../media/so100/leader_rotated.webp?raw=true" alt="SO-100 leader arm rotated position" title="SO-100 leader arm rotated position" style="width:100%;"> | <img src="../media/so100/leader_rest.webp?raw=true" alt="SO-100 leader arm rest position" title="SO-100 leader arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
|
Run this script to launch manual calibration:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--robot-overrides '~cameras' --arms main_leader
|
||||||
|
```
|
||||||
|
|
||||||
|
## Teleoperate
|
||||||
|
|
||||||
|
**Simple teleop**
|
||||||
|
Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--robot-overrides '~cameras' \
|
||||||
|
--display-cameras 0
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
**Teleop with displaying cameras**
|
||||||
|
Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml
|
||||||
|
```
|
||||||
|
|
||||||
|
## Record a dataset
|
||||||
|
|
||||||
|
Once you're familiar with teleoperation, you can record your first dataset with SO-100.
|
||||||
|
|
||||||
|
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
|
```bash
|
||||||
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
|
```
|
||||||
|
|
||||||
|
Store your Hugging Face repository name in a variable to run these commands:
|
||||||
|
```bash
|
||||||
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
|
echo $HF_USER
|
||||||
|
```
|
||||||
|
|
||||||
|
Record 2 episodes and upload your dataset to the hub:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/so100_test \
|
||||||
|
--tags so100 tutorial \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 2 \
|
||||||
|
--push-to-hub 1
|
||||||
|
```
|
||||||
|
|
||||||
|
## Visualize a dataset
|
||||||
|
|
||||||
|
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||||
|
```bash
|
||||||
|
echo ${HF_USER}/so100_test
|
||||||
|
```
|
||||||
|
|
||||||
|
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/visualize_dataset_html.py \
|
||||||
|
--repo-id ${HF_USER}/so100_test
|
||||||
|
```
|
||||||
|
|
||||||
|
## Replay an episode
|
||||||
|
|
||||||
|
Now try to replay the first episode on your robot:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/so100_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
|
||||||
|
## Train a policy
|
||||||
|
|
||||||
|
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
dataset_repo_id=${HF_USER}/so100_test \
|
||||||
|
policy=act_so100_real \
|
||||||
|
env=so100_real \
|
||||||
|
hydra.run.dir=outputs/train/act_so100_test \
|
||||||
|
hydra.job.name=act_so100_test \
|
||||||
|
device=cuda \
|
||||||
|
wandb.enable=true
|
||||||
|
```
|
||||||
|
|
||||||
|
Let's explain it:
|
||||||
|
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/so100_test`.
|
||||||
|
2. We provided the policy with `policy=act_so100_real`. This loads configurations from [`lerobot/configs/policy/act_so100_real.yaml`](../lerobot/configs/policy/act_so100_real.yaml). Importantly, this policy uses 2 cameras as input `laptop`, `phone`.
|
||||||
|
3. We provided an environment as argument with `env=so100_real`. This loads configurations from [`lerobot/configs/env/so100_real.yaml`](../lerobot/configs/env/so100_real.yaml).
|
||||||
|
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
|
||||||
|
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||||
|
|
||||||
|
Training should take several hours. You will find checkpoints in `outputs/train/act_so100_test/checkpoints`.
|
||||||
|
|
||||||
|
## Evaluate your policy
|
||||||
|
|
||||||
|
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/eval_act_so100_test \
|
||||||
|
--tags so100 tutorial eval \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 10 \
|
||||||
|
-p outputs/train/act_so100_test/checkpoints/last/pretrained_model
|
||||||
|
```
|
||||||
|
|
||||||
|
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||||
|
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_so100_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_so100_test`).
|
||||||
|
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_so100_test`).
|
||||||
|
|
||||||
|
## More
|
||||||
|
|
||||||
|
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
|
||||||
|
|
||||||
|
If you have any question or need help, please reach out on Discord in the channel [`#so100-arm`](https://discord.com/channels/1216765309076115607/1237741463832363039).
|
||||||
275
examples/11_use_moss.md
Normal file
275
examples/11_use_moss.md
Normal file
@@ -0,0 +1,275 @@
|
|||||||
|
This tutorial explains how to use [Moss v1](https://github.com/jess-moss/moss-robot-arms) with LeRobot.
|
||||||
|
|
||||||
|
## Source the parts
|
||||||
|
|
||||||
|
Follow this [README](https://github.com/jess-moss/moss-robot-arms). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
|
||||||
|
|
||||||
|
**Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
|
||||||
|
|
||||||
|
## Install LeRobot
|
||||||
|
|
||||||
|
On your computer:
|
||||||
|
|
||||||
|
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||||
|
```bash
|
||||||
|
mkdir -p ~/miniconda3
|
||||||
|
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||||
|
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||||
|
rm ~/miniconda3/miniconda.sh
|
||||||
|
~/miniconda3/bin/conda init bash
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Restart shell or `source ~/.bashrc`
|
||||||
|
|
||||||
|
3. Create and activate a fresh conda environment for lerobot
|
||||||
|
```bash
|
||||||
|
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
4. Clone LeRobot:
|
||||||
|
```bash
|
||||||
|
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
5. Install LeRobot with dependencies for the feetech motors:
|
||||||
|
```bash
|
||||||
|
cd ~/lerobot && pip install -e ".[feetech]"
|
||||||
|
```
|
||||||
|
|
||||||
|
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||||
|
```bash
|
||||||
|
conda install -y -c conda-forge ffmpeg
|
||||||
|
pip uninstall -y opencv-python
|
||||||
|
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
## Configure the motors
|
||||||
|
|
||||||
|
Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the use of our scripts below.
|
||||||
|
|
||||||
|
**Find USB ports associated to your arms**
|
||||||
|
To find the correct ports for each arm, run the utility script twice:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
```
|
||||||
|
|
||||||
|
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
||||||
|
```
|
||||||
|
Finding all available ports for the MotorBus.
|
||||||
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
|
[...Disconnect leader arm and press Enter...]
|
||||||
|
|
||||||
|
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
|
||||||
|
Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
||||||
|
```
|
||||||
|
Finding all available ports for the MotorBus.
|
||||||
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
|
[...Disconnect follower arm and press Enter...]
|
||||||
|
|
||||||
|
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
|
||||||
|
Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Troubleshooting: On Linux, you might need to give access to the USB ports by running:
|
||||||
|
```bash
|
||||||
|
sudo chmod 666 /dev/ttyACM0
|
||||||
|
sudo chmod 666 /dev/ttyACM1
|
||||||
|
```
|
||||||
|
|
||||||
|
**Configure your motors**
|
||||||
|
Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 1
|
||||||
|
```
|
||||||
|
|
||||||
|
Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).
|
||||||
|
|
||||||
|
Then unplug your motor and plug the second motor and set its ID to 2.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 2
|
||||||
|
```
|
||||||
|
|
||||||
|
Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
|
||||||
|
|
||||||
|
**Remove the gears of the 6 leader motors**
|
||||||
|
Follow step 2 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
|
||||||
|
|
||||||
|
**Add motor horn to the motors**
|
||||||
|
Follow step 3 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). For Moss v1, you need to align the holes on the motor horn to the motor spline to be approximately 3, 6, 9 and 12 o'clock.
|
||||||
|
Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
|
||||||
|
|
||||||
|
## Assemble the arms
|
||||||
|
|
||||||
|
Follow step 4 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
|
||||||
|
|
||||||
|
## Calibrate
|
||||||
|
|
||||||
|
Next, you'll need to calibrate your Moss v1 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one Moss v1 robot to work on another.
|
||||||
|
|
||||||
|
**Manual calibration of follower arm**
|
||||||
|
/!\ Contrarily to step 6 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the auto calibration, we will actually do manual calibration of follower for now.
|
||||||
|
|
||||||
|
You will need to move the follower arm to these positions sequentially:
|
||||||
|
|
||||||
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|
|---|---|---|
|
||||||
|
| <img src="../media/moss/follower_zero.webp?raw=true" alt="Moss v1 follower arm zero position" title="Moss v1 follower arm zero position" style="width:100%;"> | <img src="../media/moss/follower_rotated.webp?raw=true" alt="Moss v1 follower arm rotated position" title="Moss v1 follower arm rotated position" style="width:100%;"> | <img src="../media/moss/follower_rest.webp?raw=true" alt="Moss v1 follower arm rest position" title="Moss v1 follower arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
|
Make sure both arms are connected and run this script to launch manual calibration:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--robot-overrides '~cameras' --arms main_follower
|
||||||
|
```
|
||||||
|
|
||||||
|
**Manual calibration of leader arm**
|
||||||
|
Follow step 6 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
|
||||||
|
|
||||||
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|
|---|---|---|
|
||||||
|
| <img src="../media/moss/leader_zero.webp?raw=true" alt="Moss v1 leader arm zero position" title="Moss v1 leader arm zero position" style="width:100%;"> | <img src="../media/moss/leader_rotated.webp?raw=true" alt="Moss v1 leader arm rotated position" title="Moss v1 leader arm rotated position" style="width:100%;"> | <img src="../media/moss/leader_rest.webp?raw=true" alt="Moss v1 leader arm rest position" title="Moss v1 leader arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
|
Run this script to launch manual calibration:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--robot-overrides '~cameras' --arms main_leader
|
||||||
|
```
|
||||||
|
|
||||||
|
## Teleoperate
|
||||||
|
|
||||||
|
**Simple teleop**
|
||||||
|
Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--robot-overrides '~cameras' \
|
||||||
|
--display-cameras 0
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
**Teleop with displaying cameras**
|
||||||
|
Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml
|
||||||
|
```
|
||||||
|
|
||||||
|
## Record a dataset
|
||||||
|
|
||||||
|
Once you're familiar with teleoperation, you can record your first dataset with Moss v1.
|
||||||
|
|
||||||
|
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
|
```bash
|
||||||
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
|
```
|
||||||
|
|
||||||
|
Store your Hugging Face repository name in a variable to run these commands:
|
||||||
|
```bash
|
||||||
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
|
echo $HF_USER
|
||||||
|
```
|
||||||
|
|
||||||
|
Record 2 episodes and upload your dataset to the hub:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/moss_test \
|
||||||
|
--tags moss tutorial \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 2 \
|
||||||
|
--push-to-hub 1
|
||||||
|
```
|
||||||
|
|
||||||
|
## Visualize a dataset
|
||||||
|
|
||||||
|
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||||
|
```bash
|
||||||
|
echo ${HF_USER}/moss_test
|
||||||
|
```
|
||||||
|
|
||||||
|
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/visualize_dataset_html.py \
|
||||||
|
--repo-id ${HF_USER}/moss_test
|
||||||
|
```
|
||||||
|
|
||||||
|
## Replay an episode
|
||||||
|
|
||||||
|
Now try to replay the first episode on your robot:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/moss_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
|
||||||
|
## Train a policy
|
||||||
|
|
||||||
|
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
dataset_repo_id=${HF_USER}/moss_test \
|
||||||
|
policy=act_moss_real \
|
||||||
|
env=moss_real \
|
||||||
|
hydra.run.dir=outputs/train/act_moss_test \
|
||||||
|
hydra.job.name=act_moss_test \
|
||||||
|
device=cuda \
|
||||||
|
wandb.enable=true
|
||||||
|
```
|
||||||
|
|
||||||
|
Let's explain it:
|
||||||
|
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/moss_test`.
|
||||||
|
2. We provided the policy with `policy=act_moss_real`. This loads configurations from [`lerobot/configs/policy/act_moss_real.yaml`](../lerobot/configs/policy/act_moss_real.yaml). Importantly, this policy uses 2 cameras as input `laptop`, `phone`.
|
||||||
|
3. We provided an environment as argument with `env=moss_real`. This loads configurations from [`lerobot/configs/env/moss_real.yaml`](../lerobot/configs/env/moss_real.yaml).
|
||||||
|
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
|
||||||
|
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||||
|
|
||||||
|
Training should take several hours. You will find checkpoints in `outputs/train/act_moss_test/checkpoints`.
|
||||||
|
|
||||||
|
## Evaluate your policy
|
||||||
|
|
||||||
|
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/eval_act_moss_test \
|
||||||
|
--tags moss tutorial eval \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 10 \
|
||||||
|
-p outputs/train/act_moss_test/checkpoints/last/pretrained_model
|
||||||
|
```
|
||||||
|
|
||||||
|
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||||
|
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_moss_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_moss_test`).
|
||||||
|
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_moss_test`).
|
||||||
|
|
||||||
|
## More
|
||||||
|
|
||||||
|
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
|
||||||
|
|
||||||
|
If you have any question or need help, please reach out on Discord in the channel [`#moss-arm`](https://discord.com/channels/1216765309076115607/1275374638985252925).
|
||||||
83
examples/12_train_hilserl_classifier.md
Normal file
83
examples/12_train_hilserl_classifier.md
Normal file
@@ -0,0 +1,83 @@
|
|||||||
|
# Training a HIL-SERL Reward Classifier with LeRobot
|
||||||
|
|
||||||
|
This tutorial provides step-by-step instructions for training a reward classifier using LeRobot.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Training Script Overview
|
||||||
|
|
||||||
|
LeRobot includes a ready-to-use training script located at [`lerobot/scripts/train_hilserl_classifier.py`](../../lerobot/scripts/train_hilserl_classifier.py). Here's an outline of its workflow:
|
||||||
|
|
||||||
|
1. **Configuration Loading**
|
||||||
|
The script uses Hydra to load a configuration file for subsequent steps. (Details on Hydra follow below.)
|
||||||
|
|
||||||
|
2. **Dataset Initialization**
|
||||||
|
It loads a `LeRobotDataset` containing images and rewards. To optimize performance, a weighted random sampler is used to balance class sampling.
|
||||||
|
|
||||||
|
3. **Classifier Initialization**
|
||||||
|
A lightweight classification head is built on top of a frozen, pretrained image encoder from HuggingFace. The classifier outputs either:
|
||||||
|
- A single probability (binary classification), or
|
||||||
|
- Logits (multi-class classification).
|
||||||
|
|
||||||
|
4. **Training Loop Execution**
|
||||||
|
The script performs:
|
||||||
|
- Forward and backward passes,
|
||||||
|
- Optimization steps,
|
||||||
|
- Periodic logging, evaluation, and checkpoint saving.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Configuring with Hydra
|
||||||
|
|
||||||
|
For detailed information about Hydra usage, refer to [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md). However, note that training the reward classifier differs slightly and requires a separate configuration file.
|
||||||
|
|
||||||
|
### Config File Setup
|
||||||
|
|
||||||
|
The default `default.yaml` cannot launch the reward classifier training directly. Instead, you need a configuration file like [`lerobot/configs/policy/hilserl_classifier.yaml`](../../lerobot/configs/policy/hilserl_classifier.yaml), with the following adjustment:
|
||||||
|
|
||||||
|
Replace the `dataset_repo_id` field with the identifier for your dataset, which contains images and sparse rewards:
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
# Example: lerobot/configs/policy/reward_classifier.yaml
|
||||||
|
dataset_repo_id: "my_dataset_repo_id"
|
||||||
|
## Typical logs and metrics
|
||||||
|
```
|
||||||
|
When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
|
||||||
|
|
||||||
|
After that, you will see training log like this one:
|
||||||
|
|
||||||
|
```
|
||||||
|
[2024-11-29 18:26:36,999][root][INFO] -
|
||||||
|
Epoch 5/5
|
||||||
|
Training: 82%|██████████████████████████████████████████████████████████████████████████████▋ | 91/111 [00:50<00:09, 2.04it/s, loss=0.2999, acc=69.99%]
|
||||||
|
```
|
||||||
|
|
||||||
|
or evaluation log like:
|
||||||
|
|
||||||
|
```
|
||||||
|
Validation: 100%|████████████████████████████████████████████████████████████████████████████████████████████████████████████████████████| 28/28 [00:20<00:00, 1.37it/s]
|
||||||
|
```
|
||||||
|
|
||||||
|
### Metrics Tracking with Weights & Biases (WandB)
|
||||||
|
|
||||||
|
If `wandb.enable` is set to `true`, the training and evaluation logs will also be saved in WandB. This allows you to track key metrics in real-time, including:
|
||||||
|
|
||||||
|
- **Training Metrics**:
|
||||||
|
- `train/accuracy`
|
||||||
|
- `train/loss`
|
||||||
|
- `train/dataloading_s`
|
||||||
|
- **Evaluation Metrics**:
|
||||||
|
- `eval/accuracy`
|
||||||
|
- `eval/loss`
|
||||||
|
- `eval/eval_s`
|
||||||
|
|
||||||
|
#### Additional Features
|
||||||
|
|
||||||
|
You can also log sample predictions during evaluation. Each logged sample will include:
|
||||||
|
|
||||||
|
- The **input image**.
|
||||||
|
- The **predicted label**.
|
||||||
|
- The **true label**.
|
||||||
|
- The **classifier's "confidence" (logits/probability)**.
|
||||||
|
|
||||||
|
These logs can be useful for diagnosing and debugging performance issues.
|
||||||
@@ -3,78 +3,120 @@ This script demonstrates the use of `LeRobotDataset` class for handling and proc
|
|||||||
It illustrates how to load datasets, manipulate them, and apply transformations suitable for machine learning tasks in PyTorch.
|
It illustrates how to load datasets, manipulate them, and apply transformations suitable for machine learning tasks in PyTorch.
|
||||||
|
|
||||||
Features included in this script:
|
Features included in this script:
|
||||||
- Loading a dataset and accessing its properties.
|
- Viewing a dataset's metadata and exploring its properties.
|
||||||
- Filtering data by episode number.
|
- Loading an existing dataset from the hub or a subset of it.
|
||||||
- Converting tensor data for visualization.
|
- Accessing frames by episode number.
|
||||||
- Saving video files from dataset frames.
|
|
||||||
- Using advanced dataset features like timestamp-based frame selection.
|
- Using advanced dataset features like timestamp-based frame selection.
|
||||||
- Demonstrating compatibility with PyTorch DataLoader for batch processing.
|
- Demonstrating compatibility with PyTorch DataLoader for batch processing.
|
||||||
|
|
||||||
The script ends with examples of how to batch process data using PyTorch's DataLoader.
|
The script ends with examples of how to batch process data using PyTorch's DataLoader.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from pathlib import Path
|
|
||||||
from pprint import pprint
|
from pprint import pprint
|
||||||
|
|
||||||
import imageio
|
|
||||||
import torch
|
import torch
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
|
||||||
import lerobot
|
import lerobot
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
|
||||||
|
|
||||||
|
# We ported a number of existing datasets ourselves, use this to see the list:
|
||||||
print("List of available datasets:")
|
print("List of available datasets:")
|
||||||
pprint(lerobot.available_datasets)
|
pprint(lerobot.available_datasets)
|
||||||
|
|
||||||
# Let's take one for this example
|
# You can also browse through the datasets created/ported by the community on the hub using the hub api:
|
||||||
repo_id = "lerobot/pusht"
|
hub_api = HfApi()
|
||||||
|
repo_ids = [info.id for info in hub_api.list_datasets(task_categories="robotics", tags=["LeRobot"])]
|
||||||
|
pprint(repo_ids)
|
||||||
|
|
||||||
# You can easily load a dataset from a Hugging Face repository
|
# Or simply explore them in your web browser directly at:
|
||||||
|
# https://huggingface.co/datasets?other=LeRobot
|
||||||
|
|
||||||
|
# Let's take this one for this example
|
||||||
|
repo_id = "lerobot/aloha_mobile_cabinet"
|
||||||
|
# We can have a look and fetch its metadata to know more about it:
|
||||||
|
ds_meta = LeRobotDatasetMetadata(repo_id)
|
||||||
|
|
||||||
|
# By instantiating just this class, you can quickly access useful information about the content and the
|
||||||
|
# structure of the dataset without downloading the actual data yet (only metadata files — which are
|
||||||
|
# lightweight).
|
||||||
|
print(f"Total number of episodes: {ds_meta.total_episodes}")
|
||||||
|
print(f"Average number of frames per episode: {ds_meta.total_frames / ds_meta.total_episodes:.3f}")
|
||||||
|
print(f"Frames per second used during data collection: {ds_meta.fps}")
|
||||||
|
print(f"Robot type: {ds_meta.robot_type}")
|
||||||
|
print(f"keys to access images from cameras: {ds_meta.camera_keys=}\n")
|
||||||
|
|
||||||
|
print("Tasks:")
|
||||||
|
print(ds_meta.tasks)
|
||||||
|
print("Features:")
|
||||||
|
pprint(ds_meta.features)
|
||||||
|
|
||||||
|
# You can also get a short summary by simply printing the object:
|
||||||
|
print(ds_meta)
|
||||||
|
|
||||||
|
# You can then load the actual dataset from the hub.
|
||||||
|
# Either load any subset of episodes:
|
||||||
|
dataset = LeRobotDataset(repo_id, episodes=[0, 10, 11, 23])
|
||||||
|
|
||||||
|
# And see how many frames you have:
|
||||||
|
print(f"Selected episodes: {dataset.episodes}")
|
||||||
|
print(f"Number of episodes selected: {dataset.num_episodes}")
|
||||||
|
print(f"Number of frames selected: {dataset.num_frames}")
|
||||||
|
|
||||||
|
# Or simply load the entire dataset:
|
||||||
dataset = LeRobotDataset(repo_id)
|
dataset = LeRobotDataset(repo_id)
|
||||||
|
print(f"Number of episodes selected: {dataset.num_episodes}")
|
||||||
|
print(f"Number of frames selected: {dataset.num_frames}")
|
||||||
|
|
||||||
# LeRobotDataset is actually a thin wrapper around an underlying Hugging Face dataset
|
# The previous metadata class is contained in the 'meta' attribute of the dataset:
|
||||||
# (see https://huggingface.co/docs/datasets/index for more information).
|
print(dataset.meta)
|
||||||
print(dataset)
|
|
||||||
|
# LeRobotDataset actually wraps an underlying Hugging Face dataset
|
||||||
|
# (see https://huggingface.co/docs/datasets for more information).
|
||||||
print(dataset.hf_dataset)
|
print(dataset.hf_dataset)
|
||||||
|
|
||||||
# And provides additional utilities for robotics and compatibility with Pytorch
|
# LeRobot datasets also subclasses PyTorch datasets so you can do everything you know and love from working
|
||||||
print(f"\naverage number of frames per episode: {dataset.num_samples / dataset.num_episodes:.3f}")
|
# with the latter, like iterating through the dataset.
|
||||||
print(f"frames per second used during data collection: {dataset.fps=}")
|
# The __getitem__ iterates over the frames of the dataset. Since our datasets are also structured by
|
||||||
print(f"keys to access images from cameras: {dataset.camera_keys=}\n")
|
# episodes, you can access the frame indices of any episode using the episode_data_index. Here, we access
|
||||||
|
# frame indices associated to the first episode:
|
||||||
# Access frame indexes associated to first episode
|
|
||||||
episode_index = 0
|
episode_index = 0
|
||||||
from_idx = dataset.episode_data_index["from"][episode_index].item()
|
from_idx = dataset.episode_data_index["from"][episode_index].item()
|
||||||
to_idx = dataset.episode_data_index["to"][episode_index].item()
|
to_idx = dataset.episode_data_index["to"][episode_index].item()
|
||||||
|
|
||||||
# LeRobot datasets actually subclass PyTorch datasets so you can do everything you know and love from working
|
# Then we grab all the image frames from the first camera:
|
||||||
# with the latter, like iterating through the dataset. Here we grab all the image frames.
|
camera_key = dataset.meta.camera_keys[0]
|
||||||
frames = [dataset[idx]["observation.image"] for idx in range(from_idx, to_idx)]
|
frames = [dataset[idx][camera_key] for idx in range(from_idx, to_idx)]
|
||||||
|
|
||||||
# Video frames are now float32 in range [0,1] channel first (c,h,w) to follow pytorch convention. To visualize
|
# The objects returned by the dataset are all torch.Tensors
|
||||||
# them, we convert to uint8 in range [0,255]
|
print(type(frames[0]))
|
||||||
frames = [(frame * 255).type(torch.uint8) for frame in frames]
|
print(frames[0].shape)
|
||||||
# and to channel last (h,w,c).
|
|
||||||
frames = [frame.permute((1, 2, 0)).numpy() for frame in frames]
|
|
||||||
|
|
||||||
# Finally, we save the frames to a mp4 video for visualization.
|
# Since we're using pytorch, the shape is in pytorch, channel-first convention (c, h, w).
|
||||||
Path("outputs/examples/1_load_lerobot_dataset").mkdir(parents=True, exist_ok=True)
|
# We can compare this shape with the information available for that feature
|
||||||
imageio.mimsave("outputs/examples/1_load_lerobot_dataset/episode_0.mp4", frames, fps=dataset.fps)
|
pprint(dataset.features[camera_key])
|
||||||
|
# In particular:
|
||||||
|
print(dataset.features[camera_key]["shape"])
|
||||||
|
# The shape is in (h, w, c) which is a more universal format.
|
||||||
|
|
||||||
# For many machine learning applications we need to load the history of past observations or trajectories of
|
# For many machine learning applications we need to load the history of past observations or trajectories of
|
||||||
# future actions. Our datasets can load previous and future frames for each key/modality, using timestamps
|
# future actions. Our datasets can load previous and future frames for each key/modality, using timestamps
|
||||||
# differences with the current loaded frame. For instance:
|
# differences with the current loaded frame. For instance:
|
||||||
delta_timestamps = {
|
delta_timestamps = {
|
||||||
# loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
|
# loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
|
||||||
"observation.image": [-1, -0.5, -0.20, 0],
|
camera_key: [-1, -0.5, -0.20, 0],
|
||||||
# loads 8 state vectors: 1.5 seconds before, 1 second before, ... 20 ms, 10 ms, and current frame
|
# loads 8 state vectors: 1.5 seconds before, 1 second before, ... 200 ms, 100 ms, and current frame
|
||||||
"observation.state": [-1.5, -1, -0.5, -0.20, -0.10, -0.02, -0.01, 0],
|
"observation.state": [-1.5, -1, -0.5, -0.20, -0.10, 0],
|
||||||
# loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
|
# loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
|
||||||
"action": [t / dataset.fps for t in range(64)],
|
"action": [t / dataset.fps for t in range(64)],
|
||||||
}
|
}
|
||||||
|
# Note that in any case, these delta_timestamps values need to be multiples of (1/fps) so that added to any
|
||||||
|
# timestamp, you still get a valid timestamp.
|
||||||
|
|
||||||
dataset = LeRobotDataset(repo_id, delta_timestamps=delta_timestamps)
|
dataset = LeRobotDataset(repo_id, delta_timestamps=delta_timestamps)
|
||||||
print(f"\n{dataset[0]['observation.image'].shape=}") # (4,c,h,w)
|
print(f"\n{dataset[0][camera_key].shape=}") # (4, c, h, w)
|
||||||
print(f"{dataset[0]['observation.state'].shape=}") # (8,c)
|
print(f"{dataset[0]['observation.state'].shape=}") # (6, c)
|
||||||
print(f"{dataset[0]['action'].shape=}\n") # (64,c)
|
print(f"{dataset[0]['action'].shape=}\n") # (64, c)
|
||||||
|
|
||||||
# Finally, our datasets are fully compatible with PyTorch dataloaders and samplers because they are just
|
# Finally, our datasets are fully compatible with PyTorch dataloaders and samplers because they are just
|
||||||
# PyTorch datasets.
|
# PyTorch datasets.
|
||||||
@@ -84,8 +126,9 @@ dataloader = torch.utils.data.DataLoader(
|
|||||||
batch_size=32,
|
batch_size=32,
|
||||||
shuffle=True,
|
shuffle=True,
|
||||||
)
|
)
|
||||||
|
|
||||||
for batch in dataloader:
|
for batch in dataloader:
|
||||||
print(f"{batch['observation.image'].shape=}") # (32,4,c,h,w)
|
print(f"{batch[camera_key].shape=}") # (32, 4, c, h, w)
|
||||||
print(f"{batch['observation.state'].shape=}") # (32,8,c)
|
print(f"{batch['observation.state'].shape=}") # (32, 5, c)
|
||||||
print(f"{batch['action'].shape=}") # (32,64,c)
|
print(f"{batch['action'].shape=}") # (32, 64, c)
|
||||||
break
|
break
|
||||||
|
|||||||
@@ -40,7 +40,7 @@ dataset = LeRobotDataset("lerobot/pusht", delta_timestamps=delta_timestamps)
|
|||||||
# For this example, no arguments need to be passed because the defaults are set up for PushT.
|
# For this example, no arguments need to be passed because the defaults are set up for PushT.
|
||||||
# If you're doing something different, you will likely need to change at least some of the defaults.
|
# If you're doing something different, you will likely need to change at least some of the defaults.
|
||||||
cfg = DiffusionConfig()
|
cfg = DiffusionConfig()
|
||||||
policy = DiffusionPolicy(cfg, dataset_stats=dataset.stats)
|
policy = DiffusionPolicy(cfg, dataset_stats=dataset.meta.stats)
|
||||||
policy.train()
|
policy.train()
|
||||||
policy.to(device)
|
policy.to(device)
|
||||||
|
|
||||||
|
|||||||
@@ -170,6 +170,36 @@ python lerobot/scripts/train.py --config-dir outputs/train/my_experiment/checkpo
|
|||||||
|
|
||||||
Note that you may still use the regular syntax for config parameter overrides (eg: by adding `training.offline_steps=200000`).
|
Note that you may still use the regular syntax for config parameter overrides (eg: by adding `training.offline_steps=200000`).
|
||||||
|
|
||||||
|
## Typical logs and metrics
|
||||||
|
|
||||||
|
When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
|
||||||
|
|
||||||
|
After that, you will see training log like this one:
|
||||||
|
|
||||||
|
```
|
||||||
|
INFO 2024-08-14 13:35:12 ts/train.py:192 step:0 smpl:64 ep:1 epch:0.00 loss:1.112 grdn:15.387 lr:2.0e-07 updt_s:1.738 data_s:4.774
|
||||||
|
```
|
||||||
|
|
||||||
|
or evaluation log like:
|
||||||
|
|
||||||
|
```
|
||||||
|
INFO 2024-08-14 13:38:45 ts/train.py:226 step:100 smpl:6K ep:52 epch:0.25 ∑rwrd:20.693 success:0.0% eval_s:120.266
|
||||||
|
```
|
||||||
|
|
||||||
|
These logs will also be saved in wandb if `wandb.enable` is set to `true`. Here are the meaning of some abbreviations:
|
||||||
|
|
||||||
|
- `smpl`: number of samples seen during training.
|
||||||
|
- `ep`: number of episodes seen during training. An episode contains multiple samples in a complete manipulation task.
|
||||||
|
- `epch`: number of time all unique samples are seen (epoch).
|
||||||
|
- `grdn`: gradient norm.
|
||||||
|
- `∑rwrd`: compute the sum of rewards in every evaluation episode and then take an average of them.
|
||||||
|
- `success`: average success rate of eval episodes. Reward and success are usually different except for the sparsing reward setting, where reward=1 only when the task is completed successfully.
|
||||||
|
- `eval_s`: time to evaluate the policy in the environment, in second.
|
||||||
|
- `updt_s`: time to update the network parameters, in second.
|
||||||
|
- `data_s`: time to load a batch of data, in second.
|
||||||
|
|
||||||
|
Some metrics are useful for initial performance profiling. For example, if you find the current GPU utilization is low via the `nvidia-smi` command and `data_s` sometimes is too high, you may need to modify batch size or number of dataloading workers to accelerate dataloading. We also recommend [pytorch profiler](https://github.com/huggingface/lerobot?tab=readme-ov-file#improve-your-code-with-profiling) for detailed performance probing.
|
||||||
|
|
||||||
---
|
---
|
||||||
|
|
||||||
So far we've seen how to train Diffusion Policy for PushT and ACT for ALOHA. Now, what if we want to train ACT for PushT? Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
So far we've seen how to train Diffusion Policy for PushT and ACT for ALOHA. Now, what if we want to train ACT for PushT? Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
||||||
|
|||||||
@@ -1,7 +1,7 @@
|
|||||||
"""
|
"""
|
||||||
This script demonstrates how to use torchvision's image transformation with LeRobotDataset for data
|
This script demonstrates how to use torchvision's image transformation with LeRobotDataset for data
|
||||||
augmentation purposes. The transformations are passed to the dataset as an argument upon creation, and
|
augmentation purposes. The transformations are passed to the dataset as an argument upon creation, and
|
||||||
transforms are applied to the observation images before they are returned in the dataset's __get_item__.
|
transforms are applied to the observation images before they are returned in the dataset's __getitem__.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
@@ -10,17 +10,17 @@ from torchvision.transforms import ToPILImage, v2
|
|||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
|
||||||
dataset_repo_id = "lerobot/aloha_static_tape"
|
dataset_repo_id = "lerobot/aloha_static_screw_driver"
|
||||||
|
|
||||||
# Create a LeRobotDataset with no transformations
|
# Create a LeRobotDataset with no transformations
|
||||||
dataset = LeRobotDataset(dataset_repo_id)
|
dataset = LeRobotDataset(dataset_repo_id, episodes=[0])
|
||||||
# This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
|
# This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
|
||||||
|
|
||||||
# Get the index of the first observation in the first episode
|
# Get the index of the first observation in the first episode
|
||||||
first_idx = dataset.episode_data_index["from"][0].item()
|
first_idx = dataset.episode_data_index["from"][0].item()
|
||||||
|
|
||||||
# Get the frame corresponding to the first camera
|
# Get the frame corresponding to the first camera
|
||||||
frame = dataset[first_idx][dataset.camera_keys[0]]
|
frame = dataset[first_idx][dataset.meta.camera_keys[0]]
|
||||||
|
|
||||||
|
|
||||||
# Define the transformations
|
# Define the transformations
|
||||||
@@ -28,15 +28,16 @@ transforms = v2.Compose(
|
|||||||
[
|
[
|
||||||
v2.ColorJitter(brightness=(0.5, 1.5)),
|
v2.ColorJitter(brightness=(0.5, 1.5)),
|
||||||
v2.ColorJitter(contrast=(0.5, 1.5)),
|
v2.ColorJitter(contrast=(0.5, 1.5)),
|
||||||
|
v2.ColorJitter(hue=(-0.1, 0.1)),
|
||||||
v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
|
v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
|
||||||
]
|
]
|
||||||
)
|
)
|
||||||
|
|
||||||
# Create another LeRobotDataset with the defined transformations
|
# Create another LeRobotDataset with the defined transformations
|
||||||
transformed_dataset = LeRobotDataset(dataset_repo_id, image_transforms=transforms)
|
transformed_dataset = LeRobotDataset(dataset_repo_id, episodes=[0], image_transforms=transforms)
|
||||||
|
|
||||||
# Get a frame from the transformed dataset
|
# Get a frame from the transformed dataset
|
||||||
transformed_frame = transformed_dataset[first_idx][transformed_dataset.camera_keys[0]]
|
transformed_frame = transformed_dataset[first_idx][transformed_dataset.meta.camera_keys[0]]
|
||||||
|
|
||||||
# Create a directory to store output images
|
# Create a directory to store output images
|
||||||
output_dir = Path("outputs/image_transforms")
|
output_dir = Path("outputs/image_transforms")
|
||||||
|
|||||||
@@ -11,7 +11,7 @@ This tutorial will guide you through the process of setting up and training a ne
|
|||||||
|
|
||||||
By following these steps, you'll be able to replicate tasks like picking up a Lego block and placing it in a bin with a high success rate, as demonstrated in [this video](https://x.com/RemiCadene/status/1814680760592572934).
|
By following these steps, you'll be able to replicate tasks like picking up a Lego block and placing it in a bin with a high success rate, as demonstrated in [this video](https://x.com/RemiCadene/status/1814680760592572934).
|
||||||
|
|
||||||
Although this tutorial is general and can be easily adapted to various types of robots by changing the configuration, it is specifically based on the [Koch v1.1](https://github.com/jess-moss/koch-v1-1), an affordable robot. The Koch v1.1 consists of a leader arm and a follower arm, each with 6 motors. It can work with one or several cameras to record the scene, which serve as visual sensors for the robot.
|
This tutorial is specifically made for the affordable [Koch v1.1](https://github.com/jess-moss/koch-v1-1) robot, but it contains additional information to be easily adapted to various types of robots like [Aloha bimanual robot](https://aloha-2.github.io) by changing some configurations. The Koch v1.1 consists of a leader arm and a follower arm, each with 6 motors. It can work with one or several cameras to record the scene, which serve as visual sensors for the robot.
|
||||||
|
|
||||||
During the data collection phase, you will control the follower arm by moving the leader arm. This process is known as "teleoperation." This technique is used to collect robot trajectories. Afterward, you'll train a neural network to imitate these trajectories and deploy the network to enable your robot to operate autonomously.
|
During the data collection phase, you will control the follower arm by moving the leader arm. This process is known as "teleoperation." This technique is used to collect robot trajectories. Afterward, you'll train a neural network to imitate these trajectories and deploy the network to enable your robot to operate autonomously.
|
||||||
|
|
||||||
@@ -29,16 +29,23 @@ For a visual walkthrough of the assembly process, you can refer to [this video t
|
|||||||
|
|
||||||
## 2. Configure motors, calibrate arms, teleoperate your Koch v1.1
|
## 2. Configure motors, calibrate arms, teleoperate your Koch v1.1
|
||||||
|
|
||||||
First, install the additional dependencies required for Koch v1.1 by running one of the following commands.
|
First, install the additional dependencies required for robots built with dynamixel motors like Koch v1.1 by running one of the following commands (make sure gcc is installed).
|
||||||
|
|
||||||
Using `pip`:
|
Using `pip`:
|
||||||
```bash
|
```bash
|
||||||
pip install -e ".[koch]"
|
pip install -e ".[dynamixel]"
|
||||||
```
|
```
|
||||||
|
|
||||||
Or using `poetry`:
|
Or using `poetry`:
|
||||||
```bash
|
```bash
|
||||||
poetry install --sync --extras "koch"
|
poetry install --sync --extras "dynamixel"
|
||||||
|
```
|
||||||
|
|
||||||
|
/!\ For Linux only, ffmpeg and opencv requires conda install for now. Run this exact sequence of commands:
|
||||||
|
```bash
|
||||||
|
conda install -c conda-forge ffmpeg
|
||||||
|
pip uninstall opencv-python
|
||||||
|
conda install -c conda-forge "opencv>=4.10.0"
|
||||||
```
|
```
|
||||||
|
|
||||||
You are now ready to plug the 5V power supply to the motor bus of the leader arm (the smaller one) since all its motors only require 5V.
|
You are now ready to plug the 5V power supply to the motor bus of the leader arm (the smaller one) since all its motors only require 5V.
|
||||||
@@ -71,12 +78,12 @@ To begin, create two instances of the [`DynamixelMotorsBus`](../lerobot/common/
|
|||||||
|
|
||||||
To find the correct ports for each arm, run the utility script twice:
|
To find the correct ports for each arm, run the utility script twice:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/common/robot_devices/motors/dynamixel.py
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
```
|
```
|
||||||
|
|
||||||
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
||||||
```
|
```
|
||||||
Finding all available ports for the DynamixelMotorsBus.
|
Finding all available ports for the MotorBus.
|
||||||
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
@@ -88,7 +95,7 @@ Reconnect the usb cable.
|
|||||||
|
|
||||||
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
||||||
```
|
```
|
||||||
Finding all available ports for the DynamixelMotorsBus.
|
Finding all available ports for the MotorBus.
|
||||||
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
@@ -147,6 +154,7 @@ follower_arm = DynamixelMotorsBus(
|
|||||||
Next, update the port values in the YAML configuration file for the Koch robot at [`lerobot/configs/robot/koch.yaml`](../lerobot/configs/robot/koch.yaml) with the ports you've identified:
|
Next, update the port values in the YAML configuration file for the Koch robot at [`lerobot/configs/robot/koch.yaml`](../lerobot/configs/robot/koch.yaml) with the ports you've identified:
|
||||||
```yaml
|
```yaml
|
||||||
[...]
|
[...]
|
||||||
|
robot_type: koch
|
||||||
leader_arms:
|
leader_arms:
|
||||||
main:
|
main:
|
||||||
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
@@ -174,6 +182,8 @@ follower_arms:
|
|||||||
[...]
|
[...]
|
||||||
```
|
```
|
||||||
|
|
||||||
|
Don't forget to set `robot_type: aloha` if you follow this tutorial with [Aloha bimanual robot](aloha-2.github.io) instead of Koch v1.1
|
||||||
|
|
||||||
This configuration file is used to instantiate your robot across all scripts. We'll cover how this works later on.
|
This configuration file is used to instantiate your robot across all scripts. We'll cover how this works later on.
|
||||||
|
|
||||||
**Connect and Configure your Motors**
|
**Connect and Configure your Motors**
|
||||||
@@ -298,32 +308,37 @@ Alternatively, you can unplug the power cord, which will automatically disable t
|
|||||||
|
|
||||||
*/!\ Warning*: These motors tend to overheat, especially under torque or if left plugged in for too long. Unplug after use.
|
*/!\ Warning*: These motors tend to overheat, especially under torque or if left plugged in for too long. Unplug after use.
|
||||||
|
|
||||||
### b. Teleoperate your Koch v1.1 with KochRobot
|
### b. Teleoperate your Koch v1.1 with ManipulatorRobot
|
||||||
|
|
||||||
**Instantiate the KochRobot**
|
**Instantiate the ManipulatorRobot**
|
||||||
|
|
||||||
Before you can teleoperate your robot, you need to instantiate the [`KochRobot`](../lerobot/common/robot_devices/robots/koch.py) using the previously defined `leader_arm` and `follower_arm`.
|
Before you can teleoperate your robot, you need to instantiate the [`ManipulatorRobot`](../lerobot/common/robot_devices/robots/manipulator.py) using the previously defined `leader_arm` and `follower_arm`.
|
||||||
|
|
||||||
For the Koch robot, we only have one leader, so we refer to it as `"main"` and define it as `leader_arms={"main": leader_arm}`. We do the same for the follower arm. For other robots (like the Aloha), which may have two pairs of leader and follower arms, you would define them like this: `leader_arms={"left": left_leader_arm, "right": right_leader_arm},`. Same thing for the follower arms.
|
For the Koch v1.1 robot, we only have one leader, so we refer to it as `"main"` and define it as `leader_arms={"main": leader_arm}`. We do the same for the follower arm. For other robots (like the Aloha), which may have two pairs of leader and follower arms, you would define them like this: `leader_arms={"left": left_leader_arm, "right": right_leader_arm},`. Same thing for the follower arms.
|
||||||
|
|
||||||
You also need to provide a path to a calibration file, such as `calibration_path=".cache/calibration/koch.pkl"`. More on this in the next section.
|
You also need to provide a path to a calibration directory, such as `calibration_dir=".cache/calibration/koch"`. More on this in the next section.
|
||||||
|
|
||||||
Run the following code to instantiate your Koch robot:
|
Run the following code to instantiate your manipulator robot:
|
||||||
```python
|
```python
|
||||||
from lerobot.common.robot_devices.robots.koch import KochRobot
|
from lerobot.common.robot_devices.robots.manipulator import ManipulatorRobot
|
||||||
|
|
||||||
robot = KochRobot(
|
robot = ManipulatorRobot(
|
||||||
|
robot_type="koch",
|
||||||
leader_arms={"main": leader_arm},
|
leader_arms={"main": leader_arm},
|
||||||
follower_arms={"main": follower_arm},
|
follower_arms={"main": follower_arm},
|
||||||
calibration_path=".cache/calibration/koch.pkl",
|
calibration_dir=".cache/calibration/koch",
|
||||||
)
|
)
|
||||||
```
|
```
|
||||||
|
|
||||||
**Calibrate and Connect the KochRobot**
|
The `robot_type="koch"` is used to set the associated settings and calibration process. For instance, we activate the torque of the gripper of the leader Koch v1.1 arm and position it at a 40 degree angle to use it as a trigger.
|
||||||
|
|
||||||
Next, you'll need to calibrate your robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one Koch robot to work on another.
|
For the [Aloha bimanual robot](https://aloha-2.github.io), we would use `robot_type="aloha"` to set different settings such as a secondary ID for shadow joints (shoulder, elbow). Specific to Aloha, LeRobot comes with default calibration files stored in in `.cache/calibration/aloha_default`. Assuming the motors have been properly assembled, no manual calibration step is expected. If you need to run manual calibration, simply update `calibration_dir` to `.cache/calibration/aloha`.
|
||||||
|
|
||||||
When you connect your robot for the first time, the [`KochRobot`](../lerobot/common/robot_devices/robots/koch.py) will detect if the calibration file is missing and trigger the calibration procedure. During this process, you will be guided to move each arm to three different positions.
|
**Calibrate and Connect the ManipulatorRobot**
|
||||||
|
|
||||||
|
Next, you'll need to calibrate your Koch robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one Koch robot to work on another.
|
||||||
|
|
||||||
|
When you connect your robot for the first time, the [`ManipulatorRobot`](../lerobot/common/robot_devices/robots/manipulator.py) will detect if the calibration file is missing and trigger the calibration procedure. During this process, you will be guided to move each arm to three different positions.
|
||||||
|
|
||||||
Here are the positions you'll move the follower arm to:
|
Here are the positions you'll move the follower arm to:
|
||||||
|
|
||||||
@@ -354,27 +369,26 @@ The output will look like this:
|
|||||||
```
|
```
|
||||||
Connecting main follower arm
|
Connecting main follower arm
|
||||||
Connecting main leader arm
|
Connecting main leader arm
|
||||||
Missing calibration file '.cache/calibration/koch.pkl'. Starting calibration procedure.
|
|
||||||
|
|
||||||
Running calibration of main follower...
|
|
||||||
|
|
||||||
|
Missing calibration file '.cache/calibration/koch/main_follower.json'
|
||||||
|
Running calibration of koch main follower...
|
||||||
Move arm to zero position
|
Move arm to zero position
|
||||||
[...]
|
[...]
|
||||||
Move arm to rotated position
|
Move arm to rotated position
|
||||||
[...]
|
[...]
|
||||||
Move arm to rest position
|
Move arm to rest position
|
||||||
[...]
|
[...]
|
||||||
|
Calibration is done! Saving calibration file '.cache/calibration/koch/main_follower.json'
|
||||||
|
|
||||||
Running calibration of main leader...
|
Missing calibration file '.cache/calibration/koch/main_leader.json'
|
||||||
|
Running calibration of koch main leader...
|
||||||
Move arm to zero position
|
Move arm to zero position
|
||||||
[...]
|
[...]
|
||||||
Move arm to rotated position
|
Move arm to rotated position
|
||||||
[...]
|
[...]
|
||||||
Move arm to rest position
|
Move arm to rest position
|
||||||
[...]
|
[...]
|
||||||
|
Calibration is done! Saving calibration file '.cache/calibration/koch/main_leader.json'
|
||||||
Calibration is done! Saving calibration file '.cache/calibration/koch.pkl'
|
|
||||||
```
|
```
|
||||||
|
|
||||||
*Verifying Calibration*
|
*Verifying Calibration*
|
||||||
@@ -414,7 +428,7 @@ for _ in tqdm.tqdm(range(seconds*frequency)):
|
|||||||
|
|
||||||
*Using `teleop_step` for Teleoperation*
|
*Using `teleop_step` for Teleoperation*
|
||||||
|
|
||||||
Alternatively, you can teleoperate the robot using the `teleop_step` method from [`KochRobot`](../lerobot/common/robot_devices/robots/koch.py).
|
Alternatively, you can teleoperate the robot using the `teleop_step` method from [`ManipulatorRobot`](../lerobot/common/robot_devices/robots/manipulator.py).
|
||||||
|
|
||||||
Run this code to teleoperate:
|
Run this code to teleoperate:
|
||||||
```python
|
```python
|
||||||
@@ -607,10 +621,10 @@ Additionaly, you can set up your robot to work with your cameras.
|
|||||||
|
|
||||||
Modify the following Python code with the appropriate camera names and configurations:
|
Modify the following Python code with the appropriate camera names and configurations:
|
||||||
```python
|
```python
|
||||||
robot = KochRobot(
|
robot = ManipulatorRobot(
|
||||||
leader_arms={"main": leader_arm},
|
leader_arms={"main": leader_arm},
|
||||||
follower_arms={"main": follower_arm},
|
follower_arms={"main": follower_arm},
|
||||||
calibration_path=".cache/calibration/koch.pkl",
|
calibration_dir=".cache/calibration/koch",
|
||||||
cameras={
|
cameras={
|
||||||
"laptop": OpenCVCamera(0, fps=30, width=640, height=480),
|
"laptop": OpenCVCamera(0, fps=30, width=640, height=480),
|
||||||
"phone": OpenCVCamera(1, fps=30, width=640, height=480),
|
"phone": OpenCVCamera(1, fps=30, width=640, height=480),
|
||||||
@@ -752,7 +766,7 @@ Before trying `record`, if you want to push your dataset to the hub, make sure y
|
|||||||
```bash
|
```bash
|
||||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
```
|
```
|
||||||
Also, store your Hugging Face repositery name in a variable (e.g. `cadene` or `lerobot`). For instance, run this to use your Hugging Face user name as repositery:
|
Also, store your Hugging Face repository name in a variable (e.g. `cadene` or `lerobot`). For instance, run this to use your Hugging Face user name as repository:
|
||||||
```bash
|
```bash
|
||||||
HF_USER=$(huggingface-cli whoami | head -n 1)
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
echo $HF_USER
|
echo $HF_USER
|
||||||
@@ -764,7 +778,6 @@ Now run this to record 2 episodes:
|
|||||||
python lerobot/scripts/control_robot.py record \
|
python lerobot/scripts/control_robot.py record \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
--robot-path lerobot/configs/robot/koch.yaml \
|
||||||
--fps 30 \
|
--fps 30 \
|
||||||
--root data \
|
|
||||||
--repo-id ${HF_USER}/koch_test \
|
--repo-id ${HF_USER}/koch_test \
|
||||||
--tags tutorial \
|
--tags tutorial \
|
||||||
--warmup-time-s 5 \
|
--warmup-time-s 5 \
|
||||||
@@ -773,7 +786,7 @@ python lerobot/scripts/control_robot.py record \
|
|||||||
--num-episodes 2
|
--num-episodes 2
|
||||||
```
|
```
|
||||||
|
|
||||||
This will write your dataset locally to `{root}/{repo-id}` (e.g. `data/cadene/koch_test`) and push it on the hub at `https://huggingface.co/datasets/{HF_USER}/{repo-id}`. Your dataset will be automatically tagged with `LeRobot` for the community to find it easily, and you can also add custom tags (in this case `tutorial` for example).
|
This will write your dataset locally to `~/.cache/huggingface/lerobot/{repo-id}` (e.g. `data/cadene/koch_test`) and push it on the hub at `https://huggingface.co/datasets/{HF_USER}/{repo-id}`. Your dataset will be automatically tagged with `LeRobot` for the community to find it easily, and you can also add custom tags (in this case `tutorial` for example).
|
||||||
|
|
||||||
You can look for other LeRobot datasets on the hub by searching for `LeRobot` tags: https://huggingface.co/datasets?other=LeRobot
|
You can look for other LeRobot datasets on the hub by searching for `LeRobot` tags: https://huggingface.co/datasets?other=LeRobot
|
||||||
|
|
||||||
@@ -826,7 +839,6 @@ In the coming months, we plan to release a foundational model for robotics. We a
|
|||||||
You can visualize your dataset by running:
|
You can visualize your dataset by running:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/visualize_dataset_html.py \
|
python lerobot/scripts/visualize_dataset_html.py \
|
||||||
--root data \
|
|
||||||
--repo-id ${HF_USER}/koch_test
|
--repo-id ${HF_USER}/koch_test
|
||||||
```
|
```
|
||||||
|
|
||||||
@@ -844,7 +856,6 @@ To replay the first episode of the dataset you just recorded, run the following
|
|||||||
python lerobot/scripts/control_robot.py replay \
|
python lerobot/scripts/control_robot.py replay \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
--robot-path lerobot/configs/robot/koch.yaml \
|
||||||
--fps 30 \
|
--fps 30 \
|
||||||
--root data \
|
|
||||||
--repo-id ${HF_USER}/koch_test \
|
--repo-id ${HF_USER}/koch_test \
|
||||||
--episode 0
|
--episode 0
|
||||||
```
|
```
|
||||||
@@ -857,7 +868,7 @@ Your robot should replicate movements similar to those you recorded. For example
|
|||||||
|
|
||||||
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR=data python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
dataset_repo_id=${HF_USER}/koch_test \
|
dataset_repo_id=${HF_USER}/koch_test \
|
||||||
policy=act_koch_real \
|
policy=act_koch_real \
|
||||||
env=koch_real \
|
env=koch_real \
|
||||||
@@ -904,7 +915,6 @@ env:
|
|||||||
It should match your dataset (e.g. `fps: 30`) and your robot (e.g. `state_dim: 6` and `action_dim: 6`). We are still working on simplifying this in future versions of `lerobot`.
|
It should match your dataset (e.g. `fps: 30`) and your robot (e.g. `state_dim: 6` and `action_dim: 6`). We are still working on simplifying this in future versions of `lerobot`.
|
||||||
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you could use `device=mps` to train on Apple silicon.
|
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you could use `device=mps` to train on Apple silicon.
|
||||||
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||||
6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
|
|
||||||
|
|
||||||
For more information on the `train` script see the previous tutorial: [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md)
|
For more information on the `train` script see the previous tutorial: [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md)
|
||||||
|
|
||||||
@@ -925,7 +935,7 @@ huggingface-cli upload ${HF_USER}/act_koch_test_${CKPT} \
|
|||||||
|
|
||||||
## 5. Evaluate your policy
|
## 5. Evaluate your policy
|
||||||
|
|
||||||
Now that you have a policy checkpoint, you can easily control your robot with it using methods from [`KochRobot`](../lerobot/common/robot_devices/robots/koch.py) and the policy.
|
Now that you have a policy checkpoint, you can easily control your robot with it using methods from [`ManipulatorRobot`](../lerobot/common/robot_devices/robots/manipulator.py) and the policy.
|
||||||
|
|
||||||
Try this code for running inference for 60 seconds at 30 fps:
|
Try this code for running inference for 60 seconds at 30 fps:
|
||||||
```python
|
```python
|
||||||
@@ -977,7 +987,6 @@ To this end, you can use the `record` function from [`lerobot/scripts/control_ro
|
|||||||
python lerobot/scripts/control_robot.py record \
|
python lerobot/scripts/control_robot.py record \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
--robot-path lerobot/configs/robot/koch.yaml \
|
||||||
--fps 30 \
|
--fps 30 \
|
||||||
--root data \
|
|
||||||
--repo-id ${HF_USER}/eval_koch_test \
|
--repo-id ${HF_USER}/eval_koch_test \
|
||||||
--tags tutorial eval \
|
--tags tutorial eval \
|
||||||
--warmup-time-s 5 \
|
--warmup-time-s 5 \
|
||||||
@@ -996,7 +1005,6 @@ As you can see, it's almost the same command as previously used to record your t
|
|||||||
You can then visualize your evaluation dataset by running the same command as before but with the new inference dataset as argument:
|
You can then visualize your evaluation dataset by running the same command as before but with the new inference dataset as argument:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/visualize_dataset.py \
|
python lerobot/scripts/visualize_dataset.py \
|
||||||
--root data \
|
|
||||||
--repo-id ${HF_USER}/eval_koch_test
|
--repo-id ${HF_USER}/eval_koch_test
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|||||||
156
examples/8_use_stretch.md
Normal file
156
examples/8_use_stretch.md
Normal file
@@ -0,0 +1,156 @@
|
|||||||
|
This tutorial explains how to use [Stretch 3](https://hello-robot.com/stretch-3-product) with LeRobot.
|
||||||
|
|
||||||
|
## Setup
|
||||||
|
|
||||||
|
Familiarize yourself with Stretch by following its [tutorials](https://docs.hello-robot.com/0.3/getting_started/hello_robot/) (recommended).
|
||||||
|
|
||||||
|
To use LeRobot on Stretch, 3 options are available:
|
||||||
|
- [tethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#tethered-setup)
|
||||||
|
- [untethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#untethered-setup)
|
||||||
|
- ssh directly into Stretch (you will first need to install and configure openssh-server on stretch using one of the two above setups)
|
||||||
|
|
||||||
|
|
||||||
|
## Install LeRobot
|
||||||
|
|
||||||
|
On Stretch's CLI, follow these steps:
|
||||||
|
|
||||||
|
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||||
|
```bash
|
||||||
|
mkdir -p ~/miniconda3
|
||||||
|
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||||
|
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||||
|
rm ~/miniconda3/miniconda.sh
|
||||||
|
~/miniconda3/bin/conda init bash
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Comment out these lines in `~/.profile` (this can mess up paths used by conda and ~/.local/bin should already be in your PATH)
|
||||||
|
```
|
||||||
|
# set PATH so it includes user's private bin if it exists
|
||||||
|
if [ -d "$HOME/.local/bin" ] ; then
|
||||||
|
PATH="$HOME/.local/bin:$PATH"
|
||||||
|
fi
|
||||||
|
```
|
||||||
|
|
||||||
|
3. Restart shell or `source ~/.bashrc`
|
||||||
|
|
||||||
|
4. Create and activate a fresh conda environment for lerobot
|
||||||
|
```bash
|
||||||
|
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
5. Clone LeRobot:
|
||||||
|
```bash
|
||||||
|
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
6. Install LeRobot with stretch dependencies:
|
||||||
|
```bash
|
||||||
|
cd ~/lerobot && pip install -e ".[stretch]"
|
||||||
|
```
|
||||||
|
|
||||||
|
> **Note:** If you get this message, you can ignore it: `ERROR: pip's dependency resolver does not currently take into account all the packages that are installed.`
|
||||||
|
|
||||||
|
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||||
|
```bash
|
||||||
|
conda install -y -c conda-forge ffmpeg
|
||||||
|
pip uninstall -y opencv-python
|
||||||
|
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
7. Run a [system check](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#system-check) to make sure your robot is ready:
|
||||||
|
```bash
|
||||||
|
stretch_system_check.py
|
||||||
|
```
|
||||||
|
|
||||||
|
> **Note:** You may need to free the "robot process" after booting Stretch by running `stretch_free_robot_process.py`. For more info this Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#turning-off-gamepad-teleoperation).
|
||||||
|
|
||||||
|
You should get something like this:
|
||||||
|
```bash
|
||||||
|
For use with S T R E T C H (R) from Hello Robot Inc.
|
||||||
|
---------------------------------------------------------------------
|
||||||
|
|
||||||
|
Model = Stretch 3
|
||||||
|
Tool = DexWrist 3 w/ Gripper
|
||||||
|
Serial Number = stretch-se3-3054
|
||||||
|
|
||||||
|
---- Checking Hardware ----
|
||||||
|
[Pass] Comms are ready
|
||||||
|
[Pass] Actuators are ready
|
||||||
|
[Warn] Sensors not ready (IMU AZ = -10.19 out of range -10.1 to -9.5)
|
||||||
|
[Pass] Battery voltage is 13.6 V
|
||||||
|
|
||||||
|
---- Checking Software ----
|
||||||
|
[Pass] Ubuntu 22.04 is ready
|
||||||
|
[Pass] All APT pkgs are setup correctly
|
||||||
|
[Pass] Firmware is up-to-date
|
||||||
|
[Pass] Python pkgs are up-to-date
|
||||||
|
[Pass] ROS2 Humble is ready
|
||||||
|
```
|
||||||
|
|
||||||
|
## Teleoperate, record a dataset and run a policy
|
||||||
|
|
||||||
|
**Calibrate (Optional)**
|
||||||
|
Before operating Stretch, you need to [home](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#homing) it first. Be mindful about giving Stretch some space as this procedure will move the robot's arm and gripper. Now run this command:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/stretch.yaml
|
||||||
|
```
|
||||||
|
This is equivalent to running `stretch_robot_home.py`
|
||||||
|
|
||||||
|
> **Note:** If you run any of the LeRobot scripts below and Stretch is not poperly homed, it will automatically home/calibrate first.
|
||||||
|
|
||||||
|
**Teleoperate**
|
||||||
|
Before trying teleoperation, you need activate the gamepad controller by pressing the middle button. For more info, see Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/hello_robot/#gamepad-teleoperation).
|
||||||
|
|
||||||
|
Now try out teleoperation (see above documentation to learn about the gamepad controls):
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/stretch.yaml
|
||||||
|
```
|
||||||
|
This is essentially the same as running `stretch_gamepad_teleop.py`
|
||||||
|
|
||||||
|
**Record a dataset**
|
||||||
|
Once you're familiar with the gamepad controls and after a bit of practice, you can try to record your first dataset with Stretch.
|
||||||
|
|
||||||
|
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
|
```bash
|
||||||
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
|
```
|
||||||
|
|
||||||
|
Store your Hugging Face repository name in a variable to run these commands:
|
||||||
|
```bash
|
||||||
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
|
echo $HF_USER
|
||||||
|
```
|
||||||
|
|
||||||
|
Record one episode:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/stretch.yaml \
|
||||||
|
--fps 20 \
|
||||||
|
--repo-id ${HF_USER}/stretch_test \
|
||||||
|
--tags stretch tutorial \
|
||||||
|
--warmup-time-s 3 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 1 \
|
||||||
|
--push-to-hub 0
|
||||||
|
```
|
||||||
|
|
||||||
|
> **Note:** If you're using ssh to connect to Stretch and run this script, you won't be able to visualize its cameras feed (though they will still be recording). To see the cameras stream, use [tethered](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#tethered-setup) or [untethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#untethered-setup).
|
||||||
|
|
||||||
|
**Replay an episode**
|
||||||
|
Now try to replay this episode (make sure the robot's initial position is the same):
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/stretch.yaml \
|
||||||
|
--fps 20 \
|
||||||
|
--repo-id ${HF_USER}/stretch_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
|
||||||
|
Follow [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) to train a policy on your data and run inference on your robot. You will need to adapt the code for Stretch.
|
||||||
|
|
||||||
|
> TODO(rcadene, aliberts): Add already setup environment and policy yaml configuration files
|
||||||
|
|
||||||
|
If you need help, please reach out on Discord in the channel `#stretch3-mobile-arm`.
|
||||||
174
examples/9_use_aloha.md
Normal file
174
examples/9_use_aloha.md
Normal file
@@ -0,0 +1,174 @@
|
|||||||
|
This tutorial explains how to use [Aloha and Aloha 2 stationary](https://www.trossenrobotics.com/aloha-stationary) with LeRobot.
|
||||||
|
|
||||||
|
## Setup
|
||||||
|
|
||||||
|
Follow the [documentation from Trossen Robotics](https://docs.trossenrobotics.com/aloha_docs/getting_started/stationary/hardware_setup.html) for setting up the hardware and plugging the 4 arms and 4 cameras to your computer.
|
||||||
|
|
||||||
|
|
||||||
|
## Install LeRobot
|
||||||
|
|
||||||
|
On your computer:
|
||||||
|
|
||||||
|
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||||
|
```bash
|
||||||
|
mkdir -p ~/miniconda3
|
||||||
|
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||||
|
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||||
|
rm ~/miniconda3/miniconda.sh
|
||||||
|
~/miniconda3/bin/conda init bash
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Restart shell or `source ~/.bashrc`
|
||||||
|
|
||||||
|
3. Create and activate a fresh conda environment for lerobot
|
||||||
|
```bash
|
||||||
|
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
4. Clone LeRobot:
|
||||||
|
```bash
|
||||||
|
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
5. Install LeRobot with dependencies for the Aloha motors (dynamixel) and cameras (intelrealsense):
|
||||||
|
```bash
|
||||||
|
cd ~/lerobot && pip install -e ".[dynamixel, intelrealsense]"
|
||||||
|
```
|
||||||
|
|
||||||
|
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||||
|
```bash
|
||||||
|
conda install -y -c conda-forge ffmpeg
|
||||||
|
pip uninstall -y opencv-python
|
||||||
|
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
## Teleoperate
|
||||||
|
|
||||||
|
**/!\ FOR SAFETY, READ THIS /!\**
|
||||||
|
Teleoperation consists in manually operating the leader arms to move the follower arms. Importantly:
|
||||||
|
1. Make sure your leader arms are in the same position as the follower arms, so that the follower arms don't move too fast to match the leader arms,
|
||||||
|
2. Our code assumes that your robot has been assembled following Trossen Robotics instructions. This allows us to skip calibration, as we use the pre-defined calibration files in `.cache/calibration/aloha_default`. If you replace a motor, make sure you follow the exact instructions from Trossen Robotics.
|
||||||
|
|
||||||
|
By running the following code, you can start your first **SAFE** teleoperation:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=5
|
||||||
|
```
|
||||||
|
|
||||||
|
By adding `--robot-overrides max_relative_target=5`, we override the default value for `max_relative_target` defined in `lerobot/configs/robot/aloha.yaml`. It is expected to be `5` to limit the magnitude of the movement for more safety, but the teleoperation won't be smooth. When you feel confident, you can disable this limit by adding `--robot-overrides max_relative_target=null` to the command line:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=null
|
||||||
|
```
|
||||||
|
|
||||||
|
## Record a dataset
|
||||||
|
|
||||||
|
Once you're familiar with teleoperation, you can record your first dataset with Aloha.
|
||||||
|
|
||||||
|
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
|
```bash
|
||||||
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
|
```
|
||||||
|
|
||||||
|
Store your Hugging Face repository name in a variable to run these commands:
|
||||||
|
```bash
|
||||||
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
|
echo $HF_USER
|
||||||
|
```
|
||||||
|
|
||||||
|
Record 2 episodes and upload your dataset to the hub:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=null \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/aloha_test \
|
||||||
|
--tags aloha tutorial \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 2 \
|
||||||
|
--push-to-hub 1
|
||||||
|
```
|
||||||
|
|
||||||
|
## Visualize a dataset
|
||||||
|
|
||||||
|
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||||
|
```bash
|
||||||
|
echo ${HF_USER}/aloha_test
|
||||||
|
```
|
||||||
|
|
||||||
|
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/visualize_dataset_html.py \
|
||||||
|
--repo-id ${HF_USER}/aloha_test
|
||||||
|
```
|
||||||
|
|
||||||
|
## Replay an episode
|
||||||
|
|
||||||
|
**/!\ FOR SAFETY, READ THIS /!\**
|
||||||
|
Replay consists in automatically replaying the sequence of actions (i.e. goal positions for your motors) recorded in a given dataset episode. Make sure the current initial position of your robot is similar to the one in your episode, so that your follower arms don't move too fast to go to the first goal positions. For safety, you might want to add `--robot-overrides max_relative_target=5` to your command line as explained above.
|
||||||
|
|
||||||
|
Now try to replay the first episode on your robot:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=null \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/aloha_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
|
||||||
|
## Train a policy
|
||||||
|
|
||||||
|
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
dataset_repo_id=${HF_USER}/aloha_test \
|
||||||
|
policy=act_aloha_real \
|
||||||
|
env=aloha_real \
|
||||||
|
hydra.run.dir=outputs/train/act_aloha_test \
|
||||||
|
hydra.job.name=act_aloha_test \
|
||||||
|
device=cuda \
|
||||||
|
wandb.enable=true
|
||||||
|
```
|
||||||
|
|
||||||
|
Let's explain it:
|
||||||
|
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/aloha_test`.
|
||||||
|
2. We provided the policy with `policy=act_aloha_real`. This loads configurations from [`lerobot/configs/policy/act_aloha_real.yaml`](../lerobot/configs/policy/act_aloha_real.yaml). Importantly, this policy uses 4 cameras as input `cam_right_wrist`, `cam_left_wrist`, `cam_high`, and `cam_low`.
|
||||||
|
3. We provided an environment as argument with `env=aloha_real`. This loads configurations from [`lerobot/configs/env/aloha_real.yaml`](../lerobot/configs/env/aloha_real.yaml). Note: this yaml defines 18 dimensions for the `state_dim` and `action_dim`, corresponding to 18 motors, not 14 motors as used in previous Aloha work. This is because, we include the `shoulder_shadow` and `elbow_shadow` motors for simplicity.
|
||||||
|
4. We provided `device=cuda` since we are training on a Nvidia GPU.
|
||||||
|
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||||
|
|
||||||
|
Training should take several hours. You will find checkpoints in `outputs/train/act_aloha_test/checkpoints`.
|
||||||
|
|
||||||
|
## Evaluate your policy
|
||||||
|
|
||||||
|
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=null \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/eval_act_aloha_test \
|
||||||
|
--tags aloha tutorial eval \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 10 \
|
||||||
|
--num-image-writer-processes 1 \
|
||||||
|
-p outputs/train/act_aloha_test/checkpoints/last/pretrained_model
|
||||||
|
```
|
||||||
|
|
||||||
|
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||||
|
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_aloha_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_aloha_test`).
|
||||||
|
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_aloha_test`).
|
||||||
|
3. We use `--num-image-writer-processes 1` instead of the default value (`0`). On our computer, using a dedicated process to write images from the 4 cameras on disk allows to reach constent 30 fps during inference. Feel free to explore different values for `--num-image-writer-processes`.
|
||||||
|
|
||||||
|
## More
|
||||||
|
|
||||||
|
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth explaination.
|
||||||
|
|
||||||
|
If you have any question or need help, please reach out on Discord in the channel `#aloha-arm`.
|
||||||
@@ -14,7 +14,7 @@ from pathlib import Path
|
|||||||
import torch
|
import torch
|
||||||
from huggingface_hub import snapshot_download
|
from huggingface_hub import snapshot_download
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
|
||||||
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||||
|
|
||||||
device = torch.device("cuda")
|
device = torch.device("cuda")
|
||||||
@@ -41,26 +41,20 @@ delta_timestamps = {
|
|||||||
}
|
}
|
||||||
|
|
||||||
# Load the last 10% of episodes of the dataset as a validation set.
|
# Load the last 10% of episodes of the dataset as a validation set.
|
||||||
# - Load full dataset
|
# - Load dataset metadata
|
||||||
full_dataset = LeRobotDataset("lerobot/pusht", split="train")
|
dataset_metadata = LeRobotDatasetMetadata("lerobot/pusht")
|
||||||
# - Calculate train and val subsets
|
# - Calculate train and val episodes
|
||||||
num_train_episodes = math.floor(full_dataset.num_episodes * 90 / 100)
|
total_episodes = dataset_metadata.total_episodes
|
||||||
num_val_episodes = full_dataset.num_episodes - num_train_episodes
|
episodes = list(range(dataset_metadata.total_episodes))
|
||||||
print(f"Number of episodes in full dataset: {full_dataset.num_episodes}")
|
num_train_episodes = math.floor(total_episodes * 90 / 100)
|
||||||
print(f"Number of episodes in training dataset (90% subset): {num_train_episodes}")
|
train_episodes = episodes[:num_train_episodes]
|
||||||
print(f"Number of episodes in validation dataset (10% subset): {num_val_episodes}")
|
val_episodes = episodes[num_train_episodes:]
|
||||||
# - Get first frame index of the validation set
|
print(f"Number of episodes in full dataset: {total_episodes}")
|
||||||
first_val_frame_index = full_dataset.episode_data_index["from"][num_train_episodes].item()
|
print(f"Number of episodes in training dataset (90% subset): {len(train_episodes)}")
|
||||||
# - Load frames subset belonging to validation set using the `split` argument.
|
print(f"Number of episodes in validation dataset (10% subset): {len(val_episodes)}")
|
||||||
# It utilizes the `datasets` library's syntax for slicing datasets.
|
# - Load train an val datasets
|
||||||
# For more information on the Slice API, please see:
|
train_dataset = LeRobotDataset("lerobot/pusht", episodes=train_episodes, delta_timestamps=delta_timestamps)
|
||||||
# https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
|
val_dataset = LeRobotDataset("lerobot/pusht", episodes=val_episodes, delta_timestamps=delta_timestamps)
|
||||||
train_dataset = LeRobotDataset(
|
|
||||||
"lerobot/pusht", split=f"train[:{first_val_frame_index}]", delta_timestamps=delta_timestamps
|
|
||||||
)
|
|
||||||
val_dataset = LeRobotDataset(
|
|
||||||
"lerobot/pusht", split=f"train[{first_val_frame_index}:]", delta_timestamps=delta_timestamps
|
|
||||||
)
|
|
||||||
print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
|
print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
|
||||||
print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
|
print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
|
||||||
|
|
||||||
|
|||||||
222
examples/port_datasets/pusht_zarr.py
Normal file
222
examples/port_datasets/pusht_zarr.py
Normal file
@@ -0,0 +1,222 @@
|
|||||||
|
import shutil
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import torch
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LEROBOT_HOME, LeRobotDataset
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub._download_raw import download_raw
|
||||||
|
|
||||||
|
PUSHT_TASK = "Push the T-shaped blue block onto the T-shaped green target surface."
|
||||||
|
PUSHT_FEATURES = {
|
||||||
|
"observation.state": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (2,),
|
||||||
|
"names": {
|
||||||
|
"axes": ["x", "y"],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
"action": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (2,),
|
||||||
|
"names": {
|
||||||
|
"axes": ["x", "y"],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
"next.reward": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"next.success": {
|
||||||
|
"dtype": "bool",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"observation.environment_state": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (16,),
|
||||||
|
"names": [
|
||||||
|
"keypoints",
|
||||||
|
],
|
||||||
|
},
|
||||||
|
"observation.image": {
|
||||||
|
"dtype": None,
|
||||||
|
"shape": (3, 96, 96),
|
||||||
|
"names": [
|
||||||
|
"channel",
|
||||||
|
"height",
|
||||||
|
"width",
|
||||||
|
],
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def build_features(mode: str) -> dict:
|
||||||
|
features = PUSHT_FEATURES
|
||||||
|
if mode == "keypoints":
|
||||||
|
features.pop("observation.image")
|
||||||
|
else:
|
||||||
|
features.pop("observation.environment_state")
|
||||||
|
features["observation.image"]["dtype"] = mode
|
||||||
|
|
||||||
|
return features
|
||||||
|
|
||||||
|
|
||||||
|
def load_raw_dataset(zarr_path: Path):
|
||||||
|
try:
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub._diffusion_policy_replay_buffer import (
|
||||||
|
ReplayBuffer as DiffusionPolicyReplayBuffer,
|
||||||
|
)
|
||||||
|
except ModuleNotFoundError as e:
|
||||||
|
print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
|
||||||
|
raise e
|
||||||
|
|
||||||
|
zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
|
||||||
|
return zarr_data
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_coverage(zarr_data):
|
||||||
|
try:
|
||||||
|
import pymunk
|
||||||
|
from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
|
||||||
|
except ModuleNotFoundError as e:
|
||||||
|
print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
|
||||||
|
raise e
|
||||||
|
|
||||||
|
block_pos = zarr_data["state"][:, 2:4]
|
||||||
|
block_angle = zarr_data["state"][:, 4]
|
||||||
|
|
||||||
|
num_frames = len(block_pos)
|
||||||
|
|
||||||
|
coverage = np.zeros((num_frames,))
|
||||||
|
# 8 keypoints with 2 coords each
|
||||||
|
keypoints = np.zeros((num_frames, 16))
|
||||||
|
|
||||||
|
# Set x, y, theta (in radians)
|
||||||
|
goal_pos_angle = np.array([256, 256, np.pi / 4])
|
||||||
|
goal_body = PushTEnv.get_goal_pose_body(goal_pos_angle)
|
||||||
|
|
||||||
|
for i in range(num_frames):
|
||||||
|
space = pymunk.Space()
|
||||||
|
space.gravity = 0, 0
|
||||||
|
space.damping = 0
|
||||||
|
|
||||||
|
# Add walls.
|
||||||
|
walls = [
|
||||||
|
PushTEnv.add_segment(space, (5, 506), (5, 5), 2),
|
||||||
|
PushTEnv.add_segment(space, (5, 5), (506, 5), 2),
|
||||||
|
PushTEnv.add_segment(space, (506, 5), (506, 506), 2),
|
||||||
|
PushTEnv.add_segment(space, (5, 506), (506, 506), 2),
|
||||||
|
]
|
||||||
|
space.add(*walls)
|
||||||
|
|
||||||
|
block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
|
||||||
|
goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
|
||||||
|
block_geom = pymunk_to_shapely(block_body, block_body.shapes)
|
||||||
|
intersection_area = goal_geom.intersection(block_geom).area
|
||||||
|
goal_area = goal_geom.area
|
||||||
|
coverage[i] = intersection_area / goal_area
|
||||||
|
keypoints[i] = torch.from_numpy(PushTEnv.get_keypoints(block_shapes).flatten())
|
||||||
|
|
||||||
|
return coverage, keypoints
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_success(coverage: float, success_threshold: float):
|
||||||
|
return coverage > success_threshold
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_reward(coverage: float, success_threshold: float):
|
||||||
|
return np.clip(coverage / success_threshold, 0, 1)
|
||||||
|
|
||||||
|
|
||||||
|
def main(raw_dir: Path, repo_id: str, mode: str = "video", push_to_hub: bool = True):
|
||||||
|
if mode not in ["video", "image", "keypoints"]:
|
||||||
|
raise ValueError(mode)
|
||||||
|
|
||||||
|
if (LEROBOT_HOME / repo_id).exists():
|
||||||
|
shutil.rmtree(LEROBOT_HOME / repo_id)
|
||||||
|
|
||||||
|
if not raw_dir.exists():
|
||||||
|
download_raw(raw_dir, repo_id="lerobot-raw/pusht_raw")
|
||||||
|
|
||||||
|
zarr_data = load_raw_dataset(zarr_path=raw_dir / "pusht_cchi_v7_replay.zarr")
|
||||||
|
|
||||||
|
env_state = zarr_data["state"][:]
|
||||||
|
agent_pos = env_state[:, :2]
|
||||||
|
|
||||||
|
action = zarr_data["action"][:]
|
||||||
|
image = zarr_data["img"] # (b, h, w, c)
|
||||||
|
|
||||||
|
episode_data_index = {
|
||||||
|
"from": np.concatenate(([0], zarr_data.meta["episode_ends"][:-1])),
|
||||||
|
"to": zarr_data.meta["episode_ends"],
|
||||||
|
}
|
||||||
|
|
||||||
|
# Calculate success and reward based on the overlapping area
|
||||||
|
# of the T-object and the T-area.
|
||||||
|
coverage, keypoints = calculate_coverage(zarr_data)
|
||||||
|
success = calculate_success(coverage, success_threshold=0.95)
|
||||||
|
reward = calculate_reward(coverage, success_threshold=0.95)
|
||||||
|
|
||||||
|
features = build_features(mode)
|
||||||
|
dataset = LeRobotDataset.create(
|
||||||
|
repo_id=repo_id,
|
||||||
|
fps=10,
|
||||||
|
robot_type="2d pointer",
|
||||||
|
features=features,
|
||||||
|
image_writer_threads=4,
|
||||||
|
)
|
||||||
|
episodes = range(len(episode_data_index["from"]))
|
||||||
|
for ep_idx in episodes:
|
||||||
|
from_idx = episode_data_index["from"][ep_idx]
|
||||||
|
to_idx = episode_data_index["to"][ep_idx]
|
||||||
|
num_frames = to_idx - from_idx
|
||||||
|
|
||||||
|
for frame_idx in range(num_frames):
|
||||||
|
i = from_idx + frame_idx
|
||||||
|
frame = {
|
||||||
|
"action": torch.from_numpy(action[i]),
|
||||||
|
# Shift reward and success by +1 until the last item of the episode
|
||||||
|
"next.reward": reward[i + (frame_idx < num_frames - 1)],
|
||||||
|
"next.success": success[i + (frame_idx < num_frames - 1)],
|
||||||
|
}
|
||||||
|
|
||||||
|
frame["observation.state"] = torch.from_numpy(agent_pos[i])
|
||||||
|
|
||||||
|
if mode == "keypoints":
|
||||||
|
frame["observation.environment_state"] = torch.from_numpy(keypoints[i])
|
||||||
|
else:
|
||||||
|
frame["observation.image"] = torch.from_numpy(image[i])
|
||||||
|
|
||||||
|
dataset.add_frame(frame)
|
||||||
|
|
||||||
|
dataset.save_episode(task=PUSHT_TASK)
|
||||||
|
|
||||||
|
dataset.consolidate()
|
||||||
|
|
||||||
|
if push_to_hub:
|
||||||
|
dataset.push_to_hub()
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
# To try this script, modify the repo id with your own HuggingFace user (e.g cadene/pusht)
|
||||||
|
repo_id = "lerobot/pusht"
|
||||||
|
|
||||||
|
modes = ["video", "image", "keypoints"]
|
||||||
|
# Uncomment if you want to try with a specific mode
|
||||||
|
# modes = ["video"]
|
||||||
|
# modes = ["image"]
|
||||||
|
# modes = ["keypoints"]
|
||||||
|
|
||||||
|
raw_dir = Path("data/lerobot-raw/pusht_raw")
|
||||||
|
for mode in modes:
|
||||||
|
if mode in ["image", "keypoints"]:
|
||||||
|
repo_id += f"_{mode}"
|
||||||
|
|
||||||
|
# download and load raw dataset, create LeRobotDataset, populate it, push to hub
|
||||||
|
main(raw_dir, repo_id=repo_id, mode=mode)
|
||||||
|
|
||||||
|
# Uncomment if you want to load the local dataset and explore it
|
||||||
|
# dataset = LeRobotDataset(repo_id=repo_id, local_files_only=True)
|
||||||
|
# breakpoint()
|
||||||
@@ -27,6 +27,9 @@ Example:
|
|||||||
print(lerobot.available_real_world_datasets)
|
print(lerobot.available_real_world_datasets)
|
||||||
print(lerobot.available_policies)
|
print(lerobot.available_policies)
|
||||||
print(lerobot.available_policies_per_env)
|
print(lerobot.available_policies_per_env)
|
||||||
|
print(lerobot.available_robots)
|
||||||
|
print(lerobot.available_cameras)
|
||||||
|
print(lerobot.available_motors)
|
||||||
```
|
```
|
||||||
|
|
||||||
When implementing a new dataset loadable with LeRobotDataset follow these steps:
|
When implementing a new dataset loadable with LeRobotDataset follow these steps:
|
||||||
@@ -129,13 +132,60 @@ available_real_world_datasets = [
|
|||||||
"lerobot/unitreeh1_rearrange_objects",
|
"lerobot/unitreeh1_rearrange_objects",
|
||||||
"lerobot/unitreeh1_two_robot_greeting",
|
"lerobot/unitreeh1_two_robot_greeting",
|
||||||
"lerobot/unitreeh1_warehouse",
|
"lerobot/unitreeh1_warehouse",
|
||||||
|
"lerobot/nyu_rot_dataset",
|
||||||
|
"lerobot/utokyo_saytap",
|
||||||
|
"lerobot/imperialcollege_sawyer_wrist_cam",
|
||||||
|
"lerobot/utokyo_xarm_bimanual",
|
||||||
|
"lerobot/tokyo_u_lsmo",
|
||||||
|
"lerobot/utokyo_pr2_opening_fridge",
|
||||||
|
"lerobot/cmu_franka_exploration_dataset",
|
||||||
|
"lerobot/cmu_stretch",
|
||||||
|
"lerobot/asu_table_top",
|
||||||
|
"lerobot/utokyo_pr2_tabletop_manipulation",
|
||||||
|
"lerobot/utokyo_xarm_pick_and_place",
|
||||||
|
"lerobot/ucsd_kitchen_dataset",
|
||||||
|
"lerobot/austin_buds_dataset",
|
||||||
|
"lerobot/dlr_sara_grid_clamp",
|
||||||
|
"lerobot/conq_hose_manipulation",
|
||||||
|
"lerobot/columbia_cairlab_pusht_real",
|
||||||
|
"lerobot/dlr_sara_pour",
|
||||||
|
"lerobot/dlr_edan_shared_control",
|
||||||
|
"lerobot/ucsd_pick_and_place_dataset",
|
||||||
|
"lerobot/berkeley_cable_routing",
|
||||||
|
"lerobot/nyu_franka_play_dataset",
|
||||||
|
"lerobot/austin_sirius_dataset",
|
||||||
|
"lerobot/cmu_play_fusion",
|
||||||
|
"lerobot/berkeley_gnm_sac_son",
|
||||||
|
"lerobot/nyu_door_opening_surprising_effectiveness",
|
||||||
|
"lerobot/berkeley_fanuc_manipulation",
|
||||||
|
"lerobot/jaco_play",
|
||||||
|
"lerobot/viola",
|
||||||
|
"lerobot/kaist_nonprehensile",
|
||||||
|
"lerobot/berkeley_mvp",
|
||||||
|
"lerobot/uiuc_d3field",
|
||||||
|
"lerobot/berkeley_gnm_recon",
|
||||||
|
"lerobot/austin_sailor_dataset",
|
||||||
|
"lerobot/utaustin_mutex",
|
||||||
|
"lerobot/roboturk",
|
||||||
|
"lerobot/stanford_hydra_dataset",
|
||||||
|
"lerobot/berkeley_autolab_ur5",
|
||||||
|
"lerobot/stanford_robocook",
|
||||||
|
"lerobot/toto",
|
||||||
|
"lerobot/fmb",
|
||||||
|
"lerobot/droid_100",
|
||||||
|
"lerobot/berkeley_rpt",
|
||||||
|
"lerobot/stanford_kuka_multimodal_dataset",
|
||||||
|
"lerobot/iamlab_cmu_pickup_insert",
|
||||||
|
"lerobot/taco_play",
|
||||||
|
"lerobot/berkeley_gnm_cory_hall",
|
||||||
|
"lerobot/usc_cloth_sim",
|
||||||
]
|
]
|
||||||
|
|
||||||
available_datasets = list(
|
available_datasets = sorted(
|
||||||
itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets)
|
set(itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets))
|
||||||
)
|
)
|
||||||
|
|
||||||
# lists all available policies from `lerobot/common/policies` by their class attribute: `name`.
|
# lists all available policies from `lerobot/common/policies`
|
||||||
available_policies = [
|
available_policies = [
|
||||||
"act",
|
"act",
|
||||||
"diffusion",
|
"diffusion",
|
||||||
@@ -143,12 +193,35 @@ available_policies = [
|
|||||||
"vqbet",
|
"vqbet",
|
||||||
]
|
]
|
||||||
|
|
||||||
|
# lists all available robots from `lerobot/common/robot_devices/robots`
|
||||||
|
available_robots = [
|
||||||
|
"koch",
|
||||||
|
"koch_bimanual",
|
||||||
|
"aloha",
|
||||||
|
"so100",
|
||||||
|
"moss",
|
||||||
|
]
|
||||||
|
|
||||||
|
# lists all available cameras from `lerobot/common/robot_devices/cameras`
|
||||||
|
available_cameras = [
|
||||||
|
"opencv",
|
||||||
|
"intelrealsense",
|
||||||
|
]
|
||||||
|
|
||||||
|
# lists all available motors from `lerobot/common/robot_devices/motors`
|
||||||
|
available_motors = [
|
||||||
|
"dynamixel",
|
||||||
|
"feetech",
|
||||||
|
]
|
||||||
|
|
||||||
# keys and values refer to yaml files
|
# keys and values refer to yaml files
|
||||||
available_policies_per_env = {
|
available_policies_per_env = {
|
||||||
"aloha": ["act"],
|
"aloha": ["act"],
|
||||||
"pusht": ["diffusion", "vqbet"],
|
"pusht": ["diffusion", "vqbet"],
|
||||||
"xarm": ["tdmpc"],
|
"xarm": ["tdmpc"],
|
||||||
"dora_aloha_real": ["act_real"],
|
"koch_real": ["act_koch_real"],
|
||||||
|
"aloha_real": ["act_aloha_real"],
|
||||||
|
"dora_aloha_real": ["act_aloha_real"],
|
||||||
}
|
}
|
||||||
|
|
||||||
env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
|
env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
|
||||||
|
|||||||
27
lerobot/common/datasets/card_template.md
Normal file
27
lerobot/common/datasets/card_template.md
Normal file
@@ -0,0 +1,27 @@
|
|||||||
|
---
|
||||||
|
# For reference on dataset card metadata, see the spec: https://github.com/huggingface/hub-docs/blob/main/datasetcard.md?plain=1
|
||||||
|
# Doc / guide: https://huggingface.co/docs/hub/datasets-cards
|
||||||
|
{{ card_data }}
|
||||||
|
---
|
||||||
|
|
||||||
|
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
|
||||||
|
|
||||||
|
## Dataset Description
|
||||||
|
|
||||||
|
{{ dataset_description | default("", true) }}
|
||||||
|
|
||||||
|
- **Homepage:** {{ url | default("[More Information Needed]", true)}}
|
||||||
|
- **Paper:** {{ paper | default("[More Information Needed]", true)}}
|
||||||
|
- **License:** {{ license | default("[More Information Needed]", true)}}
|
||||||
|
|
||||||
|
## Dataset Structure
|
||||||
|
|
||||||
|
{{ dataset_structure | default("[More Information Needed]", true)}}
|
||||||
|
|
||||||
|
## Citation
|
||||||
|
|
||||||
|
**BibTeX:**
|
||||||
|
|
||||||
|
```bibtex
|
||||||
|
{{ citation_bibtex | default("[More Information Needed]", true)}}
|
||||||
|
```
|
||||||
@@ -19,9 +19,6 @@ from math import ceil
|
|||||||
import einops
|
import einops
|
||||||
import torch
|
import torch
|
||||||
import tqdm
|
import tqdm
|
||||||
from datasets import Image
|
|
||||||
|
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame
|
|
||||||
|
|
||||||
|
|
||||||
def get_stats_einops_patterns(dataset, num_workers=0):
|
def get_stats_einops_patterns(dataset, num_workers=0):
|
||||||
@@ -39,11 +36,13 @@ def get_stats_einops_patterns(dataset, num_workers=0):
|
|||||||
batch = next(iter(dataloader))
|
batch = next(iter(dataloader))
|
||||||
|
|
||||||
stats_patterns = {}
|
stats_patterns = {}
|
||||||
for key, feats_type in dataset.features.items():
|
|
||||||
|
for key in dataset.features:
|
||||||
# sanity check that tensors are not float64
|
# sanity check that tensors are not float64
|
||||||
assert batch[key].dtype != torch.float64
|
assert batch[key].dtype != torch.float64
|
||||||
|
|
||||||
if isinstance(feats_type, (VideoFrame, Image)):
|
# if isinstance(feats_type, (VideoFrame, Image)):
|
||||||
|
if key in dataset.meta.camera_keys:
|
||||||
# sanity check that images are channel first
|
# sanity check that images are channel first
|
||||||
_, c, h, w = batch[key].shape
|
_, c, h, w = batch[key].shape
|
||||||
assert c < h and c < w, f"expect channel first images, but instead {batch[key].shape}"
|
assert c < h and c < w, f"expect channel first images, but instead {batch[key].shape}"
|
||||||
@@ -59,12 +58,12 @@ def get_stats_einops_patterns(dataset, num_workers=0):
|
|||||||
elif batch[key].ndim == 1:
|
elif batch[key].ndim == 1:
|
||||||
stats_patterns[key] = "b -> 1"
|
stats_patterns[key] = "b -> 1"
|
||||||
else:
|
else:
|
||||||
raise ValueError(f"{key}, {feats_type}, {batch[key].shape}")
|
raise ValueError(f"{key}, {batch[key].shape}")
|
||||||
|
|
||||||
return stats_patterns
|
return stats_patterns
|
||||||
|
|
||||||
|
|
||||||
def compute_stats(dataset, batch_size=32, num_workers=16, max_num_samples=None):
|
def compute_stats(dataset, batch_size=8, num_workers=8, max_num_samples=None):
|
||||||
"""Compute mean/std and min/max statistics of all data keys in a LeRobotDataset."""
|
"""Compute mean/std and min/max statistics of all data keys in a LeRobotDataset."""
|
||||||
if max_num_samples is None:
|
if max_num_samples is None:
|
||||||
max_num_samples = len(dataset)
|
max_num_samples = len(dataset)
|
||||||
@@ -171,39 +170,45 @@ def aggregate_stats(ls_datasets) -> dict[str, torch.Tensor]:
|
|||||||
"""
|
"""
|
||||||
data_keys = set()
|
data_keys = set()
|
||||||
for dataset in ls_datasets:
|
for dataset in ls_datasets:
|
||||||
data_keys.update(dataset.stats.keys())
|
data_keys.update(dataset.meta.stats.keys())
|
||||||
stats = {k: {} for k in data_keys}
|
stats = {k: {} for k in data_keys}
|
||||||
for data_key in data_keys:
|
for data_key in data_keys:
|
||||||
for stat_key in ["min", "max"]:
|
for stat_key in ["min", "max"]:
|
||||||
# compute `max(dataset_0["max"], dataset_1["max"], ...)`
|
# compute `max(dataset_0["max"], dataset_1["max"], ...)`
|
||||||
stats[data_key][stat_key] = einops.reduce(
|
stats[data_key][stat_key] = einops.reduce(
|
||||||
torch.stack([d.stats[data_key][stat_key] for d in ls_datasets if data_key in d.stats], dim=0),
|
torch.stack(
|
||||||
|
[ds.meta.stats[data_key][stat_key] for ds in ls_datasets if data_key in ds.meta.stats],
|
||||||
|
dim=0,
|
||||||
|
),
|
||||||
"n ... -> ...",
|
"n ... -> ...",
|
||||||
stat_key,
|
stat_key,
|
||||||
)
|
)
|
||||||
total_samples = sum(d.num_samples for d in ls_datasets if data_key in d.stats)
|
total_samples = sum(d.num_frames for d in ls_datasets if data_key in d.meta.stats)
|
||||||
# Compute the "sum" statistic by multiplying each mean by the number of samples in the respective
|
# Compute the "sum" statistic by multiplying each mean by the number of samples in the respective
|
||||||
# dataset, then divide by total_samples to get the overall "mean".
|
# dataset, then divide by total_samples to get the overall "mean".
|
||||||
# NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
|
# NOTE: the brackets around (d.num_frames / total_samples) are needed tor minimize the risk of
|
||||||
# numerical overflow!
|
# numerical overflow!
|
||||||
stats[data_key]["mean"] = sum(
|
stats[data_key]["mean"] = sum(
|
||||||
d.stats[data_key]["mean"] * (d.num_samples / total_samples)
|
d.meta.stats[data_key]["mean"] * (d.num_frames / total_samples)
|
||||||
for d in ls_datasets
|
for d in ls_datasets
|
||||||
if data_key in d.stats
|
if data_key in d.meta.stats
|
||||||
)
|
)
|
||||||
# The derivation for standard deviation is a little more involved but is much in the same spirit as
|
# The derivation for standard deviation is a little more involved but is much in the same spirit as
|
||||||
# the computation of the mean.
|
# the computation of the mean.
|
||||||
# Given two sets of data where the statistics are known:
|
# Given two sets of data where the statistics are known:
|
||||||
# σ_combined = sqrt[ (n1 * (σ1^2 + d1^2) + n2 * (σ2^2 + d2^2)) / (n1 + n2) ]
|
# σ_combined = sqrt[ (n1 * (σ1^2 + d1^2) + n2 * (σ2^2 + d2^2)) / (n1 + n2) ]
|
||||||
# where d1 = μ1 - μ_combined, d2 = μ2 - μ_combined
|
# where d1 = μ1 - μ_combined, d2 = μ2 - μ_combined
|
||||||
# NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
|
# NOTE: the brackets around (d.num_frames / total_samples) are needed tor minimize the risk of
|
||||||
# numerical overflow!
|
# numerical overflow!
|
||||||
stats[data_key]["std"] = torch.sqrt(
|
stats[data_key]["std"] = torch.sqrt(
|
||||||
sum(
|
sum(
|
||||||
(d.stats[data_key]["std"] ** 2 + (d.stats[data_key]["mean"] - stats[data_key]["mean"]) ** 2)
|
(
|
||||||
* (d.num_samples / total_samples)
|
d.meta.stats[data_key]["std"] ** 2
|
||||||
|
+ (d.meta.stats[data_key]["mean"] - stats[data_key]["mean"]) ** 2
|
||||||
|
)
|
||||||
|
* (d.num_frames / total_samples)
|
||||||
for d in ls_datasets
|
for d in ls_datasets
|
||||||
if data_key in d.stats
|
if data_key in d.meta.stats
|
||||||
)
|
)
|
||||||
)
|
)
|
||||||
return stats
|
return stats
|
||||||
|
|||||||
@@ -91,9 +91,9 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
|
|||||||
)
|
)
|
||||||
|
|
||||||
if isinstance(cfg.dataset_repo_id, str):
|
if isinstance(cfg.dataset_repo_id, str):
|
||||||
|
# TODO (aliberts): add 'episodes' arg from config after removing hydra
|
||||||
dataset = LeRobotDataset(
|
dataset = LeRobotDataset(
|
||||||
cfg.dataset_repo_id,
|
cfg.dataset_repo_id,
|
||||||
split=split,
|
|
||||||
delta_timestamps=cfg.training.get("delta_timestamps"),
|
delta_timestamps=cfg.training.get("delta_timestamps"),
|
||||||
image_transforms=image_transforms,
|
image_transforms=image_transforms,
|
||||||
video_backend=cfg.video_backend,
|
video_backend=cfg.video_backend,
|
||||||
@@ -101,7 +101,6 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
|
|||||||
else:
|
else:
|
||||||
dataset = MultiLeRobotDataset(
|
dataset = MultiLeRobotDataset(
|
||||||
cfg.dataset_repo_id,
|
cfg.dataset_repo_id,
|
||||||
split=split,
|
|
||||||
delta_timestamps=cfg.training.get("delta_timestamps"),
|
delta_timestamps=cfg.training.get("delta_timestamps"),
|
||||||
image_transforms=image_transforms,
|
image_transforms=image_transforms,
|
||||||
video_backend=cfg.video_backend,
|
video_backend=cfg.video_backend,
|
||||||
@@ -112,6 +111,6 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
|
|||||||
for stats_type, listconfig in stats_dict.items():
|
for stats_type, listconfig in stats_dict.items():
|
||||||
# example of stats_type: min, max, mean, std
|
# example of stats_type: min, max, mean, std
|
||||||
stats = OmegaConf.to_container(listconfig, resolve=True)
|
stats = OmegaConf.to_container(listconfig, resolve=True)
|
||||||
dataset.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
|
dataset.meta.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
|
||||||
|
|
||||||
return dataset
|
return dataset
|
||||||
|
|||||||
160
lerobot/common/datasets/image_writer.py
Normal file
160
lerobot/common/datasets/image_writer.py
Normal file
@@ -0,0 +1,160 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
import multiprocessing
|
||||||
|
import queue
|
||||||
|
import threading
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import PIL.Image
|
||||||
|
import torch
|
||||||
|
|
||||||
|
|
||||||
|
def safe_stop_image_writer(func):
|
||||||
|
def wrapper(*args, **kwargs):
|
||||||
|
try:
|
||||||
|
return func(*args, **kwargs)
|
||||||
|
except Exception as e:
|
||||||
|
dataset = kwargs.get("dataset")
|
||||||
|
image_writer = getattr(dataset, "image_writer", None) if dataset else None
|
||||||
|
if image_writer is not None:
|
||||||
|
print("Waiting for image writer to terminate...")
|
||||||
|
image_writer.stop()
|
||||||
|
raise e
|
||||||
|
|
||||||
|
return wrapper
|
||||||
|
|
||||||
|
|
||||||
|
def image_array_to_image(image_array: np.ndarray) -> PIL.Image.Image:
|
||||||
|
# TODO(aliberts): handle 1 channel and 4 for depth images
|
||||||
|
if image_array.ndim == 3 and image_array.shape[0] in [1, 3]:
|
||||||
|
# Transpose from pytorch convention (C, H, W) to (H, W, C)
|
||||||
|
image_array = image_array.transpose(1, 2, 0)
|
||||||
|
if image_array.dtype != np.uint8:
|
||||||
|
# Assume the image is in [0, 1] range for floating-point data
|
||||||
|
image_array = np.clip(image_array, 0, 1)
|
||||||
|
image_array = (image_array * 255).astype(np.uint8)
|
||||||
|
return PIL.Image.fromarray(image_array)
|
||||||
|
|
||||||
|
|
||||||
|
def write_image(image: np.ndarray | PIL.Image.Image, fpath: Path):
|
||||||
|
try:
|
||||||
|
if isinstance(image, np.ndarray):
|
||||||
|
img = image_array_to_image(image)
|
||||||
|
elif isinstance(image, PIL.Image.Image):
|
||||||
|
img = image
|
||||||
|
else:
|
||||||
|
raise TypeError(f"Unsupported image type: {type(image)}")
|
||||||
|
img.save(fpath)
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error writing image {fpath}: {e}")
|
||||||
|
|
||||||
|
|
||||||
|
def worker_thread_loop(queue: queue.Queue):
|
||||||
|
while True:
|
||||||
|
item = queue.get()
|
||||||
|
if item is None:
|
||||||
|
queue.task_done()
|
||||||
|
break
|
||||||
|
image_array, fpath = item
|
||||||
|
write_image(image_array, fpath)
|
||||||
|
queue.task_done()
|
||||||
|
|
||||||
|
|
||||||
|
def worker_process(queue: queue.Queue, num_threads: int):
|
||||||
|
threads = []
|
||||||
|
for _ in range(num_threads):
|
||||||
|
t = threading.Thread(target=worker_thread_loop, args=(queue,))
|
||||||
|
t.daemon = True
|
||||||
|
t.start()
|
||||||
|
threads.append(t)
|
||||||
|
for t in threads:
|
||||||
|
t.join()
|
||||||
|
|
||||||
|
|
||||||
|
class AsyncImageWriter:
|
||||||
|
"""
|
||||||
|
This class abstract away the initialisation of processes or/and threads to
|
||||||
|
save images on disk asynchrounously, which is critical to control a robot and record data
|
||||||
|
at a high frame rate.
|
||||||
|
|
||||||
|
When `num_processes=0`, it creates a threads pool of size `num_threads`.
|
||||||
|
When `num_processes>0`, it creates processes pool of size `num_processes`, where each subprocess starts
|
||||||
|
their own threads pool of size `num_threads`.
|
||||||
|
|
||||||
|
The optimal number of processes and threads depends on your computer capabilities.
|
||||||
|
We advise to use 4 threads per camera with 0 processes. If the fps is not stable, try to increase or lower
|
||||||
|
the number of threads. If it is still not stable, try to use 1 subprocess, or more.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, num_processes: int = 0, num_threads: int = 1):
|
||||||
|
self.num_processes = num_processes
|
||||||
|
self.num_threads = num_threads
|
||||||
|
self.queue = None
|
||||||
|
self.threads = []
|
||||||
|
self.processes = []
|
||||||
|
self._stopped = False
|
||||||
|
|
||||||
|
if num_threads <= 0 and num_processes <= 0:
|
||||||
|
raise ValueError("Number of threads and processes must be greater than zero.")
|
||||||
|
|
||||||
|
if self.num_processes == 0:
|
||||||
|
# Use threading
|
||||||
|
self.queue = queue.Queue()
|
||||||
|
for _ in range(self.num_threads):
|
||||||
|
t = threading.Thread(target=worker_thread_loop, args=(self.queue,))
|
||||||
|
t.daemon = True
|
||||||
|
t.start()
|
||||||
|
self.threads.append(t)
|
||||||
|
else:
|
||||||
|
# Use multiprocessing
|
||||||
|
self.queue = multiprocessing.JoinableQueue()
|
||||||
|
for _ in range(self.num_processes):
|
||||||
|
p = multiprocessing.Process(target=worker_process, args=(self.queue, self.num_threads))
|
||||||
|
p.daemon = True
|
||||||
|
p.start()
|
||||||
|
self.processes.append(p)
|
||||||
|
|
||||||
|
def save_image(self, image: torch.Tensor | np.ndarray | PIL.Image.Image, fpath: Path):
|
||||||
|
if isinstance(image, torch.Tensor):
|
||||||
|
# Convert tensor to numpy array to minimize main process time
|
||||||
|
image = image.cpu().numpy()
|
||||||
|
self.queue.put((image, fpath))
|
||||||
|
|
||||||
|
def wait_until_done(self):
|
||||||
|
self.queue.join()
|
||||||
|
|
||||||
|
def stop(self):
|
||||||
|
if self._stopped:
|
||||||
|
return
|
||||||
|
|
||||||
|
if self.num_processes == 0:
|
||||||
|
for _ in self.threads:
|
||||||
|
self.queue.put(None)
|
||||||
|
for t in self.threads:
|
||||||
|
t.join()
|
||||||
|
else:
|
||||||
|
num_nones = self.num_processes * self.num_threads
|
||||||
|
for _ in range(num_nones):
|
||||||
|
self.queue.put(None)
|
||||||
|
for p in self.processes:
|
||||||
|
p.join()
|
||||||
|
if p.is_alive():
|
||||||
|
p.terminate()
|
||||||
|
self.queue.close()
|
||||||
|
self.queue.join_thread()
|
||||||
|
|
||||||
|
self._stopped = True
|
||||||
File diff suppressed because it is too large
Load Diff
@@ -187,7 +187,7 @@ class OnlineBuffer(torch.utils.data.Dataset):
|
|||||||
assert data[OnlineBuffer.INDEX_KEY][0].item() == 0
|
assert data[OnlineBuffer.INDEX_KEY][0].item() == 0
|
||||||
|
|
||||||
# Shift the incoming indices if necessary.
|
# Shift the incoming indices if necessary.
|
||||||
if self.num_samples > 0:
|
if self.num_frames > 0:
|
||||||
last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][next_index - 1]
|
last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][next_index - 1]
|
||||||
last_data_index = self._data[OnlineBuffer.INDEX_KEY][next_index - 1]
|
last_data_index = self._data[OnlineBuffer.INDEX_KEY][next_index - 1]
|
||||||
data[OnlineBuffer.EPISODE_INDEX_KEY] += last_episode_index + 1
|
data[OnlineBuffer.EPISODE_INDEX_KEY] += last_episode_index + 1
|
||||||
@@ -227,11 +227,11 @@ class OnlineBuffer(torch.utils.data.Dataset):
|
|||||||
)
|
)
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def num_samples(self) -> int:
|
def num_frames(self) -> int:
|
||||||
return np.count_nonzero(self._data[OnlineBuffer.OCCUPANCY_MASK_KEY])
|
return np.count_nonzero(self._data[OnlineBuffer.OCCUPANCY_MASK_KEY])
|
||||||
|
|
||||||
def __len__(self):
|
def __len__(self):
|
||||||
return self.num_samples
|
return self.num_frames
|
||||||
|
|
||||||
def _item_to_tensors(self, item: dict) -> dict:
|
def _item_to_tensors(self, item: dict) -> dict:
|
||||||
item_ = {}
|
item_ = {}
|
||||||
|
|||||||
@@ -60,8 +60,8 @@ AVAILABLE_RAW_REPO_IDS = {
|
|||||||
"lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
|
"lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
|
"lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
|
"lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/pusht_raw": "pusht_zarr",
|
|
||||||
"lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
|
"lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
|
||||||
|
"lerobot-raw/pusht_raw": "pusht_zarr",
|
||||||
"lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
|
"lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
|
"lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
|
"lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
|
||||||
@@ -70,6 +70,74 @@ AVAILABLE_RAW_REPO_IDS = {
|
|||||||
"lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
|
"lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
|
||||||
"lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
|
"lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
|
||||||
"lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
|
"lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
|
||||||
|
"lerobot-raw/fractal20220817_data_raw": "openx_rlds.fractal20220817_data",
|
||||||
|
"lerobot-raw/kuka_raw": "openx_rlds.kuka",
|
||||||
|
"lerobot-raw/bridge_openx_raw": "openx_rlds.bridge_openx",
|
||||||
|
"lerobot-raw/taco_play_raw": "openx_rlds.taco_play",
|
||||||
|
"lerobot-raw/jaco_play_raw": "openx_rlds.jaco_play",
|
||||||
|
"lerobot-raw/berkeley_cable_routing_raw": "openx_rlds.berkeley_cable_routing",
|
||||||
|
"lerobot-raw/roboturk_raw": "openx_rlds.roboturk",
|
||||||
|
"lerobot-raw/nyu_door_opening_surprising_effectiveness_raw": "openx_rlds.nyu_door_opening_surprising_effectiveness",
|
||||||
|
"lerobot-raw/viola_raw": "openx_rlds.viola",
|
||||||
|
"lerobot-raw/berkeley_autolab_ur5_raw": "openx_rlds.berkeley_autolab_ur5",
|
||||||
|
"lerobot-raw/toto_raw": "openx_rlds.toto",
|
||||||
|
"lerobot-raw/language_table_raw": "openx_rlds.language_table",
|
||||||
|
"lerobot-raw/columbia_cairlab_pusht_real_raw": "openx_rlds.columbia_cairlab_pusht_real",
|
||||||
|
"lerobot-raw/stanford_kuka_multimodal_dataset_raw": "openx_rlds.stanford_kuka_multimodal_dataset",
|
||||||
|
"lerobot-raw/nyu_rot_dataset_raw": "openx_rlds.nyu_rot_dataset",
|
||||||
|
"lerobot-raw/io_ai_tech_raw": "openx_rlds.io_ai_tech",
|
||||||
|
"lerobot-raw/stanford_hydra_dataset_raw": "openx_rlds.stanford_hydra_dataset",
|
||||||
|
"lerobot-raw/austin_buds_dataset_raw": "openx_rlds.austin_buds_dataset",
|
||||||
|
"lerobot-raw/nyu_franka_play_dataset_raw": "openx_rlds.nyu_franka_play_dataset",
|
||||||
|
"lerobot-raw/maniskill_dataset_raw": "openx_rlds.maniskill_dataset",
|
||||||
|
"lerobot-raw/furniture_bench_dataset_raw": "openx_rlds.furniture_bench_dataset",
|
||||||
|
"lerobot-raw/cmu_franka_exploration_dataset_raw": "openx_rlds.cmu_franka_exploration_dataset",
|
||||||
|
"lerobot-raw/ucsd_kitchen_dataset_raw": "openx_rlds.ucsd_kitchen_dataset",
|
||||||
|
"lerobot-raw/ucsd_pick_and_place_dataset_raw": "openx_rlds.ucsd_pick_and_place_dataset",
|
||||||
|
"lerobot-raw/spoc_raw": "openx_rlds.spoc",
|
||||||
|
"lerobot-raw/austin_sailor_dataset_raw": "openx_rlds.austin_sailor_dataset",
|
||||||
|
"lerobot-raw/austin_sirius_dataset_raw": "openx_rlds.austin_sirius_dataset",
|
||||||
|
"lerobot-raw/bc_z_raw": "openx_rlds.bc_z",
|
||||||
|
"lerobot-raw/utokyo_pr2_opening_fridge_raw": "openx_rlds.utokyo_pr2_opening_fridge",
|
||||||
|
"lerobot-raw/utokyo_pr2_tabletop_manipulation_raw": "openx_rlds.utokyo_pr2_tabletop_manipulation",
|
||||||
|
"lerobot-raw/utokyo_xarm_pick_and_place_raw": "openx_rlds.utokyo_xarm_pick_and_place",
|
||||||
|
"lerobot-raw/utokyo_xarm_bimanual_raw": "openx_rlds.utokyo_xarm_bimanual",
|
||||||
|
"lerobot-raw/utokyo_saytap_raw": "openx_rlds.utokyo_saytap",
|
||||||
|
"lerobot-raw/robo_net_raw": "openx_rlds.robo_net",
|
||||||
|
"lerobot-raw/robo_set_raw": "openx_rlds.robo_set",
|
||||||
|
"lerobot-raw/berkeley_mvp_raw": "openx_rlds.berkeley_mvp",
|
||||||
|
"lerobot-raw/berkeley_rpt_raw": "openx_rlds.berkeley_rpt",
|
||||||
|
"lerobot-raw/kaist_nonprehensile_raw": "openx_rlds.kaist_nonprehensile",
|
||||||
|
"lerobot-raw/stanford_mask_vit_raw": "openx_rlds.stanford_mask_vit",
|
||||||
|
"lerobot-raw/tokyo_u_lsmo_raw": "openx_rlds.tokyo_u_lsmo",
|
||||||
|
"lerobot-raw/dlr_sara_pour_raw": "openx_rlds.dlr_sara_pour",
|
||||||
|
"lerobot-raw/dlr_sara_grid_clamp_raw": "openx_rlds.dlr_sara_grid_clamp",
|
||||||
|
"lerobot-raw/dlr_edan_shared_control_raw": "openx_rlds.dlr_edan_shared_control",
|
||||||
|
"lerobot-raw/asu_table_top_raw": "openx_rlds.asu_table_top",
|
||||||
|
"lerobot-raw/stanford_robocook_raw": "openx_rlds.stanford_robocook",
|
||||||
|
"lerobot-raw/imperialcollege_sawyer_wrist_cam_raw": "openx_rlds.imperialcollege_sawyer_wrist_cam",
|
||||||
|
"lerobot-raw/iamlab_cmu_pickup_insert_raw": "openx_rlds.iamlab_cmu_pickup_insert",
|
||||||
|
"lerobot-raw/uiuc_d3field_raw": "openx_rlds.uiuc_d3field",
|
||||||
|
"lerobot-raw/utaustin_mutex_raw": "openx_rlds.utaustin_mutex",
|
||||||
|
"lerobot-raw/berkeley_fanuc_manipulation_raw": "openx_rlds.berkeley_fanuc_manipulation",
|
||||||
|
"lerobot-raw/cmu_playing_with_food_raw": "openx_rlds.cmu_playing_with_food",
|
||||||
|
"lerobot-raw/cmu_play_fusion_raw": "openx_rlds.cmu_play_fusion",
|
||||||
|
"lerobot-raw/cmu_stretch_raw": "openx_rlds.cmu_stretch",
|
||||||
|
"lerobot-raw/berkeley_gnm_recon_raw": "openx_rlds.berkeley_gnm_recon",
|
||||||
|
"lerobot-raw/berkeley_gnm_cory_hall_raw": "openx_rlds.berkeley_gnm_cory_hall",
|
||||||
|
"lerobot-raw/berkeley_gnm_sac_son_raw": "openx_rlds.berkeley_gnm_sac_son",
|
||||||
|
"lerobot-raw/droid_raw": "openx_rlds.droid",
|
||||||
|
"lerobot-raw/droid_100_raw": "openx_rlds.droid100",
|
||||||
|
"lerobot-raw/fmb_raw": "openx_rlds.fmb",
|
||||||
|
"lerobot-raw/dobbe_raw": "openx_rlds.dobbe",
|
||||||
|
"lerobot-raw/usc_cloth_sim_raw": "openx_rlds.usc_cloth_sim",
|
||||||
|
"lerobot-raw/plex_robosuite_raw": "openx_rlds.plex_robosuite",
|
||||||
|
"lerobot-raw/conq_hose_manipulation_raw": "openx_rlds.conq_hose_manipulation",
|
||||||
|
"lerobot-raw/vima_raw": "openx_rlds.vima",
|
||||||
|
"lerobot-raw/robot_vqa_raw": "openx_rlds.robot_vqa",
|
||||||
|
"lerobot-raw/mimic_play_raw": "openx_rlds.mimic_play",
|
||||||
|
"lerobot-raw/tidybot_raw": "openx_rlds.tidybot",
|
||||||
|
"lerobot-raw/eth_agent_affordances_raw": "openx_rlds.eth_agent_affordances",
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -110,7 +178,7 @@ def download_all_raw_datasets(data_dir: Path | None = None):
|
|||||||
def main():
|
def main():
|
||||||
parser = argparse.ArgumentParser(
|
parser = argparse.ArgumentParser(
|
||||||
description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
|
description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
|
||||||
non exhaustive list of available repositories to use in `--repo-id`: {AVAILABLE_RAW_REPO_IDS}""",
|
non exhaustive list of available repositories to use in `--repo-id`: {list(AVAILABLE_RAW_REPO_IDS.keys())}""",
|
||||||
)
|
)
|
||||||
|
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
|
|||||||
@@ -30,12 +30,12 @@ from PIL import Image as PILImage
|
|||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
concatenate_episodes,
|
concatenate_episodes,
|
||||||
get_default_encoding,
|
get_default_encoding,
|
||||||
save_images_concurrently,
|
save_images_concurrently,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|||||||
@@ -24,8 +24,11 @@ from datasets import Dataset, Features, Image, Value
|
|||||||
from PIL import Image as PILImage
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
from lerobot.common.datasets.utils import calculate_episode_data_index, hf_transform_to_torch
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.utils import hf_transform_to_torch
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame
|
from lerobot.common.datasets.video_utils import VideoFrame
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
@@ -26,8 +26,8 @@ import torch
|
|||||||
from datasets import Dataset, Features, Image, Sequence, Value
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import calculate_episode_data_index
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame
|
from lerobot.common.datasets.video_utils import VideoFrame
|
||||||
|
|||||||
312
lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py
Normal file
312
lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py
Normal file
@@ -0,0 +1,312 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""
|
||||||
|
For all datasets in the RLDS format.
|
||||||
|
For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets.
|
||||||
|
|
||||||
|
NOTE: You need to install tensorflow and tensorflow_datsets before running this script.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
python lerobot/scripts/push_dataset_to_hub.py \
|
||||||
|
--raw-dir /path/to/data/bridge_dataset/1.0.0/ \
|
||||||
|
--repo-id your_hub/sampled_bridge_data_v2 \
|
||||||
|
--raw-format rlds \
|
||||||
|
--episodes 3 4 5 8 9
|
||||||
|
|
||||||
|
Exact dataset fps defined in openx/config.py, obtained from:
|
||||||
|
https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R
|
||||||
|
"""
|
||||||
|
|
||||||
|
import shutil
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import tensorflow as tf
|
||||||
|
import tensorflow_datasets as tfds
|
||||||
|
import torch
|
||||||
|
import tqdm
|
||||||
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
get_default_encoding,
|
||||||
|
save_images_concurrently,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.utils import (
|
||||||
|
hf_transform_to_torch,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|
||||||
|
np.set_printoptions(precision=2)
|
||||||
|
|
||||||
|
|
||||||
|
def tf_to_torch(data):
|
||||||
|
return torch.from_numpy(data.numpy())
|
||||||
|
|
||||||
|
|
||||||
|
def tf_img_convert(img):
|
||||||
|
if img.dtype == tf.string:
|
||||||
|
img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8)
|
||||||
|
elif img.dtype != tf.uint8:
|
||||||
|
raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}")
|
||||||
|
return img.numpy()
|
||||||
|
|
||||||
|
|
||||||
|
def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict:
|
||||||
|
"""
|
||||||
|
In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps"
|
||||||
|
entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the
|
||||||
|
trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`.
|
||||||
|
|
||||||
|
NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/
|
||||||
|
"""
|
||||||
|
steps = traj.pop("steps")
|
||||||
|
|
||||||
|
traj_len = tf.shape(tf.nest.flatten(steps)[0])[0]
|
||||||
|
|
||||||
|
# broadcast metadata to the length of the trajectory
|
||||||
|
metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj)
|
||||||
|
|
||||||
|
# put steps back in
|
||||||
|
assert "traj_metadata" not in steps
|
||||||
|
traj = {**steps, "traj_metadata": metadata}
|
||||||
|
|
||||||
|
assert "_len" not in traj
|
||||||
|
assert "_traj_index" not in traj
|
||||||
|
assert "_frame_index" not in traj
|
||||||
|
traj["_len"] = tf.repeat(traj_len, traj_len)
|
||||||
|
traj["_traj_index"] = tf.repeat(i, traj_len)
|
||||||
|
traj["_frame_index"] = tf.range(traj_len)
|
||||||
|
|
||||||
|
return traj
|
||||||
|
|
||||||
|
|
||||||
|
def load_from_raw(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int,
|
||||||
|
video: bool,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
raw_dir (Path): _description_
|
||||||
|
videos_dir (Path): _description_
|
||||||
|
fps (int): _description_
|
||||||
|
video (bool): _description_
|
||||||
|
episodes (list[int] | None, optional): _description_. Defaults to None.
|
||||||
|
"""
|
||||||
|
ds_builder = tfds.builder_from_directory(str(raw_dir))
|
||||||
|
dataset = ds_builder.as_dataset(
|
||||||
|
split="all",
|
||||||
|
decoders={"steps": tfds.decode.SkipDecoding()},
|
||||||
|
)
|
||||||
|
|
||||||
|
dataset_info = ds_builder.info
|
||||||
|
print("dataset_info: ", dataset_info)
|
||||||
|
|
||||||
|
ds_length = len(dataset)
|
||||||
|
dataset = dataset.take(ds_length)
|
||||||
|
# "flatten" the dataset as such we can apply trajectory level map() easily
|
||||||
|
# each [obs][key] has a shape of (frame_size, ...)
|
||||||
|
dataset = dataset.enumerate().map(_broadcast_metadata_rlds)
|
||||||
|
|
||||||
|
# we will apply the standardization transform if the dataset_name is provided
|
||||||
|
# if the dataset name is not provided and the goal is to convert any rlds formatted dataset
|
||||||
|
# search for 'image' keys in the observations
|
||||||
|
image_keys = []
|
||||||
|
state_keys = []
|
||||||
|
observation_info = dataset_info.features["steps"]["observation"]
|
||||||
|
for key in observation_info:
|
||||||
|
# check whether the key is for an image or a vector observation
|
||||||
|
if len(observation_info[key].shape) == 3:
|
||||||
|
# only adding uint8 images discards depth images
|
||||||
|
if observation_info[key].dtype == tf.uint8:
|
||||||
|
image_keys.append(key)
|
||||||
|
else:
|
||||||
|
state_keys.append(key)
|
||||||
|
|
||||||
|
lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None
|
||||||
|
|
||||||
|
print(" - image_keys: ", image_keys)
|
||||||
|
print(" - lang_key: ", lang_key)
|
||||||
|
|
||||||
|
it = iter(dataset)
|
||||||
|
|
||||||
|
ep_dicts = []
|
||||||
|
# Init temp path to save ep_dicts in case of crash
|
||||||
|
tmp_ep_dicts_dir = videos_dir.parent.joinpath("ep_dicts")
|
||||||
|
tmp_ep_dicts_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
# check if ep_dicts have already been saved in /tmp
|
||||||
|
starting_ep_idx = 0
|
||||||
|
saved_ep_dicts = [ep.__str__() for ep in tmp_ep_dicts_dir.iterdir()]
|
||||||
|
if len(saved_ep_dicts) > 0:
|
||||||
|
saved_ep_dicts.sort()
|
||||||
|
# get last ep_idx number
|
||||||
|
starting_ep_idx = int(saved_ep_dicts[-1][-13:-3]) + 1
|
||||||
|
for i in range(starting_ep_idx):
|
||||||
|
episode = next(it)
|
||||||
|
ep_dicts.append(torch.load(saved_ep_dicts[i]))
|
||||||
|
|
||||||
|
# if we user specified episodes, skip the ones not in the list
|
||||||
|
if episodes is not None:
|
||||||
|
if ds_length == 0:
|
||||||
|
raise ValueError("No episodes found.")
|
||||||
|
# convert episodes index to sorted list
|
||||||
|
episodes = sorted(episodes)
|
||||||
|
|
||||||
|
for ep_idx in tqdm.tqdm(range(starting_ep_idx, ds_length)):
|
||||||
|
episode = next(it)
|
||||||
|
|
||||||
|
# if user specified episodes, skip the ones not in the list
|
||||||
|
if episodes is not None:
|
||||||
|
if len(episodes) == 0:
|
||||||
|
break
|
||||||
|
if ep_idx == episodes[0]:
|
||||||
|
# process this episode
|
||||||
|
print(" selecting episode idx: ", ep_idx)
|
||||||
|
episodes.pop(0)
|
||||||
|
else:
|
||||||
|
continue # skip
|
||||||
|
|
||||||
|
num_frames = episode["action"].shape[0]
|
||||||
|
|
||||||
|
ep_dict = {}
|
||||||
|
for key in state_keys:
|
||||||
|
ep_dict[f"observation.{key}"] = tf_to_torch(episode["observation"][key])
|
||||||
|
|
||||||
|
ep_dict["action"] = tf_to_torch(episode["action"])
|
||||||
|
ep_dict["next.reward"] = tf_to_torch(episode["reward"]).float()
|
||||||
|
ep_dict["next.done"] = tf_to_torch(episode["is_last"])
|
||||||
|
ep_dict["is_terminal"] = tf_to_torch(episode["is_terminal"])
|
||||||
|
ep_dict["is_first"] = tf_to_torch(episode["is_first"])
|
||||||
|
ep_dict["discount"] = tf_to_torch(episode["discount"])
|
||||||
|
|
||||||
|
# If lang_key is present, convert the entire tensor at once
|
||||||
|
if lang_key is not None:
|
||||||
|
ep_dict["language_instruction"] = [x.numpy().decode("utf-8") for x in episode[lang_key]]
|
||||||
|
|
||||||
|
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||||
|
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
|
||||||
|
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||||
|
|
||||||
|
image_array_dict = {key: [] for key in image_keys}
|
||||||
|
|
||||||
|
for im_key in image_keys:
|
||||||
|
imgs = episode["observation"][im_key]
|
||||||
|
image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
|
||||||
|
|
||||||
|
# loop through all cameras
|
||||||
|
for im_key in image_keys:
|
||||||
|
img_key = f"observation.images.{im_key}"
|
||||||
|
imgs_array = image_array_dict[im_key]
|
||||||
|
imgs_array = np.array(imgs_array)
|
||||||
|
if video:
|
||||||
|
# save png images in temporary directory
|
||||||
|
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||||
|
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||||
|
|
||||||
|
# encode images to a mp4 video
|
||||||
|
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||||
|
video_path = videos_dir / fname
|
||||||
|
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||||
|
|
||||||
|
# clean temporary images directory
|
||||||
|
shutil.rmtree(tmp_imgs_dir)
|
||||||
|
|
||||||
|
# store the reference to the video frame
|
||||||
|
ep_dict[img_key] = [
|
||||||
|
{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||||
|
|
||||||
|
path_ep_dict = tmp_ep_dicts_dir.joinpath(
|
||||||
|
"ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt"
|
||||||
|
)
|
||||||
|
torch.save(ep_dict, path_ep_dict)
|
||||||
|
|
||||||
|
ep_dicts.append(ep_dict)
|
||||||
|
|
||||||
|
data_dict = concatenate_episodes(ep_dicts)
|
||||||
|
|
||||||
|
total_frames = data_dict["frame_index"].shape[0]
|
||||||
|
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||||
|
return data_dict
|
||||||
|
|
||||||
|
|
||||||
|
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||||
|
features = {}
|
||||||
|
|
||||||
|
for key in data_dict:
|
||||||
|
# check if vector state obs
|
||||||
|
if key.startswith("observation.") and "observation.images." not in key:
|
||||||
|
features[key] = Sequence(length=data_dict[key].shape[1], feature=Value(dtype="float32", id=None))
|
||||||
|
# check if image obs
|
||||||
|
elif "observation.images." in key:
|
||||||
|
if video:
|
||||||
|
features[key] = VideoFrame()
|
||||||
|
else:
|
||||||
|
features[key] = Image()
|
||||||
|
|
||||||
|
if "language_instruction" in data_dict:
|
||||||
|
features["language_instruction"] = Value(dtype="string", id=None)
|
||||||
|
|
||||||
|
features["action"] = Sequence(
|
||||||
|
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||||
|
)
|
||||||
|
|
||||||
|
features["is_terminal"] = Value(dtype="bool", id=None)
|
||||||
|
features["is_first"] = Value(dtype="bool", id=None)
|
||||||
|
features["discount"] = Value(dtype="float32", id=None)
|
||||||
|
|
||||||
|
features["episode_index"] = Value(dtype="int64", id=None)
|
||||||
|
features["frame_index"] = Value(dtype="int64", id=None)
|
||||||
|
features["timestamp"] = Value(dtype="float32", id=None)
|
||||||
|
features["next.reward"] = Value(dtype="float32", id=None)
|
||||||
|
features["next.done"] = Value(dtype="bool", id=None)
|
||||||
|
features["index"] = Value(dtype="int64", id=None)
|
||||||
|
|
||||||
|
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||||
|
hf_dataset.set_transform(hf_transform_to_torch)
|
||||||
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
|
def from_raw_to_lerobot_format(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int | None = None,
|
||||||
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
|
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||||
|
hf_dataset = to_hf_dataset(data_dict, video)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
|
"fps": fps,
|
||||||
|
"video": video,
|
||||||
|
}
|
||||||
|
if video:
|
||||||
|
info["encoding"] = get_default_encoding()
|
||||||
|
|
||||||
|
return hf_dataset, episode_data_index, info
|
||||||
@@ -27,12 +27,12 @@ from PIL import Image as PILImage
|
|||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
concatenate_episodes,
|
concatenate_episodes,
|
||||||
get_default_encoding,
|
get_default_encoding,
|
||||||
save_images_concurrently,
|
save_images_concurrently,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|||||||
@@ -28,12 +28,12 @@ from PIL import Image as PILImage
|
|||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
|
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
concatenate_episodes,
|
concatenate_episodes,
|
||||||
get_default_encoding,
|
get_default_encoding,
|
||||||
save_images_concurrently,
|
save_images_concurrently,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|||||||
@@ -16,7 +16,9 @@
|
|||||||
import inspect
|
import inspect
|
||||||
from concurrent.futures import ThreadPoolExecutor
|
from concurrent.futures import ThreadPoolExecutor
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
from typing import Dict
|
||||||
|
|
||||||
|
import datasets
|
||||||
import numpy
|
import numpy
|
||||||
import PIL
|
import PIL
|
||||||
import torch
|
import torch
|
||||||
@@ -72,3 +74,58 @@ def check_repo_id(repo_id: str) -> None:
|
|||||||
f"""`repo_id` is expected to contain a community or user id `/` the name of the dataset
|
f"""`repo_id` is expected to contain a community or user id `/` the name of the dataset
|
||||||
(e.g. 'lerobot/pusht'), but contains '{repo_id}'."""
|
(e.g. 'lerobot/pusht'), but contains '{repo_id}'."""
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
|
# TODO(aliberts): remove
|
||||||
|
def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torch.Tensor]:
|
||||||
|
"""
|
||||||
|
Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
|
||||||
|
|
||||||
|
Parameters:
|
||||||
|
- hf_dataset (datasets.Dataset): A HuggingFace dataset containing the episode index.
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
- episode_data_index: A dictionary containing the data index for each episode. The dictionary has two keys:
|
||||||
|
- "from": A tensor containing the starting index of each episode.
|
||||||
|
- "to": A tensor containing the ending index of each episode.
|
||||||
|
"""
|
||||||
|
episode_data_index = {"from": [], "to": []}
|
||||||
|
|
||||||
|
current_episode = None
|
||||||
|
"""
|
||||||
|
The episode_index is a list of integers, each representing the episode index of the corresponding example.
|
||||||
|
For instance, the following is a valid episode_index:
|
||||||
|
[0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 2]
|
||||||
|
|
||||||
|
Below, we iterate through the episode_index and populate the episode_data_index dictionary with the starting and
|
||||||
|
ending index of each episode. For the episode_index above, the episode_data_index dictionary will look like this:
|
||||||
|
{
|
||||||
|
"from": [0, 3, 7],
|
||||||
|
"to": [3, 7, 12]
|
||||||
|
}
|
||||||
|
"""
|
||||||
|
if len(hf_dataset) == 0:
|
||||||
|
episode_data_index = {
|
||||||
|
"from": torch.tensor([]),
|
||||||
|
"to": torch.tensor([]),
|
||||||
|
}
|
||||||
|
return episode_data_index
|
||||||
|
for idx, episode_idx in enumerate(hf_dataset["episode_index"]):
|
||||||
|
if episode_idx != current_episode:
|
||||||
|
# We encountered a new episode, so we append its starting location to the "from" list
|
||||||
|
episode_data_index["from"].append(idx)
|
||||||
|
# If this is not the first episode, we append the ending location of the previous episode to the "to" list
|
||||||
|
if current_episode is not None:
|
||||||
|
episode_data_index["to"].append(idx)
|
||||||
|
# Let's keep track of the current episode index
|
||||||
|
current_episode = episode_idx
|
||||||
|
else:
|
||||||
|
# We are still in the same episode, so there is nothing for us to do here
|
||||||
|
pass
|
||||||
|
# We have reached the end of the dataset, so we append the ending location of the last episode to the "to" list
|
||||||
|
episode_data_index["to"].append(idx + 1)
|
||||||
|
|
||||||
|
for k in ["from", "to"]:
|
||||||
|
episode_data_index[k] = torch.tensor(episode_data_index[k])
|
||||||
|
|
||||||
|
return episode_data_index
|
||||||
|
|||||||
@@ -27,12 +27,12 @@ from PIL import Image as PILImage
|
|||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
concatenate_episodes,
|
concatenate_episodes,
|
||||||
get_default_encoding,
|
get_default_encoding,
|
||||||
save_images_concurrently,
|
save_images_concurrently,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|||||||
@@ -13,31 +13,58 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
import importlib.resources
|
||||||
import json
|
import json
|
||||||
import re
|
import logging
|
||||||
import warnings
|
import textwrap
|
||||||
from functools import cache
|
from itertools import accumulate
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from typing import Dict
|
from pprint import pformat
|
||||||
|
from typing import Any
|
||||||
|
|
||||||
import datasets
|
import datasets
|
||||||
|
import jsonlines
|
||||||
|
import numpy as np
|
||||||
|
import pyarrow.compute as pc
|
||||||
import torch
|
import torch
|
||||||
from datasets import load_dataset, load_from_disk
|
from datasets.table import embed_table_storage
|
||||||
from huggingface_hub import DatasetCard, HfApi, hf_hub_download, snapshot_download
|
from huggingface_hub import DatasetCard, DatasetCardData, HfApi
|
||||||
from PIL import Image as PILImage
|
from PIL import Image as PILImage
|
||||||
from safetensors.torch import load_file
|
|
||||||
from torchvision import transforms
|
from torchvision import transforms
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.robots.utils import Robot
|
||||||
|
|
||||||
|
DEFAULT_CHUNK_SIZE = 1000 # Max number of episodes per chunk
|
||||||
|
|
||||||
|
INFO_PATH = "meta/info.json"
|
||||||
|
EPISODES_PATH = "meta/episodes.jsonl"
|
||||||
|
STATS_PATH = "meta/stats.json"
|
||||||
|
TASKS_PATH = "meta/tasks.jsonl"
|
||||||
|
|
||||||
|
DEFAULT_VIDEO_PATH = "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4"
|
||||||
|
DEFAULT_PARQUET_PATH = "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet"
|
||||||
|
DEFAULT_IMAGE_PATH = "images/{image_key}/episode_{episode_index:06d}/frame_{frame_index:06d}.png"
|
||||||
|
|
||||||
DATASET_CARD_TEMPLATE = """
|
DATASET_CARD_TEMPLATE = """
|
||||||
---
|
---
|
||||||
# Metadata will go there
|
# Metadata will go there
|
||||||
---
|
---
|
||||||
This dataset was created using [🤗 LeRobot](https://github.com/huggingface/lerobot).
|
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
|
||||||
|
|
||||||
|
## {}
|
||||||
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
DEFAULT_FEATURES = {
|
||||||
|
"timestamp": {"dtype": "float32", "shape": (1,), "names": None},
|
||||||
|
"frame_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||||
|
"episode_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||||
|
"index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||||
|
"task_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||||
|
}
|
||||||
|
|
||||||
def flatten_dict(d, parent_key="", sep="/"):
|
|
||||||
|
def flatten_dict(d: dict, parent_key: str = "", sep: str = "/") -> dict:
|
||||||
"""Flatten a nested dictionary structure by collapsing nested keys into one key with a separator.
|
"""Flatten a nested dictionary structure by collapsing nested keys into one key with a separator.
|
||||||
|
|
||||||
For example:
|
For example:
|
||||||
@@ -56,7 +83,7 @@ def flatten_dict(d, parent_key="", sep="/"):
|
|||||||
return dict(items)
|
return dict(items)
|
||||||
|
|
||||||
|
|
||||||
def unflatten_dict(d, sep="/"):
|
def unflatten_dict(d: dict, sep: str = "/") -> dict:
|
||||||
outdict = {}
|
outdict = {}
|
||||||
for key, value in d.items():
|
for key, value in d.items():
|
||||||
parts = key.split(sep)
|
parts = key.split(sep)
|
||||||
@@ -69,6 +96,82 @@ def unflatten_dict(d, sep="/"):
|
|||||||
return outdict
|
return outdict
|
||||||
|
|
||||||
|
|
||||||
|
def serialize_dict(stats: dict[str, torch.Tensor | np.ndarray | dict]) -> dict:
|
||||||
|
serialized_dict = {key: value.tolist() for key, value in flatten_dict(stats).items()}
|
||||||
|
return unflatten_dict(serialized_dict)
|
||||||
|
|
||||||
|
|
||||||
|
def write_parquet(dataset: datasets.Dataset, fpath: Path) -> None:
|
||||||
|
# Embed image bytes into the table before saving to parquet
|
||||||
|
format = dataset.format
|
||||||
|
dataset = dataset.with_format("arrow")
|
||||||
|
dataset = dataset.map(embed_table_storage, batched=False)
|
||||||
|
dataset = dataset.with_format(**format)
|
||||||
|
dataset.to_parquet(fpath)
|
||||||
|
|
||||||
|
|
||||||
|
def load_json(fpath: Path) -> Any:
|
||||||
|
with open(fpath) as f:
|
||||||
|
return json.load(f)
|
||||||
|
|
||||||
|
|
||||||
|
def write_json(data: dict, fpath: Path) -> None:
|
||||||
|
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with open(fpath, "w") as f:
|
||||||
|
json.dump(data, f, indent=4, ensure_ascii=False)
|
||||||
|
|
||||||
|
|
||||||
|
def load_jsonlines(fpath: Path) -> list[Any]:
|
||||||
|
with jsonlines.open(fpath, "r") as reader:
|
||||||
|
return list(reader)
|
||||||
|
|
||||||
|
|
||||||
|
def write_jsonlines(data: dict, fpath: Path) -> None:
|
||||||
|
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with jsonlines.open(fpath, "w") as writer:
|
||||||
|
writer.write_all(data)
|
||||||
|
|
||||||
|
|
||||||
|
def append_jsonlines(data: dict, fpath: Path) -> None:
|
||||||
|
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with jsonlines.open(fpath, "a") as writer:
|
||||||
|
writer.write(data)
|
||||||
|
|
||||||
|
|
||||||
|
def load_info(local_dir: Path) -> dict:
|
||||||
|
info = load_json(local_dir / INFO_PATH)
|
||||||
|
for ft in info["features"].values():
|
||||||
|
ft["shape"] = tuple(ft["shape"])
|
||||||
|
return info
|
||||||
|
|
||||||
|
|
||||||
|
def load_stats(local_dir: Path) -> dict:
|
||||||
|
if not (local_dir / STATS_PATH).exists():
|
||||||
|
return None
|
||||||
|
stats = load_json(local_dir / STATS_PATH)
|
||||||
|
stats = {key: torch.tensor(value) for key, value in flatten_dict(stats).items()}
|
||||||
|
return unflatten_dict(stats)
|
||||||
|
|
||||||
|
|
||||||
|
def load_tasks(local_dir: Path) -> dict:
|
||||||
|
tasks = load_jsonlines(local_dir / TASKS_PATH)
|
||||||
|
return {item["task_index"]: item["task"] for item in sorted(tasks, key=lambda x: x["task_index"])}
|
||||||
|
|
||||||
|
|
||||||
|
def load_episodes(local_dir: Path) -> dict:
|
||||||
|
return load_jsonlines(local_dir / EPISODES_PATH)
|
||||||
|
|
||||||
|
|
||||||
|
def load_image_as_numpy(fpath: str | Path, dtype="float32", channel_first: bool = True) -> np.ndarray:
|
||||||
|
img = PILImage.open(fpath).convert("RGB")
|
||||||
|
img_array = np.array(img, dtype=dtype)
|
||||||
|
if channel_first: # (H, W, C) -> (C, H, W)
|
||||||
|
img_array = np.transpose(img_array, (2, 0, 1))
|
||||||
|
if "float" in dtype:
|
||||||
|
img_array /= 255.0
|
||||||
|
return img_array
|
||||||
|
|
||||||
|
|
||||||
def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
|
def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
|
||||||
"""Get a transform function that convert items from Hugging Face dataset (pyarrow)
|
"""Get a transform function that convert items from Hugging Face dataset (pyarrow)
|
||||||
to torch tensors. Importantly, images are converted from PIL, which corresponds to
|
to torch tensors. Importantly, images are converted from PIL, which corresponds to
|
||||||
@@ -80,9 +183,6 @@ def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
|
|||||||
if isinstance(first_item, PILImage.Image):
|
if isinstance(first_item, PILImage.Image):
|
||||||
to_tensor = transforms.ToTensor()
|
to_tensor = transforms.ToTensor()
|
||||||
items_dict[key] = [to_tensor(img) for img in items_dict[key]]
|
items_dict[key] = [to_tensor(img) for img in items_dict[key]]
|
||||||
elif isinstance(first_item, dict) and "path" in first_item and "timestamp" in first_item:
|
|
||||||
# video frame will be processed downstream
|
|
||||||
pass
|
|
||||||
elif first_item is None:
|
elif first_item is None:
|
||||||
pass
|
pass
|
||||||
else:
|
else:
|
||||||
@@ -90,19 +190,67 @@ def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
|
|||||||
return items_dict
|
return items_dict
|
||||||
|
|
||||||
|
|
||||||
@cache
|
def _get_major_minor(version: str) -> tuple[int]:
|
||||||
def get_hf_dataset_safe_version(repo_id: str, version: str) -> str:
|
split = version.strip("v").split(".")
|
||||||
|
return int(split[0]), int(split[1])
|
||||||
|
|
||||||
|
|
||||||
|
class BackwardCompatibilityError(Exception):
|
||||||
|
def __init__(self, repo_id, version):
|
||||||
|
message = textwrap.dedent(f"""
|
||||||
|
BackwardCompatibilityError: The dataset you requested ({repo_id}) is in {version} format.
|
||||||
|
|
||||||
|
We introduced a new format since v2.0 which is not backward compatible with v1.x.
|
||||||
|
Please, use our conversion script. Modify the following command with your own task description:
|
||||||
|
```
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \\
|
||||||
|
--repo-id {repo_id} \\
|
||||||
|
--single-task "TASK DESCRIPTION." # <---- /!\\ Replace TASK DESCRIPTION /!\\
|
||||||
|
```
|
||||||
|
|
||||||
|
A few examples to replace TASK DESCRIPTION: "Pick up the blue cube and place it into the bin.",
|
||||||
|
"Insert the peg into the socket.", "Slide open the ziploc bag.", "Take the elevator to the 1st floor.",
|
||||||
|
"Open the top cabinet, store the pot inside it then close the cabinet.", "Push the T-shaped block onto the T-shaped target.",
|
||||||
|
"Grab the spray paint on the shelf and place it in the bin on top of the robot dog.", "Fold the sweatshirt.", ...
|
||||||
|
|
||||||
|
If you encounter a problem, contact LeRobot maintainers on [Discord](https://discord.com/invite/s3KuuzsPFb)
|
||||||
|
or open an [issue on GitHub](https://github.com/huggingface/lerobot/issues/new/choose).
|
||||||
|
""")
|
||||||
|
super().__init__(message)
|
||||||
|
|
||||||
|
|
||||||
|
def check_version_compatibility(
|
||||||
|
repo_id: str, version_to_check: str, current_version: str, enforce_breaking_major: bool = True
|
||||||
|
) -> None:
|
||||||
|
current_major, _ = _get_major_minor(current_version)
|
||||||
|
major_to_check, _ = _get_major_minor(version_to_check)
|
||||||
|
if major_to_check < current_major and enforce_breaking_major:
|
||||||
|
raise BackwardCompatibilityError(repo_id, version_to_check)
|
||||||
|
elif float(version_to_check.strip("v")) < float(current_version.strip("v")):
|
||||||
|
logging.warning(
|
||||||
|
f"""The dataset you requested ({repo_id}) was created with a previous version ({version_to_check}) of the
|
||||||
|
codebase. The current codebase version is {current_version}. You should be fine since
|
||||||
|
backward compatibility is maintained. If you encounter a problem, contact LeRobot maintainers on
|
||||||
|
Discord ('https://discord.com/invite/s3KuuzsPFb') or open an issue on github.""",
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def get_hub_safe_version(repo_id: str, version: str) -> str:
|
||||||
api = HfApi()
|
api = HfApi()
|
||||||
dataset_info = api.list_repo_refs(repo_id, repo_type="dataset")
|
dataset_info = api.list_repo_refs(repo_id, repo_type="dataset")
|
||||||
branches = [b.name for b in dataset_info.branches]
|
branches = [b.name for b in dataset_info.branches]
|
||||||
if version not in branches:
|
if version not in branches:
|
||||||
warnings.warn(
|
num_version = float(version.strip("v"))
|
||||||
|
hub_num_versions = [float(v.strip("v")) for v in branches if v.startswith("v")]
|
||||||
|
if num_version >= 2.0 and all(v < 2.0 for v in hub_num_versions):
|
||||||
|
raise BackwardCompatibilityError(repo_id, version)
|
||||||
|
|
||||||
|
logging.warning(
|
||||||
f"""You are trying to load a dataset from {repo_id} created with a previous version of the
|
f"""You are trying to load a dataset from {repo_id} created with a previous version of the
|
||||||
codebase. The following versions are available: {branches}.
|
codebase. The following versions are available: {branches}.
|
||||||
The requested version ('{version}') is not found. You should be fine since
|
The requested version ('{version}') is not found. You should be fine since
|
||||||
backward compatibility is maintained. If you encounter a problem, contact LeRobot maintainers on
|
backward compatibility is maintained. If you encounter a problem, contact LeRobot maintainers on
|
||||||
Discord ('https://discord.com/invite/s3KuuzsPFb') or open an issue on github.""",
|
Discord ('https://discord.com/invite/s3KuuzsPFb') or open an issue on github.""",
|
||||||
stacklevel=1,
|
|
||||||
)
|
)
|
||||||
if "main" not in branches:
|
if "main" not in branches:
|
||||||
raise ValueError(f"Version 'main' not found on {repo_id}")
|
raise ValueError(f"Version 'main' not found on {repo_id}")
|
||||||
@@ -111,275 +259,184 @@ def get_hf_dataset_safe_version(repo_id: str, version: str) -> str:
|
|||||||
return version
|
return version
|
||||||
|
|
||||||
|
|
||||||
def load_hf_dataset(repo_id: str, version: str, root: Path, split: str) -> datasets.Dataset:
|
def get_hf_features_from_features(features: dict) -> datasets.Features:
|
||||||
"""hf_dataset contains all the observations, states, actions, rewards, etc."""
|
hf_features = {}
|
||||||
if root is not None:
|
for key, ft in features.items():
|
||||||
hf_dataset = load_from_disk(str(Path(root) / repo_id / "train"))
|
if ft["dtype"] == "video":
|
||||||
# TODO(rcadene): clean this which enables getting a subset of dataset
|
continue
|
||||||
if split != "train":
|
elif ft["dtype"] == "image":
|
||||||
if "%" in split:
|
hf_features[key] = datasets.Image()
|
||||||
raise NotImplementedError(f"We dont support splitting based on percentage for now ({split}).")
|
elif ft["shape"] == (1,):
|
||||||
match_from = re.search(r"train\[(\d+):\]", split)
|
hf_features[key] = datasets.Value(dtype=ft["dtype"])
|
||||||
match_to = re.search(r"train\[:(\d+)\]", split)
|
|
||||||
if match_from:
|
|
||||||
from_frame_index = int(match_from.group(1))
|
|
||||||
hf_dataset = hf_dataset.select(range(from_frame_index, len(hf_dataset)))
|
|
||||||
elif match_to:
|
|
||||||
to_frame_index = int(match_to.group(1))
|
|
||||||
hf_dataset = hf_dataset.select(range(to_frame_index))
|
|
||||||
else:
|
else:
|
||||||
raise ValueError(
|
assert len(ft["shape"]) == 1
|
||||||
f'`split` ({split}) should either be "train", "train[INT:]", or "train[:INT]"'
|
hf_features[key] = datasets.Sequence(
|
||||||
)
|
length=ft["shape"][0], feature=datasets.Value(dtype=ft["dtype"])
|
||||||
else:
|
|
||||||
safe_version = get_hf_dataset_safe_version(repo_id, version)
|
|
||||||
hf_dataset = load_dataset(repo_id, revision=safe_version, split=split)
|
|
||||||
|
|
||||||
hf_dataset.set_transform(hf_transform_to_torch)
|
|
||||||
return hf_dataset
|
|
||||||
|
|
||||||
|
|
||||||
def load_episode_data_index(repo_id, version, root) -> dict[str, torch.Tensor]:
|
|
||||||
"""episode_data_index contains the range of indices for each episode
|
|
||||||
|
|
||||||
Example:
|
|
||||||
```python
|
|
||||||
from_id = episode_data_index["from"][episode_id].item()
|
|
||||||
to_id = episode_data_index["to"][episode_id].item()
|
|
||||||
episode_frames = [dataset[i] for i in range(from_id, to_id)]
|
|
||||||
```
|
|
||||||
"""
|
|
||||||
if root is not None:
|
|
||||||
path = Path(root) / repo_id / "meta_data" / "episode_data_index.safetensors"
|
|
||||||
else:
|
|
||||||
safe_version = get_hf_dataset_safe_version(repo_id, version)
|
|
||||||
path = hf_hub_download(
|
|
||||||
repo_id, "meta_data/episode_data_index.safetensors", repo_type="dataset", revision=safe_version
|
|
||||||
)
|
)
|
||||||
|
|
||||||
return load_file(path)
|
return datasets.Features(hf_features)
|
||||||
|
|
||||||
|
|
||||||
def load_stats(repo_id, version, root) -> dict[str, dict[str, torch.Tensor]]:
|
def get_features_from_robot(robot: Robot, use_videos: bool = True) -> dict:
|
||||||
"""stats contains the statistics per modality computed over the full dataset, such as max, min, mean, std
|
camera_ft = {}
|
||||||
|
if robot.cameras:
|
||||||
Example:
|
camera_ft = {
|
||||||
```python
|
key: {"dtype": "video" if use_videos else "image", **ft}
|
||||||
normalized_action = (action - stats["action"]["mean"]) / stats["action"]["std"]
|
for key, ft in robot.camera_features.items()
|
||||||
```
|
}
|
||||||
"""
|
return {**robot.motor_features, **camera_ft, **DEFAULT_FEATURES}
|
||||||
if root is not None:
|
|
||||||
path = Path(root) / repo_id / "meta_data" / "stats.safetensors"
|
|
||||||
else:
|
|
||||||
safe_version = get_hf_dataset_safe_version(repo_id, version)
|
|
||||||
path = hf_hub_download(
|
|
||||||
repo_id, "meta_data/stats.safetensors", repo_type="dataset", revision=safe_version
|
|
||||||
)
|
|
||||||
|
|
||||||
stats = load_file(path)
|
|
||||||
return unflatten_dict(stats)
|
|
||||||
|
|
||||||
|
|
||||||
def load_info(repo_id, version, root) -> dict:
|
def create_empty_dataset_info(
|
||||||
"""info contains useful information regarding the dataset that are not stored elsewhere
|
codebase_version: str,
|
||||||
|
fps: int,
|
||||||
Example:
|
robot_type: str,
|
||||||
```python
|
features: dict,
|
||||||
print("frame per second used to collect the video", info["fps"])
|
use_videos: bool,
|
||||||
```
|
) -> dict:
|
||||||
"""
|
return {
|
||||||
if root is not None:
|
"codebase_version": codebase_version,
|
||||||
path = Path(root) / repo_id / "meta_data" / "info.json"
|
"robot_type": robot_type,
|
||||||
else:
|
"total_episodes": 0,
|
||||||
safe_version = get_hf_dataset_safe_version(repo_id, version)
|
"total_frames": 0,
|
||||||
path = hf_hub_download(repo_id, "meta_data/info.json", repo_type="dataset", revision=safe_version)
|
"total_tasks": 0,
|
||||||
|
"total_videos": 0,
|
||||||
with open(path) as f:
|
"total_chunks": 0,
|
||||||
info = json.load(f)
|
"chunks_size": DEFAULT_CHUNK_SIZE,
|
||||||
return info
|
"fps": fps,
|
||||||
|
"splits": {},
|
||||||
|
"data_path": DEFAULT_PARQUET_PATH,
|
||||||
|
"video_path": DEFAULT_VIDEO_PATH if use_videos else None,
|
||||||
|
"features": features,
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
def load_videos(repo_id, version, root) -> Path:
|
def get_episode_data_index(
|
||||||
if root is not None:
|
episode_dicts: list[dict], episodes: list[int] | None = None
|
||||||
path = Path(root) / repo_id / "videos"
|
) -> dict[str, torch.Tensor]:
|
||||||
else:
|
episode_lengths = {ep_idx: ep_dict["length"] for ep_idx, ep_dict in enumerate(episode_dicts)}
|
||||||
# TODO(rcadene): we download the whole repo here. see if we can avoid this
|
if episodes is not None:
|
||||||
safe_version = get_hf_dataset_safe_version(repo_id, version)
|
episode_lengths = {ep_idx: episode_lengths[ep_idx] for ep_idx in episodes}
|
||||||
repo_dir = snapshot_download(repo_id, repo_type="dataset", revision=safe_version)
|
|
||||||
path = Path(repo_dir) / "videos"
|
|
||||||
|
|
||||||
return path
|
cumulative_lenghts = list(accumulate(episode_lengths.values()))
|
||||||
|
return {
|
||||||
|
"from": torch.LongTensor([0] + cumulative_lenghts[:-1]),
|
||||||
|
"to": torch.LongTensor(cumulative_lenghts),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
def load_previous_and_future_frames(
|
def calculate_total_episode(
|
||||||
item: dict[str, torch.Tensor],
|
hf_dataset: datasets.Dataset, raise_if_not_contiguous: bool = True
|
||||||
|
) -> dict[str, torch.Tensor]:
|
||||||
|
episode_indices = sorted(hf_dataset.unique("episode_index"))
|
||||||
|
total_episodes = len(episode_indices)
|
||||||
|
if raise_if_not_contiguous and episode_indices != list(range(total_episodes)):
|
||||||
|
raise ValueError("episode_index values are not sorted and contiguous.")
|
||||||
|
return total_episodes
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> dict[str, torch.Tensor]:
|
||||||
|
episode_lengths = []
|
||||||
|
table = hf_dataset.data.table
|
||||||
|
total_episodes = calculate_total_episode(hf_dataset)
|
||||||
|
for ep_idx in range(total_episodes):
|
||||||
|
ep_table = table.filter(pc.equal(table["episode_index"], ep_idx))
|
||||||
|
episode_lengths.insert(ep_idx, len(ep_table))
|
||||||
|
|
||||||
|
cumulative_lenghts = list(accumulate(episode_lengths))
|
||||||
|
return {
|
||||||
|
"from": torch.LongTensor([0] + cumulative_lenghts[:-1]),
|
||||||
|
"to": torch.LongTensor(cumulative_lenghts),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def check_timestamps_sync(
|
||||||
hf_dataset: datasets.Dataset,
|
hf_dataset: datasets.Dataset,
|
||||||
episode_data_index: dict[str, torch.Tensor],
|
episode_data_index: dict[str, torch.Tensor],
|
||||||
delta_timestamps: dict[str, list[float]],
|
fps: int,
|
||||||
tolerance_s: float,
|
tolerance_s: float,
|
||||||
) -> dict[torch.Tensor]:
|
raise_value_error: bool = True,
|
||||||
|
) -> bool:
|
||||||
"""
|
"""
|
||||||
Given a current item in the dataset containing a timestamp (e.g. 0.6 seconds), and a list of time differences of
|
This check is to make sure that each timestamps is separated to the next by 1/fps +/- tolerance to
|
||||||
some modalities (e.g. delta_timestamps={"observation.image": [-0.8, -0.2, 0, 0.2]}), this function computes for each
|
account for possible numerical error.
|
||||||
given modality (e.g. "observation.image") a list of query timestamps (e.g. [-0.2, 0.4, 0.6, 0.8]) and loads the closest
|
|
||||||
frames in the dataset.
|
|
||||||
|
|
||||||
Importantly, when no frame can be found around a query timestamp within a specified tolerance window, this function
|
|
||||||
raises an AssertionError. When a timestamp is queried before the first available timestamp of the episode or after
|
|
||||||
the last available timestamp, the violation of the tolerance doesnt raise an AssertionError, and the function
|
|
||||||
populates a boolean array indicating which frames are outside of the episode range. For instance, this boolean array
|
|
||||||
is useful during batched training to not supervise actions associated to timestamps coming after the end of the
|
|
||||||
episode, or to pad the observations in a specific way. Note that by default the observation frames before the start
|
|
||||||
of the episode are the same as the first frame of the episode.
|
|
||||||
|
|
||||||
Parameters:
|
|
||||||
- item (dict): A dictionary containing all the data related to a frame. It is the result of `dataset[idx]`. Each key
|
|
||||||
corresponds to a different modality (e.g., "timestamp", "observation.image", "action").
|
|
||||||
- hf_dataset (datasets.Dataset): A dictionary containing the full dataset. Each key corresponds to a different
|
|
||||||
modality (e.g., "timestamp", "observation.image", "action").
|
|
||||||
- episode_data_index (dict): A dictionary containing two keys ("from" and "to") associated to dataset indices.
|
|
||||||
They indicate the start index and end index of each episode in the dataset.
|
|
||||||
- delta_timestamps (dict): A dictionary containing lists of delta timestamps for each possible modality to be
|
|
||||||
retrieved. These deltas are added to the item timestamp to form the query timestamps.
|
|
||||||
- tolerance_s (float, optional): The tolerance level (in seconds) used to determine if a data point is close enough to the query
|
|
||||||
timestamp by asserting `tol > difference`. It is suggested to set `tol` to a smaller value than the
|
|
||||||
smallest expected inter-frame period, but large enough to account for jitter.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
- The same item with the queried frames for each modality specified in delta_timestamps, with an additional key for
|
|
||||||
each modality (e.g. "observation.image_is_pad").
|
|
||||||
|
|
||||||
Raises:
|
|
||||||
- AssertionError: If any of the frames unexpectedly violate the tolerance level. This could indicate synchronization
|
|
||||||
issues with timestamps during data collection.
|
|
||||||
"""
|
"""
|
||||||
# get indices of the frames associated to the episode, and their timestamps
|
timestamps = torch.stack(hf_dataset["timestamp"])
|
||||||
ep_id = item["episode_index"].item()
|
diffs = torch.diff(timestamps)
|
||||||
ep_data_id_from = episode_data_index["from"][ep_id].item()
|
within_tolerance = torch.abs(diffs - 1 / fps) <= tolerance_s
|
||||||
ep_data_id_to = episode_data_index["to"][ep_id].item()
|
|
||||||
ep_data_ids = torch.arange(ep_data_id_from, ep_data_id_to, 1)
|
|
||||||
|
|
||||||
# load timestamps
|
# We mask differences between the timestamp at the end of an episode
|
||||||
ep_timestamps = hf_dataset.select_columns("timestamp")[ep_data_id_from:ep_data_id_to]["timestamp"]
|
# and the one at the start of the next episode since these are expected
|
||||||
ep_timestamps = torch.stack(ep_timestamps)
|
# to be outside tolerance.
|
||||||
|
mask = torch.ones(len(diffs), dtype=torch.bool)
|
||||||
|
ignored_diffs = episode_data_index["to"][:-1] - 1
|
||||||
|
mask[ignored_diffs] = False
|
||||||
|
filtered_within_tolerance = within_tolerance[mask]
|
||||||
|
|
||||||
# we make the assumption that the timestamps are sorted
|
if not torch.all(filtered_within_tolerance):
|
||||||
ep_first_ts = ep_timestamps[0]
|
# Track original indices before masking
|
||||||
ep_last_ts = ep_timestamps[-1]
|
original_indices = torch.arange(len(diffs))
|
||||||
current_ts = item["timestamp"].item()
|
filtered_indices = original_indices[mask]
|
||||||
|
outside_tolerance_filtered_indices = torch.nonzero(~filtered_within_tolerance) # .squeeze()
|
||||||
|
outside_tolerance_indices = filtered_indices[outside_tolerance_filtered_indices]
|
||||||
|
episode_indices = torch.stack(hf_dataset["episode_index"])
|
||||||
|
|
||||||
for key in delta_timestamps:
|
outside_tolerances = []
|
||||||
# get timestamps used as query to retrieve data of previous/future frames
|
for idx in outside_tolerance_indices:
|
||||||
delta_ts = delta_timestamps[key]
|
entry = {
|
||||||
query_ts = current_ts + torch.tensor(delta_ts)
|
"timestamps": [timestamps[idx], timestamps[idx + 1]],
|
||||||
|
"diff": diffs[idx],
|
||||||
|
"episode_index": episode_indices[idx].item(),
|
||||||
|
}
|
||||||
|
outside_tolerances.append(entry)
|
||||||
|
|
||||||
# compute distances between each query timestamp and all timestamps of all the frames belonging to the episode
|
if raise_value_error:
|
||||||
dist = torch.cdist(query_ts[:, None], ep_timestamps[:, None], p=1)
|
raise ValueError(
|
||||||
min_, argmin_ = dist.min(1)
|
f"""One or several timestamps unexpectedly violate the tolerance inside episode range.
|
||||||
|
This might be due to synchronization issues with timestamps during data collection.
|
||||||
# TODO(rcadene): synchronize timestamps + interpolation if needed
|
\n{pformat(outside_tolerances)}"""
|
||||||
|
|
||||||
is_pad = min_ > tolerance_s
|
|
||||||
|
|
||||||
# check violated query timestamps are all outside the episode range
|
|
||||||
assert ((query_ts[is_pad] < ep_first_ts) | (ep_last_ts < query_ts[is_pad])).all(), (
|
|
||||||
f"One or several timestamps unexpectedly violate the tolerance ({min_} > {tolerance_s=}) inside episode range."
|
|
||||||
"This might be due to synchronization issues with timestamps during data collection."
|
|
||||||
)
|
)
|
||||||
|
return False
|
||||||
|
|
||||||
# get dataset indices corresponding to frames to be loaded
|
return True
|
||||||
data_ids = ep_data_ids[argmin_]
|
|
||||||
|
|
||||||
# load frames modality
|
|
||||||
item[key] = hf_dataset.select_columns(key)[data_ids][key]
|
|
||||||
|
|
||||||
if isinstance(item[key][0], dict) and "path" in item[key][0]:
|
|
||||||
# video mode where frame are expressed as dict of path and timestamp
|
|
||||||
item[key] = item[key]
|
|
||||||
else:
|
|
||||||
item[key] = torch.stack(item[key])
|
|
||||||
|
|
||||||
item[f"{key}_is_pad"] = is_pad
|
|
||||||
|
|
||||||
return item
|
|
||||||
|
|
||||||
|
|
||||||
def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torch.Tensor]:
|
def check_delta_timestamps(
|
||||||
|
delta_timestamps: dict[str, list[float]], fps: int, tolerance_s: float, raise_value_error: bool = True
|
||||||
|
) -> bool:
|
||||||
|
"""This will check if all the values in delta_timestamps are multiples of 1/fps +/- tolerance.
|
||||||
|
This is to ensure that these delta_timestamps added to any timestamp from a dataset will themselves be
|
||||||
|
actual timestamps from the dataset.
|
||||||
"""
|
"""
|
||||||
Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
|
outside_tolerance = {}
|
||||||
|
for key, delta_ts in delta_timestamps.items():
|
||||||
|
within_tolerance = [abs(ts * fps - round(ts * fps)) / fps <= tolerance_s for ts in delta_ts]
|
||||||
|
if not all(within_tolerance):
|
||||||
|
outside_tolerance[key] = [
|
||||||
|
ts for ts, is_within in zip(delta_ts, within_tolerance, strict=True) if not is_within
|
||||||
|
]
|
||||||
|
|
||||||
Parameters:
|
if len(outside_tolerance) > 0:
|
||||||
- hf_dataset (datasets.Dataset): A HuggingFace dataset containing the episode index.
|
if raise_value_error:
|
||||||
|
raise ValueError(
|
||||||
Returns:
|
f"""
|
||||||
- episode_data_index: A dictionary containing the data index for each episode. The dictionary has two keys:
|
The following delta_timestamps are found outside of tolerance range.
|
||||||
- "from": A tensor containing the starting index of each episode.
|
Please make sure they are multiples of 1/{fps} +/- tolerance and adjust
|
||||||
- "to": A tensor containing the ending index of each episode.
|
their values accordingly.
|
||||||
|
\n{pformat(outside_tolerance)}
|
||||||
"""
|
"""
|
||||||
episode_data_index = {"from": [], "to": []}
|
)
|
||||||
|
return False
|
||||||
|
|
||||||
current_episode = None
|
return True
|
||||||
"""
|
|
||||||
The episode_index is a list of integers, each representing the episode index of the corresponding example.
|
|
||||||
For instance, the following is a valid episode_index:
|
|
||||||
[0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 2]
|
|
||||||
|
|
||||||
Below, we iterate through the episode_index and populate the episode_data_index dictionary with the starting and
|
|
||||||
ending index of each episode. For the episode_index above, the episode_data_index dictionary will look like this:
|
|
||||||
{
|
|
||||||
"from": [0, 3, 7],
|
|
||||||
"to": [3, 7, 12]
|
|
||||||
}
|
|
||||||
"""
|
|
||||||
if len(hf_dataset) == 0:
|
|
||||||
episode_data_index = {
|
|
||||||
"from": torch.tensor([]),
|
|
||||||
"to": torch.tensor([]),
|
|
||||||
}
|
|
||||||
return episode_data_index
|
|
||||||
for idx, episode_idx in enumerate(hf_dataset["episode_index"]):
|
|
||||||
if episode_idx != current_episode:
|
|
||||||
# We encountered a new episode, so we append its starting location to the "from" list
|
|
||||||
episode_data_index["from"].append(idx)
|
|
||||||
# If this is not the first episode, we append the ending location of the previous episode to the "to" list
|
|
||||||
if current_episode is not None:
|
|
||||||
episode_data_index["to"].append(idx)
|
|
||||||
# Let's keep track of the current episode index
|
|
||||||
current_episode = episode_idx
|
|
||||||
else:
|
|
||||||
# We are still in the same episode, so there is nothing for us to do here
|
|
||||||
pass
|
|
||||||
# We have reached the end of the dataset, so we append the ending location of the last episode to the "to" list
|
|
||||||
episode_data_index["to"].append(idx + 1)
|
|
||||||
|
|
||||||
for k in ["from", "to"]:
|
|
||||||
episode_data_index[k] = torch.tensor(episode_data_index[k])
|
|
||||||
|
|
||||||
return episode_data_index
|
|
||||||
|
|
||||||
|
|
||||||
def reset_episode_index(hf_dataset: datasets.Dataset) -> datasets.Dataset:
|
def get_delta_indices(delta_timestamps: dict[str, list[float]], fps: int) -> dict[str, list[int]]:
|
||||||
"""Reset the `episode_index` of the provided HuggingFace Dataset.
|
delta_indices = {}
|
||||||
|
for key, delta_ts in delta_timestamps.items():
|
||||||
|
delta_indices[key] = (torch.tensor(delta_ts) * fps).long().tolist()
|
||||||
|
|
||||||
`episode_data_index` (and related functionality such as `load_previous_and_future_frames`) requires the
|
return delta_indices
|
||||||
`episode_index` to be sorted, continuous (1,1,1 and not 1,2,1) and start at 0.
|
|
||||||
|
|
||||||
This brings the `episode_index` to the required format.
|
|
||||||
"""
|
|
||||||
if len(hf_dataset) == 0:
|
|
||||||
return hf_dataset
|
|
||||||
unique_episode_idxs = torch.stack(hf_dataset["episode_index"]).unique().tolist()
|
|
||||||
episode_idx_to_reset_idx_mapping = {
|
|
||||||
ep_id: reset_ep_id for reset_ep_id, ep_id in enumerate(unique_episode_idxs)
|
|
||||||
}
|
|
||||||
|
|
||||||
def modify_ep_idx_func(example):
|
|
||||||
example["episode_index"] = episode_idx_to_reset_idx_mapping[example["episode_index"].item()]
|
|
||||||
return example
|
|
||||||
|
|
||||||
hf_dataset = hf_dataset.map(modify_ep_idx_func)
|
|
||||||
|
|
||||||
return hf_dataset
|
|
||||||
|
|
||||||
|
|
||||||
def cycle(iterable):
|
def cycle(iterable):
|
||||||
@@ -395,7 +452,7 @@ def cycle(iterable):
|
|||||||
iterator = iter(iterable)
|
iterator = iter(iterable)
|
||||||
|
|
||||||
|
|
||||||
def create_branch(repo_id, *, branch: str, repo_type: str | None = None):
|
def create_branch(repo_id, *, branch: str, repo_type: str | None = None) -> None:
|
||||||
"""Create a branch on a existing Hugging Face repo. Delete the branch if it already
|
"""Create a branch on a existing Hugging Face repo. Delete the branch if it already
|
||||||
exists before creating it.
|
exists before creating it.
|
||||||
"""
|
"""
|
||||||
@@ -410,12 +467,38 @@ def create_branch(repo_id, *, branch: str, repo_type: str | None = None):
|
|||||||
api.create_branch(repo_id, repo_type=repo_type, branch=branch)
|
api.create_branch(repo_id, repo_type=repo_type, branch=branch)
|
||||||
|
|
||||||
|
|
||||||
def create_lerobot_dataset_card(tags: list | None = None, text: str | None = None) -> DatasetCard:
|
def create_lerobot_dataset_card(
|
||||||
card = DatasetCard(DATASET_CARD_TEMPLATE)
|
tags: list | None = None,
|
||||||
card.data.task_categories = ["robotics"]
|
dataset_info: dict | None = None,
|
||||||
card.data.tags = ["LeRobot"]
|
**kwargs,
|
||||||
if tags is not None:
|
) -> DatasetCard:
|
||||||
card.data.tags += tags
|
"""
|
||||||
if text is not None:
|
Keyword arguments will be used to replace values in ./lerobot/common/datasets/card_template.md.
|
||||||
card.text += text
|
Note: If specified, license must be one of https://huggingface.co/docs/hub/repositories-licenses.
|
||||||
return card
|
"""
|
||||||
|
card_tags = ["LeRobot"]
|
||||||
|
card_template_path = importlib.resources.path("lerobot.common.datasets", "card_template.md")
|
||||||
|
|
||||||
|
if tags:
|
||||||
|
card_tags += tags
|
||||||
|
if dataset_info:
|
||||||
|
dataset_structure = "[meta/info.json](meta/info.json):\n"
|
||||||
|
dataset_structure += f"```json\n{json.dumps(dataset_info, indent=4)}\n```\n"
|
||||||
|
kwargs = {**kwargs, "dataset_structure": dataset_structure}
|
||||||
|
card_data = DatasetCardData(
|
||||||
|
license=kwargs.get("license"),
|
||||||
|
tags=card_tags,
|
||||||
|
task_categories=["robotics"],
|
||||||
|
configs=[
|
||||||
|
{
|
||||||
|
"config_name": "default",
|
||||||
|
"data_files": "data/*/*.parquet",
|
||||||
|
}
|
||||||
|
],
|
||||||
|
)
|
||||||
|
|
||||||
|
return DatasetCard.from_template(
|
||||||
|
card_data=card_data,
|
||||||
|
template_path=str(card_template_path),
|
||||||
|
**kwargs,
|
||||||
|
)
|
||||||
|
|||||||
882
lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py
Normal file
882
lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py
Normal file
@@ -0,0 +1,882 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This script is for internal use to convert all datasets under the 'lerobot' hub user account to v2.
|
||||||
|
|
||||||
|
Note: Since the original Aloha datasets don't use shadow motors, you need to comment those out in
|
||||||
|
lerobot/configs/robot/aloha.yaml before running this script.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import traceback
|
||||||
|
from pathlib import Path
|
||||||
|
from textwrap import dedent
|
||||||
|
|
||||||
|
from lerobot import available_datasets
|
||||||
|
from lerobot.common.datasets.v2.convert_dataset_v1_to_v2 import convert_dataset, parse_robot_config
|
||||||
|
|
||||||
|
LOCAL_DIR = Path("data/")
|
||||||
|
|
||||||
|
ALOHA_CONFIG = Path("lerobot/configs/robot/aloha.yaml")
|
||||||
|
ALOHA_MOBILE_INFO = {
|
||||||
|
"robot_config": parse_robot_config(ALOHA_CONFIG),
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://mobile-aloha.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.02117",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{fu2024mobile,
|
||||||
|
author = {Fu, Zipeng and Zhao, Tony Z. and Finn, Chelsea},
|
||||||
|
title = {Mobile ALOHA: Learning Bimanual Mobile Manipulation with Low-Cost Whole-Body Teleoperation},
|
||||||
|
booktitle = {arXiv},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
ALOHA_STATIC_INFO = {
|
||||||
|
"robot_config": parse_robot_config(ALOHA_CONFIG),
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://tonyzhaozh.github.io/aloha/",
|
||||||
|
"paper": "https://arxiv.org/abs/2304.13705",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{Zhao2023LearningFB,
|
||||||
|
title={Learning Fine-Grained Bimanual Manipulation with Low-Cost Hardware},
|
||||||
|
author={Tony Zhao and Vikash Kumar and Sergey Levine and Chelsea Finn},
|
||||||
|
journal={RSS},
|
||||||
|
year={2023},
|
||||||
|
volume={abs/2304.13705},
|
||||||
|
url={https://arxiv.org/abs/2304.13705}
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
PUSHT_INFO = {
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://diffusion-policy.cs.columbia.edu/",
|
||||||
|
"paper": "https://arxiv.org/abs/2303.04137v5",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{chi2024diffusionpolicy,
|
||||||
|
author = {Cheng Chi and Zhenjia Xu and Siyuan Feng and Eric Cousineau and Yilun Du and Benjamin Burchfiel and Russ Tedrake and Shuran Song},
|
||||||
|
title ={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||||
|
journal = {The International Journal of Robotics Research},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
XARM_INFO = {
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://www.nicklashansen.com/td-mpc/",
|
||||||
|
"paper": "https://arxiv.org/abs/2203.04955",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{Hansen2022tdmpc,
|
||||||
|
title={Temporal Difference Learning for Model Predictive Control},
|
||||||
|
author={Nicklas Hansen and Xiaolong Wang and Hao Su},
|
||||||
|
booktitle={ICML},
|
||||||
|
year={2022}
|
||||||
|
}
|
||||||
|
"""),
|
||||||
|
}
|
||||||
|
UNITREEH_INFO = {
|
||||||
|
"license": "apache-2.0",
|
||||||
|
}
|
||||||
|
|
||||||
|
DATASETS = {
|
||||||
|
"aloha_mobile_cabinet": {
|
||||||
|
"single_task": "Open the top cabinet, store the pot inside it then close the cabinet.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_chair": {
|
||||||
|
"single_task": "Push the chairs in front of the desk to place them against it.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_elevator": {
|
||||||
|
"single_task": "Take the elevator to the 1st floor.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_shrimp": {
|
||||||
|
"single_task": "Sauté the raw shrimp on both sides, then serve it in the bowl.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_wash_pan": {
|
||||||
|
"single_task": "Pick up the pan, rinse it in the sink and then place it in the drying rack.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_wipe_wine": {
|
||||||
|
"single_task": "Pick up the wet cloth on the faucet and use it to clean the spilled wine on the table and underneath the glass.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_battery": {
|
||||||
|
"single_task": "Place the battery into the slot of the remote controller.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_candy": {"single_task": "Pick up the candy and unwrap it.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_static_coffee": {
|
||||||
|
"single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray, then push the 'Hot Water' and 'Travel Mug' buttons.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_coffee_new": {
|
||||||
|
"single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_cups_open": {
|
||||||
|
"single_task": "Pick up the plastic cup and open its lid.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_fork_pick_up": {
|
||||||
|
"single_task": "Pick up the fork and place it on the plate.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_pingpong_test": {
|
||||||
|
"single_task": "Transfer one of the two balls in the right glass into the left glass, then transfer it back to the right glass.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_pro_pencil": {
|
||||||
|
"single_task": "Pick up the pencil with the right arm, hand it over to the left arm then place it back onto the table.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_screw_driver": {
|
||||||
|
"single_task": "Pick up the screwdriver with the right arm, hand it over to the left arm then place it into the cup.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_tape": {
|
||||||
|
"single_task": "Cut a small piece of tape from the tape dispenser then place it on the cardboard box's edge.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_thread_velcro": {
|
||||||
|
"single_task": "Pick up the velcro cable tie with the left arm, then insert the end of the velcro tie into the other end's loop with the right arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_towel": {
|
||||||
|
"single_task": "Pick up a piece of paper towel and place it on the spilled liquid.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_vinh_cup": {
|
||||||
|
"single_task": "Pick up the platic cup with the right arm, then pop its lid open with the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_vinh_cup_left": {
|
||||||
|
"single_task": "Pick up the platic cup with the left arm, then pop its lid open with the right arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_ziploc_slide": {"single_task": "Slide open the ziploc bag.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_scripted": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_scripted_image": {
|
||||||
|
"single_task": "Insert the peg into the socket.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_insertion_human": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_human_image": {
|
||||||
|
"single_task": "Insert the peg into the socket.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_scripted": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_scripted_image": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_human": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_human_image": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"pusht": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
|
||||||
|
"pusht_image": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
|
||||||
|
"unitreeh1_fold_clothes": {"single_task": "Fold the sweatshirt.", **UNITREEH_INFO},
|
||||||
|
"unitreeh1_rearrange_objects": {"single_task": "Put the object into the bin.", **UNITREEH_INFO},
|
||||||
|
"unitreeh1_two_robot_greeting": {
|
||||||
|
"single_task": "Greet the other robot with a high five.",
|
||||||
|
**UNITREEH_INFO,
|
||||||
|
},
|
||||||
|
"unitreeh1_warehouse": {
|
||||||
|
"single_task": "Grab the spray paint on the shelf and place it in the bin on top of the robot dog.",
|
||||||
|
**UNITREEH_INFO,
|
||||||
|
},
|
||||||
|
"xarm_lift_medium": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_replay": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_replay_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_push_medium": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_replay": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_replay_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"umi_cup_in_the_wild": {
|
||||||
|
"single_task": "Put the cup on the plate.",
|
||||||
|
"license": "apache-2.0",
|
||||||
|
},
|
||||||
|
"asu_table_top": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://link.springer.com/article/10.1007/s10514-023-10129-1",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{zhou2023modularity,
|
||||||
|
title={Modularity through Attention: Efficient Training and Transfer of Language-Conditioned Policies for Robot Manipulation},
|
||||||
|
author={Zhou, Yifan and Sonawani, Shubham and Phielipp, Mariano and Stepputtis, Simon and Amor, Heni},
|
||||||
|
booktitle={Conference on Robot Learning},
|
||||||
|
pages={1684--1695},
|
||||||
|
year={2023},
|
||||||
|
organization={PMLR}
|
||||||
|
}
|
||||||
|
@article{zhou2023learning,
|
||||||
|
title={Learning modular language-conditioned robot policies through attention},
|
||||||
|
author={Zhou, Yifan and Sonawani, Shubham and Phielipp, Mariano and Ben Amor, Heni and Stepputtis, Simon},
|
||||||
|
journal={Autonomous Robots},
|
||||||
|
pages={1--21},
|
||||||
|
year={2023},
|
||||||
|
publisher={Springer}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_buds_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/BUDS-website/",
|
||||||
|
"paper": "https://arxiv.org/abs/2109.13841",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{zhu2022bottom,
|
||||||
|
title={Bottom-Up Skill Discovery From Unsegmented Demonstrations for Long-Horizon Robot Manipulation},
|
||||||
|
author={Zhu, Yifeng and Stone, Peter and Zhu, Yuke},
|
||||||
|
journal={IEEE Robotics and Automation Letters},
|
||||||
|
volume={7},
|
||||||
|
number={2},
|
||||||
|
pages={4126--4133},
|
||||||
|
year={2022},
|
||||||
|
publisher={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_sailor_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/sailor/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.11435",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{nasiriany2022sailor,
|
||||||
|
title={Learning and Retrieval from Prior Data for Skill-based Imitation Learning},
|
||||||
|
author={Soroush Nasiriany and Tian Gao and Ajay Mandlekar and Yuke Zhu},
|
||||||
|
booktitle={Conference on Robot Learning (CoRL)},
|
||||||
|
year={2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_sirius_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/sirius/",
|
||||||
|
"paper": "https://arxiv.org/abs/2211.08416",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{liu2022robot,
|
||||||
|
title = {Robot Learning on the Job: Human-in-the-Loop Autonomy and Learning During Deployment},
|
||||||
|
author = {Huihan Liu and Soroush Nasiriany and Lance Zhang and Zhiyao Bao and Yuke Zhu},
|
||||||
|
booktitle = {Robotics: Science and Systems (RSS)},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_autolab_ur5": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://sites.google.com/view/berkeley-ur5/home",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{BerkeleyUR5Website,
|
||||||
|
title = {Berkeley {UR5} Demonstration Dataset},
|
||||||
|
author = {Lawrence Yunliang Chen and Simeon Adebola and Ken Goldberg},
|
||||||
|
howpublished = {https://sites.google.com/view/berkeley-ur5/home},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_cable_routing": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://sites.google.com/view/cablerouting/home",
|
||||||
|
"paper": "https://arxiv.org/abs/2307.08927",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{luo2023multistage,
|
||||||
|
author = {Jianlan Luo and Charles Xu and Xinyang Geng and Gilbert Feng and Kuan Fang and Liam Tan and Stefan Schaal and Sergey Levine},
|
||||||
|
title = {Multi-Stage Cable Routing through Hierarchical Imitation Learning},
|
||||||
|
journal = {arXiv pre-print},
|
||||||
|
year = {2023},
|
||||||
|
url = {https://arxiv.org/abs/2307.08927},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_fanuc_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/berkeley.edu/fanuc-manipulation",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{fanuc_manipulation2023,
|
||||||
|
title={Fanuc Manipulation: A Dataset for Learning-based Manipulation with FANUC Mate 200iD Robot},
|
||||||
|
author={Zhu, Xinghao and Tian, Ran and Xu, Chenfeng and Ding, Mingyu and Zhan, Wei and Tomizuka, Masayoshi},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_cory_hall": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/1709.10489",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{kahn2018self,
|
||||||
|
title={Self-supervised deep reinforcement learning with generalized computation graphs for robot navigation},
|
||||||
|
author={Kahn, Gregory and Villaflor, Adam and Ding, Bosen and Abbeel, Pieter and Levine, Sergey},
|
||||||
|
booktitle={2018 IEEE international conference on robotics and automation (ICRA)},
|
||||||
|
pages={5129--5136},
|
||||||
|
year={2018},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_recon": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/recon-robot",
|
||||||
|
"paper": "https://arxiv.org/abs/2104.05859",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{shah2021rapid,
|
||||||
|
title={Rapid Exploration for Open-World Navigation with Latent Goal Models},
|
||||||
|
author={Dhruv Shah and Benjamin Eysenbach and Nicholas Rhinehart and Sergey Levine},
|
||||||
|
booktitle={5th Annual Conference on Robot Learning },
|
||||||
|
year={2021},
|
||||||
|
url={https://openreview.net/forum?id=d_SWJhyKfVw}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_sac_son": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/SACSoN-review",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.01874",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{hirose2023sacson,
|
||||||
|
title={SACSoN: Scalable Autonomous Data Collection for Social Navigation},
|
||||||
|
author={Hirose, Noriaki and Shah, Dhruv and Sridhar, Ajay and Levine, Sergey},
|
||||||
|
journal={arXiv preprint arXiv:2306.01874},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_mvp": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/2203.06173",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@InProceedings{Radosavovic2022,
|
||||||
|
title = {Real-World Robot Learning with Masked Visual Pre-training},
|
||||||
|
author = {Ilija Radosavovic and Tete Xiao and Stephen James and Pieter Abbeel and Jitendra Malik and Trevor Darrell},
|
||||||
|
booktitle = {CoRL},
|
||||||
|
year = {2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_rpt": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.10007",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{Radosavovic2023,
|
||||||
|
title={Robot Learning with Sensorimotor Pre-training},
|
||||||
|
author={Ilija Radosavovic and Baifeng Shi and Letian Fu and Ken Goldberg and Trevor Darrell and Jitendra Malik},
|
||||||
|
year={2023},
|
||||||
|
journal={arXiv:2306.10007}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_franka_exploration_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://human-world-model.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2308.10901",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{mendonca2023structured,
|
||||||
|
title={Structured World Models from Human Videos},
|
||||||
|
author={Mendonca, Russell and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
journal={RSS},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_play_fusion": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://play-fusion.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2312.04549",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{chen2023playfusion,
|
||||||
|
title={PlayFusion: Skill Acquisition via Diffusion from Language-Annotated Play},
|
||||||
|
author={Chen, Lili and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
booktitle={CoRL},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_stretch": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://robo-affordances.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2304.08488",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{bahl2023affordances,
|
||||||
|
title={Affordances from Human Videos as a Versatile Representation for Robotics},
|
||||||
|
author={Bahl, Shikhar and Mendonca, Russell and Chen, Lili and Jain, Unnat and Pathak, Deepak},
|
||||||
|
booktitle={CVPR},
|
||||||
|
year={2023}
|
||||||
|
}
|
||||||
|
@article{mendonca2023structured,
|
||||||
|
title={Structured World Models from Human Videos},
|
||||||
|
author={Mendonca, Russell and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
journal={CoRL},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"columbia_cairlab_pusht_real": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://diffusion-policy.cs.columbia.edu/",
|
||||||
|
"paper": "https://arxiv.org/abs/2303.04137v5",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{chi2023diffusionpolicy,
|
||||||
|
title={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||||
|
author={Chi, Cheng and Feng, Siyuan and Du, Yilun and Xu, Zhenjia and Cousineau, Eric and Burchfiel, Benjamin and Song, Shuran},
|
||||||
|
booktitle={Proceedings of Robotics: Science and Systems (RSS)},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"conq_hose_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/conq-hose-manipulation-dataset/home",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{ConqHoseManipData,
|
||||||
|
author={Peter Mitrano and Dmitry Berenson},
|
||||||
|
title={Conq Hose Manipulation Dataset, v1.15.0},
|
||||||
|
year={2024},
|
||||||
|
howpublished={https://sites.google.com/view/conq-hose-manipulation-dataset}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_edan_shared_control": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://ieeexplore.ieee.org/document/9341156",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{vogel_edan_2020,
|
||||||
|
title = {EDAN - an EMG-Controlled Daily Assistant to Help People with Physical Disabilities},
|
||||||
|
language = {en},
|
||||||
|
booktitle = {2020 {IEEE}/{RSJ} {International} {Conference} on {Intelligent} {Robots} and {Systems} ({IROS})},
|
||||||
|
author = {Vogel, Jörn and Hagengruber, Annette and Iskandar, Maged and Quere, Gabriel and Leipscher, Ulrike and Bustamante, Samuel and Dietrich, Alexander and Hoeppner, Hannes and Leidner, Daniel and Albu-Schäffer, Alin},
|
||||||
|
year = {2020}
|
||||||
|
}
|
||||||
|
@inproceedings{quere_shared_2020,
|
||||||
|
address = {Paris, France},
|
||||||
|
title = {Shared {Control} {Templates} for {Assistive} {Robotics}},
|
||||||
|
language = {en},
|
||||||
|
booktitle = {2020 {IEEE} {International} {Conference} on {Robotics} and {Automation} ({ICRA})},
|
||||||
|
author = {Quere, Gabriel and Hagengruber, Annette and Iskandar, Maged and Bustamante, Samuel and Leidner, Daniel and Stulp, Freek and Vogel, Joern},
|
||||||
|
year = {2020},
|
||||||
|
pages = {7},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_sara_grid_clamp": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://www.researchsquare.com/article/rs-3289569/v1",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{padalkar2023guided,
|
||||||
|
title={A guided reinforcement learning approach using shared control templates for learning manipulation skills in the real world},
|
||||||
|
author={Padalkar, Abhishek and Quere, Gabriel and Raffin, Antonin and Silv{\'e}rio, Jo{\~a}o and Stulp, Freek},
|
||||||
|
journal={Research square preprint rs-3289569/v1},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_sara_pour": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://elib.dlr.de/193739/1/padalkar2023rlsct.pdf",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{padalkar2023guiding,
|
||||||
|
title={Guiding Reinforcement Learning with Shared Control Templates},
|
||||||
|
author={Padalkar, Abhishek and Quere, Gabriel and Steinmetz, Franz and Raffin, Antonin and Nieuwenhuisen, Matthias and Silv{\'e}rio, Jo{\~a}o and Stulp, Freek},
|
||||||
|
booktitle={40th IEEE International Conference on Robotics and Automation, ICRA 2023},
|
||||||
|
year={2023},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"droid_100": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://droid-dataset.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2403.12945",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{khazatsky2024droid,
|
||||||
|
title = {DROID: A Large-Scale In-The-Wild Robot Manipulation Dataset},
|
||||||
|
author = {Alexander Khazatsky and Karl Pertsch and Suraj Nair and Ashwin Balakrishna and Sudeep Dasari and Siddharth Karamcheti and Soroush Nasiriany and Mohan Kumar Srirama and Lawrence Yunliang Chen and Kirsty Ellis and Peter David Fagan and Joey Hejna and Masha Itkina and Marion Lepert and Yecheng Jason Ma and Patrick Tree Miller and Jimmy Wu and Suneel Belkhale and Shivin Dass and Huy Ha and Arhan Jain and Abraham Lee and Youngwoon Lee and Marius Memmel and Sungjae Park and Ilija Radosavovic and Kaiyuan Wang and Albert Zhan and Kevin Black and Cheng Chi and Kyle Beltran Hatch and Shan Lin and Jingpei Lu and Jean Mercat and Abdul Rehman and Pannag R Sanketi and Archit Sharma and Cody Simpson and Quan Vuong and Homer Rich Walke and Blake Wulfe and Ted Xiao and Jonathan Heewon Yang and Arefeh Yavary and Tony Z. Zhao and Christopher Agia and Rohan Baijal and Mateo Guaman Castro and Daphne Chen and Qiuyu Chen and Trinity Chung and Jaimyn Drake and Ethan Paul Foster and Jensen Gao and David Antonio Herrera and Minho Heo and Kyle Hsu and Jiaheng Hu and Donovon Jackson and Charlotte Le and Yunshuang Li and Kevin Lin and Roy Lin and Zehan Ma and Abhiram Maddukuri and Suvir Mirchandani and Daniel Morton and Tony Nguyen and Abigail O'Neill and Rosario Scalise and Derick Seale and Victor Son and Stephen Tian and Emi Tran and Andrew E. Wang and Yilin Wu and Annie Xie and Jingyun Yang and Patrick Yin and Yunchu Zhang and Osbert Bastani and Glen Berseth and Jeannette Bohg and Ken Goldberg and Abhinav Gupta and Abhishek Gupta and Dinesh Jayaraman and Joseph J Lim and Jitendra Malik and Roberto Martín-Martín and Subramanian Ramamoorthy and Dorsa Sadigh and Shuran Song and Jiajun Wu and Michael C. Yip and Yuke Zhu and Thomas Kollar and Sergey Levine and Chelsea Finn},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"fmb": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://functional-manipulation-benchmark.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.08553",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{luo2024fmb,
|
||||||
|
title={FMB: a Functional Manipulation Benchmark for Generalizable Robotic Learning},
|
||||||
|
author={Luo, Jianlan and Xu, Charles and Liu, Fangchen and Tan, Liam and Lin, Zipeng and Wu, Jeffrey and Abbeel, Pieter and Levine, Sergey},
|
||||||
|
journal={arXiv preprint arXiv:2401.08553},
|
||||||
|
year={2024}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"iamlab_cmu_pickup_insert": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://openreview.net/forum?id=WuBv9-IGDUA",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.14502",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{saxena2023multiresolution,
|
||||||
|
title={Multi-Resolution Sensing for Real-Time Control with Vision-Language Models},
|
||||||
|
author={Saumya Saxena and Mohit Sharma and Oliver Kroemer},
|
||||||
|
booktitle={7th Annual Conference on Robot Learning},
|
||||||
|
year={2023},
|
||||||
|
url={https://openreview.net/forum?id=WuBv9-IGDUA}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"imperialcollege_sawyer_wrist_cam": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
},
|
||||||
|
"jaco_play": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://github.com/clvrai/clvr_jaco_play_dataset",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@software{dass2023jacoplay,
|
||||||
|
author = {Dass, Shivin and Yapeter, Jullian and Zhang, Jesse and Zhang, Jiahui
|
||||||
|
and Pertsch, Karl and Nikolaidis, Stefanos and Lim, Joseph J.},
|
||||||
|
title = {CLVR Jaco Play Dataset},
|
||||||
|
url = {https://github.com/clvrai/clvr_jaco_play_dataset},
|
||||||
|
version = {1.0.0},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"kaist_nonprehensile": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://github.com/JaeHyung-Kim/rlds_dataset_builder",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{kimpre,
|
||||||
|
title={Pre-and post-contact policy decomposition for non-prehensile manipulation with zero-shot sim-to-real transfer},
|
||||||
|
author={Kim, Minchan and Han, Junhyek and Kim, Jaehyung and Kim, Beomjoon},
|
||||||
|
booktitle={2023 IEEE/RSJ International Conference on Intelligent Robots and Systems (IROS)},
|
||||||
|
year={2023},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_door_opening_surprising_effectiveness": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://jyopari.github.io/VINN/",
|
||||||
|
"paper": "https://arxiv.org/abs/2112.01511",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{pari2021surprising,
|
||||||
|
title={The Surprising Effectiveness of Representation Learning for Visual Imitation},
|
||||||
|
author={Jyothish Pari and Nur Muhammad Shafiullah and Sridhar Pandian Arunachalam and Lerrel Pinto},
|
||||||
|
year={2021},
|
||||||
|
eprint={2112.01511},
|
||||||
|
archivePrefix={arXiv},
|
||||||
|
primaryClass={cs.RO}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_franka_play_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://play-to-policy.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.10047",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{cui2022play,
|
||||||
|
title = {From Play to Policy: Conditional Behavior Generation from Uncurated Robot Data},
|
||||||
|
author = {Cui, Zichen Jeff and Wang, Yibin and Shafiullah, Nur Muhammad Mahi and Pinto, Lerrel},
|
||||||
|
journal = {arXiv preprint arXiv:2210.10047},
|
||||||
|
year = {2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_rot_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://rot-robot.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2206.15469",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{haldar2023watch,
|
||||||
|
title={Watch and match: Supercharging imitation with regularized optimal transport},
|
||||||
|
author={Haldar, Siddhant and Mathur, Vaibhav and Yarats, Denis and Pinto, Lerrel},
|
||||||
|
booktitle={Conference on Robot Learning},
|
||||||
|
pages={32--43},
|
||||||
|
year={2023},
|
||||||
|
organization={PMLR}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"roboturk": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://roboturk.stanford.edu/dataset_real.html",
|
||||||
|
"paper": "PAPER",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{mandlekar2019scaling,
|
||||||
|
title={Scaling robot supervision to hundreds of hours with roboturk: Robotic manipulation dataset through human reasoning and dexterity},
|
||||||
|
author={Mandlekar, Ajay and Booher, Jonathan and Spero, Max and Tung, Albert and Gupta, Anchit and Zhu, Yuke and Garg, Animesh and Savarese, Silvio and Fei-Fei, Li},
|
||||||
|
booktitle={2019 IEEE/RSJ International Conference on Intelligent Robots and Systems (IROS)},
|
||||||
|
pages={1048--1055},
|
||||||
|
year={2019},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_hydra_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/hydra-il-2023",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.17237",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{belkhale2023hydra,
|
||||||
|
title={HYDRA: Hybrid Robot Actions for Imitation Learning},
|
||||||
|
author={Belkhale, Suneel and Cui, Yuchen and Sadigh, Dorsa},
|
||||||
|
journal={arxiv},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_kuka_multimodal_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/visionandtouch",
|
||||||
|
"paper": "https://arxiv.org/abs/1810.10191",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{lee2019icra,
|
||||||
|
title={Making sense of vision and touch: Self-supervised learning of multimodal representations for contact-rich tasks},
|
||||||
|
author={Lee, Michelle A and Zhu, Yuke and Srinivasan, Krishnan and Shah, Parth and Savarese, Silvio and Fei-Fei, Li and Garg, Animesh and Bohg, Jeannette},
|
||||||
|
booktitle={2019 IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
year={2019},
|
||||||
|
url={https://arxiv.org/abs/1810.10191}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_robocook": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://hshi74.github.io/robocook/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.14447",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{shi2023robocook,
|
||||||
|
title={RoboCook: Long-Horizon Elasto-Plastic Object Manipulation with Diverse Tools},
|
||||||
|
author={Shi, Haochen and Xu, Huazhe and Clarke, Samuel and Li, Yunzhu and Wu, Jiajun},
|
||||||
|
journal={arXiv preprint arXiv:2306.14447},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"taco_play": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://www.kaggle.com/datasets/oiermees/taco-robot",
|
||||||
|
"paper": "https://arxiv.org/abs/2209.08959, https://arxiv.org/abs/2210.01911",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{rosete2022tacorl,
|
||||||
|
author = {Erick Rosete-Beas and Oier Mees and Gabriel Kalweit and Joschka Boedecker and Wolfram Burgard},
|
||||||
|
title = {Latent Plans for Task Agnostic Offline Reinforcement Learning},
|
||||||
|
journal = {Proceedings of the 6th Conference on Robot Learning (CoRL)},
|
||||||
|
year = {2022}
|
||||||
|
}
|
||||||
|
@inproceedings{mees23hulc2,
|
||||||
|
title={Grounding Language with Visual Affordances over Unstructured Data},
|
||||||
|
author={Oier Mees and Jessica Borja-Diaz and Wolfram Burgard},
|
||||||
|
booktitle = {Proceedings of the IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
year={2023},
|
||||||
|
address = {London, UK}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"tokyo_u_lsmo": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "URL",
|
||||||
|
"paper": "https://arxiv.org/abs/2107.05842",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@Article{Osa22,
|
||||||
|
author = {Takayuki Osa},
|
||||||
|
journal = {The International Journal of Robotics Research},
|
||||||
|
title = {Motion Planning by Learning the Solution Manifold in Trajectory Optimization},
|
||||||
|
year = {2022},
|
||||||
|
number = {3},
|
||||||
|
pages = {291--311},
|
||||||
|
volume = {41},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"toto": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://toto-benchmark.org/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.00942",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{zhou2023train,
|
||||||
|
author={Zhou, Gaoyue and Dean, Victoria and Srirama, Mohan Kumar and Rajeswaran, Aravind and Pari, Jyothish and Hatch, Kyle and Jain, Aryan and Yu, Tianhe and Abbeel, Pieter and Pinto, Lerrel and Finn, Chelsea and Gupta, Abhinav},
|
||||||
|
booktitle={2023 IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
title={Train Offline, Test Online: A Real Robot Learning Benchmark},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"ucsd_kitchen_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@ARTICLE{ucsd_kitchens,
|
||||||
|
author = {Ge Yan, Kris Wu, and Xiaolong Wang},
|
||||||
|
title = {{ucsd kitchens Dataset}},
|
||||||
|
year = {2023},
|
||||||
|
month = {August}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"ucsd_pick_and_place_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://owmcorl.github.io/#",
|
||||||
|
"paper": "https://arxiv.org/abs/2310.16029",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@preprint{Feng2023Finetuning,
|
||||||
|
title={Finetuning Offline World Models in the Real World},
|
||||||
|
author={Yunhai Feng, Nicklas Hansen, Ziyan Xiong, Chandramouli Rajagopalan, Xiaolong Wang},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"uiuc_d3field": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://robopil.github.io/d3fields/",
|
||||||
|
"paper": "https://arxiv.org/abs/2309.16118",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{wang2023d3field,
|
||||||
|
title={D^3Field: Dynamic 3D Descriptor Fields for Generalizable Robotic Manipulation},
|
||||||
|
author={Wang, Yixuan and Li, Zhuoran and Zhang, Mingtong and Driggs-Campbell, Katherine and Wu, Jiajun and Fei-Fei, Li and Li, Yunzhu},
|
||||||
|
journal={arXiv preprint arXiv:},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"usc_cloth_sim": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://uscresl.github.io/dmfd/",
|
||||||
|
"paper": "https://arxiv.org/abs/2207.10148",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{salhotra2022dmfd,
|
||||||
|
author={Salhotra, Gautam and Liu, I-Chun Arthur and Dominguez-Kuhne, Marcus and Sukhatme, Gaurav S.},
|
||||||
|
journal={IEEE Robotics and Automation Letters},
|
||||||
|
title={Learning Deformable Object Manipulation From Expert Demonstrations},
|
||||||
|
year={2022},
|
||||||
|
volume={7},
|
||||||
|
number={4},
|
||||||
|
pages={8775-8782},
|
||||||
|
doi={10.1109/LRA.2022.3187843}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utaustin_mutex": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/MUTEX/",
|
||||||
|
"paper": "https://arxiv.org/abs/2309.14320",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{shah2023mutex,
|
||||||
|
title={{MUTEX}: Learning Unified Policies from Multimodal Task Specifications},
|
||||||
|
author={Rutav Shah and Roberto Mart{\'\i}n-Mart{\'\i}n and Yuke Zhu},
|
||||||
|
booktitle={7th Annual Conference on Robot Learning},
|
||||||
|
year={2023},
|
||||||
|
url={https://openreview.net/forum?id=PwqiqaaEzJ}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_pr2_opening_fridge": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{oh2023pr2utokyodatasets,
|
||||||
|
author={Jihoon Oh and Naoaki Kanazawa and Kento Kawaharazuka},
|
||||||
|
title={X-Embodiment U-Tokyo PR2 Datasets},
|
||||||
|
year={2023},
|
||||||
|
url={https://github.com/ojh6404/rlds_dataset_builder},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_pr2_tabletop_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{oh2023pr2utokyodatasets,
|
||||||
|
author={Jihoon Oh and Naoaki Kanazawa and Kento Kawaharazuka},
|
||||||
|
title={X-Embodiment U-Tokyo PR2 Datasets},
|
||||||
|
year={2023},
|
||||||
|
url={https://github.com/ojh6404/rlds_dataset_builder},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_saytap": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://saytap.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.07580",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{saytap2023,
|
||||||
|
author = {Yujin Tang and Wenhao Yu and Jie Tan and Heiga Zen and Aleksandra Faust and
|
||||||
|
Tatsuya Harada},
|
||||||
|
title = {SayTap: Language to Quadrupedal Locomotion},
|
||||||
|
eprint = {arXiv:2306.07580},
|
||||||
|
url = {https://saytap.github.io},
|
||||||
|
note = {https://saytap.github.io},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_xarm_bimanual": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{matsushima2023weblab,
|
||||||
|
title={Weblab xArm Dataset},
|
||||||
|
author={Tatsuya Matsushima and Hiroki Furuta and Yusuke Iwasawa and Yutaka Matsuo},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_xarm_pick_and_place": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{matsushima2023weblab,
|
||||||
|
title={Weblab xArm Dataset},
|
||||||
|
author={Tatsuya Matsushima and Hiroki Furuta and Yusuke Iwasawa and Yutaka Matsuo},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"viola": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/VIOLA/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.11339",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{zhu2022viola,
|
||||||
|
title={VIOLA: Imitation Learning for Vision-Based Manipulation with Object Proposal Priors},
|
||||||
|
author={Zhu, Yifeng and Joshi, Abhishek and Stone, Peter and Zhu, Yuke},
|
||||||
|
journal={6th Annual Conference on Robot Learning (CoRL)},
|
||||||
|
year={2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def batch_convert():
|
||||||
|
status = {}
|
||||||
|
logfile = LOCAL_DIR / "conversion_log.txt"
|
||||||
|
assert set(DATASETS) == {id_.split("/")[1] for id_ in available_datasets}
|
||||||
|
for num, (name, kwargs) in enumerate(DATASETS.items()):
|
||||||
|
repo_id = f"lerobot/{name}"
|
||||||
|
print(f"\nConverting {repo_id} ({num}/{len(DATASETS)})")
|
||||||
|
print("---------------------------------------------------------")
|
||||||
|
try:
|
||||||
|
convert_dataset(repo_id, LOCAL_DIR, **kwargs)
|
||||||
|
status = f"{repo_id}: success."
|
||||||
|
with open(logfile, "a") as file:
|
||||||
|
file.write(status + "\n")
|
||||||
|
except Exception:
|
||||||
|
status = f"{repo_id}: failed\n {traceback.format_exc()}"
|
||||||
|
with open(logfile, "a") as file:
|
||||||
|
file.write(status + "\n")
|
||||||
|
continue
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
batch_convert()
|
||||||
665
lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py
Normal file
665
lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py
Normal file
@@ -0,0 +1,665 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This script will help you convert any LeRobot dataset already pushed to the hub from codebase version 1.6 to
|
||||||
|
2.0. You will be required to provide the 'tasks', which is a short but accurate description in plain English
|
||||||
|
for each of the task performed in the dataset. This will allow to easily train models with task-conditionning.
|
||||||
|
|
||||||
|
We support 3 different scenarios for these tasks (see instructions below):
|
||||||
|
1. Single task dataset: all episodes of your dataset have the same single task.
|
||||||
|
2. Single task episodes: the episodes of your dataset each contain a single task but they can differ from
|
||||||
|
one episode to the next.
|
||||||
|
3. Multi task episodes: episodes of your dataset may each contain several different tasks.
|
||||||
|
|
||||||
|
|
||||||
|
Can you can also provide a robot config .yaml file (not mandatory) to this script via the option
|
||||||
|
'--robot-config' so that it writes information about the robot (robot type, motors names) this dataset was
|
||||||
|
recorded with. For now, only Aloha/Koch type robots are supported with this option.
|
||||||
|
|
||||||
|
|
||||||
|
# 1. Single task dataset
|
||||||
|
If your dataset contains a single task, you can simply provide it directly via the CLI with the
|
||||||
|
'--single-task' option.
|
||||||
|
|
||||||
|
Examples:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/aloha_sim_insertion_human_image \
|
||||||
|
--single-task "Insert the peg into the socket." \
|
||||||
|
--robot-config lerobot/configs/robot/aloha.yaml \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id aliberts/koch_tutorial \
|
||||||
|
--single-task "Pick the Lego block and drop it in the box on the right." \
|
||||||
|
--robot-config lerobot/configs/robot/koch.yaml \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
# 2. Single task episodes
|
||||||
|
If your dataset is a multi-task dataset, you have two options to provide the tasks to this script:
|
||||||
|
|
||||||
|
- If your dataset already contains a language instruction column in its parquet file, you can simply provide
|
||||||
|
this column's name with the '--tasks-col' arg.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/stanford_kuka_multimodal_dataset \
|
||||||
|
--tasks-col "language_instruction" \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
- If your dataset doesn't contain a language instruction, you should provide the path to a .json file with the
|
||||||
|
'--tasks-path' arg. This file should have the following structure where keys correspond to each
|
||||||
|
episode_index in the dataset, and values are the language instruction for that episode.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```json
|
||||||
|
{
|
||||||
|
"0": "Do something",
|
||||||
|
"1": "Do something else",
|
||||||
|
"2": "Do something",
|
||||||
|
"3": "Go there",
|
||||||
|
...
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
# 3. Multi task episodes
|
||||||
|
If you have multiple tasks per episodes, your dataset should contain a language instruction column in its
|
||||||
|
parquet file, and you must provide this column's name with the '--tasks-col' arg.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/stanford_kuka_multimodal_dataset \
|
||||||
|
--tasks-col "language_instruction" \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import contextlib
|
||||||
|
import filecmp
|
||||||
|
import json
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import shutil
|
||||||
|
import subprocess
|
||||||
|
import tempfile
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import datasets
|
||||||
|
import pyarrow.compute as pc
|
||||||
|
import pyarrow.parquet as pq
|
||||||
|
import torch
|
||||||
|
from datasets import Dataset
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
from huggingface_hub.errors import EntryNotFoundError, HfHubHTTPError
|
||||||
|
from safetensors.torch import load_file
|
||||||
|
|
||||||
|
from lerobot.common.datasets.utils import (
|
||||||
|
DEFAULT_CHUNK_SIZE,
|
||||||
|
DEFAULT_PARQUET_PATH,
|
||||||
|
DEFAULT_VIDEO_PATH,
|
||||||
|
EPISODES_PATH,
|
||||||
|
INFO_PATH,
|
||||||
|
STATS_PATH,
|
||||||
|
TASKS_PATH,
|
||||||
|
create_branch,
|
||||||
|
create_lerobot_dataset_card,
|
||||||
|
flatten_dict,
|
||||||
|
get_hub_safe_version,
|
||||||
|
load_json,
|
||||||
|
unflatten_dict,
|
||||||
|
write_json,
|
||||||
|
write_jsonlines,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.video_utils import (
|
||||||
|
VideoFrame, # noqa: F401
|
||||||
|
get_image_pixel_channels,
|
||||||
|
get_video_info,
|
||||||
|
)
|
||||||
|
from lerobot.common.utils.utils import init_hydra_config
|
||||||
|
|
||||||
|
V16 = "v1.6"
|
||||||
|
V20 = "v2.0"
|
||||||
|
|
||||||
|
GITATTRIBUTES_REF = "aliberts/gitattributes_reference"
|
||||||
|
V1_VIDEO_FILE = "{video_key}_episode_{episode_index:06d}.mp4"
|
||||||
|
V1_INFO_PATH = "meta_data/info.json"
|
||||||
|
V1_STATS_PATH = "meta_data/stats.safetensors"
|
||||||
|
|
||||||
|
|
||||||
|
def parse_robot_config(config_path: Path, config_overrides: list[str] | None = None) -> tuple[str, dict]:
|
||||||
|
robot_cfg = init_hydra_config(config_path, config_overrides)
|
||||||
|
if robot_cfg["robot_type"] in ["aloha", "koch"]:
|
||||||
|
state_names = [
|
||||||
|
f"{arm}_{motor}" if len(robot_cfg["follower_arms"]) > 1 else motor
|
||||||
|
for arm in robot_cfg["follower_arms"]
|
||||||
|
for motor in robot_cfg["follower_arms"][arm]["motors"]
|
||||||
|
]
|
||||||
|
action_names = [
|
||||||
|
# f"{arm}_{motor}" for arm in ["left", "right"] for motor in robot_cfg["leader_arms"][arm]["motors"]
|
||||||
|
f"{arm}_{motor}" if len(robot_cfg["leader_arms"]) > 1 else motor
|
||||||
|
for arm in robot_cfg["leader_arms"]
|
||||||
|
for motor in robot_cfg["leader_arms"][arm]["motors"]
|
||||||
|
]
|
||||||
|
# elif robot_cfg["robot_type"] == "stretch3": TODO
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(
|
||||||
|
"Please provide robot_config={'robot_type': ..., 'names': ...} directly to convert_dataset()."
|
||||||
|
)
|
||||||
|
|
||||||
|
return {
|
||||||
|
"robot_type": robot_cfg["robot_type"],
|
||||||
|
"names": {
|
||||||
|
"observation.state": state_names,
|
||||||
|
"observation.effort": state_names,
|
||||||
|
"action": action_names,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def convert_stats_to_json(v1_dir: Path, v2_dir: Path) -> None:
|
||||||
|
safetensor_path = v1_dir / V1_STATS_PATH
|
||||||
|
stats = load_file(safetensor_path)
|
||||||
|
serialized_stats = {key: value.tolist() for key, value in stats.items()}
|
||||||
|
serialized_stats = unflatten_dict(serialized_stats)
|
||||||
|
|
||||||
|
json_path = v2_dir / STATS_PATH
|
||||||
|
json_path.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with open(json_path, "w") as f:
|
||||||
|
json.dump(serialized_stats, f, indent=4)
|
||||||
|
|
||||||
|
# Sanity check
|
||||||
|
with open(json_path) as f:
|
||||||
|
stats_json = json.load(f)
|
||||||
|
|
||||||
|
stats_json = flatten_dict(stats_json)
|
||||||
|
stats_json = {key: torch.tensor(value) for key, value in stats_json.items()}
|
||||||
|
for key in stats:
|
||||||
|
torch.testing.assert_close(stats_json[key], stats[key])
|
||||||
|
|
||||||
|
|
||||||
|
def get_features_from_hf_dataset(dataset: Dataset, robot_config: dict | None = None) -> dict[str, list]:
|
||||||
|
features = {}
|
||||||
|
for key, ft in dataset.features.items():
|
||||||
|
if isinstance(ft, datasets.Value):
|
||||||
|
dtype = ft.dtype
|
||||||
|
shape = (1,)
|
||||||
|
names = None
|
||||||
|
if isinstance(ft, datasets.Sequence):
|
||||||
|
assert isinstance(ft.feature, datasets.Value)
|
||||||
|
dtype = ft.feature.dtype
|
||||||
|
shape = (ft.length,)
|
||||||
|
motor_names = (
|
||||||
|
robot_config["names"][key] if robot_config else [f"motor_{i}" for i in range(ft.length)]
|
||||||
|
)
|
||||||
|
assert len(motor_names) == shape[0]
|
||||||
|
names = {"motors": motor_names}
|
||||||
|
elif isinstance(ft, datasets.Image):
|
||||||
|
dtype = "image"
|
||||||
|
image = dataset[0][key] # Assuming first row
|
||||||
|
channels = get_image_pixel_channels(image)
|
||||||
|
shape = (image.height, image.width, channels)
|
||||||
|
names = ["height", "width", "channel"]
|
||||||
|
elif ft._type == "VideoFrame":
|
||||||
|
dtype = "video"
|
||||||
|
shape = None # Add shape later
|
||||||
|
names = ["height", "width", "channel"]
|
||||||
|
|
||||||
|
features[key] = {
|
||||||
|
"dtype": dtype,
|
||||||
|
"shape": shape,
|
||||||
|
"names": names,
|
||||||
|
}
|
||||||
|
|
||||||
|
return features
|
||||||
|
|
||||||
|
|
||||||
|
def add_task_index_by_episodes(dataset: Dataset, tasks_by_episodes: dict) -> tuple[Dataset, list[str]]:
|
||||||
|
df = dataset.to_pandas()
|
||||||
|
tasks = list(set(tasks_by_episodes.values()))
|
||||||
|
tasks_to_task_index = {task: task_idx for task_idx, task in enumerate(tasks)}
|
||||||
|
episodes_to_task_index = {ep_idx: tasks_to_task_index[task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
df["task_index"] = df["episode_index"].map(episodes_to_task_index).astype(int)
|
||||||
|
|
||||||
|
features = dataset.features
|
||||||
|
features["task_index"] = datasets.Value(dtype="int64")
|
||||||
|
dataset = Dataset.from_pandas(df, features=features, split="train")
|
||||||
|
return dataset, tasks
|
||||||
|
|
||||||
|
|
||||||
|
def add_task_index_from_tasks_col(
|
||||||
|
dataset: Dataset, tasks_col: str
|
||||||
|
) -> tuple[Dataset, dict[str, list[str]], list[str]]:
|
||||||
|
df = dataset.to_pandas()
|
||||||
|
|
||||||
|
# HACK: This is to clean some of the instructions in our version of Open X datasets
|
||||||
|
prefix_to_clean = "tf.Tensor(b'"
|
||||||
|
suffix_to_clean = "', shape=(), dtype=string)"
|
||||||
|
df[tasks_col] = df[tasks_col].str.removeprefix(prefix_to_clean).str.removesuffix(suffix_to_clean)
|
||||||
|
|
||||||
|
# Create task_index col
|
||||||
|
tasks_by_episode = df.groupby("episode_index")[tasks_col].unique().apply(lambda x: x.tolist()).to_dict()
|
||||||
|
tasks = df[tasks_col].unique().tolist()
|
||||||
|
tasks_to_task_index = {task: idx for idx, task in enumerate(tasks)}
|
||||||
|
df["task_index"] = df[tasks_col].map(tasks_to_task_index).astype(int)
|
||||||
|
|
||||||
|
# Build the dataset back from df
|
||||||
|
features = dataset.features
|
||||||
|
features["task_index"] = datasets.Value(dtype="int64")
|
||||||
|
dataset = Dataset.from_pandas(df, features=features, split="train")
|
||||||
|
dataset = dataset.remove_columns(tasks_col)
|
||||||
|
|
||||||
|
return dataset, tasks, tasks_by_episode
|
||||||
|
|
||||||
|
|
||||||
|
def split_parquet_by_episodes(
|
||||||
|
dataset: Dataset,
|
||||||
|
total_episodes: int,
|
||||||
|
total_chunks: int,
|
||||||
|
output_dir: Path,
|
||||||
|
) -> list:
|
||||||
|
table = dataset.data.table
|
||||||
|
episode_lengths = []
|
||||||
|
for ep_chunk in range(total_chunks):
|
||||||
|
ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
|
||||||
|
ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
|
||||||
|
chunk_dir = "/".join(DEFAULT_PARQUET_PATH.split("/")[:-1]).format(episode_chunk=ep_chunk)
|
||||||
|
(output_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
|
||||||
|
for ep_idx in range(ep_chunk_start, ep_chunk_end):
|
||||||
|
ep_table = table.filter(pc.equal(table["episode_index"], ep_idx))
|
||||||
|
episode_lengths.insert(ep_idx, len(ep_table))
|
||||||
|
output_file = output_dir / DEFAULT_PARQUET_PATH.format(
|
||||||
|
episode_chunk=ep_chunk, episode_index=ep_idx
|
||||||
|
)
|
||||||
|
pq.write_table(ep_table, output_file)
|
||||||
|
|
||||||
|
return episode_lengths
|
||||||
|
|
||||||
|
|
||||||
|
def move_videos(
|
||||||
|
repo_id: str,
|
||||||
|
video_keys: list[str],
|
||||||
|
total_episodes: int,
|
||||||
|
total_chunks: int,
|
||||||
|
work_dir: Path,
|
||||||
|
clean_gittatributes: Path,
|
||||||
|
branch: str = "main",
|
||||||
|
) -> None:
|
||||||
|
"""
|
||||||
|
HACK: Since HfApi() doesn't provide a way to move files directly in a repo, this function will run git
|
||||||
|
commands to fetch git lfs video files references to move them into subdirectories without having to
|
||||||
|
actually download them.
|
||||||
|
"""
|
||||||
|
_lfs_clone(repo_id, work_dir, branch)
|
||||||
|
|
||||||
|
videos_moved = False
|
||||||
|
video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*.mp4")]
|
||||||
|
if len(video_files) == 0:
|
||||||
|
video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*/*/*.mp4")]
|
||||||
|
videos_moved = True # Videos have already been moved
|
||||||
|
|
||||||
|
assert len(video_files) == total_episodes * len(video_keys)
|
||||||
|
|
||||||
|
lfs_untracked_videos = _get_lfs_untracked_videos(work_dir, video_files)
|
||||||
|
|
||||||
|
current_gittatributes = work_dir / ".gitattributes"
|
||||||
|
if not filecmp.cmp(current_gittatributes, clean_gittatributes, shallow=False):
|
||||||
|
fix_gitattributes(work_dir, current_gittatributes, clean_gittatributes)
|
||||||
|
|
||||||
|
if lfs_untracked_videos:
|
||||||
|
fix_lfs_video_files_tracking(work_dir, video_files)
|
||||||
|
|
||||||
|
if videos_moved:
|
||||||
|
return
|
||||||
|
|
||||||
|
video_dirs = sorted(work_dir.glob("videos*/"))
|
||||||
|
for ep_chunk in range(total_chunks):
|
||||||
|
ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
|
||||||
|
ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
|
||||||
|
for vid_key in video_keys:
|
||||||
|
chunk_dir = "/".join(DEFAULT_VIDEO_PATH.split("/")[:-1]).format(
|
||||||
|
episode_chunk=ep_chunk, video_key=vid_key
|
||||||
|
)
|
||||||
|
(work_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
for ep_idx in range(ep_chunk_start, ep_chunk_end):
|
||||||
|
target_path = DEFAULT_VIDEO_PATH.format(
|
||||||
|
episode_chunk=ep_chunk, video_key=vid_key, episode_index=ep_idx
|
||||||
|
)
|
||||||
|
video_file = V1_VIDEO_FILE.format(video_key=vid_key, episode_index=ep_idx)
|
||||||
|
if len(video_dirs) == 1:
|
||||||
|
video_path = video_dirs[0] / video_file
|
||||||
|
else:
|
||||||
|
for dir in video_dirs:
|
||||||
|
if (dir / video_file).is_file():
|
||||||
|
video_path = dir / video_file
|
||||||
|
break
|
||||||
|
|
||||||
|
video_path.rename(work_dir / target_path)
|
||||||
|
|
||||||
|
commit_message = "Move video files into chunk subdirectories"
|
||||||
|
subprocess.run(["git", "add", "."], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "commit", "-m", commit_message], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def fix_lfs_video_files_tracking(work_dir: Path, lfs_untracked_videos: list[str]) -> None:
|
||||||
|
"""
|
||||||
|
HACK: This function fixes the tracking by git lfs which was not properly set on some repos. In that case,
|
||||||
|
there's no other option than to download the actual files and reupload them with lfs tracking.
|
||||||
|
"""
|
||||||
|
for i in range(0, len(lfs_untracked_videos), 100):
|
||||||
|
files = lfs_untracked_videos[i : i + 100]
|
||||||
|
try:
|
||||||
|
subprocess.run(["git", "rm", "--cached", *files], cwd=work_dir, capture_output=True, check=True)
|
||||||
|
except subprocess.CalledProcessError as e:
|
||||||
|
print("git rm --cached ERROR:")
|
||||||
|
print(e.stderr)
|
||||||
|
subprocess.run(["git", "add", *files], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
commit_message = "Track video files with git lfs"
|
||||||
|
subprocess.run(["git", "commit", "-m", commit_message], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def fix_gitattributes(work_dir: Path, current_gittatributes: Path, clean_gittatributes: Path) -> None:
|
||||||
|
shutil.copyfile(clean_gittatributes, current_gittatributes)
|
||||||
|
subprocess.run(["git", "add", ".gitattributes"], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "commit", "-m", "Fix .gitattributes"], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def _lfs_clone(repo_id: str, work_dir: Path, branch: str) -> None:
|
||||||
|
subprocess.run(["git", "lfs", "install"], cwd=work_dir, check=True)
|
||||||
|
repo_url = f"https://huggingface.co/datasets/{repo_id}"
|
||||||
|
env = {"GIT_LFS_SKIP_SMUDGE": "1"} # Prevent downloading LFS files
|
||||||
|
subprocess.run(
|
||||||
|
["git", "clone", "--branch", branch, "--single-branch", "--depth", "1", repo_url, str(work_dir)],
|
||||||
|
check=True,
|
||||||
|
env=env,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def _get_lfs_untracked_videos(work_dir: Path, video_files: list[str]) -> list[str]:
|
||||||
|
lfs_tracked_files = subprocess.run(
|
||||||
|
["git", "lfs", "ls-files", "-n"], cwd=work_dir, capture_output=True, text=True, check=True
|
||||||
|
)
|
||||||
|
lfs_tracked_files = set(lfs_tracked_files.stdout.splitlines())
|
||||||
|
return [f for f in video_files if f not in lfs_tracked_files]
|
||||||
|
|
||||||
|
|
||||||
|
def get_videos_info(repo_id: str, local_dir: Path, video_keys: list[str], branch: str) -> dict:
|
||||||
|
# Assumes first episode
|
||||||
|
video_files = [
|
||||||
|
DEFAULT_VIDEO_PATH.format(episode_chunk=0, video_key=vid_key, episode_index=0)
|
||||||
|
for vid_key in video_keys
|
||||||
|
]
|
||||||
|
hub_api = HfApi()
|
||||||
|
hub_api.snapshot_download(
|
||||||
|
repo_id=repo_id, repo_type="dataset", local_dir=local_dir, revision=branch, allow_patterns=video_files
|
||||||
|
)
|
||||||
|
videos_info_dict = {}
|
||||||
|
for vid_key, vid_path in zip(video_keys, video_files, strict=True):
|
||||||
|
videos_info_dict[vid_key] = get_video_info(local_dir / vid_path)
|
||||||
|
|
||||||
|
return videos_info_dict
|
||||||
|
|
||||||
|
|
||||||
|
def convert_dataset(
|
||||||
|
repo_id: str,
|
||||||
|
local_dir: Path,
|
||||||
|
single_task: str | None = None,
|
||||||
|
tasks_path: Path | None = None,
|
||||||
|
tasks_col: Path | None = None,
|
||||||
|
robot_config: dict | None = None,
|
||||||
|
test_branch: str | None = None,
|
||||||
|
**card_kwargs,
|
||||||
|
):
|
||||||
|
v1 = get_hub_safe_version(repo_id, V16)
|
||||||
|
v1x_dir = local_dir / V16 / repo_id
|
||||||
|
v20_dir = local_dir / V20 / repo_id
|
||||||
|
v1x_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
v20_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
hub_api = HfApi()
|
||||||
|
hub_api.snapshot_download(
|
||||||
|
repo_id=repo_id, repo_type="dataset", revision=v1, local_dir=v1x_dir, ignore_patterns="videos*/"
|
||||||
|
)
|
||||||
|
branch = "main"
|
||||||
|
if test_branch:
|
||||||
|
branch = test_branch
|
||||||
|
create_branch(repo_id=repo_id, branch=test_branch, repo_type="dataset")
|
||||||
|
|
||||||
|
metadata_v1 = load_json(v1x_dir / V1_INFO_PATH)
|
||||||
|
dataset = datasets.load_dataset("parquet", data_dir=v1x_dir / "data", split="train")
|
||||||
|
features = get_features_from_hf_dataset(dataset, robot_config)
|
||||||
|
video_keys = [key for key, ft in features.items() if ft["dtype"] == "video"]
|
||||||
|
|
||||||
|
if single_task and "language_instruction" in dataset.column_names:
|
||||||
|
logging.warning(
|
||||||
|
"'single_task' provided but 'language_instruction' tasks_col found. Using 'language_instruction'.",
|
||||||
|
)
|
||||||
|
single_task = None
|
||||||
|
tasks_col = "language_instruction"
|
||||||
|
|
||||||
|
# Episodes & chunks
|
||||||
|
episode_indices = sorted(dataset.unique("episode_index"))
|
||||||
|
total_episodes = len(episode_indices)
|
||||||
|
assert episode_indices == list(range(total_episodes))
|
||||||
|
total_videos = total_episodes * len(video_keys)
|
||||||
|
total_chunks = total_episodes // DEFAULT_CHUNK_SIZE
|
||||||
|
if total_episodes % DEFAULT_CHUNK_SIZE != 0:
|
||||||
|
total_chunks += 1
|
||||||
|
|
||||||
|
# Tasks
|
||||||
|
if single_task:
|
||||||
|
tasks_by_episodes = {ep_idx: single_task for ep_idx in episode_indices}
|
||||||
|
dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
|
||||||
|
tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
elif tasks_path:
|
||||||
|
tasks_by_episodes = load_json(tasks_path)
|
||||||
|
tasks_by_episodes = {int(ep_idx): task for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
|
||||||
|
tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
elif tasks_col:
|
||||||
|
dataset, tasks, tasks_by_episodes = add_task_index_from_tasks_col(dataset, tasks_col)
|
||||||
|
else:
|
||||||
|
raise ValueError
|
||||||
|
|
||||||
|
assert set(tasks) == {task for ep_tasks in tasks_by_episodes.values() for task in ep_tasks}
|
||||||
|
tasks = [{"task_index": task_idx, "task": task} for task_idx, task in enumerate(tasks)]
|
||||||
|
write_jsonlines(tasks, v20_dir / TASKS_PATH)
|
||||||
|
features["task_index"] = {
|
||||||
|
"dtype": "int64",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
}
|
||||||
|
|
||||||
|
# Videos
|
||||||
|
if video_keys:
|
||||||
|
assert metadata_v1.get("video", False)
|
||||||
|
dataset = dataset.remove_columns(video_keys)
|
||||||
|
clean_gitattr = Path(
|
||||||
|
hub_api.hf_hub_download(
|
||||||
|
repo_id=GITATTRIBUTES_REF, repo_type="dataset", local_dir=local_dir, filename=".gitattributes"
|
||||||
|
)
|
||||||
|
).absolute()
|
||||||
|
with tempfile.TemporaryDirectory() as tmp_video_dir:
|
||||||
|
move_videos(
|
||||||
|
repo_id, video_keys, total_episodes, total_chunks, Path(tmp_video_dir), clean_gitattr, branch
|
||||||
|
)
|
||||||
|
videos_info = get_videos_info(repo_id, v1x_dir, video_keys=video_keys, branch=branch)
|
||||||
|
for key in video_keys:
|
||||||
|
features[key]["shape"] = (
|
||||||
|
videos_info[key].pop("video.height"),
|
||||||
|
videos_info[key].pop("video.width"),
|
||||||
|
videos_info[key].pop("video.channels"),
|
||||||
|
)
|
||||||
|
features[key]["video_info"] = videos_info[key]
|
||||||
|
assert math.isclose(videos_info[key]["video.fps"], metadata_v1["fps"], rel_tol=1e-3)
|
||||||
|
if "encoding" in metadata_v1:
|
||||||
|
assert videos_info[key]["video.pix_fmt"] == metadata_v1["encoding"]["pix_fmt"]
|
||||||
|
else:
|
||||||
|
assert metadata_v1.get("video", 0) == 0
|
||||||
|
videos_info = None
|
||||||
|
|
||||||
|
# Split data into 1 parquet file by episode
|
||||||
|
episode_lengths = split_parquet_by_episodes(dataset, total_episodes, total_chunks, v20_dir)
|
||||||
|
|
||||||
|
if robot_config is not None:
|
||||||
|
robot_type = robot_config["robot_type"]
|
||||||
|
repo_tags = [robot_type]
|
||||||
|
else:
|
||||||
|
robot_type = "unknown"
|
||||||
|
repo_tags = None
|
||||||
|
|
||||||
|
# Episodes
|
||||||
|
episodes = [
|
||||||
|
{"episode_index": ep_idx, "tasks": tasks_by_episodes[ep_idx], "length": episode_lengths[ep_idx]}
|
||||||
|
for ep_idx in episode_indices
|
||||||
|
]
|
||||||
|
write_jsonlines(episodes, v20_dir / EPISODES_PATH)
|
||||||
|
|
||||||
|
# Assemble metadata v2.0
|
||||||
|
metadata_v2_0 = {
|
||||||
|
"codebase_version": V20,
|
||||||
|
"robot_type": robot_type,
|
||||||
|
"total_episodes": total_episodes,
|
||||||
|
"total_frames": len(dataset),
|
||||||
|
"total_tasks": len(tasks),
|
||||||
|
"total_videos": total_videos,
|
||||||
|
"total_chunks": total_chunks,
|
||||||
|
"chunks_size": DEFAULT_CHUNK_SIZE,
|
||||||
|
"fps": metadata_v1["fps"],
|
||||||
|
"splits": {"train": f"0:{total_episodes}"},
|
||||||
|
"data_path": DEFAULT_PARQUET_PATH,
|
||||||
|
"video_path": DEFAULT_VIDEO_PATH if video_keys else None,
|
||||||
|
"features": features,
|
||||||
|
}
|
||||||
|
write_json(metadata_v2_0, v20_dir / INFO_PATH)
|
||||||
|
convert_stats_to_json(v1x_dir, v20_dir)
|
||||||
|
card = create_lerobot_dataset_card(tags=repo_tags, dataset_info=metadata_v2_0, **card_kwargs)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="data", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta_data", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
hub_api.upload_folder(
|
||||||
|
repo_id=repo_id,
|
||||||
|
path_in_repo="data",
|
||||||
|
folder_path=v20_dir / "data",
|
||||||
|
repo_type="dataset",
|
||||||
|
revision=branch,
|
||||||
|
)
|
||||||
|
hub_api.upload_folder(
|
||||||
|
repo_id=repo_id,
|
||||||
|
path_in_repo="meta",
|
||||||
|
folder_path=v20_dir / "meta",
|
||||||
|
repo_type="dataset",
|
||||||
|
revision=branch,
|
||||||
|
)
|
||||||
|
|
||||||
|
card.push_to_hub(repo_id=repo_id, repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
if not test_branch:
|
||||||
|
create_branch(repo_id=repo_id, branch=V20, repo_type="dataset")
|
||||||
|
|
||||||
|
|
||||||
|
def main():
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
task_args = parser.add_mutually_exclusive_group(required=True)
|
||||||
|
|
||||||
|
parser.add_argument(
|
||||||
|
"--repo-id",
|
||||||
|
type=str,
|
||||||
|
required=True,
|
||||||
|
help="Repository identifier on Hugging Face: a community or a user name `/` the name of the dataset (e.g. `lerobot/pusht`, `cadene/aloha_sim_insertion_human`).",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--single-task",
|
||||||
|
type=str,
|
||||||
|
help="A short but accurate description of the single task performed in the dataset.",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--tasks-col",
|
||||||
|
type=str,
|
||||||
|
help="The name of the column containing language instructions",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--tasks-path",
|
||||||
|
type=Path,
|
||||||
|
help="The path to a .json file containing one language instruction for each episode_index",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--robot-config",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help="Path to the robot's config yaml the dataset during conversion.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--robot-overrides",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
help="Any key=value arguments to override the robot config values (use dots for.nested=overrides)",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--local-dir",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help="Local directory to store the dataset during conversion. Defaults to /tmp/lerobot_dataset_v2",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--license",
|
||||||
|
type=str,
|
||||||
|
default="apache-2.0",
|
||||||
|
help="Repo license. Must be one of https://huggingface.co/docs/hub/repositories-licenses. Defaults to mit.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--test-branch",
|
||||||
|
type=str,
|
||||||
|
default=None,
|
||||||
|
help="Repo branch to test your conversion first (e.g. 'v2.0.test')",
|
||||||
|
)
|
||||||
|
|
||||||
|
args = parser.parse_args()
|
||||||
|
if not args.local_dir:
|
||||||
|
args.local_dir = Path("/tmp/lerobot_dataset_v2")
|
||||||
|
|
||||||
|
robot_config = parse_robot_config(args.robot_config, args.robot_overrides) if args.robot_config else None
|
||||||
|
del args.robot_config, args.robot_overrides
|
||||||
|
|
||||||
|
convert_dataset(**vars(args), robot_config=robot_config)
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
main()
|
||||||
@@ -13,6 +13,7 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
import json
|
||||||
import logging
|
import logging
|
||||||
import subprocess
|
import subprocess
|
||||||
import warnings
|
import warnings
|
||||||
@@ -25,47 +26,11 @@ import pyarrow as pa
|
|||||||
import torch
|
import torch
|
||||||
import torchvision
|
import torchvision
|
||||||
from datasets.features.features import register_feature
|
from datasets.features.features import register_feature
|
||||||
|
from PIL import Image
|
||||||
|
|
||||||
def load_from_videos(
|
|
||||||
item: dict[str, torch.Tensor],
|
|
||||||
video_frame_keys: list[str],
|
|
||||||
videos_dir: Path,
|
|
||||||
tolerance_s: float,
|
|
||||||
backend: str = "pyav",
|
|
||||||
):
|
|
||||||
"""Note: When using data workers (e.g. DataLoader with num_workers>0), do not call this function
|
|
||||||
in the main process (e.g. by using a second Dataloader with num_workers=0). It will result in a Segmentation Fault.
|
|
||||||
This probably happens because a memory reference to the video loader is created in the main process and a
|
|
||||||
subprocess fails to access it.
|
|
||||||
"""
|
|
||||||
# since video path already contains "videos" (e.g. videos_dir="data/videos", path="videos/episode_0.mp4")
|
|
||||||
data_dir = videos_dir.parent
|
|
||||||
|
|
||||||
for key in video_frame_keys:
|
|
||||||
if isinstance(item[key], list):
|
|
||||||
# load multiple frames at once (expected when delta_timestamps is not None)
|
|
||||||
timestamps = [frame["timestamp"] for frame in item[key]]
|
|
||||||
paths = [frame["path"] for frame in item[key]]
|
|
||||||
if len(set(paths)) > 1:
|
|
||||||
raise NotImplementedError("All video paths are expected to be the same for now.")
|
|
||||||
video_path = data_dir / paths[0]
|
|
||||||
|
|
||||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
|
|
||||||
item[key] = frames
|
|
||||||
else:
|
|
||||||
# load one frame
|
|
||||||
timestamps = [item[key]["timestamp"]]
|
|
||||||
video_path = data_dir / item[key]["path"]
|
|
||||||
|
|
||||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
|
|
||||||
item[key] = frames[0]
|
|
||||||
|
|
||||||
return item
|
|
||||||
|
|
||||||
|
|
||||||
def decode_video_frames_torchvision(
|
def decode_video_frames_torchvision(
|
||||||
video_path: str,
|
video_path: Path | str,
|
||||||
timestamps: list[float],
|
timestamps: list[float],
|
||||||
tolerance_s: float,
|
tolerance_s: float,
|
||||||
backend: str = "pyav",
|
backend: str = "pyav",
|
||||||
@@ -163,8 +128,8 @@ def decode_video_frames_torchvision(
|
|||||||
|
|
||||||
|
|
||||||
def encode_video_frames(
|
def encode_video_frames(
|
||||||
imgs_dir: Path,
|
imgs_dir: Path | str,
|
||||||
video_path: Path,
|
video_path: Path | str,
|
||||||
fps: int,
|
fps: int,
|
||||||
vcodec: str = "libsvtav1",
|
vcodec: str = "libsvtav1",
|
||||||
pix_fmt: str = "yuv420p",
|
pix_fmt: str = "yuv420p",
|
||||||
@@ -247,3 +212,104 @@ with warnings.catch_warnings():
|
|||||||
)
|
)
|
||||||
# to make VideoFrame available in HuggingFace `datasets`
|
# to make VideoFrame available in HuggingFace `datasets`
|
||||||
register_feature(VideoFrame, "VideoFrame")
|
register_feature(VideoFrame, "VideoFrame")
|
||||||
|
|
||||||
|
|
||||||
|
def get_audio_info(video_path: Path | str) -> dict:
|
||||||
|
ffprobe_audio_cmd = [
|
||||||
|
"ffprobe",
|
||||||
|
"-v",
|
||||||
|
"error",
|
||||||
|
"-select_streams",
|
||||||
|
"a:0",
|
||||||
|
"-show_entries",
|
||||||
|
"stream=channels,codec_name,bit_rate,sample_rate,bit_depth,channel_layout,duration",
|
||||||
|
"-of",
|
||||||
|
"json",
|
||||||
|
str(video_path),
|
||||||
|
]
|
||||||
|
result = subprocess.run(ffprobe_audio_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True)
|
||||||
|
if result.returncode != 0:
|
||||||
|
raise RuntimeError(f"Error running ffprobe: {result.stderr}")
|
||||||
|
|
||||||
|
info = json.loads(result.stdout)
|
||||||
|
audio_stream_info = info["streams"][0] if info.get("streams") else None
|
||||||
|
if audio_stream_info is None:
|
||||||
|
return {"has_audio": False}
|
||||||
|
|
||||||
|
# Return the information, defaulting to None if no audio stream is present
|
||||||
|
return {
|
||||||
|
"has_audio": True,
|
||||||
|
"audio.channels": audio_stream_info.get("channels", None),
|
||||||
|
"audio.codec": audio_stream_info.get("codec_name", None),
|
||||||
|
"audio.bit_rate": int(audio_stream_info["bit_rate"]) if audio_stream_info.get("bit_rate") else None,
|
||||||
|
"audio.sample_rate": int(audio_stream_info["sample_rate"])
|
||||||
|
if audio_stream_info.get("sample_rate")
|
||||||
|
else None,
|
||||||
|
"audio.bit_depth": audio_stream_info.get("bit_depth", None),
|
||||||
|
"audio.channel_layout": audio_stream_info.get("channel_layout", None),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def get_video_info(video_path: Path | str) -> dict:
|
||||||
|
ffprobe_video_cmd = [
|
||||||
|
"ffprobe",
|
||||||
|
"-v",
|
||||||
|
"error",
|
||||||
|
"-select_streams",
|
||||||
|
"v:0",
|
||||||
|
"-show_entries",
|
||||||
|
"stream=r_frame_rate,width,height,codec_name,nb_frames,duration,pix_fmt",
|
||||||
|
"-of",
|
||||||
|
"json",
|
||||||
|
str(video_path),
|
||||||
|
]
|
||||||
|
result = subprocess.run(ffprobe_video_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True)
|
||||||
|
if result.returncode != 0:
|
||||||
|
raise RuntimeError(f"Error running ffprobe: {result.stderr}")
|
||||||
|
|
||||||
|
info = json.loads(result.stdout)
|
||||||
|
video_stream_info = info["streams"][0]
|
||||||
|
|
||||||
|
# Calculate fps from r_frame_rate
|
||||||
|
r_frame_rate = video_stream_info["r_frame_rate"]
|
||||||
|
num, denom = map(int, r_frame_rate.split("/"))
|
||||||
|
fps = num / denom
|
||||||
|
|
||||||
|
pixel_channels = get_video_pixel_channels(video_stream_info["pix_fmt"])
|
||||||
|
|
||||||
|
video_info = {
|
||||||
|
"video.fps": fps,
|
||||||
|
"video.height": video_stream_info["height"],
|
||||||
|
"video.width": video_stream_info["width"],
|
||||||
|
"video.channels": pixel_channels,
|
||||||
|
"video.codec": video_stream_info["codec_name"],
|
||||||
|
"video.pix_fmt": video_stream_info["pix_fmt"],
|
||||||
|
"video.is_depth_map": False,
|
||||||
|
**get_audio_info(video_path),
|
||||||
|
}
|
||||||
|
|
||||||
|
return video_info
|
||||||
|
|
||||||
|
|
||||||
|
def get_video_pixel_channels(pix_fmt: str) -> int:
|
||||||
|
if "gray" in pix_fmt or "depth" in pix_fmt or "monochrome" in pix_fmt:
|
||||||
|
return 1
|
||||||
|
elif "rgba" in pix_fmt or "yuva" in pix_fmt:
|
||||||
|
return 4
|
||||||
|
elif "rgb" in pix_fmt or "yuv" in pix_fmt:
|
||||||
|
return 3
|
||||||
|
else:
|
||||||
|
raise ValueError("Unknown format")
|
||||||
|
|
||||||
|
|
||||||
|
def get_image_pixel_channels(image: Image):
|
||||||
|
if image.mode == "L":
|
||||||
|
return 1 # Grayscale
|
||||||
|
elif image.mode == "LA":
|
||||||
|
return 2 # Grayscale + Alpha
|
||||||
|
elif image.mode == "RGB":
|
||||||
|
return 3 # RGB
|
||||||
|
elif image.mode == "RGBA":
|
||||||
|
return 4 # RGBA
|
||||||
|
else:
|
||||||
|
raise ValueError("Unknown format")
|
||||||
|
|||||||
@@ -39,7 +39,7 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
|
|||||||
|
|
||||||
# sanity check that images are channel last
|
# sanity check that images are channel last
|
||||||
_, h, w, c = img.shape
|
_, h, w, c = img.shape
|
||||||
assert c < h and c < w, f"expect channel first images, but instead {img.shape}"
|
assert c < h and c < w, f"expect channel last images, but instead got {img.shape=}"
|
||||||
|
|
||||||
# sanity check that images are uint8
|
# sanity check that images are uint8
|
||||||
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
||||||
|
|||||||
@@ -25,6 +25,7 @@ from glob import glob
|
|||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
|
||||||
import torch
|
import torch
|
||||||
|
import wandb
|
||||||
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE
|
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE
|
||||||
from omegaconf import DictConfig, OmegaConf
|
from omegaconf import DictConfig, OmegaConf
|
||||||
from termcolor import colored
|
from termcolor import colored
|
||||||
@@ -107,8 +108,6 @@ class Logger:
|
|||||||
self._wandb = None
|
self._wandb = None
|
||||||
else:
|
else:
|
||||||
os.environ["WANDB_SILENT"] = "true"
|
os.environ["WANDB_SILENT"] = "true"
|
||||||
import wandb
|
|
||||||
|
|
||||||
wandb_run_id = None
|
wandb_run_id = None
|
||||||
if cfg.resume:
|
if cfg.resume:
|
||||||
wandb_run_id = get_wandb_run_id_from_filesystem(self.checkpoints_dir)
|
wandb_run_id = get_wandb_run_id_from_filesystem(self.checkpoints_dir)
|
||||||
@@ -189,7 +188,7 @@ class Logger:
|
|||||||
training_state["scheduler"] = scheduler.state_dict()
|
training_state["scheduler"] = scheduler.state_dict()
|
||||||
torch.save(training_state, save_dir / self.training_state_file_name)
|
torch.save(training_state, save_dir / self.training_state_file_name)
|
||||||
|
|
||||||
def save_checkpont(
|
def save_checkpoint(
|
||||||
self,
|
self,
|
||||||
train_step: int,
|
train_step: int,
|
||||||
policy: Policy,
|
policy: Policy,
|
||||||
@@ -232,7 +231,7 @@ class Logger:
|
|||||||
# TODO(alexander-soare): Add local text log.
|
# TODO(alexander-soare): Add local text log.
|
||||||
if self._wandb is not None:
|
if self._wandb is not None:
|
||||||
for k, v in d.items():
|
for k, v in d.items():
|
||||||
if not isinstance(v, (int, float, str)):
|
if not isinstance(v, (int, float, str, wandb.Table)):
|
||||||
logging.warning(
|
logging.warning(
|
||||||
f'WandB logging of key "{k}" was ignored as its type is not handled by this wrapper.'
|
f'WandB logging of key "{k}" was ignored as its type is not handled by this wrapper.'
|
||||||
)
|
)
|
||||||
|
|||||||
@@ -296,7 +296,7 @@ class ACT(nn.Module):
|
|||||||
self.use_images = any(k.startswith("observation.image") for k in config.input_shapes)
|
self.use_images = any(k.startswith("observation.image") for k in config.input_shapes)
|
||||||
self.use_env_state = "observation.environment_state" in config.input_shapes
|
self.use_env_state = "observation.environment_state" in config.input_shapes
|
||||||
if self.config.use_vae:
|
if self.config.use_vae:
|
||||||
self.vae_encoder = ACTEncoder(config)
|
self.vae_encoder = ACTEncoder(config, is_vae_encoder=True)
|
||||||
self.vae_encoder_cls_embed = nn.Embedding(1, config.dim_model)
|
self.vae_encoder_cls_embed = nn.Embedding(1, config.dim_model)
|
||||||
# Projection layer for joint-space configuration to hidden dimension.
|
# Projection layer for joint-space configuration to hidden dimension.
|
||||||
if self.use_robot_state:
|
if self.use_robot_state:
|
||||||
@@ -521,9 +521,11 @@ class ACT(nn.Module):
|
|||||||
class ACTEncoder(nn.Module):
|
class ACTEncoder(nn.Module):
|
||||||
"""Convenience module for running multiple encoder layers, maybe followed by normalization."""
|
"""Convenience module for running multiple encoder layers, maybe followed by normalization."""
|
||||||
|
|
||||||
def __init__(self, config: ACTConfig):
|
def __init__(self, config: ACTConfig, is_vae_encoder: bool = False):
|
||||||
super().__init__()
|
super().__init__()
|
||||||
self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(config.n_encoder_layers)])
|
self.is_vae_encoder = is_vae_encoder
|
||||||
|
num_layers = config.n_vae_encoder_layers if self.is_vae_encoder else config.n_encoder_layers
|
||||||
|
self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(num_layers)])
|
||||||
self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
|
self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
|
||||||
|
|
||||||
def forward(
|
def forward(
|
||||||
|
|||||||
@@ -67,6 +67,7 @@ class DiffusionConfig:
|
|||||||
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
||||||
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
||||||
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
||||||
|
use_separate_rgb_encoders_per_camera: Whether to use a separate RGB encoder for each camera view.
|
||||||
down_dims: Feature dimension for each stage of temporal downsampling in the diffusion modeling Unet.
|
down_dims: Feature dimension for each stage of temporal downsampling in the diffusion modeling Unet.
|
||||||
You may provide a variable number of dimensions, therefore also controlling the degree of
|
You may provide a variable number of dimensions, therefore also controlling the degree of
|
||||||
downsampling.
|
downsampling.
|
||||||
@@ -130,6 +131,7 @@ class DiffusionConfig:
|
|||||||
pretrained_backbone_weights: str | None = None
|
pretrained_backbone_weights: str | None = None
|
||||||
use_group_norm: bool = True
|
use_group_norm: bool = True
|
||||||
spatial_softmax_num_keypoints: int = 32
|
spatial_softmax_num_keypoints: int = 32
|
||||||
|
use_separate_rgb_encoder_per_camera: bool = False
|
||||||
# Unet.
|
# Unet.
|
||||||
down_dims: tuple[int, ...] = (512, 1024, 2048)
|
down_dims: tuple[int, ...] = (512, 1024, 2048)
|
||||||
kernel_size: int = 5
|
kernel_size: int = 5
|
||||||
@@ -196,3 +198,12 @@ class DiffusionConfig:
|
|||||||
f"`noise_scheduler_type` must be one of {supported_noise_schedulers}. "
|
f"`noise_scheduler_type` must be one of {supported_noise_schedulers}. "
|
||||||
f"Got {self.noise_scheduler_type}."
|
f"Got {self.noise_scheduler_type}."
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# Check that the horizon size and U-Net downsampling is compatible.
|
||||||
|
# U-Net downsamples by 2 with each stage.
|
||||||
|
downsampling_factor = 2 ** len(self.down_dims)
|
||||||
|
if self.horizon % downsampling_factor != 0:
|
||||||
|
raise ValueError(
|
||||||
|
"The horizon should be an integer multiple of the downsampling factor (which is determined "
|
||||||
|
f"by `len(down_dims)`). Got {self.horizon=} and {self.down_dims=}"
|
||||||
|
)
|
||||||
|
|||||||
@@ -182,6 +182,11 @@ class DiffusionModel(nn.Module):
|
|||||||
self._use_env_state = False
|
self._use_env_state = False
|
||||||
if num_images > 0:
|
if num_images > 0:
|
||||||
self._use_images = True
|
self._use_images = True
|
||||||
|
if self.config.use_separate_rgb_encoder_per_camera:
|
||||||
|
encoders = [DiffusionRgbEncoder(config) for _ in range(num_images)]
|
||||||
|
self.rgb_encoder = nn.ModuleList(encoders)
|
||||||
|
global_cond_dim += encoders[0].feature_dim * num_images
|
||||||
|
else:
|
||||||
self.rgb_encoder = DiffusionRgbEncoder(config)
|
self.rgb_encoder = DiffusionRgbEncoder(config)
|
||||||
global_cond_dim += self.rgb_encoder.feature_dim * num_images
|
global_cond_dim += self.rgb_encoder.feature_dim * num_images
|
||||||
if "observation.environment_state" in config.input_shapes:
|
if "observation.environment_state" in config.input_shapes:
|
||||||
@@ -239,8 +244,24 @@ class DiffusionModel(nn.Module):
|
|||||||
"""Encode image features and concatenate them all together along with the state vector."""
|
"""Encode image features and concatenate them all together along with the state vector."""
|
||||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||||
global_cond_feats = [batch["observation.state"]]
|
global_cond_feats = [batch["observation.state"]]
|
||||||
# Extract image feature (first combine batch, sequence, and camera index dims).
|
# Extract image features.
|
||||||
if self._use_images:
|
if self._use_images:
|
||||||
|
if self.config.use_separate_rgb_encoder_per_camera:
|
||||||
|
# Combine batch and sequence dims while rearranging to make the camera index dimension first.
|
||||||
|
images_per_camera = einops.rearrange(batch["observation.images"], "b s n ... -> n (b s) ...")
|
||||||
|
img_features_list = torch.cat(
|
||||||
|
[
|
||||||
|
encoder(images)
|
||||||
|
for encoder, images in zip(self.rgb_encoder, images_per_camera, strict=True)
|
||||||
|
]
|
||||||
|
)
|
||||||
|
# Separate batch and sequence dims back out. The camera index dim gets absorbed into the
|
||||||
|
# feature dim (effectively concatenating the camera features).
|
||||||
|
img_features = einops.rearrange(
|
||||||
|
img_features_list, "(n b s) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
# Combine batch, sequence, and "which camera" dims before passing to shared encoder.
|
||||||
img_features = self.rgb_encoder(
|
img_features = self.rgb_encoder(
|
||||||
einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
|
einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
|
||||||
)
|
)
|
||||||
|
|||||||
@@ -0,0 +1,36 @@
|
|||||||
|
import json
|
||||||
|
import os
|
||||||
|
from dataclasses import asdict, dataclass
|
||||||
|
|
||||||
|
import torch
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class ClassifierConfig:
|
||||||
|
"""Configuration for the Classifier model."""
|
||||||
|
|
||||||
|
num_classes: int = 2
|
||||||
|
hidden_dim: int = 256
|
||||||
|
dropout_rate: float = 0.1
|
||||||
|
model_name: str = "microsoft/resnet-50"
|
||||||
|
device: str = "cuda" if torch.cuda.is_available() else "mps"
|
||||||
|
model_type: str = "cnn" # "transformer" or "cnn"
|
||||||
|
|
||||||
|
def save_pretrained(self, save_dir):
|
||||||
|
"""Save config to json file."""
|
||||||
|
os.makedirs(save_dir, exist_ok=True)
|
||||||
|
|
||||||
|
# Convert to dict and save as JSON
|
||||||
|
config_dict = asdict(self)
|
||||||
|
with open(os.path.join(save_dir, "config.json"), "w") as f:
|
||||||
|
json.dump(config_dict, f, indent=2)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def from_pretrained(cls, pretrained_model_name_or_path):
|
||||||
|
"""Load config from json file."""
|
||||||
|
config_file = os.path.join(pretrained_model_name_or_path, "config.json")
|
||||||
|
|
||||||
|
with open(config_file) as f:
|
||||||
|
config_dict = json.load(f)
|
||||||
|
|
||||||
|
return cls(**config_dict)
|
||||||
@@ -0,0 +1,134 @@
|
|||||||
|
import logging
|
||||||
|
from typing import Optional
|
||||||
|
|
||||||
|
import torch
|
||||||
|
from huggingface_hub import PyTorchModelHubMixin
|
||||||
|
from torch import Tensor, nn
|
||||||
|
from transformers import AutoImageProcessor, AutoModel
|
||||||
|
|
||||||
|
from .configuration_classifier import ClassifierConfig
|
||||||
|
|
||||||
|
logging.basicConfig(level=logging.INFO, format="%(asctime)s - %(name)s - %(levelname)s - %(message)s")
|
||||||
|
logger = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class ClassifierOutput:
|
||||||
|
"""Wrapper for classifier outputs with additional metadata."""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self, logits: Tensor, probabilities: Optional[Tensor] = None, hidden_states: Optional[Tensor] = None
|
||||||
|
):
|
||||||
|
self.logits = logits
|
||||||
|
self.probabilities = probabilities
|
||||||
|
self.hidden_states = hidden_states
|
||||||
|
|
||||||
|
|
||||||
|
class Classifier(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
# Add Hub metadata
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "vision-classifier"],
|
||||||
|
):
|
||||||
|
"""Image classifier built on top of a pre-trained encoder."""
|
||||||
|
|
||||||
|
# Add name attribute for factory
|
||||||
|
name = "classifier"
|
||||||
|
|
||||||
|
def __init__(self, config: ClassifierConfig):
|
||||||
|
super().__init__()
|
||||||
|
self.config = config
|
||||||
|
self.processor = AutoImageProcessor.from_pretrained(self.config.model_name, trust_remote_code=True)
|
||||||
|
encoder = AutoModel.from_pretrained(self.config.model_name, trust_remote_code=True)
|
||||||
|
# Extract vision model if we're given a multimodal model
|
||||||
|
if hasattr(encoder, "vision_model"):
|
||||||
|
logging.info("Multimodal model detected - using vision encoder only")
|
||||||
|
self.encoder = encoder.vision_model
|
||||||
|
self.vision_config = encoder.config.vision_config
|
||||||
|
else:
|
||||||
|
self.encoder = encoder
|
||||||
|
self.vision_config = getattr(encoder, "config", None)
|
||||||
|
|
||||||
|
# Model type from config
|
||||||
|
self.is_cnn = self.config.model_type == "cnn"
|
||||||
|
|
||||||
|
# For CNNs, initialize backbone
|
||||||
|
if self.is_cnn:
|
||||||
|
self._setup_cnn_backbone()
|
||||||
|
|
||||||
|
self._freeze_encoder()
|
||||||
|
self._build_classifier_head()
|
||||||
|
|
||||||
|
def _setup_cnn_backbone(self):
|
||||||
|
"""Set up CNN encoder"""
|
||||||
|
if hasattr(self.encoder, "fc"):
|
||||||
|
self.feature_dim = self.encoder.fc.in_features
|
||||||
|
self.encoder = nn.Sequential(*list(self.encoder.children())[:-1])
|
||||||
|
elif hasattr(self.encoder.config, "hidden_sizes"):
|
||||||
|
self.feature_dim = self.encoder.config.hidden_sizes[-1] # Last channel dimension
|
||||||
|
else:
|
||||||
|
raise ValueError("Unsupported CNN architecture")
|
||||||
|
|
||||||
|
def _freeze_encoder(self) -> None:
|
||||||
|
"""Freeze the encoder parameters."""
|
||||||
|
for param in self.encoder.parameters():
|
||||||
|
param.requires_grad = False
|
||||||
|
|
||||||
|
def _build_classifier_head(self) -> None:
|
||||||
|
"""Initialize the classifier head architecture."""
|
||||||
|
# Get input dimension based on model type
|
||||||
|
if self.is_cnn:
|
||||||
|
input_dim = self.feature_dim
|
||||||
|
else: # Transformer models
|
||||||
|
if hasattr(self.encoder.config, "hidden_size"):
|
||||||
|
input_dim = self.encoder.config.hidden_size
|
||||||
|
else:
|
||||||
|
raise ValueError("Unsupported transformer architecture since hidden_size is not found")
|
||||||
|
|
||||||
|
self.classifier_head = nn.Sequential(
|
||||||
|
nn.Linear(input_dim, self.config.hidden_dim),
|
||||||
|
nn.Dropout(self.config.dropout_rate),
|
||||||
|
nn.LayerNorm(self.config.hidden_dim),
|
||||||
|
nn.ReLU(),
|
||||||
|
nn.Linear(self.config.hidden_dim, 1 if self.config.num_classes == 2 else self.config.num_classes),
|
||||||
|
)
|
||||||
|
|
||||||
|
def _get_encoder_output(self, x: torch.Tensor) -> torch.Tensor:
|
||||||
|
"""Extract the appropriate output from the encoder."""
|
||||||
|
# Process images with the processor (handles resizing and normalization)
|
||||||
|
processed = self.processor(
|
||||||
|
images=x, # LeRobotDataset already provides proper tensor format
|
||||||
|
return_tensors="pt",
|
||||||
|
)
|
||||||
|
processed = processed["pixel_values"].to(x.device)
|
||||||
|
|
||||||
|
with torch.no_grad():
|
||||||
|
if self.is_cnn:
|
||||||
|
# The HF ResNet applies pooling internally
|
||||||
|
outputs = self.encoder(processed)
|
||||||
|
# Get pooled output directly
|
||||||
|
features = outputs.pooler_output
|
||||||
|
|
||||||
|
if features.dim() > 2:
|
||||||
|
features = features.squeeze(-1).squeeze(-1)
|
||||||
|
return features
|
||||||
|
else: # Transformer models
|
||||||
|
outputs = self.encoder(processed)
|
||||||
|
if hasattr(outputs, "pooler_output") and outputs.pooler_output is not None:
|
||||||
|
return outputs.pooler_output
|
||||||
|
return outputs.last_hidden_state[:, 0, :]
|
||||||
|
|
||||||
|
def forward(self, x: torch.Tensor) -> ClassifierOutput:
|
||||||
|
"""Forward pass of the classifier."""
|
||||||
|
# For training, we expect input to be a tensor directly from LeRobotDataset
|
||||||
|
encoder_output = self._get_encoder_output(x)
|
||||||
|
logits = self.classifier_head(encoder_output)
|
||||||
|
|
||||||
|
if self.config.num_classes == 2:
|
||||||
|
logits = logits.squeeze(-1)
|
||||||
|
probabilities = torch.sigmoid(logits)
|
||||||
|
else:
|
||||||
|
probabilities = torch.softmax(logits, dim=-1)
|
||||||
|
|
||||||
|
return ClassifierOutput(logits=logits, probabilities=probabilities, hidden_states=encoder_output)
|
||||||
23
lerobot/common/policies/hilserl/configuration_hilserl.py
Normal file
23
lerobot/common/policies/hilserl/configuration_hilserl.py
Normal file
@@ -0,0 +1,23 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team.
|
||||||
|
# All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from dataclasses import dataclass
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class HILSerlConfig:
|
||||||
|
pass
|
||||||
29
lerobot/common/policies/hilserl/modeling_hilserl.py
Normal file
29
lerobot/common/policies/hilserl/modeling_hilserl.py
Normal file
@@ -0,0 +1,29 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team.
|
||||||
|
# All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import torch.nn as nn
|
||||||
|
from huggingface_hub import PyTorchModelHubMixin
|
||||||
|
|
||||||
|
|
||||||
|
class HILSerlPolicy(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "hilserl"],
|
||||||
|
):
|
||||||
|
pass
|
||||||
39
lerobot/common/policies/sac/configuration_sac.py
Normal file
39
lerobot/common/policies/sac/configuration_sac.py
Normal file
@@ -0,0 +1,39 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team.
|
||||||
|
# All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from dataclasses import dataclass
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class SACConfig:
|
||||||
|
discount = 0.99
|
||||||
|
temperature_init = 1.0
|
||||||
|
num_critics = 2
|
||||||
|
critic_lr = 3e-4
|
||||||
|
actor_lr = 3e-4
|
||||||
|
critic_network_kwargs = {
|
||||||
|
"hidden_dims": [256, 256],
|
||||||
|
"activate_final": True,
|
||||||
|
}
|
||||||
|
actor_network_kwargs = {
|
||||||
|
"hidden_dims": [256, 256],
|
||||||
|
"activate_final": True,
|
||||||
|
}
|
||||||
|
policy_kwargs = {
|
||||||
|
"tanh_squash_distribution": True,
|
||||||
|
"std_parameterization": "uniform",
|
||||||
|
}
|
||||||
683
lerobot/common/policies/sac/modeling_sac.py
Normal file
683
lerobot/common/policies/sac/modeling_sac.py
Normal file
@@ -0,0 +1,683 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team.
|
||||||
|
# All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
# TODO: (1) better device management
|
||||||
|
|
||||||
|
from collections import deque
|
||||||
|
from copy import deepcopy
|
||||||
|
from functools import partial
|
||||||
|
|
||||||
|
import einops
|
||||||
|
|
||||||
|
import torch
|
||||||
|
import torch.nn as nn
|
||||||
|
import torch.nn.functional as F # noqa: N812
|
||||||
|
from torch import Tensor
|
||||||
|
|
||||||
|
from huggingface_hub import PyTorchModelHubMixin
|
||||||
|
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||||
|
from lerobot.common.policies.sac.configuration_sac import SACConfig
|
||||||
|
import numpy as np
|
||||||
|
from typing import Callable, Optional, Tuple, Sequence
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
class SACPolicy(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "RL", "SAC"],
|
||||||
|
):
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self, config: SACConfig | None = None, dataset_stats: dict[str, dict[str, Tensor]] | None = None
|
||||||
|
):
|
||||||
|
|
||||||
|
super().__init__()
|
||||||
|
|
||||||
|
if config is None:
|
||||||
|
config = SACConfig()
|
||||||
|
self.config = config
|
||||||
|
|
||||||
|
if config.input_normalization_modes is not None:
|
||||||
|
self.normalize_inputs = Normalize(
|
||||||
|
config.input_shapes, config.input_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
self.normalize_inputs = nn.Identity()
|
||||||
|
self.normalize_targets = Normalize(
|
||||||
|
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
self.unnormalize_outputs = Unnormalize(
|
||||||
|
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
encoder = SACObservationEncoder(config)
|
||||||
|
# Define networks
|
||||||
|
critic_nets = []
|
||||||
|
for _ in range(config.num_critics):
|
||||||
|
critic_net = Critic(
|
||||||
|
encoder=encoder,
|
||||||
|
network=MLP(**config.critic_network_kwargs)
|
||||||
|
)
|
||||||
|
critic_nets.append(critic_net)
|
||||||
|
|
||||||
|
self.critic_ensemble = create_critic_ensemble(critic_nets, config.num_critics)
|
||||||
|
self.critic_target = deepcopy(self.critic_ensemble)
|
||||||
|
|
||||||
|
self.actor_network = Policy(
|
||||||
|
encoder=encoder,
|
||||||
|
network=MLP(**config.actor_network_kwargs),
|
||||||
|
action_dim=config.output_shapes["action"][0],
|
||||||
|
**config.policy_kwargs
|
||||||
|
)
|
||||||
|
|
||||||
|
self.temperature = LagrangeMultiplier(init_value=config.temperature_init)
|
||||||
|
|
||||||
|
def reset(self):
|
||||||
|
"""
|
||||||
|
Clear observation and action queues. Should be called on `env.reset()`
|
||||||
|
queues are populated during rollout of the policy, they contain the n latest observations and actions
|
||||||
|
"""
|
||||||
|
|
||||||
|
self._queues = {
|
||||||
|
"observation.state": deque(maxlen=1),
|
||||||
|
"action": deque(maxlen=1),
|
||||||
|
}
|
||||||
|
if self._use_image:
|
||||||
|
self._queues["observation.image"] = deque(maxlen=1)
|
||||||
|
if self._use_env_state:
|
||||||
|
self._queues["observation.environment_state"] = deque(maxlen=1)
|
||||||
|
|
||||||
|
@torch.no_grad()
|
||||||
|
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
|
actions, _ = self.actor_network(batch['observations'])###
|
||||||
|
|
||||||
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor | float]:
|
||||||
|
"""Run the batch through the model and compute the loss.
|
||||||
|
|
||||||
|
Returns a dictionary with loss as a tensor, and other information as native floats.
|
||||||
|
"""
|
||||||
|
batch = self.normalize_inputs(batch)
|
||||||
|
# batch shape is (b, 2, ...) where index 1 returns the current observation and
|
||||||
|
# the next observation for caluculating the right td index.
|
||||||
|
actions = batch["action"][:, 0]
|
||||||
|
rewards = batch["next.reward"][:, 0]
|
||||||
|
observations = {}
|
||||||
|
next_observations = {}
|
||||||
|
for k in batch:
|
||||||
|
if k.startswith("observation."):
|
||||||
|
observations[k] = batch[k][:, 0]
|
||||||
|
next_observations[k] = batch[k][:, 1]
|
||||||
|
|
||||||
|
# perform image augmentation
|
||||||
|
|
||||||
|
# reward bias
|
||||||
|
# from HIL-SERL code base
|
||||||
|
# add_or_replace={"rewards": batch["rewards"] + self.config["reward_bias"]} in reward_batch
|
||||||
|
|
||||||
|
|
||||||
|
# calculate critics loss
|
||||||
|
# 1- compute actions from policy
|
||||||
|
action_preds, log_probs = self.actor_network(observations)
|
||||||
|
# 2- compute q targets
|
||||||
|
q_targets = self.target_qs(next_observations, action_preds)
|
||||||
|
|
||||||
|
# critics subsample size
|
||||||
|
min_q = q_targets.min(dim=0)
|
||||||
|
|
||||||
|
# backup entropy
|
||||||
|
td_target = rewards + self.discount * min_q
|
||||||
|
|
||||||
|
# 3- compute predicted qs
|
||||||
|
q_preds = self.critic_ensemble(observations, actions)
|
||||||
|
|
||||||
|
# 4- Calculate loss
|
||||||
|
# Compute state-action value loss (TD loss) for all of the Q functions in the ensemble.
|
||||||
|
critics_loss = (
|
||||||
|
F.mse_loss(
|
||||||
|
q_preds,
|
||||||
|
einops.repeat(td_target, "t b -> e t b", e=q_preds.shape[0]),
|
||||||
|
reduction="none",
|
||||||
|
).sum(0) # sum over ensemble
|
||||||
|
# `q_preds_ensemble` depends on the first observation and the actions.
|
||||||
|
* ~batch["observation.state_is_pad"][0]
|
||||||
|
* ~batch["action_is_pad"]
|
||||||
|
# q_targets depends on the reward and the next observations.
|
||||||
|
* ~batch["next.reward_is_pad"]
|
||||||
|
* ~batch["observation.state_is_pad"][1:]
|
||||||
|
).sum(0).mean()
|
||||||
|
|
||||||
|
# calculate actors loss
|
||||||
|
# 1- temperature
|
||||||
|
temperature = self.temperature()
|
||||||
|
|
||||||
|
# 2- get actions (batch_size, action_dim) and log probs (batch_size,)
|
||||||
|
actions, log_probs = self.actor_network(observations) \
|
||||||
|
|
||||||
|
# 3- get q-value predictions
|
||||||
|
with torch.no_grad():
|
||||||
|
q_preds = self.critic_ensemble(observations, actions, return_type="mean")
|
||||||
|
actor_loss = (
|
||||||
|
-(q_preds - temperature * log_probs).mean()
|
||||||
|
* ~batch["observation.state_is_pad"][0]
|
||||||
|
* ~batch["action_is_pad"]
|
||||||
|
).mean()
|
||||||
|
|
||||||
|
|
||||||
|
# calculate temperature loss
|
||||||
|
# 1- calculate entropy
|
||||||
|
entropy = -log_probs.mean()
|
||||||
|
temperature_loss = temperature * (entropy - self.target_entropy).mean()
|
||||||
|
|
||||||
|
loss = critics_loss + actor_loss + temperature_loss
|
||||||
|
|
||||||
|
return {
|
||||||
|
"critics_loss": critics_loss.item(),
|
||||||
|
"actor_loss": actor_loss.item(),
|
||||||
|
"temperature_loss": temperature_loss.item(),
|
||||||
|
"temperature": temperature.item(),
|
||||||
|
"entropy": entropy.item(),
|
||||||
|
"loss": loss,
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
def update(self):
|
||||||
|
self.critic_target.lerp_(self.critic_ensemble, self.config.critic_target_update_weight)
|
||||||
|
#for target_param, param in zip(self.critic_target.parameters(), self.critic_ensemble.parameters()):
|
||||||
|
# target_param.data.copy_(target_param.data * (1.0 - self.config.critic_target_update_weight) + param.data * self.critic_target_update_weight)
|
||||||
|
|
||||||
|
|
||||||
|
class MLP(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
config: SACConfig,
|
||||||
|
activations: Callable[[torch.Tensor], torch.Tensor] | str = nn.SiLU(),
|
||||||
|
activate_final: bool = False,
|
||||||
|
dropout_rate: Optional[float] = None,
|
||||||
|
):
|
||||||
|
super().__init__()
|
||||||
|
self.activate_final = config.activate_final
|
||||||
|
layers = []
|
||||||
|
|
||||||
|
for i, size in enumerate(config.network_hidden_dims):
|
||||||
|
layers.append(nn.Linear(config.network_hidden_dims[i-1] if i > 0 else config.network_hidden_dims[0], size))
|
||||||
|
|
||||||
|
if i + 1 < len(config.network_hidden_dims) or activate_final:
|
||||||
|
if dropout_rate is not None and dropout_rate > 0:
|
||||||
|
layers.append(nn.Dropout(p=dropout_rate))
|
||||||
|
layers.append(nn.LayerNorm(size))
|
||||||
|
layers.append(activations if isinstance(activations, nn.Module) else getattr(nn, activations)())
|
||||||
|
|
||||||
|
self.net = nn.Sequential(*layers)
|
||||||
|
|
||||||
|
def forward(self, x: torch.Tensor, train: bool = False) -> torch.Tensor:
|
||||||
|
# in training mode or not. TODO: find better way to do this
|
||||||
|
self.train(train)
|
||||||
|
return self.net(x)
|
||||||
|
|
||||||
|
|
||||||
|
class Critic(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
encoder: Optional[nn.Module],
|
||||||
|
network: nn.Module,
|
||||||
|
init_final: Optional[float] = None,
|
||||||
|
activate_final: bool = False,
|
||||||
|
device: str = "cuda"
|
||||||
|
):
|
||||||
|
super().__init__()
|
||||||
|
self.device = torch.device(device)
|
||||||
|
self.encoder = encoder
|
||||||
|
self.network = network
|
||||||
|
self.init_final = init_final
|
||||||
|
self.activate_final = activate_final
|
||||||
|
|
||||||
|
# Output layer
|
||||||
|
if init_final is not None:
|
||||||
|
if self.activate_final:
|
||||||
|
self.output_layer = nn.Linear(network.net[-3].out_features, 1)
|
||||||
|
else:
|
||||||
|
self.output_layer = nn.Linear(network.net[-2].out_features, 1)
|
||||||
|
nn.init.uniform_(self.output_layer.weight, -init_final, init_final)
|
||||||
|
nn.init.uniform_(self.output_layer.bias, -init_final, init_final)
|
||||||
|
else:
|
||||||
|
if self.activate_final:
|
||||||
|
self.output_layer = nn.Linear(network.net[-3].out_features, 1)
|
||||||
|
else:
|
||||||
|
self.output_layer = nn.Linear(network.net[-2].out_features, 1)
|
||||||
|
orthogonal_init()(self.output_layer.weight)
|
||||||
|
|
||||||
|
self.to(self.device)
|
||||||
|
|
||||||
|
def forward(
|
||||||
|
self,
|
||||||
|
observations: torch.Tensor,
|
||||||
|
actions: torch.Tensor,
|
||||||
|
train: bool = False
|
||||||
|
) -> torch.Tensor:
|
||||||
|
self.train(train)
|
||||||
|
|
||||||
|
observations = observations.to(self.device)
|
||||||
|
actions = actions.to(self.device)
|
||||||
|
|
||||||
|
if self.encoder is not None:
|
||||||
|
obs_enc = self.encoder(observations)
|
||||||
|
else:
|
||||||
|
obs_enc = observations
|
||||||
|
|
||||||
|
inputs = torch.cat([obs_enc, actions], dim=-1)
|
||||||
|
x = self.network(inputs)
|
||||||
|
value = self.output_layer(x)
|
||||||
|
return value.squeeze(-1)
|
||||||
|
|
||||||
|
def q_value_ensemble(
|
||||||
|
self,
|
||||||
|
observations: torch.Tensor,
|
||||||
|
actions: torch.Tensor,
|
||||||
|
train: bool = False
|
||||||
|
) -> torch.Tensor:
|
||||||
|
observations = observations.to(self.device)
|
||||||
|
actions = actions.to(self.device)
|
||||||
|
|
||||||
|
if len(actions.shape) == 3: # [batch_size, num_actions, action_dim]
|
||||||
|
batch_size, num_actions = actions.shape[:2]
|
||||||
|
obs_expanded = observations.unsqueeze(1).expand(-1, num_actions, -1)
|
||||||
|
obs_flat = obs_expanded.reshape(-1, observations.shape[-1])
|
||||||
|
actions_flat = actions.reshape(-1, actions.shape[-1])
|
||||||
|
q_values = self(obs_flat, actions_flat, train)
|
||||||
|
return q_values.reshape(batch_size, num_actions)
|
||||||
|
else:
|
||||||
|
return self(observations, actions, train)
|
||||||
|
|
||||||
|
|
||||||
|
class Policy(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
encoder: Optional[nn.Module],
|
||||||
|
network: nn.Module,
|
||||||
|
action_dim: int,
|
||||||
|
std_parameterization: str = "exp",
|
||||||
|
std_min: float = 1e-5,
|
||||||
|
std_max: float = 10.0,
|
||||||
|
tanh_squash_distribution: bool = False,
|
||||||
|
fixed_std: Optional[torch.Tensor] = None,
|
||||||
|
init_final: Optional[float] = None,
|
||||||
|
activate_final: bool = False,
|
||||||
|
device: str = "cuda"
|
||||||
|
):
|
||||||
|
super().__init__()
|
||||||
|
self.device = torch.device(device)
|
||||||
|
self.encoder = encoder
|
||||||
|
self.network = network
|
||||||
|
self.action_dim = action_dim
|
||||||
|
self.std_parameterization = std_parameterization
|
||||||
|
self.std_min = std_min
|
||||||
|
self.std_max = std_max
|
||||||
|
self.tanh_squash_distribution = tanh_squash_distribution
|
||||||
|
self.fixed_std = fixed_std.to(self.device) if fixed_std is not None else None
|
||||||
|
self.activate_final = activate_final
|
||||||
|
|
||||||
|
# Mean layer
|
||||||
|
if self.activate_final:
|
||||||
|
self.mean_layer = nn.Linear(network.net[-3].out_features, action_dim)
|
||||||
|
else:
|
||||||
|
self.mean_layer = nn.Linear(network.net[-2].out_features, action_dim)
|
||||||
|
if init_final is not None:
|
||||||
|
nn.init.uniform_(self.mean_layer.weight, -init_final, init_final)
|
||||||
|
nn.init.uniform_(self.mean_layer.bias, -init_final, init_final)
|
||||||
|
else:
|
||||||
|
orthogonal_init()(self.mean_layer.weight)
|
||||||
|
|
||||||
|
# Standard deviation layer or parameter
|
||||||
|
if fixed_std is None:
|
||||||
|
if std_parameterization == "uniform":
|
||||||
|
self.log_stds = nn.Parameter(torch.zeros(action_dim, device=self.device))
|
||||||
|
else:
|
||||||
|
if self.activate_final:
|
||||||
|
self.std_layer = nn.Linear(network.net[-3].out_features, action_dim)
|
||||||
|
else:
|
||||||
|
self.std_layer = nn.Linear(network.net[-2].out_features, action_dim)
|
||||||
|
if init_final is not None:
|
||||||
|
nn.init.uniform_(self.std_layer.weight, -init_final, init_final)
|
||||||
|
nn.init.uniform_(self.std_layer.bias, -init_final, init_final)
|
||||||
|
else:
|
||||||
|
orthogonal_init()(self.std_layer.weight)
|
||||||
|
|
||||||
|
self.to(self.device)
|
||||||
|
|
||||||
|
def forward(
|
||||||
|
self,
|
||||||
|
observations: torch.Tensor,
|
||||||
|
temperature: float = 1.0,
|
||||||
|
train: bool = False,
|
||||||
|
non_squash_distribution: bool = False
|
||||||
|
) -> torch.distributions.Distribution:
|
||||||
|
self.train(train)
|
||||||
|
|
||||||
|
# Encode observations if encoder exists
|
||||||
|
if self.encoder is not None:
|
||||||
|
with torch.set_grad_enabled(train):
|
||||||
|
obs_enc = self.encoder(observations, train=train)
|
||||||
|
else:
|
||||||
|
obs_enc = observations
|
||||||
|
# Get network outputs
|
||||||
|
outputs = self.network(obs_enc)
|
||||||
|
means = self.mean_layer(outputs)
|
||||||
|
|
||||||
|
# Compute standard deviations
|
||||||
|
if self.fixed_std is None:
|
||||||
|
if self.std_parameterization == "exp":
|
||||||
|
log_stds = self.std_layer(outputs)
|
||||||
|
stds = torch.exp(log_stds)
|
||||||
|
elif self.std_parameterization == "softplus":
|
||||||
|
stds = torch.nn.functional.softplus(self.std_layer(outputs))
|
||||||
|
elif self.std_parameterization == "uniform":
|
||||||
|
stds = torch.exp(self.log_stds).expand_as(means)
|
||||||
|
else:
|
||||||
|
raise ValueError(
|
||||||
|
f"Invalid std_parameterization: {self.std_parameterization}"
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
assert self.std_parameterization == "fixed"
|
||||||
|
stds = self.fixed_std.expand_as(means)
|
||||||
|
|
||||||
|
# Clip standard deviations and scale with temperature
|
||||||
|
temperature = torch.tensor(temperature, device=self.device)
|
||||||
|
stds = torch.clamp(stds, self.std_min, self.std_max) * torch.sqrt(temperature)
|
||||||
|
|
||||||
|
# Create distribution
|
||||||
|
if self.tanh_squash_distribution and not non_squash_distribution:
|
||||||
|
distribution = TanhMultivariateNormalDiag(
|
||||||
|
loc=means,
|
||||||
|
scale_diag=stds,
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
distribution = torch.distributions.Normal(
|
||||||
|
loc=means,
|
||||||
|
scale=stds,
|
||||||
|
)
|
||||||
|
|
||||||
|
return distribution
|
||||||
|
|
||||||
|
def get_features(self, observations: torch.Tensor) -> torch.Tensor:
|
||||||
|
"""Get encoded features from observations"""
|
||||||
|
observations = observations.to(self.device)
|
||||||
|
if self.encoder is not None:
|
||||||
|
with torch.no_grad():
|
||||||
|
return self.encoder(observations, train=False)
|
||||||
|
return observations
|
||||||
|
|
||||||
|
|
||||||
|
class SACObservationEncoder(nn.Module):
|
||||||
|
"""Encode image and/or state vector observations.
|
||||||
|
TODO(ke-wang): The original work allows for (1) stacking multiple history frames and (2) using pretrained resnet encoders.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, config: SACConfig):
|
||||||
|
"""
|
||||||
|
Creates encoders for pixel and/or state modalities.
|
||||||
|
"""
|
||||||
|
super().__init__()
|
||||||
|
self.config = config
|
||||||
|
|
||||||
|
if "observation.image" in config.input_shapes:
|
||||||
|
self.image_enc_layers = nn.Sequential(
|
||||||
|
nn.Conv2d(
|
||||||
|
config.input_shapes["observation.image"][0], config.image_encoder_hidden_dim, 7, stride=2
|
||||||
|
),
|
||||||
|
nn.ReLU(),
|
||||||
|
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 5, stride=2),
|
||||||
|
nn.ReLU(),
|
||||||
|
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
|
||||||
|
nn.ReLU(),
|
||||||
|
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
|
||||||
|
nn.ReLU(),
|
||||||
|
)
|
||||||
|
dummy_batch = torch.zeros(1, *config.input_shapes["observation.image"])
|
||||||
|
with torch.inference_mode():
|
||||||
|
out_shape = self.image_enc_layers(dummy_batch).shape[1:]
|
||||||
|
self.image_enc_layers.extend(
|
||||||
|
nn.Sequential(
|
||||||
|
nn.Flatten(),
|
||||||
|
nn.Linear(np.prod(out_shape), config.latent_dim),
|
||||||
|
nn.LayerNorm(config.latent_dim),
|
||||||
|
nn.Tanh(),
|
||||||
|
)
|
||||||
|
)
|
||||||
|
if "observation.state" in config.input_shapes:
|
||||||
|
self.state_enc_layers = nn.Sequential(
|
||||||
|
nn.Linear(config.input_shapes["observation.state"][0], config.state_encoder_hidden_dim),
|
||||||
|
nn.ELU(),
|
||||||
|
nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
|
||||||
|
nn.LayerNorm(config.latent_dim),
|
||||||
|
nn.Tanh(),
|
||||||
|
)
|
||||||
|
if "observation.environment_state" in config.input_shapes:
|
||||||
|
self.env_state_enc_layers = nn.Sequential(
|
||||||
|
nn.Linear(
|
||||||
|
config.input_shapes["observation.environment_state"][0], config.state_encoder_hidden_dim
|
||||||
|
),
|
||||||
|
nn.ELU(),
|
||||||
|
nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
|
||||||
|
nn.LayerNorm(config.latent_dim),
|
||||||
|
nn.Tanh(),
|
||||||
|
)
|
||||||
|
|
||||||
|
def forward(self, obs_dict: dict[str, Tensor]) -> Tensor:
|
||||||
|
"""Encode the image and/or state vector.
|
||||||
|
|
||||||
|
Each modality is encoded into a feature vector of size (latent_dim,) and then a uniform mean is taken
|
||||||
|
over all features.
|
||||||
|
"""
|
||||||
|
feat = []
|
||||||
|
# Concatenate all images along the channel dimension.
|
||||||
|
image_keys = [k for k in self.config.input_shapes if k.startswith("observation.image")]
|
||||||
|
for image_key in image_keys:
|
||||||
|
feat.append(flatten_forward_unflatten(self.image_enc_layers, obs_dict[image_key]))
|
||||||
|
if "observation.environment_state" in self.config.input_shapes:
|
||||||
|
feat.append(self.env_state_enc_layers(obs_dict["observation.environment_state"]))
|
||||||
|
if "observation.state" in self.config.input_shapes:
|
||||||
|
feat.append(self.state_enc_layers(obs_dict["observation.state"]))
|
||||||
|
return torch.stack(feat, dim=0).mean(0)
|
||||||
|
|
||||||
|
|
||||||
|
class LagrangeMultiplier(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
init_value: float = 1.0,
|
||||||
|
constraint_shape: Sequence[int] = (),
|
||||||
|
device: str = "cuda"
|
||||||
|
):
|
||||||
|
super().__init__()
|
||||||
|
self.device = torch.device(device)
|
||||||
|
init_value = torch.log(torch.exp(torch.tensor(init_value, device=self.device)) - 1)
|
||||||
|
|
||||||
|
# Initialize the Lagrange multiplier as a parameter
|
||||||
|
self.lagrange = nn.Parameter(
|
||||||
|
torch.full(constraint_shape, init_value, dtype=torch.float32, device=self.device)
|
||||||
|
)
|
||||||
|
|
||||||
|
self.to(self.device)
|
||||||
|
|
||||||
|
def forward(
|
||||||
|
self,
|
||||||
|
lhs: Optional[torch.Tensor] = None,
|
||||||
|
rhs: Optional[torch.Tensor] = None
|
||||||
|
) -> torch.Tensor:
|
||||||
|
# Get the multiplier value based on parameterization
|
||||||
|
multiplier = torch.nn.functional.softplus(self.lagrange)
|
||||||
|
|
||||||
|
# Return the raw multiplier if no constraint values provided
|
||||||
|
if lhs is None:
|
||||||
|
return multiplier
|
||||||
|
|
||||||
|
# Move inputs to device
|
||||||
|
lhs = lhs.to(self.device)
|
||||||
|
if rhs is not None:
|
||||||
|
rhs = rhs.to(self.device)
|
||||||
|
|
||||||
|
# Use the multiplier to compute the Lagrange penalty
|
||||||
|
if rhs is None:
|
||||||
|
rhs = torch.zeros_like(lhs, device=self.device)
|
||||||
|
|
||||||
|
diff = lhs - rhs
|
||||||
|
|
||||||
|
assert diff.shape == multiplier.shape, f"Shape mismatch: {diff.shape} vs {multiplier.shape}"
|
||||||
|
|
||||||
|
return multiplier * diff
|
||||||
|
|
||||||
|
|
||||||
|
# The TanhMultivariateNormalDiag is a probability distribution that represents a transformed normal (Gaussian) distribution where:
|
||||||
|
# 1. The base distribution is a diagonal multivariate normal distribution
|
||||||
|
# 2. The samples from this normal distribution are transformed through a tanh function, which squashes the values to be between -1 and 1
|
||||||
|
# 3. Optionally, the values can be further transformed to fit within arbitrary bounds [low, high] using an affine transformation
|
||||||
|
# This type of distribution is commonly used in reinforcement learning, particularly for continuous action spaces
|
||||||
|
class TanhMultivariateNormalDiag(torch.distributions.TransformedDistribution):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
loc: torch.Tensor,
|
||||||
|
scale_diag: torch.Tensor,
|
||||||
|
low: Optional[torch.Tensor] = None,
|
||||||
|
high: Optional[torch.Tensor] = None,
|
||||||
|
):
|
||||||
|
# Create base normal distribution
|
||||||
|
base_distribution = torch.distributions.Normal(loc=loc, scale=scale_diag)
|
||||||
|
|
||||||
|
# Create list of transforms
|
||||||
|
transforms = []
|
||||||
|
|
||||||
|
# Add tanh transform
|
||||||
|
transforms.append(torch.distributions.transforms.TanhTransform())
|
||||||
|
|
||||||
|
# Add rescaling transform if bounds are provided
|
||||||
|
if low is not None and high is not None:
|
||||||
|
transforms.append(
|
||||||
|
torch.distributions.transforms.AffineTransform(
|
||||||
|
loc=(high + low) / 2,
|
||||||
|
scale=(high - low) / 2
|
||||||
|
)
|
||||||
|
)
|
||||||
|
|
||||||
|
# Initialize parent class
|
||||||
|
super().__init__(
|
||||||
|
base_distribution=base_distribution,
|
||||||
|
transforms=transforms
|
||||||
|
)
|
||||||
|
|
||||||
|
# Store parameters
|
||||||
|
self.loc = loc
|
||||||
|
self.scale_diag = scale_diag
|
||||||
|
self.low = low
|
||||||
|
self.high = high
|
||||||
|
|
||||||
|
def mode(self) -> torch.Tensor:
|
||||||
|
"""Get the mode of the transformed distribution"""
|
||||||
|
# The mode of a normal distribution is its mean
|
||||||
|
mode = self.loc
|
||||||
|
|
||||||
|
# Apply transforms
|
||||||
|
for transform in self.transforms:
|
||||||
|
mode = transform(mode)
|
||||||
|
|
||||||
|
return mode
|
||||||
|
|
||||||
|
def rsample(self, sample_shape=torch.Size()) -> torch.Tensor:
|
||||||
|
"""
|
||||||
|
Reparameterized sample from the distribution
|
||||||
|
"""
|
||||||
|
# Sample from base distribution
|
||||||
|
x = self.base_dist.rsample(sample_shape)
|
||||||
|
|
||||||
|
# Apply transforms
|
||||||
|
for transform in self.transforms:
|
||||||
|
x = transform(x)
|
||||||
|
|
||||||
|
return x
|
||||||
|
|
||||||
|
def log_prob(self, value: torch.Tensor) -> torch.Tensor:
|
||||||
|
"""
|
||||||
|
Compute log probability of a value
|
||||||
|
Includes the log det jacobian for the transforms
|
||||||
|
"""
|
||||||
|
# Initialize log prob
|
||||||
|
log_prob = torch.zeros_like(value[..., 0])
|
||||||
|
|
||||||
|
# Inverse transforms to get back to normal distribution
|
||||||
|
q = value
|
||||||
|
for transform in reversed(self.transforms):
|
||||||
|
q = transform.inv(q)
|
||||||
|
log_prob = log_prob - transform.log_abs_det_jacobian(q, transform(q))
|
||||||
|
|
||||||
|
# Add base distribution log prob
|
||||||
|
log_prob = log_prob + self.base_dist.log_prob(q).sum(-1)
|
||||||
|
|
||||||
|
return log_prob
|
||||||
|
|
||||||
|
def sample_and_log_prob(self, sample_shape=torch.Size()) -> Tuple[torch.Tensor, torch.Tensor]:
|
||||||
|
"""
|
||||||
|
Sample from the distribution and compute log probability
|
||||||
|
"""
|
||||||
|
x = self.rsample(sample_shape)
|
||||||
|
log_prob = self.log_prob(x)
|
||||||
|
return x, log_prob
|
||||||
|
|
||||||
|
def entropy(self) -> torch.Tensor:
|
||||||
|
"""
|
||||||
|
Compute entropy of the distribution
|
||||||
|
"""
|
||||||
|
# Start with base distribution entropy
|
||||||
|
entropy = self.base_dist.entropy().sum(-1)
|
||||||
|
|
||||||
|
# Add log det jacobian for each transform
|
||||||
|
x = self.rsample()
|
||||||
|
for transform in self.transforms:
|
||||||
|
entropy = entropy + transform.log_abs_det_jacobian(x, transform(x))
|
||||||
|
x = transform(x)
|
||||||
|
|
||||||
|
return entropy
|
||||||
|
|
||||||
|
|
||||||
|
def create_critic_ensemble(critic_class, num_critics: int, device: str = "cuda") -> nn.ModuleList:
|
||||||
|
"""Creates an ensemble of critic networks"""
|
||||||
|
critics = nn.ModuleList([critic_class() for _ in range(num_critics)])
|
||||||
|
return critics.to(device)
|
||||||
|
|
||||||
|
|
||||||
|
def orthogonal_init():
|
||||||
|
return lambda x: torch.nn.init.orthogonal_(x, gain=1.0)
|
||||||
|
|
||||||
|
|
||||||
|
# borrowed from tdmpc
|
||||||
|
def flatten_forward_unflatten(fn: Callable[[Tensor], Tensor], image_tensor: Tensor) -> Tensor:
|
||||||
|
"""Helper to temporarily flatten extra dims at the start of the image tensor.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
fn: Callable that the image tensor will be passed to. It should accept (B, C, H, W) and return
|
||||||
|
(B, *), where * is any number of dimensions.
|
||||||
|
image_tensor: An image tensor of shape (**, C, H, W), where ** is any number of dimensions and
|
||||||
|
can be more than 1 dimensions, generally different from *.
|
||||||
|
Returns:
|
||||||
|
A return value from the callable reshaped to (**, *).
|
||||||
|
"""
|
||||||
|
if image_tensor.ndim == 4:
|
||||||
|
return fn(image_tensor)
|
||||||
|
start_dims = image_tensor.shape[:-3]
|
||||||
|
inp = torch.flatten(image_tensor, end_dim=-4)
|
||||||
|
flat_out = fn(inp)
|
||||||
|
return torch.reshape(flat_out, (*start_dims, *flat_out.shape[1:]))
|
||||||
|
|
||||||
@@ -350,17 +350,22 @@ class VQBeTModel(nn.Module):
|
|||||||
|
|
||||||
# get action features (pass through GPT)
|
# get action features (pass through GPT)
|
||||||
features = self.policy(input_tokens)
|
features = self.policy(input_tokens)
|
||||||
# len(self.config.input_shapes) is the number of different observation modes. this line gets the index of action prompt tokens.
|
# len(self.config.input_shapes) is the number of different observation modes.
|
||||||
|
# this line gets the index of action prompt tokens.
|
||||||
historical_act_pred_index = np.arange(0, n_obs_steps) * (len(self.config.input_shapes) + 1) + len(
|
historical_act_pred_index = np.arange(0, n_obs_steps) * (len(self.config.input_shapes) + 1) + len(
|
||||||
self.config.input_shapes
|
self.config.input_shapes
|
||||||
)
|
)
|
||||||
|
|
||||||
# only extract the output tokens at the position of action query:
|
# only extract the output tokens at the position of action query:
|
||||||
# Behavior Transformer (BeT), and VQ-BeT are both sequence-to-sequence prediction models, mapping sequential observation to sequential action (please refer to section 2.2 in BeT paper https://arxiv.org/pdf/2206.11251).
|
# Behavior Transformer (BeT), and VQ-BeT are both sequence-to-sequence prediction models,
|
||||||
# Thus, it predict historical action sequence, in addition to current and future actions (predicting future actions : optional).
|
# mapping sequential observation to sequential action (please refer to section 2.2 in BeT paper https://arxiv.org/pdf/2206.11251).
|
||||||
|
# Thus, it predicts a historical action sequence, in addition to current and future actions (predicting future actions : optional).
|
||||||
|
if len_additional_action_token > 0:
|
||||||
features = torch.cat(
|
features = torch.cat(
|
||||||
[features[:, historical_act_pred_index], features[:, -len_additional_action_token:]], dim=1
|
[features[:, historical_act_pred_index], features[:, -len_additional_action_token:]], dim=1
|
||||||
)
|
)
|
||||||
|
else:
|
||||||
|
features = features[:, historical_act_pred_index]
|
||||||
# pass through action head
|
# pass through action head
|
||||||
action_head_output = self.action_head(features)
|
action_head_output = self.action_head(features)
|
||||||
# if rollout, VQ-BeT don't calculate loss
|
# if rollout, VQ-BeT don't calculate loss
|
||||||
|
|||||||
561
lerobot/common/robot_devices/cameras/intelrealsense.py
Normal file
561
lerobot/common/robot_devices/cameras/intelrealsense.py
Normal file
@@ -0,0 +1,561 @@
|
|||||||
|
"""
|
||||||
|
This file contains utilities for recording frames from Intel Realsense cameras.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import concurrent.futures
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import shutil
|
||||||
|
import threading
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from collections import Counter
|
||||||
|
from dataclasses import dataclass, replace
|
||||||
|
from pathlib import Path
|
||||||
|
from threading import Thread
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
from PIL import Image
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.utils import (
|
||||||
|
RobotDeviceAlreadyConnectedError,
|
||||||
|
RobotDeviceNotConnectedError,
|
||||||
|
busy_wait,
|
||||||
|
)
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
SERIAL_NUMBER_INDEX = 1
|
||||||
|
|
||||||
|
|
||||||
|
def find_cameras(raise_when_empty=True, mock=False) -> list[dict]:
|
||||||
|
"""
|
||||||
|
Find the names and the serial numbers of the Intel RealSense cameras
|
||||||
|
connected to the computer.
|
||||||
|
"""
|
||||||
|
if mock:
|
||||||
|
import tests.mock_pyrealsense2 as rs
|
||||||
|
else:
|
||||||
|
import pyrealsense2 as rs
|
||||||
|
|
||||||
|
cameras = []
|
||||||
|
for device in rs.context().query_devices():
|
||||||
|
serial_number = int(device.get_info(rs.camera_info(SERIAL_NUMBER_INDEX)))
|
||||||
|
name = device.get_info(rs.camera_info.name)
|
||||||
|
cameras.append(
|
||||||
|
{
|
||||||
|
"serial_number": serial_number,
|
||||||
|
"name": name,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
if raise_when_empty and len(cameras) == 0:
|
||||||
|
raise OSError(
|
||||||
|
"Not a single camera was detected. Try re-plugging, or re-installing `librealsense` and its python wrapper `pyrealsense2`, or updating the firmware."
|
||||||
|
)
|
||||||
|
|
||||||
|
return cameras
|
||||||
|
|
||||||
|
|
||||||
|
def save_image(img_array, serial_number, frame_index, images_dir):
|
||||||
|
try:
|
||||||
|
img = Image.fromarray(img_array)
|
||||||
|
path = images_dir / f"camera_{serial_number}_frame_{frame_index:06d}.png"
|
||||||
|
path.parent.mkdir(parents=True, exist_ok=True)
|
||||||
|
img.save(str(path), quality=100)
|
||||||
|
logging.info(f"Saved image: {path}")
|
||||||
|
except Exception as e:
|
||||||
|
logging.error(f"Failed to save image for camera {serial_number} frame {frame_index}: {e}")
|
||||||
|
|
||||||
|
|
||||||
|
def save_images_from_cameras(
|
||||||
|
images_dir: Path,
|
||||||
|
serial_numbers: list[int] | None = None,
|
||||||
|
fps=None,
|
||||||
|
width=None,
|
||||||
|
height=None,
|
||||||
|
record_time_s=2,
|
||||||
|
mock=False,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Initializes all the cameras and saves images to the directory. Useful to visually identify the camera
|
||||||
|
associated to a given serial number.
|
||||||
|
"""
|
||||||
|
if serial_numbers is None or len(serial_numbers) == 0:
|
||||||
|
camera_infos = find_cameras(mock=mock)
|
||||||
|
serial_numbers = [cam["serial_number"] for cam in camera_infos]
|
||||||
|
|
||||||
|
if mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
print("Connecting cameras")
|
||||||
|
cameras = []
|
||||||
|
for cam_sn in serial_numbers:
|
||||||
|
print(f"{cam_sn=}")
|
||||||
|
camera = IntelRealSenseCamera(cam_sn, fps=fps, width=width, height=height, mock=mock)
|
||||||
|
camera.connect()
|
||||||
|
print(
|
||||||
|
f"IntelRealSenseCamera({camera.serial_number}, fps={camera.fps}, width={camera.width}, height={camera.height}, color_mode={camera.color_mode})"
|
||||||
|
)
|
||||||
|
cameras.append(camera)
|
||||||
|
|
||||||
|
images_dir = Path(images_dir)
|
||||||
|
if images_dir.exists():
|
||||||
|
shutil.rmtree(
|
||||||
|
images_dir,
|
||||||
|
)
|
||||||
|
images_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
print(f"Saving images to {images_dir}")
|
||||||
|
frame_index = 0
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
try:
|
||||||
|
with concurrent.futures.ThreadPoolExecutor(max_workers=1) as executor:
|
||||||
|
while True:
|
||||||
|
now = time.perf_counter()
|
||||||
|
|
||||||
|
for camera in cameras:
|
||||||
|
# If we use async_read when fps is None, the loop will go full speed, and we will end up
|
||||||
|
# saving the same images from the cameras multiple times until the RAM/disk is full.
|
||||||
|
image = camera.read() if fps is None else camera.async_read()
|
||||||
|
if image is None:
|
||||||
|
print("No Frame")
|
||||||
|
|
||||||
|
bgr_converted_image = cv2.cvtColor(image, cv2.COLOR_RGB2BGR)
|
||||||
|
|
||||||
|
executor.submit(
|
||||||
|
save_image,
|
||||||
|
bgr_converted_image,
|
||||||
|
camera.serial_number,
|
||||||
|
frame_index,
|
||||||
|
images_dir,
|
||||||
|
)
|
||||||
|
|
||||||
|
if fps is not None:
|
||||||
|
dt_s = time.perf_counter() - now
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
if time.perf_counter() - start_time > record_time_s:
|
||||||
|
break
|
||||||
|
|
||||||
|
print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
|
||||||
|
|
||||||
|
frame_index += 1
|
||||||
|
finally:
|
||||||
|
print(f"Images have been saved to {images_dir}")
|
||||||
|
for camera in cameras:
|
||||||
|
camera.disconnect()
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class IntelRealSenseCameraConfig:
|
||||||
|
"""
|
||||||
|
Example of tested options for Intel Real Sense D405:
|
||||||
|
|
||||||
|
```python
|
||||||
|
IntelRealSenseCameraConfig(30, 640, 480)
|
||||||
|
IntelRealSenseCameraConfig(60, 640, 480)
|
||||||
|
IntelRealSenseCameraConfig(90, 640, 480)
|
||||||
|
IntelRealSenseCameraConfig(30, 1280, 720)
|
||||||
|
IntelRealSenseCameraConfig(30, 640, 480, use_depth=True)
|
||||||
|
IntelRealSenseCameraConfig(30, 640, 480, rotation=90)
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
fps: int | None = None
|
||||||
|
width: int | None = None
|
||||||
|
height: int | None = None
|
||||||
|
color_mode: str = "rgb"
|
||||||
|
channels: int | None = None
|
||||||
|
use_depth: bool = False
|
||||||
|
force_hardware_reset: bool = True
|
||||||
|
rotation: int | None = None
|
||||||
|
mock: bool = False
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
if self.color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"`color_mode` is expected to be 'rgb' or 'bgr', but {self.color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.channels = 3
|
||||||
|
|
||||||
|
at_least_one_is_not_none = self.fps is not None or self.width is not None or self.height is not None
|
||||||
|
at_least_one_is_none = self.fps is None or self.width is None or self.height is None
|
||||||
|
if at_least_one_is_not_none and at_least_one_is_none:
|
||||||
|
raise ValueError(
|
||||||
|
"For `fps`, `width` and `height`, either all of them need to be set, or none of them, "
|
||||||
|
f"but {self.fps=}, {self.width=}, {self.height=} were provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation not in [-90, None, 90, 180]:
|
||||||
|
raise ValueError(f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})")
|
||||||
|
|
||||||
|
|
||||||
|
class IntelRealSenseCamera:
|
||||||
|
"""
|
||||||
|
The IntelRealSenseCamera class is similar to OpenCVCamera class but adds additional features for Intel Real Sense cameras:
|
||||||
|
- is instantiated with the serial number of the camera - won't randomly change as it can be the case of OpenCVCamera for Linux,
|
||||||
|
- can also be instantiated with the camera's name — if it's unique — using IntelRealSenseCamera.init_from_name(),
|
||||||
|
- depth map can be returned.
|
||||||
|
|
||||||
|
To find the camera indices of your cameras, you can run our utility script that will save a few frames for each camera:
|
||||||
|
```bash
|
||||||
|
python lerobot/common/robot_devices/cameras/intelrealsense.py --images-dir outputs/images_from_intelrealsense_cameras
|
||||||
|
```
|
||||||
|
|
||||||
|
When an IntelRealSenseCamera is instantiated, if no specific config is provided, the default fps, width, height and color_mode
|
||||||
|
of the given camera will be used.
|
||||||
|
|
||||||
|
Example of usage:
|
||||||
|
```python
|
||||||
|
# Instantiate with its serial number
|
||||||
|
camera = IntelRealSenseCamera(128422271347)
|
||||||
|
# Or by its name if it's unique
|
||||||
|
camera = IntelRealSenseCamera.init_from_name("Intel RealSense D405")
|
||||||
|
camera.connect()
|
||||||
|
color_image = camera.read()
|
||||||
|
# when done using the camera, consider disconnecting
|
||||||
|
camera.disconnect()
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of changing default fps, width, height and color_mode:
|
||||||
|
```python
|
||||||
|
camera = IntelRealSenseCamera(serial_number, fps=30, width=1280, height=720)
|
||||||
|
camera = connect() # applies the settings, might error out if these settings are not compatible with the camera
|
||||||
|
|
||||||
|
camera = IntelRealSenseCamera(serial_number, fps=90, width=640, height=480)
|
||||||
|
camera = connect()
|
||||||
|
|
||||||
|
camera = IntelRealSenseCamera(serial_number, fps=90, width=640, height=480, color_mode="bgr")
|
||||||
|
camera = connect()
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of returning depth:
|
||||||
|
```python
|
||||||
|
camera = IntelRealSenseCamera(serial_number, use_depth=True)
|
||||||
|
camera.connect()
|
||||||
|
color_image, depth_map = camera.read()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
serial_number: int,
|
||||||
|
config: IntelRealSenseCameraConfig | None = None,
|
||||||
|
**kwargs,
|
||||||
|
):
|
||||||
|
if config is None:
|
||||||
|
config = IntelRealSenseCameraConfig()
|
||||||
|
|
||||||
|
# Overwrite the config arguments using kwargs
|
||||||
|
config = replace(config, **kwargs)
|
||||||
|
|
||||||
|
self.serial_number = serial_number
|
||||||
|
self.fps = config.fps
|
||||||
|
self.width = config.width
|
||||||
|
self.height = config.height
|
||||||
|
self.channels = config.channels
|
||||||
|
self.color_mode = config.color_mode
|
||||||
|
self.use_depth = config.use_depth
|
||||||
|
self.force_hardware_reset = config.force_hardware_reset
|
||||||
|
self.mock = config.mock
|
||||||
|
|
||||||
|
self.camera = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.thread = None
|
||||||
|
self.stop_event = None
|
||||||
|
self.color_image = None
|
||||||
|
self.depth_map = None
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
# TODO(alibets): Do we keep original width/height or do we define them after rotation?
|
||||||
|
self.rotation = None
|
||||||
|
if config.rotation == -90:
|
||||||
|
self.rotation = cv2.ROTATE_90_COUNTERCLOCKWISE
|
||||||
|
elif config.rotation == 90:
|
||||||
|
self.rotation = cv2.ROTATE_90_CLOCKWISE
|
||||||
|
elif config.rotation == 180:
|
||||||
|
self.rotation = cv2.ROTATE_180
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def init_from_name(cls, name: str, config: IntelRealSenseCameraConfig | None = None, **kwargs):
|
||||||
|
camera_infos = find_cameras()
|
||||||
|
camera_names = [cam["name"] for cam in camera_infos]
|
||||||
|
this_name_count = Counter(camera_names)[name]
|
||||||
|
if this_name_count > 1:
|
||||||
|
# TODO(aliberts): Test this with multiple identical cameras (Aloha)
|
||||||
|
raise ValueError(
|
||||||
|
f"Multiple {name} cameras have been detected. Please use their serial number to instantiate them."
|
||||||
|
)
|
||||||
|
|
||||||
|
name_to_serial_dict = {cam["name"]: cam["serial_number"] for cam in camera_infos}
|
||||||
|
cam_sn = name_to_serial_dict[name]
|
||||||
|
|
||||||
|
if config is None:
|
||||||
|
config = IntelRealSenseCameraConfig()
|
||||||
|
|
||||||
|
# Overwrite the config arguments using kwargs
|
||||||
|
config = replace(config, **kwargs)
|
||||||
|
|
||||||
|
return cls(serial_number=cam_sn, config=config, **kwargs)
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise RobotDeviceAlreadyConnectedError(
|
||||||
|
f"IntelRealSenseCamera({self.serial_number}) is already connected."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_pyrealsense2 as rs
|
||||||
|
else:
|
||||||
|
import pyrealsense2 as rs
|
||||||
|
|
||||||
|
config = rs.config()
|
||||||
|
config.enable_device(str(self.serial_number))
|
||||||
|
|
||||||
|
if self.fps and self.width and self.height:
|
||||||
|
# TODO(rcadene): can we set rgb8 directly?
|
||||||
|
config.enable_stream(rs.stream.color, self.width, self.height, rs.format.rgb8, self.fps)
|
||||||
|
else:
|
||||||
|
config.enable_stream(rs.stream.color)
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
if self.fps and self.width and self.height:
|
||||||
|
config.enable_stream(rs.stream.depth, self.width, self.height, rs.format.z16, self.fps)
|
||||||
|
else:
|
||||||
|
config.enable_stream(rs.stream.depth)
|
||||||
|
|
||||||
|
self.camera = rs.pipeline()
|
||||||
|
try:
|
||||||
|
profile = self.camera.start(config)
|
||||||
|
is_camera_open = True
|
||||||
|
except RuntimeError:
|
||||||
|
is_camera_open = False
|
||||||
|
traceback.print_exc()
|
||||||
|
|
||||||
|
# If the camera doesn't work, display the camera indices corresponding to
|
||||||
|
# valid cameras.
|
||||||
|
if not is_camera_open:
|
||||||
|
# Verify that the provided `serial_number` is valid before printing the traceback
|
||||||
|
camera_infos = find_cameras()
|
||||||
|
serial_numbers = [cam["serial_number"] for cam in camera_infos]
|
||||||
|
if self.serial_number not in serial_numbers:
|
||||||
|
raise ValueError(
|
||||||
|
f"`serial_number` is expected to be one of these available cameras {serial_numbers}, but {self.serial_number} is provided instead. "
|
||||||
|
"To find the serial number you should use, run `python lerobot/common/robot_devices/cameras/intelrealsense.py`."
|
||||||
|
)
|
||||||
|
|
||||||
|
raise OSError(f"Can't access IntelRealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
color_stream = profile.get_stream(rs.stream.color)
|
||||||
|
color_profile = color_stream.as_video_stream_profile()
|
||||||
|
actual_fps = color_profile.fps()
|
||||||
|
actual_width = color_profile.width()
|
||||||
|
actual_height = color_profile.height()
|
||||||
|
|
||||||
|
# Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
|
||||||
|
if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
|
||||||
|
# Using `OSError` since it's a broad that encompasses issues related to device communication
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.fps=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_fps}."
|
||||||
|
)
|
||||||
|
if self.width is not None and self.width != actual_width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.width=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_width}."
|
||||||
|
)
|
||||||
|
if self.height is not None and self.height != actual_height:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.height=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_height}."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.fps = round(actual_fps)
|
||||||
|
self.width = round(actual_width)
|
||||||
|
self.height = round(actual_height)
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def read(self, temporary_color: str | None = None) -> np.ndarray | tuple[np.ndarray, np.ndarray]:
|
||||||
|
"""Read a frame from the camera returned in the format height x width x channels (e.g. 480 x 640 x 3)
|
||||||
|
of type `np.uint8`, contrarily to the pytorch format which is float channel first.
|
||||||
|
|
||||||
|
When `use_depth=True`, returns a tuple `(color_image, depth_map)` with a depth map in the format
|
||||||
|
height x width (e.g. 480 x 640) of type np.uint16.
|
||||||
|
|
||||||
|
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
||||||
|
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
||||||
|
"""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
frame = self.camera.wait_for_frames(timeout_ms=5000)
|
||||||
|
|
||||||
|
color_frame = frame.get_color_frame()
|
||||||
|
|
||||||
|
if not color_frame:
|
||||||
|
raise OSError(f"Can't capture color image from IntelRealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
color_image = np.asanyarray(color_frame.get_data())
|
||||||
|
|
||||||
|
requested_color_mode = self.color_mode if temporary_color is None else temporary_color
|
||||||
|
if requested_color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
# IntelRealSense uses RGB format as default (red, green, blue).
|
||||||
|
if requested_color_mode == "bgr":
|
||||||
|
color_image = cv2.cvtColor(color_image, cv2.COLOR_RGB2BGR)
|
||||||
|
|
||||||
|
h, w, _ = color_image.shape
|
||||||
|
if h != self.height or w != self.width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
color_image = cv2.rotate(color_image, self.rotation)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the image
|
||||||
|
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the image was received
|
||||||
|
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
depth_frame = frame.get_depth_frame()
|
||||||
|
if not depth_frame:
|
||||||
|
raise OSError(f"Can't capture depth image from IntelRealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
depth_map = np.asanyarray(depth_frame.get_data())
|
||||||
|
|
||||||
|
h, w = depth_map.shape
|
||||||
|
if h != self.height or w != self.width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't capture depth map with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
depth_map = cv2.rotate(depth_map, self.rotation)
|
||||||
|
|
||||||
|
return color_image, depth_map
|
||||||
|
else:
|
||||||
|
return color_image
|
||||||
|
|
||||||
|
def read_loop(self):
|
||||||
|
while not self.stop_event.is_set():
|
||||||
|
if self.use_depth:
|
||||||
|
self.color_image, self.depth_map = self.read()
|
||||||
|
else:
|
||||||
|
self.color_image = self.read()
|
||||||
|
|
||||||
|
def async_read(self):
|
||||||
|
"""Access the latest color image"""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.thread is None:
|
||||||
|
self.stop_event = threading.Event()
|
||||||
|
self.thread = Thread(target=self.read_loop, args=())
|
||||||
|
self.thread.daemon = True
|
||||||
|
self.thread.start()
|
||||||
|
|
||||||
|
num_tries = 0
|
||||||
|
while self.color_image is None:
|
||||||
|
# TODO(rcadene, aliberts): intelrealsense has diverged compared to opencv over here
|
||||||
|
num_tries += 1
|
||||||
|
time.sleep(1 / self.fps)
|
||||||
|
if num_tries > self.fps and (self.thread.ident is None or not self.thread.is_alive()):
|
||||||
|
raise Exception(
|
||||||
|
"The thread responsible for `self.async_read()` took too much time to start. There might be an issue. Verify that `self.thread.start()` has been called."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
return self.color_image, self.depth_map
|
||||||
|
else:
|
||||||
|
return self.color_image
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.thread is not None and self.thread.is_alive():
|
||||||
|
# wait for the thread to finish
|
||||||
|
self.stop_event.set()
|
||||||
|
self.thread.join()
|
||||||
|
self.thread = None
|
||||||
|
self.stop_event = None
|
||||||
|
|
||||||
|
self.camera.stop()
|
||||||
|
self.camera = None
|
||||||
|
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser(
|
||||||
|
description="Save a few frames using `IntelRealSenseCamera` for all cameras connected to the computer, or a selected subset."
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--serial-numbers",
|
||||||
|
type=int,
|
||||||
|
nargs="*",
|
||||||
|
default=None,
|
||||||
|
help="List of serial numbers used to instantiate the `IntelRealSenseCamera`. If not provided, find and use all available camera indices.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--fps",
|
||||||
|
type=int,
|
||||||
|
default=30,
|
||||||
|
help="Set the number of frames recorded per seconds for all cameras. If not provided, use the default fps of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--width",
|
||||||
|
type=str,
|
||||||
|
default=640,
|
||||||
|
help="Set the width for all cameras. If not provided, use the default width of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--height",
|
||||||
|
type=str,
|
||||||
|
default=480,
|
||||||
|
help="Set the height for all cameras. If not provided, use the default height of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--images-dir",
|
||||||
|
type=Path,
|
||||||
|
default="outputs/images_from_intelrealsense_cameras",
|
||||||
|
help="Set directory to save a few frames for each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--record-time-s",
|
||||||
|
type=float,
|
||||||
|
default=2.0,
|
||||||
|
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
save_images_from_cameras(**vars(args))
|
||||||
@@ -13,17 +13,15 @@ from dataclasses import dataclass, replace
|
|||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from threading import Thread
|
from threading import Thread
|
||||||
|
|
||||||
import cv2
|
|
||||||
import numpy as np
|
import numpy as np
|
||||||
from PIL import Image
|
from PIL import Image
|
||||||
|
|
||||||
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
from lerobot.common.robot_devices.utils import (
|
||||||
|
RobotDeviceAlreadyConnectedError,
|
||||||
|
RobotDeviceNotConnectedError,
|
||||||
|
busy_wait,
|
||||||
|
)
|
||||||
from lerobot.common.utils.utils import capture_timestamp_utc
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
from lerobot.scripts.control_robot import busy_wait
|
|
||||||
|
|
||||||
# Use 1 thread to avoid blocking the main thread. Especially useful during data collection
|
|
||||||
# when other threads are used to save the images.
|
|
||||||
cv2.setNumThreads(1)
|
|
||||||
|
|
||||||
# The maximum opencv device index depends on your operating system. For instance,
|
# The maximum opencv device index depends on your operating system. For instance,
|
||||||
# if you have 3 cameras, they should be associated to index 0, 1, and 2. This is the case
|
# if you have 3 cameras, they should be associated to index 0, 1, and 2. This is the case
|
||||||
@@ -33,20 +31,44 @@ cv2.setNumThreads(1)
|
|||||||
MAX_OPENCV_INDEX = 60
|
MAX_OPENCV_INDEX = 60
|
||||||
|
|
||||||
|
|
||||||
def find_camera_indices(raise_when_empty=False, max_index_search_range=MAX_OPENCV_INDEX):
|
def find_cameras(raise_when_empty=False, max_index_search_range=MAX_OPENCV_INDEX, mock=False) -> list[dict]:
|
||||||
|
cameras = []
|
||||||
if platform.system() == "Linux":
|
if platform.system() == "Linux":
|
||||||
# Linux uses camera ports
|
|
||||||
print("Linux detected. Finding available camera indices through scanning '/dev/video*' ports")
|
print("Linux detected. Finding available camera indices through scanning '/dev/video*' ports")
|
||||||
possible_camera_ids = []
|
possible_ports = [str(port) for port in Path("/dev").glob("video*")]
|
||||||
for port in Path("/dev").glob("video*"):
|
ports = _find_cameras(possible_ports, mock=mock)
|
||||||
camera_idx = int(str(port).replace("/dev/video", ""))
|
for port in ports:
|
||||||
possible_camera_ids.append(camera_idx)
|
cameras.append(
|
||||||
|
{
|
||||||
|
"port": port,
|
||||||
|
"index": int(port.removeprefix("/dev/video")),
|
||||||
|
}
|
||||||
|
)
|
||||||
else:
|
else:
|
||||||
print(
|
print(
|
||||||
"Mac or Windows detected. Finding available camera indices through "
|
"Mac or Windows detected. Finding available camera indices through "
|
||||||
f"scanning all indices from 0 to {MAX_OPENCV_INDEX}"
|
f"scanning all indices from 0 to {MAX_OPENCV_INDEX}"
|
||||||
)
|
)
|
||||||
possible_camera_ids = range(max_index_search_range)
|
possible_indices = range(max_index_search_range)
|
||||||
|
indices = _find_cameras(possible_indices, mock=mock)
|
||||||
|
for index in indices:
|
||||||
|
cameras.append(
|
||||||
|
{
|
||||||
|
"port": None,
|
||||||
|
"index": index,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
return cameras
|
||||||
|
|
||||||
|
|
||||||
|
def _find_cameras(
|
||||||
|
possible_camera_ids: list[int | str], raise_when_empty=False, mock=False
|
||||||
|
) -> list[int | str]:
|
||||||
|
if mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
camera_ids = []
|
camera_ids = []
|
||||||
for camera_idx in possible_camera_ids:
|
for camera_idx in possible_camera_ids:
|
||||||
@@ -67,6 +89,16 @@ def find_camera_indices(raise_when_empty=False, max_index_search_range=MAX_OPENC
|
|||||||
return camera_ids
|
return camera_ids
|
||||||
|
|
||||||
|
|
||||||
|
def is_valid_unix_path(path: str) -> bool:
|
||||||
|
"""Note: if 'path' points to a symlink, this will return True only if the target exists"""
|
||||||
|
p = Path(path)
|
||||||
|
return p.is_absolute() and p.exists()
|
||||||
|
|
||||||
|
|
||||||
|
def get_camera_index_from_unix_port(port: Path) -> int:
|
||||||
|
return int(str(port.resolve()).removeprefix("/dev/video"))
|
||||||
|
|
||||||
|
|
||||||
def save_image(img_array, camera_index, frame_index, images_dir):
|
def save_image(img_array, camera_index, frame_index, images_dir):
|
||||||
img = Image.fromarray(img_array)
|
img = Image.fromarray(img_array)
|
||||||
path = images_dir / f"camera_{camera_index:02d}_frame_{frame_index:06d}.png"
|
path = images_dir / f"camera_{camera_index:02d}_frame_{frame_index:06d}.png"
|
||||||
@@ -75,15 +107,26 @@ def save_image(img_array, camera_index, frame_index, images_dir):
|
|||||||
|
|
||||||
|
|
||||||
def save_images_from_cameras(
|
def save_images_from_cameras(
|
||||||
images_dir: Path, camera_ids: list[int] | None = None, fps=None, width=None, height=None, record_time_s=2
|
images_dir: Path,
|
||||||
|
camera_ids: list | None = None,
|
||||||
|
fps=None,
|
||||||
|
width=None,
|
||||||
|
height=None,
|
||||||
|
record_time_s=2,
|
||||||
|
mock=False,
|
||||||
):
|
):
|
||||||
if camera_ids is None:
|
"""
|
||||||
camera_ids = find_camera_indices()
|
Initializes all the cameras and saves images to the directory. Useful to visually identify the camera
|
||||||
|
associated to a given camera index.
|
||||||
|
"""
|
||||||
|
if camera_ids is None or len(camera_ids) == 0:
|
||||||
|
camera_infos = find_cameras(mock=mock)
|
||||||
|
camera_ids = [cam["index"] for cam in camera_infos]
|
||||||
|
|
||||||
print("Connecting cameras")
|
print("Connecting cameras")
|
||||||
cameras = []
|
cameras = []
|
||||||
for cam_idx in camera_ids:
|
for cam_idx in camera_ids:
|
||||||
camera = OpenCVCamera(cam_idx, fps=fps, width=width, height=height)
|
camera = OpenCVCamera(cam_idx, fps=fps, width=width, height=height, mock=mock)
|
||||||
camera.connect()
|
camera.connect()
|
||||||
print(
|
print(
|
||||||
f"OpenCVCamera({camera.camera_index}, fps={camera.fps}, width={camera.width}, "
|
f"OpenCVCamera({camera.camera_index}, fps={camera.fps}, width={camera.width}, "
|
||||||
@@ -101,7 +144,7 @@ def save_images_from_cameras(
|
|||||||
print(f"Saving images to {images_dir}")
|
print(f"Saving images to {images_dir}")
|
||||||
frame_index = 0
|
frame_index = 0
|
||||||
start_time = time.perf_counter()
|
start_time = time.perf_counter()
|
||||||
with concurrent.futures.ThreadPoolExecutor(max_workers=4) as executor:
|
with concurrent.futures.ThreadPoolExecutor(max_workers=1) as executor:
|
||||||
while True:
|
while True:
|
||||||
now = time.perf_counter()
|
now = time.perf_counter()
|
||||||
|
|
||||||
@@ -122,11 +165,11 @@ def save_images_from_cameras(
|
|||||||
dt_s = time.perf_counter() - now
|
dt_s = time.perf_counter() - now
|
||||||
busy_wait(1 / fps - dt_s)
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
|
||||||
|
|
||||||
if time.perf_counter() - start_time > record_time_s:
|
if time.perf_counter() - start_time > record_time_s:
|
||||||
break
|
break
|
||||||
|
|
||||||
print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
|
|
||||||
|
|
||||||
frame_index += 1
|
frame_index += 1
|
||||||
|
|
||||||
print(f"Images have been saved to {images_dir}")
|
print(f"Images have been saved to {images_dir}")
|
||||||
@@ -149,13 +192,21 @@ class OpenCVCameraConfig:
|
|||||||
width: int | None = None
|
width: int | None = None
|
||||||
height: int | None = None
|
height: int | None = None
|
||||||
color_mode: str = "rgb"
|
color_mode: str = "rgb"
|
||||||
|
channels: int | None = None
|
||||||
|
rotation: int | None = None
|
||||||
|
mock: bool = False
|
||||||
|
|
||||||
def __post_init__(self):
|
def __post_init__(self):
|
||||||
if self.color_mode not in ["rgb", "bgr"]:
|
if self.color_mode not in ["rgb", "bgr"]:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"Expected color_mode values are 'rgb' or 'bgr', but {self.color_mode} is provided."
|
f"`color_mode` is expected to be 'rgb' or 'bgr', but {self.color_mode} is provided."
|
||||||
)
|
)
|
||||||
|
|
||||||
|
self.channels = 3
|
||||||
|
|
||||||
|
if self.rotation not in [-90, None, 90, 180]:
|
||||||
|
raise ValueError(f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})")
|
||||||
|
|
||||||
|
|
||||||
class OpenCVCamera:
|
class OpenCVCamera:
|
||||||
"""
|
"""
|
||||||
@@ -196,17 +247,33 @@ class OpenCVCamera:
|
|||||||
```
|
```
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, camera_index: int, config: OpenCVCameraConfig | None = None, **kwargs):
|
def __init__(self, camera_index: int | str, config: OpenCVCameraConfig | None = None, **kwargs):
|
||||||
if config is None:
|
if config is None:
|
||||||
config = OpenCVCameraConfig()
|
config = OpenCVCameraConfig()
|
||||||
|
|
||||||
# Overwrite config arguments using kwargs
|
# Overwrite config arguments using kwargs
|
||||||
config = replace(config, **kwargs)
|
config = replace(config, **kwargs)
|
||||||
|
|
||||||
self.camera_index = camera_index
|
self.camera_index = camera_index
|
||||||
|
self.port = None
|
||||||
|
|
||||||
|
# Linux uses ports for connecting to cameras
|
||||||
|
if platform.system() == "Linux":
|
||||||
|
if isinstance(self.camera_index, int):
|
||||||
|
self.port = Path(f"/dev/video{self.camera_index}")
|
||||||
|
elif isinstance(self.camera_index, str) and is_valid_unix_path(self.camera_index):
|
||||||
|
self.port = Path(self.camera_index)
|
||||||
|
# Retrieve the camera index from a potentially symlinked path
|
||||||
|
self.camera_index = get_camera_index_from_unix_port(self.port)
|
||||||
|
else:
|
||||||
|
raise ValueError(f"Please check the provided camera_index: {camera_index}")
|
||||||
|
|
||||||
self.fps = config.fps
|
self.fps = config.fps
|
||||||
self.width = config.width
|
self.width = config.width
|
||||||
self.height = config.height
|
self.height = config.height
|
||||||
|
self.channels = config.channels
|
||||||
self.color_mode = config.color_mode
|
self.color_mode = config.color_mode
|
||||||
|
self.mock = config.mock
|
||||||
|
|
||||||
self.camera = None
|
self.camera = None
|
||||||
self.is_connected = False
|
self.is_connected = False
|
||||||
@@ -215,43 +282,60 @@ class OpenCVCamera:
|
|||||||
self.color_image = None
|
self.color_image = None
|
||||||
self.logs = {}
|
self.logs = {}
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
# TODO(aliberts): Do we keep original width/height or do we define them after rotation?
|
||||||
|
self.rotation = None
|
||||||
|
if config.rotation == -90:
|
||||||
|
self.rotation = cv2.ROTATE_90_COUNTERCLOCKWISE
|
||||||
|
elif config.rotation == 90:
|
||||||
|
self.rotation = cv2.ROTATE_90_CLOCKWISE
|
||||||
|
elif config.rotation == 180:
|
||||||
|
self.rotation = cv2.ROTATE_180
|
||||||
|
|
||||||
def connect(self):
|
def connect(self):
|
||||||
if self.is_connected:
|
if self.is_connected:
|
||||||
raise RobotDeviceAlreadyConnectedError(f"Camera {self.camera_index} is already connected.")
|
raise RobotDeviceAlreadyConnectedError(f"OpenCVCamera({self.camera_index}) is already connected.")
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
# Use 1 thread to avoid blocking the main thread. Especially useful during data collection
|
||||||
|
# when other threads are used to save the images.
|
||||||
|
cv2.setNumThreads(1)
|
||||||
|
|
||||||
|
camera_idx = f"/dev/video{self.camera_index}" if platform.system() == "Linux" else self.camera_index
|
||||||
# First create a temporary camera trying to access `camera_index`,
|
# First create a temporary camera trying to access `camera_index`,
|
||||||
# and verify it is a valid camera by calling `isOpened`.
|
# and verify it is a valid camera by calling `isOpened`.
|
||||||
|
tmp_camera = cv2.VideoCapture(camera_idx)
|
||||||
if platform.system() == "Linux":
|
|
||||||
# Linux uses ports for connecting to cameras
|
|
||||||
tmp_camera = cv2.VideoCapture(f"/dev/video{self.camera_index}")
|
|
||||||
else:
|
|
||||||
tmp_camera = cv2.VideoCapture(self.camera_index)
|
|
||||||
|
|
||||||
is_camera_open = tmp_camera.isOpened()
|
is_camera_open = tmp_camera.isOpened()
|
||||||
# Release camera to make it accessible for `find_camera_indices`
|
# Release camera to make it accessible for `find_camera_indices`
|
||||||
|
tmp_camera.release()
|
||||||
del tmp_camera
|
del tmp_camera
|
||||||
|
|
||||||
# If the camera doesn't work, display the camera indices corresponding to
|
# If the camera doesn't work, display the camera indices corresponding to
|
||||||
# valid cameras.
|
# valid cameras.
|
||||||
if not is_camera_open:
|
if not is_camera_open:
|
||||||
# Verify that the provided `camera_index` is valid before printing the traceback
|
# Verify that the provided `camera_index` is valid before printing the traceback
|
||||||
available_cam_ids = find_camera_indices()
|
cameras_info = find_cameras()
|
||||||
|
available_cam_ids = [cam["index"] for cam in cameras_info]
|
||||||
if self.camera_index not in available_cam_ids:
|
if self.camera_index not in available_cam_ids:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"`camera_index` is expected to be one of these available cameras {available_cam_ids}, but {self.camera_index} is provided instead. "
|
f"`camera_index` is expected to be one of these available cameras {available_cam_ids}, but {self.camera_index} is provided instead. "
|
||||||
"To find the camera index you should use, run `python lerobot/common/robot_devices/cameras/opencv.py`."
|
"To find the camera index you should use, run `python lerobot/common/robot_devices/cameras/opencv.py`."
|
||||||
)
|
)
|
||||||
|
|
||||||
raise OSError(f"Can't access camera {self.camera_index}.")
|
raise OSError(f"Can't access OpenCVCamera({camera_idx}).")
|
||||||
|
|
||||||
# Secondly, create the camera that will be used downstream.
|
# Secondly, create the camera that will be used downstream.
|
||||||
# Note: For some unknown reason, calling `isOpened` blocks the camera which then
|
# Note: For some unknown reason, calling `isOpened` blocks the camera which then
|
||||||
# needs to be re-created.
|
# needs to be re-created.
|
||||||
if platform.system() == "Linux":
|
self.camera = cv2.VideoCapture(camera_idx)
|
||||||
self.camera = cv2.VideoCapture(f"/dev/video{self.camera_index}")
|
|
||||||
else:
|
|
||||||
self.camera = cv2.VideoCapture(self.camera_index)
|
|
||||||
|
|
||||||
if self.fps is not None:
|
if self.fps is not None:
|
||||||
self.camera.set(cv2.CAP_PROP_FPS, self.fps)
|
self.camera.set(cv2.CAP_PROP_FPS, self.fps)
|
||||||
@@ -264,28 +348,30 @@ class OpenCVCamera:
|
|||||||
actual_width = self.camera.get(cv2.CAP_PROP_FRAME_WIDTH)
|
actual_width = self.camera.get(cv2.CAP_PROP_FRAME_WIDTH)
|
||||||
actual_height = self.camera.get(cv2.CAP_PROP_FRAME_HEIGHT)
|
actual_height = self.camera.get(cv2.CAP_PROP_FRAME_HEIGHT)
|
||||||
|
|
||||||
|
# Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
|
||||||
if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
|
if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
|
||||||
|
# Using `OSError` since it's a broad that encompasses issues related to device communication
|
||||||
raise OSError(
|
raise OSError(
|
||||||
f"Can't set {self.fps=} for camera {self.camera_index}. Actual value is {actual_fps}."
|
f"Can't set {self.fps=} for OpenCVCamera({self.camera_index}). Actual value is {actual_fps}."
|
||||||
)
|
)
|
||||||
if self.width is not None and self.width != actual_width:
|
if self.width is not None and not math.isclose(self.width, actual_width, rel_tol=1e-3):
|
||||||
raise OSError(
|
raise OSError(
|
||||||
f"Can't set {self.width=} for camera {self.camera_index}. Actual value is {actual_width}."
|
f"Can't set {self.width=} for OpenCVCamera({self.camera_index}). Actual value is {actual_width}."
|
||||||
)
|
)
|
||||||
if self.height is not None and self.height != actual_height:
|
if self.height is not None and not math.isclose(self.height, actual_height, rel_tol=1e-3):
|
||||||
raise OSError(
|
raise OSError(
|
||||||
f"Can't set {self.height=} for camera {self.camera_index}. Actual value is {actual_height}."
|
f"Can't set {self.height=} for OpenCVCamera({self.camera_index}). Actual value is {actual_height}."
|
||||||
)
|
)
|
||||||
|
|
||||||
self.fps = actual_fps
|
self.fps = round(actual_fps)
|
||||||
self.width = actual_width
|
self.width = round(actual_width)
|
||||||
self.height = actual_height
|
self.height = round(actual_height)
|
||||||
|
|
||||||
self.is_connected = True
|
self.is_connected = True
|
||||||
|
|
||||||
def read(self, temporary_color_mode: str | None = None) -> np.ndarray:
|
def read(self, temporary_color_mode: str | None = None) -> np.ndarray:
|
||||||
"""Read a frame from the camera returned in the format (height, width, channels)
|
"""Read a frame from the camera returned in the format (height, width, channels)
|
||||||
(e.g. (640, 480, 3)), contrarily to the pytorch format which is channel first.
|
(e.g. 480 x 640 x 3), contrarily to the pytorch format which is channel first.
|
||||||
|
|
||||||
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
||||||
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
||||||
@@ -298,6 +384,7 @@ class OpenCVCamera:
|
|||||||
start_time = time.perf_counter()
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
ret, color_image = self.camera.read()
|
ret, color_image = self.camera.read()
|
||||||
|
|
||||||
if not ret:
|
if not ret:
|
||||||
raise OSError(f"Can't capture color image from camera {self.camera_index}.")
|
raise OSError(f"Can't capture color image from camera {self.camera_index}.")
|
||||||
|
|
||||||
@@ -308,10 +395,15 @@ class OpenCVCamera:
|
|||||||
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
||||||
)
|
)
|
||||||
|
|
||||||
# OpenCV uses BGR format as default (blue, green red) for all operations, including displaying images.
|
# OpenCV uses BGR format as default (blue, green, red) for all operations, including displaying images.
|
||||||
# However, Deep Learning framework such as LeRobot uses RGB format as default to train neural networks,
|
# However, Deep Learning framework such as LeRobot uses RGB format as default to train neural networks,
|
||||||
# so we convert the image color from BGR to RGB.
|
# so we convert the image color from BGR to RGB.
|
||||||
if requested_color_mode == "rgb":
|
if requested_color_mode == "rgb":
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
color_image = cv2.cvtColor(color_image, cv2.COLOR_BGR2RGB)
|
color_image = cv2.cvtColor(color_image, cv2.COLOR_BGR2RGB)
|
||||||
|
|
||||||
h, w, _ = color_image.shape
|
h, w, _ = color_image.shape
|
||||||
@@ -320,17 +412,25 @@ class OpenCVCamera:
|
|||||||
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
)
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
color_image = cv2.rotate(color_image, self.rotation)
|
||||||
|
|
||||||
# log the number of seconds it took to read the image
|
# log the number of seconds it took to read the image
|
||||||
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
||||||
|
|
||||||
# log the utc time at which the image was received
|
# log the utc time at which the image was received
|
||||||
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
self.color_image = color_image
|
||||||
|
|
||||||
return color_image
|
return color_image
|
||||||
|
|
||||||
def read_loop(self):
|
def read_loop(self):
|
||||||
while self.stop_event is None or not self.stop_event.is_set():
|
while not self.stop_event.is_set():
|
||||||
|
try:
|
||||||
self.color_image = self.read()
|
self.color_image = self.read()
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error reading in thread: {e}")
|
||||||
|
|
||||||
def async_read(self):
|
def async_read(self):
|
||||||
if not self.is_connected:
|
if not self.is_connected:
|
||||||
@@ -345,32 +445,29 @@ class OpenCVCamera:
|
|||||||
self.thread.start()
|
self.thread.start()
|
||||||
|
|
||||||
num_tries = 0
|
num_tries = 0
|
||||||
while self.color_image is None:
|
while True:
|
||||||
num_tries += 1
|
if self.color_image is not None:
|
||||||
time.sleep(1 / self.fps)
|
|
||||||
if num_tries > self.fps and (self.thread.ident is None or not self.thread.is_alive()):
|
|
||||||
raise Exception(
|
|
||||||
"The thread responsible for `self.async_read()` took too much time to start. There might be an issue. Verify that `self.thread.start()` has been called."
|
|
||||||
)
|
|
||||||
|
|
||||||
return self.color_image
|
return self.color_image
|
||||||
|
|
||||||
|
time.sleep(1 / self.fps)
|
||||||
|
num_tries += 1
|
||||||
|
if num_tries > self.fps * 2:
|
||||||
|
raise TimeoutError("Timed out waiting for async_read() to start.")
|
||||||
|
|
||||||
def disconnect(self):
|
def disconnect(self):
|
||||||
if not self.is_connected:
|
if not self.is_connected:
|
||||||
raise RobotDeviceNotConnectedError(
|
raise RobotDeviceNotConnectedError(
|
||||||
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
||||||
)
|
)
|
||||||
|
|
||||||
if self.thread is not None and self.thread.is_alive():
|
if self.thread is not None:
|
||||||
# wait for the thread to finish
|
|
||||||
self.stop_event.set()
|
self.stop_event.set()
|
||||||
self.thread.join()
|
self.thread.join() # wait for the thread to finish
|
||||||
self.thread = None
|
self.thread = None
|
||||||
self.stop_event = None
|
self.stop_event = None
|
||||||
|
|
||||||
self.camera.release()
|
self.camera.release()
|
||||||
self.camera = None
|
self.camera = None
|
||||||
|
|
||||||
self.is_connected = False
|
self.is_connected = False
|
||||||
|
|
||||||
def __del__(self):
|
def __del__(self):
|
||||||
@@ -416,7 +513,7 @@ if __name__ == "__main__":
|
|||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
"--record-time-s",
|
"--record-time-s",
|
||||||
type=float,
|
type=float,
|
||||||
default=2.0,
|
default=4.0,
|
||||||
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
||||||
)
|
)
|
||||||
args = parser.parse_args()
|
args = parser.parse_args()
|
||||||
|
|||||||
@@ -1,55 +1,8 @@
|
|||||||
from pathlib import Path
|
|
||||||
from typing import Protocol
|
from typing import Protocol
|
||||||
|
|
||||||
import cv2
|
|
||||||
import einops
|
|
||||||
import numpy as np
|
import numpy as np
|
||||||
|
|
||||||
|
|
||||||
def write_shape_on_image_inplace(image):
|
|
||||||
height, width = image.shape[:2]
|
|
||||||
text = f"Width: {width} Height: {height}"
|
|
||||||
|
|
||||||
# Define the font, scale, color, and thickness
|
|
||||||
font = cv2.FONT_HERSHEY_SIMPLEX
|
|
||||||
font_scale = 1
|
|
||||||
color = (255, 0, 0) # Blue in BGR
|
|
||||||
thickness = 2
|
|
||||||
|
|
||||||
position = (10, height - 10) # 10 pixels from the bottom-left corner
|
|
||||||
cv2.putText(image, text, position, font, font_scale, color, thickness)
|
|
||||||
|
|
||||||
|
|
||||||
def save_color_image(image, path, write_shape=False):
|
|
||||||
path = Path(path)
|
|
||||||
path.parent.mkdir(parents=True, exist_ok=True)
|
|
||||||
if write_shape:
|
|
||||||
write_shape_on_image_inplace(image)
|
|
||||||
cv2.imwrite(str(path), image)
|
|
||||||
|
|
||||||
|
|
||||||
def save_depth_image(depth, path, write_shape=False):
|
|
||||||
path = Path(path)
|
|
||||||
path.parent.mkdir(parents=True, exist_ok=True)
|
|
||||||
|
|
||||||
# Apply colormap on depth image (image must be converted to 8-bit per pixel first)
|
|
||||||
depth_image = cv2.applyColorMap(cv2.convertScaleAbs(depth, alpha=0.03), cv2.COLORMAP_JET)
|
|
||||||
|
|
||||||
if write_shape:
|
|
||||||
write_shape_on_image_inplace(depth_image)
|
|
||||||
cv2.imwrite(str(path), depth_image)
|
|
||||||
|
|
||||||
|
|
||||||
def convert_torch_image_to_cv2(tensor, rgb_to_bgr=True):
|
|
||||||
assert tensor.ndim == 3
|
|
||||||
c, h, w = tensor.shape
|
|
||||||
assert c < h and c < w
|
|
||||||
color_image = einops.rearrange(tensor, "c h w -> h w c").numpy()
|
|
||||||
if rgb_to_bgr:
|
|
||||||
color_image = cv2.cvtColor(color_image, cv2.COLOR_RGB2BGR)
|
|
||||||
return color_image
|
|
||||||
|
|
||||||
|
|
||||||
# Defines a camera type
|
# Defines a camera type
|
||||||
class Camera(Protocol):
|
class Camera(Protocol):
|
||||||
def connect(self): ...
|
def connect(self): ...
|
||||||
|
|||||||
382
lerobot/common/robot_devices/control_utils.py
Normal file
382
lerobot/common/robot_devices/control_utils.py
Normal file
@@ -0,0 +1,382 @@
|
|||||||
|
########################################################################################
|
||||||
|
# Utilities
|
||||||
|
########################################################################################
|
||||||
|
|
||||||
|
|
||||||
|
import logging
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from contextlib import nullcontext
|
||||||
|
from copy import copy
|
||||||
|
from functools import cache
|
||||||
|
|
||||||
|
import cv2
|
||||||
|
import torch
|
||||||
|
import tqdm
|
||||||
|
from deepdiff import DeepDiff
|
||||||
|
from termcolor import colored
|
||||||
|
|
||||||
|
from lerobot.common.datasets.image_writer import safe_stop_image_writer
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
from lerobot.common.datasets.utils import get_features_from_robot
|
||||||
|
from lerobot.common.policies.factory import make_policy
|
||||||
|
from lerobot.common.robot_devices.robots.utils import Robot
|
||||||
|
from lerobot.common.robot_devices.utils import busy_wait
|
||||||
|
from lerobot.common.utils.utils import get_safe_torch_device, init_hydra_config, set_global_seed
|
||||||
|
from lerobot.scripts.eval import get_pretrained_policy_path
|
||||||
|
|
||||||
|
|
||||||
|
def log_control_info(robot: Robot, dt_s, episode_index=None, frame_index=None, fps=None):
|
||||||
|
log_items = []
|
||||||
|
if episode_index is not None:
|
||||||
|
log_items.append(f"ep:{episode_index}")
|
||||||
|
if frame_index is not None:
|
||||||
|
log_items.append(f"frame:{frame_index}")
|
||||||
|
|
||||||
|
def log_dt(shortname, dt_val_s):
|
||||||
|
nonlocal log_items, fps
|
||||||
|
info_str = f"{shortname}:{dt_val_s * 1000:5.2f} ({1/ dt_val_s:3.1f}hz)"
|
||||||
|
if fps is not None:
|
||||||
|
actual_fps = 1 / dt_val_s
|
||||||
|
if actual_fps < fps - 1:
|
||||||
|
info_str = colored(info_str, "yellow")
|
||||||
|
log_items.append(info_str)
|
||||||
|
|
||||||
|
# total step time displayed in milliseconds and its frequency
|
||||||
|
log_dt("dt", dt_s)
|
||||||
|
|
||||||
|
# TODO(aliberts): move robot-specific logs logic in robot.print_logs()
|
||||||
|
if not robot.robot_type.startswith("stretch"):
|
||||||
|
for name in robot.leader_arms:
|
||||||
|
key = f"read_leader_{name}_pos_dt_s"
|
||||||
|
if key in robot.logs:
|
||||||
|
log_dt("dtRlead", robot.logs[key])
|
||||||
|
|
||||||
|
for name in robot.follower_arms:
|
||||||
|
key = f"write_follower_{name}_goal_pos_dt_s"
|
||||||
|
if key in robot.logs:
|
||||||
|
log_dt("dtWfoll", robot.logs[key])
|
||||||
|
|
||||||
|
key = f"read_follower_{name}_pos_dt_s"
|
||||||
|
if key in robot.logs:
|
||||||
|
log_dt("dtRfoll", robot.logs[key])
|
||||||
|
|
||||||
|
for name in robot.cameras:
|
||||||
|
key = f"read_camera_{name}_dt_s"
|
||||||
|
if key in robot.logs:
|
||||||
|
log_dt(f"dtR{name}", robot.logs[key])
|
||||||
|
|
||||||
|
info_str = " ".join(log_items)
|
||||||
|
logging.info(info_str)
|
||||||
|
|
||||||
|
|
||||||
|
@cache
|
||||||
|
def is_headless():
|
||||||
|
"""Detects if python is running without a monitor."""
|
||||||
|
try:
|
||||||
|
import pynput # noqa
|
||||||
|
|
||||||
|
return False
|
||||||
|
except Exception:
|
||||||
|
print(
|
||||||
|
"Error trying to import pynput. Switching to headless mode. "
|
||||||
|
"As a result, the video stream from the cameras won't be shown, "
|
||||||
|
"and you won't be able to change the control flow with keyboards. "
|
||||||
|
"For more info, see traceback below.\n"
|
||||||
|
)
|
||||||
|
traceback.print_exc()
|
||||||
|
print()
|
||||||
|
return True
|
||||||
|
|
||||||
|
|
||||||
|
def has_method(_object: object, method_name: str):
|
||||||
|
return hasattr(_object, method_name) and callable(getattr(_object, method_name))
|
||||||
|
|
||||||
|
|
||||||
|
def predict_action(observation, policy, device, use_amp):
|
||||||
|
observation = copy(observation)
|
||||||
|
with (
|
||||||
|
torch.inference_mode(),
|
||||||
|
torch.autocast(device_type=device.type) if device.type == "cuda" and use_amp else nullcontext(),
|
||||||
|
):
|
||||||
|
# Convert to pytorch format: channel first and float32 in [0,1] with batch dimension
|
||||||
|
for name in observation:
|
||||||
|
if "image" in name:
|
||||||
|
observation[name] = observation[name].type(torch.float32) / 255
|
||||||
|
observation[name] = observation[name].permute(2, 0, 1).contiguous()
|
||||||
|
observation[name] = observation[name].unsqueeze(0)
|
||||||
|
observation[name] = observation[name].to(device)
|
||||||
|
|
||||||
|
# Compute the next action with the policy
|
||||||
|
# based on the current observation
|
||||||
|
action = policy.select_action(observation)
|
||||||
|
|
||||||
|
# Remove batch dimension
|
||||||
|
action = action.squeeze(0)
|
||||||
|
|
||||||
|
# Move to cpu, if not already the case
|
||||||
|
action = action.to("cpu")
|
||||||
|
|
||||||
|
return action
|
||||||
|
|
||||||
|
|
||||||
|
def init_keyboard_listener(assign_rewards=False):
|
||||||
|
"""
|
||||||
|
Initializes a keyboard listener to enable early termination of an episode
|
||||||
|
or environment reset by pressing the right arrow key ('->'). This may require
|
||||||
|
sudo permissions to allow the terminal to monitor keyboard events.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
assign_rewards (bool): If True, allows annotating the collected trajectory
|
||||||
|
with a binary reward at the end of the episode to indicate success.
|
||||||
|
"""
|
||||||
|
events = {}
|
||||||
|
events["exit_early"] = False
|
||||||
|
events["rerecord_episode"] = False
|
||||||
|
events["stop_recording"] = False
|
||||||
|
if assign_rewards:
|
||||||
|
events["next.reward"] = 0
|
||||||
|
|
||||||
|
if is_headless():
|
||||||
|
logging.warning(
|
||||||
|
"Headless environment detected. On-screen cameras display and keyboard inputs will not be available."
|
||||||
|
)
|
||||||
|
listener = None
|
||||||
|
return listener, events
|
||||||
|
|
||||||
|
# Only import pynput if not in a headless environment
|
||||||
|
from pynput import keyboard
|
||||||
|
|
||||||
|
def on_press(key):
|
||||||
|
try:
|
||||||
|
if key == keyboard.Key.right:
|
||||||
|
print("Right arrow key pressed. Exiting loop...")
|
||||||
|
events["exit_early"] = True
|
||||||
|
elif key == keyboard.Key.left:
|
||||||
|
print("Left arrow key pressed. Exiting loop and rerecord the last episode...")
|
||||||
|
events["rerecord_episode"] = True
|
||||||
|
events["exit_early"] = True
|
||||||
|
elif key == keyboard.Key.esc:
|
||||||
|
print("Escape key pressed. Stopping data recording...")
|
||||||
|
events["stop_recording"] = True
|
||||||
|
events["exit_early"] = True
|
||||||
|
elif assign_rewards and key == keyboard.Key.space:
|
||||||
|
events["next.reward"] = 1 if events["next.reward"] == 0 else 0
|
||||||
|
print(
|
||||||
|
"Space key pressed. Assigning new reward to the subsequent frames. New reward:",
|
||||||
|
events["next.reward"],
|
||||||
|
)
|
||||||
|
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error handling key press: {e}")
|
||||||
|
|
||||||
|
listener = keyboard.Listener(on_press=on_press)
|
||||||
|
listener.start()
|
||||||
|
|
||||||
|
return listener, events
|
||||||
|
|
||||||
|
|
||||||
|
def init_policy(pretrained_policy_name_or_path, policy_overrides):
|
||||||
|
"""Instantiate the policy and load fps, device and use_amp from config yaml"""
|
||||||
|
pretrained_policy_path = get_pretrained_policy_path(pretrained_policy_name_or_path)
|
||||||
|
hydra_cfg = init_hydra_config(pretrained_policy_path / "config.yaml", policy_overrides)
|
||||||
|
policy = make_policy(hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=pretrained_policy_path)
|
||||||
|
|
||||||
|
# Check device is available
|
||||||
|
device = get_safe_torch_device(hydra_cfg.device, log=True)
|
||||||
|
use_amp = hydra_cfg.use_amp
|
||||||
|
policy_fps = hydra_cfg.env.fps
|
||||||
|
|
||||||
|
policy.eval()
|
||||||
|
policy.to(device)
|
||||||
|
|
||||||
|
torch.backends.cudnn.benchmark = True
|
||||||
|
torch.backends.cuda.matmul.allow_tf32 = True
|
||||||
|
set_global_seed(hydra_cfg.seed)
|
||||||
|
return policy, policy_fps, device, use_amp
|
||||||
|
|
||||||
|
|
||||||
|
def warmup_record(
|
||||||
|
robot,
|
||||||
|
events,
|
||||||
|
enable_teleoperation,
|
||||||
|
warmup_time_s,
|
||||||
|
display_cameras,
|
||||||
|
fps,
|
||||||
|
):
|
||||||
|
control_loop(
|
||||||
|
robot=robot,
|
||||||
|
control_time_s=warmup_time_s,
|
||||||
|
display_cameras=display_cameras,
|
||||||
|
events=events,
|
||||||
|
fps=fps,
|
||||||
|
teleoperate=enable_teleoperation,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def record_episode(
|
||||||
|
robot,
|
||||||
|
dataset,
|
||||||
|
events,
|
||||||
|
episode_time_s,
|
||||||
|
display_cameras,
|
||||||
|
policy,
|
||||||
|
device,
|
||||||
|
use_amp,
|
||||||
|
fps,
|
||||||
|
):
|
||||||
|
control_loop(
|
||||||
|
robot=robot,
|
||||||
|
control_time_s=episode_time_s,
|
||||||
|
display_cameras=display_cameras,
|
||||||
|
dataset=dataset,
|
||||||
|
events=events,
|
||||||
|
policy=policy,
|
||||||
|
device=device,
|
||||||
|
use_amp=use_amp,
|
||||||
|
fps=fps,
|
||||||
|
teleoperate=policy is None,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
@safe_stop_image_writer
|
||||||
|
def control_loop(
|
||||||
|
robot,
|
||||||
|
control_time_s=None,
|
||||||
|
teleoperate=False,
|
||||||
|
display_cameras=False,
|
||||||
|
dataset: LeRobotDataset | None = None,
|
||||||
|
events=None,
|
||||||
|
policy=None,
|
||||||
|
device=None,
|
||||||
|
use_amp=None,
|
||||||
|
fps=None,
|
||||||
|
):
|
||||||
|
# TODO(rcadene): Add option to record logs
|
||||||
|
if not robot.is_connected:
|
||||||
|
robot.connect()
|
||||||
|
|
||||||
|
if events is None:
|
||||||
|
events = {"exit_early": False}
|
||||||
|
|
||||||
|
if control_time_s is None:
|
||||||
|
control_time_s = float("inf")
|
||||||
|
|
||||||
|
if teleoperate and policy is not None:
|
||||||
|
raise ValueError("When `teleoperate` is True, `policy` should be None.")
|
||||||
|
|
||||||
|
if dataset is not None and fps is not None and dataset.fps != fps:
|
||||||
|
raise ValueError(f"The dataset fps should be equal to requested fps ({dataset['fps']} != {fps}).")
|
||||||
|
|
||||||
|
timestamp = 0
|
||||||
|
start_episode_t = time.perf_counter()
|
||||||
|
while timestamp < control_time_s:
|
||||||
|
start_loop_t = time.perf_counter()
|
||||||
|
|
||||||
|
if teleoperate:
|
||||||
|
observation, action = robot.teleop_step(record_data=True)
|
||||||
|
else:
|
||||||
|
observation = robot.capture_observation()
|
||||||
|
|
||||||
|
if policy is not None:
|
||||||
|
pred_action = predict_action(observation, policy, device, use_amp)
|
||||||
|
# Action can eventually be clipped using `max_relative_target`,
|
||||||
|
# so action actually sent is saved in the dataset.
|
||||||
|
action = robot.send_action(pred_action)
|
||||||
|
action = {"action": action}
|
||||||
|
|
||||||
|
if dataset is not None:
|
||||||
|
frame = {**observation, **action}
|
||||||
|
if "next.reward" in events:
|
||||||
|
frame["next.reward"] = events["next.reward"]
|
||||||
|
dataset.add_frame(frame)
|
||||||
|
|
||||||
|
if display_cameras and not is_headless():
|
||||||
|
image_keys = [key for key in observation if "image" in key]
|
||||||
|
for key in image_keys:
|
||||||
|
cv2.imshow(key, cv2.cvtColor(observation[key].numpy(), cv2.COLOR_RGB2BGR))
|
||||||
|
cv2.waitKey(1)
|
||||||
|
|
||||||
|
if fps is not None:
|
||||||
|
dt_s = time.perf_counter() - start_loop_t
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
dt_s = time.perf_counter() - start_loop_t
|
||||||
|
log_control_info(robot, dt_s, fps=fps)
|
||||||
|
|
||||||
|
timestamp = time.perf_counter() - start_episode_t
|
||||||
|
if events["exit_early"]:
|
||||||
|
events["exit_early"] = False
|
||||||
|
break
|
||||||
|
|
||||||
|
|
||||||
|
def reset_environment(robot, events, reset_time_s):
|
||||||
|
# TODO(rcadene): refactor warmup_record and reset_environment
|
||||||
|
# TODO(alibets): allow for teleop during reset
|
||||||
|
if has_method(robot, "teleop_safety_stop"):
|
||||||
|
robot.teleop_safety_stop()
|
||||||
|
|
||||||
|
timestamp = 0
|
||||||
|
start_vencod_t = time.perf_counter()
|
||||||
|
if "next.reward" in events:
|
||||||
|
events["next.reward"] = 0
|
||||||
|
|
||||||
|
# Wait if necessary
|
||||||
|
with tqdm.tqdm(total=reset_time_s, desc="Waiting") as pbar:
|
||||||
|
while timestamp < reset_time_s:
|
||||||
|
time.sleep(1)
|
||||||
|
timestamp = time.perf_counter() - start_vencod_t
|
||||||
|
pbar.update(1)
|
||||||
|
if events["exit_early"]:
|
||||||
|
events["exit_early"] = False
|
||||||
|
break
|
||||||
|
|
||||||
|
|
||||||
|
def stop_recording(robot, listener, display_cameras):
|
||||||
|
robot.disconnect()
|
||||||
|
|
||||||
|
if not is_headless():
|
||||||
|
if listener is not None:
|
||||||
|
listener.stop()
|
||||||
|
|
||||||
|
if display_cameras:
|
||||||
|
cv2.destroyAllWindows()
|
||||||
|
|
||||||
|
|
||||||
|
def sanity_check_dataset_name(repo_id, policy):
|
||||||
|
_, dataset_name = repo_id.split("/")
|
||||||
|
# either repo_id doesnt start with "eval_" and there is no policy
|
||||||
|
# or repo_id starts with "eval_" and there is a policy
|
||||||
|
|
||||||
|
# Check if dataset_name starts with "eval_" but policy is missing
|
||||||
|
if dataset_name.startswith("eval_") and policy is None:
|
||||||
|
raise ValueError(
|
||||||
|
f"Your dataset name begins with 'eval_' ({dataset_name}), but no policy is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
# Check if dataset_name does not start with "eval_" but policy is provided
|
||||||
|
if not dataset_name.startswith("eval_") and policy is not None:
|
||||||
|
raise ValueError(
|
||||||
|
f"Your dataset name does not begin with 'eval_' ({dataset_name}), but a policy is provided ({policy})."
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def sanity_check_dataset_robot_compatibility(
|
||||||
|
dataset: LeRobotDataset, robot: Robot, fps: int, use_videos: bool
|
||||||
|
) -> None:
|
||||||
|
fields = [
|
||||||
|
("robot_type", dataset.meta.robot_type, robot.robot_type),
|
||||||
|
("fps", dataset.fps, fps),
|
||||||
|
("features", dataset.features, get_features_from_robot(robot, use_videos)),
|
||||||
|
]
|
||||||
|
|
||||||
|
mismatches = []
|
||||||
|
for field, dataset_value, present_value in fields:
|
||||||
|
diff = DeepDiff(dataset_value, present_value, exclude_regex_paths=[r".*\['info'\]$"])
|
||||||
|
if diff:
|
||||||
|
mismatches.append(f"{field}: expected {present_value}, got {dataset_value}")
|
||||||
|
|
||||||
|
if mismatches:
|
||||||
|
raise ValueError(
|
||||||
|
"Dataset metadata compatibility check failed with mismatches:\n" + "\n".join(mismatches)
|
||||||
|
)
|
||||||
@@ -1,22 +1,12 @@
|
|||||||
import enum
|
import enum
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
import time
|
import time
|
||||||
import traceback
|
import traceback
|
||||||
from copy import deepcopy
|
from copy import deepcopy
|
||||||
from pathlib import Path
|
|
||||||
|
|
||||||
import numpy as np
|
import numpy as np
|
||||||
import tqdm
|
import tqdm
|
||||||
from dynamixel_sdk import (
|
|
||||||
COMM_SUCCESS,
|
|
||||||
DXL_HIBYTE,
|
|
||||||
DXL_HIWORD,
|
|
||||||
DXL_LOBYTE,
|
|
||||||
DXL_LOWORD,
|
|
||||||
GroupSyncRead,
|
|
||||||
GroupSyncWrite,
|
|
||||||
PacketHandler,
|
|
||||||
PortHandler,
|
|
||||||
)
|
|
||||||
|
|
||||||
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
||||||
from lerobot.common.utils.utils import capture_timestamp_utc
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
@@ -27,11 +17,28 @@ TIMEOUT_MS = 1000
|
|||||||
|
|
||||||
MAX_ID_RANGE = 252
|
MAX_ID_RANGE = 252
|
||||||
|
|
||||||
|
# The following bounds define the lower and upper joints range (after calibration).
|
||||||
|
# For joints in degree (i.e. revolute joints), their nominal range is [-180, 180] degrees
|
||||||
|
# which corresponds to a half rotation on the left and half rotation on the right.
|
||||||
|
# Some joints might require higher range, so we allow up to [-270, 270] degrees until
|
||||||
|
# an error is raised.
|
||||||
|
LOWER_BOUND_DEGREE = -270
|
||||||
|
UPPER_BOUND_DEGREE = 270
|
||||||
|
# For joints in percentage (i.e. joints that move linearly like the prismatic joint of a gripper),
|
||||||
|
# their nominal range is [0, 100] %. For instance, for Aloha gripper, 0% is fully
|
||||||
|
# closed, and 100% is fully open. To account for slight calibration issue, we allow up to
|
||||||
|
# [-10, 110] until an error is raised.
|
||||||
|
LOWER_BOUND_LINEAR = -10
|
||||||
|
UPPER_BOUND_LINEAR = 110
|
||||||
|
|
||||||
|
HALF_TURN_DEGREE = 180
|
||||||
|
|
||||||
# https://emanual.robotis.com/docs/en/dxl/x/xl330-m077
|
# https://emanual.robotis.com/docs/en/dxl/x/xl330-m077
|
||||||
# https://emanual.robotis.com/docs/en/dxl/x/xl330-m288
|
# https://emanual.robotis.com/docs/en/dxl/x/xl330-m288
|
||||||
# https://emanual.robotis.com/docs/en/dxl/x/xl430-w250
|
# https://emanual.robotis.com/docs/en/dxl/x/xl430-w250
|
||||||
# https://emanual.robotis.com/docs/en/dxl/x/xm430-w350
|
# https://emanual.robotis.com/docs/en/dxl/x/xm430-w350
|
||||||
# https://emanual.robotis.com/docs/en/dxl/x/xm540-w270
|
# https://emanual.robotis.com/docs/en/dxl/x/xm540-w270
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xc430-w150
|
||||||
|
|
||||||
# data_name: (address, size_byte)
|
# data_name: (address, size_byte)
|
||||||
X_SERIES_CONTROL_TABLE = {
|
X_SERIES_CONTROL_TABLE = {
|
||||||
@@ -109,6 +116,7 @@ MODEL_CONTROL_TABLE = {
|
|||||||
"xl430-w250": X_SERIES_CONTROL_TABLE,
|
"xl430-w250": X_SERIES_CONTROL_TABLE,
|
||||||
"xm430-w350": X_SERIES_CONTROL_TABLE,
|
"xm430-w350": X_SERIES_CONTROL_TABLE,
|
||||||
"xm540-w270": X_SERIES_CONTROL_TABLE,
|
"xm540-w270": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xc430-w150": X_SERIES_CONTROL_TABLE,
|
||||||
}
|
}
|
||||||
|
|
||||||
MODEL_RESOLUTION = {
|
MODEL_RESOLUTION = {
|
||||||
@@ -118,6 +126,7 @@ MODEL_RESOLUTION = {
|
|||||||
"xl430-w250": 4096,
|
"xl430-w250": 4096,
|
||||||
"xm430-w350": 4096,
|
"xm430-w350": 4096,
|
||||||
"xm540-w270": 4096,
|
"xm540-w270": 4096,
|
||||||
|
"xc430-w150": 4096,
|
||||||
}
|
}
|
||||||
|
|
||||||
MODEL_BAUDRATE_TABLE = {
|
MODEL_BAUDRATE_TABLE = {
|
||||||
@@ -127,44 +136,47 @@ MODEL_BAUDRATE_TABLE = {
|
|||||||
"xl430-w250": X_SERIES_BAUDRATE_TABLE,
|
"xl430-w250": X_SERIES_BAUDRATE_TABLE,
|
||||||
"xm430-w350": X_SERIES_BAUDRATE_TABLE,
|
"xm430-w350": X_SERIES_BAUDRATE_TABLE,
|
||||||
"xm540-w270": X_SERIES_BAUDRATE_TABLE,
|
"xm540-w270": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xc430-w150": X_SERIES_BAUDRATE_TABLE,
|
||||||
}
|
}
|
||||||
|
|
||||||
NUM_READ_RETRY = 10
|
NUM_READ_RETRY = 10
|
||||||
NUM_WRITE_RETRY = 10
|
NUM_WRITE_RETRY = 10
|
||||||
|
|
||||||
|
|
||||||
def convert_degrees_to_steps(degrees: float | np.ndarray, models: str | list[str]):
|
def convert_degrees_to_steps(degrees: float | np.ndarray, models: str | list[str]) -> np.ndarray:
|
||||||
"""This function convert the degree range to the step range for indicating motors rotation.
|
"""This function converts the degree range to the step range for indicating motors rotation.
|
||||||
It assums a motor achieves a full rotation by going from -180 degree position to +180.
|
It assumes a motor achieves a full rotation by going from -180 degree position to +180.
|
||||||
The motor resolution (e.g. 4096) corresponds to the number of steps needed to achieve a full rotation.
|
The motor resolution (e.g. 4096) corresponds to the number of steps needed to achieve a full rotation.
|
||||||
"""
|
"""
|
||||||
if isinstance(degrees, float):
|
|
||||||
degrees = np.array(degrees)
|
|
||||||
|
|
||||||
resolutions = [MODEL_RESOLUTION[model] for model in models]
|
resolutions = [MODEL_RESOLUTION[model] for model in models]
|
||||||
steps = degrees / 180 * np.array(resolutions) / 2
|
steps = degrees / 180 * np.array(resolutions) / 2
|
||||||
steps = steps.astype(int)
|
steps = steps.astype(int)
|
||||||
return steps
|
return steps
|
||||||
|
|
||||||
|
|
||||||
def convert_to_bytes(value, bytes):
|
def convert_to_bytes(value, bytes, mock=False):
|
||||||
|
if mock:
|
||||||
|
return value
|
||||||
|
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
# Note: No need to convert back into unsigned int, since this byte preprocessing
|
# Note: No need to convert back into unsigned int, since this byte preprocessing
|
||||||
# already handles it for us.
|
# already handles it for us.
|
||||||
if bytes == 1:
|
if bytes == 1:
|
||||||
data = [
|
data = [
|
||||||
DXL_LOBYTE(DXL_LOWORD(value)),
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
]
|
]
|
||||||
elif bytes == 2:
|
elif bytes == 2:
|
||||||
data = [
|
data = [
|
||||||
DXL_LOBYTE(DXL_LOWORD(value)),
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
DXL_HIBYTE(DXL_LOWORD(value)),
|
dxl.DXL_HIBYTE(dxl.DXL_LOWORD(value)),
|
||||||
]
|
]
|
||||||
elif bytes == 4:
|
elif bytes == 4:
|
||||||
data = [
|
data = [
|
||||||
DXL_LOBYTE(DXL_LOWORD(value)),
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
DXL_HIBYTE(DXL_LOWORD(value)),
|
dxl.DXL_HIBYTE(dxl.DXL_LOWORD(value)),
|
||||||
DXL_LOBYTE(DXL_HIWORD(value)),
|
dxl.DXL_LOBYTE(dxl.DXL_HIWORD(value)),
|
||||||
DXL_HIBYTE(DXL_HIWORD(value)),
|
dxl.DXL_HIBYTE(dxl.DXL_HIWORD(value)),
|
||||||
]
|
]
|
||||||
else:
|
else:
|
||||||
raise NotImplementedError(
|
raise NotImplementedError(
|
||||||
@@ -216,54 +228,29 @@ def assert_same_address(model_ctrl_table, motor_models, data_name):
|
|||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
def find_available_ports():
|
|
||||||
ports = []
|
|
||||||
for path in Path("/dev").glob("tty*"):
|
|
||||||
ports.append(str(path))
|
|
||||||
return ports
|
|
||||||
|
|
||||||
|
|
||||||
def find_port():
|
|
||||||
print("Finding all available ports for the DynamixelMotorsBus.")
|
|
||||||
ports_before = find_available_ports()
|
|
||||||
print(ports_before)
|
|
||||||
|
|
||||||
print("Remove the usb cable from your DynamixelMotorsBus and press Enter when done.")
|
|
||||||
input()
|
|
||||||
|
|
||||||
time.sleep(0.5)
|
|
||||||
ports_after = find_available_ports()
|
|
||||||
ports_diff = list(set(ports_before) - set(ports_after))
|
|
||||||
|
|
||||||
if len(ports_diff) == 1:
|
|
||||||
port = ports_diff[0]
|
|
||||||
print(f"The port of this DynamixelMotorsBus is '{port}'")
|
|
||||||
print("Reconnect the usb cable.")
|
|
||||||
elif len(ports_diff) == 0:
|
|
||||||
raise OSError(f"Could not detect the port. No difference was found ({ports_diff}).")
|
|
||||||
else:
|
|
||||||
raise OSError(f"Could not detect the port. More than one port was found ({ports_diff}).")
|
|
||||||
|
|
||||||
|
|
||||||
class TorqueMode(enum.Enum):
|
class TorqueMode(enum.Enum):
|
||||||
ENABLED = 1
|
ENABLED = 1
|
||||||
DISABLED = 0
|
DISABLED = 0
|
||||||
|
|
||||||
|
|
||||||
class OperatingMode(enum.Enum):
|
|
||||||
VELOCITY = 1
|
|
||||||
POSITION = 3
|
|
||||||
EXTENDED_POSITION = 4
|
|
||||||
CURRENT_CONTROLLED_POSITION = 5
|
|
||||||
PWM = 16
|
|
||||||
UNKNOWN = -1
|
|
||||||
|
|
||||||
|
|
||||||
class DriveMode(enum.Enum):
|
class DriveMode(enum.Enum):
|
||||||
NON_INVERTED = 0
|
NON_INVERTED = 0
|
||||||
INVERTED = 1
|
INVERTED = 1
|
||||||
|
|
||||||
|
|
||||||
|
class CalibrationMode(enum.Enum):
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
DEGREE = 0
|
||||||
|
# Joints with linear motions (like gripper of Aloha) are experessed in nominal range of [0, 100]
|
||||||
|
LINEAR = 1
|
||||||
|
|
||||||
|
|
||||||
|
class JointOutOfRangeError(Exception):
|
||||||
|
def __init__(self, message="Joint is out of range"):
|
||||||
|
self.message = message
|
||||||
|
super().__init__(self.message)
|
||||||
|
|
||||||
|
|
||||||
class DynamixelMotorsBus:
|
class DynamixelMotorsBus:
|
||||||
# TODO(rcadene): Add a script to find the motor indices without DynamixelWizzard2
|
# TODO(rcadene): Add a script to find the motor indices without DynamixelWizzard2
|
||||||
"""
|
"""
|
||||||
@@ -273,8 +260,8 @@ class DynamixelMotorsBus:
|
|||||||
A DynamixelMotorsBus instance requires a port (e.g. `DynamixelMotorsBus(port="/dev/tty.usbmodem575E0031751"`)).
|
A DynamixelMotorsBus instance requires a port (e.g. `DynamixelMotorsBus(port="/dev/tty.usbmodem575E0031751"`)).
|
||||||
To find the port, you can run our utility script:
|
To find the port, you can run our utility script:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/common/robot_devices/motors/dynamixel.py
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
>>> Finding all available ports for the DynamixelMotorsBus.
|
>>> Finding all available ports for the MotorBus.
|
||||||
>>> ['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
>>> ['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
>>> Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
>>> Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
>>> The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751.
|
>>> The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751.
|
||||||
@@ -310,9 +297,11 @@ class DynamixelMotorsBus:
|
|||||||
motors: dict[str, tuple[int, str]],
|
motors: dict[str, tuple[int, str]],
|
||||||
extra_model_control_table: dict[str, list[tuple]] | None = None,
|
extra_model_control_table: dict[str, list[tuple]] | None = None,
|
||||||
extra_model_resolution: dict[str, int] | None = None,
|
extra_model_resolution: dict[str, int] | None = None,
|
||||||
|
mock=False,
|
||||||
):
|
):
|
||||||
self.port = port
|
self.port = port
|
||||||
self.motors = motors
|
self.motors = motors
|
||||||
|
self.mock = mock
|
||||||
|
|
||||||
self.model_ctrl_table = deepcopy(MODEL_CONTROL_TABLE)
|
self.model_ctrl_table = deepcopy(MODEL_CONTROL_TABLE)
|
||||||
if extra_model_control_table:
|
if extra_model_control_table:
|
||||||
@@ -336,8 +325,13 @@ class DynamixelMotorsBus:
|
|||||||
f"DynamixelMotorsBus({self.port}) is already connected. Do not call `motors_bus.connect()` twice."
|
f"DynamixelMotorsBus({self.port}) is already connected. Do not call `motors_bus.connect()` twice."
|
||||||
)
|
)
|
||||||
|
|
||||||
self.port_handler = PortHandler(self.port)
|
if self.mock:
|
||||||
self.packet_handler = PacketHandler(PROTOCOL_VERSION)
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
self.port_handler = dxl.PortHandler(self.port)
|
||||||
|
self.packet_handler = dxl.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
try:
|
try:
|
||||||
if not self.port_handler.openPort():
|
if not self.port_handler.openPort():
|
||||||
@@ -345,7 +339,7 @@ class DynamixelMotorsBus:
|
|||||||
except Exception:
|
except Exception:
|
||||||
traceback.print_exc()
|
traceback.print_exc()
|
||||||
print(
|
print(
|
||||||
"\nTry running `python lerobot/common/robot_devices/motors/dynamixel.py` to make sure you are using the correct port.\n"
|
"\nTry running `python lerobot/scripts/find_motors_bus_port.py` to make sure you are using the correct port.\n"
|
||||||
)
|
)
|
||||||
raise
|
raise
|
||||||
|
|
||||||
@@ -354,25 +348,18 @@ class DynamixelMotorsBus:
|
|||||||
|
|
||||||
self.port_handler.setPacketTimeoutMillis(TIMEOUT_MS)
|
self.port_handler.setPacketTimeoutMillis(TIMEOUT_MS)
|
||||||
|
|
||||||
# Set expected baudrate for the bus
|
|
||||||
self.set_bus_baudrate(BAUDRATE)
|
|
||||||
|
|
||||||
if not self.are_motors_configured():
|
|
||||||
input(
|
|
||||||
"\n/!\\ A configuration issue has been detected with your motors: \n"
|
|
||||||
"If it's the first time that you use these motors, press enter to configure your motors... but before "
|
|
||||||
"verify that all the cables are connected the proper way. If you find an issue, before making a modification, "
|
|
||||||
"kill the python process, unplug the power cord to not damage the motors, rewire correctly, then plug the power "
|
|
||||||
"again and relaunch the script.\n"
|
|
||||||
)
|
|
||||||
print()
|
|
||||||
self.configure_motors()
|
|
||||||
|
|
||||||
def reconnect(self):
|
def reconnect(self):
|
||||||
self.port_handler = PortHandler(self.port)
|
if self.mock:
|
||||||
self.packet_handler = PacketHandler(PROTOCOL_VERSION)
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
self.port_handler = dxl.PortHandler(self.port)
|
||||||
|
self.packet_handler = dxl.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
if not self.port_handler.openPort():
|
if not self.port_handler.openPort():
|
||||||
raise OSError(f"Failed to open port '{self.port}'.")
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
|
||||||
self.is_connected = True
|
self.is_connected = True
|
||||||
|
|
||||||
def are_motors_configured(self):
|
def are_motors_configured(self):
|
||||||
@@ -384,120 +371,14 @@ class DynamixelMotorsBus:
|
|||||||
print(e)
|
print(e)
|
||||||
return False
|
return False
|
||||||
|
|
||||||
def configure_motors(self):
|
def find_motor_indices(self, possible_ids=None, num_retry=2):
|
||||||
# TODO(rcadene): This script assumes motors follow the X_SERIES baudrates
|
|
||||||
# TODO(rcadene): Refactor this function with intermediate high-level functions
|
|
||||||
|
|
||||||
print("Scanning all baudrates and motor indices")
|
|
||||||
all_baudrates = set(X_SERIES_BAUDRATE_TABLE.values())
|
|
||||||
ids_per_baudrate = {}
|
|
||||||
for baudrate in all_baudrates:
|
|
||||||
self.set_bus_baudrate(baudrate)
|
|
||||||
present_ids = self.find_motor_indices()
|
|
||||||
if len(present_ids) > 0:
|
|
||||||
ids_per_baudrate[baudrate] = present_ids
|
|
||||||
print(f"Motor indices detected: {ids_per_baudrate}")
|
|
||||||
print()
|
|
||||||
|
|
||||||
possible_baudrates = list(ids_per_baudrate.keys())
|
|
||||||
possible_ids = list({idx for sublist in ids_per_baudrate.values() for idx in sublist})
|
|
||||||
untaken_ids = list(set(range(MAX_ID_RANGE)) - set(possible_ids) - set(self.motor_indices))
|
|
||||||
|
|
||||||
# Connect successively one motor to the chain and write a unique random index for each
|
|
||||||
for i in range(len(self.motors)):
|
|
||||||
self.disconnect()
|
|
||||||
input(
|
|
||||||
"1. Unplug the power cord\n"
|
|
||||||
"2. Plug/unplug minimal number of cables to only have the first "
|
|
||||||
f"{i+1} motor(s) ({self.motor_names[:i+1]}) connected.\n"
|
|
||||||
"3. Re-plug the power cord\n"
|
|
||||||
"Press Enter to continue..."
|
|
||||||
)
|
|
||||||
print()
|
|
||||||
self.reconnect()
|
|
||||||
|
|
||||||
if i > 0:
|
|
||||||
try:
|
|
||||||
self._read_with_motor_ids(self.motor_models, untaken_ids[:i], "ID")
|
|
||||||
except ConnectionError:
|
|
||||||
print(f"Failed to read from {untaken_ids[:i+1]}. Make sure the power cord is plugged in.")
|
|
||||||
input("Press Enter to continue...")
|
|
||||||
print()
|
|
||||||
self.reconnect()
|
|
||||||
|
|
||||||
print("Scanning possible baudrates and motor indices")
|
|
||||||
motor_found = False
|
|
||||||
for baudrate in possible_baudrates:
|
|
||||||
self.set_bus_baudrate(baudrate)
|
|
||||||
present_ids = self.find_motor_indices(possible_ids)
|
|
||||||
if len(present_ids) == 1:
|
|
||||||
present_idx = present_ids[0]
|
|
||||||
print(f"Detected motor with index {present_idx}")
|
|
||||||
|
|
||||||
if baudrate != BAUDRATE:
|
|
||||||
print(f"Setting its baudrate to {BAUDRATE}")
|
|
||||||
baudrate_idx = list(X_SERIES_BAUDRATE_TABLE.values()).index(BAUDRATE)
|
|
||||||
|
|
||||||
# The write can fail, so we allow retries
|
|
||||||
for _ in range(NUM_WRITE_RETRY):
|
|
||||||
self._write_with_motor_ids(
|
|
||||||
self.motor_models, present_idx, "Baud_Rate", baudrate_idx
|
|
||||||
)
|
|
||||||
time.sleep(0.5)
|
|
||||||
self.set_bus_baudrate(BAUDRATE)
|
|
||||||
try:
|
|
||||||
present_baudrate_idx = self._read_with_motor_ids(
|
|
||||||
self.motor_models, present_idx, "Baud_Rate"
|
|
||||||
)
|
|
||||||
except ConnectionError:
|
|
||||||
print("Failed to write baudrate. Retrying.")
|
|
||||||
self.set_bus_baudrate(baudrate)
|
|
||||||
continue
|
|
||||||
break
|
|
||||||
else:
|
|
||||||
raise
|
|
||||||
|
|
||||||
if present_baudrate_idx != baudrate_idx:
|
|
||||||
raise OSError("Failed to write baudrate.")
|
|
||||||
|
|
||||||
print(f"Setting its index to a temporary untaken index ({untaken_ids[i]})")
|
|
||||||
self._write_with_motor_ids(self.motor_models, present_idx, "ID", untaken_ids[i])
|
|
||||||
|
|
||||||
present_idx = self._read_with_motor_ids(self.motor_models, untaken_ids[i], "ID")
|
|
||||||
if present_idx != untaken_ids[i]:
|
|
||||||
raise OSError("Failed to write index.")
|
|
||||||
|
|
||||||
motor_found = True
|
|
||||||
break
|
|
||||||
elif len(present_ids) > 1:
|
|
||||||
raise OSError(f"More than one motor detected ({present_ids}), but only one was expected.")
|
|
||||||
|
|
||||||
if not motor_found:
|
|
||||||
raise OSError(
|
|
||||||
"No motor found, but one new motor expected. Verify power cord is plugged in and retry."
|
|
||||||
)
|
|
||||||
print()
|
|
||||||
|
|
||||||
print(f"Setting expected motor indices: {self.motor_indices}")
|
|
||||||
self.set_bus_baudrate(BAUDRATE)
|
|
||||||
self._write_with_motor_ids(
|
|
||||||
self.motor_models, untaken_ids[: len(self.motors)], "ID", self.motor_indices
|
|
||||||
)
|
|
||||||
print()
|
|
||||||
|
|
||||||
if (self.read("ID") != self.motor_indices).any():
|
|
||||||
raise OSError("Failed to write motors indices.")
|
|
||||||
|
|
||||||
print("Configuration is done!")
|
|
||||||
|
|
||||||
def find_motor_indices(self, possible_ids=None):
|
|
||||||
if possible_ids is None:
|
if possible_ids is None:
|
||||||
possible_ids = range(MAX_ID_RANGE)
|
possible_ids = range(MAX_ID_RANGE)
|
||||||
|
|
||||||
indices = []
|
indices = []
|
||||||
for idx in tqdm.tqdm(possible_ids):
|
for idx in tqdm.tqdm(possible_ids):
|
||||||
try:
|
try:
|
||||||
present_idx = self._read_with_motor_ids(self.motor_models, [idx], "ID")[0]
|
present_idx = self.read_with_motor_ids(self.motor_models, [idx], "ID", num_retry=num_retry)[0]
|
||||||
except ConnectionError:
|
except ConnectionError:
|
||||||
continue
|
continue
|
||||||
|
|
||||||
@@ -531,9 +412,22 @@ class DynamixelMotorsBus:
|
|||||||
def motor_indices(self) -> list[int]:
|
def motor_indices(self) -> list[int]:
|
||||||
return [idx for idx, _ in self.motors.values()]
|
return [idx for idx, _ in self.motors.values()]
|
||||||
|
|
||||||
def set_calibration(self, calibration: dict[str, tuple[int, bool]]):
|
def set_calibration(self, calibration: dict[str, list]):
|
||||||
self.calibration = calibration
|
self.calibration = calibration
|
||||||
|
|
||||||
|
def apply_calibration_autocorrect(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function applies the calibration, automatically detects out of range errors for motors values and attempts to correct.
|
||||||
|
|
||||||
|
For more info, see docstring of `apply_calibration` and `autocorrect_calibration`.
|
||||||
|
"""
|
||||||
|
try:
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
except JointOutOfRangeError as e:
|
||||||
|
print(e)
|
||||||
|
self.autocorrect_calibration(values, motor_names)
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
return values
|
||||||
|
|
||||||
def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
"""Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
|
"""Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
|
||||||
a "zero position" at 0 degree.
|
a "zero position" at 0 degree.
|
||||||
@@ -551,56 +445,205 @@ class DynamixelMotorsBus:
|
|||||||
if motor_names is None:
|
if motor_names is None:
|
||||||
motor_names = self.motor_names
|
motor_names = self.motor_names
|
||||||
|
|
||||||
# Convert from unsigned int32 original range [0, 2**32[ to centered signed int32 range [-2**31, 2**31[
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
values = values.astype(np.int32)
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
for i, name in enumerate(motor_names):
|
for i, name in enumerate(motor_names):
|
||||||
homing_offset, drive_mode = self.calibration[name]
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
# Update direction of rotation of the motor to match between leader and follower. In fact, the motor of the leader for a given joint
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
# can be assembled in an opposite direction in term of rotation than the motor of the follower on the same joint.
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Update direction of rotation of the motor to match between leader and follower.
|
||||||
|
# In fact, the motor of the leader for a given joint can be assembled in an
|
||||||
|
# opposite direction in term of rotation than the motor of the follower on the same joint.
|
||||||
if drive_mode:
|
if drive_mode:
|
||||||
values[i] *= -1
|
values[i] *= -1
|
||||||
|
|
||||||
# Convert from range [-2**31, 2**31[ to nominal range ]-resolution, resolution[ (e.g. ]-2048, 2048[)
|
# Convert from range [-2**31, 2**31] to
|
||||||
|
# nominal range [-resolution//2, resolution//2] (e.g. [-2048, 2048])
|
||||||
values[i] += homing_offset
|
values[i] += homing_offset
|
||||||
|
|
||||||
# Convert from range ]-resolution, resolution[ to the universal float32 centered degree range ]-180, 180[
|
# Convert from range [-resolution//2, resolution//2] to
|
||||||
values = values.astype(np.float32)
|
# universal float32 centered degree range [-180, 180]
|
||||||
for i, name in enumerate(motor_names):
|
# (e.g. 2048 / (4096 // 2) * 180 = 180)
|
||||||
_, model = self.motors[name]
|
values[i] = values[i] / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
resolution = self.model_resolution[model]
|
|
||||||
values[i] = values[i] / (resolution // 2) * 180
|
if (values[i] < LOWER_BOUND_DEGREE) or (values[i] > UPPER_BOUND_DEGREE):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [-{HALF_TURN_DEGREE}, {HALF_TURN_DEGREE}] degrees (a full rotation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_DEGREE}, {UPPER_BOUND_DEGREE}] degrees to account for joints that can rotate a bit more, "
|
||||||
|
f"but present value is {values[i]} degree. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial 360 degrees jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Rescale the present position to a nominal range [0, 100] %,
|
||||||
|
# useful for joints with linear motions like Aloha gripper
|
||||||
|
values[i] = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_LINEAR) or (values[i] > UPPER_BOUND_LINEAR):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [0, 100] % (a full linear translation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_LINEAR}, {UPPER_BOUND_LINEAR}] % to account for some imprecision during calibration, "
|
||||||
|
f"but present value is {values[i]} %. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
return values
|
return values
|
||||||
|
|
||||||
|
def autocorrect_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function automatically detects issues with values of motors after calibration, and correct for these issues.
|
||||||
|
|
||||||
|
Some motors might have values outside of expected maximum bounds after calibration.
|
||||||
|
For instance, for a joint in degree, its value can be outside [-270, 270] degrees, which is totally unexpected given
|
||||||
|
a nominal range of [-180, 180] degrees, which represents half a turn to the left or right starting from zero position.
|
||||||
|
|
||||||
|
Known issues:
|
||||||
|
#1: Motor value randomly shifts of a full turn, caused by hardware/connection errors.
|
||||||
|
#2: Motor internal homing offset is shifted by a full turn, caused by using default calibration (e.g Aloha).
|
||||||
|
#3: motor internal homing offset is shifted by less or more than a full turn, caused by using default calibration
|
||||||
|
or by human error during manual calibration.
|
||||||
|
|
||||||
|
Issues #1 and #2 can be solved by shifting the calibration homing offset by a full turn.
|
||||||
|
Issue #3 will be visually detected by user and potentially captured by the safety feature `max_relative_target`,
|
||||||
|
that will slow down the motor, raise an error asking to recalibrate. Manual recalibrating will solve the issue.
|
||||||
|
|
||||||
|
Note: A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Update direction of rotation of the motor to match between leader and follower.
|
||||||
|
# In fact, the motor of the leader for a given joint can be assembled in an
|
||||||
|
# opposite direction in term of rotation than the motor of the follower on the same joint.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from initial range to range [-180, 180] degrees
|
||||||
|
calib_val = (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
in_range = (calib_val > LOWER_BOUND_DEGREE) and (calib_val < UPPER_BOUND_DEGREE)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [-180, 180] degrees
|
||||||
|
# values[i] = (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
# - HALF_TURN_DEGREE <= (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE <= HALF_TURN_DEGREE
|
||||||
|
# (- (resolution // 2) - values[i] - homing_offset) / resolution <= factor <= ((resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
low_factor = (-(resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
upp_factor = ((resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from initial range to range [0, 100] in %
|
||||||
|
calib_val = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
in_range = (calib_val > LOWER_BOUND_LINEAR) and (calib_val < UPPER_BOUND_LINEAR)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [0, 100] %
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos + resolution * factor - start_pos - resolution * factor) * 100
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100
|
||||||
|
# 0 <= (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100 <= 100
|
||||||
|
# (start_pos - values[i]) / resolution <= factor <= (end_pos - values[i]) / resolution
|
||||||
|
low_factor = (start_pos - values[i]) / resolution
|
||||||
|
upp_factor = (end_pos - values[i]) / resolution
|
||||||
|
|
||||||
|
if not in_range:
|
||||||
|
# Get first integer between the two bounds
|
||||||
|
if low_factor < upp_factor:
|
||||||
|
factor = math.ceil(low_factor)
|
||||||
|
|
||||||
|
if factor > upp_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
else:
|
||||||
|
factor = math.ceil(upp_factor)
|
||||||
|
|
||||||
|
if factor > low_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
in_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
in_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
|
||||||
|
logging.warning(
|
||||||
|
f"Auto-correct calibration of motor '{name}' by shifting value by {abs(factor)} full turns, "
|
||||||
|
f"from '{out_of_range_str}' to '{in_range_str}'."
|
||||||
|
)
|
||||||
|
|
||||||
|
# A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
self.calibration["homing_offset"][calib_idx] += resolution * factor
|
||||||
|
|
||||||
def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
"""Inverse of `apply_calibration`."""
|
"""Inverse of `apply_calibration`."""
|
||||||
if motor_names is None:
|
if motor_names is None:
|
||||||
motor_names = self.motor_names
|
motor_names = self.motor_names
|
||||||
|
|
||||||
# Convert from the universal float32 centered degree range ]-180, 180[ to resolution range ]-resolution, resolution[
|
|
||||||
for i, name in enumerate(motor_names):
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
_, model = self.motors[name]
|
_, model = self.motors[name]
|
||||||
resolution = self.model_resolution[model]
|
resolution = self.model_resolution[model]
|
||||||
values[i] = values[i] / 180 * (resolution // 2)
|
|
||||||
|
|
||||||
values = np.round(values).astype(np.int32)
|
# Convert from nominal 0-centered degree range [-180, 180] to
|
||||||
|
# 0-centered resolution range (e.g. [-2048, 2048] for resolution=4096)
|
||||||
|
values[i] = values[i] / HALF_TURN_DEGREE * (resolution // 2)
|
||||||
|
|
||||||
# Convert from nominal range ]-resolution, resolution[ to centered signed int32 range [-2**31, 2**31[
|
# Substract the homing offsets to come back to actual motor range of values
|
||||||
for i, name in enumerate(motor_names):
|
# which can be arbitrary.
|
||||||
homing_offset, drive_mode = self.calibration[name]
|
|
||||||
values[i] -= homing_offset
|
values[i] -= homing_offset
|
||||||
|
|
||||||
# Update direction of rotation of the motor that was matching between leader and follower to their original direction.
|
# Remove drive mode, which is the rotation direction of the motor, to come back to
|
||||||
# In fact, the motor of the leader for a given joint can be assembled in an opposite direction in term of rotation
|
# actual motor rotation direction which can be arbitrary.
|
||||||
# than the motor of the follower on the same joint.
|
|
||||||
if drive_mode:
|
if drive_mode:
|
||||||
values[i] *= -1
|
values[i] *= -1
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from nominal lnear range of [0, 100] % to
|
||||||
|
# actual motor range of values which can be arbitrary.
|
||||||
|
values[i] = values[i] / 100 * (end_pos - start_pos) + start_pos
|
||||||
|
|
||||||
|
values = np.round(values).astype(np.int32)
|
||||||
return values
|
return values
|
||||||
|
|
||||||
def _read_with_motor_ids(self, motor_models, motor_ids, data_name):
|
def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
return_list = True
|
return_list = True
|
||||||
if not isinstance(motor_ids, list):
|
if not isinstance(motor_ids, list):
|
||||||
return_list = False
|
return_list = False
|
||||||
@@ -608,12 +651,16 @@ class DynamixelMotorsBus:
|
|||||||
|
|
||||||
assert_same_address(self.model_ctrl_table, self.motor_models, data_name)
|
assert_same_address(self.model_ctrl_table, self.motor_models, data_name)
|
||||||
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
group = GroupSyncRead(self.port_handler, self.packet_handler, addr, bytes)
|
group = dxl.GroupSyncRead(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
for idx in motor_ids:
|
for idx in motor_ids:
|
||||||
group.addParam(idx)
|
group.addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
comm = group.txRxPacket()
|
comm = group.txRxPacket()
|
||||||
if comm != COMM_SUCCESS:
|
if comm == dxl.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
raise ConnectionError(
|
raise ConnectionError(
|
||||||
f"Read failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
f"Read failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
f"{self.packet_handler.getTxRxResult(comm)}"
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
@@ -637,6 +684,11 @@ class DynamixelMotorsBus:
|
|||||||
|
|
||||||
start_time = time.perf_counter()
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
if motor_names is None:
|
if motor_names is None:
|
||||||
motor_names = self.motor_names
|
motor_names = self.motor_names
|
||||||
|
|
||||||
@@ -656,16 +708,18 @@ class DynamixelMotorsBus:
|
|||||||
|
|
||||||
if data_name not in self.group_readers:
|
if data_name not in self.group_readers:
|
||||||
# create new group reader
|
# create new group reader
|
||||||
self.group_readers[group_key] = GroupSyncRead(self.port_handler, self.packet_handler, addr, bytes)
|
self.group_readers[group_key] = dxl.GroupSyncRead(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
for idx in motor_ids:
|
for idx in motor_ids:
|
||||||
self.group_readers[group_key].addParam(idx)
|
self.group_readers[group_key].addParam(idx)
|
||||||
|
|
||||||
for _ in range(NUM_READ_RETRY):
|
for _ in range(NUM_READ_RETRY):
|
||||||
comm = self.group_readers[group_key].txRxPacket()
|
comm = self.group_readers[group_key].txRxPacket()
|
||||||
if comm == COMM_SUCCESS:
|
if comm == dxl.COMM_SUCCESS:
|
||||||
break
|
break
|
||||||
|
|
||||||
if comm != COMM_SUCCESS:
|
if comm != dxl.COMM_SUCCESS:
|
||||||
raise ConnectionError(
|
raise ConnectionError(
|
||||||
f"Read failed due to communication error on port {self.port} for group_key {group_key}: "
|
f"Read failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
f"{self.packet_handler.getTxRxResult(comm)}"
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
@@ -683,19 +737,7 @@ class DynamixelMotorsBus:
|
|||||||
values = values.astype(np.int32)
|
values = values.astype(np.int32)
|
||||||
|
|
||||||
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
values = self.apply_calibration(values, motor_names)
|
values = self.apply_calibration_autocorrect(values, motor_names)
|
||||||
|
|
||||||
# We expect our motors to stay in a nominal range of [-180, 180] degrees
|
|
||||||
# which corresponds to a half turn rotation.
|
|
||||||
# However, some motors can turn a bit more, hence we extend the nominal range to [-270, 270]
|
|
||||||
# which is less than a full 360 degree rotation.
|
|
||||||
if not np.all((values > -270) & (values < 270)):
|
|
||||||
raise ValueError(
|
|
||||||
f"Wrong motor position range detected. "
|
|
||||||
f"Expected to be in [-270, +270] but in [{values.min()}, {values.max()}]. "
|
|
||||||
"This might be due to a cable connection issue creating an artificial 360 degrees jump in motor values. "
|
|
||||||
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
|
||||||
)
|
|
||||||
|
|
||||||
# log the number of seconds it took to read the data from the motors
|
# log the number of seconds it took to read the data from the motors
|
||||||
delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
|
delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
|
||||||
@@ -707,7 +749,12 @@ class DynamixelMotorsBus:
|
|||||||
|
|
||||||
return values
|
return values
|
||||||
|
|
||||||
def _write_with_motor_ids(self, motor_models, motor_ids, data_name, values):
|
def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
if not isinstance(motor_ids, list):
|
if not isinstance(motor_ids, list):
|
||||||
motor_ids = [motor_ids]
|
motor_ids = [motor_ids]
|
||||||
if not isinstance(values, list):
|
if not isinstance(values, list):
|
||||||
@@ -715,13 +762,17 @@ class DynamixelMotorsBus:
|
|||||||
|
|
||||||
assert_same_address(self.model_ctrl_table, motor_models, data_name)
|
assert_same_address(self.model_ctrl_table, motor_models, data_name)
|
||||||
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
group = GroupSyncWrite(self.port_handler, self.packet_handler, addr, bytes)
|
group = dxl.GroupSyncWrite(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
for idx, value in zip(motor_ids, values, strict=True):
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
data = convert_to_bytes(value, bytes)
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
group.addParam(idx, data)
|
group.addParam(idx, data)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
comm = group.txPacket()
|
comm = group.txPacket()
|
||||||
if comm != COMM_SUCCESS:
|
if comm == dxl.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
raise ConnectionError(
|
raise ConnectionError(
|
||||||
f"Write failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
f"Write failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
f"{self.packet_handler.getTxRxResult(comm)}"
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
@@ -735,6 +786,11 @@ class DynamixelMotorsBus:
|
|||||||
|
|
||||||
start_time = time.perf_counter()
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
if motor_names is None:
|
if motor_names is None:
|
||||||
motor_names = self.motor_names
|
motor_names = self.motor_names
|
||||||
|
|
||||||
@@ -764,19 +820,19 @@ class DynamixelMotorsBus:
|
|||||||
|
|
||||||
init_group = data_name not in self.group_readers
|
init_group = data_name not in self.group_readers
|
||||||
if init_group:
|
if init_group:
|
||||||
self.group_writers[group_key] = GroupSyncWrite(
|
self.group_writers[group_key] = dxl.GroupSyncWrite(
|
||||||
self.port_handler, self.packet_handler, addr, bytes
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
)
|
)
|
||||||
|
|
||||||
for idx, value in zip(motor_ids, values, strict=True):
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
data = convert_to_bytes(value, bytes)
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
if init_group:
|
if init_group:
|
||||||
self.group_writers[group_key].addParam(idx, data)
|
self.group_writers[group_key].addParam(idx, data)
|
||||||
else:
|
else:
|
||||||
self.group_writers[group_key].changeParam(idx, data)
|
self.group_writers[group_key].changeParam(idx, data)
|
||||||
|
|
||||||
comm = self.group_writers[group_key].txPacket()
|
comm = self.group_writers[group_key].txPacket()
|
||||||
if comm != COMM_SUCCESS:
|
if comm != dxl.COMM_SUCCESS:
|
||||||
raise ConnectionError(
|
raise ConnectionError(
|
||||||
f"Write failed due to communication error on port {self.port} for group_key {group_key}: "
|
f"Write failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
f"{self.packet_handler.getTxRxResult(comm)}"
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
@@ -809,8 +865,3 @@ class DynamixelMotorsBus:
|
|||||||
def __del__(self):
|
def __del__(self):
|
||||||
if getattr(self, "is_connected", False):
|
if getattr(self, "is_connected", False):
|
||||||
self.disconnect()
|
self.disconnect()
|
||||||
|
|
||||||
|
|
||||||
if __name__ == "__main__":
|
|
||||||
# Helper to find the usb port associated to all your DynamixelMotorsBus.
|
|
||||||
find_port()
|
|
||||||
|
|||||||
887
lerobot/common/robot_devices/motors/feetech.py
Normal file
887
lerobot/common/robot_devices/motors/feetech.py
Normal file
@@ -0,0 +1,887 @@
|
|||||||
|
import enum
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from copy import deepcopy
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import tqdm
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
PROTOCOL_VERSION = 0
|
||||||
|
BAUDRATE = 1_000_000
|
||||||
|
TIMEOUT_MS = 1000
|
||||||
|
|
||||||
|
MAX_ID_RANGE = 252
|
||||||
|
|
||||||
|
# The following bounds define the lower and upper joints range (after calibration).
|
||||||
|
# For joints in degree (i.e. revolute joints), their nominal range is [-180, 180] degrees
|
||||||
|
# which corresponds to a half rotation on the left and half rotation on the right.
|
||||||
|
# Some joints might require higher range, so we allow up to [-270, 270] degrees until
|
||||||
|
# an error is raised.
|
||||||
|
LOWER_BOUND_DEGREE = -270
|
||||||
|
UPPER_BOUND_DEGREE = 270
|
||||||
|
# For joints in percentage (i.e. joints that move linearly like the prismatic joint of a gripper),
|
||||||
|
# their nominal range is [0, 100] %. For instance, for Aloha gripper, 0% is fully
|
||||||
|
# closed, and 100% is fully open. To account for slight calibration issue, we allow up to
|
||||||
|
# [-10, 110] until an error is raised.
|
||||||
|
LOWER_BOUND_LINEAR = -10
|
||||||
|
UPPER_BOUND_LINEAR = 110
|
||||||
|
|
||||||
|
HALF_TURN_DEGREE = 180
|
||||||
|
|
||||||
|
|
||||||
|
# See this link for STS3215 Memory Table:
|
||||||
|
# https://docs.google.com/spreadsheets/d/1GVs7W1VS1PqdhA1nW-abeyAHhTUxKUdR/edit?usp=sharing&ouid=116566590112741600240&rtpof=true&sd=true
|
||||||
|
# data_name: (address, size_byte)
|
||||||
|
SCS_SERIES_CONTROL_TABLE = {
|
||||||
|
"Model": (3, 2),
|
||||||
|
"ID": (5, 1),
|
||||||
|
"Baud_Rate": (6, 1),
|
||||||
|
"Return_Delay": (7, 1),
|
||||||
|
"Response_Status_Level": (8, 1),
|
||||||
|
"Min_Angle_Limit": (9, 2),
|
||||||
|
"Max_Angle_Limit": (11, 2),
|
||||||
|
"Max_Temperature_Limit": (13, 1),
|
||||||
|
"Max_Voltage_Limit": (14, 1),
|
||||||
|
"Min_Voltage_Limit": (15, 1),
|
||||||
|
"Max_Torque_Limit": (16, 2),
|
||||||
|
"Phase": (18, 1),
|
||||||
|
"Unloading_Condition": (19, 1),
|
||||||
|
"LED_Alarm_Condition": (20, 1),
|
||||||
|
"P_Coefficient": (21, 1),
|
||||||
|
"D_Coefficient": (22, 1),
|
||||||
|
"I_Coefficient": (23, 1),
|
||||||
|
"Minimum_Startup_Force": (24, 2),
|
||||||
|
"CW_Dead_Zone": (26, 1),
|
||||||
|
"CCW_Dead_Zone": (27, 1),
|
||||||
|
"Protection_Current": (28, 2),
|
||||||
|
"Angular_Resolution": (30, 1),
|
||||||
|
"Offset": (31, 2),
|
||||||
|
"Mode": (33, 1),
|
||||||
|
"Protective_Torque": (34, 1),
|
||||||
|
"Protection_Time": (35, 1),
|
||||||
|
"Overload_Torque": (36, 1),
|
||||||
|
"Speed_closed_loop_P_proportional_coefficient": (37, 1),
|
||||||
|
"Over_Current_Protection_Time": (38, 1),
|
||||||
|
"Velocity_closed_loop_I_integral_coefficient": (39, 1),
|
||||||
|
"Torque_Enable": (40, 1),
|
||||||
|
"Acceleration": (41, 1),
|
||||||
|
"Goal_Position": (42, 2),
|
||||||
|
"Goal_Time": (44, 2),
|
||||||
|
"Goal_Speed": (46, 2),
|
||||||
|
"Torque_Limit": (48, 2),
|
||||||
|
"Lock": (55, 1),
|
||||||
|
"Present_Position": (56, 2),
|
||||||
|
"Present_Speed": (58, 2),
|
||||||
|
"Present_Load": (60, 2),
|
||||||
|
"Present_Voltage": (62, 1),
|
||||||
|
"Present_Temperature": (63, 1),
|
||||||
|
"Status": (65, 1),
|
||||||
|
"Moving": (66, 1),
|
||||||
|
"Present_Current": (69, 2),
|
||||||
|
# Not in the Memory Table
|
||||||
|
"Maximum_Acceleration": (85, 2),
|
||||||
|
}
|
||||||
|
|
||||||
|
SCS_SERIES_BAUDRATE_TABLE = {
|
||||||
|
0: 1_000_000,
|
||||||
|
1: 500_000,
|
||||||
|
2: 250_000,
|
||||||
|
3: 128_000,
|
||||||
|
4: 115_200,
|
||||||
|
5: 57_600,
|
||||||
|
6: 38_400,
|
||||||
|
7: 19_200,
|
||||||
|
}
|
||||||
|
|
||||||
|
CALIBRATION_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
CONVERT_UINT32_TO_INT32_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
|
||||||
|
|
||||||
|
MODEL_CONTROL_TABLE = {
|
||||||
|
"scs_series": SCS_SERIES_CONTROL_TABLE,
|
||||||
|
"sts3215": SCS_SERIES_CONTROL_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_RESOLUTION = {
|
||||||
|
"scs_series": 4096,
|
||||||
|
"sts3215": 4096,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_BAUDRATE_TABLE = {
|
||||||
|
"scs_series": SCS_SERIES_BAUDRATE_TABLE,
|
||||||
|
"sts3215": SCS_SERIES_BAUDRATE_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
# High number of retries is needed for feetech compared to dynamixel motors.
|
||||||
|
NUM_READ_RETRY = 20
|
||||||
|
NUM_WRITE_RETRY = 20
|
||||||
|
|
||||||
|
|
||||||
|
def convert_degrees_to_steps(degrees: float | np.ndarray, models: str | list[str]) -> np.ndarray:
|
||||||
|
"""This function converts the degree range to the step range for indicating motors rotation.
|
||||||
|
It assumes a motor achieves a full rotation by going from -180 degree position to +180.
|
||||||
|
The motor resolution (e.g. 4096) corresponds to the number of steps needed to achieve a full rotation.
|
||||||
|
"""
|
||||||
|
resolutions = [MODEL_RESOLUTION[model] for model in models]
|
||||||
|
steps = degrees / 180 * np.array(resolutions) / 2
|
||||||
|
steps = steps.astype(int)
|
||||||
|
return steps
|
||||||
|
|
||||||
|
|
||||||
|
def convert_to_bytes(value, bytes, mock=False):
|
||||||
|
if mock:
|
||||||
|
return value
|
||||||
|
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
# Note: No need to convert back into unsigned int, since this byte preprocessing
|
||||||
|
# already handles it for us.
|
||||||
|
if bytes == 1:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 2:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 4:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_HIWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_HIWORD(value)),
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"Value of the number of bytes to be sent is expected to be in [1, 2, 4], but "
|
||||||
|
f"{bytes} is provided instead."
|
||||||
|
)
|
||||||
|
return data
|
||||||
|
|
||||||
|
|
||||||
|
def get_group_sync_key(data_name, motor_names):
|
||||||
|
group_key = f"{data_name}_" + "_".join(motor_names)
|
||||||
|
return group_key
|
||||||
|
|
||||||
|
|
||||||
|
def get_result_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
rslt_name = f"{fn_name}_{group_key}"
|
||||||
|
return rslt_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_queue_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
queue_name = f"{fn_name}_{group_key}"
|
||||||
|
return queue_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_log_name(var_name, fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
log_name = f"{var_name}_{fn_name}_{group_key}"
|
||||||
|
return log_name
|
||||||
|
|
||||||
|
|
||||||
|
def assert_same_address(model_ctrl_table, motor_models, data_name):
|
||||||
|
all_addr = []
|
||||||
|
all_bytes = []
|
||||||
|
for model in motor_models:
|
||||||
|
addr, bytes = model_ctrl_table[model][data_name]
|
||||||
|
all_addr.append(addr)
|
||||||
|
all_bytes.append(bytes)
|
||||||
|
|
||||||
|
if len(set(all_addr)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different address for `data_name`='{data_name}' ({list(zip(motor_models, all_addr, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
if len(set(all_bytes)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different bytes representation for `data_name`='{data_name}' ({list(zip(motor_models, all_bytes, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
class TorqueMode(enum.Enum):
|
||||||
|
ENABLED = 1
|
||||||
|
DISABLED = 0
|
||||||
|
|
||||||
|
|
||||||
|
class DriveMode(enum.Enum):
|
||||||
|
NON_INVERTED = 0
|
||||||
|
INVERTED = 1
|
||||||
|
|
||||||
|
|
||||||
|
class CalibrationMode(enum.Enum):
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
DEGREE = 0
|
||||||
|
# Joints with linear motions (like gripper of Aloha) are experessed in nominal range of [0, 100]
|
||||||
|
LINEAR = 1
|
||||||
|
|
||||||
|
|
||||||
|
class JointOutOfRangeError(Exception):
|
||||||
|
def __init__(self, message="Joint is out of range"):
|
||||||
|
self.message = message
|
||||||
|
super().__init__(self.message)
|
||||||
|
|
||||||
|
|
||||||
|
class FeetechMotorsBus:
|
||||||
|
"""
|
||||||
|
The FeetechMotorsBus class allows to efficiently read and write to the attached motors. It relies on
|
||||||
|
the python feetech sdk to communicate with the motors. For more info, see the [feetech SDK Documentation](https://emanual.robotis.com/docs/en/software/feetech/feetech_sdk/sample_code/python_read_write_protocol_2_0/#python-read-write-protocol-20).
|
||||||
|
|
||||||
|
A FeetechMotorsBus instance requires a port (e.g. `FeetechMotorsBus(port="/dev/tty.usbmodem575E0031751"`)).
|
||||||
|
To find the port, you can run our utility script:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
>>> Finding all available ports for the MotorsBus.
|
||||||
|
>>> ['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
>>> Remove the usb cable from your FeetechMotorsBus and press Enter when done.
|
||||||
|
>>> The port of this FeetechMotorsBus is /dev/tty.usbmodem575E0031751.
|
||||||
|
>>> Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of usage for 1 motor connected to the bus:
|
||||||
|
```python
|
||||||
|
motor_name = "gripper"
|
||||||
|
motor_index = 6
|
||||||
|
motor_model = "sts3215"
|
||||||
|
|
||||||
|
motors_bus = FeetechMotorsBus(
|
||||||
|
port="/dev/tty.usbmodem575E0031751",
|
||||||
|
motors={motor_name: (motor_index, motor_model)},
|
||||||
|
)
|
||||||
|
motors_bus.connect()
|
||||||
|
|
||||||
|
position = motors_bus.read("Present_Position")
|
||||||
|
|
||||||
|
# move from a few motor steps as an example
|
||||||
|
few_steps = 30
|
||||||
|
motors_bus.write("Goal_Position", position + few_steps)
|
||||||
|
|
||||||
|
# when done, consider disconnecting
|
||||||
|
motors_bus.disconnect()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
port: str,
|
||||||
|
motors: dict[str, tuple[int, str]],
|
||||||
|
extra_model_control_table: dict[str, list[tuple]] | None = None,
|
||||||
|
extra_model_resolution: dict[str, int] | None = None,
|
||||||
|
mock=False,
|
||||||
|
):
|
||||||
|
self.port = port
|
||||||
|
self.motors = motors
|
||||||
|
self.mock = mock
|
||||||
|
|
||||||
|
self.model_ctrl_table = deepcopy(MODEL_CONTROL_TABLE)
|
||||||
|
if extra_model_control_table:
|
||||||
|
self.model_ctrl_table.update(extra_model_control_table)
|
||||||
|
|
||||||
|
self.model_resolution = deepcopy(MODEL_RESOLUTION)
|
||||||
|
if extra_model_resolution:
|
||||||
|
self.model_resolution.update(extra_model_resolution)
|
||||||
|
|
||||||
|
self.port_handler = None
|
||||||
|
self.packet_handler = None
|
||||||
|
self.calibration = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
self.track_positions = {}
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise RobotDeviceAlreadyConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is already connected. Do not call `motors_bus.connect()` twice."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
self.port_handler = scs.PortHandler(self.port)
|
||||||
|
self.packet_handler = scs.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
try:
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
except Exception:
|
||||||
|
traceback.print_exc()
|
||||||
|
print(
|
||||||
|
"\nTry running `python lerobot/scripts/find_motors_bus_port.py` to make sure you are using the correct port.\n"
|
||||||
|
)
|
||||||
|
raise
|
||||||
|
|
||||||
|
# Allow to read and write
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
self.port_handler.setPacketTimeoutMillis(TIMEOUT_MS)
|
||||||
|
|
||||||
|
def reconnect(self):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
self.port_handler = scs.PortHandler(self.port)
|
||||||
|
self.packet_handler = scs.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def are_motors_configured(self):
|
||||||
|
# Only check the motor indices and not baudrate, since if the motor baudrates are incorrect,
|
||||||
|
# a ConnectionError will be raised anyway.
|
||||||
|
try:
|
||||||
|
return (self.motor_indices == self.read("ID")).all()
|
||||||
|
except ConnectionError as e:
|
||||||
|
print(e)
|
||||||
|
return False
|
||||||
|
|
||||||
|
def find_motor_indices(self, possible_ids=None, num_retry=2):
|
||||||
|
if possible_ids is None:
|
||||||
|
possible_ids = range(MAX_ID_RANGE)
|
||||||
|
|
||||||
|
indices = []
|
||||||
|
for idx in tqdm.tqdm(possible_ids):
|
||||||
|
try:
|
||||||
|
present_idx = self.read_with_motor_ids(self.motor_models, [idx], "ID", num_retry=num_retry)[0]
|
||||||
|
except ConnectionError:
|
||||||
|
continue
|
||||||
|
|
||||||
|
if idx != present_idx:
|
||||||
|
# sanity check
|
||||||
|
raise OSError(
|
||||||
|
"Motor index used to communicate through the bus is not the same as the one present in the motor memory. The motor memory might be damaged."
|
||||||
|
)
|
||||||
|
indices.append(idx)
|
||||||
|
|
||||||
|
return indices
|
||||||
|
|
||||||
|
def set_bus_baudrate(self, baudrate):
|
||||||
|
present_bus_baudrate = self.port_handler.getBaudRate()
|
||||||
|
if present_bus_baudrate != baudrate:
|
||||||
|
print(f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}.")
|
||||||
|
self.port_handler.setBaudRate(baudrate)
|
||||||
|
|
||||||
|
if self.port_handler.getBaudRate() != baudrate:
|
||||||
|
raise OSError("Failed to write bus baud rate.")
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_names(self) -> list[str]:
|
||||||
|
return list(self.motors.keys())
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_models(self) -> list[str]:
|
||||||
|
return [model for _, model in self.motors.values()]
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_indices(self) -> list[int]:
|
||||||
|
return [idx for idx, _ in self.motors.values()]
|
||||||
|
|
||||||
|
def set_calibration(self, calibration: dict[str, list]):
|
||||||
|
self.calibration = calibration
|
||||||
|
|
||||||
|
def apply_calibration_autocorrect(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function apply the calibration, automatically detects out of range errors for motors values and attempt to correct.
|
||||||
|
|
||||||
|
For more info, see docstring of `apply_calibration` and `autocorrect_calibration`.
|
||||||
|
"""
|
||||||
|
try:
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
except JointOutOfRangeError as e:
|
||||||
|
print(e)
|
||||||
|
self.autocorrect_calibration(values, motor_names)
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
|
||||||
|
a "zero position" at 0 degree.
|
||||||
|
|
||||||
|
Note: We say "nominal degree range" since the motors can take values outside this range. For instance, 190 degrees, if the motor
|
||||||
|
rotate more than a half a turn from the zero position. However, most motors can't rotate more than 180 degrees and will stay in this range.
|
||||||
|
|
||||||
|
Joints values are original in [0, 2**32[ (unsigned int32). Each motor are expected to complete a full rotation
|
||||||
|
when given a goal position that is + or - their resolution. For instance, feetech xl330-m077 have a resolution of 4096, and
|
||||||
|
at any position in their original range, let's say the position 56734, they complete a full rotation clockwise by moving to 60830,
|
||||||
|
or anticlockwise by moving to 52638. The position in the original range is arbitrary and might change a lot between each motor.
|
||||||
|
To harmonize between motors of the same model, different robots, or even models of different brands, we propose to work
|
||||||
|
in the centered nominal degree range ]-180, 180[.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Update direction of rotation of the motor to match between leader and follower.
|
||||||
|
# In fact, the motor of the leader for a given joint can be assembled in an
|
||||||
|
# opposite direction in term of rotation than the motor of the follower on the same joint.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from range [-2**31, 2**31[ to
|
||||||
|
# nominal range ]-resolution, resolution[ (e.g. ]-2048, 2048[)
|
||||||
|
values[i] += homing_offset
|
||||||
|
|
||||||
|
# Convert from range ]-resolution, resolution[ to
|
||||||
|
# universal float32 centered degree range ]-180, 180[
|
||||||
|
values[i] = values[i] / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_DEGREE) or (values[i] > UPPER_BOUND_DEGREE):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [-{HALF_TURN_DEGREE}, {HALF_TURN_DEGREE}] degrees (a full rotation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_DEGREE}, {UPPER_BOUND_DEGREE}] degrees to account for joints that can rotate a bit more, "
|
||||||
|
f"but present value is {values[i]} degree. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial 360 degrees jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Rescale the present position to a nominal range [0, 100] %,
|
||||||
|
# useful for joints with linear motions like Aloha gripper
|
||||||
|
values[i] = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_LINEAR) or (values[i] > UPPER_BOUND_LINEAR):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [0, 100] % (a full linear translation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_LINEAR}, {UPPER_BOUND_LINEAR}] % to account for some imprecision during calibration, "
|
||||||
|
f"but present value is {values[i]} %. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def autocorrect_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function automatically detects issues with values of motors after calibration, and correct for these issues.
|
||||||
|
|
||||||
|
Some motors might have values outside of expected maximum bounds after calibration.
|
||||||
|
For instance, for a joint in degree, its value can be outside [-270, 270] degrees, which is totally unexpected given
|
||||||
|
a nominal range of [-180, 180] degrees, which represents half a turn to the left or right starting from zero position.
|
||||||
|
|
||||||
|
Known issues:
|
||||||
|
#1: Motor value randomly shifts of a full turn, caused by hardware/connection errors.
|
||||||
|
#2: Motor internal homing offset is shifted of a full turn, caused by using default calibration (e.g Aloha).
|
||||||
|
#3: motor internal homing offset is shifted of less or more than a full turn, caused by using default calibration
|
||||||
|
or by human error during manual calibration.
|
||||||
|
|
||||||
|
Issues #1 and #2 can be solved by shifting the calibration homing offset by a full turn.
|
||||||
|
Issue #3 will be visually detected by user and potentially captured by the safety feature `max_relative_target`,
|
||||||
|
that will slow down the motor, raise an error asking to recalibrate. Manual recalibrating will solve the issue.
|
||||||
|
|
||||||
|
Note: A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from initial range to range [-180, 180] degrees
|
||||||
|
calib_val = (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
in_range = (calib_val > LOWER_BOUND_DEGREE) and (calib_val < UPPER_BOUND_DEGREE)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [-180, 180] degrees
|
||||||
|
# values[i] = (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
# - HALF_TURN_DEGREE <= (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE <= HALF_TURN_DEGREE
|
||||||
|
# (- HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset) / resolution <= factor <= (HALF_TURN_DEGREE / 180 * (resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
low_factor = (
|
||||||
|
-HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset
|
||||||
|
) / resolution
|
||||||
|
upp_factor = (
|
||||||
|
HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset
|
||||||
|
) / resolution
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from initial range to range [0, 100] in %
|
||||||
|
calib_val = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
in_range = (calib_val > LOWER_BOUND_LINEAR) and (calib_val < UPPER_BOUND_LINEAR)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [0, 100] %
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos + resolution * factor - start_pos - resolution * factor) * 100
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100
|
||||||
|
# 0 <= (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100 <= 100
|
||||||
|
# (start_pos - values[i]) / resolution <= factor <= (end_pos - values[i]) / resolution
|
||||||
|
low_factor = (start_pos - values[i]) / resolution
|
||||||
|
upp_factor = (end_pos - values[i]) / resolution
|
||||||
|
|
||||||
|
if not in_range:
|
||||||
|
# Get first integer between the two bounds
|
||||||
|
if low_factor < upp_factor:
|
||||||
|
factor = math.ceil(low_factor)
|
||||||
|
|
||||||
|
if factor > upp_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
else:
|
||||||
|
factor = math.ceil(upp_factor)
|
||||||
|
|
||||||
|
if factor > low_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
in_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
in_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
|
||||||
|
logging.warning(
|
||||||
|
f"Auto-correct calibration of motor '{name}' by shifting value by {abs(factor)} full turns, "
|
||||||
|
f"from '{out_of_range_str}' to '{in_range_str}'."
|
||||||
|
)
|
||||||
|
|
||||||
|
# A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
self.calibration["homing_offset"][calib_idx] += resolution * factor
|
||||||
|
|
||||||
|
def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Inverse of `apply_calibration`."""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Convert from nominal 0-centered degree range [-180, 180] to
|
||||||
|
# 0-centered resolution range (e.g. [-2048, 2048] for resolution=4096)
|
||||||
|
values[i] = values[i] / HALF_TURN_DEGREE * (resolution // 2)
|
||||||
|
|
||||||
|
# Substract the homing offsets to come back to actual motor range of values
|
||||||
|
# which can be arbitrary.
|
||||||
|
values[i] -= homing_offset
|
||||||
|
|
||||||
|
# Remove drive mode, which is the rotation direction of the motor, to come back to
|
||||||
|
# actual motor rotation direction which can be arbitrary.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from nominal lnear range of [0, 100] % to
|
||||||
|
# actual motor range of values which can be arbitrary.
|
||||||
|
values[i] = values[i] / 100 * (end_pos - start_pos) + start_pos
|
||||||
|
|
||||||
|
values = np.round(values).astype(np.int32)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def avoid_rotation_reset(self, values, motor_names, data_name):
|
||||||
|
if data_name not in self.track_positions:
|
||||||
|
self.track_positions[data_name] = {
|
||||||
|
"prev": [None] * len(self.motor_names),
|
||||||
|
# Assume False at initialization
|
||||||
|
"below_zero": [False] * len(self.motor_names),
|
||||||
|
"above_max": [False] * len(self.motor_names),
|
||||||
|
}
|
||||||
|
|
||||||
|
track = self.track_positions[data_name]
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
idx = self.motor_names.index(name)
|
||||||
|
|
||||||
|
if track["prev"][idx] is None:
|
||||||
|
track["prev"][idx] = values[i]
|
||||||
|
continue
|
||||||
|
|
||||||
|
# Detect a full rotation occured
|
||||||
|
if abs(track["prev"][idx] - values[i]) > 2048:
|
||||||
|
# Position went below 0 and got reset to 4095
|
||||||
|
if track["prev"][idx] < values[i]:
|
||||||
|
# So we set negative value by adding a full rotation
|
||||||
|
values[i] -= 4096
|
||||||
|
|
||||||
|
# Position went above 4095 and got reset to 0
|
||||||
|
elif track["prev"][idx] > values[i]:
|
||||||
|
# So we add a full rotation
|
||||||
|
values[i] += 4096
|
||||||
|
|
||||||
|
track["prev"][idx] = values[i]
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
return_list = True
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
return_list = False
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, self.motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = scs.GroupSyncRead(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx in motor_ids:
|
||||||
|
group.addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txRxPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = group.getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
if return_list:
|
||||||
|
return values
|
||||||
|
else:
|
||||||
|
return values[0]
|
||||||
|
|
||||||
|
def read(self, data_name, motor_names: str | list[str] | None = None):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
if data_name not in self.group_readers:
|
||||||
|
# create new group reader
|
||||||
|
self.group_readers[group_key] = scs.GroupSyncRead(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
for idx in motor_ids:
|
||||||
|
self.group_readers[group_key].addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(NUM_READ_RETRY):
|
||||||
|
comm = self.group_readers[group_key].txRxPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = self.group_readers[group_key].getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
# Convert to signed int to use range [-2048, 2048] for our motor positions.
|
||||||
|
if data_name in CONVERT_UINT32_TO_INT32_REQUIRED:
|
||||||
|
values = values.astype(np.int32)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED:
|
||||||
|
values = self.avoid_rotation_reset(values, motor_names, data_name)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.apply_calibration_autocorrect(values, motor_names)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the data from the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the data was received
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "read", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
if not isinstance(values, list):
|
||||||
|
values = [values]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = scs.GroupSyncWrite(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
group.addParam(idx, data)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
def write(self, data_name, values: int | float | np.ndarray, motor_names: str | list[str] | None = None):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
if isinstance(values, (int, float, np.integer)):
|
||||||
|
values = [int(values)] * len(motor_names)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.revert_calibration(values, motor_names)
|
||||||
|
|
||||||
|
values = values.tolist()
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
init_group = data_name not in self.group_readers
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key] = scs.GroupSyncWrite(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key].addParam(idx, data)
|
||||||
|
else:
|
||||||
|
self.group_writers[group_key].changeParam(idx, data)
|
||||||
|
|
||||||
|
comm = self.group_writers[group_key].txPacket()
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
# log the number of seconds it took to write the data to the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "write", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# TODO(rcadene): should we log the time before sending the write command?
|
||||||
|
# log the utc time when the write has been completed
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "write", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. Try running `motors_bus.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.port_handler is not None:
|
||||||
|
self.port_handler.closePort()
|
||||||
|
self.port_handler = None
|
||||||
|
|
||||||
|
self.packet_handler = None
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
130
lerobot/common/robot_devices/robots/dynamixel_calibration.py
Normal file
130
lerobot/common/robot_devices/robots/dynamixel_calibration.py
Normal file
@@ -0,0 +1,130 @@
|
|||||||
|
"""Logic to calibrate a robot arm built with dynamixel motors"""
|
||||||
|
# TODO(rcadene, aliberts): move this logic into the robot code when refactoring
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.motors.dynamixel import (
|
||||||
|
CalibrationMode,
|
||||||
|
TorqueMode,
|
||||||
|
convert_degrees_to_steps,
|
||||||
|
)
|
||||||
|
from lerobot.common.robot_devices.motors.utils import MotorsBus
|
||||||
|
|
||||||
|
URL_TEMPLATE = (
|
||||||
|
"https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
|
||||||
|
)
|
||||||
|
|
||||||
|
# The following positions are provided in nominal degree range ]-180, +180[
|
||||||
|
# For more info on these constants, see comments in the code where they get used.
|
||||||
|
ZERO_POSITION_DEGREE = 0
|
||||||
|
ROTATED_POSITION_DEGREE = 90
|
||||||
|
|
||||||
|
|
||||||
|
def assert_drive_mode(drive_mode):
|
||||||
|
# `drive_mode` is in [0,1] with 0 means original rotation direction for the motor, and 1 means inverted.
|
||||||
|
if not np.all(np.isin(drive_mode, [0, 1])):
|
||||||
|
raise ValueError(f"`drive_mode` contains values other than 0 or 1: ({drive_mode})")
|
||||||
|
|
||||||
|
|
||||||
|
def apply_drive_mode(position, drive_mode):
|
||||||
|
assert_drive_mode(drive_mode)
|
||||||
|
# Convert `drive_mode` from [0, 1] with 0 indicates original rotation direction and 1 inverted,
|
||||||
|
# to [-1, 1] with 1 indicates original rotation direction and -1 inverted.
|
||||||
|
signed_drive_mode = -(drive_mode * 2 - 1)
|
||||||
|
position *= signed_drive_mode
|
||||||
|
return position
|
||||||
|
|
||||||
|
|
||||||
|
def compute_nearest_rounded_position(position, models):
|
||||||
|
delta_turn = convert_degrees_to_steps(ROTATED_POSITION_DEGREE, models)
|
||||||
|
nearest_pos = np.round(position.astype(float) / delta_turn) * delta_turn
|
||||||
|
return nearest_pos.astype(position.dtype)
|
||||||
|
|
||||||
|
|
||||||
|
def run_arm_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
|
||||||
|
"""This function ensures that a neural network trained on data collected on a given robot
|
||||||
|
can work on another robot. For instance before calibration, setting a same goal position
|
||||||
|
for each motor of two different robots will get two very different positions. But after calibration,
|
||||||
|
the two robots will move to the same position.To this end, this function computes the homing offset
|
||||||
|
and the drive mode for each motor of a given robot.
|
||||||
|
|
||||||
|
Homing offset is used to shift the motor position to a ]-2048, +2048[ nominal range (when the motor uses 2048 steps
|
||||||
|
to complete a half a turn). This range is set around an arbitrary "zero position" corresponding to all motor positions
|
||||||
|
being 0. During the calibration process, you will need to manually move the robot to this "zero position".
|
||||||
|
|
||||||
|
Drive mode is used to invert the rotation direction of the motor. This is useful when some motors have been assembled
|
||||||
|
in the opposite orientation for some robots. During the calibration process, you will need to manually move the robot
|
||||||
|
to the "rotated position".
|
||||||
|
|
||||||
|
After calibration, the homing offsets and drive modes are stored in a cache.
|
||||||
|
|
||||||
|
Example of usage:
|
||||||
|
```python
|
||||||
|
run_arm_calibration(arm, "koch", "left", "follower")
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
|
||||||
|
raise ValueError("To run calibration, the torque must be disabled on all motors.")
|
||||||
|
|
||||||
|
print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
|
||||||
|
|
||||||
|
print("\nMove arm to zero position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="zero"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
# We arbitrarily chose our zero target position to be a straight horizontal position with gripper upwards and closed.
|
||||||
|
# It is easy to identify and all motors are in a "quarter turn" position. Once calibration is done, this position will
|
||||||
|
# correspond to every motor angle being 0. If you set all 0 as Goal Position, the arm will move in this position.
|
||||||
|
zero_target_pos = convert_degrees_to_steps(ZERO_POSITION_DEGREE, arm.motor_models)
|
||||||
|
|
||||||
|
# Compute homing offset so that `present_position + homing_offset ~= target_position`.
|
||||||
|
zero_pos = arm.read("Present_Position")
|
||||||
|
zero_nearest_pos = compute_nearest_rounded_position(zero_pos, arm.motor_models)
|
||||||
|
homing_offset = zero_target_pos - zero_nearest_pos
|
||||||
|
|
||||||
|
# The rotated target position corresponds to a rotation of a quarter turn from the zero position.
|
||||||
|
# This allows to identify the rotation direction of each motor.
|
||||||
|
# For instance, if the motor rotates 90 degree, and its value is -90 after applying the homing offset, then we know its rotation direction
|
||||||
|
# is inverted. However, for the calibration being successful, we need everyone to follow the same target position.
|
||||||
|
# Sometimes, there is only one possible rotation direction. For instance, if the gripper is closed, there is only one direction which
|
||||||
|
# corresponds to opening the gripper. When the rotation direction is ambiguous, we arbitrarely rotate clockwise from the point of view
|
||||||
|
# of the previous motor in the kinetic chain.
|
||||||
|
print("\nMove arm to rotated target position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rotated"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
rotated_target_pos = convert_degrees_to_steps(ROTATED_POSITION_DEGREE, arm.motor_models)
|
||||||
|
|
||||||
|
# Find drive mode by rotating each motor by a quarter of a turn.
|
||||||
|
# Drive mode indicates if the motor rotation direction should be inverted (=1) or not (=0).
|
||||||
|
rotated_pos = arm.read("Present_Position")
|
||||||
|
drive_mode = (rotated_pos < zero_pos).astype(np.int32)
|
||||||
|
|
||||||
|
# Re-compute homing offset to take into account drive mode
|
||||||
|
rotated_drived_pos = apply_drive_mode(rotated_pos, drive_mode)
|
||||||
|
rotated_nearest_pos = compute_nearest_rounded_position(rotated_drived_pos, arm.motor_models)
|
||||||
|
homing_offset = rotated_target_pos - rotated_nearest_pos
|
||||||
|
|
||||||
|
print("\nMove arm to rest position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rest"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
print()
|
||||||
|
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
calib_mode = [CalibrationMode.DEGREE.name] * len(arm.motor_names)
|
||||||
|
|
||||||
|
# TODO(rcadene): make type of joints (DEGREE or LINEAR) configurable from yaml?
|
||||||
|
if robot_type in ["aloha"] and "gripper" in arm.motor_names:
|
||||||
|
# Joints with linear motions (like gripper of Aloha) are experessed in nominal range of [0, 100]
|
||||||
|
calib_idx = arm.motor_names.index("gripper")
|
||||||
|
calib_mode[calib_idx] = CalibrationMode.LINEAR.name
|
||||||
|
|
||||||
|
calib_data = {
|
||||||
|
"homing_offset": homing_offset.tolist(),
|
||||||
|
"drive_mode": drive_mode.tolist(),
|
||||||
|
"start_pos": zero_pos.tolist(),
|
||||||
|
"end_pos": rotated_pos.tolist(),
|
||||||
|
"calib_mode": calib_mode,
|
||||||
|
"motor_names": arm.motor_names,
|
||||||
|
}
|
||||||
|
return calib_data
|
||||||
@@ -1,7 +1,9 @@
|
|||||||
import hydra
|
import hydra
|
||||||
from omegaconf import DictConfig
|
from omegaconf import DictConfig
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.robots.utils import Robot
|
||||||
|
|
||||||
def make_robot(cfg: DictConfig):
|
|
||||||
|
def make_robot(cfg: DictConfig) -> Robot:
|
||||||
robot = hydra.utils.instantiate(cfg)
|
robot = hydra.utils.instantiate(cfg)
|
||||||
return robot
|
return robot
|
||||||
|
|||||||
484
lerobot/common/robot_devices/robots/feetech_calibration.py
Normal file
484
lerobot/common/robot_devices/robots/feetech_calibration.py
Normal file
@@ -0,0 +1,484 @@
|
|||||||
|
"""Logic to calibrate a robot arm built with feetech motors"""
|
||||||
|
# TODO(rcadene, aliberts): move this logic into the robot code when refactoring
|
||||||
|
|
||||||
|
import time
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.motors.feetech import (
|
||||||
|
CalibrationMode,
|
||||||
|
TorqueMode,
|
||||||
|
convert_degrees_to_steps,
|
||||||
|
)
|
||||||
|
from lerobot.common.robot_devices.motors.utils import MotorsBus
|
||||||
|
|
||||||
|
URL_TEMPLATE = (
|
||||||
|
"https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
|
||||||
|
)
|
||||||
|
|
||||||
|
# The following positions are provided in nominal degree range ]-180, +180[
|
||||||
|
# For more info on these constants, see comments in the code where they get used.
|
||||||
|
ZERO_POSITION_DEGREE = 0
|
||||||
|
ROTATED_POSITION_DEGREE = 90
|
||||||
|
|
||||||
|
|
||||||
|
def assert_drive_mode(drive_mode):
|
||||||
|
# `drive_mode` is in [0,1] with 0 means original rotation direction for the motor, and 1 means inverted.
|
||||||
|
if not np.all(np.isin(drive_mode, [0, 1])):
|
||||||
|
raise ValueError(f"`drive_mode` contains values other than 0 or 1: ({drive_mode})")
|
||||||
|
|
||||||
|
|
||||||
|
def apply_drive_mode(position, drive_mode):
|
||||||
|
assert_drive_mode(drive_mode)
|
||||||
|
# Convert `drive_mode` from [0, 1] with 0 indicates original rotation direction and 1 inverted,
|
||||||
|
# to [-1, 1] with 1 indicates original rotation direction and -1 inverted.
|
||||||
|
signed_drive_mode = -(drive_mode * 2 - 1)
|
||||||
|
position *= signed_drive_mode
|
||||||
|
return position
|
||||||
|
|
||||||
|
|
||||||
|
def move_until_block(arm, motor_name, positive_direction=True, while_move_hook=None):
|
||||||
|
count = 0
|
||||||
|
while True:
|
||||||
|
present_pos = arm.read("Present_Position", motor_name)
|
||||||
|
if positive_direction:
|
||||||
|
# Move +100 steps every time. Lower the steps to lower the speed at which the arm moves.
|
||||||
|
arm.write("Goal_Position", present_pos + 100, motor_name)
|
||||||
|
else:
|
||||||
|
arm.write("Goal_Position", present_pos - 100, motor_name)
|
||||||
|
|
||||||
|
if while_move_hook is not None:
|
||||||
|
while_move_hook()
|
||||||
|
|
||||||
|
present_pos = arm.read("Present_Position", motor_name).item()
|
||||||
|
present_speed = arm.read("Present_Speed", motor_name).item()
|
||||||
|
present_current = arm.read("Present_Current", motor_name).item()
|
||||||
|
# present_load = arm.read("Present_Load", motor_name).item()
|
||||||
|
# present_voltage = arm.read("Present_Voltage", motor_name).item()
|
||||||
|
# present_temperature = arm.read("Present_Temperature", motor_name).item()
|
||||||
|
|
||||||
|
# print(f"{present_pos=}")
|
||||||
|
# print(f"{present_speed=}")
|
||||||
|
# print(f"{present_current=}")
|
||||||
|
# print(f"{present_load=}")
|
||||||
|
# print(f"{present_voltage=}")
|
||||||
|
# print(f"{present_temperature=}")
|
||||||
|
|
||||||
|
if present_speed == 0 and present_current > 40:
|
||||||
|
count += 1
|
||||||
|
if count > 100 or present_current > 300:
|
||||||
|
return present_pos
|
||||||
|
else:
|
||||||
|
count = 0
|
||||||
|
|
||||||
|
|
||||||
|
def move_to_calibrate(
|
||||||
|
arm,
|
||||||
|
motor_name,
|
||||||
|
invert_drive_mode=False,
|
||||||
|
positive_first=True,
|
||||||
|
in_between_move_hook=None,
|
||||||
|
while_move_hook=None,
|
||||||
|
):
|
||||||
|
initial_pos = arm.read("Present_Position", motor_name)
|
||||||
|
|
||||||
|
if positive_first:
|
||||||
|
p_present_pos = move_until_block(
|
||||||
|
arm, motor_name, positive_direction=True, while_move_hook=while_move_hook
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
n_present_pos = move_until_block(
|
||||||
|
arm, motor_name, positive_direction=False, while_move_hook=while_move_hook
|
||||||
|
)
|
||||||
|
|
||||||
|
if in_between_move_hook is not None:
|
||||||
|
in_between_move_hook()
|
||||||
|
|
||||||
|
if positive_first:
|
||||||
|
n_present_pos = move_until_block(
|
||||||
|
arm, motor_name, positive_direction=False, while_move_hook=while_move_hook
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
p_present_pos = move_until_block(
|
||||||
|
arm, motor_name, positive_direction=True, while_move_hook=while_move_hook
|
||||||
|
)
|
||||||
|
|
||||||
|
zero_pos = (n_present_pos + p_present_pos) / 2
|
||||||
|
|
||||||
|
calib_data = {
|
||||||
|
"initial_pos": initial_pos,
|
||||||
|
"homing_offset": zero_pos if invert_drive_mode else -zero_pos,
|
||||||
|
"invert_drive_mode": invert_drive_mode,
|
||||||
|
"drive_mode": -1 if invert_drive_mode else 0,
|
||||||
|
"zero_pos": zero_pos,
|
||||||
|
"start_pos": n_present_pos if invert_drive_mode else p_present_pos,
|
||||||
|
"end_pos": p_present_pos if invert_drive_mode else n_present_pos,
|
||||||
|
}
|
||||||
|
return calib_data
|
||||||
|
|
||||||
|
|
||||||
|
def apply_offset(calib, offset):
|
||||||
|
calib["zero_pos"] += offset
|
||||||
|
if calib["drive_mode"]:
|
||||||
|
calib["homing_offset"] += offset
|
||||||
|
else:
|
||||||
|
calib["homing_offset"] -= offset
|
||||||
|
return calib
|
||||||
|
|
||||||
|
|
||||||
|
def run_arm_auto_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
|
||||||
|
if robot_type == "so100":
|
||||||
|
return run_arm_auto_calibration_so100(arm, robot_type, arm_name, arm_type)
|
||||||
|
elif robot_type == "moss":
|
||||||
|
return run_arm_auto_calibration_moss(arm, robot_type, arm_name, arm_type)
|
||||||
|
else:
|
||||||
|
raise ValueError(robot_type)
|
||||||
|
|
||||||
|
|
||||||
|
def run_arm_auto_calibration_so100(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
|
||||||
|
"""All the offsets and magic numbers are hand tuned, and are unique to SO-100 follower arms"""
|
||||||
|
if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
|
||||||
|
raise ValueError("To run calibration, the torque must be disabled on all motors.")
|
||||||
|
|
||||||
|
if not (robot_type == "so100" and arm_type == "follower"):
|
||||||
|
raise NotImplementedError("Auto calibration only supports the follower of so100 arms for now.")
|
||||||
|
|
||||||
|
print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
|
||||||
|
|
||||||
|
print("\nMove arm to initial position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="initial"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
# Lower the acceleration of the motors (in [0,254])
|
||||||
|
initial_acceleration = arm.read("Acceleration")
|
||||||
|
arm.write("Lock", 0)
|
||||||
|
arm.write("Acceleration", 10)
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
arm.write("Torque_Enable", TorqueMode.ENABLED.value)
|
||||||
|
|
||||||
|
print(f'{arm.read("Present_Position", "elbow_flex")=}')
|
||||||
|
|
||||||
|
calib = {}
|
||||||
|
|
||||||
|
init_wf_pos = arm.read("Present_Position", "wrist_flex")
|
||||||
|
init_sl_pos = arm.read("Present_Position", "shoulder_lift")
|
||||||
|
init_ef_pos = arm.read("Present_Position", "elbow_flex")
|
||||||
|
arm.write("Goal_Position", init_wf_pos - 800, "wrist_flex")
|
||||||
|
arm.write("Goal_Position", init_sl_pos + 150 + 1024, "shoulder_lift")
|
||||||
|
arm.write("Goal_Position", init_ef_pos - 2048, "elbow_flex")
|
||||||
|
time.sleep(2)
|
||||||
|
|
||||||
|
print("Calibrate shoulder_pan")
|
||||||
|
calib["shoulder_pan"] = move_to_calibrate(arm, "shoulder_pan")
|
||||||
|
arm.write("Goal_Position", calib["shoulder_pan"]["zero_pos"], "shoulder_pan")
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
print("Calibrate gripper")
|
||||||
|
calib["gripper"] = move_to_calibrate(arm, "gripper", invert_drive_mode=True)
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
print("Calibrate wrist_flex")
|
||||||
|
calib["wrist_flex"] = move_to_calibrate(arm, "wrist_flex")
|
||||||
|
calib["wrist_flex"] = apply_offset(calib["wrist_flex"], offset=80)
|
||||||
|
|
||||||
|
def in_between_move_hook():
|
||||||
|
nonlocal arm, calib
|
||||||
|
time.sleep(2)
|
||||||
|
ef_pos = arm.read("Present_Position", "elbow_flex")
|
||||||
|
sl_pos = arm.read("Present_Position", "shoulder_lift")
|
||||||
|
arm.write("Goal_Position", ef_pos + 1024, "elbow_flex")
|
||||||
|
arm.write("Goal_Position", sl_pos - 1024, "shoulder_lift")
|
||||||
|
time.sleep(2)
|
||||||
|
|
||||||
|
print("Calibrate elbow_flex")
|
||||||
|
calib["elbow_flex"] = move_to_calibrate(
|
||||||
|
arm, "elbow_flex", positive_first=False, in_between_move_hook=in_between_move_hook
|
||||||
|
)
|
||||||
|
calib["elbow_flex"] = apply_offset(calib["elbow_flex"], offset=80 - 1024)
|
||||||
|
|
||||||
|
arm.write("Goal_Position", calib["elbow_flex"]["zero_pos"] + 1024 + 512, "elbow_flex")
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
def in_between_move_hook():
|
||||||
|
nonlocal arm, calib
|
||||||
|
arm.write("Goal_Position", calib["elbow_flex"]["zero_pos"], "elbow_flex")
|
||||||
|
|
||||||
|
print("Calibrate shoulder_lift")
|
||||||
|
calib["shoulder_lift"] = move_to_calibrate(
|
||||||
|
arm,
|
||||||
|
"shoulder_lift",
|
||||||
|
invert_drive_mode=True,
|
||||||
|
positive_first=False,
|
||||||
|
in_between_move_hook=in_between_move_hook,
|
||||||
|
)
|
||||||
|
# add an 30 steps as offset to align with body
|
||||||
|
calib["shoulder_lift"] = apply_offset(calib["shoulder_lift"], offset=1024 - 50)
|
||||||
|
|
||||||
|
def while_move_hook():
|
||||||
|
nonlocal arm, calib
|
||||||
|
positions = {
|
||||||
|
"shoulder_lift": round(calib["shoulder_lift"]["zero_pos"] - 1600),
|
||||||
|
"elbow_flex": round(calib["elbow_flex"]["zero_pos"] + 1700),
|
||||||
|
"wrist_flex": round(calib["wrist_flex"]["zero_pos"] + 800),
|
||||||
|
"gripper": round(calib["gripper"]["end_pos"]),
|
||||||
|
}
|
||||||
|
arm.write("Goal_Position", list(positions.values()), list(positions.keys()))
|
||||||
|
|
||||||
|
arm.write("Goal_Position", round(calib["shoulder_lift"]["zero_pos"] - 1600), "shoulder_lift")
|
||||||
|
time.sleep(2)
|
||||||
|
arm.write("Goal_Position", round(calib["elbow_flex"]["zero_pos"] + 1700), "elbow_flex")
|
||||||
|
time.sleep(2)
|
||||||
|
arm.write("Goal_Position", round(calib["wrist_flex"]["zero_pos"] + 800), "wrist_flex")
|
||||||
|
time.sleep(2)
|
||||||
|
arm.write("Goal_Position", round(calib["gripper"]["end_pos"]), "gripper")
|
||||||
|
time.sleep(2)
|
||||||
|
|
||||||
|
print("Calibrate wrist_roll")
|
||||||
|
calib["wrist_roll"] = move_to_calibrate(
|
||||||
|
arm, "wrist_roll", invert_drive_mode=True, positive_first=False, while_move_hook=while_move_hook
|
||||||
|
)
|
||||||
|
|
||||||
|
arm.write("Goal_Position", calib["wrist_roll"]["zero_pos"], "wrist_roll")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["gripper"]["start_pos"], "gripper")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"], "wrist_flex")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["elbow_flex"]["zero_pos"] + 2048, "elbow_flex")
|
||||||
|
arm.write("Goal_Position", calib["shoulder_lift"]["zero_pos"] - 2048, "shoulder_lift")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["shoulder_pan"]["zero_pos"], "shoulder_pan")
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
calib_modes = []
|
||||||
|
for name in arm.motor_names:
|
||||||
|
if name == "gripper":
|
||||||
|
calib_modes.append(CalibrationMode.LINEAR.name)
|
||||||
|
else:
|
||||||
|
calib_modes.append(CalibrationMode.DEGREE.name)
|
||||||
|
|
||||||
|
calib_dict = {
|
||||||
|
"homing_offset": [calib[name]["homing_offset"] for name in arm.motor_names],
|
||||||
|
"drive_mode": [calib[name]["drive_mode"] for name in arm.motor_names],
|
||||||
|
"start_pos": [calib[name]["start_pos"] for name in arm.motor_names],
|
||||||
|
"end_pos": [calib[name]["end_pos"] for name in arm.motor_names],
|
||||||
|
"calib_mode": calib_modes,
|
||||||
|
"motor_names": arm.motor_names,
|
||||||
|
}
|
||||||
|
|
||||||
|
# Re-enable original accerlation
|
||||||
|
arm.write("Lock", 0)
|
||||||
|
arm.write("Acceleration", initial_acceleration)
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
return calib_dict
|
||||||
|
|
||||||
|
|
||||||
|
def run_arm_auto_calibration_moss(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
|
||||||
|
"""All the offsets and magic numbers are hand tuned, and are unique to SO-100 follower arms"""
|
||||||
|
if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
|
||||||
|
raise ValueError("To run calibration, the torque must be disabled on all motors.")
|
||||||
|
|
||||||
|
if not (robot_type == "moss" and arm_type == "follower"):
|
||||||
|
raise NotImplementedError("Auto calibration only supports the follower of moss arms for now.")
|
||||||
|
|
||||||
|
print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
|
||||||
|
|
||||||
|
print("\nMove arm to initial position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="initial"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
# Lower the acceleration of the motors (in [0,254])
|
||||||
|
initial_acceleration = arm.read("Acceleration")
|
||||||
|
arm.write("Lock", 0)
|
||||||
|
arm.write("Acceleration", 10)
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
arm.write("Torque_Enable", TorqueMode.ENABLED.value)
|
||||||
|
|
||||||
|
sl_pos = arm.read("Present_Position", "shoulder_lift")
|
||||||
|
arm.write("Goal_Position", sl_pos - 1024 - 450, "shoulder_lift")
|
||||||
|
ef_pos = arm.read("Present_Position", "elbow_flex")
|
||||||
|
arm.write("Goal_Position", ef_pos + 1024 + 450, "elbow_flex")
|
||||||
|
time.sleep(2)
|
||||||
|
|
||||||
|
calib = {}
|
||||||
|
|
||||||
|
print("Calibrate shoulder_pan")
|
||||||
|
calib["shoulder_pan"] = move_to_calibrate(arm, "shoulder_pan")
|
||||||
|
arm.write("Goal_Position", calib["shoulder_pan"]["zero_pos"], "shoulder_pan")
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
print("Calibrate gripper")
|
||||||
|
calib["gripper"] = move_to_calibrate(arm, "gripper", invert_drive_mode=True)
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
print("Calibrate wrist_flex")
|
||||||
|
calib["wrist_flex"] = move_to_calibrate(arm, "wrist_flex", invert_drive_mode=True)
|
||||||
|
calib["wrist_flex"] = apply_offset(calib["wrist_flex"], offset=-210 + 1024)
|
||||||
|
|
||||||
|
wr_pos = arm.read("Present_Position", "wrist_roll")
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"] - 1024, "wrist_flex")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", wr_pos - 1024, "wrist_roll")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"] - 2048, "wrist_flex")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["gripper"]["end_pos"], "gripper")
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
print("Calibrate wrist_roll")
|
||||||
|
calib["wrist_roll"] = move_to_calibrate(arm, "wrist_roll", invert_drive_mode=True)
|
||||||
|
calib["wrist_roll"] = apply_offset(calib["wrist_roll"], offset=790)
|
||||||
|
|
||||||
|
arm.write("Goal_Position", calib["wrist_roll"]["zero_pos"] - 1024, "wrist_roll")
|
||||||
|
arm.write("Goal_Position", calib["gripper"]["start_pos"], "gripper")
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"] - 1024, "wrist_flex")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["wrist_roll"]["zero_pos"], "wrist_roll")
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"] - 2048, "wrist_flex")
|
||||||
|
|
||||||
|
def in_between_move_elbow_flex_hook():
|
||||||
|
nonlocal arm, calib
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"], "wrist_flex")
|
||||||
|
|
||||||
|
print("Calibrate elbow_flex")
|
||||||
|
calib["elbow_flex"] = move_to_calibrate(
|
||||||
|
arm,
|
||||||
|
"elbow_flex",
|
||||||
|
invert_drive_mode=True,
|
||||||
|
in_between_move_hook=in_between_move_elbow_flex_hook,
|
||||||
|
)
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"] - 1024, "wrist_flex")
|
||||||
|
|
||||||
|
def in_between_move_shoulder_lift_hook():
|
||||||
|
nonlocal arm, calib
|
||||||
|
sl = arm.read("Present_Position", "shoulder_lift")
|
||||||
|
arm.write("Goal_Position", sl - 1500, "shoulder_lift")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["elbow_flex"]["zero_pos"] + 1536, "elbow_flex")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["start_pos"], "wrist_flex")
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
print("Calibrate shoulder_lift")
|
||||||
|
calib["shoulder_lift"] = move_to_calibrate(
|
||||||
|
arm, "shoulder_lift", in_between_move_hook=in_between_move_shoulder_lift_hook
|
||||||
|
)
|
||||||
|
calib["shoulder_lift"] = apply_offset(calib["shoulder_lift"], offset=-1024)
|
||||||
|
|
||||||
|
arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"] - 1024, "wrist_flex")
|
||||||
|
time.sleep(1)
|
||||||
|
arm.write("Goal_Position", calib["shoulder_lift"]["zero_pos"] + 2048, "shoulder_lift")
|
||||||
|
arm.write("Goal_Position", calib["elbow_flex"]["zero_pos"] - 1024 - 400, "elbow_flex")
|
||||||
|
time.sleep(2)
|
||||||
|
|
||||||
|
calib_modes = []
|
||||||
|
for name in arm.motor_names:
|
||||||
|
if name == "gripper":
|
||||||
|
calib_modes.append(CalibrationMode.LINEAR.name)
|
||||||
|
else:
|
||||||
|
calib_modes.append(CalibrationMode.DEGREE.name)
|
||||||
|
|
||||||
|
calib_dict = {
|
||||||
|
"homing_offset": [calib[name]["homing_offset"] for name in arm.motor_names],
|
||||||
|
"drive_mode": [calib[name]["drive_mode"] for name in arm.motor_names],
|
||||||
|
"start_pos": [calib[name]["start_pos"] for name in arm.motor_names],
|
||||||
|
"end_pos": [calib[name]["end_pos"] for name in arm.motor_names],
|
||||||
|
"calib_mode": calib_modes,
|
||||||
|
"motor_names": arm.motor_names,
|
||||||
|
}
|
||||||
|
|
||||||
|
# Re-enable original accerlation
|
||||||
|
arm.write("Lock", 0)
|
||||||
|
arm.write("Acceleration", initial_acceleration)
|
||||||
|
time.sleep(1)
|
||||||
|
|
||||||
|
return calib_dict
|
||||||
|
|
||||||
|
|
||||||
|
def run_arm_manual_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
|
||||||
|
"""This function ensures that a neural network trained on data collected on a given robot
|
||||||
|
can work on another robot. For instance before calibration, setting a same goal position
|
||||||
|
for each motor of two different robots will get two very different positions. But after calibration,
|
||||||
|
the two robots will move to the same position.To this end, this function computes the homing offset
|
||||||
|
and the drive mode for each motor of a given robot.
|
||||||
|
|
||||||
|
Homing offset is used to shift the motor position to a ]-2048, +2048[ nominal range (when the motor uses 2048 steps
|
||||||
|
to complete a half a turn). This range is set around an arbitrary "zero position" corresponding to all motor positions
|
||||||
|
being 0. During the calibration process, you will need to manually move the robot to this "zero position".
|
||||||
|
|
||||||
|
Drive mode is used to invert the rotation direction of the motor. This is useful when some motors have been assembled
|
||||||
|
in the opposite orientation for some robots. During the calibration process, you will need to manually move the robot
|
||||||
|
to the "rotated position".
|
||||||
|
|
||||||
|
After calibration, the homing offsets and drive modes are stored in a cache.
|
||||||
|
|
||||||
|
Example of usage:
|
||||||
|
```python
|
||||||
|
run_arm_calibration(arm, "so100", "left", "follower")
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
|
||||||
|
raise ValueError("To run calibration, the torque must be disabled on all motors.")
|
||||||
|
|
||||||
|
print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
|
||||||
|
|
||||||
|
print("\nMove arm to zero position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="zero"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
# We arbitrarily chose our zero target position to be a straight horizontal position with gripper upwards and closed.
|
||||||
|
# It is easy to identify and all motors are in a "quarter turn" position. Once calibration is done, this position will
|
||||||
|
# correspond to every motor angle being 0. If you set all 0 as Goal Position, the arm will move in this position.
|
||||||
|
zero_target_pos = convert_degrees_to_steps(ZERO_POSITION_DEGREE, arm.motor_models)
|
||||||
|
|
||||||
|
# Compute homing offset so that `present_position + homing_offset ~= target_position`.
|
||||||
|
zero_pos = arm.read("Present_Position")
|
||||||
|
homing_offset = zero_target_pos - zero_pos
|
||||||
|
|
||||||
|
# The rotated target position corresponds to a rotation of a quarter turn from the zero position.
|
||||||
|
# This allows to identify the rotation direction of each motor.
|
||||||
|
# For instance, if the motor rotates 90 degree, and its value is -90 after applying the homing offset, then we know its rotation direction
|
||||||
|
# is inverted. However, for the calibration being successful, we need everyone to follow the same target position.
|
||||||
|
# Sometimes, there is only one possible rotation direction. For instance, if the gripper is closed, there is only one direction which
|
||||||
|
# corresponds to opening the gripper. When the rotation direction is ambiguous, we arbitrarely rotate clockwise from the point of view
|
||||||
|
# of the previous motor in the kinetic chain.
|
||||||
|
print("\nMove arm to rotated target position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rotated"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
rotated_target_pos = convert_degrees_to_steps(ROTATED_POSITION_DEGREE, arm.motor_models)
|
||||||
|
|
||||||
|
# Find drive mode by rotating each motor by a quarter of a turn.
|
||||||
|
# Drive mode indicates if the motor rotation direction should be inverted (=1) or not (=0).
|
||||||
|
rotated_pos = arm.read("Present_Position")
|
||||||
|
drive_mode = (rotated_pos < zero_pos).astype(np.int32)
|
||||||
|
|
||||||
|
# Re-compute homing offset to take into account drive mode
|
||||||
|
rotated_drived_pos = apply_drive_mode(rotated_pos, drive_mode)
|
||||||
|
homing_offset = rotated_target_pos - rotated_drived_pos
|
||||||
|
|
||||||
|
print("\nMove arm to rest position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rest"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
print()
|
||||||
|
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
calib_modes = []
|
||||||
|
for name in arm.motor_names:
|
||||||
|
if name == "gripper":
|
||||||
|
calib_modes.append(CalibrationMode.LINEAR.name)
|
||||||
|
else:
|
||||||
|
calib_modes.append(CalibrationMode.DEGREE.name)
|
||||||
|
|
||||||
|
calib_dict = {
|
||||||
|
"homing_offset": homing_offset.tolist(),
|
||||||
|
"drive_mode": drive_mode.tolist(),
|
||||||
|
"start_pos": zero_pos.tolist(),
|
||||||
|
"end_pos": rotated_pos.tolist(),
|
||||||
|
"calib_mode": calib_modes,
|
||||||
|
"motor_names": arm.motor_names,
|
||||||
|
}
|
||||||
|
return calib_dict
|
||||||
@@ -1,515 +0,0 @@
|
|||||||
import pickle
|
|
||||||
import time
|
|
||||||
from dataclasses import dataclass, field, replace
|
|
||||||
from pathlib import Path
|
|
||||||
|
|
||||||
import numpy as np
|
|
||||||
import torch
|
|
||||||
|
|
||||||
from lerobot.common.robot_devices.cameras.utils import Camera
|
|
||||||
from lerobot.common.robot_devices.motors.dynamixel import (
|
|
||||||
OperatingMode,
|
|
||||||
TorqueMode,
|
|
||||||
convert_degrees_to_steps,
|
|
||||||
)
|
|
||||||
from lerobot.common.robot_devices.motors.utils import MotorsBus
|
|
||||||
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
|
||||||
|
|
||||||
########################################################################
|
|
||||||
# Calibration logic
|
|
||||||
########################################################################
|
|
||||||
|
|
||||||
URL_TEMPLATE = (
|
|
||||||
"https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
|
|
||||||
)
|
|
||||||
|
|
||||||
# In nominal degree range ]-180, +180[
|
|
||||||
ZERO_POSITION_DEGREE = 0
|
|
||||||
ROTATED_POSITION_DEGREE = 90
|
|
||||||
GRIPPER_OPEN_DEGREE = 35.156
|
|
||||||
|
|
||||||
|
|
||||||
def assert_drive_mode(drive_mode):
|
|
||||||
# `drive_mode` is in [0,1] with 0 means original rotation direction for the motor, and 1 means inverted.
|
|
||||||
if not np.all(np.isin(drive_mode, [0, 1])):
|
|
||||||
raise ValueError(f"`drive_mode` contains values other than 0 or 1: ({drive_mode})")
|
|
||||||
|
|
||||||
|
|
||||||
def apply_drive_mode(position, drive_mode):
|
|
||||||
assert_drive_mode(drive_mode)
|
|
||||||
# Convert `drive_mode` from [0, 1] with 0 indicates original rotation direction and 1 inverted,
|
|
||||||
# to [-1, 1] with 1 indicates original rotation direction and -1 inverted.
|
|
||||||
signed_drive_mode = -(drive_mode * 2 - 1)
|
|
||||||
position *= signed_drive_mode
|
|
||||||
return position
|
|
||||||
|
|
||||||
|
|
||||||
def reset_torque_mode(arm: MotorsBus):
|
|
||||||
# To be configured, all servos must be in "torque disable" mode
|
|
||||||
arm.write("Torque_Enable", TorqueMode.DISABLED.value)
|
|
||||||
|
|
||||||
# Use 'extended position mode' for all motors except gripper, because in joint mode the servos can't
|
|
||||||
# rotate more than 360 degrees (from 0 to 4095) And some mistake can happen while assembling the arm,
|
|
||||||
# you could end up with a servo with a position 0 or 4095 at a crucial point See [
|
|
||||||
# https://emanual.robotis.com/docs/en/dxl/x/x_series/#operating-mode11]
|
|
||||||
all_motors_except_gripper = [name for name in arm.motor_names if name != "gripper"]
|
|
||||||
if len(all_motors_except_gripper) > 0:
|
|
||||||
arm.write("Operating_Mode", OperatingMode.EXTENDED_POSITION.value, all_motors_except_gripper)
|
|
||||||
|
|
||||||
# Use 'position control current based' for gripper to be limited by the limit of the current.
|
|
||||||
# For the follower gripper, it means it can grasp an object without forcing too much even tho,
|
|
||||||
# it's goal position is a complete grasp (both gripper fingers are ordered to join and reach a touch).
|
|
||||||
# For the leader gripper, it means we can use it as a physical trigger, since we can force with our finger
|
|
||||||
# to make it move, and it will move back to its original target position when we release the force.
|
|
||||||
arm.write("Operating_Mode", OperatingMode.CURRENT_CONTROLLED_POSITION.value, "gripper")
|
|
||||||
|
|
||||||
|
|
||||||
def run_arm_calibration(arm: MotorsBus, name: str, arm_type: str):
|
|
||||||
"""This function ensures that a neural network trained on data collected on a given robot
|
|
||||||
can work on another robot. For instance before calibration, setting a same goal position
|
|
||||||
for each motor of two different robots will get two very different positions. But after calibration,
|
|
||||||
the two robots will move to the same position.To this end, this function computes the homing offset
|
|
||||||
and the drive mode for each motor of a given robot.
|
|
||||||
|
|
||||||
Homing offset is used to shift the motor position to a ]-2048, +2048[ nominal range (when the motor uses 2048 steps
|
|
||||||
to complete a half a turn). This range is set around an arbitrary "zero position" corresponding to all motor positions
|
|
||||||
being 0. During the calibration process, you will need to manually move the robot to this "zero position".
|
|
||||||
|
|
||||||
Drive mode is used to invert the rotation direction of the motor. This is useful when some motors have been assembled
|
|
||||||
in the opposite orientation for some robots. During the calibration process, you will need to manually move the robot
|
|
||||||
to the "rotated position".
|
|
||||||
|
|
||||||
After calibration, the homing offsets and drive modes are stored in a cache.
|
|
||||||
|
|
||||||
Example of usage:
|
|
||||||
```python
|
|
||||||
run_arm_calibration(arm, "left", "follower")
|
|
||||||
```
|
|
||||||
"""
|
|
||||||
reset_torque_mode(arm)
|
|
||||||
|
|
||||||
print(f"\nRunning calibration of {name} {arm_type}...")
|
|
||||||
|
|
||||||
print("\nMove arm to zero position")
|
|
||||||
print("See: " + URL_TEMPLATE.format(robot="koch", arm=arm_type, position="zero"))
|
|
||||||
input("Press Enter to continue...")
|
|
||||||
|
|
||||||
# We arbitrarely choosed our zero target position to be a straight horizontal position with gripper upwards and closed.
|
|
||||||
# It is easy to identify and all motors are in a "quarter turn" position. Once calibration is done, this position will
|
|
||||||
# corresponds to every motor angle being 0. If you set all 0 as Goal Position, the arm will move in this position.
|
|
||||||
zero_position = convert_degrees_to_steps(ZERO_POSITION_DEGREE, arm.motor_models)
|
|
||||||
|
|
||||||
def _compute_nearest_rounded_position(position, models):
|
|
||||||
# TODO(rcadene): Rework this function since some motors cant physically rotate a quarter turn
|
|
||||||
# (e.g. the gripper of Aloha arms can only rotate ~50 degree)
|
|
||||||
quarter_turn_degree = 90
|
|
||||||
quarter_turn = convert_degrees_to_steps(quarter_turn_degree, models)
|
|
||||||
nearest_pos = np.round(position.astype(float) / quarter_turn) * quarter_turn
|
|
||||||
return nearest_pos.astype(position.dtype)
|
|
||||||
|
|
||||||
# Compute homing offset so that `present_position + homing_offset ~= target_position`.
|
|
||||||
position = arm.read("Present_Position")
|
|
||||||
position = _compute_nearest_rounded_position(position, arm.motor_models)
|
|
||||||
homing_offset = zero_position - position
|
|
||||||
|
|
||||||
print("\nMove arm to rotated target position")
|
|
||||||
print("See: " + URL_TEMPLATE.format(robot="koch", arm=arm_type, position="rotated"))
|
|
||||||
input("Press Enter to continue...")
|
|
||||||
|
|
||||||
# The rotated target position corresponds to a rotation of a quarter turn from the zero position.
|
|
||||||
# This allows to identify the rotation direction of each motor.
|
|
||||||
# For instance, if the motor rotates 90 degree, and its value is -90 after applying the homing offset, then we know its rotation direction
|
|
||||||
# is inverted. However, for the calibration being successful, we need everyone to follow the same target position.
|
|
||||||
# Sometimes, there is only one possible rotation direction. For instance, if the gripper is closed, there is only one direction which
|
|
||||||
# corresponds to opening the gripper. When the rotation direction is ambiguous, we arbitrarely rotate clockwise from the point of view
|
|
||||||
# of the previous motor in the kinetic chain.
|
|
||||||
rotated_position = convert_degrees_to_steps(ROTATED_POSITION_DEGREE, arm.motor_models)
|
|
||||||
|
|
||||||
# Find drive mode by rotating each motor by a quarter of a turn.
|
|
||||||
# Drive mode indicates if the motor rotation direction should be inverted (=1) or not (=0).
|
|
||||||
position = arm.read("Present_Position")
|
|
||||||
position += homing_offset
|
|
||||||
position = _compute_nearest_rounded_position(position, arm.motor_models)
|
|
||||||
drive_mode = (position != rotated_position).astype(np.int32)
|
|
||||||
|
|
||||||
# Re-compute homing offset to take into account drive mode
|
|
||||||
position = arm.read("Present_Position")
|
|
||||||
position = apply_drive_mode(position, drive_mode)
|
|
||||||
position = _compute_nearest_rounded_position(position, arm.motor_models)
|
|
||||||
homing_offset = rotated_position - position
|
|
||||||
|
|
||||||
print("\nMove arm to rest position")
|
|
||||||
print("See: " + URL_TEMPLATE.format(robot="koch", arm=arm_type, position="rest"))
|
|
||||||
input("Press Enter to continue...")
|
|
||||||
print()
|
|
||||||
|
|
||||||
return homing_offset, drive_mode
|
|
||||||
|
|
||||||
|
|
||||||
########################################################################
|
|
||||||
# Alexander Koch robot arm
|
|
||||||
########################################################################
|
|
||||||
|
|
||||||
|
|
||||||
@dataclass
|
|
||||||
class KochRobotConfig:
|
|
||||||
"""
|
|
||||||
Example of usage:
|
|
||||||
```python
|
|
||||||
KochRobotConfig()
|
|
||||||
```
|
|
||||||
"""
|
|
||||||
|
|
||||||
# Define all components of the robot
|
|
||||||
leader_arms: dict[str, MotorsBus] = field(default_factory=lambda: {})
|
|
||||||
follower_arms: dict[str, MotorsBus] = field(default_factory=lambda: {})
|
|
||||||
cameras: dict[str, Camera] = field(default_factory=lambda: {})
|
|
||||||
|
|
||||||
|
|
||||||
class KochRobot:
|
|
||||||
# TODO(rcadene): Implement force feedback
|
|
||||||
"""This class allows to control any Koch robot of various number of motors.
|
|
||||||
|
|
||||||
A few versions are available:
|
|
||||||
- [Koch v1.0](https://github.com/AlexanderKoch-Koch/low_cost_robot), with and without the wrist-to-elbow expansion, which was developed
|
|
||||||
by Alexander Koch from [Tau Robotics](https://tau-robotics.com): [Github for sourcing and assembly](
|
|
||||||
- [Koch v1.1])https://github.com/jess-moss/koch-v1-1), which was developed by Jess Moss.
|
|
||||||
|
|
||||||
Example of highest frequency teleoperation without camera:
|
|
||||||
```python
|
|
||||||
# Defines how to communicate with the motors of the leader and follower arms
|
|
||||||
leader_arms = {
|
|
||||||
"main": DynamixelMotorsBus(
|
|
||||||
port="/dev/tty.usbmodem575E0031751",
|
|
||||||
motors={
|
|
||||||
# name: (index, model)
|
|
||||||
"shoulder_pan": (1, "xl330-m077"),
|
|
||||||
"shoulder_lift": (2, "xl330-m077"),
|
|
||||||
"elbow_flex": (3, "xl330-m077"),
|
|
||||||
"wrist_flex": (4, "xl330-m077"),
|
|
||||||
"wrist_roll": (5, "xl330-m077"),
|
|
||||||
"gripper": (6, "xl330-m077"),
|
|
||||||
},
|
|
||||||
),
|
|
||||||
}
|
|
||||||
follower_arms = {
|
|
||||||
"main": DynamixelMotorsBus(
|
|
||||||
port="/dev/tty.usbmodem575E0032081",
|
|
||||||
motors={
|
|
||||||
# name: (index, model)
|
|
||||||
"shoulder_pan": (1, "xl430-w250"),
|
|
||||||
"shoulder_lift": (2, "xl430-w250"),
|
|
||||||
"elbow_flex": (3, "xl330-m288"),
|
|
||||||
"wrist_flex": (4, "xl330-m288"),
|
|
||||||
"wrist_roll": (5, "xl330-m288"),
|
|
||||||
"gripper": (6, "xl330-m288"),
|
|
||||||
},
|
|
||||||
),
|
|
||||||
}
|
|
||||||
robot = KochRobot(leader_arms, follower_arms)
|
|
||||||
|
|
||||||
# Connect motors buses and cameras if any (Required)
|
|
||||||
robot.connect()
|
|
||||||
|
|
||||||
while True:
|
|
||||||
robot.teleop_step()
|
|
||||||
```
|
|
||||||
|
|
||||||
Example of highest frequency data collection without camera:
|
|
||||||
```python
|
|
||||||
# Assumes leader and follower arms have been instantiated already (see first example)
|
|
||||||
robot = KochRobot(leader_arms, follower_arms)
|
|
||||||
robot.connect()
|
|
||||||
while True:
|
|
||||||
observation, action = robot.teleop_step(record_data=True)
|
|
||||||
```
|
|
||||||
|
|
||||||
Example of highest frequency data collection with cameras:
|
|
||||||
```python
|
|
||||||
# Defines how to communicate with 2 cameras connected to the computer.
|
|
||||||
# Here, the webcam of the laptop and the phone (connected in USB to the laptop)
|
|
||||||
# can be reached respectively using the camera indices 0 and 1. These indices can be
|
|
||||||
# arbitrary. See the documentation of `OpenCVCamera` to find your own camera indices.
|
|
||||||
cameras = {
|
|
||||||
"laptop": OpenCVCamera(camera_index=0, fps=30, width=640, height=480),
|
|
||||||
"phone": OpenCVCamera(camera_index=1, fps=30, width=640, height=480),
|
|
||||||
}
|
|
||||||
|
|
||||||
# Assumes leader and follower arms have been instantiated already (see first example)
|
|
||||||
robot = KochRobot(leader_arms, follower_arms, cameras)
|
|
||||||
robot.connect()
|
|
||||||
while True:
|
|
||||||
observation, action = robot.teleop_step(record_data=True)
|
|
||||||
```
|
|
||||||
|
|
||||||
Example of controlling the robot with a policy (without running multiple policies in parallel to ensure highest frequency):
|
|
||||||
```python
|
|
||||||
# Assumes leader and follower arms + cameras have been instantiated already (see previous example)
|
|
||||||
robot = KochRobot(leader_arms, follower_arms, cameras)
|
|
||||||
robot.connect()
|
|
||||||
while True:
|
|
||||||
# Uses the follower arms and cameras to capture an observation
|
|
||||||
observation = robot.capture_observation()
|
|
||||||
|
|
||||||
# Assumes a policy has been instantiated
|
|
||||||
with torch.inference_mode():
|
|
||||||
action = policy.select_action(observation)
|
|
||||||
|
|
||||||
# Orders the robot to move
|
|
||||||
robot.send_action(action)
|
|
||||||
```
|
|
||||||
|
|
||||||
Example of disconnecting which is not mandatory since we disconnect when the object is deleted:
|
|
||||||
```python
|
|
||||||
robot.disconnect()
|
|
||||||
```
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
config: KochRobotConfig | None = None,
|
|
||||||
calibration_path: Path = ".cache/calibration/koch.pkl",
|
|
||||||
**kwargs,
|
|
||||||
):
|
|
||||||
if config is None:
|
|
||||||
config = KochRobotConfig()
|
|
||||||
# Overwrite config arguments using kwargs
|
|
||||||
self.config = replace(config, **kwargs)
|
|
||||||
self.calibration_path = Path(calibration_path)
|
|
||||||
|
|
||||||
self.leader_arms = self.config.leader_arms
|
|
||||||
self.follower_arms = self.config.follower_arms
|
|
||||||
self.cameras = self.config.cameras
|
|
||||||
self.is_connected = False
|
|
||||||
self.logs = {}
|
|
||||||
|
|
||||||
def connect(self):
|
|
||||||
if self.is_connected:
|
|
||||||
raise RobotDeviceAlreadyConnectedError(
|
|
||||||
"KochRobot is already connected. Do not run `robot.connect()` twice."
|
|
||||||
)
|
|
||||||
|
|
||||||
if not self.leader_arms and not self.follower_arms and not self.cameras:
|
|
||||||
raise ValueError(
|
|
||||||
"KochRobot doesn't have any device to connect. See example of usage in docstring of the class."
|
|
||||||
)
|
|
||||||
|
|
||||||
# Connect the arms
|
|
||||||
for name in self.follower_arms:
|
|
||||||
print(f"Connecting {name} follower arm.")
|
|
||||||
self.follower_arms[name].connect()
|
|
||||||
print(f"Connecting {name} leader arm.")
|
|
||||||
self.leader_arms[name].connect()
|
|
||||||
|
|
||||||
# Reset the arms and load or run calibration
|
|
||||||
if self.calibration_path.exists():
|
|
||||||
# Reset all arms before setting calibration
|
|
||||||
for name in self.follower_arms:
|
|
||||||
reset_torque_mode(self.follower_arms[name])
|
|
||||||
for name in self.leader_arms:
|
|
||||||
reset_torque_mode(self.leader_arms[name])
|
|
||||||
|
|
||||||
with open(self.calibration_path, "rb") as f:
|
|
||||||
calibration = pickle.load(f)
|
|
||||||
else:
|
|
||||||
print(f"Missing calibration file '{self.calibration_path}'. Starting calibration precedure.")
|
|
||||||
# Run calibration process which begins by reseting all arms
|
|
||||||
calibration = self.run_calibration()
|
|
||||||
|
|
||||||
print(f"Calibration is done! Saving calibration file '{self.calibration_path}'")
|
|
||||||
self.calibration_path.parent.mkdir(parents=True, exist_ok=True)
|
|
||||||
with open(self.calibration_path, "wb") as f:
|
|
||||||
pickle.dump(calibration, f)
|
|
||||||
|
|
||||||
# Set calibration
|
|
||||||
for name in self.follower_arms:
|
|
||||||
self.follower_arms[name].set_calibration(calibration[f"follower_{name}"])
|
|
||||||
for name in self.leader_arms:
|
|
||||||
self.leader_arms[name].set_calibration(calibration[f"leader_{name}"])
|
|
||||||
|
|
||||||
# Set better PID values to close the gap between recored states and actions
|
|
||||||
# TODO(rcadene): Implement an automatic procedure to set optimial PID values for each motor
|
|
||||||
for name in self.follower_arms:
|
|
||||||
self.follower_arms[name].write("Position_P_Gain", 1500, "elbow_flex")
|
|
||||||
self.follower_arms[name].write("Position_I_Gain", 0, "elbow_flex")
|
|
||||||
self.follower_arms[name].write("Position_D_Gain", 600, "elbow_flex")
|
|
||||||
|
|
||||||
# Enable torque on all motors of the follower arms
|
|
||||||
for name in self.follower_arms:
|
|
||||||
print(f"Activating torque on {name} follower arm.")
|
|
||||||
self.follower_arms[name].write("Torque_Enable", 1)
|
|
||||||
|
|
||||||
# Enable torque on the gripper of the leader arms, and move it to 45 degrees,
|
|
||||||
# so that we can use it as a trigger to close the gripper of the follower arms.
|
|
||||||
for name in self.leader_arms:
|
|
||||||
self.leader_arms[name].write("Torque_Enable", 1, "gripper")
|
|
||||||
self.leader_arms[name].write("Goal_Position", GRIPPER_OPEN_DEGREE, "gripper")
|
|
||||||
|
|
||||||
# Connect the cameras
|
|
||||||
for name in self.cameras:
|
|
||||||
self.cameras[name].connect()
|
|
||||||
|
|
||||||
self.is_connected = True
|
|
||||||
|
|
||||||
def run_calibration(self):
|
|
||||||
calibration = {}
|
|
||||||
|
|
||||||
for name in self.follower_arms:
|
|
||||||
homing_offset, drive_mode = run_arm_calibration(self.follower_arms[name], name, "follower")
|
|
||||||
|
|
||||||
calibration[f"follower_{name}"] = {}
|
|
||||||
for idx, motor_name in enumerate(self.follower_arms[name].motor_names):
|
|
||||||
calibration[f"follower_{name}"][motor_name] = (homing_offset[idx], drive_mode[idx])
|
|
||||||
|
|
||||||
for name in self.leader_arms:
|
|
||||||
homing_offset, drive_mode = run_arm_calibration(self.leader_arms[name], name, "leader")
|
|
||||||
|
|
||||||
calibration[f"leader_{name}"] = {}
|
|
||||||
for idx, motor_name in enumerate(self.leader_arms[name].motor_names):
|
|
||||||
calibration[f"leader_{name}"][motor_name] = (homing_offset[idx], drive_mode[idx])
|
|
||||||
|
|
||||||
return calibration
|
|
||||||
|
|
||||||
def teleop_step(
|
|
||||||
self, record_data=False
|
|
||||||
) -> None | tuple[dict[str, torch.Tensor], dict[str, torch.Tensor]]:
|
|
||||||
if not self.is_connected:
|
|
||||||
raise RobotDeviceNotConnectedError(
|
|
||||||
"KochRobot is not connected. You need to run `robot.connect()`."
|
|
||||||
)
|
|
||||||
|
|
||||||
# Prepare to assign the position of the leader to the follower
|
|
||||||
leader_pos = {}
|
|
||||||
for name in self.leader_arms:
|
|
||||||
before_lread_t = time.perf_counter()
|
|
||||||
leader_pos[name] = self.leader_arms[name].read("Present_Position")
|
|
||||||
self.logs[f"read_leader_{name}_pos_dt_s"] = time.perf_counter() - before_lread_t
|
|
||||||
|
|
||||||
follower_goal_pos = {}
|
|
||||||
for name in self.leader_arms:
|
|
||||||
follower_goal_pos[name] = leader_pos[name]
|
|
||||||
|
|
||||||
# Send action
|
|
||||||
for name in self.follower_arms:
|
|
||||||
before_fwrite_t = time.perf_counter()
|
|
||||||
self.follower_arms[name].write("Goal_Position", follower_goal_pos[name])
|
|
||||||
self.logs[f"write_follower_{name}_goal_pos_dt_s"] = time.perf_counter() - before_fwrite_t
|
|
||||||
|
|
||||||
# Early exit when recording data is not requested
|
|
||||||
if not record_data:
|
|
||||||
return
|
|
||||||
|
|
||||||
# TODO(rcadene): Add velocity and other info
|
|
||||||
# Read follower position
|
|
||||||
follower_pos = {}
|
|
||||||
for name in self.follower_arms:
|
|
||||||
before_fread_t = time.perf_counter()
|
|
||||||
follower_pos[name] = self.follower_arms[name].read("Present_Position")
|
|
||||||
self.logs[f"read_follower_{name}_pos_dt_s"] = time.perf_counter() - before_fread_t
|
|
||||||
|
|
||||||
# Create state by concatenating follower current position
|
|
||||||
state = []
|
|
||||||
for name in self.follower_arms:
|
|
||||||
if name in follower_pos:
|
|
||||||
state.append(follower_pos[name])
|
|
||||||
state = np.concatenate(state)
|
|
||||||
|
|
||||||
# Create action by concatenating follower goal position
|
|
||||||
action = []
|
|
||||||
for name in self.follower_arms:
|
|
||||||
if name in follower_goal_pos:
|
|
||||||
action.append(follower_goal_pos[name])
|
|
||||||
action = np.concatenate(action)
|
|
||||||
|
|
||||||
# Capture images from cameras
|
|
||||||
images = {}
|
|
||||||
for name in self.cameras:
|
|
||||||
before_camread_t = time.perf_counter()
|
|
||||||
images[name] = self.cameras[name].async_read()
|
|
||||||
self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
|
|
||||||
self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
|
|
||||||
|
|
||||||
# Populate output dictionnaries and format to pytorch
|
|
||||||
obs_dict, action_dict = {}, {}
|
|
||||||
obs_dict["observation.state"] = torch.from_numpy(state)
|
|
||||||
action_dict["action"] = torch.from_numpy(action)
|
|
||||||
for name in self.cameras:
|
|
||||||
obs_dict[f"observation.images.{name}"] = torch.from_numpy(images[name])
|
|
||||||
|
|
||||||
return obs_dict, action_dict
|
|
||||||
|
|
||||||
def capture_observation(self):
|
|
||||||
"""The returned observations do not have a batch dimension."""
|
|
||||||
if not self.is_connected:
|
|
||||||
raise RobotDeviceNotConnectedError(
|
|
||||||
"KochRobot is not connected. You need to run `robot.connect()`."
|
|
||||||
)
|
|
||||||
|
|
||||||
# Read follower position
|
|
||||||
follower_pos = {}
|
|
||||||
for name in self.follower_arms:
|
|
||||||
before_fread_t = time.perf_counter()
|
|
||||||
follower_pos[name] = self.follower_arms[name].read("Present_Position")
|
|
||||||
self.logs[f"read_follower_{name}_pos_dt_s"] = time.perf_counter() - before_fread_t
|
|
||||||
|
|
||||||
# Create state by concatenating follower current position
|
|
||||||
state = []
|
|
||||||
for name in self.follower_arms:
|
|
||||||
if name in follower_pos:
|
|
||||||
state.append(follower_pos[name])
|
|
||||||
state = np.concatenate(state)
|
|
||||||
|
|
||||||
# Capture images from cameras
|
|
||||||
images = {}
|
|
||||||
for name in self.cameras:
|
|
||||||
before_camread_t = time.perf_counter()
|
|
||||||
images[name] = self.cameras[name].async_read()
|
|
||||||
self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
|
|
||||||
self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
|
|
||||||
|
|
||||||
# Populate output dictionnaries and format to pytorch
|
|
||||||
obs_dict = {}
|
|
||||||
obs_dict["observation.state"] = torch.from_numpy(state)
|
|
||||||
for name in self.cameras:
|
|
||||||
obs_dict[f"observation.images.{name}"] = torch.from_numpy(images[name])
|
|
||||||
return obs_dict
|
|
||||||
|
|
||||||
def send_action(self, action: torch.Tensor):
|
|
||||||
"""The provided action is expected to be a vector."""
|
|
||||||
if not self.is_connected:
|
|
||||||
raise RobotDeviceNotConnectedError(
|
|
||||||
"KochRobot is not connected. You need to run `robot.connect()`."
|
|
||||||
)
|
|
||||||
|
|
||||||
from_idx = 0
|
|
||||||
to_idx = 0
|
|
||||||
follower_goal_pos = {}
|
|
||||||
for name in self.follower_arms:
|
|
||||||
if name in self.follower_arms:
|
|
||||||
to_idx += len(self.follower_arms[name].motor_names)
|
|
||||||
follower_goal_pos[name] = action[from_idx:to_idx].numpy()
|
|
||||||
from_idx = to_idx
|
|
||||||
|
|
||||||
for name in self.follower_arms:
|
|
||||||
self.follower_arms[name].write("Goal_Position", follower_goal_pos[name].astype(np.int32))
|
|
||||||
|
|
||||||
def disconnect(self):
|
|
||||||
if not self.is_connected:
|
|
||||||
raise RobotDeviceNotConnectedError(
|
|
||||||
"KochRobot is not connected. You need to run `robot.connect()` before disconnecting."
|
|
||||||
)
|
|
||||||
|
|
||||||
for name in self.follower_arms:
|
|
||||||
self.follower_arms[name].disconnect()
|
|
||||||
|
|
||||||
for name in self.leader_arms:
|
|
||||||
self.leader_arms[name].disconnect()
|
|
||||||
|
|
||||||
for name in self.cameras:
|
|
||||||
self.cameras[name].disconnect()
|
|
||||||
|
|
||||||
self.is_connected = False
|
|
||||||
|
|
||||||
def __del__(self):
|
|
||||||
if getattr(self, "is_connected", False):
|
|
||||||
self.disconnect()
|
|
||||||
686
lerobot/common/robot_devices/robots/manipulator.py
Normal file
686
lerobot/common/robot_devices/robots/manipulator.py
Normal file
@@ -0,0 +1,686 @@
|
|||||||
|
"""Contains logic to instantiate a robot, read information from its motors and cameras,
|
||||||
|
and send orders to its motors.
|
||||||
|
"""
|
||||||
|
# TODO(rcadene, aliberts): reorganize the codebase into one file per robot, with the associated
|
||||||
|
# calibration procedure, to make it easy for people to add their own robot.
|
||||||
|
|
||||||
|
import json
|
||||||
|
import logging
|
||||||
|
import time
|
||||||
|
import warnings
|
||||||
|
from dataclasses import dataclass, field, replace
|
||||||
|
from pathlib import Path
|
||||||
|
from typing import Sequence
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import torch
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.cameras.utils import Camera
|
||||||
|
from lerobot.common.robot_devices.motors.utils import MotorsBus
|
||||||
|
from lerobot.common.robot_devices.robots.utils import get_arm_id
|
||||||
|
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
||||||
|
|
||||||
|
|
||||||
|
def ensure_safe_goal_position(
|
||||||
|
goal_pos: torch.Tensor, present_pos: torch.Tensor, max_relative_target: float | list[float]
|
||||||
|
):
|
||||||
|
# Cap relative action target magnitude for safety.
|
||||||
|
diff = goal_pos - present_pos
|
||||||
|
max_relative_target = torch.tensor(max_relative_target)
|
||||||
|
safe_diff = torch.minimum(diff, max_relative_target)
|
||||||
|
safe_diff = torch.maximum(safe_diff, -max_relative_target)
|
||||||
|
safe_goal_pos = present_pos + safe_diff
|
||||||
|
|
||||||
|
if not torch.allclose(goal_pos, safe_goal_pos):
|
||||||
|
logging.warning(
|
||||||
|
"Relative goal position magnitude had to be clamped to be safe.\n"
|
||||||
|
f" requested relative goal position target: {diff}\n"
|
||||||
|
f" clamped relative goal position target: {safe_diff}"
|
||||||
|
)
|
||||||
|
|
||||||
|
return safe_goal_pos
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class ManipulatorRobotConfig:
|
||||||
|
"""
|
||||||
|
Example of usage:
|
||||||
|
```python
|
||||||
|
ManipulatorRobotConfig()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Define all components of the robot
|
||||||
|
robot_type: str = "koch"
|
||||||
|
leader_arms: dict[str, MotorsBus] = field(default_factory=lambda: {})
|
||||||
|
follower_arms: dict[str, MotorsBus] = field(default_factory=lambda: {})
|
||||||
|
cameras: dict[str, Camera] = field(default_factory=lambda: {})
|
||||||
|
|
||||||
|
# Optionally limit the magnitude of the relative positional target vector for safety purposes.
|
||||||
|
# Set this to a positive scalar to have the same value for all motors, or a list that is the same length
|
||||||
|
# as the number of motors in your follower arms (assumes all follower arms have the same number of
|
||||||
|
# motors).
|
||||||
|
max_relative_target: list[float] | float | None = None
|
||||||
|
|
||||||
|
# Optionally set the leader arm in torque mode with the gripper motor set to this angle. This makes it
|
||||||
|
# possible to squeeze the gripper and have it spring back to an open position on its own. If None, the
|
||||||
|
# gripper is not put in torque mode.
|
||||||
|
gripper_open_degree: float | None = None
|
||||||
|
|
||||||
|
def __setattr__(self, prop: str, val):
|
||||||
|
if prop == "max_relative_target" and val is not None and isinstance(val, Sequence):
|
||||||
|
for name in self.follower_arms:
|
||||||
|
if len(self.follower_arms[name].motors) != len(val):
|
||||||
|
raise ValueError(
|
||||||
|
f"len(max_relative_target)={len(val)} but the follower arm with name {name} has "
|
||||||
|
f"{len(self.follower_arms[name].motors)} motors. Please make sure that the "
|
||||||
|
f"`max_relative_target` list has as many parameters as there are motors per arm. "
|
||||||
|
"Note: This feature does not yet work with robots where different follower arms have "
|
||||||
|
"different numbers of motors."
|
||||||
|
)
|
||||||
|
super().__setattr__(prop, val)
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
if self.robot_type not in ["koch", "koch_bimanual", "aloha", "so100", "moss"]:
|
||||||
|
raise ValueError(f"Provided robot type ({self.robot_type}) is not supported.")
|
||||||
|
|
||||||
|
|
||||||
|
class ManipulatorRobot:
|
||||||
|
# TODO(rcadene): Implement force feedback
|
||||||
|
"""This class allows to control any manipulator robot of various number of motors.
|
||||||
|
|
||||||
|
Non exaustive list of robots:
|
||||||
|
- [Koch v1.0](https://github.com/AlexanderKoch-Koch/low_cost_robot), with and without the wrist-to-elbow expansion, developed
|
||||||
|
by Alexander Koch from [Tau Robotics](https://tau-robotics.com)
|
||||||
|
- [Koch v1.1](https://github.com/jess-moss/koch-v1-1) developed by Jess Moss
|
||||||
|
- [Aloha](https://www.trossenrobotics.com/aloha-kits) developed by Trossen Robotics
|
||||||
|
|
||||||
|
Example of highest frequency teleoperation without camera:
|
||||||
|
```python
|
||||||
|
# Defines how to communicate with the motors of the leader and follower arms
|
||||||
|
leader_arms = {
|
||||||
|
"main": DynamixelMotorsBus(
|
||||||
|
port="/dev/tty.usbmodem575E0031751",
|
||||||
|
motors={
|
||||||
|
# name: (index, model)
|
||||||
|
"shoulder_pan": (1, "xl330-m077"),
|
||||||
|
"shoulder_lift": (2, "xl330-m077"),
|
||||||
|
"elbow_flex": (3, "xl330-m077"),
|
||||||
|
"wrist_flex": (4, "xl330-m077"),
|
||||||
|
"wrist_roll": (5, "xl330-m077"),
|
||||||
|
"gripper": (6, "xl330-m077"),
|
||||||
|
},
|
||||||
|
),
|
||||||
|
}
|
||||||
|
follower_arms = {
|
||||||
|
"main": DynamixelMotorsBus(
|
||||||
|
port="/dev/tty.usbmodem575E0032081",
|
||||||
|
motors={
|
||||||
|
# name: (index, model)
|
||||||
|
"shoulder_pan": (1, "xl430-w250"),
|
||||||
|
"shoulder_lift": (2, "xl430-w250"),
|
||||||
|
"elbow_flex": (3, "xl330-m288"),
|
||||||
|
"wrist_flex": (4, "xl330-m288"),
|
||||||
|
"wrist_roll": (5, "xl330-m288"),
|
||||||
|
"gripper": (6, "xl330-m288"),
|
||||||
|
},
|
||||||
|
),
|
||||||
|
}
|
||||||
|
robot = ManipulatorRobot(
|
||||||
|
robot_type="koch",
|
||||||
|
calibration_dir=".cache/calibration/koch",
|
||||||
|
leader_arms=leader_arms,
|
||||||
|
follower_arms=follower_arms,
|
||||||
|
)
|
||||||
|
|
||||||
|
# Connect motors buses and cameras if any (Required)
|
||||||
|
robot.connect()
|
||||||
|
|
||||||
|
while True:
|
||||||
|
robot.teleop_step()
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of highest frequency data collection without camera:
|
||||||
|
```python
|
||||||
|
# Assumes leader and follower arms have been instantiated already (see first example)
|
||||||
|
robot = ManipulatorRobot(
|
||||||
|
robot_type="koch",
|
||||||
|
calibration_dir=".cache/calibration/koch",
|
||||||
|
leader_arms=leader_arms,
|
||||||
|
follower_arms=follower_arms,
|
||||||
|
)
|
||||||
|
robot.connect()
|
||||||
|
while True:
|
||||||
|
observation, action = robot.teleop_step(record_data=True)
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of highest frequency data collection with cameras:
|
||||||
|
```python
|
||||||
|
# Defines how to communicate with 2 cameras connected to the computer.
|
||||||
|
# Here, the webcam of the laptop and the phone (connected in USB to the laptop)
|
||||||
|
# can be reached respectively using the camera indices 0 and 1. These indices can be
|
||||||
|
# arbitrary. See the documentation of `OpenCVCamera` to find your own camera indices.
|
||||||
|
cameras = {
|
||||||
|
"laptop": OpenCVCamera(camera_index=0, fps=30, width=640, height=480),
|
||||||
|
"phone": OpenCVCamera(camera_index=1, fps=30, width=640, height=480),
|
||||||
|
}
|
||||||
|
|
||||||
|
# Assumes leader and follower arms have been instantiated already (see first example)
|
||||||
|
robot = ManipulatorRobot(
|
||||||
|
robot_type="koch",
|
||||||
|
calibration_dir=".cache/calibration/koch",
|
||||||
|
leader_arms=leader_arms,
|
||||||
|
follower_arms=follower_arms,
|
||||||
|
cameras=cameras,
|
||||||
|
)
|
||||||
|
robot.connect()
|
||||||
|
while True:
|
||||||
|
observation, action = robot.teleop_step(record_data=True)
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of controlling the robot with a policy (without running multiple policies in parallel to ensure highest frequency):
|
||||||
|
```python
|
||||||
|
# Assumes leader and follower arms + cameras have been instantiated already (see previous example)
|
||||||
|
robot = ManipulatorRobot(
|
||||||
|
robot_type="koch",
|
||||||
|
calibration_dir=".cache/calibration/koch",
|
||||||
|
leader_arms=leader_arms,
|
||||||
|
follower_arms=follower_arms,
|
||||||
|
cameras=cameras,
|
||||||
|
)
|
||||||
|
robot.connect()
|
||||||
|
while True:
|
||||||
|
# Uses the follower arms and cameras to capture an observation
|
||||||
|
observation = robot.capture_observation()
|
||||||
|
|
||||||
|
# Assumes a policy has been instantiated
|
||||||
|
with torch.inference_mode():
|
||||||
|
action = policy.select_action(observation)
|
||||||
|
|
||||||
|
# Orders the robot to move
|
||||||
|
robot.send_action(action)
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of disconnecting which is not mandatory since we disconnect when the object is deleted:
|
||||||
|
```python
|
||||||
|
robot.disconnect()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
config: ManipulatorRobotConfig | None = None,
|
||||||
|
calibration_dir: Path = ".cache/calibration/koch",
|
||||||
|
**kwargs,
|
||||||
|
):
|
||||||
|
if config is None:
|
||||||
|
config = ManipulatorRobotConfig()
|
||||||
|
# Overwrite config arguments using kwargs
|
||||||
|
self.config = replace(config, **kwargs)
|
||||||
|
self.calibration_dir = Path(calibration_dir)
|
||||||
|
|
||||||
|
self.robot_type = self.config.robot_type
|
||||||
|
self.leader_arms = self.config.leader_arms
|
||||||
|
self.follower_arms = self.config.follower_arms
|
||||||
|
self.cameras = self.config.cameras
|
||||||
|
self.is_connected = False
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
def get_motor_names(self, arm: dict[str, MotorsBus]) -> list:
|
||||||
|
return [f"{arm}_{motor}" for arm, bus in arm.items() for motor in bus.motors]
|
||||||
|
|
||||||
|
@property
|
||||||
|
def camera_features(self) -> dict:
|
||||||
|
cam_ft = {}
|
||||||
|
for cam_key, cam in self.cameras.items():
|
||||||
|
key = f"observation.images.{cam_key}"
|
||||||
|
cam_ft[key] = {
|
||||||
|
"shape": (cam.height, cam.width, cam.channels),
|
||||||
|
"names": ["height", "width", "channels"],
|
||||||
|
"info": None,
|
||||||
|
}
|
||||||
|
return cam_ft
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_features(self) -> dict:
|
||||||
|
action_names = self.get_motor_names(self.leader_arms)
|
||||||
|
state_names = self.get_motor_names(self.leader_arms)
|
||||||
|
return {
|
||||||
|
"action": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (len(action_names),),
|
||||||
|
"names": action_names,
|
||||||
|
},
|
||||||
|
"observation.state": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (len(state_names),),
|
||||||
|
"names": state_names,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
@property
|
||||||
|
def features(self):
|
||||||
|
return {**self.motor_features, **self.camera_features}
|
||||||
|
|
||||||
|
@property
|
||||||
|
def has_camera(self):
|
||||||
|
return len(self.cameras) > 0
|
||||||
|
|
||||||
|
@property
|
||||||
|
def num_cameras(self):
|
||||||
|
return len(self.cameras)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def available_arms(self):
|
||||||
|
available_arms = []
|
||||||
|
for name in self.follower_arms:
|
||||||
|
arm_id = get_arm_id(name, "follower")
|
||||||
|
available_arms.append(arm_id)
|
||||||
|
for name in self.leader_arms:
|
||||||
|
arm_id = get_arm_id(name, "leader")
|
||||||
|
available_arms.append(arm_id)
|
||||||
|
return available_arms
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise RobotDeviceAlreadyConnectedError(
|
||||||
|
"ManipulatorRobot is already connected. Do not run `robot.connect()` twice."
|
||||||
|
)
|
||||||
|
|
||||||
|
if not self.leader_arms and not self.follower_arms and not self.cameras:
|
||||||
|
raise ValueError(
|
||||||
|
"ManipulatorRobot doesn't have any device to connect. See example of usage in docstring of the class."
|
||||||
|
)
|
||||||
|
|
||||||
|
# Connect the arms
|
||||||
|
for name in self.follower_arms:
|
||||||
|
print(f"Connecting {name} follower arm.")
|
||||||
|
self.follower_arms[name].connect()
|
||||||
|
for name in self.leader_arms:
|
||||||
|
print(f"Connecting {name} leader arm.")
|
||||||
|
self.leader_arms[name].connect()
|
||||||
|
|
||||||
|
if self.robot_type in ["koch", "koch_bimanual", "aloha"]:
|
||||||
|
from lerobot.common.robot_devices.motors.dynamixel import TorqueMode
|
||||||
|
elif self.robot_type in ["so100", "moss"]:
|
||||||
|
from lerobot.common.robot_devices.motors.feetech import TorqueMode
|
||||||
|
|
||||||
|
# We assume that at connection time, arms are in a rest position, and torque can
|
||||||
|
# be safely disabled to run calibration and/or set robot preset configurations.
|
||||||
|
for name in self.follower_arms:
|
||||||
|
self.follower_arms[name].write("Torque_Enable", TorqueMode.DISABLED.value)
|
||||||
|
for name in self.leader_arms:
|
||||||
|
self.leader_arms[name].write("Torque_Enable", TorqueMode.DISABLED.value)
|
||||||
|
|
||||||
|
self.activate_calibration()
|
||||||
|
|
||||||
|
# Set robot preset (e.g. torque in leader gripper for Koch v1.1)
|
||||||
|
if self.robot_type in ["koch", "koch_bimanual"]:
|
||||||
|
self.set_koch_robot_preset()
|
||||||
|
elif self.robot_type == "aloha":
|
||||||
|
self.set_aloha_robot_preset()
|
||||||
|
elif self.robot_type in ["so100", "moss"]:
|
||||||
|
self.set_so100_robot_preset()
|
||||||
|
|
||||||
|
# Enable torque on all motors of the follower arms
|
||||||
|
for name in self.follower_arms:
|
||||||
|
print(f"Activating torque on {name} follower arm.")
|
||||||
|
self.follower_arms[name].write("Torque_Enable", 1)
|
||||||
|
|
||||||
|
if self.config.gripper_open_degree is not None:
|
||||||
|
if self.robot_type not in ["koch", "koch_bimanual"]:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"{self.robot_type} does not support position AND current control in the handle, which is require to set the gripper open."
|
||||||
|
)
|
||||||
|
# Set the leader arm in torque mode with the gripper motor set to an angle. This makes it possible
|
||||||
|
# to squeeze the gripper and have it spring back to an open position on its own.
|
||||||
|
for name in self.leader_arms:
|
||||||
|
self.leader_arms[name].write("Torque_Enable", 1, "gripper")
|
||||||
|
self.leader_arms[name].write("Goal_Position", self.config.gripper_open_degree, "gripper")
|
||||||
|
|
||||||
|
# Check both arms can be read
|
||||||
|
for name in self.follower_arms:
|
||||||
|
self.follower_arms[name].read("Present_Position")
|
||||||
|
for name in self.leader_arms:
|
||||||
|
self.leader_arms[name].read("Present_Position")
|
||||||
|
|
||||||
|
# Connect the cameras
|
||||||
|
for name in self.cameras:
|
||||||
|
self.cameras[name].connect()
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def activate_calibration(self):
|
||||||
|
"""After calibration all motors function in human interpretable ranges.
|
||||||
|
Rotations are expressed in degrees in nominal range of [-180, 180],
|
||||||
|
and linear motions (like gripper of Aloha) in nominal range of [0, 100].
|
||||||
|
"""
|
||||||
|
|
||||||
|
def load_or_run_calibration_(name, arm, arm_type):
|
||||||
|
arm_id = get_arm_id(name, arm_type)
|
||||||
|
arm_calib_path = self.calibration_dir / f"{arm_id}.json"
|
||||||
|
|
||||||
|
if arm_calib_path.exists():
|
||||||
|
with open(arm_calib_path) as f:
|
||||||
|
calibration = json.load(f)
|
||||||
|
else:
|
||||||
|
# TODO(rcadene): display a warning in __init__ if calibration file not available
|
||||||
|
print(f"Missing calibration file '{arm_calib_path}'")
|
||||||
|
|
||||||
|
if self.robot_type in ["koch", "koch_bimanual", "aloha"]:
|
||||||
|
from lerobot.common.robot_devices.robots.dynamixel_calibration import run_arm_calibration
|
||||||
|
|
||||||
|
calibration = run_arm_calibration(arm, self.robot_type, name, arm_type)
|
||||||
|
|
||||||
|
elif self.robot_type in ["so100", "moss"]:
|
||||||
|
from lerobot.common.robot_devices.robots.feetech_calibration import (
|
||||||
|
run_arm_manual_calibration,
|
||||||
|
)
|
||||||
|
|
||||||
|
calibration = run_arm_manual_calibration(arm, self.robot_type, name, arm_type)
|
||||||
|
|
||||||
|
print(f"Calibration is done! Saving calibration file '{arm_calib_path}'")
|
||||||
|
arm_calib_path.parent.mkdir(parents=True, exist_ok=True)
|
||||||
|
with open(arm_calib_path, "w") as f:
|
||||||
|
json.dump(calibration, f)
|
||||||
|
|
||||||
|
return calibration
|
||||||
|
|
||||||
|
for name, arm in self.follower_arms.items():
|
||||||
|
calibration = load_or_run_calibration_(name, arm, "follower")
|
||||||
|
arm.set_calibration(calibration)
|
||||||
|
for name, arm in self.leader_arms.items():
|
||||||
|
calibration = load_or_run_calibration_(name, arm, "leader")
|
||||||
|
arm.set_calibration(calibration)
|
||||||
|
|
||||||
|
def set_koch_robot_preset(self):
|
||||||
|
def set_operating_mode_(arm):
|
||||||
|
from lerobot.common.robot_devices.motors.dynamixel import TorqueMode
|
||||||
|
|
||||||
|
if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
|
||||||
|
raise ValueError("To run set robot preset, the torque must be disabled on all motors.")
|
||||||
|
|
||||||
|
# Use 'extended position mode' for all motors except gripper, because in joint mode the servos can't
|
||||||
|
# rotate more than 360 degrees (from 0 to 4095) And some mistake can happen while assembling the arm,
|
||||||
|
# you could end up with a servo with a position 0 or 4095 at a crucial point See [
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/x_series/#operating-mode11]
|
||||||
|
all_motors_except_gripper = [name for name in arm.motor_names if name != "gripper"]
|
||||||
|
if len(all_motors_except_gripper) > 0:
|
||||||
|
# 4 corresponds to Extended Position on Koch motors
|
||||||
|
arm.write("Operating_Mode", 4, all_motors_except_gripper)
|
||||||
|
|
||||||
|
# Use 'position control current based' for gripper to be limited by the limit of the current.
|
||||||
|
# For the follower gripper, it means it can grasp an object without forcing too much even tho,
|
||||||
|
# it's goal position is a complete grasp (both gripper fingers are ordered to join and reach a touch).
|
||||||
|
# For the leader gripper, it means we can use it as a physical trigger, since we can force with our finger
|
||||||
|
# to make it move, and it will move back to its original target position when we release the force.
|
||||||
|
# 5 corresponds to Current Controlled Position on Koch gripper motors "xl330-m077, xl330-m288"
|
||||||
|
arm.write("Operating_Mode", 5, "gripper")
|
||||||
|
|
||||||
|
for name in self.follower_arms:
|
||||||
|
set_operating_mode_(self.follower_arms[name])
|
||||||
|
|
||||||
|
# Set better PID values to close the gap between recorded states and actions
|
||||||
|
# TODO(rcadene): Implement an automatic procedure to set optimial PID values for each motor
|
||||||
|
self.follower_arms[name].write("Position_P_Gain", 1500, "elbow_flex")
|
||||||
|
self.follower_arms[name].write("Position_I_Gain", 0, "elbow_flex")
|
||||||
|
self.follower_arms[name].write("Position_D_Gain", 600, "elbow_flex")
|
||||||
|
|
||||||
|
if self.config.gripper_open_degree is not None:
|
||||||
|
for name in self.leader_arms:
|
||||||
|
set_operating_mode_(self.leader_arms[name])
|
||||||
|
|
||||||
|
# Enable torque on the gripper of the leader arms, and move it to 45 degrees,
|
||||||
|
# so that we can use it as a trigger to close the gripper of the follower arms.
|
||||||
|
self.leader_arms[name].write("Torque_Enable", 1, "gripper")
|
||||||
|
self.leader_arms[name].write("Goal_Position", self.config.gripper_open_degree, "gripper")
|
||||||
|
|
||||||
|
def set_aloha_robot_preset(self):
|
||||||
|
def set_shadow_(arm):
|
||||||
|
# Set secondary/shadow ID for shoulder and elbow. These joints have two motors.
|
||||||
|
# As a result, if only one of them is required to move to a certain position,
|
||||||
|
# the other will follow. This is to avoid breaking the motors.
|
||||||
|
if "shoulder_shadow" in arm.motor_names:
|
||||||
|
shoulder_idx = arm.read("ID", "shoulder")
|
||||||
|
arm.write("Secondary_ID", shoulder_idx, "shoulder_shadow")
|
||||||
|
|
||||||
|
if "elbow_shadow" in arm.motor_names:
|
||||||
|
elbow_idx = arm.read("ID", "elbow")
|
||||||
|
arm.write("Secondary_ID", elbow_idx, "elbow_shadow")
|
||||||
|
|
||||||
|
for name in self.follower_arms:
|
||||||
|
set_shadow_(self.follower_arms[name])
|
||||||
|
|
||||||
|
for name in self.leader_arms:
|
||||||
|
set_shadow_(self.leader_arms[name])
|
||||||
|
|
||||||
|
for name in self.follower_arms:
|
||||||
|
# Set a velocity limit of 131 as advised by Trossen Robotics
|
||||||
|
self.follower_arms[name].write("Velocity_Limit", 131)
|
||||||
|
|
||||||
|
# Use 'extended position mode' for all motors except gripper, because in joint mode the servos can't
|
||||||
|
# rotate more than 360 degrees (from 0 to 4095) And some mistake can happen while assembling the arm,
|
||||||
|
# you could end up with a servo with a position 0 or 4095 at a crucial point See [
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/x_series/#operating-mode11]
|
||||||
|
all_motors_except_gripper = [
|
||||||
|
name for name in self.follower_arms[name].motor_names if name != "gripper"
|
||||||
|
]
|
||||||
|
if len(all_motors_except_gripper) > 0:
|
||||||
|
# 4 corresponds to Extended Position on Aloha motors
|
||||||
|
self.follower_arms[name].write("Operating_Mode", 4, all_motors_except_gripper)
|
||||||
|
|
||||||
|
# Use 'position control current based' for follower gripper to be limited by the limit of the current.
|
||||||
|
# It can grasp an object without forcing too much even tho,
|
||||||
|
# it's goal position is a complete grasp (both gripper fingers are ordered to join and reach a touch).
|
||||||
|
# 5 corresponds to Current Controlled Position on Aloha gripper follower "xm430-w350"
|
||||||
|
self.follower_arms[name].write("Operating_Mode", 5, "gripper")
|
||||||
|
|
||||||
|
# Note: We can't enable torque on the leader gripper since "xc430-w150" doesn't have
|
||||||
|
# a Current Controlled Position mode.
|
||||||
|
|
||||||
|
if self.config.gripper_open_degree is not None:
|
||||||
|
warnings.warn(
|
||||||
|
f"`gripper_open_degree` is set to {self.config.gripper_open_degree}, but None is expected for Aloha instead",
|
||||||
|
stacklevel=1,
|
||||||
|
)
|
||||||
|
|
||||||
|
def set_so100_robot_preset(self):
|
||||||
|
for name in self.follower_arms:
|
||||||
|
# Mode=0 for Position Control
|
||||||
|
self.follower_arms[name].write("Mode", 0)
|
||||||
|
# Set P_Coefficient to lower value to avoid shakiness (Default is 32)
|
||||||
|
self.follower_arms[name].write("P_Coefficient", 16)
|
||||||
|
# Set I_Coefficient and D_Coefficient to default value 0 and 32
|
||||||
|
self.follower_arms[name].write("I_Coefficient", 0)
|
||||||
|
self.follower_arms[name].write("D_Coefficient", 32)
|
||||||
|
# Close the write lock so that Maximum_Acceleration gets written to EPROM address,
|
||||||
|
# which is mandatory for Maximum_Acceleration to take effect after rebooting.
|
||||||
|
self.follower_arms[name].write("Lock", 0)
|
||||||
|
# Set Maximum_Acceleration to 254 to speedup acceleration and deceleration of
|
||||||
|
# the motors. Note: this configuration is not in the official STS3215 Memory Table
|
||||||
|
self.follower_arms[name].write("Maximum_Acceleration", 254)
|
||||||
|
self.follower_arms[name].write("Acceleration", 254)
|
||||||
|
|
||||||
|
def teleop_step(
|
||||||
|
self, record_data=False
|
||||||
|
) -> None | tuple[dict[str, torch.Tensor], dict[str, torch.Tensor]]:
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
"ManipulatorRobot is not connected. You need to run `robot.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
# Prepare to assign the position of the leader to the follower
|
||||||
|
leader_pos = {}
|
||||||
|
for name in self.leader_arms:
|
||||||
|
before_lread_t = time.perf_counter()
|
||||||
|
leader_pos[name] = self.leader_arms[name].read("Present_Position")
|
||||||
|
leader_pos[name] = torch.from_numpy(leader_pos[name])
|
||||||
|
self.logs[f"read_leader_{name}_pos_dt_s"] = time.perf_counter() - before_lread_t
|
||||||
|
|
||||||
|
# Send goal position to the follower
|
||||||
|
follower_goal_pos = {}
|
||||||
|
for name in self.follower_arms:
|
||||||
|
before_fwrite_t = time.perf_counter()
|
||||||
|
goal_pos = leader_pos[name]
|
||||||
|
|
||||||
|
# Cap goal position when too far away from present position.
|
||||||
|
# Slower fps expected due to reading from the follower.
|
||||||
|
if self.config.max_relative_target is not None:
|
||||||
|
present_pos = self.follower_arms[name].read("Present_Position")
|
||||||
|
present_pos = torch.from_numpy(present_pos)
|
||||||
|
goal_pos = ensure_safe_goal_position(goal_pos, present_pos, self.config.max_relative_target)
|
||||||
|
|
||||||
|
# Used when record_data=True
|
||||||
|
follower_goal_pos[name] = goal_pos
|
||||||
|
|
||||||
|
goal_pos = goal_pos.numpy().astype(np.int32)
|
||||||
|
self.follower_arms[name].write("Goal_Position", goal_pos)
|
||||||
|
self.logs[f"write_follower_{name}_goal_pos_dt_s"] = time.perf_counter() - before_fwrite_t
|
||||||
|
|
||||||
|
# Early exit when recording data is not requested
|
||||||
|
if not record_data:
|
||||||
|
return
|
||||||
|
|
||||||
|
# TODO(rcadene): Add velocity and other info
|
||||||
|
# Read follower position
|
||||||
|
follower_pos = {}
|
||||||
|
for name in self.follower_arms:
|
||||||
|
before_fread_t = time.perf_counter()
|
||||||
|
follower_pos[name] = self.follower_arms[name].read("Present_Position")
|
||||||
|
follower_pos[name] = torch.from_numpy(follower_pos[name])
|
||||||
|
self.logs[f"read_follower_{name}_pos_dt_s"] = time.perf_counter() - before_fread_t
|
||||||
|
|
||||||
|
# Create state by concatenating follower current position
|
||||||
|
state = []
|
||||||
|
for name in self.follower_arms:
|
||||||
|
if name in follower_pos:
|
||||||
|
state.append(follower_pos[name])
|
||||||
|
state = torch.cat(state)
|
||||||
|
|
||||||
|
# Create action by concatenating follower goal position
|
||||||
|
action = []
|
||||||
|
for name in self.follower_arms:
|
||||||
|
if name in follower_goal_pos:
|
||||||
|
action.append(follower_goal_pos[name])
|
||||||
|
action = torch.cat(action)
|
||||||
|
|
||||||
|
# Capture images from cameras
|
||||||
|
images = {}
|
||||||
|
for name in self.cameras:
|
||||||
|
before_camread_t = time.perf_counter()
|
||||||
|
images[name] = self.cameras[name].async_read()
|
||||||
|
images[name] = torch.from_numpy(images[name])
|
||||||
|
self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
|
||||||
|
self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
|
||||||
|
|
||||||
|
# Populate output dictionnaries
|
||||||
|
obs_dict, action_dict = {}, {}
|
||||||
|
obs_dict["observation.state"] = state
|
||||||
|
action_dict["action"] = action
|
||||||
|
for name in self.cameras:
|
||||||
|
obs_dict[f"observation.images.{name}"] = images[name]
|
||||||
|
|
||||||
|
return obs_dict, action_dict
|
||||||
|
|
||||||
|
def capture_observation(self):
|
||||||
|
"""The returned observations do not have a batch dimension."""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
"ManipulatorRobot is not connected. You need to run `robot.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
# Read follower position
|
||||||
|
follower_pos = {}
|
||||||
|
for name in self.follower_arms:
|
||||||
|
before_fread_t = time.perf_counter()
|
||||||
|
follower_pos[name] = self.follower_arms[name].read("Present_Position")
|
||||||
|
follower_pos[name] = torch.from_numpy(follower_pos[name])
|
||||||
|
self.logs[f"read_follower_{name}_pos_dt_s"] = time.perf_counter() - before_fread_t
|
||||||
|
|
||||||
|
# Create state by concatenating follower current position
|
||||||
|
state = []
|
||||||
|
for name in self.follower_arms:
|
||||||
|
if name in follower_pos:
|
||||||
|
state.append(follower_pos[name])
|
||||||
|
state = torch.cat(state)
|
||||||
|
|
||||||
|
# Capture images from cameras
|
||||||
|
images = {}
|
||||||
|
for name in self.cameras:
|
||||||
|
before_camread_t = time.perf_counter()
|
||||||
|
images[name] = self.cameras[name].async_read()
|
||||||
|
images[name] = torch.from_numpy(images[name])
|
||||||
|
self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
|
||||||
|
self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
|
||||||
|
|
||||||
|
# Populate output dictionnaries and format to pytorch
|
||||||
|
obs_dict = {}
|
||||||
|
obs_dict["observation.state"] = state
|
||||||
|
for name in self.cameras:
|
||||||
|
obs_dict[f"observation.images.{name}"] = images[name]
|
||||||
|
return obs_dict
|
||||||
|
|
||||||
|
def send_action(self, action: torch.Tensor) -> torch.Tensor:
|
||||||
|
"""Command the follower arms to move to a target joint configuration.
|
||||||
|
|
||||||
|
The relative action magnitude may be clipped depending on the configuration parameter
|
||||||
|
`max_relative_target`. In this case, the action sent differs from original action.
|
||||||
|
Thus, this function always returns the action actually sent.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
action: tensor containing the concatenated goal positions for the follower arms.
|
||||||
|
"""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
"ManipulatorRobot is not connected. You need to run `robot.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
from_idx = 0
|
||||||
|
to_idx = 0
|
||||||
|
action_sent = []
|
||||||
|
for name in self.follower_arms:
|
||||||
|
# Get goal position of each follower arm by splitting the action vector
|
||||||
|
to_idx += len(self.follower_arms[name].motor_names)
|
||||||
|
goal_pos = action[from_idx:to_idx]
|
||||||
|
from_idx = to_idx
|
||||||
|
|
||||||
|
# Cap goal position when too far away from present position.
|
||||||
|
# Slower fps expected due to reading from the follower.
|
||||||
|
if self.config.max_relative_target is not None:
|
||||||
|
present_pos = self.follower_arms[name].read("Present_Position")
|
||||||
|
present_pos = torch.from_numpy(present_pos)
|
||||||
|
goal_pos = ensure_safe_goal_position(goal_pos, present_pos, self.config.max_relative_target)
|
||||||
|
|
||||||
|
# Save tensor to concat and return
|
||||||
|
action_sent.append(goal_pos)
|
||||||
|
|
||||||
|
# Send goal position to each follower
|
||||||
|
goal_pos = goal_pos.numpy().astype(np.int32)
|
||||||
|
self.follower_arms[name].write("Goal_Position", goal_pos)
|
||||||
|
|
||||||
|
return torch.cat(action_sent)
|
||||||
|
|
||||||
|
def print_logs(self):
|
||||||
|
pass
|
||||||
|
# TODO(aliberts): move robot-specific logs logic here
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
"ManipulatorRobot is not connected. You need to run `robot.connect()` before disconnecting."
|
||||||
|
)
|
||||||
|
|
||||||
|
for name in self.follower_arms:
|
||||||
|
self.follower_arms[name].disconnect()
|
||||||
|
|
||||||
|
for name in self.leader_arms:
|
||||||
|
self.leader_arms[name].disconnect()
|
||||||
|
|
||||||
|
for name in self.cameras:
|
||||||
|
self.cameras[name].disconnect()
|
||||||
|
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
216
lerobot/common/robot_devices/robots/stretch.py
Normal file
216
lerobot/common/robot_devices/robots/stretch.py
Normal file
@@ -0,0 +1,216 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import time
|
||||||
|
from dataclasses import dataclass, field, replace
|
||||||
|
|
||||||
|
import torch
|
||||||
|
from stretch_body.gamepad_teleop import GamePadTeleop
|
||||||
|
from stretch_body.robot import Robot as StretchAPI
|
||||||
|
from stretch_body.robot_params import RobotParams
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.cameras.utils import Camera
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class StretchRobotConfig:
|
||||||
|
robot_type: str | None = "stretch"
|
||||||
|
cameras: dict[str, Camera] = field(default_factory=lambda: {})
|
||||||
|
# TODO(aliberts): add feature with max_relative target
|
||||||
|
# TODO(aliberts): add comment on max_relative target
|
||||||
|
max_relative_target: list[float] | float | None = None
|
||||||
|
|
||||||
|
|
||||||
|
class StretchRobot(StretchAPI):
|
||||||
|
"""Wrapper of stretch_body.robot.Robot"""
|
||||||
|
|
||||||
|
def __init__(self, config: StretchRobotConfig | None = None, **kwargs):
|
||||||
|
super().__init__()
|
||||||
|
if config is None:
|
||||||
|
config = StretchRobotConfig()
|
||||||
|
# Overwrite config arguments using kwargs
|
||||||
|
self.config = replace(config, **kwargs)
|
||||||
|
|
||||||
|
self.robot_type = self.config.robot_type
|
||||||
|
self.cameras = self.config.cameras
|
||||||
|
self.is_connected = False
|
||||||
|
self.teleop = None
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
# TODO(aliberts): test this
|
||||||
|
RobotParams.set_logging_level("WARNING")
|
||||||
|
RobotParams.set_logging_formatter("brief_console_formatter")
|
||||||
|
|
||||||
|
self.state_keys = None
|
||||||
|
self.action_keys = None
|
||||||
|
|
||||||
|
def connect(self) -> None:
|
||||||
|
self.is_connected = self.startup()
|
||||||
|
if not self.is_connected:
|
||||||
|
print("Another process is already using Stretch. Try running 'stretch_free_robot_process.py'")
|
||||||
|
raise ConnectionError()
|
||||||
|
|
||||||
|
for name in self.cameras:
|
||||||
|
self.cameras[name].connect()
|
||||||
|
self.is_connected = self.is_connected and self.cameras[name].is_connected
|
||||||
|
|
||||||
|
if not self.is_connected:
|
||||||
|
print("Could not connect to the cameras, check that all cameras are plugged-in.")
|
||||||
|
raise ConnectionError()
|
||||||
|
|
||||||
|
self.run_calibration()
|
||||||
|
|
||||||
|
def run_calibration(self) -> None:
|
||||||
|
if not self.is_homed():
|
||||||
|
self.home()
|
||||||
|
|
||||||
|
def teleop_step(
|
||||||
|
self, record_data=False
|
||||||
|
) -> None | tuple[dict[str, torch.Tensor], dict[str, torch.Tensor]]:
|
||||||
|
# TODO(aliberts): return ndarrays instead of torch.Tensors
|
||||||
|
if not self.is_connected:
|
||||||
|
raise ConnectionError()
|
||||||
|
|
||||||
|
if self.teleop is None:
|
||||||
|
self.teleop = GamePadTeleop(robot_instance=False)
|
||||||
|
self.teleop.startup(robot=self)
|
||||||
|
|
||||||
|
before_read_t = time.perf_counter()
|
||||||
|
state = self.get_state()
|
||||||
|
action = self.teleop.gamepad_controller.get_state()
|
||||||
|
self.logs["read_pos_dt_s"] = time.perf_counter() - before_read_t
|
||||||
|
|
||||||
|
before_write_t = time.perf_counter()
|
||||||
|
self.teleop.do_motion(robot=self)
|
||||||
|
self.push_command()
|
||||||
|
self.logs["write_pos_dt_s"] = time.perf_counter() - before_write_t
|
||||||
|
|
||||||
|
if self.state_keys is None:
|
||||||
|
self.state_keys = list(state)
|
||||||
|
|
||||||
|
if not record_data:
|
||||||
|
return
|
||||||
|
|
||||||
|
state = torch.as_tensor(list(state.values()))
|
||||||
|
action = torch.as_tensor(list(action.values()))
|
||||||
|
|
||||||
|
# Capture images from cameras
|
||||||
|
images = {}
|
||||||
|
for name in self.cameras:
|
||||||
|
before_camread_t = time.perf_counter()
|
||||||
|
images[name] = self.cameras[name].async_read()
|
||||||
|
images[name] = torch.from_numpy(images[name])
|
||||||
|
self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
|
||||||
|
self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
|
||||||
|
|
||||||
|
# Populate output dictionnaries
|
||||||
|
obs_dict, action_dict = {}, {}
|
||||||
|
obs_dict["observation.state"] = state
|
||||||
|
action_dict["action"] = action
|
||||||
|
for name in self.cameras:
|
||||||
|
obs_dict[f"observation.images.{name}"] = images[name]
|
||||||
|
|
||||||
|
return obs_dict, action_dict
|
||||||
|
|
||||||
|
def get_state(self) -> dict:
|
||||||
|
status = self.get_status()
|
||||||
|
return {
|
||||||
|
"head_pan.pos": status["head"]["head_pan"]["pos"],
|
||||||
|
"head_tilt.pos": status["head"]["head_tilt"]["pos"],
|
||||||
|
"lift.pos": status["lift"]["pos"],
|
||||||
|
"arm.pos": status["arm"]["pos"],
|
||||||
|
"wrist_pitch.pos": status["end_of_arm"]["wrist_pitch"]["pos"],
|
||||||
|
"wrist_roll.pos": status["end_of_arm"]["wrist_roll"]["pos"],
|
||||||
|
"wrist_yaw.pos": status["end_of_arm"]["wrist_yaw"]["pos"],
|
||||||
|
"gripper.pos": status["end_of_arm"]["stretch_gripper"]["pos"],
|
||||||
|
"base_x.vel": status["base"]["x_vel"],
|
||||||
|
"base_y.vel": status["base"]["y_vel"],
|
||||||
|
"base_theta.vel": status["base"]["theta_vel"],
|
||||||
|
}
|
||||||
|
|
||||||
|
def capture_observation(self) -> dict:
|
||||||
|
# TODO(aliberts): return ndarrays instead of torch.Tensors
|
||||||
|
before_read_t = time.perf_counter()
|
||||||
|
state = self.get_state()
|
||||||
|
self.logs["read_pos_dt_s"] = time.perf_counter() - before_read_t
|
||||||
|
|
||||||
|
if self.state_keys is None:
|
||||||
|
self.state_keys = list(state)
|
||||||
|
|
||||||
|
state = torch.as_tensor(list(state.values()))
|
||||||
|
|
||||||
|
# Capture images from cameras
|
||||||
|
images = {}
|
||||||
|
for name in self.cameras:
|
||||||
|
before_camread_t = time.perf_counter()
|
||||||
|
images[name] = self.cameras[name].async_read()
|
||||||
|
images[name] = torch.from_numpy(images[name])
|
||||||
|
self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
|
||||||
|
self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
|
||||||
|
|
||||||
|
# Populate output dictionnaries
|
||||||
|
obs_dict = {}
|
||||||
|
obs_dict["observation.state"] = state
|
||||||
|
for name in self.cameras:
|
||||||
|
obs_dict[f"observation.images.{name}"] = images[name]
|
||||||
|
|
||||||
|
return obs_dict
|
||||||
|
|
||||||
|
def send_action(self, action: torch.Tensor) -> torch.Tensor:
|
||||||
|
# TODO(aliberts): return ndarrays instead of torch.Tensors
|
||||||
|
if not self.is_connected:
|
||||||
|
raise ConnectionError()
|
||||||
|
|
||||||
|
if self.teleop is None:
|
||||||
|
self.teleop = GamePadTeleop(robot_instance=False)
|
||||||
|
self.teleop.startup(robot=self)
|
||||||
|
|
||||||
|
if self.action_keys is None:
|
||||||
|
dummy_action = self.teleop.gamepad_controller.get_state()
|
||||||
|
self.action_keys = list(dummy_action.keys())
|
||||||
|
|
||||||
|
action_dict = dict(zip(self.action_keys, action.tolist(), strict=True))
|
||||||
|
|
||||||
|
before_write_t = time.perf_counter()
|
||||||
|
self.teleop.do_motion(state=action_dict, robot=self)
|
||||||
|
self.push_command()
|
||||||
|
self.logs["write_pos_dt_s"] = time.perf_counter() - before_write_t
|
||||||
|
|
||||||
|
# TODO(aliberts): return action_sent when motion is limited
|
||||||
|
return action
|
||||||
|
|
||||||
|
def print_logs(self) -> None:
|
||||||
|
pass
|
||||||
|
# TODO(aliberts): move robot-specific logs logic here
|
||||||
|
|
||||||
|
def teleop_safety_stop(self) -> None:
|
||||||
|
if self.teleop is not None:
|
||||||
|
self.teleop._safety_stop(robot=self)
|
||||||
|
|
||||||
|
def disconnect(self) -> None:
|
||||||
|
self.stop()
|
||||||
|
if self.teleop is not None:
|
||||||
|
self.teleop.gamepad_controller.stop()
|
||||||
|
self.teleop.stop()
|
||||||
|
|
||||||
|
if len(self.cameras) > 0:
|
||||||
|
for cam in self.cameras.values():
|
||||||
|
cam.disconnect()
|
||||||
|
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
self.disconnect()
|
||||||
@@ -1,9 +1,21 @@
|
|||||||
from typing import Protocol
|
from typing import Protocol
|
||||||
|
|
||||||
|
|
||||||
|
def get_arm_id(name, arm_type):
|
||||||
|
"""Returns the string identifier of a robot arm. For instance, for a bimanual manipulator
|
||||||
|
like Aloha, it could be left_follower, right_follower, left_leader, or right_leader.
|
||||||
|
"""
|
||||||
|
return f"{name}_{arm_type}"
|
||||||
|
|
||||||
|
|
||||||
class Robot(Protocol):
|
class Robot(Protocol):
|
||||||
def init_teleop(self): ...
|
# TODO(rcadene, aliberts): Add unit test checking the protocol is implemented in the corresponding classes
|
||||||
|
robot_type: str
|
||||||
|
features: dict
|
||||||
|
|
||||||
|
def connect(self): ...
|
||||||
def run_calibration(self): ...
|
def run_calibration(self): ...
|
||||||
def teleop_step(self, record_data=False): ...
|
def teleop_step(self, record_data=False): ...
|
||||||
def capture_observation(self): ...
|
def capture_observation(self): ...
|
||||||
def send_action(self, action): ...
|
def send_action(self, action): ...
|
||||||
|
def disconnect(self): ...
|
||||||
|
|||||||
@@ -1,3 +1,35 @@
|
|||||||
|
import platform
|
||||||
|
import time
|
||||||
|
|
||||||
|
|
||||||
|
def busy_wait(seconds):
|
||||||
|
if platform.system() == "Darwin":
|
||||||
|
# On Mac, `time.sleep` is not accurate and we need to use this while loop trick,
|
||||||
|
# but it consumes CPU cycles.
|
||||||
|
# TODO(rcadene): find an alternative: from python 11, time.sleep is precise
|
||||||
|
end_time = time.perf_counter() + seconds
|
||||||
|
while time.perf_counter() < end_time:
|
||||||
|
pass
|
||||||
|
else:
|
||||||
|
# On Linux time.sleep is accurate
|
||||||
|
if seconds > 0:
|
||||||
|
time.sleep(seconds)
|
||||||
|
|
||||||
|
|
||||||
|
def safe_disconnect(func):
|
||||||
|
# TODO(aliberts): Allow to pass custom exceptions
|
||||||
|
# (e.g. ThreadServiceExit, KeyboardInterrupt, SystemExit, UnpluggedError, DynamixelCommError)
|
||||||
|
def wrapper(robot, *args, **kwargs):
|
||||||
|
try:
|
||||||
|
return func(robot, *args, **kwargs)
|
||||||
|
except Exception as e:
|
||||||
|
if robot.is_connected:
|
||||||
|
robot.disconnect()
|
||||||
|
raise e
|
||||||
|
|
||||||
|
return wrapper
|
||||||
|
|
||||||
|
|
||||||
class RobotDeviceNotConnectedError(Exception):
|
class RobotDeviceNotConnectedError(Exception):
|
||||||
"""Exception raised when the robot device is not connected."""
|
"""Exception raised when the robot device is not connected."""
|
||||||
|
|
||||||
|
|||||||
@@ -14,7 +14,9 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
import logging
|
import logging
|
||||||
|
import os
|
||||||
import os.path as osp
|
import os.path as osp
|
||||||
|
import platform
|
||||||
import random
|
import random
|
||||||
from contextlib import contextmanager
|
from contextlib import contextmanager
|
||||||
from datetime import datetime, timezone
|
from datetime import datetime, timezone
|
||||||
@@ -27,6 +29,18 @@ import torch
|
|||||||
from omegaconf import DictConfig
|
from omegaconf import DictConfig
|
||||||
|
|
||||||
|
|
||||||
|
def none_or_int(value):
|
||||||
|
if value == "None":
|
||||||
|
return None
|
||||||
|
return int(value)
|
||||||
|
|
||||||
|
|
||||||
|
def inside_slurm():
|
||||||
|
"""Check whether the python process was launched through slurm"""
|
||||||
|
# TODO(rcadene): return False for interactive mode `--pty bash`
|
||||||
|
return "SLURM_JOB_ID" in os.environ
|
||||||
|
|
||||||
|
|
||||||
def get_safe_torch_device(cfg_device: str, log: bool = False) -> torch.device:
|
def get_safe_torch_device(cfg_device: str, log: bool = False) -> torch.device:
|
||||||
"""Given a string, return a torch.device with checks on whether the device is available."""
|
"""Given a string, return a torch.device with checks on whether the device is available."""
|
||||||
match cfg_device:
|
match cfg_device:
|
||||||
@@ -158,7 +172,6 @@ def init_hydra_config(config_path: str, overrides: list[str] | None = None) -> D
|
|||||||
version_base="1.2",
|
version_base="1.2",
|
||||||
)
|
)
|
||||||
cfg = hydra.compose(Path(config_path).stem, overrides)
|
cfg = hydra.compose(Path(config_path).stem, overrides)
|
||||||
|
|
||||||
return cfg
|
return cfg
|
||||||
|
|
||||||
|
|
||||||
@@ -177,3 +190,30 @@ def print_cuda_memory_usage():
|
|||||||
|
|
||||||
def capture_timestamp_utc():
|
def capture_timestamp_utc():
|
||||||
return datetime.now(timezone.utc)
|
return datetime.now(timezone.utc)
|
||||||
|
|
||||||
|
|
||||||
|
def say(text, blocking=False):
|
||||||
|
# Check if mac, linux, or windows.
|
||||||
|
if platform.system() == "Darwin":
|
||||||
|
cmd = f'say "{text}"'
|
||||||
|
if not blocking:
|
||||||
|
cmd += " &"
|
||||||
|
elif platform.system() == "Linux":
|
||||||
|
cmd = f'spd-say "{text}"'
|
||||||
|
if blocking:
|
||||||
|
cmd += " --wait"
|
||||||
|
elif platform.system() == "Windows":
|
||||||
|
# TODO(rcadene): Make blocking option work for Windows
|
||||||
|
cmd = (
|
||||||
|
'PowerShell -Command "Add-Type -AssemblyName System.Speech; '
|
||||||
|
f"(New-Object System.Speech.Synthesis.SpeechSynthesizer).Speak('{text}')\""
|
||||||
|
)
|
||||||
|
|
||||||
|
os.system(cmd)
|
||||||
|
|
||||||
|
|
||||||
|
def log_say(text, play_sounds, blocking=False):
|
||||||
|
logging.info(text)
|
||||||
|
|
||||||
|
if play_sounds:
|
||||||
|
say(text, blocking)
|
||||||
|
|||||||
10
lerobot/configs/env/aloha_real.yaml
vendored
Normal file
10
lerobot/configs/env/aloha_real.yaml
vendored
Normal file
@@ -0,0 +1,10 @@
|
|||||||
|
# @package _global_
|
||||||
|
|
||||||
|
fps: 30
|
||||||
|
|
||||||
|
env:
|
||||||
|
name: real_world
|
||||||
|
task: null
|
||||||
|
state_dim: 18
|
||||||
|
action_dim: 18
|
||||||
|
fps: ${fps}
|
||||||
10
lerobot/configs/env/moss_real.yaml
vendored
Normal file
10
lerobot/configs/env/moss_real.yaml
vendored
Normal file
@@ -0,0 +1,10 @@
|
|||||||
|
# @package _global_
|
||||||
|
|
||||||
|
fps: 30
|
||||||
|
|
||||||
|
env:
|
||||||
|
name: real_world
|
||||||
|
task: null
|
||||||
|
state_dim: 6
|
||||||
|
action_dim: 6
|
||||||
|
fps: ${fps}
|
||||||
10
lerobot/configs/env/so100_real.yaml
vendored
Normal file
10
lerobot/configs/env/so100_real.yaml
vendored
Normal file
@@ -0,0 +1,10 @@
|
|||||||
|
# @package _global_
|
||||||
|
|
||||||
|
fps: 30
|
||||||
|
|
||||||
|
env:
|
||||||
|
name: real_world
|
||||||
|
task: null
|
||||||
|
state_dim: 6
|
||||||
|
action_dim: 6
|
||||||
|
fps: ${fps}
|
||||||
@@ -1,16 +1,22 @@
|
|||||||
# @package _global_
|
# @package _global_
|
||||||
|
|
||||||
# Use `act_real.yaml` to train on real-world Aloha/Aloha2 datasets.
|
# Use `act_aloha_real.yaml` to train on real-world datasets collected on Aloha or Aloha-2 robots.
|
||||||
# Compared to `act.yaml`, it contains 4 cameras (i.e. cam_right_wrist, cam_left_wrist, images,
|
# Compared to `act.yaml`, it contains 4 cameras (i.e. cam_right_wrist, cam_left_wrist, cam_high, cam_low) instead of 1 camera (i.e. top).
|
||||||
# cam_low) instead of 1 camera (i.e. top). Also, `training.eval_freq` is set to -1. This config is used
|
# Also, `training.eval_freq` is set to -1. This config is used to evaluate checkpoints at a certain frequency of training steps.
|
||||||
# to evaluate checkpoints at a certain frequency of training steps. When it is set to -1, it deactivates evaluation.
|
# When it is set to -1, it deactivates evaluation. This is because real-world evaluation is done through our `control_robot.py` script.
|
||||||
# This is because real-world evaluation is done through [dora-lerobot](https://github.com/dora-rs/dora-lerobot).
|
# Look at the documentation in header of `control_robot.py` for more information on how to collect data , train and evaluate a policy.
|
||||||
# Look at its README for more information on how to evaluate a checkpoint in the real-world.
|
|
||||||
#
|
#
|
||||||
# Example of usage for training:
|
# Example of usage for training and inference with `control_robot.py`:
|
||||||
# ```bash
|
# ```bash
|
||||||
# python lerobot/scripts/train.py \
|
# python lerobot/scripts/train.py \
|
||||||
# policy=act_real \
|
# policy=act_aloha_real \
|
||||||
|
# env=aloha_real
|
||||||
|
# ```
|
||||||
|
#
|
||||||
|
# Example of usage for training and inference with [Dora-rs](https://github.com/dora-rs/dora-lerobot):
|
||||||
|
# ```bash
|
||||||
|
# python lerobot/scripts/train.py \
|
||||||
|
# policy=act_aloha_real \
|
||||||
# env=dora_aloha_real
|
# env=dora_aloha_real
|
||||||
# ```
|
# ```
|
||||||
|
|
||||||
@@ -36,10 +42,11 @@ override_dataset_stats:
|
|||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||||
|
|
||||||
training:
|
training:
|
||||||
offline_steps: 100000
|
offline_steps: 80000
|
||||||
online_steps: 0
|
online_steps: 0
|
||||||
eval_freq: -1
|
eval_freq: -1
|
||||||
save_freq: 20000
|
save_freq: 10000
|
||||||
|
log_freq: 100
|
||||||
save_checkpoint: true
|
save_checkpoint: true
|
||||||
|
|
||||||
batch_size: 8
|
batch_size: 8
|
||||||
@@ -62,7 +69,7 @@ policy:
|
|||||||
|
|
||||||
# Input / output structure.
|
# Input / output structure.
|
||||||
n_obs_steps: 1
|
n_obs_steps: 1
|
||||||
chunk_size: 100 # chunk_size
|
chunk_size: 100
|
||||||
n_action_steps: 100
|
n_action_steps: 100
|
||||||
|
|
||||||
input_shapes:
|
input_shapes:
|
||||||
@@ -95,7 +95,7 @@ policy:
|
|||||||
n_vae_encoder_layers: 4
|
n_vae_encoder_layers: 4
|
||||||
|
|
||||||
# Inference.
|
# Inference.
|
||||||
temporal_ensemble_momentum: null
|
temporal_ensemble_coeff: null
|
||||||
|
|
||||||
# Training and loss computation.
|
# Training and loss computation.
|
||||||
dropout: 0.1
|
dropout: 0.1
|
||||||
|
|||||||
@@ -1,43 +1,37 @@
|
|||||||
# @package _global_
|
# @package _global_
|
||||||
|
|
||||||
# Use `act_real_no_state.yaml` to train on real-world Aloha/Aloha2 datasets when cameras are moving (e.g. wrist cameras)
|
# Use `act_koch_real.yaml` to train on real-world datasets collected on Alexander Koch's robots.
|
||||||
# Compared to `act_real.yaml`, it is camera only and does not use the state as input which is vector of robot joint positions.
|
# Compared to `act.yaml`, it contains 2 cameras (i.e. laptop, phone) instead of 1 camera (i.e. top).
|
||||||
# We validated experimentaly that not using state reaches better success rate. Our hypothesis is that `act_real.yaml` might
|
# Also, `training.eval_freq` is set to -1. This config is used to evaluate checkpoints at a certain frequency of training steps.
|
||||||
# overfits to the state, because the images are more complex to learn from since they are moving.
|
# When it is set to -1, it deactivates evaluation. This is because real-world evaluation is done through our `control_robot.py` script.
|
||||||
|
# Look at the documentation in header of `control_robot.py` for more information on how to collect data , train and evaluate a policy.
|
||||||
#
|
#
|
||||||
# Example of usage for training:
|
# Example of usage for training:
|
||||||
# ```bash
|
# ```bash
|
||||||
# python lerobot/scripts/train.py \
|
# python lerobot/scripts/train.py \
|
||||||
# policy=act_real_no_state \
|
# policy=act_koch_real \
|
||||||
# env=dora_aloha_real
|
# env=koch_real
|
||||||
# ```
|
# ```
|
||||||
|
|
||||||
seed: 1000
|
seed: 1000
|
||||||
dataset_repo_id: lerobot/aloha_static_vinh_cup
|
dataset_repo_id: lerobot/moss_pick_place_lego
|
||||||
|
|
||||||
override_dataset_stats:
|
override_dataset_stats:
|
||||||
observation.images.cam_right_wrist:
|
observation.images.laptop:
|
||||||
# stats from imagenet, since we use a pretrained vision model
|
# stats from imagenet, since we use a pretrained vision model
|
||||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||||
observation.images.cam_left_wrist:
|
observation.images.phone:
|
||||||
# stats from imagenet, since we use a pretrained vision model
|
|
||||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
|
||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
|
||||||
observation.images.cam_high:
|
|
||||||
# stats from imagenet, since we use a pretrained vision model
|
|
||||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
|
||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
|
||||||
observation.images.cam_low:
|
|
||||||
# stats from imagenet, since we use a pretrained vision model
|
# stats from imagenet, since we use a pretrained vision model
|
||||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||||
|
|
||||||
training:
|
training:
|
||||||
offline_steps: 100000
|
offline_steps: 80000
|
||||||
online_steps: 0
|
online_steps: 0
|
||||||
eval_freq: -1
|
eval_freq: -1
|
||||||
save_freq: 20000
|
save_freq: 10000
|
||||||
|
log_freq: 100
|
||||||
save_checkpoint: true
|
save_checkpoint: true
|
||||||
|
|
||||||
batch_size: 8
|
batch_size: 8
|
||||||
@@ -60,24 +54,22 @@ policy:
|
|||||||
|
|
||||||
# Input / output structure.
|
# Input / output structure.
|
||||||
n_obs_steps: 1
|
n_obs_steps: 1
|
||||||
chunk_size: 100 # chunk_size
|
chunk_size: 100
|
||||||
n_action_steps: 100
|
n_action_steps: 100
|
||||||
|
|
||||||
input_shapes:
|
input_shapes:
|
||||||
# TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
|
# TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
|
||||||
observation.images.cam_right_wrist: [3, 480, 640]
|
observation.images.laptop: [3, 480, 640]
|
||||||
observation.images.cam_left_wrist: [3, 480, 640]
|
observation.images.phone: [3, 480, 640]
|
||||||
observation.images.cam_high: [3, 480, 640]
|
observation.state: ["${env.state_dim}"]
|
||||||
observation.images.cam_low: [3, 480, 640]
|
|
||||||
output_shapes:
|
output_shapes:
|
||||||
action: ["${env.action_dim}"]
|
action: ["${env.action_dim}"]
|
||||||
|
|
||||||
# Normalization / Unnormalization
|
# Normalization / Unnormalization
|
||||||
input_normalization_modes:
|
input_normalization_modes:
|
||||||
observation.images.cam_right_wrist: mean_std
|
observation.images.laptop: mean_std
|
||||||
observation.images.cam_left_wrist: mean_std
|
observation.images.phone: mean_std
|
||||||
observation.images.cam_high: mean_std
|
observation.state: mean_std
|
||||||
observation.images.cam_low: mean_std
|
|
||||||
output_normalization_modes:
|
output_normalization_modes:
|
||||||
action: mean_std
|
action: mean_std
|
||||||
|
|
||||||
102
lerobot/configs/policy/act_so100_real.yaml
Normal file
102
lerobot/configs/policy/act_so100_real.yaml
Normal file
@@ -0,0 +1,102 @@
|
|||||||
|
# @package _global_
|
||||||
|
|
||||||
|
# Use `act_koch_real.yaml` to train on real-world datasets collected on Alexander Koch's robots.
|
||||||
|
# Compared to `act.yaml`, it contains 2 cameras (i.e. laptop, phone) instead of 1 camera (i.e. top).
|
||||||
|
# Also, `training.eval_freq` is set to -1. This config is used to evaluate checkpoints at a certain frequency of training steps.
|
||||||
|
# When it is set to -1, it deactivates evaluation. This is because real-world evaluation is done through our `control_robot.py` script.
|
||||||
|
# Look at the documentation in header of `control_robot.py` for more information on how to collect data , train and evaluate a policy.
|
||||||
|
#
|
||||||
|
# Example of usage for training:
|
||||||
|
# ```bash
|
||||||
|
# python lerobot/scripts/train.py \
|
||||||
|
# policy=act_koch_real \
|
||||||
|
# env=koch_real
|
||||||
|
# ```
|
||||||
|
|
||||||
|
seed: 1000
|
||||||
|
dataset_repo_id: lerobot/so100_pick_place_lego
|
||||||
|
|
||||||
|
override_dataset_stats:
|
||||||
|
observation.images.laptop:
|
||||||
|
# stats from imagenet, since we use a pretrained vision model
|
||||||
|
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||||
|
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||||
|
observation.images.phone:
|
||||||
|
# stats from imagenet, since we use a pretrained vision model
|
||||||
|
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||||
|
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||||
|
|
||||||
|
training:
|
||||||
|
offline_steps: 80000
|
||||||
|
online_steps: 0
|
||||||
|
eval_freq: -1
|
||||||
|
save_freq: 10000
|
||||||
|
log_freq: 100
|
||||||
|
save_checkpoint: true
|
||||||
|
|
||||||
|
batch_size: 8
|
||||||
|
lr: 1e-5
|
||||||
|
lr_backbone: 1e-5
|
||||||
|
weight_decay: 1e-4
|
||||||
|
grad_clip_norm: 10
|
||||||
|
online_steps_between_rollouts: 1
|
||||||
|
|
||||||
|
delta_timestamps:
|
||||||
|
action: "[i / ${fps} for i in range(${policy.chunk_size})]"
|
||||||
|
|
||||||
|
eval:
|
||||||
|
n_episodes: 50
|
||||||
|
batch_size: 50
|
||||||
|
|
||||||
|
# See `configuration_act.py` for more details.
|
||||||
|
policy:
|
||||||
|
name: act
|
||||||
|
|
||||||
|
# Input / output structure.
|
||||||
|
n_obs_steps: 1
|
||||||
|
chunk_size: 100
|
||||||
|
n_action_steps: 100
|
||||||
|
|
||||||
|
input_shapes:
|
||||||
|
# TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
|
||||||
|
observation.images.laptop: [3, 480, 640]
|
||||||
|
observation.images.phone: [3, 480, 640]
|
||||||
|
observation.state: ["${env.state_dim}"]
|
||||||
|
output_shapes:
|
||||||
|
action: ["${env.action_dim}"]
|
||||||
|
|
||||||
|
# Normalization / Unnormalization
|
||||||
|
input_normalization_modes:
|
||||||
|
observation.images.laptop: mean_std
|
||||||
|
observation.images.phone: mean_std
|
||||||
|
observation.state: mean_std
|
||||||
|
output_normalization_modes:
|
||||||
|
action: mean_std
|
||||||
|
|
||||||
|
# Architecture.
|
||||||
|
# Vision backbone.
|
||||||
|
vision_backbone: resnet18
|
||||||
|
pretrained_backbone_weights: ResNet18_Weights.IMAGENET1K_V1
|
||||||
|
replace_final_stride_with_dilation: false
|
||||||
|
# Transformer layers.
|
||||||
|
pre_norm: false
|
||||||
|
dim_model: 512
|
||||||
|
n_heads: 8
|
||||||
|
dim_feedforward: 3200
|
||||||
|
feedforward_activation: relu
|
||||||
|
n_encoder_layers: 4
|
||||||
|
# Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
|
||||||
|
# that means only the first layer is used. Here we match the original implementation by setting this to 1.
|
||||||
|
# See this issue https://github.com/tonyzhaozh/act/issues/25#issue-2258740521.
|
||||||
|
n_decoder_layers: 1
|
||||||
|
# VAE.
|
||||||
|
use_vae: true
|
||||||
|
latent_dim: 32
|
||||||
|
n_vae_encoder_layers: 4
|
||||||
|
|
||||||
|
# Inference.
|
||||||
|
temporal_ensemble_coeff: null
|
||||||
|
|
||||||
|
# Training and loss computation.
|
||||||
|
dropout: 0.1
|
||||||
|
kl_weight: 10.0
|
||||||
48
lerobot/configs/policy/hilserl_classifier.yaml
Normal file
48
lerobot/configs/policy/hilserl_classifier.yaml
Normal file
@@ -0,0 +1,48 @@
|
|||||||
|
# @package _global_
|
||||||
|
|
||||||
|
defaults:
|
||||||
|
- _self_
|
||||||
|
|
||||||
|
seed: 13
|
||||||
|
dataset_repo_id: "dataset_repo_id"
|
||||||
|
train_split_proportion: 0.8
|
||||||
|
|
||||||
|
# Required by logger
|
||||||
|
env:
|
||||||
|
name: "classifier"
|
||||||
|
task: "binary_classification"
|
||||||
|
|
||||||
|
|
||||||
|
training:
|
||||||
|
num_epochs: 5
|
||||||
|
batch_size: 16
|
||||||
|
learning_rate: 1e-4
|
||||||
|
num_workers: 4
|
||||||
|
grad_clip_norm: 10
|
||||||
|
use_amp: true
|
||||||
|
log_freq: 1
|
||||||
|
eval_freq: 1 # How often to run validation (in epochs)
|
||||||
|
save_freq: 1 # How often to save checkpoints (in epochs)
|
||||||
|
save_checkpoint: true
|
||||||
|
image_key: "observation.images.phone"
|
||||||
|
label_key: "next.reward"
|
||||||
|
|
||||||
|
eval:
|
||||||
|
batch_size: 16
|
||||||
|
num_samples_to_log: 30 # Number of validation samples to log in the table
|
||||||
|
|
||||||
|
policy:
|
||||||
|
name: "hilserl/classifier"
|
||||||
|
model_name: "facebook/convnext-base-224"
|
||||||
|
model_type: "cnn"
|
||||||
|
|
||||||
|
wandb:
|
||||||
|
enable: false
|
||||||
|
project: "classifier-training"
|
||||||
|
entity: "wandb_entity"
|
||||||
|
job_name: "classifier_training_0"
|
||||||
|
disable_artifact: false
|
||||||
|
|
||||||
|
device: "mps"
|
||||||
|
resume: false
|
||||||
|
output_dir: "output"
|
||||||
@@ -12,6 +12,7 @@ training:
|
|||||||
grad_clip_norm: 10.0
|
grad_clip_norm: 10.0
|
||||||
lr: 3e-4
|
lr: 3e-4
|
||||||
|
|
||||||
|
save_freq: 10000
|
||||||
eval_freq: 5000
|
eval_freq: 5000
|
||||||
log_freq: 100
|
log_freq: 100
|
||||||
|
|
||||||
|
|||||||
117
lerobot/configs/robot/aloha.yaml
Normal file
117
lerobot/configs/robot/aloha.yaml
Normal file
@@ -0,0 +1,117 @@
|
|||||||
|
# [Aloha: A Low-Cost Hardware for Bimanual Teleoperation](https://www.trossenrobotics.com/aloha-stationary)
|
||||||
|
# https://aloha-2.github.io
|
||||||
|
|
||||||
|
# Requires installing extras packages
|
||||||
|
# With pip: `pip install -e ".[dynamixel intelrealsense]"`
|
||||||
|
# With poetry: `poetry install --sync --extras "dynamixel intelrealsense"`
|
||||||
|
|
||||||
|
# See [tutorial](https://github.com/huggingface/lerobot/blob/main/examples/9_use_aloha.md)
|
||||||
|
|
||||||
|
|
||||||
|
_target_: lerobot.common.robot_devices.robots.manipulator.ManipulatorRobot
|
||||||
|
robot_type: aloha
|
||||||
|
# Specific to Aloha, LeRobot comes with default calibration files. Assuming the motors have been
|
||||||
|
# properly assembled, no manual calibration step is expected. If you need to run manual calibration,
|
||||||
|
# simply update this path to ".cache/calibration/aloha"
|
||||||
|
calibration_dir: .cache/calibration/aloha_default
|
||||||
|
|
||||||
|
# /!\ FOR SAFETY, READ THIS /!\
|
||||||
|
# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes.
|
||||||
|
# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
|
||||||
|
# the number of motors in your follower arms.
|
||||||
|
# For Aloha, for every goal position request, motor rotations are capped at 5 degrees by default.
|
||||||
|
# When you feel more confident with teleoperation or running the policy, you can extend
|
||||||
|
# this safety limit and even removing it by setting it to `null`.
|
||||||
|
# Also, everything is expected to work safely out-of-the-box, but we highly advise to
|
||||||
|
# first try to teleoperate the grippers only (by commenting out the rest of the motors in this yaml),
|
||||||
|
# then to gradually add more motors (by uncommenting), until you can teleoperate both arms fully
|
||||||
|
max_relative_target: 5
|
||||||
|
|
||||||
|
leader_arms:
|
||||||
|
left:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
|
port: /dev/ttyDXL_leader_left
|
||||||
|
motors: # window_x
|
||||||
|
# name: (index, model)
|
||||||
|
waist: [1, xm430-w350]
|
||||||
|
shoulder: [2, xm430-w350]
|
||||||
|
shoulder_shadow: [3, xm430-w350]
|
||||||
|
elbow: [4, xm430-w350]
|
||||||
|
elbow_shadow: [5, xm430-w350]
|
||||||
|
forearm_roll: [6, xm430-w350]
|
||||||
|
wrist_angle: [7, xm430-w350]
|
||||||
|
wrist_rotate: [8, xl430-w250]
|
||||||
|
gripper: [9, xc430-w150]
|
||||||
|
right:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
|
port: /dev/ttyDXL_leader_right
|
||||||
|
motors: # window_x
|
||||||
|
# name: (index, model)
|
||||||
|
waist: [1, xm430-w350]
|
||||||
|
shoulder: [2, xm430-w350]
|
||||||
|
shoulder_shadow: [3, xm430-w350]
|
||||||
|
elbow: [4, xm430-w350]
|
||||||
|
elbow_shadow: [5, xm430-w350]
|
||||||
|
forearm_roll: [6, xm430-w350]
|
||||||
|
wrist_angle: [7, xm430-w350]
|
||||||
|
wrist_rotate: [8, xl430-w250]
|
||||||
|
gripper: [9, xc430-w150]
|
||||||
|
|
||||||
|
follower_arms:
|
||||||
|
left:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
|
port: /dev/ttyDXL_follower_left
|
||||||
|
motors:
|
||||||
|
# name: [index, model]
|
||||||
|
waist: [1, xm540-w270]
|
||||||
|
shoulder: [2, xm540-w270]
|
||||||
|
shoulder_shadow: [3, xm540-w270]
|
||||||
|
elbow: [4, xm540-w270]
|
||||||
|
elbow_shadow: [5, xm540-w270]
|
||||||
|
forearm_roll: [6, xm540-w270]
|
||||||
|
wrist_angle: [7, xm540-w270]
|
||||||
|
wrist_rotate: [8, xm430-w350]
|
||||||
|
gripper: [9, xm430-w350]
|
||||||
|
right:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
|
port: /dev/ttyDXL_follower_right
|
||||||
|
motors:
|
||||||
|
# name: [index, model]
|
||||||
|
waist: [1, xm540-w270]
|
||||||
|
shoulder: [2, xm540-w270]
|
||||||
|
shoulder_shadow: [3, xm540-w270]
|
||||||
|
elbow: [4, xm540-w270]
|
||||||
|
elbow_shadow: [5, xm540-w270]
|
||||||
|
forearm_roll: [6, xm540-w270]
|
||||||
|
wrist_angle: [7, xm540-w270]
|
||||||
|
wrist_rotate: [8, xm430-w350]
|
||||||
|
gripper: [9, xm430-w350]
|
||||||
|
|
||||||
|
# Troubleshooting: If one of your IntelRealSense cameras freeze during
|
||||||
|
# data recording due to bandwidth limit, you might need to plug the camera
|
||||||
|
# on another USB hub or PCIe card.
|
||||||
|
cameras:
|
||||||
|
cam_high:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.intelrealsense.IntelRealSenseCamera
|
||||||
|
serial_number: 128422271347
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
|
cam_low:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.intelrealsense.IntelRealSenseCamera
|
||||||
|
serial_number: 130322270656
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
|
cam_left_wrist:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.intelrealsense.IntelRealSenseCamera
|
||||||
|
serial_number: 218622272670
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
|
cam_right_wrist:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.intelrealsense.IntelRealSenseCamera
|
||||||
|
serial_number: 130322272300
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
@@ -1,9 +1,16 @@
|
|||||||
_target_: lerobot.common.robot_devices.robots.koch.KochRobot
|
_target_: lerobot.common.robot_devices.robots.manipulator.ManipulatorRobot
|
||||||
calibration_path: .cache/calibration/koch.pkl
|
robot_type: koch
|
||||||
|
calibration_dir: .cache/calibration/koch
|
||||||
|
|
||||||
|
# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes.
|
||||||
|
# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
|
||||||
|
# the number of motors in your follower arms.
|
||||||
|
max_relative_target: null
|
||||||
|
|
||||||
leader_arms:
|
leader_arms:
|
||||||
main:
|
main:
|
||||||
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
port: /dev/tty.usbmodem575E0031751
|
port: /dev/tty.usbmodem58760430441
|
||||||
motors:
|
motors:
|
||||||
# name: (index, model)
|
# name: (index, model)
|
||||||
shoulder_pan: [1, "xl330-m077"]
|
shoulder_pan: [1, "xl330-m077"]
|
||||||
@@ -12,10 +19,11 @@ leader_arms:
|
|||||||
wrist_flex: [4, "xl330-m077"]
|
wrist_flex: [4, "xl330-m077"]
|
||||||
wrist_roll: [5, "xl330-m077"]
|
wrist_roll: [5, "xl330-m077"]
|
||||||
gripper: [6, "xl330-m077"]
|
gripper: [6, "xl330-m077"]
|
||||||
|
|
||||||
follower_arms:
|
follower_arms:
|
||||||
main:
|
main:
|
||||||
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
port: /dev/tty.usbmodem575E0032081
|
port: /dev/tty.usbmodem585A0083391
|
||||||
motors:
|
motors:
|
||||||
# name: (index, model)
|
# name: (index, model)
|
||||||
shoulder_pan: [1, "xl430-w250"]
|
shoulder_pan: [1, "xl430-w250"]
|
||||||
@@ -24,6 +32,7 @@ follower_arms:
|
|||||||
wrist_flex: [4, "xl330-m288"]
|
wrist_flex: [4, "xl330-m288"]
|
||||||
wrist_roll: [5, "xl330-m288"]
|
wrist_roll: [5, "xl330-m288"]
|
||||||
gripper: [6, "xl330-m288"]
|
gripper: [6, "xl330-m288"]
|
||||||
|
|
||||||
cameras:
|
cameras:
|
||||||
laptop:
|
laptop:
|
||||||
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
||||||
@@ -37,3 +46,8 @@ cameras:
|
|||||||
fps: 30
|
fps: 30
|
||||||
width: 640
|
width: 640
|
||||||
height: 480
|
height: 480
|
||||||
|
|
||||||
|
# ~ Koch specific settings ~
|
||||||
|
# Sets the leader arm in torque mode with the gripper motor set to this angle. This makes it possible
|
||||||
|
# to squeeze the gripper and have it spring back to an open position on its own.
|
||||||
|
gripper_open_degree: 35.156
|
||||||
|
|||||||
75
lerobot/configs/robot/koch_bimanual.yaml
Normal file
75
lerobot/configs/robot/koch_bimanual.yaml
Normal file
@@ -0,0 +1,75 @@
|
|||||||
|
_target_: lerobot.common.robot_devices.robots.manipulator.ManipulatorRobot
|
||||||
|
robot_type: koch_bimanual
|
||||||
|
calibration_dir: .cache/calibration/koch_bimanual
|
||||||
|
|
||||||
|
# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes.
|
||||||
|
# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
|
||||||
|
# the number of motors in your follower arms.
|
||||||
|
max_relative_target: null
|
||||||
|
|
||||||
|
leader_arms:
|
||||||
|
left:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
|
port: /dev/tty.usbmodem585A0085511
|
||||||
|
motors:
|
||||||
|
# name: (index, model)
|
||||||
|
shoulder_pan: [1, "xl330-m077"]
|
||||||
|
shoulder_lift: [2, "xl330-m077"]
|
||||||
|
elbow_flex: [3, "xl330-m077"]
|
||||||
|
wrist_flex: [4, "xl330-m077"]
|
||||||
|
wrist_roll: [5, "xl330-m077"]
|
||||||
|
gripper: [6, "xl330-m077"]
|
||||||
|
right:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
|
port: /dev/tty.usbmodem575E0031751
|
||||||
|
motors:
|
||||||
|
# name: (index, model)
|
||||||
|
shoulder_pan: [1, "xl330-m077"]
|
||||||
|
shoulder_lift: [2, "xl330-m077"]
|
||||||
|
elbow_flex: [3, "xl330-m077"]
|
||||||
|
wrist_flex: [4, "xl330-m077"]
|
||||||
|
wrist_roll: [5, "xl330-m077"]
|
||||||
|
gripper: [6, "xl330-m077"]
|
||||||
|
|
||||||
|
follower_arms:
|
||||||
|
left:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
|
port: /dev/tty.usbmodem585A0076891
|
||||||
|
motors:
|
||||||
|
# name: (index, model)
|
||||||
|
shoulder_pan: [1, "xl430-w250"]
|
||||||
|
shoulder_lift: [2, "xl430-w250"]
|
||||||
|
elbow_flex: [3, "xl330-m288"]
|
||||||
|
wrist_flex: [4, "xl330-m288"]
|
||||||
|
wrist_roll: [5, "xl330-m288"]
|
||||||
|
gripper: [6, "xl330-m288"]
|
||||||
|
right:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
||||||
|
port: /dev/tty.usbmodem575E0032081
|
||||||
|
motors:
|
||||||
|
# name: (index, model)
|
||||||
|
shoulder_pan: [1, "xl430-w250"]
|
||||||
|
shoulder_lift: [2, "xl430-w250"]
|
||||||
|
elbow_flex: [3, "xl330-m288"]
|
||||||
|
wrist_flex: [4, "xl330-m288"]
|
||||||
|
wrist_roll: [5, "xl330-m288"]
|
||||||
|
gripper: [6, "xl330-m288"]
|
||||||
|
|
||||||
|
cameras:
|
||||||
|
laptop:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
||||||
|
camera_index: 0
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
|
phone:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
||||||
|
camera_index: 1
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
|
|
||||||
|
# ~ Koch specific settings ~
|
||||||
|
# Sets the leader arm in torque mode with the gripper motor set to this angle. This makes it possible
|
||||||
|
# to squeeze the gripper and have it spring back to an open position on its own.
|
||||||
|
gripper_open_degree: 35.156
|
||||||
56
lerobot/configs/robot/moss.yaml
Normal file
56
lerobot/configs/robot/moss.yaml
Normal file
@@ -0,0 +1,56 @@
|
|||||||
|
# [Moss v1 robot arm](https://github.com/jess-moss/moss-robot-arms)
|
||||||
|
|
||||||
|
# Requires installing extras packages
|
||||||
|
# With pip: `pip install -e ".[feetech]"`
|
||||||
|
# With poetry: `poetry install --sync --extras "feetech"`
|
||||||
|
|
||||||
|
# See [tutorial](https://github.com/huggingface/lerobot/blob/main/examples/11_use_moss.md)
|
||||||
|
|
||||||
|
_target_: lerobot.common.robot_devices.robots.manipulator.ManipulatorRobot
|
||||||
|
robot_type: moss
|
||||||
|
calibration_dir: .cache/calibration/moss
|
||||||
|
|
||||||
|
# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes.
|
||||||
|
# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
|
||||||
|
# the number of motors in your follower arms.
|
||||||
|
max_relative_target: null
|
||||||
|
|
||||||
|
leader_arms:
|
||||||
|
main:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.feetech.FeetechMotorsBus
|
||||||
|
port: /dev/tty.usbmodem58760431091
|
||||||
|
motors:
|
||||||
|
# name: (index, model)
|
||||||
|
shoulder_pan: [1, "sts3215"]
|
||||||
|
shoulder_lift: [2, "sts3215"]
|
||||||
|
elbow_flex: [3, "sts3215"]
|
||||||
|
wrist_flex: [4, "sts3215"]
|
||||||
|
wrist_roll: [5, "sts3215"]
|
||||||
|
gripper: [6, "sts3215"]
|
||||||
|
|
||||||
|
follower_arms:
|
||||||
|
main:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.feetech.FeetechMotorsBus
|
||||||
|
port: /dev/tty.usbmodem58760431191
|
||||||
|
motors:
|
||||||
|
# name: (index, model)
|
||||||
|
shoulder_pan: [1, "sts3215"]
|
||||||
|
shoulder_lift: [2, "sts3215"]
|
||||||
|
elbow_flex: [3, "sts3215"]
|
||||||
|
wrist_flex: [4, "sts3215"]
|
||||||
|
wrist_roll: [5, "sts3215"]
|
||||||
|
gripper: [6, "sts3215"]
|
||||||
|
|
||||||
|
cameras:
|
||||||
|
laptop:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
||||||
|
camera_index: 0
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
|
phone:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
||||||
|
camera_index: 1
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
56
lerobot/configs/robot/so100.yaml
Normal file
56
lerobot/configs/robot/so100.yaml
Normal file
@@ -0,0 +1,56 @@
|
|||||||
|
# [SO-100 robot arm](https://github.com/TheRobotStudio/SO-ARM100)
|
||||||
|
|
||||||
|
# Requires installing extras packages
|
||||||
|
# With pip: `pip install -e ".[feetech]"`
|
||||||
|
# With poetry: `poetry install --sync --extras "feetech"`
|
||||||
|
|
||||||
|
# See [tutorial](https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md)
|
||||||
|
|
||||||
|
_target_: lerobot.common.robot_devices.robots.manipulator.ManipulatorRobot
|
||||||
|
robot_type: so100
|
||||||
|
calibration_dir: .cache/calibration/so100
|
||||||
|
|
||||||
|
# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes.
|
||||||
|
# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
|
||||||
|
# the number of motors in your follower arms.
|
||||||
|
max_relative_target: null
|
||||||
|
|
||||||
|
leader_arms:
|
||||||
|
main:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.feetech.FeetechMotorsBus
|
||||||
|
port: /dev/tty.usbmodem58760433331
|
||||||
|
motors:
|
||||||
|
# name: (index, model)
|
||||||
|
shoulder_pan: [1, "sts3215"]
|
||||||
|
shoulder_lift: [2, "sts3215"]
|
||||||
|
elbow_flex: [3, "sts3215"]
|
||||||
|
wrist_flex: [4, "sts3215"]
|
||||||
|
wrist_roll: [5, "sts3215"]
|
||||||
|
gripper: [6, "sts3215"]
|
||||||
|
|
||||||
|
follower_arms:
|
||||||
|
main:
|
||||||
|
_target_: lerobot.common.robot_devices.motors.feetech.FeetechMotorsBus
|
||||||
|
port: /dev/tty.usbmodem585A0080971
|
||||||
|
motors:
|
||||||
|
# name: (index, model)
|
||||||
|
shoulder_pan: [1, "sts3215"]
|
||||||
|
shoulder_lift: [2, "sts3215"]
|
||||||
|
elbow_flex: [3, "sts3215"]
|
||||||
|
wrist_flex: [4, "sts3215"]
|
||||||
|
wrist_roll: [5, "sts3215"]
|
||||||
|
gripper: [6, "sts3215"]
|
||||||
|
|
||||||
|
cameras:
|
||||||
|
laptop:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
||||||
|
camera_index: 0
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
|
phone:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
||||||
|
camera_index: 1
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
33
lerobot/configs/robot/stretch.yaml
Normal file
33
lerobot/configs/robot/stretch.yaml
Normal file
@@ -0,0 +1,33 @@
|
|||||||
|
# [Stretch3 from Hello Robot](https://hello-robot.com/stretch-3-product)
|
||||||
|
|
||||||
|
# Requires installing extras packages
|
||||||
|
# With pip: `pip install -e ".[stretch]"`
|
||||||
|
# With poetry: `poetry install --sync --extras "stretch"`
|
||||||
|
|
||||||
|
# See [tutorial](https://github.com/huggingface/lerobot/blob/main/examples/8_use_stretch.md)
|
||||||
|
|
||||||
|
|
||||||
|
_target_: lerobot.common.robot_devices.robots.stretch.StretchRobot
|
||||||
|
robot_type: stretch3
|
||||||
|
|
||||||
|
cameras:
|
||||||
|
navigation:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
||||||
|
camera_index: /dev/hello-nav-head-camera
|
||||||
|
fps: 10
|
||||||
|
width: 1280
|
||||||
|
height: 720
|
||||||
|
rotation: -90
|
||||||
|
head:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.intelrealsense.IntelRealSenseCamera.init_from_name
|
||||||
|
name: Intel RealSense D435I
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
|
rotation: 90
|
||||||
|
wrist:
|
||||||
|
_target_: lerobot.common.robot_devices.cameras.intelrealsense.IntelRealSenseCamera.init_from_name
|
||||||
|
name: Intel RealSense D405
|
||||||
|
fps: 30
|
||||||
|
width: 640
|
||||||
|
height: 480
|
||||||
145
lerobot/scripts/configure_motor.py
Normal file
145
lerobot/scripts/configure_motor.py
Normal file
@@ -0,0 +1,145 @@
|
|||||||
|
"""
|
||||||
|
This script configure a single motor at a time to a given ID and baudrate.
|
||||||
|
|
||||||
|
Example of usage:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem585A0080521 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 1
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import time
|
||||||
|
|
||||||
|
|
||||||
|
def configure_motor(port, brand, model, motor_idx_des, baudrate_des):
|
||||||
|
if brand == "feetech":
|
||||||
|
from lerobot.common.robot_devices.motors.feetech import MODEL_BAUDRATE_TABLE
|
||||||
|
from lerobot.common.robot_devices.motors.feetech import (
|
||||||
|
SCS_SERIES_BAUDRATE_TABLE as SERIES_BAUDRATE_TABLE,
|
||||||
|
)
|
||||||
|
from lerobot.common.robot_devices.motors.feetech import FeetechMotorsBus as MotorsBusClass
|
||||||
|
elif brand == "dynamixel":
|
||||||
|
from lerobot.common.robot_devices.motors.dynamixel import MODEL_BAUDRATE_TABLE
|
||||||
|
from lerobot.common.robot_devices.motors.dynamixel import (
|
||||||
|
X_SERIES_BAUDRATE_TABLE as SERIES_BAUDRATE_TABLE,
|
||||||
|
)
|
||||||
|
from lerobot.common.robot_devices.motors.dynamixel import DynamixelMotorsBus as MotorsBusClass
|
||||||
|
else:
|
||||||
|
raise ValueError(
|
||||||
|
f"Currently we do not support this motor brand: {brand}. We currently support feetech and dynamixel motors."
|
||||||
|
)
|
||||||
|
|
||||||
|
# Check if the provided model exists in the model_baud_rate_table
|
||||||
|
if model not in MODEL_BAUDRATE_TABLE:
|
||||||
|
raise ValueError(
|
||||||
|
f"Invalid model '{model}' for brand '{brand}'. Supported models: {list(MODEL_BAUDRATE_TABLE.keys())}"
|
||||||
|
)
|
||||||
|
|
||||||
|
# Setup motor names, indices, and models
|
||||||
|
motor_name = "motor"
|
||||||
|
motor_index_arbitrary = motor_idx_des # Use the motor ID passed via argument
|
||||||
|
motor_model = model # Use the motor model passed via argument
|
||||||
|
|
||||||
|
# Initialize the MotorBus with the correct port and motor configurations
|
||||||
|
motor_bus = MotorsBusClass(port=port, motors={motor_name: (motor_index_arbitrary, motor_model)})
|
||||||
|
|
||||||
|
# Try to connect to the motor bus and handle any connection-specific errors
|
||||||
|
try:
|
||||||
|
motor_bus.connect()
|
||||||
|
print(f"Connected on port {motor_bus.port}")
|
||||||
|
except OSError as e:
|
||||||
|
print(f"Error occurred when connecting to the motor bus: {e}")
|
||||||
|
return
|
||||||
|
|
||||||
|
# Motor bus is connected, proceed with the rest of the operations
|
||||||
|
try:
|
||||||
|
print("Scanning all baudrates and motor indices")
|
||||||
|
all_baudrates = set(SERIES_BAUDRATE_TABLE.values())
|
||||||
|
motor_index = -1 # Set the motor index to an out-of-range value.
|
||||||
|
|
||||||
|
for baudrate in all_baudrates:
|
||||||
|
motor_bus.set_bus_baudrate(baudrate)
|
||||||
|
present_ids = motor_bus.find_motor_indices(list(range(1, 10)))
|
||||||
|
if len(present_ids) > 1:
|
||||||
|
raise ValueError(
|
||||||
|
"Error: More than one motor ID detected. This script is designed to only handle one motor at a time. Please disconnect all but one motor."
|
||||||
|
)
|
||||||
|
|
||||||
|
if len(present_ids) == 1:
|
||||||
|
if motor_index != -1:
|
||||||
|
raise ValueError(
|
||||||
|
"Error: More than one motor ID detected. This script is designed to only handle one motor at a time. Please disconnect all but one motor."
|
||||||
|
)
|
||||||
|
motor_index = present_ids[0]
|
||||||
|
|
||||||
|
if motor_index == -1:
|
||||||
|
raise ValueError("No motors detected. Please ensure you have one motor connected.")
|
||||||
|
|
||||||
|
print(f"Motor index found at: {motor_index}")
|
||||||
|
|
||||||
|
if brand == "feetech":
|
||||||
|
# Allows ID and BAUDRATE to be written in memory
|
||||||
|
motor_bus.write_with_motor_ids(motor_bus.motor_models, motor_index, "Lock", 0)
|
||||||
|
|
||||||
|
if baudrate != baudrate_des:
|
||||||
|
print(f"Setting its baudrate to {baudrate_des}")
|
||||||
|
baudrate_idx = list(SERIES_BAUDRATE_TABLE.values()).index(baudrate_des)
|
||||||
|
|
||||||
|
# The write can fail, so we allow retries
|
||||||
|
motor_bus.write_with_motor_ids(motor_bus.motor_models, motor_index, "Baud_Rate", baudrate_idx)
|
||||||
|
time.sleep(0.5)
|
||||||
|
motor_bus.set_bus_baudrate(baudrate_des)
|
||||||
|
present_baudrate_idx = motor_bus.read_with_motor_ids(
|
||||||
|
motor_bus.motor_models, motor_index, "Baud_Rate", num_retry=2
|
||||||
|
)
|
||||||
|
|
||||||
|
if present_baudrate_idx != baudrate_idx:
|
||||||
|
raise OSError("Failed to write baudrate.")
|
||||||
|
|
||||||
|
print(f"Setting its index to desired index {motor_idx_des}")
|
||||||
|
motor_bus.write_with_motor_ids(motor_bus.motor_models, motor_index, "Lock", 0)
|
||||||
|
motor_bus.write_with_motor_ids(motor_bus.motor_models, motor_index, "ID", motor_idx_des)
|
||||||
|
|
||||||
|
present_idx = motor_bus.read_with_motor_ids(motor_bus.motor_models, motor_idx_des, "ID", num_retry=2)
|
||||||
|
if present_idx != motor_idx_des:
|
||||||
|
raise OSError("Failed to write index.")
|
||||||
|
|
||||||
|
if brand == "feetech":
|
||||||
|
# Set Maximum_Acceleration to 254 to speedup acceleration and deceleration of
|
||||||
|
# the motors. Note: this configuration is not in the official STS3215 Memory Table
|
||||||
|
motor_bus.write("Lock", 0)
|
||||||
|
motor_bus.write("Maximum_Acceleration", 254)
|
||||||
|
|
||||||
|
motor_bus.write("Goal_Position", 2048)
|
||||||
|
time.sleep(4)
|
||||||
|
print("Present Position", motor_bus.read("Present_Position"))
|
||||||
|
|
||||||
|
motor_bus.write("Offset", 0)
|
||||||
|
time.sleep(4)
|
||||||
|
print("Offset", motor_bus.read("Offset"))
|
||||||
|
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error occurred during motor configuration: {e}")
|
||||||
|
|
||||||
|
finally:
|
||||||
|
motor_bus.disconnect()
|
||||||
|
print("Disconnected from motor bus.")
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
parser.add_argument("--port", type=str, required=True, help="Motors bus port (e.g. dynamixel,feetech)")
|
||||||
|
parser.add_argument("--brand", type=str, required=True, help="Motor brand (e.g. dynamixel,feetech)")
|
||||||
|
parser.add_argument("--model", type=str, required=True, help="Motor model (e.g. xl330-m077,sts3215)")
|
||||||
|
parser.add_argument("--ID", type=int, required=True, help="Desired ID of the current motor (e.g. 1,2,3)")
|
||||||
|
parser.add_argument(
|
||||||
|
"--baudrate", type=int, default=1000000, help="Desired baudrate for the motor (default: 1000000)"
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
|
||||||
|
configure_motor(args.port, args.brand, args.model, args.ID, args.baudrate)
|
||||||
File diff suppressed because it is too large
Load Diff
546
lerobot/scripts/control_sim_robot.py
Normal file
546
lerobot/scripts/control_sim_robot.py
Normal file
@@ -0,0 +1,546 @@
|
|||||||
|
"""
|
||||||
|
Utilities to control a robot in simulation.
|
||||||
|
|
||||||
|
Useful to record a dataset, replay a recorded episode and record an evaluation dataset.
|
||||||
|
|
||||||
|
Examples of usage:
|
||||||
|
|
||||||
|
|
||||||
|
- Unlimited teleoperation at a limited frequency of 30 Hz, to simulate data recording frequency.
|
||||||
|
You can modify this value depending on how fast your simulation can run:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--fps 30 \
|
||||||
|
--robot-path lerobot/configs/robot/your_robot_config.yaml \
|
||||||
|
--sim-config lerobot/configs/env/your_sim_config.yaml
|
||||||
|
```
|
||||||
|
|
||||||
|
- Record one episode in order to test replay:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_sim_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/your_robot_config.yaml \
|
||||||
|
--sim-config lerobot/configs/env/your_sim_config.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id $USER/robot_sim_test \
|
||||||
|
--num-episodes 1 \
|
||||||
|
--run-compute-stats 0
|
||||||
|
```
|
||||||
|
|
||||||
|
Enable the --push-to-hub 1 to push the recorded dataset to the huggingface hub.
|
||||||
|
|
||||||
|
- Visualize dataset:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/visualize_dataset.py \
|
||||||
|
--repo-id $USER/robot_sim_test \
|
||||||
|
--episode-index 0
|
||||||
|
```
|
||||||
|
|
||||||
|
- Replay a sequence of test episodes:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_sim_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/your_robot_config.yaml \
|
||||||
|
--sim-config lerobot/configs/env/your_sim_config.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id $USER/robot_sim_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
Note: The seed is saved, therefore, during replay we can load the same environment state as the one during collection.
|
||||||
|
|
||||||
|
- Record a full dataset in order to train a policy,
|
||||||
|
30 seconds of recording for each episode, and 10 seconds to reset the environment in between episodes:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_sim_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/your_robot_config.yaml \
|
||||||
|
--sim-config lerobot/configs/env/your_sim_config.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id $USER/robot_sim_test \
|
||||||
|
--num-episodes 50 \
|
||||||
|
--episode-time-s 30 \
|
||||||
|
```
|
||||||
|
|
||||||
|
**NOTE**: You can use your keyboard to control data recording flow.
|
||||||
|
- Tap right arrow key '->' to early exit while recording an episode and go to reseting the environment.
|
||||||
|
- Tap right arrow key '->' to early exit while reseting the environment and got to recording the next episode.
|
||||||
|
- Tap left arrow key '<-' to early exit and re-record the current episode.
|
||||||
|
- Tap escape key 'esc' to stop the data recording.
|
||||||
|
This might require a sudo permission to allow your terminal to monitor keyboard events.
|
||||||
|
|
||||||
|
**NOTE**: You can resume/continue data recording by running the same data recording command twice.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import importlib
|
||||||
|
import logging
|
||||||
|
import time
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import cv2
|
||||||
|
import gymnasium as gym
|
||||||
|
import numpy as np
|
||||||
|
import torch
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
from lerobot.common.robot_devices.control_utils import (
|
||||||
|
init_keyboard_listener,
|
||||||
|
init_policy,
|
||||||
|
is_headless,
|
||||||
|
log_control_info,
|
||||||
|
predict_action,
|
||||||
|
sanity_check_dataset_name,
|
||||||
|
sanity_check_dataset_robot_compatibility,
|
||||||
|
stop_recording,
|
||||||
|
)
|
||||||
|
from lerobot.common.robot_devices.robots.factory import make_robot
|
||||||
|
from lerobot.common.robot_devices.robots.utils import Robot
|
||||||
|
from lerobot.common.robot_devices.utils import busy_wait
|
||||||
|
from lerobot.common.utils.utils import init_hydra_config, init_logging, log_say
|
||||||
|
|
||||||
|
DEFAULT_FEATURES = {
|
||||||
|
"next.reward": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"next.success": {
|
||||||
|
"dtype": "bool",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"seed": {
|
||||||
|
"dtype": "int64",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"timestamp": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
########################################################################################
|
||||||
|
# Utilities
|
||||||
|
########################################################################################
|
||||||
|
def none_or_int(value):
|
||||||
|
if value == "None":
|
||||||
|
return None
|
||||||
|
return int(value)
|
||||||
|
|
||||||
|
|
||||||
|
def init_sim_calibration(robot, cfg):
|
||||||
|
# Constants necessary for transforming the joint pos of the real robot to the sim
|
||||||
|
# depending on the robot discription used in that sim.
|
||||||
|
start_pos = np.array(robot.leader_arms.main.calibration["start_pos"])
|
||||||
|
axis_directions = np.array(cfg.get("axis_directions", [1]))
|
||||||
|
offsets = np.array(cfg.get("offsets", [0])) * np.pi
|
||||||
|
|
||||||
|
return {"start_pos": start_pos, "axis_directions": axis_directions, "offsets": offsets}
|
||||||
|
|
||||||
|
|
||||||
|
def real_positions_to_sim(real_positions, axis_directions, start_pos, offsets):
|
||||||
|
"""Counts - starting position -> radians -> align axes -> offset"""
|
||||||
|
return axis_directions * (real_positions - start_pos) * 2.0 * np.pi / 4096 + offsets
|
||||||
|
|
||||||
|
|
||||||
|
########################################################################################
|
||||||
|
# Control modes
|
||||||
|
########################################################################################
|
||||||
|
|
||||||
|
|
||||||
|
def teleoperate(env, robot: Robot, process_action_fn, teleop_time_s=None):
|
||||||
|
env = env()
|
||||||
|
env.reset()
|
||||||
|
start_teleop_t = time.perf_counter()
|
||||||
|
while True:
|
||||||
|
leader_pos = robot.leader_arms.main.read("Present_Position")
|
||||||
|
action = process_action_fn(leader_pos)
|
||||||
|
env.step(np.expand_dims(action, 0))
|
||||||
|
if teleop_time_s is not None and time.perf_counter() - start_teleop_t > teleop_time_s:
|
||||||
|
print("Teleoperation processes finished.")
|
||||||
|
break
|
||||||
|
|
||||||
|
|
||||||
|
def record(
|
||||||
|
env,
|
||||||
|
robot: Robot,
|
||||||
|
process_action_from_leader,
|
||||||
|
root: Path,
|
||||||
|
repo_id: str,
|
||||||
|
task: str,
|
||||||
|
fps: int | None = None,
|
||||||
|
tags: list[str] | None = None,
|
||||||
|
pretrained_policy_name_or_path: str = None,
|
||||||
|
policy_overrides: bool | None = None,
|
||||||
|
episode_time_s: int = 30,
|
||||||
|
num_episodes: int = 50,
|
||||||
|
video: bool = True,
|
||||||
|
push_to_hub: bool = True,
|
||||||
|
num_image_writer_processes: int = 0,
|
||||||
|
num_image_writer_threads_per_camera: int = 4,
|
||||||
|
display_cameras: bool = False,
|
||||||
|
play_sounds: bool = True,
|
||||||
|
resume: bool = False,
|
||||||
|
local_files_only: bool = False,
|
||||||
|
run_compute_stats: bool = True,
|
||||||
|
) -> LeRobotDataset:
|
||||||
|
# Load pretrained policy
|
||||||
|
policy = None
|
||||||
|
if pretrained_policy_name_or_path is not None:
|
||||||
|
policy, policy_fps, device, use_amp = init_policy(pretrained_policy_name_or_path, policy_overrides)
|
||||||
|
|
||||||
|
if fps is None:
|
||||||
|
fps = policy_fps
|
||||||
|
logging.warning(f"No fps provided, so using the fps from policy config ({policy_fps}).")
|
||||||
|
|
||||||
|
if policy is None and process_action_from_leader is None:
|
||||||
|
raise ValueError("Either policy or process_action_fn has to be set to enable control in sim.")
|
||||||
|
|
||||||
|
# initialize listener before sim env
|
||||||
|
listener, events = init_keyboard_listener()
|
||||||
|
|
||||||
|
# create sim env
|
||||||
|
env = env()
|
||||||
|
|
||||||
|
# Create empty dataset or load existing saved episodes
|
||||||
|
num_cameras = sum([1 if "image" in key else 0 for key in env.observation_space])
|
||||||
|
|
||||||
|
# get image keys
|
||||||
|
image_keys = [key for key in env.observation_space if "image" in key]
|
||||||
|
state_keys_dict = env_cfg.state_keys
|
||||||
|
|
||||||
|
if resume:
|
||||||
|
dataset = LeRobotDataset(
|
||||||
|
repo_id,
|
||||||
|
root=root,
|
||||||
|
local_files_only=local_files_only,
|
||||||
|
)
|
||||||
|
dataset.start_image_writer(
|
||||||
|
num_processes=num_image_writer_processes,
|
||||||
|
num_threads=num_image_writer_threads_per_camera * num_cameras,
|
||||||
|
)
|
||||||
|
sanity_check_dataset_robot_compatibility(dataset, robot, fps, video)
|
||||||
|
else:
|
||||||
|
features = DEFAULT_FEATURES
|
||||||
|
# add image keys to features
|
||||||
|
for key in image_keys:
|
||||||
|
shape = env.observation_space[key].shape
|
||||||
|
if not key.startswith("observation.image."):
|
||||||
|
key = "observation.image." + key
|
||||||
|
features[key] = {"dtype": "video", "names": ["channel", "height", "width"], "shape": shape}
|
||||||
|
|
||||||
|
for key, obs_key in state_keys_dict.items():
|
||||||
|
features[key] = {
|
||||||
|
"dtype": "float32",
|
||||||
|
"names": None,
|
||||||
|
"shape": env.observation_space[obs_key].shape,
|
||||||
|
}
|
||||||
|
|
||||||
|
features["action"] = {"dtype": "float32", "shape": env.action_space.shape, "names": None}
|
||||||
|
|
||||||
|
# Create empty dataset or load existing saved episodes
|
||||||
|
sanity_check_dataset_name(repo_id, policy)
|
||||||
|
dataset = LeRobotDataset.create(
|
||||||
|
repo_id,
|
||||||
|
fps,
|
||||||
|
root=root,
|
||||||
|
features=features,
|
||||||
|
use_videos=video,
|
||||||
|
image_writer_processes=num_image_writer_processes,
|
||||||
|
image_writer_threads=num_image_writer_threads_per_camera * num_cameras,
|
||||||
|
)
|
||||||
|
|
||||||
|
recorded_episodes = 0
|
||||||
|
while True:
|
||||||
|
log_say(f"Recording episode {dataset.num_episodes}", play_sounds)
|
||||||
|
|
||||||
|
if events is None:
|
||||||
|
events = {"exit_early": False}
|
||||||
|
|
||||||
|
if episode_time_s is None:
|
||||||
|
episode_time_s = float("inf")
|
||||||
|
|
||||||
|
timestamp = 0
|
||||||
|
start_episode_t = time.perf_counter()
|
||||||
|
|
||||||
|
seed = np.random.randint(0, 1e5)
|
||||||
|
observation, info = env.reset(seed=seed)
|
||||||
|
|
||||||
|
while timestamp < episode_time_s:
|
||||||
|
start_loop_t = time.perf_counter()
|
||||||
|
|
||||||
|
if policy is not None:
|
||||||
|
action = predict_action(observation, policy, device, use_amp)
|
||||||
|
else:
|
||||||
|
leader_pos = robot.leader_arms.main.read("Present_Position")
|
||||||
|
action = process_action_from_leader(leader_pos)
|
||||||
|
|
||||||
|
observation, reward, terminated, _, info = env.step(action)
|
||||||
|
|
||||||
|
success = info.get("is_success", False)
|
||||||
|
env_timestamp = info.get("timestamp", dataset.episode_buffer["size"] / fps)
|
||||||
|
|
||||||
|
frame = {
|
||||||
|
"action": torch.from_numpy(action),
|
||||||
|
"next.reward": reward,
|
||||||
|
"next.success": success,
|
||||||
|
"seed": seed,
|
||||||
|
"timestamp": env_timestamp,
|
||||||
|
}
|
||||||
|
|
||||||
|
for key in image_keys:
|
||||||
|
if not key.startswith("observation.image"):
|
||||||
|
frame["observation.image." + key] = observation[key]
|
||||||
|
else:
|
||||||
|
frame[key] = observation[key]
|
||||||
|
|
||||||
|
for key, obs_key in state_keys_dict.items():
|
||||||
|
frame[key] = torch.from_numpy(observation[obs_key])
|
||||||
|
|
||||||
|
dataset.add_frame(frame)
|
||||||
|
|
||||||
|
if display_cameras and not is_headless():
|
||||||
|
for key in image_keys:
|
||||||
|
cv2.imshow(key, cv2.cvtColor(observation[key], cv2.COLOR_RGB2BGR))
|
||||||
|
cv2.waitKey(1)
|
||||||
|
|
||||||
|
if fps is not None:
|
||||||
|
dt_s = time.perf_counter() - start_loop_t
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
dt_s = time.perf_counter() - start_loop_t
|
||||||
|
log_control_info(robot, dt_s, fps=fps)
|
||||||
|
|
||||||
|
timestamp = time.perf_counter() - start_episode_t
|
||||||
|
if events["exit_early"] or terminated:
|
||||||
|
events["exit_early"] = False
|
||||||
|
break
|
||||||
|
|
||||||
|
if events["rerecord_episode"]:
|
||||||
|
log_say("Re-record episode", play_sounds)
|
||||||
|
events["rerecord_episode"] = False
|
||||||
|
events["exit_early"] = False
|
||||||
|
dataset.clear_episode_buffer()
|
||||||
|
continue
|
||||||
|
|
||||||
|
dataset.save_episode(task=task)
|
||||||
|
recorded_episodes += 1
|
||||||
|
|
||||||
|
if events["stop_recording"] or recorded_episodes >= num_episodes:
|
||||||
|
break
|
||||||
|
else:
|
||||||
|
logging.info("Waiting for a few seconds before starting next episode recording...")
|
||||||
|
busy_wait(3)
|
||||||
|
|
||||||
|
log_say("Stop recording", play_sounds, blocking=True)
|
||||||
|
stop_recording(robot, listener, display_cameras)
|
||||||
|
|
||||||
|
if run_compute_stats:
|
||||||
|
logging.info("Computing dataset statistics")
|
||||||
|
dataset.consolidate(run_compute_stats)
|
||||||
|
|
||||||
|
if push_to_hub:
|
||||||
|
dataset.push_to_hub(tags=tags)
|
||||||
|
|
||||||
|
log_say("Exiting", play_sounds)
|
||||||
|
return dataset
|
||||||
|
|
||||||
|
|
||||||
|
def replay(
|
||||||
|
env, root: Path, repo_id: str, episode: int, fps: int | None = None, local_files_only: bool = True
|
||||||
|
):
|
||||||
|
env = env()
|
||||||
|
|
||||||
|
local_dir = Path(root) / repo_id
|
||||||
|
if not local_dir.exists():
|
||||||
|
raise ValueError(local_dir)
|
||||||
|
|
||||||
|
dataset = LeRobotDataset(repo_id, root=root, local_files_only=local_files_only)
|
||||||
|
items = dataset.hf_dataset.select_columns("action")
|
||||||
|
seeds = dataset.hf_dataset.select_columns("seed")["seed"]
|
||||||
|
|
||||||
|
from_idx = dataset.episode_data_index["from"][episode].item()
|
||||||
|
to_idx = dataset.episode_data_index["to"][episode].item()
|
||||||
|
env.reset(seed=seeds[from_idx].item())
|
||||||
|
logging.info("Replaying episode")
|
||||||
|
log_say("Replaying episode", play_sounds=True)
|
||||||
|
for idx in range(from_idx, to_idx):
|
||||||
|
start_episode_t = time.perf_counter()
|
||||||
|
action = items[idx]["action"]
|
||||||
|
env.step(action.unsqueeze(0).numpy())
|
||||||
|
dt_s = time.perf_counter() - start_episode_t
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
subparsers = parser.add_subparsers(dest="mode", required=True)
|
||||||
|
|
||||||
|
# Set common options for all the subparsers
|
||||||
|
base_parser = argparse.ArgumentParser(add_help=False)
|
||||||
|
base_parser.add_argument(
|
||||||
|
"--robot-path",
|
||||||
|
type=str,
|
||||||
|
default="lerobot/configs/robot/koch.yaml",
|
||||||
|
help="Path to robot yaml file used to instantiate the robot using `make_robot` factory function.",
|
||||||
|
)
|
||||||
|
|
||||||
|
base_parser.add_argument(
|
||||||
|
"--sim-config",
|
||||||
|
help="Path to a yaml config you want to use for initializing a sim environment based on gym ",
|
||||||
|
)
|
||||||
|
|
||||||
|
parser_record = subparsers.add_parser("teleoperate", parents=[base_parser])
|
||||||
|
|
||||||
|
parser_record = subparsers.add_parser("record", parents=[base_parser])
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--fps", type=none_or_int, default=None, help="Frames per second (set to None to disable)"
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--root",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help="Root directory where the dataset will be stored locally at '{root}/{repo_id}' (e.g. 'data/hf_username/dataset_name').",
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--repo-id",
|
||||||
|
type=str,
|
||||||
|
default="lerobot/test",
|
||||||
|
help="Dataset identifier. By convention it should match '{hf_username}/{dataset_name}' (e.g. `lerobot/test`).",
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--episode-time-s",
|
||||||
|
type=int,
|
||||||
|
default=60,
|
||||||
|
help="Number of seconds for data recording for each episode.",
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--task",
|
||||||
|
type=str,
|
||||||
|
required=True,
|
||||||
|
help="A description of the task preformed during recording that can be used as a language instruction.",
|
||||||
|
)
|
||||||
|
parser_record.add_argument("--num-episodes", type=int, default=50, help="Number of episodes to record.")
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--run-compute-stats",
|
||||||
|
type=int,
|
||||||
|
default=1,
|
||||||
|
help="By default, run the computation of the data statistics at the end of data collection. Compute intensive and not required to just replay an episode.",
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--push-to-hub",
|
||||||
|
type=int,
|
||||||
|
default=1,
|
||||||
|
help="Upload dataset to Hugging Face hub.",
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--tags",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
help="Add tags to your dataset on the hub.",
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--num-image-writer-processes",
|
||||||
|
type=int,
|
||||||
|
default=0,
|
||||||
|
help=(
|
||||||
|
"Number of subprocesses handling the saving of frames as PNGs. Set to 0 to use threads only; "
|
||||||
|
"set to ≥1 to use subprocesses, each using threads to write images. The best number of processes "
|
||||||
|
"and threads depends on your system. We recommend 4 threads per camera with 0 processes. "
|
||||||
|
"If fps is unstable, adjust the thread count. If still unstable, try using 1 or more subprocesses."
|
||||||
|
),
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--num-image-writer-threads-per-camera",
|
||||||
|
type=int,
|
||||||
|
default=4,
|
||||||
|
help=(
|
||||||
|
"Number of threads writing the frames as png images on disk, per camera. "
|
||||||
|
"Too much threads might cause unstable teleoperation fps due to main thread being blocked. "
|
||||||
|
"Not enough threads might cause low camera fps."
|
||||||
|
),
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--display-cameras",
|
||||||
|
type=int,
|
||||||
|
default=0,
|
||||||
|
help="Visualize image observations with opencv.",
|
||||||
|
)
|
||||||
|
parser_record.add_argument(
|
||||||
|
"--resume",
|
||||||
|
type=int,
|
||||||
|
default=0,
|
||||||
|
help="Resume recording on an existing dataset.",
|
||||||
|
)
|
||||||
|
parser_replay = subparsers.add_parser("replay", parents=[base_parser])
|
||||||
|
parser_replay.add_argument(
|
||||||
|
"--fps", type=none_or_int, default=None, help="Frames per second (set to None to disable)"
|
||||||
|
)
|
||||||
|
parser_replay.add_argument(
|
||||||
|
"--root",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help="Root directory where the dataset will be stored locally (e.g. 'data/hf_username/dataset_name'). By default, stored in cache folder.",
|
||||||
|
)
|
||||||
|
parser_replay.add_argument(
|
||||||
|
"--repo-id",
|
||||||
|
type=str,
|
||||||
|
default="lerobot/test",
|
||||||
|
help="Dataset identifier. By convention it should match '{hf_username}/{dataset_name}' (e.g. `lerobot/test`).",
|
||||||
|
)
|
||||||
|
parser_replay.add_argument("--episode", type=int, default=0, help="Index of the episodes to replay.")
|
||||||
|
|
||||||
|
args = parser.parse_args()
|
||||||
|
|
||||||
|
init_logging()
|
||||||
|
|
||||||
|
control_mode = args.mode
|
||||||
|
robot_path = args.robot_path
|
||||||
|
env_config_path = args.sim_config
|
||||||
|
kwargs = vars(args)
|
||||||
|
del kwargs["mode"]
|
||||||
|
del kwargs["robot_path"]
|
||||||
|
del kwargs["sim_config"]
|
||||||
|
|
||||||
|
# make gym env
|
||||||
|
env_cfg = init_hydra_config(env_config_path)
|
||||||
|
importlib.import_module(f"gym_{env_cfg.env.name}")
|
||||||
|
|
||||||
|
def env_constructor():
|
||||||
|
return gym.make(env_cfg.env.handle, disable_env_checker=True, **env_cfg.env.gym)
|
||||||
|
|
||||||
|
robot = None
|
||||||
|
process_leader_actions_fn = None
|
||||||
|
|
||||||
|
if control_mode in ["teleoperate", "record"]:
|
||||||
|
# make robot
|
||||||
|
robot_overrides = ["~cameras", "~follower_arms"]
|
||||||
|
robot_cfg = init_hydra_config(robot_path, robot_overrides)
|
||||||
|
robot = make_robot(robot_cfg)
|
||||||
|
robot.connect()
|
||||||
|
|
||||||
|
calib_kwgs = init_sim_calibration(robot, env_cfg.calibration)
|
||||||
|
|
||||||
|
def process_leader_actions_fn(action):
|
||||||
|
return real_positions_to_sim(action, **calib_kwgs)
|
||||||
|
|
||||||
|
robot.leader_arms.main.calibration = None
|
||||||
|
|
||||||
|
if control_mode == "teleoperate":
|
||||||
|
teleoperate(env_constructor, robot, process_leader_actions_fn)
|
||||||
|
|
||||||
|
elif control_mode == "record":
|
||||||
|
record(env_constructor, robot, process_leader_actions_fn, **kwargs)
|
||||||
|
|
||||||
|
elif control_mode == "replay":
|
||||||
|
replay(env_constructor, **kwargs)
|
||||||
|
|
||||||
|
else:
|
||||||
|
raise ValueError(
|
||||||
|
f"Invalid control mode: '{control_mode}', only valid modes are teleoperate, record and replay."
|
||||||
|
)
|
||||||
|
|
||||||
|
if robot and robot.is_connected:
|
||||||
|
# Disconnect manually to avoid a "Core dump" during process
|
||||||
|
# termination due to camera threads not properly exiting.
|
||||||
|
robot.disconnect()
|
||||||
@@ -57,7 +57,7 @@ import gymnasium as gym
|
|||||||
import numpy as np
|
import numpy as np
|
||||||
import torch
|
import torch
|
||||||
from huggingface_hub import snapshot_download
|
from huggingface_hub import snapshot_download
|
||||||
from huggingface_hub.utils._errors import RepositoryNotFoundError
|
from huggingface_hub.errors import RepositoryNotFoundError
|
||||||
from huggingface_hub.utils._validators import HFValidationError
|
from huggingface_hub.utils._validators import HFValidationError
|
||||||
from torch import Tensor, nn
|
from torch import Tensor, nn
|
||||||
from tqdm import trange
|
from tqdm import trange
|
||||||
@@ -70,7 +70,13 @@ from lerobot.common.policies.factory import make_policy
|
|||||||
from lerobot.common.policies.policy_protocol import Policy
|
from lerobot.common.policies.policy_protocol import Policy
|
||||||
from lerobot.common.policies.utils import get_device_from_parameters
|
from lerobot.common.policies.utils import get_device_from_parameters
|
||||||
from lerobot.common.utils.io_utils import write_video
|
from lerobot.common.utils.io_utils import write_video
|
||||||
from lerobot.common.utils.utils import get_safe_torch_device, init_hydra_config, init_logging, set_global_seed
|
from lerobot.common.utils.utils import (
|
||||||
|
get_safe_torch_device,
|
||||||
|
init_hydra_config,
|
||||||
|
init_logging,
|
||||||
|
inside_slurm,
|
||||||
|
set_global_seed,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
def rollout(
|
def rollout(
|
||||||
@@ -79,7 +85,6 @@ def rollout(
|
|||||||
seeds: list[int] | None = None,
|
seeds: list[int] | None = None,
|
||||||
return_observations: bool = False,
|
return_observations: bool = False,
|
||||||
render_callback: Callable[[gym.vector.VectorEnv], None] | None = None,
|
render_callback: Callable[[gym.vector.VectorEnv], None] | None = None,
|
||||||
enable_progbar: bool = False,
|
|
||||||
) -> dict:
|
) -> dict:
|
||||||
"""Run a batched policy rollout once through a batch of environments.
|
"""Run a batched policy rollout once through a batch of environments.
|
||||||
|
|
||||||
@@ -109,7 +114,6 @@ def rollout(
|
|||||||
are returned optionally because they typically take more memory to cache. Defaults to False.
|
are returned optionally because they typically take more memory to cache. Defaults to False.
|
||||||
render_callback: Optional rendering callback to be used after the environments are reset, and after
|
render_callback: Optional rendering callback to be used after the environments are reset, and after
|
||||||
every step.
|
every step.
|
||||||
enable_progbar: Enable a progress bar over rollout steps.
|
|
||||||
Returns:
|
Returns:
|
||||||
The dictionary described above.
|
The dictionary described above.
|
||||||
"""
|
"""
|
||||||
@@ -136,7 +140,7 @@ def rollout(
|
|||||||
progbar = trange(
|
progbar = trange(
|
||||||
max_steps,
|
max_steps,
|
||||||
desc=f"Running rollout with at most {max_steps} steps",
|
desc=f"Running rollout with at most {max_steps} steps",
|
||||||
disable=not enable_progbar,
|
disable=inside_slurm(), # we dont want progress bar when we use slurm, since it clutters the logs
|
||||||
leave=False,
|
leave=False,
|
||||||
)
|
)
|
||||||
while not np.all(done):
|
while not np.all(done):
|
||||||
@@ -210,8 +214,6 @@ def eval_policy(
|
|||||||
videos_dir: Path | None = None,
|
videos_dir: Path | None = None,
|
||||||
return_episode_data: bool = False,
|
return_episode_data: bool = False,
|
||||||
start_seed: int | None = None,
|
start_seed: int | None = None,
|
||||||
enable_progbar: bool = False,
|
|
||||||
enable_inner_progbar: bool = False,
|
|
||||||
) -> dict:
|
) -> dict:
|
||||||
"""
|
"""
|
||||||
Args:
|
Args:
|
||||||
@@ -224,8 +226,6 @@ def eval_policy(
|
|||||||
the "episodes" key of the returned dictionary.
|
the "episodes" key of the returned dictionary.
|
||||||
start_seed: The first seed to use for the first individual rollout. For all subsequent rollouts the
|
start_seed: The first seed to use for the first individual rollout. For all subsequent rollouts the
|
||||||
seed is incremented by 1. If not provided, the environments are not manually seeded.
|
seed is incremented by 1. If not provided, the environments are not manually seeded.
|
||||||
enable_progbar: Enable progress bar over batches.
|
|
||||||
enable_inner_progbar: Enable progress bar over steps in each batch.
|
|
||||||
Returns:
|
Returns:
|
||||||
Dictionary with metrics and data regarding the rollouts.
|
Dictionary with metrics and data regarding the rollouts.
|
||||||
"""
|
"""
|
||||||
@@ -266,7 +266,8 @@ def eval_policy(
|
|||||||
if return_episode_data:
|
if return_episode_data:
|
||||||
episode_data: dict | None = None
|
episode_data: dict | None = None
|
||||||
|
|
||||||
progbar = trange(n_batches, desc="Stepping through eval batches", disable=not enable_progbar)
|
# we dont want progress bar when we use slurm, since it clutters the logs
|
||||||
|
progbar = trange(n_batches, desc="Stepping through eval batches", disable=inside_slurm())
|
||||||
for batch_ix in progbar:
|
for batch_ix in progbar:
|
||||||
# Cache frames for rendering videos. Each item will be (b, h, w, c), and the list indexes the rollout
|
# Cache frames for rendering videos. Each item will be (b, h, w, c), and the list indexes the rollout
|
||||||
# step.
|
# step.
|
||||||
@@ -285,7 +286,6 @@ def eval_policy(
|
|||||||
seeds=list(seeds) if seeds else None,
|
seeds=list(seeds) if seeds else None,
|
||||||
return_observations=return_episode_data,
|
return_observations=return_episode_data,
|
||||||
render_callback=render_frame if max_episodes_rendered > 0 else None,
|
render_callback=render_frame if max_episodes_rendered > 0 else None,
|
||||||
enable_progbar=enable_inner_progbar,
|
|
||||||
)
|
)
|
||||||
|
|
||||||
# Figure out where in each rollout sequence the first done condition was encountered (results after
|
# Figure out where in each rollout sequence the first done condition was encountered (results after
|
||||||
@@ -454,6 +454,16 @@ def main(
|
|||||||
else:
|
else:
|
||||||
hydra_cfg = init_hydra_config(hydra_cfg_path, config_overrides)
|
hydra_cfg = init_hydra_config(hydra_cfg_path, config_overrides)
|
||||||
|
|
||||||
|
if hydra_cfg.eval.batch_size > hydra_cfg.eval.n_episodes:
|
||||||
|
raise ValueError(
|
||||||
|
"The eval batch size is greater than the number of eval episodes "
|
||||||
|
f"({hydra_cfg.eval.batch_size} > {hydra_cfg.eval.n_episodes}). As a result, {hydra_cfg.eval.batch_size} "
|
||||||
|
f"eval environments will be instantiated, but only {hydra_cfg.eval.n_episodes} will be used. "
|
||||||
|
"This might significantly slow down evaluation. To fix this, you should update your command "
|
||||||
|
f"to increase the number of episodes to match the batch size (e.g. `eval.n_episodes={hydra_cfg.eval.batch_size}`), "
|
||||||
|
f"or lower the batch size (e.g. `eval.batch_size={hydra_cfg.eval.n_episodes}`)."
|
||||||
|
)
|
||||||
|
|
||||||
if out_dir is None:
|
if out_dir is None:
|
||||||
out_dir = f"outputs/eval/{dt.now().strftime('%Y-%m-%d/%H-%M-%S')}_{hydra_cfg.env.name}_{hydra_cfg.policy.name}"
|
out_dir = f"outputs/eval/{dt.now().strftime('%Y-%m-%d/%H-%M-%S')}_{hydra_cfg.env.name}_{hydra_cfg.policy.name}"
|
||||||
|
|
||||||
@@ -474,7 +484,7 @@ def main(
|
|||||||
policy = make_policy(hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=str(pretrained_policy_path))
|
policy = make_policy(hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=str(pretrained_policy_path))
|
||||||
else:
|
else:
|
||||||
# Note: We need the dataset stats to pass to the policy's normalization modules.
|
# Note: We need the dataset stats to pass to the policy's normalization modules.
|
||||||
policy = make_policy(hydra_cfg=hydra_cfg, dataset_stats=make_dataset(hydra_cfg).stats)
|
policy = make_policy(hydra_cfg=hydra_cfg, dataset_stats=make_dataset(hydra_cfg).meta.stats)
|
||||||
|
|
||||||
assert isinstance(policy, nn.Module)
|
assert isinstance(policy, nn.Module)
|
||||||
policy.eval()
|
policy.eval()
|
||||||
@@ -487,8 +497,6 @@ def main(
|
|||||||
max_episodes_rendered=10,
|
max_episodes_rendered=10,
|
||||||
videos_dir=Path(out_dir) / "videos",
|
videos_dir=Path(out_dir) / "videos",
|
||||||
start_seed=hydra_cfg.seed,
|
start_seed=hydra_cfg.seed,
|
||||||
enable_progbar=True,
|
|
||||||
enable_inner_progbar=True,
|
|
||||||
)
|
)
|
||||||
print(info["aggregated"])
|
print(info["aggregated"])
|
||||||
|
|
||||||
|
|||||||
335
lerobot/scripts/eval_on_robot.py
Normal file
335
lerobot/scripts/eval_on_robot.py
Normal file
@@ -0,0 +1,335 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""Evaluate a policy by running rollouts on the real robot and computing metrics.
|
||||||
|
|
||||||
|
Usage examples: evaluate a checkpoint from the LeRobot training script for 10 episodes.
|
||||||
|
|
||||||
|
```
|
||||||
|
python lerobot/scripts/eval_on_robot.py \
|
||||||
|
-p outputs/train/model/checkpoints/005000/pretrained_model \
|
||||||
|
eval.n_episodes=10
|
||||||
|
```
|
||||||
|
|
||||||
|
**NOTE** (michel-aractingi): This script is incomplete and it is being prepared
|
||||||
|
for running training on the real robot.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import logging
|
||||||
|
import time
|
||||||
|
from copy import deepcopy
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import torch
|
||||||
|
from tqdm import trange
|
||||||
|
|
||||||
|
from lerobot.common.policies.policy_protocol import Policy
|
||||||
|
from lerobot.common.robot_devices.control_utils import busy_wait, is_headless
|
||||||
|
from lerobot.common.robot_devices.robots.factory import Robot, make_robot
|
||||||
|
from lerobot.common.utils.utils import (
|
||||||
|
init_hydra_config,
|
||||||
|
init_logging,
|
||||||
|
log_say,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def rollout(robot: Robot, policy: Policy, fps: int, control_time_s: float = 20, use_amp: bool = True) -> dict:
|
||||||
|
"""Run a batched policy rollout on the real robot.
|
||||||
|
|
||||||
|
The return dictionary contains:
|
||||||
|
"robot": A a dictionary of (batch, sequence + 1, *) tensors mapped to observation
|
||||||
|
keys. NOTE the that this has an extra sequence element relative to the other keys in the
|
||||||
|
dictionary. This is because an extra observation is included for after the environment is
|
||||||
|
terminated or truncated.
|
||||||
|
"action": A (batch, sequence, action_dim) tensor of actions applied based on the observations (not
|
||||||
|
including the last observations).
|
||||||
|
"reward": A (batch, sequence) tensor of rewards received for applying the actions.
|
||||||
|
"success": A (batch, sequence) tensor of success conditions (the only time this can be True is upon
|
||||||
|
environment termination/truncation).
|
||||||
|
"done": A (batch, sequence) tensor of **cumulative** done conditions. For any given batch element,
|
||||||
|
the first True is followed by True's all the way till the end. This can be used for masking
|
||||||
|
extraneous elements from the sequences above.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
robot: The robot class that defines the interface with the real robot.
|
||||||
|
policy: The policy. Must be a PyTorch nn module.
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
The dictionary described above.
|
||||||
|
"""
|
||||||
|
# assert isinstance(policy, nn.Module), "Policy must be a PyTorch nn module."
|
||||||
|
# device = get_device_from_parameters(policy)
|
||||||
|
|
||||||
|
# define keyboard listener
|
||||||
|
listener, events = init_keyboard_listener()
|
||||||
|
|
||||||
|
# Reset the policy. TODO (michel-aractingi) add real policy evaluation once the code is ready.
|
||||||
|
# policy.reset()
|
||||||
|
|
||||||
|
# Get observation from real robot
|
||||||
|
observation = robot.capture_observation()
|
||||||
|
|
||||||
|
# Calculate reward. TODO (michel-aractingi)
|
||||||
|
# in HIL-SERL it will be with a reward classifier
|
||||||
|
reward = calculate_reward(observation)
|
||||||
|
all_observations = []
|
||||||
|
all_actions = []
|
||||||
|
all_rewards = []
|
||||||
|
all_successes = []
|
||||||
|
|
||||||
|
start_episode_t = time.perf_counter()
|
||||||
|
timestamp = 0.0
|
||||||
|
while timestamp < control_time_s:
|
||||||
|
start_loop_t = time.perf_counter()
|
||||||
|
|
||||||
|
all_observations.append(deepcopy(observation))
|
||||||
|
# observation = {key: observation[key].to(device, non_blocking=True) for key in observation}
|
||||||
|
|
||||||
|
# Apply the next action.
|
||||||
|
while events["pause_policy"] and not events["human_intervention_step"]:
|
||||||
|
busy_wait(0.5)
|
||||||
|
|
||||||
|
if events["human_intervention_step"]:
|
||||||
|
# take over the robot's actions
|
||||||
|
observation, action = robot.teleop_step(record_data=True)
|
||||||
|
action = action["action"] # teleop step returns torch tensors but in a dict
|
||||||
|
else:
|
||||||
|
# explore with policy
|
||||||
|
with torch.inference_mode():
|
||||||
|
action = robot.follower_arms["main"].read("Present_Position")
|
||||||
|
action = torch.from_numpy(action)
|
||||||
|
robot.send_action(action)
|
||||||
|
# action = predict_action(observation, policy, device, use_amp)
|
||||||
|
|
||||||
|
observation = robot.capture_observation()
|
||||||
|
# Calculate reward
|
||||||
|
# in HIL-SERL it will be with a reward classifier
|
||||||
|
reward = calculate_reward(observation)
|
||||||
|
|
||||||
|
all_actions.append(action)
|
||||||
|
all_rewards.append(torch.from_numpy(reward))
|
||||||
|
all_successes.append(torch.tensor([False]))
|
||||||
|
|
||||||
|
dt_s = time.perf_counter() - start_loop_t
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
timestamp = time.perf_counter() - start_episode_t
|
||||||
|
if events["exit_early"]:
|
||||||
|
events["exit_early"] = False
|
||||||
|
events["human_intervention_step"] = False
|
||||||
|
events["pause_policy"] = False
|
||||||
|
break
|
||||||
|
all_observations.append(deepcopy(observation))
|
||||||
|
|
||||||
|
dones = torch.tensor([False] * len(all_actions))
|
||||||
|
dones[-1] = True
|
||||||
|
# Stack the sequence along the first dimension so that we have (batch, sequence, *) tensors.
|
||||||
|
ret = {
|
||||||
|
"action": torch.stack(all_actions, dim=1),
|
||||||
|
"next.reward": torch.stack(all_rewards, dim=1),
|
||||||
|
"next.success": torch.stack(all_successes, dim=1),
|
||||||
|
"done": dones,
|
||||||
|
}
|
||||||
|
stacked_observations = {}
|
||||||
|
for key in all_observations[0]:
|
||||||
|
stacked_observations[key] = torch.stack([obs[key] for obs in all_observations], dim=1)
|
||||||
|
ret["observation"] = stacked_observations
|
||||||
|
|
||||||
|
listener.stop()
|
||||||
|
|
||||||
|
return ret
|
||||||
|
|
||||||
|
|
||||||
|
def eval_policy(
|
||||||
|
robot: Robot,
|
||||||
|
policy: torch.nn.Module,
|
||||||
|
fps: float,
|
||||||
|
n_episodes: int,
|
||||||
|
control_time_s: int = 20,
|
||||||
|
use_amp: bool = True,
|
||||||
|
) -> dict:
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
env: The batch of environments.
|
||||||
|
policy: The policy.
|
||||||
|
n_episodes: The number of episodes to evaluate.
|
||||||
|
Returns:
|
||||||
|
Dictionary with metrics and data regarding the rollouts.
|
||||||
|
"""
|
||||||
|
# TODO (michel-aractingi) comment this out for testing with a fixed policy
|
||||||
|
# assert isinstance(policy, Policy)
|
||||||
|
# policy.eval()
|
||||||
|
|
||||||
|
sum_rewards = []
|
||||||
|
max_rewards = []
|
||||||
|
successes = []
|
||||||
|
rollouts = []
|
||||||
|
|
||||||
|
start_eval = time.perf_counter()
|
||||||
|
progbar = trange(n_episodes, desc="Evaluating policy on real robot")
|
||||||
|
for _batch_idx in progbar:
|
||||||
|
rollout_data = rollout(robot, policy, fps, control_time_s, use_amp)
|
||||||
|
|
||||||
|
rollouts.append(rollout_data)
|
||||||
|
sum_rewards.append(sum(rollout_data["next.reward"]))
|
||||||
|
max_rewards.append(max(rollout_data["next.reward"]))
|
||||||
|
successes.append(rollout_data["next.success"][-1])
|
||||||
|
|
||||||
|
info = {
|
||||||
|
"per_episode": [
|
||||||
|
{
|
||||||
|
"episode_ix": i,
|
||||||
|
"sum_reward": sum_reward,
|
||||||
|
"max_reward": max_reward,
|
||||||
|
"pc_success": success * 100,
|
||||||
|
}
|
||||||
|
for i, (sum_reward, max_reward, success) in enumerate(
|
||||||
|
zip(
|
||||||
|
sum_rewards[:n_episodes],
|
||||||
|
max_rewards[:n_episodes],
|
||||||
|
successes[:n_episodes],
|
||||||
|
strict=False,
|
||||||
|
)
|
||||||
|
)
|
||||||
|
],
|
||||||
|
"aggregated": {
|
||||||
|
"avg_sum_reward": float(np.nanmean(torch.cat(sum_rewards[:n_episodes]))),
|
||||||
|
"avg_max_reward": float(np.nanmean(torch.cat(max_rewards[:n_episodes]))),
|
||||||
|
"pc_success": float(np.nanmean(torch.cat(successes[:n_episodes])) * 100),
|
||||||
|
"eval_s": time.time() - start_eval,
|
||||||
|
"eval_ep_s": (time.time() - start_eval) / n_episodes,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
if robot.is_connected:
|
||||||
|
robot.disconnect()
|
||||||
|
|
||||||
|
return info
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_reward(observation):
|
||||||
|
"""
|
||||||
|
Method to calculate reward function in some way.
|
||||||
|
In HIL-SERL this is done through defining a reward classifier
|
||||||
|
"""
|
||||||
|
# reward = reward_classifier(observation)
|
||||||
|
return np.array([0.0])
|
||||||
|
|
||||||
|
|
||||||
|
def init_keyboard_listener():
|
||||||
|
# Allow to exit early while recording an episode or resetting the environment,
|
||||||
|
# by tapping the right arrow key '->'. This might require a sudo permission
|
||||||
|
# to allow your terminal to monitor keyboard events.
|
||||||
|
events = {}
|
||||||
|
events["exit_early"] = False
|
||||||
|
events["rerecord_episode"] = False
|
||||||
|
events["pause_policy"] = False
|
||||||
|
events["human_intervention_step"] = False
|
||||||
|
|
||||||
|
if is_headless():
|
||||||
|
logging.warning(
|
||||||
|
"Headless environment detected. On-screen cameras display and keyboard inputs will not be available."
|
||||||
|
)
|
||||||
|
listener = None
|
||||||
|
return listener, events
|
||||||
|
|
||||||
|
# Only import pynput if not in a headless environment
|
||||||
|
from pynput import keyboard
|
||||||
|
|
||||||
|
def on_press(key):
|
||||||
|
try:
|
||||||
|
if key == keyboard.Key.right:
|
||||||
|
print("Right arrow key pressed. Exiting loop...")
|
||||||
|
events["exit_early"] = True
|
||||||
|
elif key == keyboard.Key.left:
|
||||||
|
print("Left arrow key pressed. Exiting loop and rerecord the last episode...")
|
||||||
|
events["rerecord_episode"] = True
|
||||||
|
events["exit_early"] = True
|
||||||
|
elif key == keyboard.Key.space:
|
||||||
|
# check if first space press then pause the policy for the user to get ready
|
||||||
|
# if second space press then the user is ready to start intervention
|
||||||
|
if not events["pause_policy"]:
|
||||||
|
print(
|
||||||
|
"Space key pressed. Human intervention required.\n"
|
||||||
|
"Place the leader in similar pose to the follower and press space again."
|
||||||
|
)
|
||||||
|
events["pause_policy"] = True
|
||||||
|
log_say("Human intervention stage. Get ready to take over.", play_sounds=True)
|
||||||
|
else:
|
||||||
|
events["human_intervention_step"] = True
|
||||||
|
print("Space key pressed. Human intervention starting.")
|
||||||
|
log_say("Starting human intervention.", play_sounds=True)
|
||||||
|
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error handling key press: {e}")
|
||||||
|
|
||||||
|
listener = keyboard.Listener(on_press=on_press)
|
||||||
|
listener.start()
|
||||||
|
|
||||||
|
return listener, events
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
init_logging()
|
||||||
|
|
||||||
|
parser = argparse.ArgumentParser(
|
||||||
|
description=__doc__, formatter_class=argparse.RawDescriptionHelpFormatter
|
||||||
|
)
|
||||||
|
group = parser.add_mutually_exclusive_group(required=True)
|
||||||
|
group.add_argument(
|
||||||
|
"--robot-path",
|
||||||
|
type=str,
|
||||||
|
default="lerobot/configs/robot/koch.yaml",
|
||||||
|
help="Path to robot yaml file used to instantiate the robot using `make_robot` factory function.",
|
||||||
|
)
|
||||||
|
group.add_argument(
|
||||||
|
"--robot-overrides",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
help="Any key=value arguments to override config values (use dots for.nested=overrides)",
|
||||||
|
)
|
||||||
|
group.add_argument(
|
||||||
|
"-p",
|
||||||
|
"--pretrained-policy-name-or-path",
|
||||||
|
help=(
|
||||||
|
"Either the repo ID of a model hosted on the Hub or a path to a directory containing weights "
|
||||||
|
"saved using `Policy.save_pretrained`. If not provided, the policy is initialized from scratch "
|
||||||
|
"(useful for debugging). This argument is mutually exclusive with `--config`."
|
||||||
|
),
|
||||||
|
)
|
||||||
|
group.add_argument(
|
||||||
|
"--config",
|
||||||
|
help=(
|
||||||
|
"Path to a yaml config you want to use for initializing a policy from scratch (useful for "
|
||||||
|
"debugging). This argument is mutually exclusive with `--pretrained-policy-name-or-path` (`-p`)."
|
||||||
|
),
|
||||||
|
)
|
||||||
|
parser.add_argument("--revision", help="Optionally provide the Hugging Face Hub revision ID.")
|
||||||
|
parser.add_argument(
|
||||||
|
"--out-dir",
|
||||||
|
help=(
|
||||||
|
"Where to save the evaluation outputs. If not provided, outputs are saved in "
|
||||||
|
"outputs/eval/{timestamp}_{env_name}_{policy_name}"
|
||||||
|
),
|
||||||
|
)
|
||||||
|
|
||||||
|
args = parser.parse_args()
|
||||||
|
|
||||||
|
robot_cfg = init_hydra_config(args.robot_path, args.robot_overrides)
|
||||||
|
robot = make_robot(robot_cfg)
|
||||||
|
if not robot.is_connected:
|
||||||
|
robot.connect()
|
||||||
|
|
||||||
|
eval_policy(robot, None, fps=40, n_episodes=2, control_time_s=100)
|
||||||
42
lerobot/scripts/find_motors_bus_port.py
Normal file
42
lerobot/scripts/find_motors_bus_port.py
Normal file
@@ -0,0 +1,42 @@
|
|||||||
|
import os
|
||||||
|
import time
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
from serial.tools import list_ports # Part of pyserial library
|
||||||
|
|
||||||
|
|
||||||
|
def find_available_ports():
|
||||||
|
if os.name == "nt": # Windows
|
||||||
|
# List COM ports using pyserial
|
||||||
|
ports = [port.device for port in list_ports.comports()]
|
||||||
|
else: # Linux/macOS
|
||||||
|
# List /dev/tty* ports for Unix-based systems
|
||||||
|
ports = [str(path) for path in Path("/dev").glob("tty*")]
|
||||||
|
return ports
|
||||||
|
|
||||||
|
|
||||||
|
def find_port():
|
||||||
|
print("Finding all available ports for the MotorsBus.")
|
||||||
|
ports_before = find_available_ports()
|
||||||
|
print("Ports before disconnecting:", ports_before)
|
||||||
|
|
||||||
|
print("Remove the USB cable from your MotorsBus and press Enter when done.")
|
||||||
|
input() # Wait for user to disconnect the device
|
||||||
|
|
||||||
|
time.sleep(0.5) # Allow some time for port to be released
|
||||||
|
ports_after = find_available_ports()
|
||||||
|
ports_diff = list(set(ports_before) - set(ports_after))
|
||||||
|
|
||||||
|
if len(ports_diff) == 1:
|
||||||
|
port = ports_diff[0]
|
||||||
|
print(f"The port of this MotorsBus is '{port}'")
|
||||||
|
print("Reconnect the USB cable.")
|
||||||
|
elif len(ports_diff) == 0:
|
||||||
|
raise OSError(f"Could not detect the port. No difference was found ({ports_diff}).")
|
||||||
|
else:
|
||||||
|
raise OSError(f"Could not detect the port. More than one port was found ({ports_diff}).")
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
# Helper to find the USB port associated with your MotorsBus.
|
||||||
|
find_port()
|
||||||
@@ -66,6 +66,8 @@ def get_from_raw_to_lerobot_format_fn(raw_format: str):
|
|||||||
from lerobot.common.datasets.push_dataset_to_hub.umi_zarr_format import from_raw_to_lerobot_format
|
from lerobot.common.datasets.push_dataset_to_hub.umi_zarr_format import from_raw_to_lerobot_format
|
||||||
elif raw_format == "aloha_hdf5":
|
elif raw_format == "aloha_hdf5":
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.aloha_hdf5_format import from_raw_to_lerobot_format
|
from lerobot.common.datasets.push_dataset_to_hub.aloha_hdf5_format import from_raw_to_lerobot_format
|
||||||
|
elif raw_format in ["rlds", "openx"]:
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.openx_rlds_format import from_raw_to_lerobot_format
|
||||||
elif raw_format == "dora_parquet":
|
elif raw_format == "dora_parquet":
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.dora_parquet_format import from_raw_to_lerobot_format
|
from lerobot.common.datasets.push_dataset_to_hub.dora_parquet_format import from_raw_to_lerobot_format
|
||||||
elif raw_format == "xarm_pkl":
|
elif raw_format == "xarm_pkl":
|
||||||
@@ -115,10 +117,14 @@ def push_meta_data_to_hub(repo_id: str, meta_data_dir: str | Path, revision: str
|
|||||||
|
|
||||||
|
|
||||||
def push_dataset_card_to_hub(
|
def push_dataset_card_to_hub(
|
||||||
repo_id: str, revision: str | None, tags: list | None = None, text: str | None = None
|
repo_id: str,
|
||||||
|
revision: str | None,
|
||||||
|
tags: list | None = None,
|
||||||
|
license: str = "apache-2.0",
|
||||||
|
**card_kwargs,
|
||||||
):
|
):
|
||||||
"""Creates and pushes a LeRobotDataset Card with appropriate tags to easily find it on the hub."""
|
"""Creates and pushes a LeRobotDataset Card with appropriate tags to easily find it on the hub."""
|
||||||
card = create_lerobot_dataset_card(tags=tags, text=text)
|
card = create_lerobot_dataset_card(tags=tags, license=license, **card_kwargs)
|
||||||
card.push_to_hub(repo_id=repo_id, repo_type="dataset", revision=revision)
|
card.push_to_hub(repo_id=repo_id, repo_type="dataset", revision=revision)
|
||||||
|
|
||||||
|
|
||||||
@@ -197,8 +203,14 @@ def push_dataset_to_hub(
|
|||||||
|
|
||||||
# convert dataset from original raw format to LeRobot format
|
# convert dataset from original raw format to LeRobot format
|
||||||
from_raw_to_lerobot_format = get_from_raw_to_lerobot_format_fn(raw_format)
|
from_raw_to_lerobot_format = get_from_raw_to_lerobot_format_fn(raw_format)
|
||||||
|
|
||||||
hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(
|
hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(
|
||||||
raw_dir, videos_dir, fps, video, episodes, encoding
|
raw_dir,
|
||||||
|
videos_dir,
|
||||||
|
fps,
|
||||||
|
video,
|
||||||
|
episodes,
|
||||||
|
encoding,
|
||||||
)
|
)
|
||||||
|
|
||||||
lerobot_dataset = LeRobotDataset.from_preloaded(
|
lerobot_dataset = LeRobotDataset.from_preloaded(
|
||||||
@@ -242,7 +254,7 @@ def push_dataset_to_hub(
|
|||||||
episode_index = 0
|
episode_index = 0
|
||||||
tests_videos_dir = tests_data_dir / repo_id / "videos"
|
tests_videos_dir = tests_data_dir / repo_id / "videos"
|
||||||
tests_videos_dir.mkdir(parents=True, exist_ok=True)
|
tests_videos_dir.mkdir(parents=True, exist_ok=True)
|
||||||
for key in lerobot_dataset.video_frame_keys:
|
for key in lerobot_dataset.camera_keys:
|
||||||
fname = f"{key}_episode_{episode_index:06d}.mp4"
|
fname = f"{key}_episode_{episode_index:06d}.mp4"
|
||||||
shutil.copy(videos_dir / fname, tests_videos_dir / fname)
|
shutil.copy(videos_dir / fname, tests_videos_dir / fname)
|
||||||
|
|
||||||
@@ -268,7 +280,7 @@ def main():
|
|||||||
"--raw-format",
|
"--raw-format",
|
||||||
type=str,
|
type=str,
|
||||||
required=True,
|
required=True,
|
||||||
help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`).",
|
help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`, `rlds`, `openx`).",
|
||||||
)
|
)
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
"--repo-id",
|
"--repo-id",
|
||||||
@@ -328,6 +340,13 @@ def main():
|
|||||||
default=0,
|
default=0,
|
||||||
help="When set to 1, resumes a previous run.",
|
help="When set to 1, resumes a previous run.",
|
||||||
)
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--cache-dir",
|
||||||
|
type=Path,
|
||||||
|
required=False,
|
||||||
|
default="/tmp",
|
||||||
|
help="Directory to store the temporary videos and images generated while creating the dataset.",
|
||||||
|
)
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
"--tests-data-dir",
|
"--tests-data-dir",
|
||||||
type=Path,
|
type=Path,
|
||||||
|
|||||||
@@ -171,9 +171,9 @@ def log_train_info(logger: Logger, info, step, cfg, dataset, is_online):
|
|||||||
# A sample is an (observation,action) pair, where observation and action
|
# A sample is an (observation,action) pair, where observation and action
|
||||||
# can be on multiple timestamps. In a batch, we have `batch_size`` number of samples.
|
# can be on multiple timestamps. In a batch, we have `batch_size`` number of samples.
|
||||||
num_samples = (step + 1) * cfg.training.batch_size
|
num_samples = (step + 1) * cfg.training.batch_size
|
||||||
avg_samples_per_ep = dataset.num_samples / dataset.num_episodes
|
avg_samples_per_ep = dataset.num_frames / dataset.num_episodes
|
||||||
num_episodes = num_samples / avg_samples_per_ep
|
num_episodes = num_samples / avg_samples_per_ep
|
||||||
num_epochs = num_samples / dataset.num_samples
|
num_epochs = num_samples / dataset.num_frames
|
||||||
log_items = [
|
log_items = [
|
||||||
f"step:{format_big_number(step)}",
|
f"step:{format_big_number(step)}",
|
||||||
# number of samples seen during training
|
# number of samples seen during training
|
||||||
@@ -208,9 +208,9 @@ def log_eval_info(logger, info, step, cfg, dataset, is_online):
|
|||||||
# A sample is an (observation,action) pair, where observation and action
|
# A sample is an (observation,action) pair, where observation and action
|
||||||
# can be on multiple timestamps. In a batch, we have `batch_size`` number of samples.
|
# can be on multiple timestamps. In a batch, we have `batch_size`` number of samples.
|
||||||
num_samples = (step + 1) * cfg.training.batch_size
|
num_samples = (step + 1) * cfg.training.batch_size
|
||||||
avg_samples_per_ep = dataset.num_samples / dataset.num_episodes
|
avg_samples_per_ep = dataset.num_frames / dataset.num_episodes
|
||||||
num_episodes = num_samples / avg_samples_per_ep
|
num_episodes = num_samples / avg_samples_per_ep
|
||||||
num_epochs = num_samples / dataset.num_samples
|
num_epochs = num_samples / dataset.num_frames
|
||||||
log_items = [
|
log_items = [
|
||||||
f"step:{format_big_number(step)}",
|
f"step:{format_big_number(step)}",
|
||||||
# number of samples seen during training
|
# number of samples seen during training
|
||||||
@@ -241,6 +241,7 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
|||||||
raise NotImplementedError()
|
raise NotImplementedError()
|
||||||
|
|
||||||
init_logging()
|
init_logging()
|
||||||
|
logging.info(pformat(OmegaConf.to_container(cfg)))
|
||||||
|
|
||||||
if cfg.training.online_steps > 0 and isinstance(cfg.dataset_repo_id, ListConfig):
|
if cfg.training.online_steps > 0 and isinstance(cfg.dataset_repo_id, ListConfig):
|
||||||
raise NotImplementedError("Online training with LeRobotMultiDataset is not implemented.")
|
raise NotImplementedError("Online training with LeRobotMultiDataset is not implemented.")
|
||||||
@@ -287,6 +288,16 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
|||||||
"you meant to resume training, please use `resume=true` in your command or yaml configuration."
|
"you meant to resume training, please use `resume=true` in your command or yaml configuration."
|
||||||
)
|
)
|
||||||
|
|
||||||
|
if cfg.eval.batch_size > cfg.eval.n_episodes:
|
||||||
|
raise ValueError(
|
||||||
|
"The eval batch size is greater than the number of eval episodes "
|
||||||
|
f"({cfg.eval.batch_size} > {cfg.eval.n_episodes}). As a result, {cfg.eval.batch_size} "
|
||||||
|
f"eval environments will be instantiated, but only {cfg.eval.n_episodes} will be used. "
|
||||||
|
"This might significantly slow down evaluation. To fix this, you should update your command "
|
||||||
|
f"to increase the number of episodes to match the batch size (e.g. `eval.n_episodes={cfg.eval.batch_size}`), "
|
||||||
|
f"or lower the batch size (e.g. `eval.batch_size={cfg.eval.n_episodes}`)."
|
||||||
|
)
|
||||||
|
|
||||||
# log metrics to terminal and wandb
|
# log metrics to terminal and wandb
|
||||||
logger = Logger(cfg, out_dir, wandb_job_name=job_name)
|
logger = Logger(cfg, out_dir, wandb_job_name=job_name)
|
||||||
|
|
||||||
@@ -317,7 +328,7 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
|||||||
logging.info("make_policy")
|
logging.info("make_policy")
|
||||||
policy = make_policy(
|
policy = make_policy(
|
||||||
hydra_cfg=cfg,
|
hydra_cfg=cfg,
|
||||||
dataset_stats=offline_dataset.stats if not cfg.resume else None,
|
dataset_stats=offline_dataset.meta.stats if not cfg.resume else None,
|
||||||
pretrained_policy_name_or_path=str(logger.last_pretrained_model_dir) if cfg.resume else None,
|
pretrained_policy_name_or_path=str(logger.last_pretrained_model_dir) if cfg.resume else None,
|
||||||
)
|
)
|
||||||
assert isinstance(policy, nn.Module)
|
assert isinstance(policy, nn.Module)
|
||||||
@@ -338,7 +349,7 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
|||||||
logging.info(f"{cfg.env.task=}")
|
logging.info(f"{cfg.env.task=}")
|
||||||
logging.info(f"{cfg.training.offline_steps=} ({format_big_number(cfg.training.offline_steps)})")
|
logging.info(f"{cfg.training.offline_steps=} ({format_big_number(cfg.training.offline_steps)})")
|
||||||
logging.info(f"{cfg.training.online_steps=}")
|
logging.info(f"{cfg.training.online_steps=}")
|
||||||
logging.info(f"{offline_dataset.num_samples=} ({format_big_number(offline_dataset.num_samples)})")
|
logging.info(f"{offline_dataset.num_frames=} ({format_big_number(offline_dataset.num_frames)})")
|
||||||
logging.info(f"{offline_dataset.num_episodes=}")
|
logging.info(f"{offline_dataset.num_episodes=}")
|
||||||
logging.info(f"{num_learnable_params=} ({format_big_number(num_learnable_params)})")
|
logging.info(f"{num_learnable_params=} ({format_big_number(num_learnable_params)})")
|
||||||
logging.info(f"{num_total_params=} ({format_big_number(num_total_params)})")
|
logging.info(f"{num_total_params=} ({format_big_number(num_total_params)})")
|
||||||
@@ -372,7 +383,7 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
|||||||
logging.info(f"Checkpoint policy after step {step}")
|
logging.info(f"Checkpoint policy after step {step}")
|
||||||
# Note: Save with step as the identifier, and format it to have at least 6 digits but more if
|
# Note: Save with step as the identifier, and format it to have at least 6 digits but more if
|
||||||
# needed (choose 6 as a minimum for consistency without being overkill).
|
# needed (choose 6 as a minimum for consistency without being overkill).
|
||||||
logger.save_checkpont(
|
logger.save_checkpoint(
|
||||||
step,
|
step,
|
||||||
policy,
|
policy,
|
||||||
optimizer,
|
optimizer,
|
||||||
@@ -562,7 +573,7 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
|||||||
online_drop_n_last_frames=cfg.training.get("drop_n_last_frames", 0) + 1,
|
online_drop_n_last_frames=cfg.training.get("drop_n_last_frames", 0) + 1,
|
||||||
online_sampling_ratio=cfg.training.online_sampling_ratio,
|
online_sampling_ratio=cfg.training.online_sampling_ratio,
|
||||||
)
|
)
|
||||||
sampler.num_samples = len(concat_dataset)
|
sampler.num_frames = len(concat_dataset)
|
||||||
|
|
||||||
update_online_buffer_s = time.perf_counter() - start_update_buffer_time
|
update_online_buffer_s = time.perf_counter() - start_update_buffer_time
|
||||||
|
|
||||||
|
|||||||
310
lerobot/scripts/train_hilserl_classifier.py
Normal file
310
lerobot/scripts/train_hilserl_classifier.py
Normal file
@@ -0,0 +1,310 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
import logging
|
||||||
|
import time
|
||||||
|
from contextlib import nullcontext
|
||||||
|
from pathlib import Path
|
||||||
|
from pprint import pformat
|
||||||
|
|
||||||
|
import hydra
|
||||||
|
import torch
|
||||||
|
import torch.nn as nn
|
||||||
|
import wandb
|
||||||
|
from deepdiff import DeepDiff
|
||||||
|
from omegaconf import DictConfig, OmegaConf
|
||||||
|
from termcolor import colored
|
||||||
|
from torch import optim
|
||||||
|
from torch.cuda.amp import GradScaler
|
||||||
|
from torch.utils.data import DataLoader, WeightedRandomSampler, random_split
|
||||||
|
from tqdm import tqdm
|
||||||
|
|
||||||
|
from lerobot.common.datasets.factory import resolve_delta_timestamps
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
from lerobot.common.logger import Logger
|
||||||
|
from lerobot.common.policies.factory import _policy_cfg_from_hydra_cfg
|
||||||
|
from lerobot.common.policies.hilserl.classifier.configuration_classifier import ClassifierConfig
|
||||||
|
from lerobot.common.policies.hilserl.classifier.modeling_classifier import Classifier
|
||||||
|
from lerobot.common.utils.utils import (
|
||||||
|
format_big_number,
|
||||||
|
get_safe_torch_device,
|
||||||
|
init_hydra_config,
|
||||||
|
set_global_seed,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def get_model(cfg, logger):
|
||||||
|
classifier_config = _policy_cfg_from_hydra_cfg(ClassifierConfig, cfg)
|
||||||
|
model = Classifier(classifier_config)
|
||||||
|
if cfg.resume:
|
||||||
|
model.load_state_dict(Classifier.from_pretrained(str(logger.last_pretrained_model_dir)).state_dict())
|
||||||
|
return model
|
||||||
|
|
||||||
|
|
||||||
|
def create_balanced_sampler(dataset, cfg):
|
||||||
|
# Creates a weighted sampler to handle class imbalance
|
||||||
|
|
||||||
|
labels = torch.tensor([item[cfg.training.label_key] for item in dataset])
|
||||||
|
_, counts = torch.unique(labels, return_counts=True)
|
||||||
|
class_weights = 1.0 / counts.float()
|
||||||
|
sample_weights = class_weights[labels]
|
||||||
|
|
||||||
|
return WeightedRandomSampler(weights=sample_weights, num_samples=len(sample_weights), replacement=True)
|
||||||
|
|
||||||
|
|
||||||
|
def train_epoch(model, train_loader, criterion, optimizer, grad_scaler, device, logger, step, cfg):
|
||||||
|
# Single epoch training loop with AMP support and progress tracking
|
||||||
|
model.train()
|
||||||
|
correct = 0
|
||||||
|
total = 0
|
||||||
|
|
||||||
|
pbar = tqdm(train_loader, desc="Training")
|
||||||
|
for batch_idx, batch in enumerate(pbar):
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
images = batch[cfg.training.image_key].to(device)
|
||||||
|
labels = batch[cfg.training.label_key].float().to(device)
|
||||||
|
|
||||||
|
# Forward pass with optional AMP
|
||||||
|
with torch.autocast(device_type=device.type) if cfg.training.use_amp else nullcontext():
|
||||||
|
outputs = model(images)
|
||||||
|
loss = criterion(outputs.logits, labels)
|
||||||
|
|
||||||
|
# Backward pass with gradient scaling if AMP enabled
|
||||||
|
optimizer.zero_grad()
|
||||||
|
if cfg.training.use_amp:
|
||||||
|
grad_scaler.scale(loss).backward()
|
||||||
|
grad_scaler.step(optimizer)
|
||||||
|
grad_scaler.update()
|
||||||
|
else:
|
||||||
|
loss.backward()
|
||||||
|
optimizer.step()
|
||||||
|
|
||||||
|
# Track metrics
|
||||||
|
if model.config.num_classes == 2:
|
||||||
|
predictions = (torch.sigmoid(outputs.logits) > 0.5).float()
|
||||||
|
else:
|
||||||
|
predictions = torch.argmax(outputs.logits, dim=1)
|
||||||
|
correct += (predictions == labels).sum().item()
|
||||||
|
total += labels.size(0)
|
||||||
|
|
||||||
|
current_acc = 100 * correct / total
|
||||||
|
train_info = {
|
||||||
|
"loss": loss.item(),
|
||||||
|
"accuracy": current_acc,
|
||||||
|
"dataloading_s": time.perf_counter() - start_time,
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log_dict(train_info, step + batch_idx, mode="train")
|
||||||
|
pbar.set_postfix({"loss": f"{loss.item():.4f}", "acc": f"{current_acc:.2f}%"})
|
||||||
|
|
||||||
|
|
||||||
|
def validate(model, val_loader, criterion, device, logger, cfg, num_samples_to_log=8):
|
||||||
|
# Validation loop with metric tracking and sample logging
|
||||||
|
model.eval()
|
||||||
|
correct = 0
|
||||||
|
total = 0
|
||||||
|
batch_start_time = time.perf_counter()
|
||||||
|
samples = []
|
||||||
|
running_loss = 0
|
||||||
|
|
||||||
|
with torch.no_grad(), torch.autocast(device_type=device.type) if cfg.training.use_amp else nullcontext():
|
||||||
|
for batch in tqdm(val_loader, desc="Validation"):
|
||||||
|
images = batch[cfg.training.image_key].to(device)
|
||||||
|
labels = batch[cfg.training.label_key].float().to(device)
|
||||||
|
|
||||||
|
outputs = model(images)
|
||||||
|
loss = criterion(outputs.logits, labels)
|
||||||
|
|
||||||
|
# Track metrics
|
||||||
|
if model.config.num_classes == 2:
|
||||||
|
predictions = (torch.sigmoid(outputs.logits) > 0.5).float()
|
||||||
|
else:
|
||||||
|
predictions = torch.argmax(outputs.logits, dim=1)
|
||||||
|
correct += (predictions == labels).sum().item()
|
||||||
|
total += labels.size(0)
|
||||||
|
running_loss += loss.item()
|
||||||
|
|
||||||
|
# Log sample predictions for visualization
|
||||||
|
if len(samples) < num_samples_to_log:
|
||||||
|
for i in range(min(num_samples_to_log - len(samples), len(images))):
|
||||||
|
if model.config.num_classes == 2:
|
||||||
|
confidence = round(outputs.probabilities[i].item(), 3)
|
||||||
|
else:
|
||||||
|
confidence = [round(prob, 3) for prob in outputs.probabilities[i].tolist()]
|
||||||
|
samples.append(
|
||||||
|
{
|
||||||
|
"image": wandb.Image(images[i].cpu()),
|
||||||
|
"true_label": labels[i].item(),
|
||||||
|
"predicted": predictions[i].item(),
|
||||||
|
"confidence": confidence,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
accuracy = 100 * correct / total
|
||||||
|
avg_loss = running_loss / len(val_loader)
|
||||||
|
|
||||||
|
eval_info = {
|
||||||
|
"loss": avg_loss,
|
||||||
|
"accuracy": accuracy,
|
||||||
|
"eval_s": time.perf_counter() - batch_start_time,
|
||||||
|
"eval/prediction_samples": wandb.Table(
|
||||||
|
data=[[s["image"], s["true_label"], s["predicted"], f"{s['confidence']}"] for s in samples],
|
||||||
|
columns=["Image", "True Label", "Predicted", "Confidence"],
|
||||||
|
)
|
||||||
|
if logger._cfg.wandb.enable
|
||||||
|
else None,
|
||||||
|
}
|
||||||
|
|
||||||
|
return accuracy, eval_info
|
||||||
|
|
||||||
|
|
||||||
|
@hydra.main(version_base="1.2", config_path="../configs", config_name="hilserl_classifier")
|
||||||
|
def train(cfg: DictConfig) -> None:
|
||||||
|
# Main training pipeline with support for resuming training
|
||||||
|
logging.info(OmegaConf.to_yaml(cfg))
|
||||||
|
|
||||||
|
# Initialize training environment
|
||||||
|
device = get_safe_torch_device(cfg.device, log=True)
|
||||||
|
set_global_seed(cfg.seed)
|
||||||
|
|
||||||
|
out_dir = Path(cfg.output_dir)
|
||||||
|
out_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
logger = Logger(cfg, out_dir, cfg.wandb.job_name if cfg.wandb.enable else None)
|
||||||
|
|
||||||
|
# Setup dataset and dataloaders
|
||||||
|
dataset = LeRobotDataset(cfg.dataset_repo_id)
|
||||||
|
logging.info(f"Dataset size: {len(dataset)}")
|
||||||
|
|
||||||
|
train_size = int(cfg.train_split_proportion * len(dataset))
|
||||||
|
val_size = len(dataset) - train_size
|
||||||
|
train_dataset, val_dataset = random_split(dataset, [train_size, val_size])
|
||||||
|
|
||||||
|
sampler = create_balanced_sampler(train_dataset, cfg)
|
||||||
|
train_loader = DataLoader(
|
||||||
|
train_dataset,
|
||||||
|
batch_size=cfg.training.batch_size,
|
||||||
|
num_workers=cfg.training.num_workers,
|
||||||
|
sampler=sampler,
|
||||||
|
pin_memory=True,
|
||||||
|
)
|
||||||
|
|
||||||
|
val_loader = DataLoader(
|
||||||
|
val_dataset,
|
||||||
|
batch_size=cfg.eval.batch_size,
|
||||||
|
shuffle=False,
|
||||||
|
num_workers=cfg.training.num_workers,
|
||||||
|
pin_memory=True,
|
||||||
|
)
|
||||||
|
|
||||||
|
# Resume training if requested
|
||||||
|
step = 0
|
||||||
|
best_val_acc = 0
|
||||||
|
|
||||||
|
if cfg.resume:
|
||||||
|
if not Logger.get_last_checkpoint_dir(out_dir).exists():
|
||||||
|
raise RuntimeError(
|
||||||
|
"You have set resume=True, but there is no model checkpoint in "
|
||||||
|
f"{Logger.get_last_checkpoint_dir(out_dir)}"
|
||||||
|
)
|
||||||
|
checkpoint_cfg_path = str(Logger.get_last_pretrained_model_dir(out_dir) / "config.yaml")
|
||||||
|
logging.info(
|
||||||
|
colored(
|
||||||
|
"You have set resume=True, indicating that you wish to resume a run",
|
||||||
|
color="yellow",
|
||||||
|
attrs=["bold"],
|
||||||
|
)
|
||||||
|
)
|
||||||
|
# Load and validate checkpoint configuration
|
||||||
|
checkpoint_cfg = init_hydra_config(checkpoint_cfg_path)
|
||||||
|
# Check for differences between the checkpoint configuration and provided configuration.
|
||||||
|
# Hack to resolve the delta_timestamps ahead of time in order to properly diff.
|
||||||
|
resolve_delta_timestamps(cfg)
|
||||||
|
diff = DeepDiff(OmegaConf.to_container(checkpoint_cfg), OmegaConf.to_container(cfg))
|
||||||
|
# Ignore the `resume` and parameters.
|
||||||
|
if "values_changed" in diff and "root['resume']" in diff["values_changed"]:
|
||||||
|
del diff["values_changed"]["root['resume']"]
|
||||||
|
if len(diff) > 0:
|
||||||
|
logging.warning(
|
||||||
|
"At least one difference was detected between the checkpoint configuration and "
|
||||||
|
f"the provided configuration: \n{pformat(diff)}\nNote that the checkpoint configuration "
|
||||||
|
"takes precedence.",
|
||||||
|
)
|
||||||
|
# Use the checkpoint config instead of the provided config (but keep `resume` parameter).
|
||||||
|
cfg = checkpoint_cfg
|
||||||
|
cfg.resume = True
|
||||||
|
|
||||||
|
# Initialize model and training components
|
||||||
|
model = get_model(cfg=cfg, logger=logger).to(device)
|
||||||
|
|
||||||
|
optimizer = optim.AdamW(model.parameters(), lr=cfg.training.learning_rate)
|
||||||
|
# Use BCEWithLogitsLoss for binary classification and CrossEntropyLoss for multi-class
|
||||||
|
criterion = nn.BCEWithLogitsLoss() if model.config.num_classes == 2 else nn.CrossEntropyLoss()
|
||||||
|
grad_scaler = GradScaler(enabled=cfg.training.use_amp)
|
||||||
|
|
||||||
|
# Log model parameters
|
||||||
|
num_learnable_params = sum(p.numel() for p in model.parameters() if p.requires_grad)
|
||||||
|
num_total_params = sum(p.numel() for p in model.parameters())
|
||||||
|
logging.info(f"Learnable parameters: {format_big_number(num_learnable_params)}")
|
||||||
|
logging.info(f"Total parameters: {format_big_number(num_total_params)}")
|
||||||
|
|
||||||
|
if cfg.resume:
|
||||||
|
step = logger.load_last_training_state(optimizer, None)
|
||||||
|
|
||||||
|
# Training loop with validation and checkpointing
|
||||||
|
for epoch in range(cfg.training.num_epochs):
|
||||||
|
logging.info(f"\nEpoch {epoch+1}/{cfg.training.num_epochs}")
|
||||||
|
|
||||||
|
train_epoch(model, train_loader, criterion, optimizer, grad_scaler, device, logger, step, cfg)
|
||||||
|
|
||||||
|
# Periodic validation
|
||||||
|
if cfg.training.eval_freq > 0 and (epoch + 1) % cfg.training.eval_freq == 0:
|
||||||
|
val_acc, eval_info = validate(
|
||||||
|
model,
|
||||||
|
val_loader,
|
||||||
|
criterion,
|
||||||
|
device,
|
||||||
|
logger,
|
||||||
|
cfg,
|
||||||
|
)
|
||||||
|
logger.log_dict(eval_info, step + len(train_loader), mode="eval")
|
||||||
|
|
||||||
|
# Save best model
|
||||||
|
if val_acc > best_val_acc:
|
||||||
|
best_val_acc = val_acc
|
||||||
|
logger.save_checkpoint(
|
||||||
|
train_step=step + len(train_loader),
|
||||||
|
policy=model,
|
||||||
|
optimizer=optimizer,
|
||||||
|
scheduler=None,
|
||||||
|
identifier="best",
|
||||||
|
)
|
||||||
|
|
||||||
|
# Periodic checkpointing
|
||||||
|
if cfg.training.save_checkpoint and (epoch + 1) % cfg.training.save_freq == 0:
|
||||||
|
logger.save_checkpoint(
|
||||||
|
train_step=step + len(train_loader),
|
||||||
|
policy=model,
|
||||||
|
optimizer=optimizer,
|
||||||
|
scheduler=None,
|
||||||
|
identifier=f"{epoch+1:06d}",
|
||||||
|
)
|
||||||
|
|
||||||
|
step += len(train_loader)
|
||||||
|
|
||||||
|
logging.info("Training completed")
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
train()
|
||||||
@@ -100,7 +100,7 @@ def to_hwc_uint8_numpy(chw_float32_torch: torch.Tensor) -> np.ndarray:
|
|||||||
|
|
||||||
|
|
||||||
def visualize_dataset(
|
def visualize_dataset(
|
||||||
repo_id: str,
|
dataset: LeRobotDataset,
|
||||||
episode_index: int,
|
episode_index: int,
|
||||||
batch_size: int = 32,
|
batch_size: int = 32,
|
||||||
num_workers: int = 0,
|
num_workers: int = 0,
|
||||||
@@ -108,7 +108,6 @@ def visualize_dataset(
|
|||||||
web_port: int = 9090,
|
web_port: int = 9090,
|
||||||
ws_port: int = 9087,
|
ws_port: int = 9087,
|
||||||
save: bool = False,
|
save: bool = False,
|
||||||
root: Path | None = None,
|
|
||||||
output_dir: Path | None = None,
|
output_dir: Path | None = None,
|
||||||
) -> Path | None:
|
) -> Path | None:
|
||||||
if save:
|
if save:
|
||||||
@@ -116,8 +115,7 @@ def visualize_dataset(
|
|||||||
output_dir is not None
|
output_dir is not None
|
||||||
), "Set an output directory where to write .rrd files with `--output-dir path/to/directory`."
|
), "Set an output directory where to write .rrd files with `--output-dir path/to/directory`."
|
||||||
|
|
||||||
logging.info("Loading dataset")
|
repo_id = dataset.repo_id
|
||||||
dataset = LeRobotDataset(repo_id, root=root)
|
|
||||||
|
|
||||||
logging.info("Loading dataloader")
|
logging.info("Loading dataloader")
|
||||||
episode_sampler = EpisodeSampler(dataset, episode_index)
|
episode_sampler = EpisodeSampler(dataset, episode_index)
|
||||||
@@ -153,7 +151,7 @@ def visualize_dataset(
|
|||||||
rr.set_time_seconds("timestamp", batch["timestamp"][i].item())
|
rr.set_time_seconds("timestamp", batch["timestamp"][i].item())
|
||||||
|
|
||||||
# display each camera image
|
# display each camera image
|
||||||
for key in dataset.camera_keys:
|
for key in dataset.meta.camera_keys:
|
||||||
# TODO(rcadene): add `.compress()`? is it lossless?
|
# TODO(rcadene): add `.compress()`? is it lossless?
|
||||||
rr.log(key, rr.Image(to_hwc_uint8_numpy(batch[key][i])))
|
rr.log(key, rr.Image(to_hwc_uint8_numpy(batch[key][i])))
|
||||||
|
|
||||||
@@ -209,11 +207,17 @@ def main():
|
|||||||
required=True,
|
required=True,
|
||||||
help="Episode to visualize.",
|
help="Episode to visualize.",
|
||||||
)
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--local-files-only",
|
||||||
|
type=int,
|
||||||
|
default=0,
|
||||||
|
help="Use local files only. By default, this script will try to fetch the dataset from the hub if it exists.",
|
||||||
|
)
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
"--root",
|
"--root",
|
||||||
type=Path,
|
type=Path,
|
||||||
default=None,
|
default=None,
|
||||||
help="Root directory for a dataset stored locally (e.g. `--root data`). By default, the dataset will be loaded from hugging face cache folder, or downloaded from the hub if available.",
|
help="Root directory for the dataset stored locally (e.g. `--root data`). By default, the dataset will be loaded from hugging face cache folder, or downloaded from the hub if available.",
|
||||||
)
|
)
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
"--output-dir",
|
"--output-dir",
|
||||||
@@ -268,7 +272,15 @@ def main():
|
|||||||
)
|
)
|
||||||
|
|
||||||
args = parser.parse_args()
|
args = parser.parse_args()
|
||||||
visualize_dataset(**vars(args))
|
kwargs = vars(args)
|
||||||
|
repo_id = kwargs.pop("repo_id")
|
||||||
|
root = kwargs.pop("root")
|
||||||
|
local_files_only = kwargs.pop("local_files_only")
|
||||||
|
|
||||||
|
logging.info("Loading dataset")
|
||||||
|
dataset = LeRobotDataset(repo_id, root=root, local_files_only=local_files_only)
|
||||||
|
|
||||||
|
visualize_dataset(dataset, **vars(args))
|
||||||
|
|
||||||
|
|
||||||
if __name__ == "__main__":
|
if __name__ == "__main__":
|
||||||
|
|||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user