forked from tangger/lerobot
Compare commits
186 Commits
Cadene-pat
...
feat/add_r
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
374d4351fd | ||
|
|
4f3eaff2bd | ||
|
|
1f7ddc1d76 | ||
|
|
ce63cfdb25 | ||
|
|
974028bd28 | ||
|
|
a36ed39487 | ||
|
|
c37b1d45b6 | ||
|
|
d6f1359e69 | ||
|
|
2357d4aceb | ||
|
|
f994febca4 | ||
|
|
12f52632ed | ||
|
|
8a64d8268b | ||
|
|
d6ccdc222c | ||
|
|
9bd0788131 | ||
|
|
1ae62c28f7 | ||
|
|
baf6e66c3d | ||
|
|
a065bd61ae | ||
|
|
84565c7c2e | ||
|
|
05b54733da | ||
|
|
513b008bcc | ||
|
|
32fffd4bbb | ||
|
|
03c7cf8a63 | ||
|
|
074f0ac8fe | ||
|
|
25c63ccf63 | ||
|
|
5dc3c74e64 | ||
|
|
5e9473806c | ||
|
|
4214b01703 | ||
|
|
b974e5541f | ||
|
|
10706ed753 | ||
|
|
fd64dc84ae | ||
|
|
0b8205a8a0 | ||
|
|
57ae509823 | ||
|
|
5d24ce3160 | ||
|
|
d694ea1d38 | ||
|
|
a00936686f | ||
|
|
2feb5edc65 | ||
|
|
b80e55ca44 | ||
|
|
e8ce388109 | ||
|
|
a4c1da25de | ||
|
|
a003e7c081 | ||
|
|
06988b2135 | ||
|
|
7ed7570b17 | ||
|
|
e2d13ba7e4 | ||
|
|
f6c1049474 | ||
|
|
2b24feb604 | ||
|
|
a27411022d | ||
|
|
3827974b58 | ||
|
|
b299cfea8a | ||
|
|
a13e49073c | ||
|
|
2c7e0f17b6 | ||
|
|
418866007e | ||
|
|
5ab418dbeb | ||
|
|
95f61ee9d4 | ||
|
|
ac89c8d226 | ||
|
|
d75d904e43 | ||
|
|
ea4d8d990c | ||
|
|
c93cbb8311 | ||
|
|
c0137e89b9 | ||
|
|
3111ba78ad | ||
|
|
3d3a176940 | ||
|
|
212c6095a2 | ||
|
|
bf6f89a5b5 | ||
|
|
48469ec674 | ||
|
|
c7dfd32b43 | ||
|
|
8861546ad8 | ||
|
|
9c1a893ee3 | ||
|
|
e81c36cf74 | ||
|
|
ed83cbd4f2 | ||
|
|
2a33b9ad87 | ||
|
|
6e85aa13ec | ||
|
|
af05a1725c | ||
|
|
800c4a847f | ||
|
|
bba8c4c0d4 | ||
|
|
68b369e321 | ||
|
|
8d60ac3ffc | ||
|
|
731fb6ebaf | ||
|
|
13e124302f | ||
|
|
59bdd29106 | ||
|
|
659ec4434d | ||
|
|
124829104b | ||
|
|
21cd2940a9 | ||
|
|
da265ca920 | ||
|
|
a1809ad3de | ||
|
|
8699a28be0 | ||
|
|
65db5afe1c | ||
|
|
75d5fa4604 | ||
|
|
e64fad2224 | ||
|
|
eecf32e77a | ||
|
|
3354d919fc | ||
|
|
aca464ca72 | ||
|
|
fe483b1d0d | ||
|
|
ddeade077e | ||
|
|
c4c2ce04e7 | ||
|
|
2cb0bf5d41 | ||
|
|
b86a2c0b47 | ||
|
|
c574eb4984 | ||
|
|
1e49cc4d60 | ||
|
|
e71095960f | ||
|
|
90e099b39f | ||
|
|
334deb985d | ||
|
|
8548a87bd4 | ||
|
|
638d411cd3 | ||
|
|
dd974529cf | ||
|
|
43e079f73e | ||
|
|
6674e36824 | ||
|
|
ae9605f03c | ||
|
|
3c0a209f9f | ||
|
|
1ee1acf8ad | ||
|
|
c4d912a241 | ||
|
|
4323bdce22 | ||
|
|
5daa45436d | ||
|
|
4def6d6ac2 | ||
|
|
d8560b8d5f | ||
|
|
380b836eee | ||
|
|
eec6796cb8 | ||
|
|
25a8597680 | ||
|
|
b8b368310c | ||
|
|
5097cd900e | ||
|
|
bc16e1b497 | ||
|
|
8f821ecad0 | ||
|
|
4519016e67 | ||
|
|
59e2757434 | ||
|
|
73b64c3089 | ||
|
|
66f8736598 | ||
|
|
4c41f6fcc6 | ||
|
|
44f9b21e74 | ||
|
|
03f49ceaf0 | ||
|
|
8e7d6970ea | ||
|
|
286bca37cc | ||
|
|
a2c181992a | ||
|
|
32eb0cec8f | ||
|
|
96c7052777 | ||
|
|
975c1c25c3 | ||
|
|
20f466768e | ||
|
|
8af693548e | ||
|
|
963738d983 | ||
|
|
e0df56de62 | ||
|
|
538455a965 | ||
|
|
172809a502 | ||
|
|
55e4ff6742 | ||
|
|
07e8716315 | ||
|
|
114870d703 | ||
|
|
2efee45ef1 | ||
|
|
c351e1fff9 | ||
|
|
cd0fc261c0 | ||
|
|
77478d50e5 | ||
|
|
97b1feb0b3 | ||
|
|
c29e70e5a1 | ||
|
|
d5b669634a | ||
|
|
1a343c3591 | ||
|
|
26f97cfd17 | ||
|
|
72f402d44b | ||
|
|
92573486a8 | ||
|
|
c712d68f6a | ||
|
|
f431a08efa | ||
|
|
beaa427504 | ||
|
|
a88dd602d9 | ||
|
|
6c0324f467 | ||
|
|
a60d27b132 | ||
|
|
9c463661c1 | ||
|
|
4255655618 | ||
|
|
f17d9a2ba1 | ||
|
|
9ff829a3a1 | ||
|
|
d6516f0e03 | ||
|
|
b0b8612eff | ||
|
|
1072a055db | ||
|
|
9c9f5cac90 | ||
|
|
9d0c6fe419 | ||
|
|
54ac25cfc9 | ||
|
|
150a292795 | ||
|
|
429a463aff | ||
|
|
27ba2951d1 | ||
|
|
b2896d38f5 | ||
|
|
c0da806232 | ||
|
|
114e09f570 | ||
|
|
04a995e7d1 | ||
|
|
4806336816 | ||
|
|
1ce418e4a1 | ||
|
|
eb4c505cff | ||
|
|
aad59e6b6b | ||
|
|
9ce98bb93c | ||
|
|
97086cdcdf | ||
|
|
9c7649f140 | ||
|
|
a2592a5563 | ||
|
|
b5ad79a7d3 | ||
|
|
996468bcce |
68
.cache/calibration/aloha_default/left_follower.json
Normal file
68
.cache/calibration/aloha_default/left_follower.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2015,
|
||||||
|
3058,
|
||||||
|
3061,
|
||||||
|
1071,
|
||||||
|
1071,
|
||||||
|
2035,
|
||||||
|
2152,
|
||||||
|
2029,
|
||||||
|
2499
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1008,
|
||||||
|
-1963,
|
||||||
|
-1966,
|
||||||
|
2141,
|
||||||
|
2143,
|
||||||
|
-971,
|
||||||
|
3043,
|
||||||
|
-1077,
|
||||||
|
3144
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/left_leader.json
Normal file
68
.cache/calibration/aloha_default/left_leader.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-1024
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2035,
|
||||||
|
3024,
|
||||||
|
3019,
|
||||||
|
979,
|
||||||
|
981,
|
||||||
|
1982,
|
||||||
|
2166,
|
||||||
|
2124,
|
||||||
|
1968
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-990,
|
||||||
|
-2017,
|
||||||
|
-2015,
|
||||||
|
2078,
|
||||||
|
2076,
|
||||||
|
-1030,
|
||||||
|
3117,
|
||||||
|
-1016,
|
||||||
|
2556
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/right_follower.json
Normal file
68
.cache/calibration/aloha_default/right_follower.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2056,
|
||||||
|
2895,
|
||||||
|
2896,
|
||||||
|
1191,
|
||||||
|
1190,
|
||||||
|
2018,
|
||||||
|
2051,
|
||||||
|
2056,
|
||||||
|
2509
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1040,
|
||||||
|
-2004,
|
||||||
|
-2006,
|
||||||
|
2126,
|
||||||
|
2127,
|
||||||
|
-1010,
|
||||||
|
3050,
|
||||||
|
-1117,
|
||||||
|
3143
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/right_leader.json
Normal file
68
.cache/calibration/aloha_default/right_leader.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2068,
|
||||||
|
3034,
|
||||||
|
3030,
|
||||||
|
1038,
|
||||||
|
1041,
|
||||||
|
1991,
|
||||||
|
1948,
|
||||||
|
2090,
|
||||||
|
1985
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1025,
|
||||||
|
-2014,
|
||||||
|
-2015,
|
||||||
|
2058,
|
||||||
|
2060,
|
||||||
|
-955,
|
||||||
|
3091,
|
||||||
|
-940,
|
||||||
|
2576
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
@@ -1,3 +1,17 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
# Misc
|
# Misc
|
||||||
.git
|
.git
|
||||||
tmp
|
tmp
|
||||||
@@ -59,13 +73,12 @@ pip-log.txt
|
|||||||
pip-delete-this-directory.txt
|
pip-delete-this-directory.txt
|
||||||
|
|
||||||
# Unit test / coverage reports
|
# Unit test / coverage reports
|
||||||
!tests/data
|
!tests/artifacts
|
||||||
htmlcov/
|
htmlcov/
|
||||||
.tox/
|
.tox/
|
||||||
.nox/
|
.nox/
|
||||||
.coverage
|
.coverage
|
||||||
.coverage.*
|
.coverage.*
|
||||||
.cache
|
|
||||||
nosetests.xml
|
nosetests.xml
|
||||||
coverage.xml
|
coverage.xml
|
||||||
*.cover
|
*.cover
|
||||||
@@ -73,6 +86,11 @@ coverage.xml
|
|||||||
.hypothesis/
|
.hypothesis/
|
||||||
.pytest_cache/
|
.pytest_cache/
|
||||||
|
|
||||||
|
# Ignore .cache except calibration
|
||||||
|
.cache/*
|
||||||
|
!.cache/calibration/
|
||||||
|
!.cache/calibration/**
|
||||||
|
|
||||||
# Translations
|
# Translations
|
||||||
*.mo
|
*.mo
|
||||||
*.pot
|
*.pot
|
||||||
|
|||||||
16
.gitattributes
vendored
16
.gitattributes
vendored
@@ -1,6 +1,20 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
*.memmap filter=lfs diff=lfs merge=lfs -text
|
*.memmap filter=lfs diff=lfs merge=lfs -text
|
||||||
*.stl filter=lfs diff=lfs merge=lfs -text
|
*.stl filter=lfs diff=lfs merge=lfs -text
|
||||||
*.safetensors filter=lfs diff=lfs merge=lfs -text
|
*.safetensors filter=lfs diff=lfs merge=lfs -text
|
||||||
*.mp4 filter=lfs diff=lfs merge=lfs -text
|
*.mp4 filter=lfs diff=lfs merge=lfs -text
|
||||||
*.arrow filter=lfs diff=lfs merge=lfs -text
|
*.arrow filter=lfs diff=lfs merge=lfs -text
|
||||||
*.json filter=lfs diff=lfs merge=lfs -text
|
*.json !text !filter !merge !diff
|
||||||
|
|||||||
14
.github/ISSUE_TEMPLATE/bug-report.yml
vendored
14
.github/ISSUE_TEMPLATE/bug-report.yml
vendored
@@ -1,3 +1,17 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
name: "\U0001F41B Bug Report"
|
name: "\U0001F41B Bug Report"
|
||||||
description: Submit a bug report to help us improve LeRobot
|
description: Submit a bug report to help us improve LeRobot
|
||||||
body:
|
body:
|
||||||
|
|||||||
2
.github/PULL_REQUEST_TEMPLATE.md
vendored
2
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -21,7 +21,7 @@ Provide a simple way for the reviewer to try out your changes.
|
|||||||
|
|
||||||
Examples:
|
Examples:
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR=tests/data pytest -sx tests/test_stuff.py::test_something
|
pytest -sx tests/test_stuff.py::test_something
|
||||||
```
|
```
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py --some.option=true
|
python lerobot/scripts/train.py --some.option=true
|
||||||
|
|||||||
26
.github/workflows/build-docker-images.yml
vendored
26
.github/workflows/build-docker-images.yml
vendored
@@ -1,3 +1,17 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
# Inspired by
|
# Inspired by
|
||||||
# https://github.com/huggingface/peft/blob/main/.github/workflows/build_docker_images.yml
|
# https://github.com/huggingface/peft/blob/main/.github/workflows/build_docker_images.yml
|
||||||
name: Builds
|
name: Builds
|
||||||
@@ -8,6 +22,8 @@ on:
|
|||||||
schedule:
|
schedule:
|
||||||
- cron: "0 1 * * *"
|
- cron: "0 1 * * *"
|
||||||
|
|
||||||
|
permissions: {}
|
||||||
|
|
||||||
env:
|
env:
|
||||||
PYTHON_VERSION: "3.10"
|
PYTHON_VERSION: "3.10"
|
||||||
|
|
||||||
@@ -25,11 +41,14 @@ jobs:
|
|||||||
|
|
||||||
- name: Set up Docker Buildx
|
- name: Set up Docker Buildx
|
||||||
uses: docker/setup-buildx-action@v3
|
uses: docker/setup-buildx-action@v3
|
||||||
|
with:
|
||||||
|
cache-binary: false
|
||||||
|
|
||||||
- name: Check out code
|
- name: Check out code
|
||||||
uses: actions/checkout@v4
|
uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
lfs: true
|
lfs: true
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Login to DockerHub
|
- name: Login to DockerHub
|
||||||
uses: docker/login-action@v3
|
uses: docker/login-action@v3
|
||||||
@@ -60,11 +79,14 @@ jobs:
|
|||||||
|
|
||||||
- name: Set up Docker Buildx
|
- name: Set up Docker Buildx
|
||||||
uses: docker/setup-buildx-action@v3
|
uses: docker/setup-buildx-action@v3
|
||||||
|
with:
|
||||||
|
cache-binary: false
|
||||||
|
|
||||||
- name: Check out code
|
- name: Check out code
|
||||||
uses: actions/checkout@v4
|
uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
lfs: true
|
lfs: true
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Login to DockerHub
|
- name: Login to DockerHub
|
||||||
uses: docker/login-action@v3
|
uses: docker/login-action@v3
|
||||||
@@ -89,9 +111,13 @@ jobs:
|
|||||||
steps:
|
steps:
|
||||||
- name: Set up Docker Buildx
|
- name: Set up Docker Buildx
|
||||||
uses: docker/setup-buildx-action@v3
|
uses: docker/setup-buildx-action@v3
|
||||||
|
with:
|
||||||
|
cache-binary: false
|
||||||
|
|
||||||
- name: Check out code
|
- name: Check out code
|
||||||
uses: actions/checkout@v4
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Login to DockerHub
|
- name: Login to DockerHub
|
||||||
uses: docker/login-action@v3
|
uses: docker/login-action@v3
|
||||||
|
|||||||
24
.github/workflows/nightly-tests.yml
vendored
24
.github/workflows/nightly-tests.yml
vendored
@@ -1,3 +1,17 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
# Inspired by
|
# Inspired by
|
||||||
# https://github.com/huggingface/peft/blob/main/.github/workflows/nightly.yml
|
# https://github.com/huggingface/peft/blob/main/.github/workflows/nightly.yml
|
||||||
name: Nightly
|
name: Nightly
|
||||||
@@ -7,10 +21,10 @@ on:
|
|||||||
schedule:
|
schedule:
|
||||||
- cron: "0 2 * * *"
|
- cron: "0 2 * * *"
|
||||||
|
|
||||||
env:
|
permissions: {}
|
||||||
DATA_DIR: tests/data
|
|
||||||
# SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
|
|
||||||
|
|
||||||
|
# env:
|
||||||
|
# SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
|
||||||
jobs:
|
jobs:
|
||||||
run_all_tests_cpu:
|
run_all_tests_cpu:
|
||||||
name: CPU
|
name: CPU
|
||||||
@@ -30,13 +44,9 @@ jobs:
|
|||||||
working-directory: /lerobot
|
working-directory: /lerobot
|
||||||
steps:
|
steps:
|
||||||
- name: Tests
|
- name: Tests
|
||||||
env:
|
|
||||||
DATA_DIR: tests/data
|
|
||||||
run: pytest -v --cov=./lerobot --disable-warnings tests
|
run: pytest -v --cov=./lerobot --disable-warnings tests
|
||||||
|
|
||||||
- name: Tests end-to-end
|
- name: Tests end-to-end
|
||||||
env:
|
|
||||||
DATA_DIR: tests/data
|
|
||||||
run: make test-end-to-end
|
run: make test-end-to-end
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
74
.github/workflows/quality.yml
vendored
74
.github/workflows/quality.yml
vendored
@@ -1,15 +1,29 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
name: Quality
|
name: Quality
|
||||||
|
|
||||||
on:
|
on:
|
||||||
workflow_dispatch:
|
workflow_dispatch:
|
||||||
workflow_call:
|
workflow_call:
|
||||||
pull_request:
|
pull_request:
|
||||||
branches:
|
|
||||||
- main
|
|
||||||
push:
|
push:
|
||||||
branches:
|
branches:
|
||||||
- main
|
- main
|
||||||
|
|
||||||
|
permissions: {}
|
||||||
|
|
||||||
env:
|
env:
|
||||||
PYTHON_VERSION: "3.10"
|
PYTHON_VERSION: "3.10"
|
||||||
|
|
||||||
@@ -19,7 +33,9 @@ jobs:
|
|||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout Repository
|
- name: Checkout Repository
|
||||||
uses: actions/checkout@v3
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Set up Python
|
- name: Set up Python
|
||||||
uses: actions/setup-python@v4
|
uses: actions/setup-python@v4
|
||||||
@@ -30,55 +46,27 @@ jobs:
|
|||||||
id: get-ruff-version
|
id: get-ruff-version
|
||||||
run: |
|
run: |
|
||||||
RUFF_VERSION=$(awk '/repo: https:\/\/github.com\/astral-sh\/ruff-pre-commit/{flag=1;next}/rev:/{if(flag){print $2;exit}}' .pre-commit-config.yaml)
|
RUFF_VERSION=$(awk '/repo: https:\/\/github.com\/astral-sh\/ruff-pre-commit/{flag=1;next}/rev:/{if(flag){print $2;exit}}' .pre-commit-config.yaml)
|
||||||
echo "RUFF_VERSION=${RUFF_VERSION}" >> $GITHUB_ENV
|
echo "ruff_version=${RUFF_VERSION}" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
- name: Install Ruff
|
- name: Install Ruff
|
||||||
run: python -m pip install "ruff==${{ env.RUFF_VERSION }}"
|
env:
|
||||||
|
RUFF_VERSION: ${{ steps.get-ruff-version.outputs.ruff_version }}
|
||||||
|
run: python -m pip install "ruff==${RUFF_VERSION}"
|
||||||
|
|
||||||
- name: Ruff check
|
- name: Ruff check
|
||||||
run: ruff check
|
run: ruff check --output-format=github
|
||||||
|
|
||||||
- name: Ruff format
|
- name: Ruff format
|
||||||
run: ruff format --diff
|
run: ruff format --diff
|
||||||
|
|
||||||
|
typos:
|
||||||
poetry_check:
|
name: Typos
|
||||||
name: Poetry check
|
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout Repository
|
- name: Checkout Repository
|
||||||
uses: actions/checkout@v3
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Install poetry
|
- name: typos-action
|
||||||
run: pipx install poetry
|
uses: crate-ci/typos@v1.29.10
|
||||||
|
|
||||||
- name: Poetry check
|
|
||||||
run: poetry check
|
|
||||||
|
|
||||||
|
|
||||||
poetry_relax:
|
|
||||||
name: Poetry relax
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- name: Checkout Repository
|
|
||||||
uses: actions/checkout@v3
|
|
||||||
|
|
||||||
- name: Install poetry
|
|
||||||
run: pipx install poetry
|
|
||||||
|
|
||||||
- name: Install poetry-relax
|
|
||||||
run: poetry self add poetry-relax
|
|
||||||
|
|
||||||
- name: Poetry relax
|
|
||||||
id: poetry_relax
|
|
||||||
run: |
|
|
||||||
output=$(poetry relax --check 2>&1)
|
|
||||||
if echo "$output" | grep -q "Proposing updates"; then
|
|
||||||
echo "$output"
|
|
||||||
echo ""
|
|
||||||
echo "Some dependencies have caret '^' version requirement added by poetry by default."
|
|
||||||
echo "Please replace them with '>='. You can do this by hand or use poetry-relax to do this."
|
|
||||||
exit 1
|
|
||||||
else
|
|
||||||
echo "$output"
|
|
||||||
fi
|
|
||||||
|
|||||||
31
.github/workflows/test-docker-build.yml
vendored
31
.github/workflows/test-docker-build.yml
vendored
@@ -1,15 +1,29 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
# Inspired by
|
# Inspired by
|
||||||
# https://github.com/huggingface/peft/blob/main/.github/workflows/test-docker-build.yml
|
# https://github.com/huggingface/peft/blob/main/.github/workflows/test-docker-build.yml
|
||||||
name: Test Dockerfiles
|
name: Test Dockerfiles
|
||||||
|
|
||||||
on:
|
on:
|
||||||
pull_request:
|
pull_request:
|
||||||
branches:
|
|
||||||
- main
|
|
||||||
paths:
|
paths:
|
||||||
# Run only when DockerFile files are modified
|
# Run only when DockerFile files are modified
|
||||||
- "docker/**"
|
- "docker/**"
|
||||||
|
|
||||||
|
permissions: {}
|
||||||
|
|
||||||
env:
|
env:
|
||||||
PYTHON_VERSION: "3.10"
|
PYTHON_VERSION: "3.10"
|
||||||
|
|
||||||
@@ -22,6 +36,8 @@ jobs:
|
|||||||
steps:
|
steps:
|
||||||
- name: Check out code
|
- name: Check out code
|
||||||
uses: actions/checkout@v4
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Get changed files
|
- name: Get changed files
|
||||||
id: changed-files
|
id: changed-files
|
||||||
@@ -30,21 +46,18 @@ jobs:
|
|||||||
files: docker/**
|
files: docker/**
|
||||||
json: "true"
|
json: "true"
|
||||||
|
|
||||||
- name: Run step if only the files listed above change
|
- name: Run step if only the files listed above change # zizmor: ignore[template-injection]
|
||||||
if: steps.changed-files.outputs.any_changed == 'true'
|
if: steps.changed-files.outputs.any_changed == 'true'
|
||||||
id: set-matrix
|
id: set-matrix
|
||||||
env:
|
|
||||||
ALL_CHANGED_FILES: ${{ steps.changed-files.outputs.all_changed_files }}
|
|
||||||
run: |
|
run: |
|
||||||
echo "matrix=${{ steps.changed-files.outputs.all_changed_files}}" >> $GITHUB_OUTPUT
|
echo "matrix=${{ steps.changed-files.outputs.all_changed_files}}" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
|
||||||
build_modified_dockerfiles:
|
build_modified_dockerfiles:
|
||||||
name: Build modified Docker images
|
name: Build modified Docker images
|
||||||
needs: get_changed_files
|
needs: get_changed_files
|
||||||
runs-on:
|
runs-on:
|
||||||
group: aws-general-8-plus
|
group: aws-general-8-plus
|
||||||
if: ${{ needs.get_changed_files.outputs.matrix }} != ''
|
if: needs.get_changed_files.outputs.matrix != ''
|
||||||
strategy:
|
strategy:
|
||||||
fail-fast: false
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
@@ -52,9 +65,13 @@ jobs:
|
|||||||
steps:
|
steps:
|
||||||
- name: Set up Docker Buildx
|
- name: Set up Docker Buildx
|
||||||
uses: docker/setup-buildx-action@v3
|
uses: docker/setup-buildx-action@v3
|
||||||
|
with:
|
||||||
|
cache-binary: false
|
||||||
|
|
||||||
- name: Check out code
|
- name: Check out code
|
||||||
uses: actions/checkout@v4
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Build Docker image
|
- name: Build Docker image
|
||||||
uses: docker/build-push-action@v5
|
uses: docker/build-push-action@v5
|
||||||
|
|||||||
101
.github/workflows/test.yml
vendored
101
.github/workflows/test.yml
vendored
@@ -1,16 +1,30 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
name: Tests
|
name: Tests
|
||||||
|
|
||||||
on:
|
on:
|
||||||
pull_request:
|
pull_request:
|
||||||
branches:
|
|
||||||
- main
|
|
||||||
paths:
|
paths:
|
||||||
- "lerobot/**"
|
- "lerobot/**"
|
||||||
- "tests/**"
|
- "tests/**"
|
||||||
- "examples/**"
|
- "examples/**"
|
||||||
- ".github/**"
|
- ".github/**"
|
||||||
- "poetry.lock"
|
- "pyproject.toml"
|
||||||
|
- ".pre-commit-config.yaml"
|
||||||
- "Makefile"
|
- "Makefile"
|
||||||
|
- ".cache/**"
|
||||||
push:
|
push:
|
||||||
branches:
|
branches:
|
||||||
- main
|
- main
|
||||||
@@ -19,113 +33,116 @@ on:
|
|||||||
- "tests/**"
|
- "tests/**"
|
||||||
- "examples/**"
|
- "examples/**"
|
||||||
- ".github/**"
|
- ".github/**"
|
||||||
- "poetry.lock"
|
- "pyproject.toml"
|
||||||
|
- ".pre-commit-config.yaml"
|
||||||
- "Makefile"
|
- "Makefile"
|
||||||
|
- ".cache/**"
|
||||||
|
|
||||||
|
permissions: {}
|
||||||
|
|
||||||
|
env:
|
||||||
|
UV_VERSION: "0.6.0"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
pytest:
|
pytest:
|
||||||
name: Pytest
|
name: Pytest
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
env:
|
env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
MUJOCO_GL: egl
|
MUJOCO_GL: egl
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v4
|
- uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
lfs: true # Ensure LFS files are pulled
|
lfs: true # Ensure LFS files are pulled
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Install apt dependencies
|
- name: Install apt dependencies
|
||||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev ffmpeg
|
# portaudio19-dev is needed to install pyaudio
|
||||||
|
|
||||||
- name: Install poetry
|
|
||||||
run: |
|
run: |
|
||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
sudo apt-get update && \
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
sudo apt-get install -y libegl1-mesa-dev ffmpeg portaudio19-dev
|
||||||
|
|
||||||
- name: Set up Python 3.10
|
- name: Install uv and python
|
||||||
uses: actions/setup-python@v5
|
uses: astral-sh/setup-uv@v5
|
||||||
with:
|
with:
|
||||||
|
enable-cache: true
|
||||||
|
version: ${{ env.UV_VERSION }}
|
||||||
python-version: "3.10"
|
python-version: "3.10"
|
||||||
cache: "poetry"
|
|
||||||
|
|
||||||
- name: Install poetry dependencies
|
- name: Install lerobot (all extras)
|
||||||
run: |
|
run: uv sync --all-extras
|
||||||
poetry install --all-extras
|
|
||||||
|
|
||||||
- name: Test with pytest
|
- name: Test with pytest
|
||||||
run: |
|
run: |
|
||||||
pytest tests -v --cov=./lerobot --durations=0 \
|
uv run pytest tests -v --cov=./lerobot --durations=0 \
|
||||||
-W ignore::DeprecationWarning:imageio_ffmpeg._utils:7 \
|
-W ignore::DeprecationWarning:imageio_ffmpeg._utils:7 \
|
||||||
-W ignore::UserWarning:torch.utils.data.dataloader:558 \
|
-W ignore::UserWarning:torch.utils.data.dataloader:558 \
|
||||||
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
||||||
&& rm -rf tests/outputs outputs
|
&& rm -rf tests/outputs outputs
|
||||||
|
|
||||||
|
|
||||||
pytest-minimal:
|
pytest-minimal:
|
||||||
name: Pytest (minimal install)
|
name: Pytest (minimal install)
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
env:
|
env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
MUJOCO_GL: egl
|
MUJOCO_GL: egl
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v4
|
- uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
lfs: true # Ensure LFS files are pulled
|
lfs: true # Ensure LFS files are pulled
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Install apt dependencies
|
- name: Install apt dependencies
|
||||||
run: sudo apt-get update && sudo apt-get install -y ffmpeg
|
run: sudo apt-get update && sudo apt-get install -y ffmpeg
|
||||||
|
|
||||||
- name: Install poetry
|
- name: Install uv and python
|
||||||
run: |
|
uses: astral-sh/setup-uv@v5
|
||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
|
||||||
|
|
||||||
- name: Set up Python 3.10
|
|
||||||
uses: actions/setup-python@v5
|
|
||||||
with:
|
with:
|
||||||
|
enable-cache: true
|
||||||
|
version: ${{ env.UV_VERSION }}
|
||||||
python-version: "3.10"
|
python-version: "3.10"
|
||||||
|
|
||||||
- name: Install poetry dependencies
|
- name: Install lerobot
|
||||||
run: |
|
run: uv sync --extra "test"
|
||||||
poetry install --extras "test"
|
|
||||||
|
|
||||||
- name: Test with pytest
|
- name: Test with pytest
|
||||||
run: |
|
run: |
|
||||||
pytest tests -v --cov=./lerobot --durations=0 \
|
uv run pytest tests -v --cov=./lerobot --durations=0 \
|
||||||
-W ignore::DeprecationWarning:imageio_ffmpeg._utils:7 \
|
-W ignore::DeprecationWarning:imageio_ffmpeg._utils:7 \
|
||||||
-W ignore::UserWarning:torch.utils.data.dataloader:558 \
|
-W ignore::UserWarning:torch.utils.data.dataloader:558 \
|
||||||
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
||||||
&& rm -rf tests/outputs outputs
|
&& rm -rf tests/outputs outputs
|
||||||
|
|
||||||
|
|
||||||
end-to-end:
|
end-to-end:
|
||||||
name: End-to-end
|
name: End-to-end
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
env:
|
env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
MUJOCO_GL: egl
|
MUJOCO_GL: egl
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v4
|
- uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
lfs: true # Ensure LFS files are pulled
|
lfs: true # Ensure LFS files are pulled
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Install apt dependencies
|
- name: Install apt dependencies
|
||||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
|
# portaudio19-dev is needed to install pyaudio
|
||||||
|
|
||||||
- name: Install poetry
|
|
||||||
run: |
|
run: |
|
||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
sudo apt-get update && \
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
sudo apt-get install -y libegl1-mesa-dev portaudio19-dev
|
||||||
|
|
||||||
- name: Set up Python 3.10
|
- name: Install uv and python
|
||||||
uses: actions/setup-python@v5
|
uses: astral-sh/setup-uv@v5
|
||||||
with:
|
with:
|
||||||
|
enable-cache: true
|
||||||
|
version: ${{ env.UV_VERSION }}
|
||||||
python-version: "3.10"
|
python-version: "3.10"
|
||||||
cache: "poetry"
|
|
||||||
|
|
||||||
- name: Install poetry dependencies
|
- name: Install lerobot (all extras)
|
||||||
run: |
|
run: |
|
||||||
poetry install --all-extras
|
uv venv
|
||||||
|
uv sync --all-extras
|
||||||
|
|
||||||
|
- name: venv
|
||||||
|
run: |
|
||||||
|
echo "PYTHON_PATH=${{ github.workspace }}/.venv/bin/python" >> $GITHUB_ENV
|
||||||
|
|
||||||
- name: Test end-to-end
|
- name: Test end-to-end
|
||||||
run: |
|
run: |
|
||||||
|
|||||||
19
.github/workflows/trufflehog.yml
vendored
19
.github/workflows/trufflehog.yml
vendored
@@ -1,10 +1,23 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
on:
|
on:
|
||||||
push:
|
push:
|
||||||
|
|
||||||
name: Secret Leaks
|
name: Secret Leaks
|
||||||
|
|
||||||
permissions:
|
permissions: {}
|
||||||
contents: read
|
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
trufflehog:
|
trufflehog:
|
||||||
@@ -14,6 +27,8 @@ jobs:
|
|||||||
uses: actions/checkout@v4
|
uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
fetch-depth: 0
|
fetch-depth: 0
|
||||||
|
persist-credentials: false
|
||||||
|
|
||||||
- name: Secret Scanning
|
- name: Secret Scanning
|
||||||
uses: trufflesecurity/trufflehog@main
|
uses: trufflesecurity/trufflehog@main
|
||||||
with:
|
with:
|
||||||
|
|||||||
26
.gitignore
vendored
26
.gitignore
vendored
@@ -1,3 +1,17 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
# Logging
|
# Logging
|
||||||
logs
|
logs
|
||||||
tmp
|
tmp
|
||||||
@@ -49,6 +63,10 @@ share/python-wheels/
|
|||||||
*.egg
|
*.egg
|
||||||
MANIFEST
|
MANIFEST
|
||||||
|
|
||||||
|
# uv/poetry lock files
|
||||||
|
poetry.lock
|
||||||
|
uv.lock
|
||||||
|
|
||||||
# PyInstaller
|
# PyInstaller
|
||||||
# Usually these files are written by a python script from a template
|
# Usually these files are written by a python script from a template
|
||||||
# before PyInstaller builds the exe, so as to inject date/other infos into it.
|
# before PyInstaller builds the exe, so as to inject date/other infos into it.
|
||||||
@@ -60,13 +78,12 @@ pip-log.txt
|
|||||||
pip-delete-this-directory.txt
|
pip-delete-this-directory.txt
|
||||||
|
|
||||||
# Unit test / coverage reports
|
# Unit test / coverage reports
|
||||||
!tests/data
|
!tests/artifacts
|
||||||
htmlcov/
|
htmlcov/
|
||||||
.tox/
|
.tox/
|
||||||
.nox/
|
.nox/
|
||||||
.coverage
|
.coverage
|
||||||
.coverage.*
|
.coverage.*
|
||||||
.cache
|
|
||||||
nosetests.xml
|
nosetests.xml
|
||||||
coverage.xml
|
coverage.xml
|
||||||
*.cover
|
*.cover
|
||||||
@@ -74,6 +91,11 @@ coverage.xml
|
|||||||
.hypothesis/
|
.hypothesis/
|
||||||
.pytest_cache/
|
.pytest_cache/
|
||||||
|
|
||||||
|
# Ignore .cache except calibration
|
||||||
|
.cache/*
|
||||||
|
!.cache/calibration/
|
||||||
|
!.cache/calibration/**
|
||||||
|
|
||||||
# Translations
|
# Translations
|
||||||
*.mo
|
*.mo
|
||||||
*.pot
|
*.pot
|
||||||
|
|||||||
@@ -1,9 +1,31 @@
|
|||||||
exclude: ^(tests/data)
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
exclude: "tests/artifacts/.*\\.safetensors$"
|
||||||
default_language_version:
|
default_language_version:
|
||||||
python: python3.10
|
python: python3.10
|
||||||
repos:
|
repos:
|
||||||
|
##### Meta #####
|
||||||
|
- repo: meta
|
||||||
|
hooks:
|
||||||
|
- id: check-useless-excludes
|
||||||
|
- id: check-hooks-apply
|
||||||
|
|
||||||
|
|
||||||
|
##### Style / Misc. #####
|
||||||
- repo: https://github.com/pre-commit/pre-commit-hooks
|
- repo: https://github.com/pre-commit/pre-commit-hooks
|
||||||
rev: v4.6.0
|
rev: v5.0.0
|
||||||
hooks:
|
hooks:
|
||||||
- id: check-added-large-files
|
- id: check-added-large-files
|
||||||
- id: debug-statements
|
- id: debug-statements
|
||||||
@@ -13,25 +35,40 @@ repos:
|
|||||||
- id: check-toml
|
- id: check-toml
|
||||||
- id: end-of-file-fixer
|
- id: end-of-file-fixer
|
||||||
- id: trailing-whitespace
|
- id: trailing-whitespace
|
||||||
|
|
||||||
|
- repo: https://github.com/crate-ci/typos
|
||||||
|
rev: v1.30.2
|
||||||
|
hooks:
|
||||||
|
- id: typos
|
||||||
|
args: [--force-exclude]
|
||||||
|
|
||||||
- repo: https://github.com/asottile/pyupgrade
|
- repo: https://github.com/asottile/pyupgrade
|
||||||
rev: v3.16.0
|
rev: v3.19.1
|
||||||
hooks:
|
hooks:
|
||||||
- id: pyupgrade
|
- id: pyupgrade
|
||||||
|
|
||||||
- repo: https://github.com/astral-sh/ruff-pre-commit
|
- repo: https://github.com/astral-sh/ruff-pre-commit
|
||||||
rev: v0.5.2
|
rev: v0.9.10
|
||||||
hooks:
|
hooks:
|
||||||
- id: ruff
|
- id: ruff
|
||||||
args: [--fix]
|
args: [--fix]
|
||||||
- id: ruff-format
|
- id: ruff-format
|
||||||
- repo: https://github.com/python-poetry/poetry
|
|
||||||
rev: 1.8.0
|
|
||||||
hooks:
|
##### Security #####
|
||||||
- id: poetry-check
|
|
||||||
- id: poetry-lock
|
|
||||||
args:
|
|
||||||
- "--check"
|
|
||||||
- "--no-update"
|
|
||||||
- repo: https://github.com/gitleaks/gitleaks
|
- repo: https://github.com/gitleaks/gitleaks
|
||||||
rev: v8.18.4
|
rev: v8.24.0
|
||||||
hooks:
|
hooks:
|
||||||
- id: gitleaks
|
- id: gitleaks
|
||||||
|
|
||||||
|
- repo: https://github.com/woodruffw/zizmor-pre-commit
|
||||||
|
rev: v1.4.1
|
||||||
|
hooks:
|
||||||
|
- id: zizmor
|
||||||
|
|
||||||
|
- repo: https://github.com/PyCQA/bandit
|
||||||
|
rev: 1.8.3
|
||||||
|
hooks:
|
||||||
|
- id: bandit
|
||||||
|
args: ["-c", "pyproject.toml"]
|
||||||
|
additional_dependencies: ["bandit[toml]"]
|
||||||
|
|||||||
@@ -20,7 +20,7 @@ Some of the ways you can contribute to 🤗 LeRobot:
|
|||||||
* Contributing to the examples or to the documentation.
|
* Contributing to the examples or to the documentation.
|
||||||
* Submitting issues related to bugs or desired new features.
|
* Submitting issues related to bugs or desired new features.
|
||||||
|
|
||||||
Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](remi.cadene@huggingface.co).
|
Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](mailto:remi.cadene@huggingface.co).
|
||||||
|
|
||||||
If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/orgs/huggingface/projects/46)
|
If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/orgs/huggingface/projects/46)
|
||||||
|
|
||||||
@@ -129,38 +129,71 @@ Follow these steps to start contributing:
|
|||||||
|
|
||||||
🚨 **Do not** work on the `main` branch.
|
🚨 **Do not** work on the `main` branch.
|
||||||
|
|
||||||
4. for development, we use `poetry` instead of just `pip` to easily track our dependencies.
|
4. for development, we advise to use a tool like `poetry` or `uv` instead of just `pip` to easily track our dependencies.
|
||||||
If you don't have it already, follow the [instructions](https://python-poetry.org/docs/#installation) to install it.
|
Follow the instructions to [install poetry](https://python-poetry.org/docs/#installation) (use a version >=2.1.0) or to [install uv](https://docs.astral.sh/uv/getting-started/installation/#installation-methods) if you don't have one of them already.
|
||||||
|
|
||||||
Set up a development environment with conda or miniconda:
|
Set up a development environment with conda or miniconda:
|
||||||
```bash
|
```bash
|
||||||
conda create -y -n lerobot-dev python=3.10 && conda activate lerobot-dev
|
conda create -y -n lerobot-dev python=3.10 && conda activate lerobot-dev
|
||||||
```
|
```
|
||||||
|
|
||||||
To develop on 🤗 LeRobot, you will at least need to install the `dev` and `test` extras dependencies along with the core library:
|
If you're using `uv`, it can manage python versions so you can instead do:
|
||||||
```bash
|
```bash
|
||||||
poetry install --sync --extras "dev test"
|
uv venv --python 3.10 && source .venv/bin/activate
|
||||||
|
```
|
||||||
|
|
||||||
|
To develop on 🤗 LeRobot, you will at least need to install the `dev` and `test` extras dependencies along with the core library:
|
||||||
|
|
||||||
|
using `poetry`
|
||||||
|
```bash
|
||||||
|
poetry sync --extras "dev test"
|
||||||
|
```
|
||||||
|
|
||||||
|
using `uv`
|
||||||
|
```bash
|
||||||
|
uv sync --extra dev --extra test
|
||||||
```
|
```
|
||||||
|
|
||||||
You can also install the project with all its dependencies (including environments):
|
You can also install the project with all its dependencies (including environments):
|
||||||
|
|
||||||
|
using `poetry`
|
||||||
```bash
|
```bash
|
||||||
poetry install --sync --all-extras
|
poetry sync --all-extras
|
||||||
|
```
|
||||||
|
|
||||||
|
using `uv`
|
||||||
|
```bash
|
||||||
|
uv sync --all-extras
|
||||||
```
|
```
|
||||||
|
|
||||||
> **Note:** If you don't install simulation environments with `--all-extras`, the tests that require them will be skipped when running the pytest suite locally. However, they *will* be tested in the CI. In general, we advise you to install everything and test locally before pushing.
|
> **Note:** If you don't install simulation environments with `--all-extras`, the tests that require them will be skipped when running the pytest suite locally. However, they *will* be tested in the CI. In general, we advise you to install everything and test locally before pushing.
|
||||||
|
|
||||||
Whichever command you chose to install the project (e.g. `poetry install --sync --all-extras`), you should run it again when pulling code with an updated version of `pyproject.toml` and `poetry.lock` in order to synchronize your virtual environment with the new dependencies.
|
Whichever command you chose to install the project (e.g. `poetry sync --all-extras`), you should run it again when pulling code with an updated version of `pyproject.toml` and `poetry.lock` in order to synchronize your virtual environment with the new dependencies.
|
||||||
|
|
||||||
The equivalent of `pip install some-package`, would just be:
|
The equivalent of `pip install some-package`, would just be:
|
||||||
|
|
||||||
|
using `poetry`
|
||||||
```bash
|
```bash
|
||||||
poetry add some-package
|
poetry add some-package
|
||||||
```
|
```
|
||||||
|
|
||||||
When making changes to the poetry sections of the `pyproject.toml`, you should run the following command to lock dependencies.
|
using `uv`
|
||||||
```bash
|
```bash
|
||||||
poetry lock --no-update
|
uv add some-package
|
||||||
```
|
```
|
||||||
|
|
||||||
|
When making changes to the poetry sections of the `pyproject.toml`, you should run the following command to lock dependencies.
|
||||||
|
using `poetry`
|
||||||
|
```bash
|
||||||
|
poetry lock
|
||||||
|
```
|
||||||
|
|
||||||
|
using `uv`
|
||||||
|
```bash
|
||||||
|
uv lock
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
5. Develop the features on your branch.
|
5. Develop the features on your branch.
|
||||||
|
|
||||||
As you work on the features, you should make sure that the test suite
|
As you work on the features, you should make sure that the test suite
|
||||||
@@ -195,7 +228,7 @@ Follow these steps to start contributing:
|
|||||||
git commit
|
git commit
|
||||||
```
|
```
|
||||||
|
|
||||||
Note, if you already commited some changes that have a wrong formatting, you can use:
|
Note, if you already committed some changes that have a wrong formatting, you can use:
|
||||||
```bash
|
```bash
|
||||||
pre-commit run --all-files
|
pre-commit run --all-files
|
||||||
```
|
```
|
||||||
@@ -258,7 +291,7 @@ sudo apt-get install git-lfs
|
|||||||
git lfs install
|
git lfs install
|
||||||
```
|
```
|
||||||
|
|
||||||
Pull artifacts if they're not in [tests/data](tests/data)
|
Pull artifacts if they're not in [tests/artifacts](tests/artifacts)
|
||||||
```bash
|
```bash
|
||||||
git lfs pull
|
git lfs pull
|
||||||
```
|
```
|
||||||
@@ -267,7 +300,7 @@ We use `pytest` in order to run the tests. From the root of the
|
|||||||
repository, here's how to run tests with `pytest` for the library:
|
repository, here's how to run tests with `pytest` for the library:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR="tests/data" python -m pytest -sv ./tests
|
python -m pytest -sv ./tests
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
250
Makefile
250
Makefile
@@ -1,11 +1,25 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
.PHONY: tests
|
.PHONY: tests
|
||||||
|
|
||||||
PYTHON_PATH := $(shell which python)
|
PYTHON_PATH := $(shell which python)
|
||||||
|
|
||||||
# If Poetry is installed, redefine PYTHON_PATH to use the Poetry-managed Python
|
# If uv is installed and a virtual environment exists, use it
|
||||||
POETRY_CHECK := $(shell command -v poetry)
|
UV_CHECK := $(shell command -v uv)
|
||||||
ifneq ($(POETRY_CHECK),)
|
ifneq ($(UV_CHECK),)
|
||||||
PYTHON_PATH := $(shell poetry run which python)
|
PYTHON_PATH := $(shell .venv/bin/python)
|
||||||
endif
|
endif
|
||||||
|
|
||||||
export PATH := $(dir $(PYTHON_PATH)):$(PATH)
|
export PATH := $(dir $(PYTHON_PATH)):$(PATH)
|
||||||
@@ -20,171 +34,109 @@ build-gpu:
|
|||||||
|
|
||||||
test-end-to-end:
|
test-end-to-end:
|
||||||
${MAKE} DEVICE=$(DEVICE) test-act-ete-train
|
${MAKE} DEVICE=$(DEVICE) test-act-ete-train
|
||||||
|
${MAKE} DEVICE=$(DEVICE) test-act-ete-train-resume
|
||||||
${MAKE} DEVICE=$(DEVICE) test-act-ete-eval
|
${MAKE} DEVICE=$(DEVICE) test-act-ete-eval
|
||||||
${MAKE} DEVICE=$(DEVICE) test-act-ete-train-amp
|
|
||||||
${MAKE} DEVICE=$(DEVICE) test-act-ete-eval-amp
|
|
||||||
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-train
|
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-train
|
||||||
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-eval
|
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-eval
|
||||||
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train
|
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train
|
||||||
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train-with-online
|
|
||||||
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-eval
|
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-eval
|
||||||
${MAKE} DEVICE=$(DEVICE) test-default-ete-eval
|
|
||||||
${MAKE} DEVICE=$(DEVICE) test-act-pusht-tutorial
|
|
||||||
|
|
||||||
test-act-ete-train:
|
test-act-ete-train:
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
policy=act \
|
--policy.type=act \
|
||||||
policy.dim_model=64 \
|
--policy.dim_model=64 \
|
||||||
env=aloha \
|
--policy.n_action_steps=20 \
|
||||||
wandb.enable=False \
|
--policy.chunk_size=20 \
|
||||||
training.offline_steps=2 \
|
--policy.device=$(DEVICE) \
|
||||||
training.online_steps=0 \
|
--env.type=aloha \
|
||||||
eval.n_episodes=1 \
|
--env.episode_length=5 \
|
||||||
eval.batch_size=1 \
|
--dataset.repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||||
device=$(DEVICE) \
|
--dataset.image_transforms.enable=true \
|
||||||
training.save_checkpoint=true \
|
--dataset.episodes="[0]" \
|
||||||
training.save_freq=2 \
|
--batch_size=2 \
|
||||||
policy.n_action_steps=20 \
|
--steps=4 \
|
||||||
policy.chunk_size=20 \
|
--eval_freq=2 \
|
||||||
training.batch_size=2 \
|
--eval.n_episodes=1 \
|
||||||
training.image_transforms.enable=true \
|
--eval.batch_size=1 \
|
||||||
hydra.run.dir=tests/outputs/act/
|
--save_freq=2 \
|
||||||
|
--save_checkpoint=true \
|
||||||
|
--log_freq=1 \
|
||||||
|
--wandb.enable=false \
|
||||||
|
--output_dir=tests/outputs/act/
|
||||||
|
|
||||||
|
test-act-ete-train-resume:
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--config_path=tests/outputs/act/checkpoints/000002/pretrained_model/train_config.json \
|
||||||
|
--resume=true
|
||||||
|
|
||||||
test-act-ete-eval:
|
test-act-ete-eval:
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py \
|
||||||
-p tests/outputs/act/checkpoints/000002/pretrained_model \
|
--policy.path=tests/outputs/act/checkpoints/000004/pretrained_model \
|
||||||
eval.n_episodes=1 \
|
--policy.device=$(DEVICE) \
|
||||||
eval.batch_size=1 \
|
--env.type=aloha \
|
||||||
env.episode_length=8 \
|
--env.episode_length=5 \
|
||||||
device=$(DEVICE) \
|
--eval.n_episodes=1 \
|
||||||
|
--eval.batch_size=1
|
||||||
test-act-ete-train-amp:
|
|
||||||
python lerobot/scripts/train.py \
|
|
||||||
policy=act \
|
|
||||||
policy.dim_model=64 \
|
|
||||||
env=aloha \
|
|
||||||
wandb.enable=False \
|
|
||||||
training.offline_steps=2 \
|
|
||||||
training.online_steps=0 \
|
|
||||||
eval.n_episodes=1 \
|
|
||||||
eval.batch_size=1 \
|
|
||||||
device=$(DEVICE) \
|
|
||||||
training.save_checkpoint=true \
|
|
||||||
training.save_freq=2 \
|
|
||||||
policy.n_action_steps=20 \
|
|
||||||
policy.chunk_size=20 \
|
|
||||||
training.batch_size=2 \
|
|
||||||
hydra.run.dir=tests/outputs/act_amp/ \
|
|
||||||
training.image_transforms.enable=true \
|
|
||||||
use_amp=true
|
|
||||||
|
|
||||||
test-act-ete-eval-amp:
|
|
||||||
python lerobot/scripts/eval.py \
|
|
||||||
-p tests/outputs/act_amp/checkpoints/000002/pretrained_model \
|
|
||||||
eval.n_episodes=1 \
|
|
||||||
eval.batch_size=1 \
|
|
||||||
env.episode_length=8 \
|
|
||||||
device=$(DEVICE) \
|
|
||||||
use_amp=true
|
|
||||||
|
|
||||||
test-diffusion-ete-train:
|
test-diffusion-ete-train:
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
policy=diffusion \
|
--policy.type=diffusion \
|
||||||
policy.down_dims=\[64,128,256\] \
|
--policy.down_dims='[64,128,256]' \
|
||||||
policy.diffusion_step_embed_dim=32 \
|
--policy.diffusion_step_embed_dim=32 \
|
||||||
policy.num_inference_steps=10 \
|
--policy.num_inference_steps=10 \
|
||||||
env=pusht \
|
--policy.device=$(DEVICE) \
|
||||||
wandb.enable=False \
|
--env.type=pusht \
|
||||||
training.offline_steps=2 \
|
--env.episode_length=5 \
|
||||||
training.online_steps=0 \
|
--dataset.repo_id=lerobot/pusht \
|
||||||
eval.n_episodes=1 \
|
--dataset.image_transforms.enable=true \
|
||||||
eval.batch_size=1 \
|
--dataset.episodes="[0]" \
|
||||||
device=$(DEVICE) \
|
--batch_size=2 \
|
||||||
training.save_checkpoint=true \
|
--steps=2 \
|
||||||
training.save_freq=2 \
|
--eval_freq=2 \
|
||||||
training.batch_size=2 \
|
--eval.n_episodes=1 \
|
||||||
training.image_transforms.enable=true \
|
--eval.batch_size=1 \
|
||||||
hydra.run.dir=tests/outputs/diffusion/
|
--save_checkpoint=true \
|
||||||
|
--save_freq=2 \
|
||||||
|
--log_freq=1 \
|
||||||
|
--wandb.enable=false \
|
||||||
|
--output_dir=tests/outputs/diffusion/
|
||||||
|
|
||||||
test-diffusion-ete-eval:
|
test-diffusion-ete-eval:
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py \
|
||||||
-p tests/outputs/diffusion/checkpoints/000002/pretrained_model \
|
--policy.path=tests/outputs/diffusion/checkpoints/000002/pretrained_model \
|
||||||
eval.n_episodes=1 \
|
--policy.device=$(DEVICE) \
|
||||||
eval.batch_size=1 \
|
--env.type=pusht \
|
||||||
env.episode_length=8 \
|
--env.episode_length=5 \
|
||||||
device=$(DEVICE) \
|
--eval.n_episodes=1 \
|
||||||
|
--eval.batch_size=1
|
||||||
|
|
||||||
test-tdmpc-ete-train:
|
test-tdmpc-ete-train:
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
policy=tdmpc \
|
--policy.type=tdmpc \
|
||||||
env=xarm \
|
--policy.device=$(DEVICE) \
|
||||||
env.task=XarmLift-v0 \
|
--env.type=xarm \
|
||||||
dataset_repo_id=lerobot/xarm_lift_medium \
|
--env.task=XarmLift-v0 \
|
||||||
wandb.enable=False \
|
--env.episode_length=5 \
|
||||||
training.offline_steps=2 \
|
--dataset.repo_id=lerobot/xarm_lift_medium \
|
||||||
training.online_steps=0 \
|
--dataset.image_transforms.enable=true \
|
||||||
eval.n_episodes=1 \
|
--dataset.episodes="[0]" \
|
||||||
eval.batch_size=1 \
|
--batch_size=2 \
|
||||||
env.episode_length=2 \
|
--steps=2 \
|
||||||
device=$(DEVICE) \
|
--eval_freq=2 \
|
||||||
training.save_checkpoint=true \
|
--eval.n_episodes=1 \
|
||||||
training.save_freq=2 \
|
--eval.batch_size=1 \
|
||||||
training.batch_size=2 \
|
--save_checkpoint=true \
|
||||||
training.image_transforms.enable=true \
|
--save_freq=2 \
|
||||||
hydra.run.dir=tests/outputs/tdmpc/
|
--log_freq=1 \
|
||||||
|
--wandb.enable=false \
|
||||||
test-tdmpc-ete-train-with-online:
|
--output_dir=tests/outputs/tdmpc/
|
||||||
python lerobot/scripts/train.py \
|
|
||||||
env=pusht \
|
|
||||||
env.gym.obs_type=environment_state_agent_pos \
|
|
||||||
policy=tdmpc_pusht_keypoints \
|
|
||||||
eval.n_episodes=1 \
|
|
||||||
eval.batch_size=1 \
|
|
||||||
env.episode_length=10 \
|
|
||||||
device=$(DEVICE) \
|
|
||||||
training.offline_steps=2 \
|
|
||||||
training.online_steps=20 \
|
|
||||||
training.save_checkpoint=false \
|
|
||||||
training.save_freq=10 \
|
|
||||||
training.batch_size=2 \
|
|
||||||
training.online_rollout_n_episodes=2 \
|
|
||||||
training.online_rollout_batch_size=2 \
|
|
||||||
training.online_steps_between_rollouts=10 \
|
|
||||||
training.online_buffer_capacity=15 \
|
|
||||||
eval.use_async_envs=true \
|
|
||||||
hydra.run.dir=tests/outputs/tdmpc_online/
|
|
||||||
|
|
||||||
|
|
||||||
test-tdmpc-ete-eval:
|
test-tdmpc-ete-eval:
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py \
|
||||||
-p tests/outputs/tdmpc/checkpoints/000002/pretrained_model \
|
--policy.path=tests/outputs/tdmpc/checkpoints/000002/pretrained_model \
|
||||||
eval.n_episodes=1 \
|
--policy.device=$(DEVICE) \
|
||||||
eval.batch_size=1 \
|
--env.type=xarm \
|
||||||
env.episode_length=8 \
|
--env.episode_length=5 \
|
||||||
device=$(DEVICE) \
|
--env.task=XarmLift-v0 \
|
||||||
|
--eval.n_episodes=1 \
|
||||||
test-default-ete-eval:
|
--eval.batch_size=1
|
||||||
python lerobot/scripts/eval.py \
|
|
||||||
--config lerobot/configs/default.yaml \
|
|
||||||
eval.n_episodes=1 \
|
|
||||||
eval.batch_size=1 \
|
|
||||||
env.episode_length=8 \
|
|
||||||
device=$(DEVICE) \
|
|
||||||
|
|
||||||
test-act-pusht-tutorial:
|
|
||||||
cp examples/advanced/1_train_act_pusht/act_pusht.yaml lerobot/configs/policy/created_by_Makefile.yaml
|
|
||||||
python lerobot/scripts/train.py \
|
|
||||||
policy=created_by_Makefile.yaml \
|
|
||||||
env=pusht \
|
|
||||||
wandb.enable=False \
|
|
||||||
training.offline_steps=2 \
|
|
||||||
eval.n_episodes=1 \
|
|
||||||
eval.batch_size=1 \
|
|
||||||
env.episode_length=2 \
|
|
||||||
device=$(DEVICE) \
|
|
||||||
training.save_model=true \
|
|
||||||
training.save_freq=2 \
|
|
||||||
training.batch_size=2 \
|
|
||||||
training.image_transforms.enable=true \
|
|
||||||
hydra.run.dir=tests/outputs/act_pusht/
|
|
||||||
rm lerobot/configs/policy/created_by_Makefile.yaml
|
|
||||||
|
|||||||
122
README.md
122
README.md
@@ -23,20 +23,30 @@
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<h2 align="center">
|
<h2 align="center">
|
||||||
<p><a href="https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md">Hot new tutorial: Getting started with real-world robots</a></p>
|
<p><a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">
|
||||||
|
Build Your Own SO-100 Robot!</a></p>
|
||||||
</h2>
|
</h2>
|
||||||
|
|
||||||
<div align="center">
|
<div align="center">
|
||||||
<img src="media/tutorial/koch_v1_1_leader_follower.webp?raw=true" alt="Koch v1.1 leader and follower arms" title="Koch v1.1 leader and follower arms" width="50%">
|
<img src="media/so100/leader_follower.webp?raw=true" alt="SO-100 leader and follower arms" title="SO-100 leader and follower arms" width="50%">
|
||||||
<p>We just dropped an in-depth tutorial on how to build your own robot!</p>
|
|
||||||
<p>Teach it new skills by showing it a few moves with just a laptop.</p>
|
<p><strong>Meet the SO-100 – Just $110 per arm!</strong></p>
|
||||||
<p>Then watch your homemade robot act autonomously 🤯</p>
|
<p>Train it in minutes with a few simple moves on your laptop.</p>
|
||||||
<p>For more info, see <a href="https://x.com/RemiCadene/status/1825455895561859185">our thread on X</a> or <a href="https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md">our tutorial page</a>.</p>
|
<p>Then sit back and watch your creation act autonomously! 🤯</p>
|
||||||
|
|
||||||
|
<p><a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">
|
||||||
|
Get the full SO-100 tutorial here.</a></p>
|
||||||
|
|
||||||
|
<p>Want to take it to the next level? Make your SO-100 mobile by building LeKiwi!</p>
|
||||||
|
<p>Check out the <a href="https://github.com/huggingface/lerobot/blob/main/examples/11_use_lekiwi.md">LeKiwi tutorial</a> and bring your robot to life on wheels.</p>
|
||||||
|
|
||||||
|
<img src="media/lekiwi/kiwi.webp?raw=true" alt="LeKiwi mobile robot" title="LeKiwi mobile robot" width="50%">
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<br/>
|
||||||
|
|
||||||
<h3 align="center">
|
<h3 align="center">
|
||||||
<p>State-of-the-art AI for real-world robotics</p>
|
<p>LeRobot: State-of-the-art AI for real-world robotics</p>
|
||||||
</h3>
|
</h3>
|
||||||
|
|
||||||
---
|
---
|
||||||
@@ -54,9 +64,9 @@
|
|||||||
|
|
||||||
<table>
|
<table>
|
||||||
<tr>
|
<tr>
|
||||||
<td><img src="http://remicadene.com/assets/gif/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
|
<td><img src="media/gym/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
|
||||||
<td><img src="http://remicadene.com/assets/gif/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
|
<td><img src="media/gym/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
|
||||||
<td><img src="http://remicadene.com/assets/gif/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
|
<td><img src="media/gym/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td align="center">ACT policy on ALOHA env</td>
|
<td align="center">ACT policy on ALOHA env</td>
|
||||||
@@ -67,7 +77,7 @@
|
|||||||
|
|
||||||
### Acknowledgment
|
### Acknowledgment
|
||||||
|
|
||||||
- Thanks to Tony Zaho, Zipeng Fu and colleagues for open sourcing ACT policy, ALOHA environments and datasets. Ours are adapted from [ALOHA](https://tonyzhaozh.github.io/aloha) and [Mobile ALOHA](https://mobile-aloha.github.io).
|
- Thanks to Tony Zhao, Zipeng Fu and colleagues for open sourcing ACT policy, ALOHA environments and datasets. Ours are adapted from [ALOHA](https://tonyzhaozh.github.io/aloha) and [Mobile ALOHA](https://mobile-aloha.github.io).
|
||||||
- Thanks to Cheng Chi, Zhenjia Xu and colleagues for open sourcing Diffusion policy, Pusht environment and datasets, as well as UMI datasets. Ours are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu) and [UMI Gripper](https://umi-gripper.github.io).
|
- Thanks to Cheng Chi, Zhenjia Xu and colleagues for open sourcing Diffusion policy, Pusht environment and datasets, as well as UMI datasets. Ours are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu) and [UMI Gripper](https://umi-gripper.github.io).
|
||||||
- Thanks to Nicklas Hansen, Yunhai Feng and colleagues for open sourcing TDMPC policy, Simxarm environments and datasets. Ours are adapted from [TDMPC](https://github.com/nicklashansen/tdmpc) and [FOWM](https://www.yunhaifeng.com/FOWM).
|
- Thanks to Nicklas Hansen, Yunhai Feng and colleagues for open sourcing TDMPC policy, Simxarm environments and datasets. Ours are adapted from [TDMPC](https://github.com/nicklashansen/tdmpc) and [FOWM](https://www.yunhaifeng.com/FOWM).
|
||||||
- Thanks to Antonio Loquercio and Ashish Kumar for their early support.
|
- Thanks to Antonio Loquercio and Ashish Kumar for their early support.
|
||||||
@@ -121,10 +131,7 @@ wandb login
|
|||||||
├── examples # contains demonstration examples, start here to learn about LeRobot
|
├── examples # contains demonstration examples, start here to learn about LeRobot
|
||||||
| └── advanced # contains even more examples for those who have mastered the basics
|
| └── advanced # contains even more examples for those who have mastered the basics
|
||||||
├── lerobot
|
├── lerobot
|
||||||
| ├── configs # contains hydra yaml files with all options that you can override in the command line
|
| ├── configs # contains config classes with all options that you can override in the command line
|
||||||
| | ├── default.yaml # selected by default, it loads pusht environment and diffusion policy
|
|
||||||
| | ├── env # various sim environments and their datasets: aloha.yaml, pusht.yaml, xarm.yaml
|
|
||||||
| | └── policy # various policies: act.yaml, diffusion.yaml, tdmpc.yaml
|
|
||||||
| ├── common # contains classes and utilities
|
| ├── common # contains classes and utilities
|
||||||
| | ├── datasets # various datasets of human demonstrations: aloha, pusht, xarm
|
| | ├── datasets # various datasets of human demonstrations: aloha, pusht, xarm
|
||||||
| | ├── envs # various sim environments: aloha, pusht, xarm
|
| | ├── envs # various sim environments: aloha, pusht, xarm
|
||||||
@@ -143,7 +150,7 @@ wandb login
|
|||||||
|
|
||||||
### Visualize datasets
|
### Visualize datasets
|
||||||
|
|
||||||
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically download data from the Hugging Face hub.
|
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically downloads data from the Hugging Face hub.
|
||||||
|
|
||||||
You can also locally visualize episodes from a dataset on the hub by executing our script from the command line:
|
You can also locally visualize episodes from a dataset on the hub by executing our script from the command line:
|
||||||
```bash
|
```bash
|
||||||
@@ -152,10 +159,12 @@ python lerobot/scripts/visualize_dataset.py \
|
|||||||
--episode-index 0
|
--episode-index 0
|
||||||
```
|
```
|
||||||
|
|
||||||
or from a dataset in a local folder with the root `DATA_DIR` environment variable (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
|
or from a dataset in a local folder with the `root` option and the `--local-files-only` (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR='./my_local_data_dir' python lerobot/scripts/visualize_dataset.py \
|
python lerobot/scripts/visualize_dataset.py \
|
||||||
--repo-id lerobot/pusht \
|
--repo-id lerobot/pusht \
|
||||||
|
--root ./my_local_data_dir \
|
||||||
|
--local-files-only 1 \
|
||||||
--episode-index 0
|
--episode-index 0
|
||||||
```
|
```
|
||||||
|
|
||||||
@@ -207,12 +216,10 @@ dataset attributes:
|
|||||||
|
|
||||||
A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
|
A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
|
||||||
- hf_dataset stored using Hugging Face datasets library serialization to parquet
|
- hf_dataset stored using Hugging Face datasets library serialization to parquet
|
||||||
- videos are stored in mp4 format to save space or png files
|
- videos are stored in mp4 format to save space
|
||||||
- episode_data_index saved using `safetensor` tensor serialization format
|
- metadata are stored in plain json/jsonl files
|
||||||
- stats saved using `safetensor` tensor serialization format
|
|
||||||
- info are saved using JSON
|
|
||||||
|
|
||||||
Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can set the `DATA_DIR` environment variable to your root dataset folder as illustrated in the above section on dataset visualization.
|
Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can specify its location with the `root` argument if it's not in the default `~/.cache/huggingface/lerobot` location.
|
||||||
|
|
||||||
### Evaluate a pretrained policy
|
### Evaluate a pretrained policy
|
||||||
|
|
||||||
@@ -221,80 +228,48 @@ Check out [example 2](./examples/2_evaluate_pretrained_policy.py) that illustrat
|
|||||||
We also provide a more capable script to parallelize the evaluation over multiple environments during the same rollout. Here is an example with a pretrained model hosted on [lerobot/diffusion_pusht](https://huggingface.co/lerobot/diffusion_pusht):
|
We also provide a more capable script to parallelize the evaluation over multiple environments during the same rollout. Here is an example with a pretrained model hosted on [lerobot/diffusion_pusht](https://huggingface.co/lerobot/diffusion_pusht):
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py \
|
||||||
-p lerobot/diffusion_pusht \
|
--policy.path=lerobot/diffusion_pusht \
|
||||||
eval.n_episodes=10 \
|
--env.type=pusht \
|
||||||
eval.batch_size=10
|
--eval.batch_size=10 \
|
||||||
|
--eval.n_episodes=10 \
|
||||||
|
--policy.use_amp=false \
|
||||||
|
--policy.device=cuda
|
||||||
```
|
```
|
||||||
|
|
||||||
Note: After training your own policy, you can re-evaluate the checkpoints with:
|
Note: After training your own policy, you can re-evaluate the checkpoints with:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/eval.py -p {OUTPUT_DIR}/checkpoints/last/pretrained_model
|
python lerobot/scripts/eval.py --policy.path={OUTPUT_DIR}/checkpoints/last/pretrained_model
|
||||||
```
|
```
|
||||||
|
|
||||||
See `python lerobot/scripts/eval.py --help` for more instructions.
|
See `python lerobot/scripts/eval.py --help` for more instructions.
|
||||||
|
|
||||||
### Train your own policy
|
### Train your own policy
|
||||||
|
|
||||||
Check out [example 3](./examples/3_train_policy.py) that illustrates how to train a model using our core library in python, and [example 4](./examples/4_train_policy_with_script.md) that shows how to use our training script from command line.
|
Check out [example 3](./examples/3_train_policy.py) that illustrate how to train a model using our core library in python, and [example 4](./examples/4_train_policy_with_script.md) that shows how to use our training script from command line.
|
||||||
|
|
||||||
In general, you can use our training script to easily train any policy. Here is an example of training the ACT policy on trajectories collected by humans on the Aloha simulation environment for the insertion task:
|
To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding `--wandb.enable=true`.
|
||||||
|
|
||||||
```bash
|
A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser. Please also check [here](./examples/4_train_policy_with_script.md#typical-logs-and-metrics) for the explanation of some commonly used metrics in logs.
|
||||||
python lerobot/scripts/train.py \
|
|
||||||
policy=act \
|
|
||||||
env=aloha \
|
|
||||||
env.task=AlohaInsertion-v0 \
|
|
||||||
dataset_repo_id=lerobot/aloha_sim_insertion_human \
|
|
||||||
```
|
|
||||||
|
|
||||||
The experiment directory is automatically generated and will show up in yellow in your terminal. It looks like `outputs/train/2024-05-05/20-21-12_aloha_act_default`. You can manually specify an experiment directory by adding this argument to the `train.py` python command:
|
|
||||||
```bash
|
|
||||||
hydra.run.dir=your/new/experiment/dir
|
|
||||||
```
|
|
||||||
|
|
||||||
In the experiment directory there will be a folder called `checkpoints` which will have the following structure:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
checkpoints
|
|
||||||
├── 000250 # checkpoint_dir for training step 250
|
|
||||||
│ ├── pretrained_model # Hugging Face pretrained model dir
|
|
||||||
│ │ ├── config.json # Hugging Face pretrained model config
|
|
||||||
│ │ ├── config.yaml # consolidated Hydra config
|
|
||||||
│ │ ├── model.safetensors # model weights
|
|
||||||
│ │ └── README.md # Hugging Face model card
|
|
||||||
│ └── training_state.pth # optimizer/scheduler/rng state and training step
|
|
||||||
```
|
|
||||||
|
|
||||||
To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
wandb.enable=true
|
|
||||||
```
|
|
||||||
|
|
||||||
A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser:
|
|
||||||
|
|
||||||

|

|
||||||
|
|
||||||
Note: For efficiency, during training every checkpoint is evaluated on a low number of episodes. You may use `eval.n_episodes=500` to evaluate on more episodes than the default. Or, after training, you may want to re-evaluate your best checkpoints on more episodes or change the evaluation settings. See `python lerobot/scripts/eval.py --help` for more instructions.
|
Note: For efficiency, during training every checkpoint is evaluated on a low number of episodes. You may use `--eval.n_episodes=500` to evaluate on more episodes than the default. Or, after training, you may want to re-evaluate your best checkpoints on more episodes or change the evaluation settings. See `python lerobot/scripts/eval.py --help` for more instructions.
|
||||||
|
|
||||||
#### Reproduce state-of-the-art (SOTA)
|
#### Reproduce state-of-the-art (SOTA)
|
||||||
|
|
||||||
We have organized our configuration files (found under [`lerobot/configs`](./lerobot/configs)) such that they reproduce SOTA results from a given model variant in their respective original works. Simply running:
|
We provide some pretrained policies on our [hub page](https://huggingface.co/lerobot) that can achieve state-of-the-art performances.
|
||||||
|
You can reproduce their training by loading the config from their run. Simply running:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py policy=diffusion env=pusht
|
python lerobot/scripts/train.py --config_path=lerobot/diffusion_pusht
|
||||||
```
|
```
|
||||||
|
|
||||||
reproduces SOTA results for Diffusion Policy on the PushT task.
|
reproduces SOTA results for Diffusion Policy on the PushT task.
|
||||||
|
|
||||||
Pretrained policies, along with reproduction details, can be found under the "Models" section of https://huggingface.co/lerobot.
|
|
||||||
|
|
||||||
## Contribute
|
## Contribute
|
||||||
|
|
||||||
If you would like to contribute to 🤗 LeRobot, please check out our [contribution guide](https://github.com/huggingface/lerobot/blob/main/CONTRIBUTING.md).
|
If you would like to contribute to 🤗 LeRobot, please check out our [contribution guide](https://github.com/huggingface/lerobot/blob/main/CONTRIBUTING.md).
|
||||||
|
|
||||||
### Add a new dataset
|
<!-- ### Add a new dataset
|
||||||
|
|
||||||
To add a dataset to the hub, you need to login using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
To add a dataset to the hub, you need to login using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
```bash
|
```bash
|
||||||
@@ -312,7 +287,7 @@ python lerobot/scripts/push_dataset_to_hub.py \
|
|||||||
|
|
||||||
See `python lerobot/scripts/push_dataset_to_hub.py --help` for more instructions.
|
See `python lerobot/scripts/push_dataset_to_hub.py --help` for more instructions.
|
||||||
|
|
||||||
If your dataset format is not supported, implement your own in `lerobot/common/datasets/push_dataset_to_hub/${raw_format}_format.py` by copying examples like [pusht_zarr](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/pusht_zarr_format.py), [umi_zarr](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/umi_zarr_format.py), [aloha_hdf5](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/aloha_hdf5_format.py), or [xarm_pkl](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/xarm_pkl_format.py).
|
If your dataset format is not supported, implement your own in `lerobot/common/datasets/push_dataset_to_hub/${raw_format}_format.py` by copying examples like [pusht_zarr](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/pusht_zarr_format.py), [umi_zarr](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/umi_zarr_format.py), [aloha_hdf5](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/aloha_hdf5_format.py), or [xarm_pkl](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/xarm_pkl_format.py). -->
|
||||||
|
|
||||||
|
|
||||||
### Add a pretrained policy
|
### Add a pretrained policy
|
||||||
@@ -322,7 +297,7 @@ Once you have trained a policy you may upload it to the Hugging Face hub using a
|
|||||||
You first need to find the checkpoint folder located inside your experiment directory (e.g. `outputs/train/2024-05-05/20-21-12_aloha_act_default/checkpoints/002500`). Within that there is a `pretrained_model` directory which should contain:
|
You first need to find the checkpoint folder located inside your experiment directory (e.g. `outputs/train/2024-05-05/20-21-12_aloha_act_default/checkpoints/002500`). Within that there is a `pretrained_model` directory which should contain:
|
||||||
- `config.json`: A serialized version of the policy configuration (following the policy's dataclass config).
|
- `config.json`: A serialized version of the policy configuration (following the policy's dataclass config).
|
||||||
- `model.safetensors`: A set of `torch.nn.Module` parameters, saved in [Hugging Face Safetensors](https://huggingface.co/docs/safetensors/index) format.
|
- `model.safetensors`: A set of `torch.nn.Module` parameters, saved in [Hugging Face Safetensors](https://huggingface.co/docs/safetensors/index) format.
|
||||||
- `config.yaml`: A consolidated Hydra training configuration containing the policy, environment, and dataset configs. The policy configuration should match `config.json` exactly. The environment config is useful for anyone who wants to evaluate your policy. The dataset config just serves as a paper trail for reproducibility.
|
- `train_config.json`: A consolidated configuration containing all parameter userd for training. The policy configuration should match `config.json` exactly. Thisis useful for anyone who wants to evaluate your policy or for reproducibility.
|
||||||
|
|
||||||
To upload these to the hub, run the following:
|
To upload these to the hub, run the following:
|
||||||
```bash
|
```bash
|
||||||
@@ -409,3 +384,6 @@ Additionally, if you are using any of the particular policy architecture, pretra
|
|||||||
year={2024}
|
year={2024}
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
## Star History
|
||||||
|
|
||||||
|
[](https://star-history.com/#huggingface/lerobot&Timeline)
|
||||||
|
|||||||
@@ -21,7 +21,7 @@ How to decode videos?
|
|||||||
|
|
||||||
## Variables
|
## Variables
|
||||||
**Image content & size**
|
**Image content & size**
|
||||||
We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an appartment, or in a factory, or outdoor, or with lots of moving objects in the scene, etc. Similarly, loading times might not vary linearly with the image size (resolution).
|
We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an apartment, or in a factory, or outdoor, or with lots of moving objects in the scene, etc. Similarly, loading times might not vary linearly with the image size (resolution).
|
||||||
For these reasons, we run this benchmark on four representative datasets:
|
For these reasons, we run this benchmark on four representative datasets:
|
||||||
- `lerobot/pusht_image`: (96 x 96 pixels) simulation with simple geometric shapes, fixed camera.
|
- `lerobot/pusht_image`: (96 x 96 pixels) simulation with simple geometric shapes, fixed camera.
|
||||||
- `aliberts/aloha_mobile_shrimp_image`: (480 x 640 pixels) real-world indoor, moving camera.
|
- `aliberts/aloha_mobile_shrimp_image`: (480 x 640 pixels) real-world indoor, moving camera.
|
||||||
@@ -63,7 +63,7 @@ This of course is affected by the `-g` parameter during encoding, which specifie
|
|||||||
|
|
||||||
Note that this differs significantly from a typical use case like watching a movie, in which every frame is loaded sequentially from the beginning to the end and it's acceptable to have big values for `-g`.
|
Note that this differs significantly from a typical use case like watching a movie, in which every frame is loaded sequentially from the beginning to the end and it's acceptable to have big values for `-g`.
|
||||||
|
|
||||||
Additionally, because some policies might request single timestamps that are a few frames appart, we also have the following scenario:
|
Additionally, because some policies might request single timestamps that are a few frames apart, we also have the following scenario:
|
||||||
- `2_frames_4_space`: 2 frames with 4 consecutive frames of spacing in between (e.g `[t, t + 5 / fps]`),
|
- `2_frames_4_space`: 2 frames with 4 consecutive frames of spacing in between (e.g `[t, t + 5 / fps]`),
|
||||||
|
|
||||||
However, due to how video decoding is implemented with `pyav`, we don't have access to an accurate seek so in practice this scenario is essentially the same as `6_frames` since all 6 frames between `t` and `t + 5 / fps` will be decoded.
|
However, due to how video decoding is implemented with `pyav`, we don't have access to an accurate seek so in practice this scenario is essentially the same as `6_frames` since all 6 frames between `t` and `t + 5 / fps` will be decoded.
|
||||||
@@ -85,8 +85,8 @@ However, due to how video decoding is implemented with `pyav`, we don't have acc
|
|||||||
**Average Structural Similarity Index Measure (higher is better)**
|
**Average Structural Similarity Index Measure (higher is better)**
|
||||||
`avg_ssim` evaluates the perceived quality of images by comparing luminance, contrast, and structure. SSIM values range from -1 to 1, where 1 indicates perfect similarity.
|
`avg_ssim` evaluates the perceived quality of images by comparing luminance, contrast, and structure. SSIM values range from -1 to 1, where 1 indicates perfect similarity.
|
||||||
|
|
||||||
One aspect that can't be measured here with those metrics is the compatibility of the encoding accross platforms, in particular on web browser, for visualization purposes.
|
One aspect that can't be measured here with those metrics is the compatibility of the encoding across platforms, in particular on web browser, for visualization purposes.
|
||||||
h264, h265 and AV1 are all commonly used codecs and should not be pose an issue. However, the chroma subsampling (`pix_fmt`) format might affect compatibility:
|
h264, h265 and AV1 are all commonly used codecs and should not pose an issue. However, the chroma subsampling (`pix_fmt`) format might affect compatibility:
|
||||||
- `yuv420p` is more widely supported across various platforms, including web browsers.
|
- `yuv420p` is more widely supported across various platforms, including web browsers.
|
||||||
- `yuv444p` offers higher color fidelity but might not be supported as broadly.
|
- `yuv444p` offers higher color fidelity but might not be supported as broadly.
|
||||||
|
|
||||||
@@ -114,9 +114,9 @@ We tried to measure the most impactful parameters for both encoding and decoding
|
|||||||
|
|
||||||
Additional encoding parameters exist that are not included in this benchmark. In particular:
|
Additional encoding parameters exist that are not included in this benchmark. In particular:
|
||||||
- `-preset` which allows for selecting encoding presets. This represents a collection of options that will provide a certain encoding speed to compression ratio. By leaving this parameter unspecified, it is considered to be `medium` for libx264 and libx265 and `8` for libsvtav1.
|
- `-preset` which allows for selecting encoding presets. This represents a collection of options that will provide a certain encoding speed to compression ratio. By leaving this parameter unspecified, it is considered to be `medium` for libx264 and libx265 and `8` for libsvtav1.
|
||||||
- `-tune` which allows to optimize the encoding for certains aspects (e.g. film quality, fast decoding, etc.).
|
- `-tune` which allows to optimize the encoding for certain aspects (e.g. film quality, fast decoding, etc.).
|
||||||
|
|
||||||
See the documentation mentioned above for more detailled info on these settings and for a more comprehensive list of other parameters.
|
See the documentation mentioned above for more detailed info on these settings and for a more comprehensive list of other parameters.
|
||||||
|
|
||||||
Similarly on the decoding side, other decoders exist but are not implemented in our current benchmark. To name a few:
|
Similarly on the decoding side, other decoders exist but are not implemented in our current benchmark. To name a few:
|
||||||
- `torchaudio`
|
- `torchaudio`
|
||||||
|
|||||||
@@ -266,7 +266,7 @@ def benchmark_encoding_decoding(
|
|||||||
)
|
)
|
||||||
|
|
||||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||||
width, height = tuple(dataset[0][dataset.camera_keys[0]].shape[-2:])
|
width, height = tuple(dataset[0][dataset.meta.camera_keys[0]].shape[-2:])
|
||||||
num_pixels = width * height
|
num_pixels = width * height
|
||||||
video_size_bytes = video_path.stat().st_size
|
video_size_bytes = video_path.stat().st_size
|
||||||
images_size_bytes = get_directory_size(imgs_dir)
|
images_size_bytes = get_directory_size(imgs_dir)
|
||||||
|
|||||||
@@ -1,32 +1,29 @@
|
|||||||
# Configure image
|
# Configure image
|
||||||
ARG PYTHON_VERSION=3.10
|
ARG PYTHON_VERSION=3.10
|
||||||
|
|
||||||
FROM python:${PYTHON_VERSION}-slim
|
FROM python:${PYTHON_VERSION}-slim
|
||||||
|
|
||||||
|
# Configure environment variables
|
||||||
ARG PYTHON_VERSION
|
ARG PYTHON_VERSION
|
||||||
ARG DEBIAN_FRONTEND=noninteractive
|
ENV DEBIAN_FRONTEND=noninteractive
|
||||||
|
ENV MUJOCO_GL="egl"
|
||||||
# Install apt dependencies
|
|
||||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
|
||||||
build-essential cmake \
|
|
||||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
|
||||||
speech-dispatcher \
|
|
||||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
|
||||||
|
|
||||||
# Create virtual environment
|
|
||||||
RUN ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python
|
|
||||||
RUN python -m venv /opt/venv
|
|
||||||
ENV PATH="/opt/venv/bin:$PATH"
|
ENV PATH="/opt/venv/bin:$PATH"
|
||||||
RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
|
||||||
|
|
||||||
# Install LeRobot
|
# Install dependencies and set up Python in a single layer
|
||||||
|
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||||
|
build-essential cmake git \
|
||||||
|
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||||
|
speech-dispatcher libgeos-dev \
|
||||||
|
&& ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python \
|
||||||
|
&& python -m venv /opt/venv \
|
||||||
|
&& apt-get clean && rm -rf /var/lib/apt/lists/* \
|
||||||
|
&& echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
||||||
|
|
||||||
|
# Clone repository and install LeRobot in a single layer
|
||||||
COPY . /lerobot
|
COPY . /lerobot
|
||||||
WORKDIR /lerobot
|
WORKDIR /lerobot
|
||||||
RUN pip install --upgrade --no-cache-dir pip
|
RUN /opt/venv/bin/pip install --upgrade --no-cache-dir pip \
|
||||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, koch]" \
|
&& /opt/venv/bin/pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]" \
|
||||||
--extra-index-url https://download.pytorch.org/whl/cpu
|
--extra-index-url https://download.pytorch.org/whl/cpu
|
||||||
|
|
||||||
# Set EGL as the rendering backend for MuJoCo
|
|
||||||
ENV MUJOCO_GL="egl"
|
|
||||||
|
|
||||||
# Execute in bash shell rather than python
|
# Execute in bash shell rather than python
|
||||||
CMD ["/bin/bash"]
|
CMD ["/bin/bash"]
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ RUN apt-get update && apt-get install -y --no-install-recommends \
|
|||||||
sed gawk grep curl wget zip unzip \
|
sed gawk grep curl wget zip unzip \
|
||||||
tcpdump sysstat screen tmux \
|
tcpdump sysstat screen tmux \
|
||||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
||||||
speech-dispatcher \
|
speech-dispatcher portaudio19-dev libgeos-dev \
|
||||||
python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
|
python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
|
||||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||||
|
|
||||||
|
|||||||
@@ -1,30 +1,24 @@
|
|||||||
FROM nvidia/cuda:12.4.1-base-ubuntu22.04
|
FROM nvidia/cuda:12.4.1-base-ubuntu22.04
|
||||||
|
|
||||||
# Configure image
|
# Configure environment variables
|
||||||
ARG PYTHON_VERSION=3.10
|
ARG PYTHON_VERSION=3.10
|
||||||
ARG DEBIAN_FRONTEND=noninteractive
|
ENV DEBIAN_FRONTEND=noninteractive
|
||||||
|
ENV MUJOCO_GL="egl"
|
||||||
|
|
||||||
# Install apt dependencies
|
|
||||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
|
||||||
build-essential cmake \
|
|
||||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
|
||||||
speech-dispatcher \
|
|
||||||
python${PYTHON_VERSION}-dev python${PYTHON_VERSION}-venv \
|
|
||||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
|
||||||
|
|
||||||
|
|
||||||
# Create virtual environment
|
|
||||||
RUN ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python
|
|
||||||
RUN python -m venv /opt/venv
|
|
||||||
ENV PATH="/opt/venv/bin:$PATH"
|
ENV PATH="/opt/venv/bin:$PATH"
|
||||||
RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
|
||||||
|
|
||||||
# Install LeRobot
|
# Install dependencies and set up Python in a single layer
|
||||||
|
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||||
|
build-essential cmake git \
|
||||||
|
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||||
|
speech-dispatcher libgeos-dev \
|
||||||
|
python${PYTHON_VERSION}-dev python${PYTHON_VERSION}-venv \
|
||||||
|
&& ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python \
|
||||||
|
&& python -m venv /opt/venv \
|
||||||
|
&& apt-get clean && rm -rf /var/lib/apt/lists/* \
|
||||||
|
&& echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
||||||
|
|
||||||
|
# Clone repository and install LeRobot in a single layer
|
||||||
COPY . /lerobot
|
COPY . /lerobot
|
||||||
WORKDIR /lerobot
|
WORKDIR /lerobot
|
||||||
RUN pip install --upgrade --no-cache-dir pip
|
RUN /opt/venv/bin/pip install --upgrade --no-cache-dir pip \
|
||||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, koch]"
|
&& /opt/venv/bin/pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]"
|
||||||
|
|
||||||
# Set EGL as the rendering backend for MuJoCo
|
|
||||||
ENV MUJOCO_GL="egl"
|
|
||||||
|
|||||||
@@ -1,80 +1,136 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
This script demonstrates the use of `LeRobotDataset` class for handling and processing robotic datasets from Hugging Face.
|
This script demonstrates the use of `LeRobotDataset` class for handling and processing robotic datasets from Hugging Face.
|
||||||
It illustrates how to load datasets, manipulate them, and apply transformations suitable for machine learning tasks in PyTorch.
|
It illustrates how to load datasets, manipulate them, and apply transformations suitable for machine learning tasks in PyTorch.
|
||||||
|
|
||||||
Features included in this script:
|
Features included in this script:
|
||||||
- Loading a dataset and accessing its properties.
|
- Viewing a dataset's metadata and exploring its properties.
|
||||||
- Filtering data by episode number.
|
- Loading an existing dataset from the hub or a subset of it.
|
||||||
- Converting tensor data for visualization.
|
- Accessing frames by episode number.
|
||||||
- Saving video files from dataset frames.
|
|
||||||
- Using advanced dataset features like timestamp-based frame selection.
|
- Using advanced dataset features like timestamp-based frame selection.
|
||||||
- Demonstrating compatibility with PyTorch DataLoader for batch processing.
|
- Demonstrating compatibility with PyTorch DataLoader for batch processing.
|
||||||
|
|
||||||
The script ends with examples of how to batch process data using PyTorch's DataLoader.
|
The script ends with examples of how to batch process data using PyTorch's DataLoader.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from pathlib import Path
|
|
||||||
from pprint import pprint
|
from pprint import pprint
|
||||||
|
|
||||||
import imageio
|
|
||||||
import torch
|
import torch
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
|
||||||
import lerobot
|
import lerobot
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
|
||||||
|
|
||||||
|
# We ported a number of existing datasets ourselves, use this to see the list:
|
||||||
print("List of available datasets:")
|
print("List of available datasets:")
|
||||||
pprint(lerobot.available_datasets)
|
pprint(lerobot.available_datasets)
|
||||||
|
|
||||||
# Let's take one for this example
|
# You can also browse through the datasets created/ported by the community on the hub using the hub api:
|
||||||
repo_id = "lerobot/pusht"
|
hub_api = HfApi()
|
||||||
|
repo_ids = [info.id for info in hub_api.list_datasets(task_categories="robotics", tags=["LeRobot"])]
|
||||||
|
pprint(repo_ids)
|
||||||
|
|
||||||
# You can easily load a dataset from a Hugging Face repository
|
# Or simply explore them in your web browser directly at:
|
||||||
|
# https://huggingface.co/datasets?other=LeRobot
|
||||||
|
|
||||||
|
# Let's take this one for this example
|
||||||
|
repo_id = "lerobot/aloha_mobile_cabinet"
|
||||||
|
# We can have a look and fetch its metadata to know more about it:
|
||||||
|
ds_meta = LeRobotDatasetMetadata(repo_id)
|
||||||
|
|
||||||
|
# By instantiating just this class, you can quickly access useful information about the content and the
|
||||||
|
# structure of the dataset without downloading the actual data yet (only metadata files — which are
|
||||||
|
# lightweight).
|
||||||
|
print(f"Total number of episodes: {ds_meta.total_episodes}")
|
||||||
|
print(f"Average number of frames per episode: {ds_meta.total_frames / ds_meta.total_episodes:.3f}")
|
||||||
|
print(f"Frames per second used during data collection: {ds_meta.fps}")
|
||||||
|
print(f"Robot type: {ds_meta.robot_type}")
|
||||||
|
print(f"keys to access images from cameras: {ds_meta.camera_keys=}\n")
|
||||||
|
|
||||||
|
print("Tasks:")
|
||||||
|
print(ds_meta.tasks)
|
||||||
|
print("Features:")
|
||||||
|
pprint(ds_meta.features)
|
||||||
|
|
||||||
|
# You can also get a short summary by simply printing the object:
|
||||||
|
print(ds_meta)
|
||||||
|
|
||||||
|
# You can then load the actual dataset from the hub.
|
||||||
|
# Either load any subset of episodes:
|
||||||
|
dataset = LeRobotDataset(repo_id, episodes=[0, 10, 11, 23])
|
||||||
|
|
||||||
|
# And see how many frames you have:
|
||||||
|
print(f"Selected episodes: {dataset.episodes}")
|
||||||
|
print(f"Number of episodes selected: {dataset.num_episodes}")
|
||||||
|
print(f"Number of frames selected: {dataset.num_frames}")
|
||||||
|
|
||||||
|
# Or simply load the entire dataset:
|
||||||
dataset = LeRobotDataset(repo_id)
|
dataset = LeRobotDataset(repo_id)
|
||||||
|
print(f"Number of episodes selected: {dataset.num_episodes}")
|
||||||
|
print(f"Number of frames selected: {dataset.num_frames}")
|
||||||
|
|
||||||
# LeRobotDataset is actually a thin wrapper around an underlying Hugging Face dataset
|
# The previous metadata class is contained in the 'meta' attribute of the dataset:
|
||||||
# (see https://huggingface.co/docs/datasets/index for more information).
|
print(dataset.meta)
|
||||||
print(dataset)
|
|
||||||
|
# LeRobotDataset actually wraps an underlying Hugging Face dataset
|
||||||
|
# (see https://huggingface.co/docs/datasets for more information).
|
||||||
print(dataset.hf_dataset)
|
print(dataset.hf_dataset)
|
||||||
|
|
||||||
# And provides additional utilities for robotics and compatibility with Pytorch
|
# LeRobot datasets also subclasses PyTorch datasets so you can do everything you know and love from working
|
||||||
print(f"\naverage number of frames per episode: {dataset.num_samples / dataset.num_episodes:.3f}")
|
# with the latter, like iterating through the dataset.
|
||||||
print(f"frames per second used during data collection: {dataset.fps=}")
|
# The __getitem__ iterates over the frames of the dataset. Since our datasets are also structured by
|
||||||
print(f"keys to access images from cameras: {dataset.camera_keys=}\n")
|
# episodes, you can access the frame indices of any episode using the episode_data_index. Here, we access
|
||||||
|
# frame indices associated to the first episode:
|
||||||
# Access frame indexes associated to first episode
|
|
||||||
episode_index = 0
|
episode_index = 0
|
||||||
from_idx = dataset.episode_data_index["from"][episode_index].item()
|
from_idx = dataset.episode_data_index["from"][episode_index].item()
|
||||||
to_idx = dataset.episode_data_index["to"][episode_index].item()
|
to_idx = dataset.episode_data_index["to"][episode_index].item()
|
||||||
|
|
||||||
# LeRobot datasets actually subclass PyTorch datasets so you can do everything you know and love from working
|
# Then we grab all the image frames from the first camera:
|
||||||
# with the latter, like iterating through the dataset. Here we grab all the image frames.
|
camera_key = dataset.meta.camera_keys[0]
|
||||||
frames = [dataset[idx]["observation.image"] for idx in range(from_idx, to_idx)]
|
frames = [dataset[idx][camera_key] for idx in range(from_idx, to_idx)]
|
||||||
|
|
||||||
# Video frames are now float32 in range [0,1] channel first (c,h,w) to follow pytorch convention. To visualize
|
# The objects returned by the dataset are all torch.Tensors
|
||||||
# them, we convert to uint8 in range [0,255]
|
print(type(frames[0]))
|
||||||
frames = [(frame * 255).type(torch.uint8) for frame in frames]
|
print(frames[0].shape)
|
||||||
# and to channel last (h,w,c).
|
|
||||||
frames = [frame.permute((1, 2, 0)).numpy() for frame in frames]
|
|
||||||
|
|
||||||
# Finally, we save the frames to a mp4 video for visualization.
|
# Since we're using pytorch, the shape is in pytorch, channel-first convention (c, h, w).
|
||||||
Path("outputs/examples/1_load_lerobot_dataset").mkdir(parents=True, exist_ok=True)
|
# We can compare this shape with the information available for that feature
|
||||||
imageio.mimsave("outputs/examples/1_load_lerobot_dataset/episode_0.mp4", frames, fps=dataset.fps)
|
pprint(dataset.features[camera_key])
|
||||||
|
# In particular:
|
||||||
|
print(dataset.features[camera_key]["shape"])
|
||||||
|
# The shape is in (h, w, c) which is a more universal format.
|
||||||
|
|
||||||
# For many machine learning applications we need to load the history of past observations or trajectories of
|
# For many machine learning applications we need to load the history of past observations or trajectories of
|
||||||
# future actions. Our datasets can load previous and future frames for each key/modality, using timestamps
|
# future actions. Our datasets can load previous and future frames for each key/modality, using timestamps
|
||||||
# differences with the current loaded frame. For instance:
|
# differences with the current loaded frame. For instance:
|
||||||
delta_timestamps = {
|
delta_timestamps = {
|
||||||
# loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
|
# loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
|
||||||
"observation.image": [-1, -0.5, -0.20, 0],
|
camera_key: [-1, -0.5, -0.20, 0],
|
||||||
# loads 8 state vectors: 1.5 seconds before, 1 second before, ... 20 ms, 10 ms, and current frame
|
# loads 8 state vectors: 1.5 seconds before, 1 second before, ... 200 ms, 100 ms, and current frame
|
||||||
"observation.state": [-1.5, -1, -0.5, -0.20, -0.10, -0.02, -0.01, 0],
|
"observation.state": [-1.5, -1, -0.5, -0.20, -0.10, 0],
|
||||||
# loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
|
# loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
|
||||||
"action": [t / dataset.fps for t in range(64)],
|
"action": [t / dataset.fps for t in range(64)],
|
||||||
}
|
}
|
||||||
|
# Note that in any case, these delta_timestamps values need to be multiples of (1/fps) so that added to any
|
||||||
|
# timestamp, you still get a valid timestamp.
|
||||||
|
|
||||||
dataset = LeRobotDataset(repo_id, delta_timestamps=delta_timestamps)
|
dataset = LeRobotDataset(repo_id, delta_timestamps=delta_timestamps)
|
||||||
print(f"\n{dataset[0]['observation.image'].shape=}") # (4,c,h,w)
|
print(f"\n{dataset[0][camera_key].shape=}") # (4, c, h, w)
|
||||||
print(f"{dataset[0]['observation.state'].shape=}") # (8,c)
|
print(f"{dataset[0]['observation.state'].shape=}") # (6, c)
|
||||||
print(f"{dataset[0]['action'].shape=}\n") # (64,c)
|
print(f"{dataset[0]['action'].shape=}\n") # (64, c)
|
||||||
|
|
||||||
# Finally, our datasets are fully compatible with PyTorch dataloaders and samplers because they are just
|
# Finally, our datasets are fully compatible with PyTorch dataloaders and samplers because they are just
|
||||||
# PyTorch datasets.
|
# PyTorch datasets.
|
||||||
@@ -84,8 +140,9 @@ dataloader = torch.utils.data.DataLoader(
|
|||||||
batch_size=32,
|
batch_size=32,
|
||||||
shuffle=True,
|
shuffle=True,
|
||||||
)
|
)
|
||||||
|
|
||||||
for batch in dataloader:
|
for batch in dataloader:
|
||||||
print(f"{batch['observation.image'].shape=}") # (32,4,c,h,w)
|
print(f"{batch[camera_key].shape=}") # (32, 4, c, h, w)
|
||||||
print(f"{batch['observation.state'].shape=}") # (32,8,c)
|
print(f"{batch['observation.state'].shape=}") # (32, 5, c)
|
||||||
print(f"{batch['action'].shape=}") # (32,64,c)
|
print(f"{batch['action'].shape=}") # (32, 64, c)
|
||||||
break
|
break
|
||||||
|
|||||||
@@ -1,6 +1,25 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
This scripts demonstrates how to evaluate a pretrained policy from the HuggingFace Hub or from your local
|
This scripts demonstrates how to evaluate a pretrained policy from the HuggingFace Hub or from your local
|
||||||
training outputs directory. In the latter case, you might want to run examples/3_train_policy.py first.
|
training outputs directory. In the latter case, you might want to run examples/3_train_policy.py first.
|
||||||
|
|
||||||
|
It requires the installation of the 'gym_pusht' simulation environment. Install it by running:
|
||||||
|
```bash
|
||||||
|
pip install -e ".[pusht]"`
|
||||||
|
```
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
@@ -10,7 +29,6 @@ import gymnasium as gym
|
|||||||
import imageio
|
import imageio
|
||||||
import numpy
|
import numpy
|
||||||
import torch
|
import torch
|
||||||
from huggingface_hub import snapshot_download
|
|
||||||
|
|
||||||
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||||
|
|
||||||
@@ -18,25 +36,15 @@ from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
|||||||
output_directory = Path("outputs/eval/example_pusht_diffusion")
|
output_directory = Path("outputs/eval/example_pusht_diffusion")
|
||||||
output_directory.mkdir(parents=True, exist_ok=True)
|
output_directory.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
# Download the diffusion policy for pusht environment
|
# Select your device
|
||||||
pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
|
device = "cuda"
|
||||||
# OR uncomment the following to evaluate a policy from the local outputs/train folder.
|
|
||||||
|
# Provide the [hugging face repo id](https://huggingface.co/lerobot/diffusion_pusht):
|
||||||
|
pretrained_policy_path = "lerobot/diffusion_pusht"
|
||||||
|
# OR a path to a local outputs/train folder.
|
||||||
# pretrained_policy_path = Path("outputs/train/example_pusht_diffusion")
|
# pretrained_policy_path = Path("outputs/train/example_pusht_diffusion")
|
||||||
|
|
||||||
policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
|
policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
|
||||||
policy.eval()
|
|
||||||
|
|
||||||
# Check if GPU is available
|
|
||||||
if torch.cuda.is_available():
|
|
||||||
device = torch.device("cuda")
|
|
||||||
print("GPU is available. Device set to:", device)
|
|
||||||
else:
|
|
||||||
device = torch.device("cpu")
|
|
||||||
print(f"GPU is not available. Device set to: {device}. Inference will be slower than on GPU.")
|
|
||||||
# Decrease the number of reverse-diffusion steps (trades off a bit of quality for 10x speed)
|
|
||||||
policy.diffusion.num_inference_steps = 10
|
|
||||||
|
|
||||||
policy.to(device)
|
|
||||||
|
|
||||||
# Initialize evaluation environment to render two observation types:
|
# Initialize evaluation environment to render two observation types:
|
||||||
# an image of the scene and state/position of the agent. The environment
|
# an image of the scene and state/position of the agent. The environment
|
||||||
@@ -47,7 +55,17 @@ env = gym.make(
|
|||||||
max_episode_steps=300,
|
max_episode_steps=300,
|
||||||
)
|
)
|
||||||
|
|
||||||
# Reset the policy and environmens to prepare for rollout
|
# We can verify that the shapes of the features expected by the policy match the ones from the observations
|
||||||
|
# produced by the environment
|
||||||
|
print(policy.config.input_features)
|
||||||
|
print(env.observation_space)
|
||||||
|
|
||||||
|
# Similarly, we can check that the actions produced by the policy will match the actions expected by the
|
||||||
|
# environment
|
||||||
|
print(policy.config.output_features)
|
||||||
|
print(env.action_space)
|
||||||
|
|
||||||
|
# Reset the policy and environments to prepare for rollout
|
||||||
policy.reset()
|
policy.reset()
|
||||||
numpy_observation, info = env.reset(seed=42)
|
numpy_observation, info = env.reset(seed=42)
|
||||||
|
|
||||||
|
|||||||
@@ -1,3 +1,17 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
"""This scripts demonstrates how to train Diffusion Policy on the PushT environment.
|
"""This scripts demonstrates how to train Diffusion Policy on the PushT environment.
|
||||||
|
|
||||||
Once you have trained a model with this script, you can try to evaluate it on
|
Once you have trained a model with this script, you can try to evaluate it on
|
||||||
@@ -8,72 +22,99 @@ from pathlib import Path
|
|||||||
|
|
||||||
import torch
|
import torch
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
|
||||||
|
from lerobot.common.datasets.utils import dataset_to_policy_features
|
||||||
from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
|
from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
|
||||||
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||||
|
from lerobot.configs.types import FeatureType
|
||||||
|
|
||||||
# Create a directory to store the training checkpoint.
|
|
||||||
output_directory = Path("outputs/train/example_pusht_diffusion")
|
|
||||||
output_directory.mkdir(parents=True, exist_ok=True)
|
|
||||||
|
|
||||||
# Number of offline training steps (we'll only do offline training for this example.)
|
def main():
|
||||||
# Adjust as you prefer. 5000 steps are needed to get something worth evaluating.
|
# Create a directory to store the training checkpoint.
|
||||||
training_steps = 5000
|
output_directory = Path("outputs/train/example_pusht_diffusion")
|
||||||
device = torch.device("cuda")
|
output_directory.mkdir(parents=True, exist_ok=True)
|
||||||
log_freq = 250
|
|
||||||
|
|
||||||
# Set up the dataset.
|
# # Select your device
|
||||||
delta_timestamps = {
|
device = torch.device("cuda")
|
||||||
# Load the previous image and state at -0.1 seconds before current frame,
|
|
||||||
# then load current image and state corresponding to 0.0 second.
|
|
||||||
"observation.image": [-0.1, 0.0],
|
|
||||||
"observation.state": [-0.1, 0.0],
|
|
||||||
# Load the previous action (-0.1), the next action to be executed (0.0),
|
|
||||||
# and 14 future actions with a 0.1 seconds spacing. All these actions will be
|
|
||||||
# used to supervise the policy.
|
|
||||||
"action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
|
|
||||||
}
|
|
||||||
dataset = LeRobotDataset("lerobot/pusht", delta_timestamps=delta_timestamps)
|
|
||||||
|
|
||||||
# Set up the the policy.
|
# Number of offline training steps (we'll only do offline training for this example.)
|
||||||
# Policies are initialized with a configuration class, in this case `DiffusionConfig`.
|
# Adjust as you prefer. 5000 steps are needed to get something worth evaluating.
|
||||||
# For this example, no arguments need to be passed because the defaults are set up for PushT.
|
training_steps = 5000
|
||||||
# If you're doing something different, you will likely need to change at least some of the defaults.
|
log_freq = 1
|
||||||
cfg = DiffusionConfig()
|
|
||||||
policy = DiffusionPolicy(cfg, dataset_stats=dataset.stats)
|
|
||||||
policy.train()
|
|
||||||
policy.to(device)
|
|
||||||
|
|
||||||
optimizer = torch.optim.Adam(policy.parameters(), lr=1e-4)
|
# When starting from scratch (i.e. not from a pretrained policy), we need to specify 2 things before
|
||||||
|
# creating the policy:
|
||||||
|
# - input/output shapes: to properly size the policy
|
||||||
|
# - dataset stats: for normalization and denormalization of input/outputs
|
||||||
|
dataset_metadata = LeRobotDatasetMetadata("lerobot/pusht")
|
||||||
|
features = dataset_to_policy_features(dataset_metadata.features)
|
||||||
|
output_features = {key: ft for key, ft in features.items() if ft.type is FeatureType.ACTION}
|
||||||
|
input_features = {key: ft for key, ft in features.items() if key not in output_features}
|
||||||
|
|
||||||
# Create dataloader for offline training.
|
# Policies are initialized with a configuration class, in this case `DiffusionConfig`. For this example,
|
||||||
dataloader = torch.utils.data.DataLoader(
|
# we'll just use the defaults and so no arguments other than input/output features need to be passed.
|
||||||
dataset,
|
cfg = DiffusionConfig(input_features=input_features, output_features=output_features)
|
||||||
num_workers=4,
|
|
||||||
batch_size=64,
|
|
||||||
shuffle=True,
|
|
||||||
pin_memory=device != torch.device("cpu"),
|
|
||||||
drop_last=True,
|
|
||||||
)
|
|
||||||
|
|
||||||
# Run training loop.
|
# We can now instantiate our policy with this config and the dataset stats.
|
||||||
step = 0
|
policy = DiffusionPolicy(cfg, dataset_stats=dataset_metadata.stats)
|
||||||
done = False
|
policy.train()
|
||||||
while not done:
|
policy.to(device)
|
||||||
for batch in dataloader:
|
|
||||||
batch = {k: v.to(device, non_blocking=True) for k, v in batch.items()}
|
|
||||||
output_dict = policy.forward(batch)
|
|
||||||
loss = output_dict["loss"]
|
|
||||||
loss.backward()
|
|
||||||
optimizer.step()
|
|
||||||
optimizer.zero_grad()
|
|
||||||
|
|
||||||
if step % log_freq == 0:
|
# Another policy-dataset interaction is with the delta_timestamps. Each policy expects a given number frames
|
||||||
print(f"step: {step} loss: {loss.item():.3f}")
|
# which can differ for inputs, outputs and rewards (if there are some).
|
||||||
step += 1
|
delta_timestamps = {
|
||||||
if step >= training_steps:
|
"observation.image": [i / dataset_metadata.fps for i in cfg.observation_delta_indices],
|
||||||
done = True
|
"observation.state": [i / dataset_metadata.fps for i in cfg.observation_delta_indices],
|
||||||
break
|
"action": [i / dataset_metadata.fps for i in cfg.action_delta_indices],
|
||||||
|
}
|
||||||
|
|
||||||
# Save a policy checkpoint.
|
# In this case with the standard configuration for Diffusion Policy, it is equivalent to this:
|
||||||
policy.save_pretrained(output_directory)
|
delta_timestamps = {
|
||||||
|
# Load the previous image and state at -0.1 seconds before current frame,
|
||||||
|
# then load current image and state corresponding to 0.0 second.
|
||||||
|
"observation.image": [-0.1, 0.0],
|
||||||
|
"observation.state": [-0.1, 0.0],
|
||||||
|
# Load the previous action (-0.1), the next action to be executed (0.0),
|
||||||
|
# and 14 future actions with a 0.1 seconds spacing. All these actions will be
|
||||||
|
# used to supervise the policy.
|
||||||
|
"action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
|
||||||
|
}
|
||||||
|
|
||||||
|
# We can then instantiate the dataset with these delta_timestamps configuration.
|
||||||
|
dataset = LeRobotDataset("lerobot/pusht", delta_timestamps=delta_timestamps)
|
||||||
|
|
||||||
|
# Then we create our optimizer and dataloader for offline training.
|
||||||
|
optimizer = torch.optim.Adam(policy.parameters(), lr=1e-4)
|
||||||
|
dataloader = torch.utils.data.DataLoader(
|
||||||
|
dataset,
|
||||||
|
num_workers=4,
|
||||||
|
batch_size=64,
|
||||||
|
shuffle=True,
|
||||||
|
pin_memory=device.type != "cpu",
|
||||||
|
drop_last=True,
|
||||||
|
)
|
||||||
|
|
||||||
|
# Run training loop.
|
||||||
|
step = 0
|
||||||
|
done = False
|
||||||
|
while not done:
|
||||||
|
for batch in dataloader:
|
||||||
|
batch = {k: (v.to(device) if isinstance(v, torch.Tensor) else v) for k, v in batch.items()}
|
||||||
|
loss, _ = policy.forward(batch)
|
||||||
|
loss.backward()
|
||||||
|
optimizer.step()
|
||||||
|
optimizer.zero_grad()
|
||||||
|
|
||||||
|
if step % log_freq == 0:
|
||||||
|
print(f"step: {step} loss: {loss.item():.3f}")
|
||||||
|
step += 1
|
||||||
|
if step >= training_steps:
|
||||||
|
done = True
|
||||||
|
break
|
||||||
|
|
||||||
|
# Save a policy checkpoint.
|
||||||
|
policy.save_pretrained(output_directory)
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
main()
|
||||||
|
|||||||
@@ -1,183 +1,274 @@
|
|||||||
This tutorial will explain the training script, how to use it, and particularly the use of Hydra to configure everything needed for the training run.
|
This tutorial will explain the training script, how to use it, and particularly how to configure everything needed for the training run.
|
||||||
|
> **Note:** The following assume you're running these commands on a machine equipped with a cuda GPU. If you don't have one (or if you're using a Mac), you can add `--policy.device=cpu` (`--policy.device=mps` respectively). However, be advised that the code executes much slower on cpu.
|
||||||
|
|
||||||
|
|
||||||
## The training script
|
## The training script
|
||||||
|
|
||||||
LeRobot offers a training script at [`lerobot/scripts/train.py`](../../lerobot/scripts/train.py). At a high level it does the following:
|
LeRobot offers a training script at [`lerobot/scripts/train.py`](../../lerobot/scripts/train.py). At a high level it does the following:
|
||||||
|
|
||||||
- Loads a Hydra configuration file for the following steps (more on Hydra in a moment).
|
- Initialize/load a configuration for the following steps using.
|
||||||
- Makes a simulation environment.
|
- Instantiates a dataset.
|
||||||
- Makes a dataset corresponding to that simulation environment.
|
- (Optional) Instantiates a simulation environment corresponding to that dataset.
|
||||||
- Makes a policy.
|
- Instantiates a policy.
|
||||||
- Runs a standard training loop with forward pass, backward pass, optimization step, and occasional logging, evaluation (of the policy on the environment), and checkpointing.
|
- Runs a standard training loop with forward pass, backward pass, optimization step, and occasional logging, evaluation (of the policy on the environment), and checkpointing.
|
||||||
|
|
||||||
## Basics of how we use Hydra
|
## Overview of the configuration system
|
||||||
|
|
||||||
Explaining the ins and outs of [Hydra](https://hydra.cc/docs/intro/) is beyond the scope of this document, but here we'll share the main points you need to know.
|
|
||||||
|
|
||||||
First, `lerobot/configs` has a directory structure like this:
|
|
||||||
|
|
||||||
```
|
|
||||||
.
|
|
||||||
├── default.yaml
|
|
||||||
├── env
|
|
||||||
│ ├── aloha.yaml
|
|
||||||
│ ├── pusht.yaml
|
|
||||||
│ └── xarm.yaml
|
|
||||||
└── policy
|
|
||||||
├── act.yaml
|
|
||||||
├── diffusion.yaml
|
|
||||||
└── tdmpc.yaml
|
|
||||||
```
|
|
||||||
|
|
||||||
**_For brevity, in the rest of this document we'll drop the leading `lerobot/configs` path. So `default.yaml` really refers to `lerobot/configs/default.yaml`._**
|
|
||||||
|
|
||||||
When you run the training script with
|
|
||||||
|
|
||||||
|
In the training script, the main function `train` expects a `TrainPipelineConfig` object:
|
||||||
```python
|
```python
|
||||||
python lerobot/scripts/train.py
|
# train.py
|
||||||
|
@parser.wrap()
|
||||||
|
def train(cfg: TrainPipelineConfig):
|
||||||
```
|
```
|
||||||
|
|
||||||
Hydra is set up to read `default.yaml` (via the `@hydra.main` decorator). If you take a look at the `@hydra.main`'s arguments you will see `config_path="../configs", config_name="default"`. At the top of `default.yaml`, is a `defaults` section which looks likes this:
|
You can inspect the `TrainPipelineConfig` defined in [`lerobot/configs/train.py`](../../lerobot/configs/train.py) (which is heavily commented and meant to be a reference to understand any option)
|
||||||
|
|
||||||
```yaml
|
When running the script, inputs for the command line are parsed thanks to the `@parser.wrap()` decorator and an instance of this class is automatically generated. Under the hood, this is done with [Draccus](https://github.com/dlwh/draccus) which is a tool dedicated for this purpose. If you're familiar with Hydra, Draccus can similarly load configurations from config files (.json, .yaml) and also override their values through command line inputs. Unlike Hydra, these configurations are pre-defined in the code through dataclasses rather than being defined entirely in config files. This allows for more rigorous serialization/deserialization, typing, and to manipulate configuration as objects directly in the code and not as dictionaries or namespaces (which enables nice features in an IDE such as autocomplete, jump-to-def, etc.)
|
||||||
defaults:
|
|
||||||
- _self_
|
Let's have a look at a simplified example. Amongst other attributes, the training config has the following attributes:
|
||||||
- env: pusht
|
```python
|
||||||
- policy: diffusion
|
@dataclass
|
||||||
|
class TrainPipelineConfig:
|
||||||
|
dataset: DatasetConfig
|
||||||
|
env: envs.EnvConfig | None = None
|
||||||
|
policy: PreTrainedConfig | None = None
|
||||||
|
```
|
||||||
|
in which `DatasetConfig` for example is defined as such:
|
||||||
|
```python
|
||||||
|
@dataclass
|
||||||
|
class DatasetConfig:
|
||||||
|
repo_id: str
|
||||||
|
episodes: list[int] | None = None
|
||||||
|
video_backend: str = "pyav"
|
||||||
```
|
```
|
||||||
|
|
||||||
This logic tells Hydra to incorporate configuration parameters from `env/pusht.yaml` and `policy/diffusion.yaml`. _Note: Be aware of the order as any configuration parameters with the same name will be overidden. Thus, `default.yaml` is overridden by `env/pusht.yaml` which is overidden by `policy/diffusion.yaml`_.
|
This creates a hierarchical relationship where, for example assuming we have a `cfg` instance of `TrainPipelineConfig`, we can access the `repo_id` value with `cfg.dataset.repo_id`.
|
||||||
|
From the command line, we can specify this value with using a very similar syntax `--dataset.repo_id=repo/id`.
|
||||||
|
|
||||||
Then, `default.yaml` also contains common configuration parameters such as `device: cuda` or `use_amp: false` (for enabling fp16 training). Some other parameters are set to `???` which indicates that they are expected to be set in additional yaml files. For instance, `training.offline_steps: ???` in `default.yaml` is set to `200000` in `diffusion.yaml`.
|
By default, every field takes its default value specified in the dataclass. If a field doesn't have a default value, it needs to be specified either from the command line or from a config file – which path is also given in the command line (more in this below). In the example above, the `dataset` field doesn't have a default value which means it must be specified.
|
||||||
|
|
||||||
Thanks to this `defaults` section in `default.yaml`, if you want to train Diffusion Policy with PushT, you really only need to run:
|
|
||||||
|
|
||||||
```bash
|
## Specifying values from the CLI
|
||||||
python lerobot/scripts/train.py
|
|
||||||
```
|
|
||||||
|
|
||||||
However, you can be more explicit and launch the exact same Diffusion Policy training on PushT with:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
python lerobot/scripts/train.py policy=diffusion env=pusht
|
|
||||||
```
|
|
||||||
|
|
||||||
This way of overriding defaults via the CLI is especially useful when you want to change the policy and/or environment. For instance, you can train ACT on the default Aloha environment with:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
python lerobot/scripts/train.py policy=act env=aloha
|
|
||||||
```
|
|
||||||
|
|
||||||
There are two things to note here:
|
|
||||||
- Config overrides are passed as `param_name=param_value`.
|
|
||||||
- Here we have overridden the defaults section. `policy=act` tells Hydra to use `policy/act.yaml`, and `env=aloha` tells Hydra to use `env/aloha.yaml`.
|
|
||||||
|
|
||||||
_As an aside: we've set up all of our configurations so that they reproduce state-of-the-art results from papers in the literature._
|
|
||||||
|
|
||||||
## Overriding configuration parameters in the CLI
|
|
||||||
|
|
||||||
Now let's say that we want to train on a different task in the Aloha environment. If you look in `env/aloha.yaml` you will see something like:
|
|
||||||
|
|
||||||
```yaml
|
|
||||||
# lerobot/configs/env/aloha.yaml
|
|
||||||
env:
|
|
||||||
task: AlohaInsertion-v0
|
|
||||||
```
|
|
||||||
|
|
||||||
And if you look in `policy/act.yaml` you will see something like:
|
|
||||||
|
|
||||||
```yaml
|
|
||||||
# lerobot/configs/policy/act.yaml
|
|
||||||
dataset_repo_id: lerobot/aloha_sim_insertion_human
|
|
||||||
```
|
|
||||||
|
|
||||||
But our Aloha environment actually supports a cube transfer task as well. To train for this task, you could manually modify the two yaml configuration files respectively.
|
|
||||||
|
|
||||||
First, we'd need to switch to using the cube transfer task for the ALOHA environment.
|
|
||||||
|
|
||||||
```diff
|
|
||||||
# lerobot/configs/env/aloha.yaml
|
|
||||||
env:
|
|
||||||
- task: AlohaInsertion-v0
|
|
||||||
+ task: AlohaTransferCube-v0
|
|
||||||
```
|
|
||||||
|
|
||||||
Then, we'd also need to switch to using the cube transfer dataset.
|
|
||||||
|
|
||||||
```diff
|
|
||||||
# lerobot/configs/policy/act.yaml
|
|
||||||
-dataset_repo_id: lerobot/aloha_sim_insertion_human
|
|
||||||
+dataset_repo_id: lerobot/aloha_sim_transfer_cube_human
|
|
||||||
```
|
|
||||||
|
|
||||||
Then, you'd be able to run:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
python lerobot/scripts/train.py policy=act env=aloha
|
|
||||||
```
|
|
||||||
|
|
||||||
and you'd be training and evaluating on the cube transfer task.
|
|
||||||
|
|
||||||
An alternative approach to editing the yaml configuration files, would be to override the defaults via the command line:
|
|
||||||
|
|
||||||
|
Let's say that we want to train [Diffusion Policy](../../lerobot/common/policies/diffusion) on the [pusht](https://huggingface.co/datasets/lerobot/pusht) dataset, using the [gym_pusht](https://github.com/huggingface/gym-pusht) environment for evaluation. The command to do so would look like this:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
policy=act \
|
--dataset.repo_id=lerobot/pusht \
|
||||||
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
--policy.type=diffusion \
|
||||||
env=aloha \
|
--env.type=pusht
|
||||||
env.task=AlohaTransferCube-v0
|
|
||||||
```
|
```
|
||||||
|
|
||||||
There's something new here. Notice the `.` delimiter used to traverse the configuration hierarchy. _But be aware that the `defaults` section is an exception. As you saw above, we didn't need to write `defaults.policy=act` in the CLI. `policy=act` was enough._
|
Let's break this down:
|
||||||
|
- To specify the dataset, we just need to specify its `repo_id` on the hub which is the only required argument in the `DatasetConfig`. The rest of the fields have default values and in this case we are fine with those so we can just add the option `--dataset.repo_id=lerobot/pusht`.
|
||||||
Putting all that knowledge together, here's the command that was used to train https://huggingface.co/lerobot/act_aloha_sim_transfer_cube_human.
|
- To specify the policy, we can just select diffusion policy using `--policy` appended with `.type`. Here, `.type` is a special argument which allows us to select config classes inheriting from `draccus.ChoiceRegistry` and that have been decorated with the `register_subclass()` method. To have a better explanation of this feature, have a look at this [Draccus demo](https://github.com/dlwh/draccus?tab=readme-ov-file#more-flexible-configuration-with-choice-types). In our code, we use this mechanism mainly to select policies, environments, robots, and some other components like optimizers. The policies available to select are located in [lerobot/common/policies](../../lerobot/common/policies)
|
||||||
|
- Similarly, we select the environment with `--env.type=pusht`. The different environment configs are available in [`lerobot/common/envs/configs.py`](../../lerobot/common/envs/configs.py)
|
||||||
|
|
||||||
|
Let's see another example. Let's say you've been training [ACT](../../lerobot/common/policies/act) on [lerobot/aloha_sim_insertion_human](https://huggingface.co/datasets/lerobot/aloha_sim_insertion_human) using the [gym-aloha](https://github.com/huggingface/gym-aloha) environment for evaluation with:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
hydra.run.dir=outputs/train/act_aloha_sim_transfer_cube_human \
|
--policy.type=act \
|
||||||
device=cuda
|
--dataset.repo_id=lerobot/aloha_sim_insertion_human \
|
||||||
env=aloha \
|
--env.type=aloha \
|
||||||
env.task=AlohaTransferCube-v0 \
|
--output_dir=outputs/train/act_aloha_insertion
|
||||||
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
|
||||||
policy=act \
|
|
||||||
training.eval_freq=10000 \
|
|
||||||
training.log_freq=250 \
|
|
||||||
training.offline_steps=100000 \
|
|
||||||
training.save_model=true \
|
|
||||||
training.save_freq=25000 \
|
|
||||||
eval.n_episodes=50 \
|
|
||||||
eval.batch_size=50 \
|
|
||||||
wandb.enable=false \
|
|
||||||
```
|
```
|
||||||
|
> Notice we added `--output_dir` to explicitly tell where to write outputs from this run (checkpoints, training state, configs etc.). This is not mandatory and if you don't specify it, a default directory will be created from the current date and time, env.type and policy.type. This will typically look like `outputs/train/2025-01-24/16-10-05_aloha_act`.
|
||||||
|
|
||||||
There's one new thing here: `hydra.run.dir=outputs/train/act_aloha_sim_transfer_cube_human`, which specifies where to save the training output.
|
We now want to train a different policy for aloha on another task. We'll change the dataset and use [lerobot/aloha_sim_transfer_cube_human](https://huggingface.co/datasets/lerobot/aloha_sim_transfer_cube_human) instead. Of course, we also need to change the task of the environment as well to match this other task.
|
||||||
|
Looking at the [`AlohaEnv`](../../lerobot/common/envs/configs.py) config, the task is `"AlohaInsertion-v0"` by default, which corresponds to the task we trained on in the command above. The [gym-aloha](https://github.com/huggingface/gym-aloha?tab=readme-ov-file#description) environment also has the `AlohaTransferCube-v0` task which corresponds to this other task we want to train on. Putting this together, we can train this new policy on this different task using:
|
||||||
## Using a configuration file not in `lerobot/configs`
|
|
||||||
|
|
||||||
Above we discusses the our training script is set up such that Hydra looks for `default.yaml` in `lerobot/configs`. But, if you have a configuration file elsewhere in your filesystem you may use:
|
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py --config-dir PARENT/PATH --config-name FILE_NAME_WITHOUT_EXTENSION
|
python lerobot/scripts/train.py \
|
||||||
|
--policy.type=act \
|
||||||
|
--dataset.repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||||
|
--env.type=aloha \
|
||||||
|
--env.task=AlohaTransferCube-v0 \
|
||||||
|
--output_dir=outputs/train/act_aloha_transfer
|
||||||
```
|
```
|
||||||
|
|
||||||
Note: here we use regular syntax for providing CLI arguments to a Python script, not Hydra's `param_name=param_value` syntax.
|
## Loading from a config file
|
||||||
|
|
||||||
As a concrete example, this becomes particularly handy when you have a folder with training outputs, and would like to re-run the training. For example, say you previously ran the training script with one of the earlier commands and have `outputs/train/my_experiment/checkpoints/pretrained_model/config.yaml`. This `config.yaml` file will have the full set of configuration parameters within it. To run the training with the same configuration again, do:
|
Now, let's assume that we want to reproduce the run just above. That run has produced a `train_config.json` file in its checkpoints, which serializes the `TrainPipelineConfig` instance it used:
|
||||||
|
```json
|
||||||
|
{
|
||||||
|
"dataset": {
|
||||||
|
"repo_id": "lerobot/aloha_sim_transfer_cube_human",
|
||||||
|
"episodes": null,
|
||||||
|
...
|
||||||
|
},
|
||||||
|
"env": {
|
||||||
|
"type": "aloha",
|
||||||
|
"task": "AlohaTransferCube-v0",
|
||||||
|
"fps": 50,
|
||||||
|
...
|
||||||
|
},
|
||||||
|
"policy": {
|
||||||
|
"type": "act",
|
||||||
|
"n_obs_steps": 1,
|
||||||
|
...
|
||||||
|
},
|
||||||
|
...
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
We can then simply load the config values from this file using:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py --config-dir outputs/train/my_experiment/checkpoints/last/pretrained_model --config-name config
|
python lerobot/scripts/train.py \
|
||||||
|
--config_path=outputs/train/act_aloha_transfer/checkpoints/last/pretrained_model/ \
|
||||||
|
--output_dir=outputs/train/act_aloha_transfer_2
|
||||||
|
```
|
||||||
|
`--config_path` is also a special argument which allows to initialize the config from a local config file. It can point to a directory that contains `train_config.json` or to the config file itself directly.
|
||||||
|
|
||||||
|
Similarly to Hydra, we can still override some parameters in the CLI if we want to, e.g.:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--config_path=outputs/train/act_aloha_transfer/checkpoints/last/pretrained_model/ \
|
||||||
|
--output_dir=outputs/train/act_aloha_transfer_2
|
||||||
|
--policy.n_action_steps=80
|
||||||
|
```
|
||||||
|
> Note: While `--output_dir` is not required in general, in this case we need to specify it since it will otherwise take the value from the `train_config.json` (which is `outputs/train/act_aloha_transfer`). In order to prevent accidental deletion of previous run checkpoints, we raise an error if you're trying to write in an existing directory. This is not the case when resuming a run, which is what you'll learn next.
|
||||||
|
|
||||||
|
`--config_path` can also accept the repo_id of a repo on the hub that contains a `train_config.json` file, e.g. running:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py --config_path=lerobot/diffusion_pusht
|
||||||
|
```
|
||||||
|
will start a training run with the same configuration used for training [lerobot/diffusion_pusht](https://huggingface.co/lerobot/diffusion_pusht)
|
||||||
|
|
||||||
|
|
||||||
|
## Resume training
|
||||||
|
|
||||||
|
Being able to resume a training run is important in case it crashed or aborted for any reason. We'll demonstrate how to that here.
|
||||||
|
|
||||||
|
Let's reuse the command from the previous run and add a few more options:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--policy.type=act \
|
||||||
|
--dataset.repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||||
|
--env.type=aloha \
|
||||||
|
--env.task=AlohaTransferCube-v0 \
|
||||||
|
--log_freq=25 \
|
||||||
|
--save_freq=100 \
|
||||||
|
--output_dir=outputs/train/run_resumption
|
||||||
```
|
```
|
||||||
|
|
||||||
Note that you may still use the regular syntax for config parameter overrides (eg: by adding `training.offline_steps=200000`).
|
Here we've taken care to set up the log frequency and checkpointing frequency to low numbers so we can showcase resumption. You should be able to see some logging and have a first checkpoint within 1 minute (depending on hardware). Wait for the first checkpoint to happen, you should see a line that looks like this in your terminal:
|
||||||
|
```
|
||||||
|
INFO 2025-01-24 16:10:56 ts/train.py:263 Checkpoint policy after step 100
|
||||||
|
```
|
||||||
|
Now let's simulate a crash by killing the process (hit `ctrl`+`c`). We can then simply resume this run from the last checkpoint available with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--config_path=outputs/train/run_resumption/checkpoints/last/pretrained_model/ \
|
||||||
|
--resume=true
|
||||||
|
```
|
||||||
|
You should see from the logging that your training picks up from where it left off.
|
||||||
|
|
||||||
|
Another reason for which you might want to resume a run is simply to extend training and add more training steps. The number of training steps is set by the option `--steps`, which is 100 000 by default.
|
||||||
|
You could double the number of steps of the previous run with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--config_path=outputs/train/run_resumption/checkpoints/last/pretrained_model/ \
|
||||||
|
--resume=true \
|
||||||
|
--steps=200000
|
||||||
|
```
|
||||||
|
|
||||||
|
## Outputs of a run
|
||||||
|
In the output directory, there will be a folder called `checkpoints` with the following structure:
|
||||||
|
```bash
|
||||||
|
outputs/train/run_resumption/checkpoints
|
||||||
|
├── 000100 # checkpoint_dir for training step 100
|
||||||
|
│ ├── pretrained_model/
|
||||||
|
│ │ ├── config.json # policy config
|
||||||
|
│ │ ├── model.safetensors # policy weights
|
||||||
|
│ │ └── train_config.json # train config
|
||||||
|
│ └── training_state/
|
||||||
|
│ ├── optimizer_param_groups.json # optimizer param groups
|
||||||
|
│ ├── optimizer_state.safetensors # optimizer state
|
||||||
|
│ ├── rng_state.safetensors # rng states
|
||||||
|
│ ├── scheduler_state.json # scheduler state
|
||||||
|
│ └── training_step.json # training step
|
||||||
|
├── 000200
|
||||||
|
└── last -> 000200 # symlink to the last available checkpoint
|
||||||
|
```
|
||||||
|
|
||||||
|
## Fine-tuning a pre-trained policy
|
||||||
|
|
||||||
|
In addition to the features currently in Draccus, we've added a special `.path` argument for the policy, which allows to load a policy as you would with `PreTrainedPolicy.from_pretrained()`. In that case, `path` can be a local directory that contains a checkpoint or a repo_id pointing to a pretrained policy on the hub.
|
||||||
|
|
||||||
|
For example, we could fine-tune a [policy pre-trained on the aloha transfer task](https://huggingface.co/lerobot/act_aloha_sim_transfer_cube_human) on the aloha insertion task. We can achieve this with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--policy.path=lerobot/act_aloha_sim_transfer_cube_human \
|
||||||
|
--dataset.repo_id=lerobot/aloha_sim_insertion_human \
|
||||||
|
--env.type=aloha \
|
||||||
|
--env.task=AlohaInsertion-v0
|
||||||
|
```
|
||||||
|
|
||||||
|
When doing so, keep in mind that the features of the fine-tuning dataset would have to match the input/output features of the pretrained policy.
|
||||||
|
|
||||||
|
## Typical logs and metrics
|
||||||
|
|
||||||
|
When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you configured your run correctly. The final configuration will also be saved with the checkpoint.
|
||||||
|
|
||||||
|
After that, you will see training log like this one:
|
||||||
|
```
|
||||||
|
INFO 2024-08-14 13:35:12 ts/train.py:192 step:0 smpl:64 ep:1 epch:0.00 loss:1.112 grdn:15.387 lr:2.0e-07 updt_s:1.738 data_s:4.774
|
||||||
|
```
|
||||||
|
or evaluation log:
|
||||||
|
```
|
||||||
|
INFO 2024-08-14 13:38:45 ts/train.py:226 step:100 smpl:6K ep:52 epch:0.25 ∑rwrd:20.693 success:0.0% eval_s:120.266
|
||||||
|
```
|
||||||
|
|
||||||
|
These logs will also be saved in wandb if `wandb.enable` is set to `true`. Here are the meaning of some abbreviations:
|
||||||
|
- `smpl`: number of samples seen during training.
|
||||||
|
- `ep`: number of episodes seen during training. An episode contains multiple samples in a complete manipulation task.
|
||||||
|
- `epch`: number of time all unique samples are seen (epoch).
|
||||||
|
- `grdn`: gradient norm.
|
||||||
|
- `∑rwrd`: compute the sum of rewards in every evaluation episode and then take an average of them.
|
||||||
|
- `success`: average success rate of eval episodes. Reward and success are usually different except for the sparsing reward setting, where reward=1 only when the task is completed successfully.
|
||||||
|
- `eval_s`: time to evaluate the policy in the environment, in second.
|
||||||
|
- `updt_s`: time to update the network parameters, in second.
|
||||||
|
- `data_s`: time to load a batch of data, in second.
|
||||||
|
|
||||||
|
Some metrics are useful for initial performance profiling. For example, if you find the current GPU utilization is low via the `nvidia-smi` command and `data_s` sometimes is too high, you may need to modify batch size or number of dataloading workers to accelerate dataloading. We also recommend [pytorch profiler](https://github.com/huggingface/lerobot?tab=readme-ov-file#improve-your-code-with-profiling) for detailed performance probing.
|
||||||
|
|
||||||
|
## In short
|
||||||
|
|
||||||
|
We'll summarize here the main use cases to remember from this tutorial.
|
||||||
|
|
||||||
|
#### Train a policy from scratch – CLI
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--policy.type=act \ # <- select 'act' policy
|
||||||
|
--env.type=pusht \ # <- select 'pusht' environment
|
||||||
|
--dataset.repo_id=lerobot/pusht # <- train on this dataset
|
||||||
|
```
|
||||||
|
|
||||||
|
#### Train a policy from scratch - config file + CLI
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--config_path=path/to/pretrained_model \ # <- can also be a repo_id
|
||||||
|
--policy.n_action_steps=80 # <- you may still override values
|
||||||
|
```
|
||||||
|
|
||||||
|
#### Resume/continue a training run
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--config_path=checkpoint/pretrained_model/ \
|
||||||
|
--resume=true \
|
||||||
|
--steps=200000 # <- you can change some training parameters
|
||||||
|
```
|
||||||
|
|
||||||
|
#### Fine-tuning
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
--policy.path=lerobot/act_aloha_sim_transfer_cube_human \ # <- can also be a local path to a checkpoint
|
||||||
|
--dataset.repo_id=lerobot/aloha_sim_insertion_human \
|
||||||
|
--env.type=aloha \
|
||||||
|
--env.task=AlohaInsertion-v0
|
||||||
|
```
|
||||||
|
|
||||||
---
|
---
|
||||||
|
|
||||||
So far we've seen how to train Diffusion Policy for PushT and ACT for ALOHA. Now, what if we want to train ACT for PushT? Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
Now that you know the basics of how to train a policy, you might want to know how to apply this knowledge to actual robots, or how to record your own datasets and train policies on your specific task?
|
||||||
|
If that's the case, head over to the next tutorial [`7_get_started_with_real_robot.md`](./7_get_started_with_real_robot.md).
|
||||||
|
|
||||||
```bash
|
Or in the meantime, happy training! 🤗
|
||||||
python lerobot/scripts/train.py policy=act env=pusht dataset_repo_id=lerobot/pusht
|
|
||||||
```
|
|
||||||
|
|
||||||
Please, head on over to our [advanced tutorial on adapting policy configuration to various environments](./advanced/train_act_pusht/train_act_pusht.md) to learn more.
|
|
||||||
|
|
||||||
Or in the meantime, happy coding! 🤗
|
|
||||||
|
|||||||
@@ -1,37 +0,0 @@
|
|||||||
This tutorial explains how to resume a training run that you've started with the training script. If you don't know how our training script and configuration system works, please read [4_train_policy_with_script.md](./4_train_policy_with_script.md) first.
|
|
||||||
|
|
||||||
## Basic training resumption
|
|
||||||
|
|
||||||
Let's consider the example of training ACT for one of the ALOHA tasks. Here's a command that can achieve that:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
python lerobot/scripts/train.py \
|
|
||||||
hydra.run.dir=outputs/train/run_resumption \
|
|
||||||
policy=act \
|
|
||||||
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
|
||||||
env=aloha \
|
|
||||||
env.task=AlohaTransferCube-v0 \
|
|
||||||
training.log_freq=25 \
|
|
||||||
training.save_checkpoint=true \
|
|
||||||
training.save_freq=100
|
|
||||||
```
|
|
||||||
|
|
||||||
Here we're using the default dataset and environment for ACT, and we've taken care to set up the log frequency and checkpointing frequency to low numbers so we can test resumption. You should be able to see some logging and have a first checkpoint within 1 minute. Please interrupt the training after the first checkpoint.
|
|
||||||
|
|
||||||
To resume, all that we have to do is run the training script, providing the run directory, and the resume option:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
python lerobot/scripts/train.py \
|
|
||||||
hydra.run.dir=outputs/train/run_resumption \
|
|
||||||
resume=true
|
|
||||||
```
|
|
||||||
|
|
||||||
You should see from the logging that your training picks up from where it left off.
|
|
||||||
|
|
||||||
Note that with `resume=true`, the configuration file from the last checkpoint in the training output directory is loaded. So it doesn't matter that we haven't provided all the other configuration parameters from our previous command (although there may be warnings to notify you that your command has a different configuration than than the checkpoint).
|
|
||||||
|
|
||||||
---
|
|
||||||
|
|
||||||
Now you should know how to resume your training run in case it gets interrupted or you want to extend a finished training run.
|
|
||||||
|
|
||||||
Happy coding! 🤗
|
|
||||||
@@ -11,7 +11,7 @@ This tutorial will guide you through the process of setting up and training a ne
|
|||||||
|
|
||||||
By following these steps, you'll be able to replicate tasks like picking up a Lego block and placing it in a bin with a high success rate, as demonstrated in [this video](https://x.com/RemiCadene/status/1814680760592572934).
|
By following these steps, you'll be able to replicate tasks like picking up a Lego block and placing it in a bin with a high success rate, as demonstrated in [this video](https://x.com/RemiCadene/status/1814680760592572934).
|
||||||
|
|
||||||
Although this tutorial is general and can be easily adapted to various types of robots by changing the configuration, it is specifically based on the [Koch v1.1](https://github.com/jess-moss/koch-v1-1), an affordable robot. The Koch v1.1 consists of a leader arm and a follower arm, each with 6 motors. It can work with one or several cameras to record the scene, which serve as visual sensors for the robot.
|
This tutorial is specifically made for the affordable [Koch v1.1](https://github.com/jess-moss/koch-v1-1) robot, but it contains additional information to be easily adapted to various types of robots like [Aloha bimanual robot](https://aloha-2.github.io) by changing some configurations. The Koch v1.1 consists of a leader arm and a follower arm, each with 6 motors. It can work with one or several cameras to record the scene, which serve as visual sensors for the robot.
|
||||||
|
|
||||||
During the data collection phase, you will control the follower arm by moving the leader arm. This process is known as "teleoperation." This technique is used to collect robot trajectories. Afterward, you'll train a neural network to imitate these trajectories and deploy the network to enable your robot to operate autonomously.
|
During the data collection phase, you will control the follower arm by moving the leader arm. This process is known as "teleoperation." This technique is used to collect robot trajectories. Afterward, you'll train a neural network to imitate these trajectories and deploy the network to enable your robot to operate autonomously.
|
||||||
|
|
||||||
@@ -29,16 +29,28 @@ For a visual walkthrough of the assembly process, you can refer to [this video t
|
|||||||
|
|
||||||
## 2. Configure motors, calibrate arms, teleoperate your Koch v1.1
|
## 2. Configure motors, calibrate arms, teleoperate your Koch v1.1
|
||||||
|
|
||||||
First, install the additional dependencies required for Koch v1.1 by running one of the following commands.
|
First, install the additional dependencies required for robots built with dynamixel motors like Koch v1.1 by running one of the following commands (make sure gcc is installed).
|
||||||
|
|
||||||
Using `pip`:
|
Using `pip`:
|
||||||
```bash
|
```bash
|
||||||
pip install -e ".[koch]"
|
pip install -e ".[dynamixel]"
|
||||||
```
|
```
|
||||||
|
|
||||||
Or using `poetry`:
|
Using `poetry`:
|
||||||
```bash
|
```bash
|
||||||
poetry install --sync --extras "koch"
|
poetry sync --extras "dynamixel"
|
||||||
|
```
|
||||||
|
|
||||||
|
Using `uv`:
|
||||||
|
```bash
|
||||||
|
uv sync --extra "dynamixel"
|
||||||
|
```
|
||||||
|
|
||||||
|
/!\ For Linux only, ffmpeg and opencv requires conda install for now. Run this exact sequence of commands:
|
||||||
|
```bash
|
||||||
|
conda install -c conda-forge ffmpeg
|
||||||
|
pip uninstall opencv-python
|
||||||
|
conda install -c conda-forge "opencv>=4.10.0"
|
||||||
```
|
```
|
||||||
|
|
||||||
You are now ready to plug the 5V power supply to the motor bus of the leader arm (the smaller one) since all its motors only require 5V.
|
You are now ready to plug the 5V power supply to the motor bus of the leader arm (the smaller one) since all its motors only require 5V.
|
||||||
@@ -47,36 +59,65 @@ Then plug the 12V power supply to the motor bus of the follower arm. It has two
|
|||||||
|
|
||||||
Finally, connect both arms to your computer via USB. Note that the USB doesn't provide any power, and both arms need to be plugged in with their associated power supply to be detected by your computer.
|
Finally, connect both arms to your computer via USB. Note that the USB doesn't provide any power, and both arms need to be plugged in with their associated power supply to be detected by your computer.
|
||||||
|
|
||||||
*Copy pasting python code*
|
Now you are ready to configure your motors for the first time, as detailed in the sections below. In the upcoming sections, you'll learn about our classes and functions by running some python code in an interactive session, or by copy-pasting it in a python file.
|
||||||
|
|
||||||
In the upcoming sections, you'll learn about our classes and functions by running some python code, in an interactive session, or by copy-pasting it in a python file. If this is your first time using the tutorial., we highly recommend going through these steps to get deeper intuition about how things work. Once you're more familiar, you can streamline the process by directly running the teleoperate script (which is detailed further in the tutorial):
|
If you have already configured your motors the first time, you can streamline the process by directly running the teleoperate script (which is detailed further in the tutorial):
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/control_robot.py teleoperate \
|
python lerobot/scripts/control_robot.py \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
--robot.type=koch \
|
||||||
--robot-overrides '~cameras' # do not instantiate the cameras
|
--control.type=teleoperate
|
||||||
```
|
```
|
||||||
|
|
||||||
It will automatically:
|
It will automatically:
|
||||||
1. Detect and help you correct any motor configuration issues.
|
1. Identify any missing calibrations and initiate the calibration procedure.
|
||||||
2. Identify any missing calibrations and initiate the calibration procedure.
|
2. Connect the robot and start teleoperation.
|
||||||
3. Connect the robot and start teleoperation.
|
|
||||||
|
|
||||||
### a. Control your motors with DynamixelMotorsBus
|
### a. Control your motors with DynamixelMotorsBus
|
||||||
|
|
||||||
You can use the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dynamixel.py) to communicate with the motors connected as a chain to the corresponding USB bus. This class leverages the Python [Dynamixel SDK](https://emanual.robotis.com/docs/en/software/dynamixel/dynamixel_sdk/sample_code/python_read_write_protocol_2_0/#python-read-write-protocol-20) to facilitate reading from and writing to the motors.
|
You can use the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dynamixel.py) to communicate with the motors connected as a chain to the corresponding USB bus. This class leverages the Python [Dynamixel SDK](https://emanual.robotis.com/docs/en/software/dynamixel/dynamixel_sdk/sample_code/python_read_write_protocol_2_0/#python-read-write-protocol-20) to facilitate reading from and writing to the motors.
|
||||||
|
|
||||||
|
**First Configuration of your motors**
|
||||||
|
|
||||||
|
You will need to unplug each motor in turn and run a command the identify the motor. The motor will save its own identification, so you only need to do this once. Start by unplugging all of the motors.
|
||||||
|
|
||||||
|
Do the Leader arm first, as all of its motors are of the same type. Plug in your first motor on your leader arm and run this script to set its ID to 1.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand dynamixel \
|
||||||
|
--model xl330-m288 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 1
|
||||||
|
```
|
||||||
|
|
||||||
|
Then unplug your first motor and plug the second motor and set its ID to 2.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand dynamixel \
|
||||||
|
--model xl330-m288 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 2
|
||||||
|
```
|
||||||
|
|
||||||
|
Redo the process for all your motors until ID 6.
|
||||||
|
|
||||||
|
The process for the follower arm is almost the same, but the follower arm has two types of motors. For the first two motors, make sure you set the model to `xl430-w250`. _Important: configuring follower motors requires plugging and unplugging power. Make sure you use the 5V power for the XL330s and the 12V power for the XL430s!_
|
||||||
|
|
||||||
|
After all of your motors are configured properly, you're ready to plug them all together in a daisy-chain as shown in the original video.
|
||||||
|
|
||||||
**Instantiate the DynamixelMotorsBus**
|
**Instantiate the DynamixelMotorsBus**
|
||||||
|
|
||||||
To begin, create two instances of the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dynamixel.py), one for each arm, using their corresponding USB ports (e.g. `DynamixelMotorsBus(port="/dev/tty.usbmodem575E0031751"`).
|
To begin, create two instances of the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dynamixel.py), one for each arm, using their corresponding USB ports (e.g. `DynamixelMotorsBus(port="/dev/tty.usbmodem575E0031751"`).
|
||||||
|
|
||||||
To find the correct ports for each arm, run the utility script twice:
|
To find the correct ports for each arm, run the utility script twice:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/common/robot_devices/motors/dynamixel.py
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
```
|
```
|
||||||
|
|
||||||
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
||||||
```
|
```
|
||||||
Finding all available ports for the DynamixelMotorsBus.
|
Finding all available ports for the MotorBus.
|
||||||
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
@@ -88,7 +129,7 @@ Reconnect the usb cable.
|
|||||||
|
|
||||||
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
||||||
```
|
```
|
||||||
Finding all available ports for the DynamixelMotorsBus.
|
Finding all available ports for the MotorBus.
|
||||||
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
@@ -98,10 +139,10 @@ The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
|
|||||||
Reconnect the usb cable.
|
Reconnect the usb cable.
|
||||||
```
|
```
|
||||||
|
|
||||||
Troubleshooting: On Linux, you might need to give access to the USB ports by running:
|
Troubleshooting: On Linux, you might need to give access to the USB ports by running this command with your ports:
|
||||||
```bash
|
```bash
|
||||||
sudo chmod 666 /dev/ttyACM0
|
sudo chmod 666 /dev/tty.usbmodem575E0032081
|
||||||
sudo chmod 666 /dev/ttyACM1
|
sudo chmod 666 /dev/tty.usbmodem575E0031751
|
||||||
```
|
```
|
||||||
|
|
||||||
*Listing and Configuring Motors*
|
*Listing and Configuring Motors*
|
||||||
@@ -110,13 +151,11 @@ Next, you'll need to list the motors for each arm, including their name, index,
|
|||||||
|
|
||||||
To assign indices to the motors, run this code in an interactive Python session. Replace the `port` values with the ones you identified earlier:
|
To assign indices to the motors, run this code in an interactive Python session. Replace the `port` values with the ones you identified earlier:
|
||||||
```python
|
```python
|
||||||
|
from lerobot.common.robot_devices.motors.configs import DynamixelMotorsBusConfig
|
||||||
from lerobot.common.robot_devices.motors.dynamixel import DynamixelMotorsBus
|
from lerobot.common.robot_devices.motors.dynamixel import DynamixelMotorsBus
|
||||||
|
|
||||||
leader_port = "/dev/tty.usbmodem575E0031751"
|
leader_config = DynamixelMotorsBusConfig(
|
||||||
follower_port = "/dev/tty.usbmodem575E0032081"
|
port="/dev/tty.usbmodem575E0031751",
|
||||||
|
|
||||||
leader_arm = DynamixelMotorsBus(
|
|
||||||
port=leader_port,
|
|
||||||
motors={
|
motors={
|
||||||
# name: (index, model)
|
# name: (index, model)
|
||||||
"shoulder_pan": (1, "xl330-m077"),
|
"shoulder_pan": (1, "xl330-m077"),
|
||||||
@@ -128,8 +167,8 @@ leader_arm = DynamixelMotorsBus(
|
|||||||
},
|
},
|
||||||
)
|
)
|
||||||
|
|
||||||
follower_arm = DynamixelMotorsBus(
|
follower_config = DynamixelMotorsBusConfig(
|
||||||
port=follower_port,
|
port="/dev/tty.usbmodem575E0032081",
|
||||||
motors={
|
motors={
|
||||||
# name: (index, model)
|
# name: (index, model)
|
||||||
"shoulder_pan": (1, "xl430-w250"),
|
"shoulder_pan": (1, "xl430-w250"),
|
||||||
@@ -140,42 +179,57 @@ follower_arm = DynamixelMotorsBus(
|
|||||||
"gripper": (6, "xl330-m288"),
|
"gripper": (6, "xl330-m288"),
|
||||||
},
|
},
|
||||||
)
|
)
|
||||||
|
|
||||||
|
leader_arm = DynamixelMotorsBus(leader_config)
|
||||||
|
follower_arm = DynamixelMotorsBus(follower_config)
|
||||||
```
|
```
|
||||||
|
|
||||||
*Updating the YAML Configuration File*
|
IMPORTANTLY: Now that you have your ports, update [`KochRobotConfig`](../lerobot/common/robot_devices/robots/configs.py). You will find something like:
|
||||||
|
```python
|
||||||
|
@RobotConfig.register_subclass("koch")
|
||||||
|
@dataclass
|
||||||
|
class KochRobotConfig(ManipulatorRobotConfig):
|
||||||
|
calibration_dir: str = ".cache/calibration/koch"
|
||||||
|
# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes.
|
||||||
|
# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
|
||||||
|
# the number of motors in your follower arms.
|
||||||
|
max_relative_target: int | None = None
|
||||||
|
|
||||||
Next, update the port values in the YAML configuration file for the Koch robot at [`lerobot/configs/robot/koch.yaml`](../lerobot/configs/robot/koch.yaml) with the ports you've identified:
|
leader_arms: dict[str, MotorsBusConfig] = field(
|
||||||
```yaml
|
default_factory=lambda: {
|
||||||
[...]
|
"main": DynamixelMotorsBusConfig(
|
||||||
leader_arms:
|
port="/dev/tty.usbmodem585A0085511", <-- UPDATE HERE
|
||||||
main:
|
motors={
|
||||||
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
# name: (index, model)
|
||||||
port: /dev/tty.usbmodem575E0031751 # <- Update
|
"shoulder_pan": [1, "xl330-m077"],
|
||||||
motors:
|
"shoulder_lift": [2, "xl330-m077"],
|
||||||
# name: (index, model)
|
"elbow_flex": [3, "xl330-m077"],
|
||||||
shoulder_pan: [1, "xl330-m077"]
|
"wrist_flex": [4, "xl330-m077"],
|
||||||
shoulder_lift: [2, "xl330-m077"]
|
"wrist_roll": [5, "xl330-m077"],
|
||||||
elbow_flex: [3, "xl330-m077"]
|
"gripper": [6, "xl330-m077"],
|
||||||
wrist_flex: [4, "xl330-m077"]
|
},
|
||||||
wrist_roll: [5, "xl330-m077"]
|
),
|
||||||
gripper: [6, "xl330-m077"]
|
}
|
||||||
follower_arms:
|
)
|
||||||
main:
|
|
||||||
_target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
|
follower_arms: dict[str, MotorsBusConfig] = field(
|
||||||
port: /dev/tty.usbmodem575E0032081 # <- Update
|
default_factory=lambda: {
|
||||||
motors:
|
"main": DynamixelMotorsBusConfig(
|
||||||
# name: (index, model)
|
port="/dev/tty.usbmodem585A0076891", <-- UPDATE HERE
|
||||||
shoulder_pan: [1, "xl430-w250"]
|
motors={
|
||||||
shoulder_lift: [2, "xl430-w250"]
|
# name: (index, model)
|
||||||
elbow_flex: [3, "xl330-m288"]
|
"shoulder_pan": [1, "xl430-w250"],
|
||||||
wrist_flex: [4, "xl330-m288"]
|
"shoulder_lift": [2, "xl430-w250"],
|
||||||
wrist_roll: [5, "xl330-m288"]
|
"elbow_flex": [3, "xl330-m288"],
|
||||||
gripper: [6, "xl330-m288"]
|
"wrist_flex": [4, "xl330-m288"],
|
||||||
[...]
|
"wrist_roll": [5, "xl330-m288"],
|
||||||
|
"gripper": [6, "xl330-m288"],
|
||||||
|
},
|
||||||
|
),
|
||||||
|
}
|
||||||
|
)
|
||||||
```
|
```
|
||||||
|
|
||||||
This configuration file is used to instantiate your robot across all scripts. We'll cover how this works later on.
|
|
||||||
|
|
||||||
**Connect and Configure your Motors**
|
**Connect and Configure your Motors**
|
||||||
|
|
||||||
Before you can start using your motors, you'll need to configure them to ensure proper communication. When you first connect the motors, the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dynamixel.py) automatically detects any mismatch between the current motor indices (factory set to `1`) and the specified indices (e.g., `1, 2, 3, 4, 5, 6`). This triggers a configuration procedure that requires you to unplug the power cord and motors, then reconnect each motor sequentially, starting from the one closest to the bus.
|
Before you can start using your motors, you'll need to configure them to ensure proper communication. When you first connect the motors, the [`DynamixelMotorsBus`](../lerobot/common/robot_devices/motors/dynamixel.py) automatically detects any mismatch between the current motor indices (factory set to `1`) and the specified indices (e.g., `1, 2, 3, 4, 5, 6`). This triggers a configuration procedure that requires you to unplug the power cord and motors, then reconnect each motor sequentially, starting from the one closest to the bus.
|
||||||
@@ -298,48 +352,53 @@ Alternatively, you can unplug the power cord, which will automatically disable t
|
|||||||
|
|
||||||
*/!\ Warning*: These motors tend to overheat, especially under torque or if left plugged in for too long. Unplug after use.
|
*/!\ Warning*: These motors tend to overheat, especially under torque or if left plugged in for too long. Unplug after use.
|
||||||
|
|
||||||
### b. Teleoperate your Koch v1.1 with KochRobot
|
### b. Teleoperate your Koch v1.1 with ManipulatorRobot
|
||||||
|
|
||||||
**Instantiate the KochRobot**
|
**Instantiate the ManipulatorRobot**
|
||||||
|
|
||||||
Before you can teleoperate your robot, you need to instantiate the [`KochRobot`](../lerobot/common/robot_devices/robots/koch.py) using the previously defined `leader_arm` and `follower_arm`.
|
Before you can teleoperate your robot, you need to instantiate the [`ManipulatorRobot`](../lerobot/common/robot_devices/robots/manipulator.py) using the previously defined `leader_config` and `follower_config`.
|
||||||
|
|
||||||
For the Koch robot, we only have one leader, so we refer to it as `"main"` and define it as `leader_arms={"main": leader_arm}`. We do the same for the follower arm. For other robots (like the Aloha), which may have two pairs of leader and follower arms, you would define them like this: `leader_arms={"left": left_leader_arm, "right": right_leader_arm},`. Same thing for the follower arms.
|
For the Koch v1.1 robot, we only have one leader, so we refer to it as `"main"` and define it as `leader_arms={"main": leader_config}`. We do the same for the follower arm. For other robots (like the Aloha), which may have two pairs of leader and follower arms, you would define them like this: `leader_arms={"left": left_leader_config, "right": right_leader_config},`. Same thing for the follower arms.
|
||||||
|
|
||||||
You also need to provide a path to a calibration file, such as `calibration_path=".cache/calibration/koch.pkl"`. More on this in the next section.
|
|
||||||
|
|
||||||
Run the following code to instantiate your Koch robot:
|
Run the following code to instantiate your manipulator robot:
|
||||||
```python
|
```python
|
||||||
from lerobot.common.robot_devices.robots.koch import KochRobot
|
from lerobot.common.robot_devices.robots.configs import KochRobotConfig
|
||||||
|
from lerobot.common.robot_devices.robots.manipulator import ManipulatorRobot
|
||||||
|
|
||||||
robot = KochRobot(
|
robot_config = KochRobotConfig(
|
||||||
leader_arms={"main": leader_arm},
|
leader_arms={"main": leader_config},
|
||||||
follower_arms={"main": follower_arm},
|
follower_arms={"main": follower_config},
|
||||||
calibration_path=".cache/calibration/koch.pkl",
|
cameras={}, # We don't use any camera for now
|
||||||
)
|
)
|
||||||
|
robot = ManipulatorRobot(robot_config)
|
||||||
```
|
```
|
||||||
|
|
||||||
**Calibrate and Connect the KochRobot**
|
The `KochRobotConfig` is used to set the associated settings and calibration process. For instance, we activate the torque of the gripper of the leader Koch v1.1 arm and position it at a 40 degree angle to use it as a trigger.
|
||||||
|
|
||||||
Next, you'll need to calibrate your robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one Koch robot to work on another.
|
For the [Aloha bimanual robot](https://aloha-2.github.io), we would use `AlohaRobotConfig` to set different settings such as a secondary ID for shadow joints (shoulder, elbow). Specific to Aloha, LeRobot comes with default calibration files stored in in `.cache/calibration/aloha_default`. Assuming the motors have been properly assembled, no manual calibration step is expected for Aloha.
|
||||||
|
|
||||||
When you connect your robot for the first time, the [`KochRobot`](../lerobot/common/robot_devices/robots/koch.py) will detect if the calibration file is missing and trigger the calibration procedure. During this process, you will be guided to move each arm to three different positions.
|
**Calibrate and Connect the ManipulatorRobot**
|
||||||
|
|
||||||
|
Next, you'll need to calibrate your Koch robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one Koch robot to work on another.
|
||||||
|
|
||||||
|
When you connect your robot for the first time, the [`ManipulatorRobot`](../lerobot/common/robot_devices/robots/manipulator.py) will detect if the calibration file is missing and trigger the calibration procedure. During this process, you will be guided to move each arm to three different positions.
|
||||||
|
|
||||||
Here are the positions you'll move the follower arm to:
|
Here are the positions you'll move the follower arm to:
|
||||||
|
|
||||||
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|---|---|---|
|
| ----------------------------------------------------------------------------------------------------------------------------------------------------------------- | -------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------- |
|
||||||
| <img src="../media/koch/follower_zero.webp?raw=true" alt="Koch v1.1 follower arm zero position" title="Koch v1.1 follower arm zero position" style="width:100%;"> | <img src="../media/koch/follower_rotated.webp?raw=true" alt="Koch v1.1 follower arm rotated position" title="Koch v1.1 follower arm rotated position" style="width:100%;"> | <img src="../media/koch/follower_rest.webp?raw=true" alt="Koch v1.1 follower arm rest position" title="Koch v1.1 follower arm rest position" style="width:100%;"> |
|
| <img src="../media/koch/follower_zero.webp?raw=true" alt="Koch v1.1 follower arm zero position" title="Koch v1.1 follower arm zero position" style="width:100%;"> | <img src="../media/koch/follower_rotated.webp?raw=true" alt="Koch v1.1 follower arm rotated position" title="Koch v1.1 follower arm rotated position" style="width:100%;"> | <img src="../media/koch/follower_rest.webp?raw=true" alt="Koch v1.1 follower arm rest position" title="Koch v1.1 follower arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
And here are the corresponding positions for the leader arm:
|
And here are the corresponding positions for the leader arm:
|
||||||
|
|
||||||
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|---|---|---|
|
| ----------------------------------------------------------------------------------------------------------------------------------------------------------- | -------------------------------------------------------------------------------------------------------------------------------------------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------- |
|
||||||
| <img src="../media/koch/leader_zero.webp?raw=true" alt="Koch v1.1 leader arm zero position" title="Koch v1.1 leader arm zero position" style="width:100%;"> | <img src="../media/koch/leader_rotated.webp?raw=true" alt="Koch v1.1 leader arm rotated position" title="Koch v1.1 leader arm rotated position" style="width:100%;"> | <img src="../media/koch/leader_rest.webp?raw=true" alt="Koch v1.1 leader arm rest position" title="Koch v1.1 leader arm rest position" style="width:100%;"> |
|
| <img src="../media/koch/leader_zero.webp?raw=true" alt="Koch v1.1 leader arm zero position" title="Koch v1.1 leader arm zero position" style="width:100%;"> | <img src="../media/koch/leader_rotated.webp?raw=true" alt="Koch v1.1 leader arm rotated position" title="Koch v1.1 leader arm rotated position" style="width:100%;"> | <img src="../media/koch/leader_rest.webp?raw=true" alt="Koch v1.1 leader arm rest position" title="Koch v1.1 leader arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
You can watch a [video tutorial of the calibration procedure](https://youtu.be/8drnU9uRY24) for more details.
|
You can watch a [video tutorial of the calibration procedure](https://youtu.be/8drnU9uRY24) for more details.
|
||||||
|
|
||||||
During calibration, we count the number of full 360-degree rotations your motors have made since they were first used. That's why we ask yo to move to this arbitrary "zero" position. We don't actually "set" the zero position, so you don't need to be accurate. After calculating these "offsets" to shift the motor values around 0, we need to assess the rotation direction of each motor, which might differ. That's why we ask you to rotate all motors to roughly 90 degrees, to mesure if the values changed negatively or positively.
|
During calibration, we count the number of full 360-degree rotations your motors have made since they were first used. That's why we ask yo to move to this arbitrary "zero" position. We don't actually "set" the zero position, so you don't need to be accurate. After calculating these "offsets" to shift the motor values around 0, we need to assess the rotation direction of each motor, which might differ. That's why we ask you to rotate all motors to roughly 90 degrees, to measure if the values changed negatively or positively.
|
||||||
|
|
||||||
Finally, the rest position ensures that the follower and leader arms are roughly aligned after calibration, preventing sudden movements that could damage the motors when starting teleoperation.
|
Finally, the rest position ensures that the follower and leader arms are roughly aligned after calibration, preventing sudden movements that could damage the motors when starting teleoperation.
|
||||||
|
|
||||||
@@ -354,27 +413,26 @@ The output will look like this:
|
|||||||
```
|
```
|
||||||
Connecting main follower arm
|
Connecting main follower arm
|
||||||
Connecting main leader arm
|
Connecting main leader arm
|
||||||
Missing calibration file '.cache/calibration/koch.pkl'. Starting calibration procedure.
|
|
||||||
|
|
||||||
Running calibration of main follower...
|
|
||||||
|
|
||||||
|
Missing calibration file '.cache/calibration/koch/main_follower.json'
|
||||||
|
Running calibration of koch main follower...
|
||||||
Move arm to zero position
|
Move arm to zero position
|
||||||
[...]
|
[...]
|
||||||
Move arm to rotated position
|
Move arm to rotated position
|
||||||
[...]
|
[...]
|
||||||
Move arm to rest position
|
Move arm to rest position
|
||||||
[...]
|
[...]
|
||||||
|
Calibration is done! Saving calibration file '.cache/calibration/koch/main_follower.json'
|
||||||
|
|
||||||
Running calibration of main leader...
|
Missing calibration file '.cache/calibration/koch/main_leader.json'
|
||||||
|
Running calibration of koch main leader...
|
||||||
Move arm to zero position
|
Move arm to zero position
|
||||||
[...]
|
[...]
|
||||||
Move arm to rotated position
|
Move arm to rotated position
|
||||||
[...]
|
[...]
|
||||||
Move arm to rest position
|
Move arm to rest position
|
||||||
[...]
|
[...]
|
||||||
|
Calibration is done! Saving calibration file '.cache/calibration/koch/main_leader.json'
|
||||||
Calibration is done! Saving calibration file '.cache/calibration/koch.pkl'
|
|
||||||
```
|
```
|
||||||
|
|
||||||
*Verifying Calibration*
|
*Verifying Calibration*
|
||||||
@@ -414,7 +472,7 @@ for _ in tqdm.tqdm(range(seconds*frequency)):
|
|||||||
|
|
||||||
*Using `teleop_step` for Teleoperation*
|
*Using `teleop_step` for Teleoperation*
|
||||||
|
|
||||||
Alternatively, you can teleoperate the robot using the `teleop_step` method from [`KochRobot`](../lerobot/common/robot_devices/robots/koch.py).
|
Alternatively, you can teleoperate the robot using the `teleop_step` method from [`ManipulatorRobot`](../lerobot/common/robot_devices/robots/manipulator.py).
|
||||||
|
|
||||||
Run this code to teleoperate:
|
Run this code to teleoperate:
|
||||||
```python
|
```python
|
||||||
@@ -565,9 +623,11 @@ Note: Some cameras may take a few seconds to warm up, and the first frame might
|
|||||||
|
|
||||||
Finally, run this code to instantiate and connectyour camera:
|
Finally, run this code to instantiate and connectyour camera:
|
||||||
```python
|
```python
|
||||||
|
from lerobot.common.robot_devices.cameras.configs import OpenCVCameraConfig
|
||||||
from lerobot.common.robot_devices.cameras.opencv import OpenCVCamera
|
from lerobot.common.robot_devices.cameras.opencv import OpenCVCamera
|
||||||
|
|
||||||
camera = OpenCVCamera(camera_index=0)
|
config = OpenCVCameraConfig(camera_index=0)
|
||||||
|
camera = OpenCVCamera(config)
|
||||||
camera.connect()
|
camera.connect()
|
||||||
color_image = camera.read()
|
color_image = camera.read()
|
||||||
|
|
||||||
@@ -589,7 +649,7 @@ uint8
|
|||||||
|
|
||||||
With certain camera, you can also specify additional parameters like frame rate, resolution, and color mode during instantiation. For instance:
|
With certain camera, you can also specify additional parameters like frame rate, resolution, and color mode during instantiation. For instance:
|
||||||
```python
|
```python
|
||||||
camera = OpenCVCamera(camera_index=0, fps=30, width=640, height=480)
|
config = OpenCVCameraConfig(camera_index=0, fps=30, width=640, height=480)
|
||||||
```
|
```
|
||||||
|
|
||||||
If the provided arguments are not compatible with the camera, an exception will be raised.
|
If the provided arguments are not compatible with the camera, an exception will be raised.
|
||||||
@@ -603,18 +663,20 @@ camera.disconnect()
|
|||||||
|
|
||||||
**Instantiate your robot with cameras**
|
**Instantiate your robot with cameras**
|
||||||
|
|
||||||
Additionaly, you can set up your robot to work with your cameras.
|
Additionally, you can set up your robot to work with your cameras.
|
||||||
|
|
||||||
Modify the following Python code with the appropriate camera names and configurations:
|
Modify the following Python code with the appropriate camera names and configurations:
|
||||||
```python
|
```python
|
||||||
robot = KochRobot(
|
robot = ManipulatorRobot(
|
||||||
leader_arms={"main": leader_arm},
|
KochRobotConfig(
|
||||||
follower_arms={"main": follower_arm},
|
leader_arms={"main": leader_arm},
|
||||||
calibration_path=".cache/calibration/koch.pkl",
|
follower_arms={"main": follower_arm},
|
||||||
cameras={
|
calibration_dir=".cache/calibration/koch",
|
||||||
"laptop": OpenCVCamera(0, fps=30, width=640, height=480),
|
cameras={
|
||||||
"phone": OpenCVCamera(1, fps=30, width=640, height=480),
|
"laptop": OpenCVCameraConfig(0, fps=30, width=640, height=480),
|
||||||
},
|
"phone": OpenCVCameraConfig(1, fps=30, width=640, height=480),
|
||||||
|
},
|
||||||
|
)
|
||||||
)
|
)
|
||||||
robot.connect()
|
robot.connect()
|
||||||
```
|
```
|
||||||
@@ -638,39 +700,20 @@ torch.Size([3, 480, 640])
|
|||||||
255
|
255
|
||||||
```
|
```
|
||||||
|
|
||||||
Also, update the following lines of the yaml file for Koch robot [`lerobot/configs/robot/koch.yaml`](../lerobot/configs/robot/koch.yaml) with the names and configurations of your cameras:
|
### d. Use `control_robot.py` and our `teleoperate` function
|
||||||
```yaml
|
|
||||||
[...]
|
|
||||||
cameras:
|
|
||||||
laptop:
|
|
||||||
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
|
||||||
camera_index: 0
|
|
||||||
fps: 30
|
|
||||||
width: 640
|
|
||||||
height: 480
|
|
||||||
phone:
|
|
||||||
_target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
|
|
||||||
camera_index: 1
|
|
||||||
fps: 30
|
|
||||||
width: 640
|
|
||||||
height: 480
|
|
||||||
```
|
|
||||||
|
|
||||||
This file is used to instantiate your robot in all our scripts. We will explain how this works in the next section.
|
Instead of manually running the python code in a terminal window, you can use [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) to instantiate your robot by providing the robot configurations via command line and control your robot with various modes as explained next.
|
||||||
|
|
||||||
### d. Use `koch.yaml` and our `teleoperate` function
|
|
||||||
|
|
||||||
Instead of manually running the python code in a terminal window, you can use [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) to instantiate your robot by providing the path to the robot yaml file (e.g. [`lerobot/configs/robot/koch.yaml`](../lerobot/configs/robot/koch.yaml)) and control your robot with various modes as explained next.
|
|
||||||
|
|
||||||
Try running this code to teleoperate your robot (if you dont have a camera, keep reading):
|
Try running this code to teleoperate your robot (if you dont have a camera, keep reading):
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/control_robot.py teleoperate \
|
python lerobot/scripts/control_robot.py \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml
|
--robot.type=koch \
|
||||||
|
--control.type=teleoperate
|
||||||
```
|
```
|
||||||
|
|
||||||
You will see a lot of lines appearing like this one:
|
You will see a lot of lines appearing like this one:
|
||||||
```
|
```
|
||||||
INFO 2024-08-10 11:15:03 ol_robot.py:209 dt: 5.12 (195.1hz) dtRlead: 4.93 (203.0hz) dtRfoll: 0.19 (5239.0hz)
|
INFO 2024-08-10 11:15:03 ol_robot.py:209 dt: 5.12 (195.1hz) dtRlead: 4.93 (203.0hz) dtWfoll: 0.19 (5239.0hz)
|
||||||
```
|
```
|
||||||
|
|
||||||
It contains
|
It contains
|
||||||
@@ -680,21 +723,12 @@ It contains
|
|||||||
- `dtRlead: 4.93 (203.0hz)` which is the number of milliseconds it took to read the position of the leader arm using `leader_arm.read("Present_Position")`.
|
- `dtRlead: 4.93 (203.0hz)` which is the number of milliseconds it took to read the position of the leader arm using `leader_arm.read("Present_Position")`.
|
||||||
- `dtWfoll: 0.22 (4446.9hz)` which is the number of milliseconds it took to set a new goal position for the follower arm using `follower_arm.write("Goal_position", leader_pos)` ; note that writing is done asynchronously so it takes less time than reading.
|
- `dtWfoll: 0.22 (4446.9hz)` which is the number of milliseconds it took to set a new goal position for the follower arm using `follower_arm.write("Goal_position", leader_pos)` ; note that writing is done asynchronously so it takes less time than reading.
|
||||||
|
|
||||||
Note: you can override any entry in the yaml file using `--robot-overrides` and the [hydra.cc](https://hydra.cc/docs/advanced/override_grammar/basic) syntax. If needed, you can override the ports like this:
|
Importantly: If you don't have any camera, you can remove them dynamically with this [draccus](https://github.com/dlwh/draccus) syntax `--robot.cameras='{}'`:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/control_robot.py teleoperate \
|
python lerobot/scripts/control_robot.py \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
--robot.type=koch \
|
||||||
--robot-overrides \
|
--robot.cameras='{}' \
|
||||||
leader_arms.main.port=/dev/tty.usbmodem575E0031751 \
|
--control.type=teleoperate
|
||||||
follower_arms.main.port=/dev/tty.usbmodem575E0032081
|
|
||||||
```
|
|
||||||
|
|
||||||
Importantly: If you don't have any camera, you can remove them dynamically with this [hydra.cc](https://hydra.cc/docs/advanced/override_grammar/basic) syntax `'~cameras'`:
|
|
||||||
```bash
|
|
||||||
python lerobot/scripts/control_robot.py teleoperate \
|
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
|
||||||
--robot-overrides \
|
|
||||||
'~cameras'
|
|
||||||
```
|
```
|
||||||
|
|
||||||
We advise to create a new yaml file when the command becomes too long.
|
We advise to create a new yaml file when the command becomes too long.
|
||||||
@@ -730,55 +764,56 @@ for _ in range(record_time_s * fps):
|
|||||||
|
|
||||||
Importantly, many utilities are still missing. For instance, if you have cameras, you will need to save the images on disk to not go out of RAM, and to do so in threads to not slow down communication with your robot. Also, you will need to store your data in a format optimized for training and web sharing like [`LeRobotDataset`](../lerobot/common/datasets/lerobot_dataset.py). More on this in the next section.
|
Importantly, many utilities are still missing. For instance, if you have cameras, you will need to save the images on disk to not go out of RAM, and to do so in threads to not slow down communication with your robot. Also, you will need to store your data in a format optimized for training and web sharing like [`LeRobotDataset`](../lerobot/common/datasets/lerobot_dataset.py). More on this in the next section.
|
||||||
|
|
||||||
### a. Use `koch.yaml` and the `record` function
|
### a. Use the `record` function
|
||||||
|
|
||||||
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) to achieve efficient data recording. It encompasses many recording utilities:
|
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) to achieve efficient data recording. It encompasses many recording utilities:
|
||||||
1. Frames from cameras are saved on disk in threads, and encoded into videos at the end of recording.
|
1. Frames from cameras are saved on disk in threads, and encoded into videos at the end of each episode recording.
|
||||||
2. Video streams from cameras are displayed in window so that you can verify them.
|
2. Video streams from cameras are displayed in window so that you can verify them.
|
||||||
3. Data is stored with [`LeRobotDataset`](../lerobot/common/datasets/lerobot_dataset.py) format which is pushed to your Hugging Face page (unless `--push-to-hub 0` is provided).
|
3. Data is stored with [`LeRobotDataset`](../lerobot/common/datasets/lerobot_dataset.py) format which is pushed to your Hugging Face page (unless `--control.push_to_hub=false` is provided).
|
||||||
4. Checkpoints are done during recording, so if any issue occurs, you can resume recording by re-running the same command again. You can also use `--force-override 1` to start recording from scratch.
|
4. Checkpoints are done during recording, so if any issue occurs, you can resume recording by re-running the same command again with `--control.resume=true`. You will need to manually delete the dataset directory if you want to start recording from scratch.
|
||||||
5. Set the flow of data recording using command line arguments:
|
5. Set the flow of data recording using command line arguments:
|
||||||
- `--warmup-time-s` defines the number of seconds before starting data collection. It allows the robot devices to warmup and synchronize (10 seconds by default).
|
- `--control.warmup_time_s=10` defines the number of seconds before starting data collection. It allows the robot devices to warmup and synchronize (10 seconds by default).
|
||||||
- `--episode-time-s` defines the number of seconds for data recording for each episode (60 seconds by default).
|
- `--control.episode_time_s=60` defines the number of seconds for data recording for each episode (60 seconds by default).
|
||||||
- `--reset-time-s` defines the number of seconds for resetting the environment after each episode (60 seconds by default).
|
- `--control.reset_time_s=60` defines the number of seconds for resetting the environment after each episode (60 seconds by default).
|
||||||
- `--num-episodes` defines the number of episodes to record (50 by default).
|
- `--control.num_episodes=50` defines the number of episodes to record (50 by default).
|
||||||
6. Control the flow during data recording using keyboard keys:
|
6. Control the flow during data recording using keyboard keys:
|
||||||
- Press right arrow `->` at any time during episode recording to early stop and go to resetting. Same during resetting, to early stop and to go to the next episode recording.
|
- Press right arrow `->` at any time during episode recording to early stop and go to resetting. Same during resetting, to early stop and to go to the next episode recording.
|
||||||
- Press left arrow `<-` at any time during episode recording or resetting to early stop, cancel the current episode, and re-record it.
|
- Press left arrow `<-` at any time during episode recording or resetting to early stop, cancel the current episode, and re-record it.
|
||||||
- Press escape `ESC` at any time during episode recording to end the session early and go straight to video encoding and dataset uploading.
|
- Press escape `ESC` at any time during episode recording to end the session early and go straight to video encoding and dataset uploading.
|
||||||
7. Similarly to `teleoperate`, you can also use `--robot-path` and `--robot-overrides` to specify your robots.
|
7. Similarly to `teleoperate`, you can also use the command line to override anything.
|
||||||
|
|
||||||
Before trying `record`, if you want to push your dataset to the hub, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
Before trying `record`, if you want to push your dataset to the hub, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
```bash
|
```bash
|
||||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
```
|
```
|
||||||
Also, store your Hugging Face repositery name in a variable (e.g. `cadene` or `lerobot`). For instance, run this to use your Hugging Face user name as repositery:
|
Also, store your Hugging Face repository name in a variable (e.g. `cadene` or `lerobot`). For instance, run this to use your Hugging Face user name as repository:
|
||||||
```bash
|
```bash
|
||||||
HF_USER=$(huggingface-cli whoami | head -n 1)
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
echo $HF_USER
|
echo $HF_USER
|
||||||
```
|
```
|
||||||
If you don't want to push to hub, use `--push-to-hub 0`.
|
If you don't want to push to hub, use `--control.push_to_hub=false`.
|
||||||
|
|
||||||
Now run this to record 2 episodes:
|
Now run this to record 2 episodes:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/control_robot.py record \
|
python lerobot/scripts/control_robot.py \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
--robot.type=koch \
|
||||||
--fps 30 \
|
--control.type=record \
|
||||||
--root data \
|
--control.single_task="Grasp a lego block and put it in the bin." \
|
||||||
--repo-id ${HF_USER}/koch_test \
|
--control.fps=30 \
|
||||||
--tags tutorial \
|
--control.repo_id=${HF_USER}/koch_test \
|
||||||
--warmup-time-s 5 \
|
--control.tags='["tutorial"]' \
|
||||||
--episode-time-s 30 \
|
--control.warmup_time_s=5 \
|
||||||
--reset-time-s 30 \
|
--control.episode_time_s=30 \
|
||||||
--num-episodes 2
|
--control.reset_time_s=30 \
|
||||||
|
--control.num_episodes=2 \
|
||||||
|
--control.push_to_hub=true
|
||||||
```
|
```
|
||||||
|
|
||||||
This will write your dataset locally to `{root}/{repo-id}` (e.g. `data/cadene/koch_test`) and push it on the hub at `https://huggingface.co/datasets/{HF_USER}/{repo-id}`. Your dataset will be automatically tagged with `LeRobot` for the community to find it easily, and you can also add custom tags (in this case `tutorial` for example).
|
|
||||||
|
This will write your dataset locally to `~/.cache/huggingface/lerobot/{repo-id}` (e.g. `data/cadene/koch_test`) and push it on the hub at `https://huggingface.co/datasets/{HF_USER}/{repo-id}`. Your dataset will be automatically tagged with `LeRobot` for the community to find it easily, and you can also add custom tags (in this case `tutorial` for example).
|
||||||
|
|
||||||
You can look for other LeRobot datasets on the hub by searching for `LeRobot` tags: https://huggingface.co/datasets?other=LeRobot
|
You can look for other LeRobot datasets on the hub by searching for `LeRobot` tags: https://huggingface.co/datasets?other=LeRobot
|
||||||
|
|
||||||
Remember to add `--robot-overrides '~cameras'` if you don't have any cameras and you still use the default `koch.yaml` configuration.
|
|
||||||
|
|
||||||
You will see a lot of lines appearing like this one:
|
You will see a lot of lines appearing like this one:
|
||||||
```
|
```
|
||||||
INFO 2024-08-10 15:02:58 ol_robot.py:219 dt:33.34 (30.0hz) dtRlead: 5.06 (197.5hz) dtWfoll: 0.25 (3963.7hz) dtRfoll: 6.22 (160.7hz) dtRlaptop: 32.57 (30.7hz) dtRphone: 33.84 (29.5hz)
|
INFO 2024-08-10 15:02:58 ol_robot.py:219 dt:33.34 (30.0hz) dtRlead: 5.06 (197.5hz) dtWfoll: 0.25 (3963.7hz) dtRfoll: 6.22 (160.7hz) dtRlaptop: 32.57 (30.7hz) dtRphone: 33.84 (29.5hz)
|
||||||
@@ -790,8 +825,8 @@ It contains:
|
|||||||
- `dtRlead: 5.06 (197.5hz)` which is the delta time of reading the present position of the leader arm.
|
- `dtRlead: 5.06 (197.5hz)` which is the delta time of reading the present position of the leader arm.
|
||||||
- `dtWfoll: 0.25 (3963.7hz)` which is the delta time of writing the goal position on the follower arm ; writing is asynchronous so it takes less time than reading.
|
- `dtWfoll: 0.25 (3963.7hz)` which is the delta time of writing the goal position on the follower arm ; writing is asynchronous so it takes less time than reading.
|
||||||
- `dtRfoll: 6.22 (160.7hz)` which is the delta time of reading the present position on the follower arm.
|
- `dtRfoll: 6.22 (160.7hz)` which is the delta time of reading the present position on the follower arm.
|
||||||
- `dtRlaptop:32.57 (30.7hz) ` which is the delta time of capturing an image from the laptop camera in the thread running asynchrously.
|
- `dtRlaptop:32.57 (30.7hz) ` which is the delta time of capturing an image from the laptop camera in the thread running asynchronously.
|
||||||
- `dtRphone:33.84 (29.5hz)` which is the delta time of capturing an image from the phone camera in the thread running asynchrously.
|
- `dtRphone:33.84 (29.5hz)` which is the delta time of capturing an image from the phone camera in the thread running asynchronously.
|
||||||
|
|
||||||
Troubleshooting:
|
Troubleshooting:
|
||||||
- On Linux, if you encounter a hanging issue when using cameras, uninstall opencv and re-install it with conda:
|
- On Linux, if you encounter a hanging issue when using cameras, uninstall opencv and re-install it with conda:
|
||||||
@@ -811,7 +846,7 @@ At the end of data recording, your dataset will be uploaded on your Hugging Face
|
|||||||
echo https://huggingface.co/datasets/${HF_USER}/koch_test
|
echo https://huggingface.co/datasets/${HF_USER}/koch_test
|
||||||
```
|
```
|
||||||
|
|
||||||
### b. Advices for recording dataset
|
### b. Advice for recording dataset
|
||||||
|
|
||||||
Once you're comfortable with data recording, it's time to create a larger dataset for training. A good starting task is grasping an object at different locations and placing it in a bin. We suggest recording at least 50 episodes, with 10 episodes per location. Keep the cameras fixed and maintain consistent grasping behavior throughout the recordings.
|
Once you're comfortable with data recording, it's time to create a larger dataset for training. A good starting task is grasping an object at different locations and placing it in a bin. We suggest recording at least 50 episodes, with 10 episodes per location. Keep the cameras fixed and maintain consistent grasping behavior throughout the recordings.
|
||||||
|
|
||||||
@@ -826,10 +861,11 @@ In the coming months, we plan to release a foundational model for robotics. We a
|
|||||||
You can visualize your dataset by running:
|
You can visualize your dataset by running:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/visualize_dataset_html.py \
|
python lerobot/scripts/visualize_dataset_html.py \
|
||||||
--root data \
|
|
||||||
--repo-id ${HF_USER}/koch_test
|
--repo-id ${HF_USER}/koch_test
|
||||||
```
|
```
|
||||||
|
|
||||||
|
Note: You might need to add `--local-files-only 1` if your dataset was not uploaded to hugging face hub.
|
||||||
|
|
||||||
This will launch a local web server that looks like this:
|
This will launch a local web server that looks like this:
|
||||||
<div style="text-align:center;">
|
<div style="text-align:center;">
|
||||||
<img src="../media/tutorial/visualize_dataset_html.webp?raw=true" alt="Koch v1.1 leader and follower arms" title="Koch v1.1 leader and follower arms" width="100%">
|
<img src="../media/tutorial/visualize_dataset_html.webp?raw=true" alt="Koch v1.1 leader and follower arms" title="Koch v1.1 leader and follower arms" width="100%">
|
||||||
@@ -841,12 +877,12 @@ A useful feature of [`lerobot/scripts/control_robot.py`](../lerobot/scripts/cont
|
|||||||
|
|
||||||
To replay the first episode of the dataset you just recorded, run the following command:
|
To replay the first episode of the dataset you just recorded, run the following command:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/control_robot.py replay \
|
python lerobot/scripts/control_robot.py \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
--robot.type=koch \
|
||||||
--fps 30 \
|
--control.type=replay \
|
||||||
--root data \
|
--control.fps=30 \
|
||||||
--repo-id ${HF_USER}/koch_test \
|
--control.repo_id=${HF_USER}/koch_test \
|
||||||
--episode 0
|
--control.episode=0
|
||||||
```
|
```
|
||||||
|
|
||||||
Your robot should replicate movements similar to those you recorded. For example, check out [this video](https://x.com/RemiCadene/status/1793654950905680090) where we use `replay` on a Aloha robot from [Trossen Robotics](https://www.trossenrobotics.com).
|
Your robot should replicate movements similar to those you recorded. For example, check out [this video](https://x.com/RemiCadene/status/1793654950905680090) where we use `replay` on a Aloha robot from [Trossen Robotics](https://www.trossenrobotics.com).
|
||||||
@@ -857,54 +893,20 @@ Your robot should replicate movements similar to those you recorded. For example
|
|||||||
|
|
||||||
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR=data python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
dataset_repo_id=${HF_USER}/koch_test \
|
--dataset.repo_id=${HF_USER}/koch_test \
|
||||||
policy=act_koch_real \
|
--policy.type=act \
|
||||||
env=koch_real \
|
--output_dir=outputs/train/act_koch_test \
|
||||||
hydra.run.dir=outputs/train/act_koch_test \
|
--job_name=act_koch_test \
|
||||||
hydra.job.name=act_koch_test \
|
--policy.device=cuda \
|
||||||
device=cuda \
|
--wandb.enable=true
|
||||||
wandb.enable=true
|
|
||||||
```
|
```
|
||||||
|
|
||||||
Let's explain it:
|
Let's explain it:
|
||||||
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/koch_test`.
|
1. We provided the dataset as argument with `--dataset.repo_id=${HF_USER}/koch_test`.
|
||||||
2. We provided the policy with `policy=act_koch_real`. This loads configurations from [`lerobot/configs/policy/act_koch_real.yaml`](../lerobot/configs/policy/act_koch_real.yaml). Importantly, this policy uses 2 cameras as input `laptop` and `phone`. If your dataset has different cameras, update the yaml file to account for it in the following parts:
|
2. We provided the policy with `policy.type=act`. This loads configurations from [`configuration_act.py`](../lerobot/common/policies/act/configuration_act.py). Importantly, this policy will automatically adapt to the number of motor sates, motor actions and cameras of your robot (e.g. `laptop` and `phone`) which have been saved in your dataset.
|
||||||
```yaml
|
4. We provided `policy.device=cuda` since we are training on a Nvidia GPU, but you could use `policy.device=mps` to train on Apple silicon.
|
||||||
...
|
|
||||||
override_dataset_stats:
|
|
||||||
observation.images.laptop:
|
|
||||||
# stats from imagenet, since we use a pretrained vision model
|
|
||||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
|
||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
|
||||||
observation.images.phone:
|
|
||||||
# stats from imagenet, since we use a pretrained vision model
|
|
||||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
|
||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
|
||||||
...
|
|
||||||
input_shapes:
|
|
||||||
observation.images.laptop: [3, 480, 640]
|
|
||||||
observation.images.phone: [3, 480, 640]
|
|
||||||
...
|
|
||||||
input_normalization_modes:
|
|
||||||
observation.images.laptop: mean_std
|
|
||||||
observation.images.phone: mean_std
|
|
||||||
...
|
|
||||||
```
|
|
||||||
3. We provided an environment as argument with `env=koch_real`. This loads configurations from [`lerobot/configs/env/koch_real.yaml`](../lerobot/configs/env/koch_real.yaml). It looks like
|
|
||||||
```yaml
|
|
||||||
fps: 30
|
|
||||||
env:
|
|
||||||
name: real_world
|
|
||||||
task: null
|
|
||||||
state_dim: 6
|
|
||||||
action_dim: 6
|
|
||||||
fps: ${fps}
|
|
||||||
```
|
|
||||||
It should match your dataset (e.g. `fps: 30`) and your robot (e.g. `state_dim: 6` and `action_dim: 6`). We are still working on simplifying this in future versions of `lerobot`.
|
|
||||||
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you could use `device=mps` to train on Apple silicon.
|
|
||||||
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||||
6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
|
|
||||||
|
|
||||||
For more information on the `train` script see the previous tutorial: [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md)
|
For more information on the `train` script see the previous tutorial: [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md)
|
||||||
|
|
||||||
@@ -925,7 +927,7 @@ huggingface-cli upload ${HF_USER}/act_koch_test_${CKPT} \
|
|||||||
|
|
||||||
## 5. Evaluate your policy
|
## 5. Evaluate your policy
|
||||||
|
|
||||||
Now that you have a policy checkpoint, you can easily control your robot with it using methods from [`KochRobot`](../lerobot/common/robot_devices/robots/koch.py) and the policy.
|
Now that you have a policy checkpoint, you can easily control your robot with it using methods from [`ManipulatorRobot`](../lerobot/common/robot_devices/robots/manipulator.py) and the policy.
|
||||||
|
|
||||||
Try this code for running inference for 60 seconds at 30 fps:
|
Try this code for running inference for 60 seconds at 30 fps:
|
||||||
```python
|
```python
|
||||||
@@ -968,36 +970,36 @@ for _ in range(inference_time_s * fps):
|
|||||||
busy_wait(1 / fps - dt_s)
|
busy_wait(1 / fps - dt_s)
|
||||||
```
|
```
|
||||||
|
|
||||||
### a. Use `koch.yaml` and our `record` function
|
### a. Use our `record` function
|
||||||
|
|
||||||
Ideally, when controlling your robot with your neural network, you would want to record evaluation episodes and to be able to visualize them later on, or even train on them like in Reinforcement Learning. This pretty much corresponds to recording a new dataset but with a neural network providing the actions instead of teleoperation.
|
Ideally, when controlling your robot with your neural network, you would want to record evaluation episodes and to be able to visualize them later on, or even train on them like in Reinforcement Learning. This pretty much corresponds to recording a new dataset but with a neural network providing the actions instead of teleoperation.
|
||||||
|
|
||||||
To this end, you can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
To this end, you can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/control_robot.py record \
|
python lerobot/scripts/control_robot.py \
|
||||||
--robot-path lerobot/configs/robot/koch.yaml \
|
--robot.type=koch \
|
||||||
--fps 30 \
|
--control.type=record \
|
||||||
--root data \
|
--control.fps=30 \
|
||||||
--repo-id ${HF_USER}/eval_koch_test \
|
--control.repo_id=${HF_USER}/eval_act_koch_test \
|
||||||
--tags tutorial eval \
|
--control.tags='["tutorial"]' \
|
||||||
--warmup-time-s 5 \
|
--control.warmup_time_s=5 \
|
||||||
--episode-time-s 30 \
|
--control.episode_time_s=30 \
|
||||||
--reset-time-s 30 \
|
--control.reset_time_s=30 \
|
||||||
--num-episodes 10 \
|
--control.num_episodes=10 \
|
||||||
-p outputs/train/act_koch_test/checkpoints/last/pretrained_model
|
--control.push_to_hub=true \
|
||||||
|
--control.policy.path=outputs/train/act_koch_test/checkpoints/last/pretrained_model
|
||||||
```
|
```
|
||||||
|
|
||||||
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||||
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_koch_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_koch_test`).
|
1. There is an additional `--control.policy.path` argument which indicates the path to your policy checkpoint with (e.g. `outputs/train/eval_koch_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `${HF_USER}/act_koch_test`).
|
||||||
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_koch_test`).
|
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `${HF_USER}/eval_act_koch_test`).
|
||||||
|
|
||||||
### b. Visualize evaluation afterwards
|
### b. Visualize evaluation afterwards
|
||||||
|
|
||||||
You can then visualize your evaluation dataset by running the same command as before but with the new inference dataset as argument:
|
You can then visualize your evaluation dataset by running the same command as before but with the new inference dataset as argument:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/visualize_dataset.py \
|
python lerobot/scripts/visualize_dataset.py \
|
||||||
--root data \
|
--repo-id ${HF_USER}/eval_act_koch_test
|
||||||
--repo-id ${HF_USER}/eval_koch_test
|
|
||||||
```
|
```
|
||||||
|
|
||||||
## 6. Next step
|
## 6. Next step
|
||||||
|
|||||||
@@ -1,7 +1,21 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
This script demonstrates how to use torchvision's image transformation with LeRobotDataset for data
|
This script demonstrates how to use torchvision's image transformation with LeRobotDataset for data
|
||||||
augmentation purposes. The transformations are passed to the dataset as an argument upon creation, and
|
augmentation purposes. The transformations are passed to the dataset as an argument upon creation, and
|
||||||
transforms are applied to the observation images before they are returned in the dataset's __get_item__.
|
transforms are applied to the observation images before they are returned in the dataset's __getitem__.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
@@ -10,17 +24,17 @@ from torchvision.transforms import ToPILImage, v2
|
|||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
|
||||||
dataset_repo_id = "lerobot/aloha_static_tape"
|
dataset_repo_id = "lerobot/aloha_static_screw_driver"
|
||||||
|
|
||||||
# Create a LeRobotDataset with no transformations
|
# Create a LeRobotDataset with no transformations
|
||||||
dataset = LeRobotDataset(dataset_repo_id)
|
dataset = LeRobotDataset(dataset_repo_id, episodes=[0])
|
||||||
# This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
|
# This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
|
||||||
|
|
||||||
# Get the index of the first observation in the first episode
|
# Get the index of the first observation in the first episode
|
||||||
first_idx = dataset.episode_data_index["from"][0].item()
|
first_idx = dataset.episode_data_index["from"][0].item()
|
||||||
|
|
||||||
# Get the frame corresponding to the first camera
|
# Get the frame corresponding to the first camera
|
||||||
frame = dataset[first_idx][dataset.camera_keys[0]]
|
frame = dataset[first_idx][dataset.meta.camera_keys[0]]
|
||||||
|
|
||||||
|
|
||||||
# Define the transformations
|
# Define the transformations
|
||||||
@@ -28,15 +42,16 @@ transforms = v2.Compose(
|
|||||||
[
|
[
|
||||||
v2.ColorJitter(brightness=(0.5, 1.5)),
|
v2.ColorJitter(brightness=(0.5, 1.5)),
|
||||||
v2.ColorJitter(contrast=(0.5, 1.5)),
|
v2.ColorJitter(contrast=(0.5, 1.5)),
|
||||||
|
v2.ColorJitter(hue=(-0.1, 0.1)),
|
||||||
v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
|
v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
|
||||||
]
|
]
|
||||||
)
|
)
|
||||||
|
|
||||||
# Create another LeRobotDataset with the defined transformations
|
# Create another LeRobotDataset with the defined transformations
|
||||||
transformed_dataset = LeRobotDataset(dataset_repo_id, image_transforms=transforms)
|
transformed_dataset = LeRobotDataset(dataset_repo_id, episodes=[0], image_transforms=transforms)
|
||||||
|
|
||||||
# Get a frame from the transformed dataset
|
# Get a frame from the transformed dataset
|
||||||
transformed_frame = transformed_dataset[first_idx][transformed_dataset.camera_keys[0]]
|
transformed_frame = transformed_dataset[first_idx][transformed_dataset.meta.camera_keys[0]]
|
||||||
|
|
||||||
# Create a directory to store output images
|
# Create a directory to store output images
|
||||||
output_dir = Path("outputs/image_transforms")
|
output_dir = Path("outputs/image_transforms")
|
||||||
@@ -1,87 +0,0 @@
|
|||||||
# @package _global_
|
|
||||||
|
|
||||||
# Change the seed to match what PushT eval uses
|
|
||||||
# (to avoid evaluating on seeds used for generating the training data).
|
|
||||||
seed: 100000
|
|
||||||
# Change the dataset repository to the PushT one.
|
|
||||||
dataset_repo_id: lerobot/pusht
|
|
||||||
|
|
||||||
override_dataset_stats:
|
|
||||||
observation.image:
|
|
||||||
# stats from imagenet, since we use a pretrained vision model
|
|
||||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
|
||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
|
||||||
|
|
||||||
training:
|
|
||||||
offline_steps: 80000
|
|
||||||
online_steps: 0
|
|
||||||
eval_freq: 10000
|
|
||||||
save_freq: 100000
|
|
||||||
log_freq: 250
|
|
||||||
save_model: true
|
|
||||||
|
|
||||||
batch_size: 8
|
|
||||||
lr: 1e-5
|
|
||||||
lr_backbone: 1e-5
|
|
||||||
weight_decay: 1e-4
|
|
||||||
grad_clip_norm: 10
|
|
||||||
online_steps_between_rollouts: 1
|
|
||||||
|
|
||||||
delta_timestamps:
|
|
||||||
action: "[i / ${fps} for i in range(${policy.chunk_size})]"
|
|
||||||
|
|
||||||
eval:
|
|
||||||
n_episodes: 50
|
|
||||||
batch_size: 50
|
|
||||||
|
|
||||||
# See `configuration_act.py` for more details.
|
|
||||||
policy:
|
|
||||||
name: act
|
|
||||||
|
|
||||||
# Input / output structure.
|
|
||||||
n_obs_steps: 1
|
|
||||||
chunk_size: 100 # chunk_size
|
|
||||||
n_action_steps: 100
|
|
||||||
|
|
||||||
input_shapes:
|
|
||||||
observation.image: [3, 96, 96]
|
|
||||||
observation.state: ["${env.state_dim}"]
|
|
||||||
output_shapes:
|
|
||||||
action: ["${env.action_dim}"]
|
|
||||||
|
|
||||||
# Normalization / Unnormalization
|
|
||||||
input_normalization_modes:
|
|
||||||
observation.image: mean_std
|
|
||||||
# Use min_max normalization just because it's more standard.
|
|
||||||
observation.state: min_max
|
|
||||||
output_normalization_modes:
|
|
||||||
# Use min_max normalization just because it's more standard.
|
|
||||||
action: min_max
|
|
||||||
|
|
||||||
# Architecture.
|
|
||||||
# Vision backbone.
|
|
||||||
vision_backbone: resnet18
|
|
||||||
pretrained_backbone_weights: ResNet18_Weights.IMAGENET1K_V1
|
|
||||||
replace_final_stride_with_dilation: false
|
|
||||||
# Transformer layers.
|
|
||||||
pre_norm: false
|
|
||||||
dim_model: 512
|
|
||||||
n_heads: 8
|
|
||||||
dim_feedforward: 3200
|
|
||||||
feedforward_activation: relu
|
|
||||||
n_encoder_layers: 4
|
|
||||||
# Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
|
|
||||||
# that means only the first layer is used. Here we match the original implementation by setting this to 1.
|
|
||||||
# See this issue https://github.com/tonyzhaozh/act/issues/25#issue-2258740521.
|
|
||||||
n_decoder_layers: 1
|
|
||||||
# VAE.
|
|
||||||
use_vae: true
|
|
||||||
latent_dim: 32
|
|
||||||
n_vae_encoder_layers: 4
|
|
||||||
|
|
||||||
# Inference.
|
|
||||||
temporal_ensemble_coeff: null
|
|
||||||
|
|
||||||
# Training and loss computation.
|
|
||||||
dropout: 0.1
|
|
||||||
kl_weight: 10.0
|
|
||||||
@@ -1,70 +0,0 @@
|
|||||||
In this tutorial we will learn how to adapt a policy configuration to be compatible with a new environment and dataset. As a concrete example, we will adapt the default configuration for ACT to be compatible with the PushT environment and dataset.
|
|
||||||
|
|
||||||
If you haven't already read our tutorial on the [training script and configuration tooling](../4_train_policy_with_script.md) please do so prior to tackling this tutorial.
|
|
||||||
|
|
||||||
Let's get started!
|
|
||||||
|
|
||||||
Suppose we want to train ACT for PushT. Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
|
||||||
|
|
||||||
```bash
|
|
||||||
python lerobot/scripts/train.py policy=act env=pusht dataset_repo_id=lerobot/pusht
|
|
||||||
```
|
|
||||||
|
|
||||||
We need to adapt the parameters of the ACT policy configuration to the PushT environment. The most important ones are the image keys.
|
|
||||||
|
|
||||||
ALOHA's datasets and environments typically use a variable number of cameras. In `lerobot/configs/policy/act.yaml` you may notice two relevant sections. Here we show you the minimal diff needed to adjust to PushT:
|
|
||||||
|
|
||||||
```diff
|
|
||||||
override_dataset_stats:
|
|
||||||
- observation.images.top:
|
|
||||||
+ observation.image:
|
|
||||||
# stats from imagenet, since we use a pretrained vision model
|
|
||||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
|
||||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
|
||||||
|
|
||||||
policy:
|
|
||||||
input_shapes:
|
|
||||||
- observation.images.top: [3, 480, 640]
|
|
||||||
+ observation.image: [3, 96, 96]
|
|
||||||
observation.state: ["${env.state_dim}"]
|
|
||||||
output_shapes:
|
|
||||||
action: ["${env.action_dim}"]
|
|
||||||
|
|
||||||
input_normalization_modes:
|
|
||||||
- observation.images.top: mean_std
|
|
||||||
+ observation.image: mean_std
|
|
||||||
observation.state: min_max
|
|
||||||
output_normalization_modes:
|
|
||||||
action: min_max
|
|
||||||
```
|
|
||||||
|
|
||||||
Here we've accounted for the following:
|
|
||||||
- PushT uses "observation.image" for its image key.
|
|
||||||
- PushT provides smaller images.
|
|
||||||
|
|
||||||
_Side note: technically we could override these via the CLI, but with many changes it gets a bit messy, and we also have a bit of a challenge in that we're using `.` in our observation keys which is treated by Hydra as a hierarchical separator_.
|
|
||||||
|
|
||||||
For your convenience, we provide [`act_pusht.yaml`](./act_pusht.yaml) in this directory. It contains the diff above, plus some other (optional) ones that are explained within. Please copy it into `lerobot/configs/policy` with:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
cp examples/advanced/1_train_act_pusht/act_pusht.yaml lerobot/configs/policy/act_pusht.yaml
|
|
||||||
```
|
|
||||||
|
|
||||||
(remember from a [previous tutorial](../4_train_policy_with_script.md) that Hydra will look in the `lerobot/configs` directory). Now try running the following.
|
|
||||||
|
|
||||||
<!-- Note to contributor: are you changing this command? Note that it's tested in `Makefile`, so change it there too! -->
|
|
||||||
```bash
|
|
||||||
python lerobot/scripts/train.py policy=act_pusht env=pusht
|
|
||||||
```
|
|
||||||
|
|
||||||
Notice that this is much the same as the command that failed at the start of the tutorial, only:
|
|
||||||
- Now we are using `policy=act_pusht` to point to our new configuration file.
|
|
||||||
- We can drop `dataset_repo_id=lerobot/pusht` as the change is incorporated in our new configuration file.
|
|
||||||
|
|
||||||
Hurrah! You're now training ACT for the PushT environment.
|
|
||||||
|
|
||||||
---
|
|
||||||
|
|
||||||
The bottom line of this tutorial is that when training policies for different environments and datasets you will need to understand what parts of the policy configuration are specific to those and make changes accordingly.
|
|
||||||
|
|
||||||
Happy coding! 🤗
|
|
||||||
@@ -1,3 +1,17 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
"""This script demonstrates how to slice a dataset and calculate the loss on a subset of the data.
|
"""This script demonstrates how to slice a dataset and calculate the loss on a subset of the data.
|
||||||
|
|
||||||
This technique can be useful for debugging and testing purposes, as well as identifying whether a policy
|
This technique can be useful for debugging and testing purposes, as well as identifying whether a policy
|
||||||
@@ -9,82 +23,82 @@ on the target environment, whether that be in simulation or the real world.
|
|||||||
"""
|
"""
|
||||||
|
|
||||||
import math
|
import math
|
||||||
from pathlib import Path
|
|
||||||
|
|
||||||
import torch
|
import torch
|
||||||
from huggingface_hub import snapshot_download
|
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
|
||||||
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||||
|
|
||||||
device = torch.device("cuda")
|
|
||||||
|
|
||||||
# Download the diffusion policy for pusht environment
|
def main():
|
||||||
pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
|
device = torch.device("cuda")
|
||||||
# OR uncomment the following to evaluate a policy from the local outputs/train folder.
|
|
||||||
# pretrained_policy_path = Path("outputs/train/example_pusht_diffusion")
|
|
||||||
|
|
||||||
policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
|
# Download the diffusion policy for pusht environment
|
||||||
policy.eval()
|
pretrained_policy_path = "lerobot/diffusion_pusht"
|
||||||
policy.to(device)
|
# OR uncomment the following to evaluate a policy from the local outputs/train folder.
|
||||||
|
# pretrained_policy_path = Path("outputs/train/example_pusht_diffusion")
|
||||||
|
|
||||||
# Set up the dataset.
|
policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
|
||||||
delta_timestamps = {
|
policy.eval()
|
||||||
# Load the previous image and state at -0.1 seconds before current frame,
|
policy.to(device)
|
||||||
# then load current image and state corresponding to 0.0 second.
|
|
||||||
"observation.image": [-0.1, 0.0],
|
|
||||||
"observation.state": [-0.1, 0.0],
|
|
||||||
# Load the previous action (-0.1), the next action to be executed (0.0),
|
|
||||||
# and 14 future actions with a 0.1 seconds spacing. All these actions will be
|
|
||||||
# used to calculate the loss.
|
|
||||||
"action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
|
|
||||||
}
|
|
||||||
|
|
||||||
# Load the last 10% of episodes of the dataset as a validation set.
|
# Set up the dataset.
|
||||||
# - Load full dataset
|
delta_timestamps = {
|
||||||
full_dataset = LeRobotDataset("lerobot/pusht", split="train")
|
# Load the previous image and state at -0.1 seconds before current frame,
|
||||||
# - Calculate train and val subsets
|
# then load current image and state corresponding to 0.0 second.
|
||||||
num_train_episodes = math.floor(full_dataset.num_episodes * 90 / 100)
|
"observation.image": [-0.1, 0.0],
|
||||||
num_val_episodes = full_dataset.num_episodes - num_train_episodes
|
"observation.state": [-0.1, 0.0],
|
||||||
print(f"Number of episodes in full dataset: {full_dataset.num_episodes}")
|
# Load the previous action (-0.1), the next action to be executed (0.0),
|
||||||
print(f"Number of episodes in training dataset (90% subset): {num_train_episodes}")
|
# and 14 future actions with a 0.1 seconds spacing. All these actions will be
|
||||||
print(f"Number of episodes in validation dataset (10% subset): {num_val_episodes}")
|
# used to calculate the loss.
|
||||||
# - Get first frame index of the validation set
|
"action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
|
||||||
first_val_frame_index = full_dataset.episode_data_index["from"][num_train_episodes].item()
|
}
|
||||||
# - Load frames subset belonging to validation set using the `split` argument.
|
|
||||||
# It utilizes the `datasets` library's syntax for slicing datasets.
|
|
||||||
# For more information on the Slice API, please see:
|
|
||||||
# https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
|
|
||||||
train_dataset = LeRobotDataset(
|
|
||||||
"lerobot/pusht", split=f"train[:{first_val_frame_index}]", delta_timestamps=delta_timestamps
|
|
||||||
)
|
|
||||||
val_dataset = LeRobotDataset(
|
|
||||||
"lerobot/pusht", split=f"train[{first_val_frame_index}:]", delta_timestamps=delta_timestamps
|
|
||||||
)
|
|
||||||
print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
|
|
||||||
print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
|
|
||||||
|
|
||||||
# Create dataloader for evaluation.
|
# Load the last 10% of episodes of the dataset as a validation set.
|
||||||
val_dataloader = torch.utils.data.DataLoader(
|
# - Load dataset metadata
|
||||||
val_dataset,
|
dataset_metadata = LeRobotDatasetMetadata("lerobot/pusht")
|
||||||
num_workers=4,
|
# - Calculate train and val episodes
|
||||||
batch_size=64,
|
total_episodes = dataset_metadata.total_episodes
|
||||||
shuffle=False,
|
episodes = list(range(dataset_metadata.total_episodes))
|
||||||
pin_memory=device != torch.device("cpu"),
|
num_train_episodes = math.floor(total_episodes * 90 / 100)
|
||||||
drop_last=False,
|
train_episodes = episodes[:num_train_episodes]
|
||||||
)
|
val_episodes = episodes[num_train_episodes:]
|
||||||
|
print(f"Number of episodes in full dataset: {total_episodes}")
|
||||||
|
print(f"Number of episodes in training dataset (90% subset): {len(train_episodes)}")
|
||||||
|
print(f"Number of episodes in validation dataset (10% subset): {len(val_episodes)}")
|
||||||
|
# - Load train an val datasets
|
||||||
|
train_dataset = LeRobotDataset(
|
||||||
|
"lerobot/pusht", episodes=train_episodes, delta_timestamps=delta_timestamps
|
||||||
|
)
|
||||||
|
val_dataset = LeRobotDataset("lerobot/pusht", episodes=val_episodes, delta_timestamps=delta_timestamps)
|
||||||
|
print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
|
||||||
|
print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
|
||||||
|
|
||||||
# Run validation loop.
|
# Create dataloader for evaluation.
|
||||||
loss_cumsum = 0
|
val_dataloader = torch.utils.data.DataLoader(
|
||||||
n_examples_evaluated = 0
|
val_dataset,
|
||||||
for batch in val_dataloader:
|
num_workers=4,
|
||||||
batch = {k: v.to(device, non_blocking=True) for k, v in batch.items()}
|
batch_size=64,
|
||||||
output_dict = policy.forward(batch)
|
shuffle=False,
|
||||||
|
pin_memory=device != torch.device("cpu"),
|
||||||
|
drop_last=False,
|
||||||
|
)
|
||||||
|
|
||||||
loss_cumsum += output_dict["loss"].item()
|
# Run validation loop.
|
||||||
n_examples_evaluated += batch["index"].shape[0]
|
loss_cumsum = 0
|
||||||
|
n_examples_evaluated = 0
|
||||||
|
for batch in val_dataloader:
|
||||||
|
batch = {k: v.to(device, non_blocking=True) for k, v in batch.items()}
|
||||||
|
loss, _ = policy.forward(batch)
|
||||||
|
|
||||||
# Calculate the average loss over the validation set.
|
loss_cumsum += loss.item()
|
||||||
average_loss = loss_cumsum / n_examples_evaluated
|
n_examples_evaluated += batch["index"].shape[0]
|
||||||
|
|
||||||
print(f"Average loss on validation set: {average_loss:.4f}")
|
# Calculate the average loss over the validation set.
|
||||||
|
average_loss = loss_cumsum / n_examples_evaluated
|
||||||
|
|
||||||
|
print(f"Average loss on validation set: {average_loss:.4f}")
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
main()
|
||||||
|
|||||||
243
examples/port_datasets/pusht_zarr.py
Normal file
243
examples/port_datasets/pusht_zarr.py
Normal file
@@ -0,0 +1,243 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import shutil
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
|
||||||
|
from lerobot.common.constants import HF_LEROBOT_HOME
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION, LeRobotDataset
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub._download_raw import download_raw
|
||||||
|
|
||||||
|
PUSHT_TASK = "Push the T-shaped blue block onto the T-shaped green target surface."
|
||||||
|
PUSHT_FEATURES = {
|
||||||
|
"observation.state": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (2,),
|
||||||
|
"names": {
|
||||||
|
"axes": ["x", "y"],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
"action": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (2,),
|
||||||
|
"names": {
|
||||||
|
"axes": ["x", "y"],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
"next.reward": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"next.success": {
|
||||||
|
"dtype": "bool",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"observation.environment_state": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (16,),
|
||||||
|
"names": [
|
||||||
|
"keypoints",
|
||||||
|
],
|
||||||
|
},
|
||||||
|
"observation.image": {
|
||||||
|
"dtype": None,
|
||||||
|
"shape": (3, 96, 96),
|
||||||
|
"names": [
|
||||||
|
"channels",
|
||||||
|
"height",
|
||||||
|
"width",
|
||||||
|
],
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def build_features(mode: str) -> dict:
|
||||||
|
features = PUSHT_FEATURES
|
||||||
|
if mode == "keypoints":
|
||||||
|
features.pop("observation.image")
|
||||||
|
else:
|
||||||
|
features.pop("observation.environment_state")
|
||||||
|
features["observation.image"]["dtype"] = mode
|
||||||
|
|
||||||
|
return features
|
||||||
|
|
||||||
|
|
||||||
|
def load_raw_dataset(zarr_path: Path):
|
||||||
|
try:
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub._diffusion_policy_replay_buffer import (
|
||||||
|
ReplayBuffer as DiffusionPolicyReplayBuffer,
|
||||||
|
)
|
||||||
|
except ModuleNotFoundError as e:
|
||||||
|
print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
|
||||||
|
raise e
|
||||||
|
|
||||||
|
zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
|
||||||
|
return zarr_data
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_coverage(zarr_data):
|
||||||
|
try:
|
||||||
|
import pymunk
|
||||||
|
from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
|
||||||
|
except ModuleNotFoundError as e:
|
||||||
|
print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
|
||||||
|
raise e
|
||||||
|
|
||||||
|
block_pos = zarr_data["state"][:, 2:4]
|
||||||
|
block_angle = zarr_data["state"][:, 4]
|
||||||
|
|
||||||
|
num_frames = len(block_pos)
|
||||||
|
|
||||||
|
coverage = np.zeros((num_frames,), dtype=np.float32)
|
||||||
|
# 8 keypoints with 2 coords each
|
||||||
|
keypoints = np.zeros((num_frames, 16), dtype=np.float32)
|
||||||
|
|
||||||
|
# Set x, y, theta (in radians)
|
||||||
|
goal_pos_angle = np.array([256, 256, np.pi / 4])
|
||||||
|
goal_body = PushTEnv.get_goal_pose_body(goal_pos_angle)
|
||||||
|
|
||||||
|
for i in range(num_frames):
|
||||||
|
space = pymunk.Space()
|
||||||
|
space.gravity = 0, 0
|
||||||
|
space.damping = 0
|
||||||
|
|
||||||
|
# Add walls.
|
||||||
|
walls = [
|
||||||
|
PushTEnv.add_segment(space, (5, 506), (5, 5), 2),
|
||||||
|
PushTEnv.add_segment(space, (5, 5), (506, 5), 2),
|
||||||
|
PushTEnv.add_segment(space, (506, 5), (506, 506), 2),
|
||||||
|
PushTEnv.add_segment(space, (5, 506), (506, 506), 2),
|
||||||
|
]
|
||||||
|
space.add(*walls)
|
||||||
|
|
||||||
|
block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
|
||||||
|
goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
|
||||||
|
block_geom = pymunk_to_shapely(block_body, block_body.shapes)
|
||||||
|
intersection_area = goal_geom.intersection(block_geom).area
|
||||||
|
goal_area = goal_geom.area
|
||||||
|
coverage[i] = intersection_area / goal_area
|
||||||
|
keypoints[i] = PushTEnv.get_keypoints(block_shapes).flatten()
|
||||||
|
|
||||||
|
return coverage, keypoints
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_success(coverage: float, success_threshold: float):
|
||||||
|
return coverage > success_threshold
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_reward(coverage: float, success_threshold: float):
|
||||||
|
return np.clip(coverage / success_threshold, 0, 1)
|
||||||
|
|
||||||
|
|
||||||
|
def main(raw_dir: Path, repo_id: str, mode: str = "video", push_to_hub: bool = True):
|
||||||
|
if mode not in ["video", "image", "keypoints"]:
|
||||||
|
raise ValueError(mode)
|
||||||
|
|
||||||
|
if (HF_LEROBOT_HOME / repo_id).exists():
|
||||||
|
shutil.rmtree(HF_LEROBOT_HOME / repo_id)
|
||||||
|
|
||||||
|
if not raw_dir.exists():
|
||||||
|
download_raw(raw_dir, repo_id="lerobot-raw/pusht_raw")
|
||||||
|
|
||||||
|
zarr_data = load_raw_dataset(zarr_path=raw_dir / "pusht_cchi_v7_replay.zarr")
|
||||||
|
|
||||||
|
env_state = zarr_data["state"][:]
|
||||||
|
agent_pos = env_state[:, :2]
|
||||||
|
|
||||||
|
action = zarr_data["action"][:]
|
||||||
|
image = zarr_data["img"] # (b, h, w, c)
|
||||||
|
|
||||||
|
if image.dtype == np.float32 and image.max() == np.float32(255):
|
||||||
|
# HACK: images are loaded as float32 but they actually encode uint8 data
|
||||||
|
image = image.astype(np.uint8)
|
||||||
|
|
||||||
|
episode_data_index = {
|
||||||
|
"from": np.concatenate(([0], zarr_data.meta["episode_ends"][:-1])),
|
||||||
|
"to": zarr_data.meta["episode_ends"],
|
||||||
|
}
|
||||||
|
|
||||||
|
# Calculate success and reward based on the overlapping area
|
||||||
|
# of the T-object and the T-area.
|
||||||
|
coverage, keypoints = calculate_coverage(zarr_data)
|
||||||
|
success = calculate_success(coverage, success_threshold=0.95)
|
||||||
|
reward = calculate_reward(coverage, success_threshold=0.95)
|
||||||
|
|
||||||
|
features = build_features(mode)
|
||||||
|
dataset = LeRobotDataset.create(
|
||||||
|
repo_id=repo_id,
|
||||||
|
fps=10,
|
||||||
|
robot_type="2d pointer",
|
||||||
|
features=features,
|
||||||
|
image_writer_threads=4,
|
||||||
|
)
|
||||||
|
episodes = range(len(episode_data_index["from"]))
|
||||||
|
for ep_idx in episodes:
|
||||||
|
from_idx = episode_data_index["from"][ep_idx]
|
||||||
|
to_idx = episode_data_index["to"][ep_idx]
|
||||||
|
num_frames = to_idx - from_idx
|
||||||
|
|
||||||
|
for frame_idx in range(num_frames):
|
||||||
|
i = from_idx + frame_idx
|
||||||
|
idx = i + (frame_idx < num_frames - 1)
|
||||||
|
frame = {
|
||||||
|
"action": action[i],
|
||||||
|
# Shift reward and success by +1 until the last item of the episode
|
||||||
|
"next.reward": reward[idx : idx + 1],
|
||||||
|
"next.success": success[idx : idx + 1],
|
||||||
|
"task": PUSHT_TASK,
|
||||||
|
}
|
||||||
|
|
||||||
|
frame["observation.state"] = agent_pos[i]
|
||||||
|
|
||||||
|
if mode == "keypoints":
|
||||||
|
frame["observation.environment_state"] = keypoints[i]
|
||||||
|
else:
|
||||||
|
frame["observation.image"] = image[i]
|
||||||
|
|
||||||
|
dataset.add_frame(frame)
|
||||||
|
|
||||||
|
dataset.save_episode()
|
||||||
|
|
||||||
|
if push_to_hub:
|
||||||
|
dataset.push_to_hub()
|
||||||
|
hub_api = HfApi()
|
||||||
|
hub_api.create_tag(repo_id, tag=CODEBASE_VERSION, repo_type="dataset")
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
# To try this script, modify the repo id with your own HuggingFace user (e.g cadene/pusht)
|
||||||
|
repo_id = "lerobot/pusht"
|
||||||
|
|
||||||
|
modes = ["video", "image", "keypoints"]
|
||||||
|
# Uncomment if you want to try with a specific mode
|
||||||
|
# modes = ["video"]
|
||||||
|
# modes = ["image"]
|
||||||
|
# modes = ["keypoints"]
|
||||||
|
|
||||||
|
raw_dir = Path("data/lerobot-raw/pusht_raw")
|
||||||
|
for mode in modes:
|
||||||
|
if mode in ["image", "keypoints"]:
|
||||||
|
repo_id += f"_{mode}"
|
||||||
|
|
||||||
|
# download and load raw dataset, create LeRobotDataset, populate it, push to hub
|
||||||
|
main(raw_dir, repo_id=repo_id, mode=mode)
|
||||||
|
|
||||||
|
# Uncomment if you want to load the local dataset and explore it
|
||||||
|
# dataset = LeRobotDataset(repo_id=repo_id)
|
||||||
|
# breakpoint()
|
||||||
@@ -27,6 +27,9 @@ Example:
|
|||||||
print(lerobot.available_real_world_datasets)
|
print(lerobot.available_real_world_datasets)
|
||||||
print(lerobot.available_policies)
|
print(lerobot.available_policies)
|
||||||
print(lerobot.available_policies_per_env)
|
print(lerobot.available_policies_per_env)
|
||||||
|
print(lerobot.available_robots)
|
||||||
|
print(lerobot.available_cameras)
|
||||||
|
print(lerobot.available_motors)
|
||||||
```
|
```
|
||||||
|
|
||||||
When implementing a new dataset loadable with LeRobotDataset follow these steps:
|
When implementing a new dataset loadable with LeRobotDataset follow these steps:
|
||||||
@@ -55,7 +58,6 @@ available_tasks_per_env = {
|
|||||||
],
|
],
|
||||||
"pusht": ["PushT-v0"],
|
"pusht": ["PushT-v0"],
|
||||||
"xarm": ["XarmLift-v0"],
|
"xarm": ["XarmLift-v0"],
|
||||||
"dora_aloha_real": ["DoraAloha-v0", "DoraKoch-v0", "DoraReachy2-v0"],
|
|
||||||
}
|
}
|
||||||
available_envs = list(available_tasks_per_env.keys())
|
available_envs = list(available_tasks_per_env.keys())
|
||||||
|
|
||||||
@@ -83,23 +85,6 @@ available_datasets_per_env = {
|
|||||||
"lerobot/xarm_push_medium_image",
|
"lerobot/xarm_push_medium_image",
|
||||||
"lerobot/xarm_push_medium_replay_image",
|
"lerobot/xarm_push_medium_replay_image",
|
||||||
],
|
],
|
||||||
"dora_aloha_real": [
|
|
||||||
"lerobot/aloha_static_battery",
|
|
||||||
"lerobot/aloha_static_candy",
|
|
||||||
"lerobot/aloha_static_coffee",
|
|
||||||
"lerobot/aloha_static_coffee_new",
|
|
||||||
"lerobot/aloha_static_cups_open",
|
|
||||||
"lerobot/aloha_static_fork_pick_up",
|
|
||||||
"lerobot/aloha_static_pingpong_test",
|
|
||||||
"lerobot/aloha_static_pro_pencil",
|
|
||||||
"lerobot/aloha_static_screw_driver",
|
|
||||||
"lerobot/aloha_static_tape",
|
|
||||||
"lerobot/aloha_static_thread_velcro",
|
|
||||||
"lerobot/aloha_static_towel",
|
|
||||||
"lerobot/aloha_static_vinh_cup",
|
|
||||||
"lerobot/aloha_static_vinh_cup_left",
|
|
||||||
"lerobot/aloha_static_ziploc_slide",
|
|
||||||
],
|
|
||||||
}
|
}
|
||||||
|
|
||||||
available_real_world_datasets = [
|
available_real_world_datasets = [
|
||||||
@@ -129,13 +114,60 @@ available_real_world_datasets = [
|
|||||||
"lerobot/unitreeh1_rearrange_objects",
|
"lerobot/unitreeh1_rearrange_objects",
|
||||||
"lerobot/unitreeh1_two_robot_greeting",
|
"lerobot/unitreeh1_two_robot_greeting",
|
||||||
"lerobot/unitreeh1_warehouse",
|
"lerobot/unitreeh1_warehouse",
|
||||||
|
"lerobot/nyu_rot_dataset",
|
||||||
|
"lerobot/utokyo_saytap",
|
||||||
|
"lerobot/imperialcollege_sawyer_wrist_cam",
|
||||||
|
"lerobot/utokyo_xarm_bimanual",
|
||||||
|
"lerobot/tokyo_u_lsmo",
|
||||||
|
"lerobot/utokyo_pr2_opening_fridge",
|
||||||
|
"lerobot/cmu_franka_exploration_dataset",
|
||||||
|
"lerobot/cmu_stretch",
|
||||||
|
"lerobot/asu_table_top",
|
||||||
|
"lerobot/utokyo_pr2_tabletop_manipulation",
|
||||||
|
"lerobot/utokyo_xarm_pick_and_place",
|
||||||
|
"lerobot/ucsd_kitchen_dataset",
|
||||||
|
"lerobot/austin_buds_dataset",
|
||||||
|
"lerobot/dlr_sara_grid_clamp",
|
||||||
|
"lerobot/conq_hose_manipulation",
|
||||||
|
"lerobot/columbia_cairlab_pusht_real",
|
||||||
|
"lerobot/dlr_sara_pour",
|
||||||
|
"lerobot/dlr_edan_shared_control",
|
||||||
|
"lerobot/ucsd_pick_and_place_dataset",
|
||||||
|
"lerobot/berkeley_cable_routing",
|
||||||
|
"lerobot/nyu_franka_play_dataset",
|
||||||
|
"lerobot/austin_sirius_dataset",
|
||||||
|
"lerobot/cmu_play_fusion",
|
||||||
|
"lerobot/berkeley_gnm_sac_son",
|
||||||
|
"lerobot/nyu_door_opening_surprising_effectiveness",
|
||||||
|
"lerobot/berkeley_fanuc_manipulation",
|
||||||
|
"lerobot/jaco_play",
|
||||||
|
"lerobot/viola",
|
||||||
|
"lerobot/kaist_nonprehensile",
|
||||||
|
"lerobot/berkeley_mvp",
|
||||||
|
"lerobot/uiuc_d3field",
|
||||||
|
"lerobot/berkeley_gnm_recon",
|
||||||
|
"lerobot/austin_sailor_dataset",
|
||||||
|
"lerobot/utaustin_mutex",
|
||||||
|
"lerobot/roboturk",
|
||||||
|
"lerobot/stanford_hydra_dataset",
|
||||||
|
"lerobot/berkeley_autolab_ur5",
|
||||||
|
"lerobot/stanford_robocook",
|
||||||
|
"lerobot/toto",
|
||||||
|
"lerobot/fmb",
|
||||||
|
"lerobot/droid_100",
|
||||||
|
"lerobot/berkeley_rpt",
|
||||||
|
"lerobot/stanford_kuka_multimodal_dataset",
|
||||||
|
"lerobot/iamlab_cmu_pickup_insert",
|
||||||
|
"lerobot/taco_play",
|
||||||
|
"lerobot/berkeley_gnm_cory_hall",
|
||||||
|
"lerobot/usc_cloth_sim",
|
||||||
]
|
]
|
||||||
|
|
||||||
available_datasets = list(
|
available_datasets = sorted(
|
||||||
itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets)
|
set(itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets))
|
||||||
)
|
)
|
||||||
|
|
||||||
# lists all available policies from `lerobot/common/policies` by their class attribute: `name`.
|
# lists all available policies from `lerobot/common/policies`
|
||||||
available_policies = [
|
available_policies = [
|
||||||
"act",
|
"act",
|
||||||
"diffusion",
|
"diffusion",
|
||||||
@@ -143,12 +175,34 @@ available_policies = [
|
|||||||
"vqbet",
|
"vqbet",
|
||||||
]
|
]
|
||||||
|
|
||||||
|
# lists all available robots from `lerobot/common/robot_devices/robots`
|
||||||
|
available_robots = [
|
||||||
|
"koch",
|
||||||
|
"koch_bimanual",
|
||||||
|
"aloha",
|
||||||
|
"so100",
|
||||||
|
"moss",
|
||||||
|
]
|
||||||
|
|
||||||
|
# lists all available cameras from `lerobot/common/robot_devices/cameras`
|
||||||
|
available_cameras = [
|
||||||
|
"opencv",
|
||||||
|
"intelrealsense",
|
||||||
|
]
|
||||||
|
|
||||||
|
# lists all available motors from `lerobot/common/robot_devices/motors`
|
||||||
|
available_motors = [
|
||||||
|
"dynamixel",
|
||||||
|
"feetech",
|
||||||
|
]
|
||||||
|
|
||||||
# keys and values refer to yaml files
|
# keys and values refer to yaml files
|
||||||
available_policies_per_env = {
|
available_policies_per_env = {
|
||||||
"aloha": ["act"],
|
"aloha": ["act"],
|
||||||
"pusht": ["diffusion", "vqbet"],
|
"pusht": ["diffusion", "vqbet"],
|
||||||
"xarm": ["tdmpc"],
|
"xarm": ["tdmpc"],
|
||||||
"dora_aloha_real": ["act_real"],
|
"koch_real": ["act_koch_real"],
|
||||||
|
"aloha_real": ["act_aloha_real"],
|
||||||
}
|
}
|
||||||
|
|
||||||
env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
|
env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
|
||||||
|
|||||||
4
lerobot/common/cameras/__init__.py
Normal file
4
lerobot/common/cameras/__init__.py
Normal file
@@ -0,0 +1,4 @@
|
|||||||
|
from .camera import Camera
|
||||||
|
from .configs import CameraConfig
|
||||||
|
|
||||||
|
__all__ = ["Camera", "CameraConfig"]
|
||||||
25
lerobot/common/cameras/camera.py
Normal file
25
lerobot/common/cameras/camera.py
Normal file
@@ -0,0 +1,25 @@
|
|||||||
|
import abc
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
|
||||||
|
|
||||||
|
class Camera(abc.ABC):
|
||||||
|
@abc.abstractmethod
|
||||||
|
def connect(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def read(self, temporary_color: str | None = None) -> np.ndarray:
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def async_read(self) -> np.ndarray:
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def disconnect(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
11
lerobot/common/cameras/configs.py
Normal file
11
lerobot/common/cameras/configs.py
Normal file
@@ -0,0 +1,11 @@
|
|||||||
|
import abc
|
||||||
|
from dataclasses import dataclass
|
||||||
|
|
||||||
|
import draccus
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class CameraConfig(draccus.ChoiceRegistry, abc.ABC):
|
||||||
|
@property
|
||||||
|
def type(self) -> str:
|
||||||
|
return self.get_choice_name(self.__class__)
|
||||||
4
lerobot/common/cameras/intel/__init__.py
Normal file
4
lerobot/common/cameras/intel/__init__.py
Normal file
@@ -0,0 +1,4 @@
|
|||||||
|
from .camera_realsense import RealSenseCamera
|
||||||
|
from .configuration_realsense import RealSenseCameraConfig
|
||||||
|
|
||||||
|
__all__ = ["RealSenseCamera", "RealSenseCameraConfig"]
|
||||||
535
lerobot/common/cameras/intel/camera_realsense.py
Normal file
535
lerobot/common/cameras/intel/camera_realsense.py
Normal file
@@ -0,0 +1,535 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This file contains utilities for recording frames from Intel Realsense cameras.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import concurrent.futures
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import shutil
|
||||||
|
import threading
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from collections import Counter
|
||||||
|
from pathlib import Path
|
||||||
|
from threading import Thread
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
from PIL import Image
|
||||||
|
|
||||||
|
from lerobot.common.errors import DeviceAlreadyConnectedError, DeviceNotConnectedError
|
||||||
|
from lerobot.common.utils.robot_utils import (
|
||||||
|
busy_wait,
|
||||||
|
)
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
from ..camera import Camera
|
||||||
|
from .configuration_realsense import RealSenseCameraConfig
|
||||||
|
|
||||||
|
SERIAL_NUMBER_INDEX = 1
|
||||||
|
|
||||||
|
|
||||||
|
def find_cameras(raise_when_empty=True, mock=False) -> list[dict]:
|
||||||
|
"""
|
||||||
|
Find the names and the serial numbers of the Intel RealSense cameras
|
||||||
|
connected to the computer.
|
||||||
|
"""
|
||||||
|
if mock:
|
||||||
|
import tests.cameras.mock_pyrealsense2 as rs
|
||||||
|
else:
|
||||||
|
import pyrealsense2 as rs
|
||||||
|
|
||||||
|
cameras = []
|
||||||
|
for device in rs.context().query_devices():
|
||||||
|
serial_number = int(device.get_info(rs.camera_info(SERIAL_NUMBER_INDEX)))
|
||||||
|
name = device.get_info(rs.camera_info.name)
|
||||||
|
cameras.append(
|
||||||
|
{
|
||||||
|
"serial_number": serial_number,
|
||||||
|
"name": name,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
if raise_when_empty and len(cameras) == 0:
|
||||||
|
raise OSError(
|
||||||
|
"Not a single camera was detected. Try re-plugging, or re-installing `librealsense` and its python wrapper `pyrealsense2`, or updating the firmware."
|
||||||
|
)
|
||||||
|
|
||||||
|
return cameras
|
||||||
|
|
||||||
|
|
||||||
|
def save_image(img_array, serial_number, frame_index, images_dir):
|
||||||
|
try:
|
||||||
|
img = Image.fromarray(img_array)
|
||||||
|
path = images_dir / f"camera_{serial_number}_frame_{frame_index:06d}.png"
|
||||||
|
path.parent.mkdir(parents=True, exist_ok=True)
|
||||||
|
img.save(str(path), quality=100)
|
||||||
|
logging.info(f"Saved image: {path}")
|
||||||
|
except Exception as e:
|
||||||
|
logging.error(f"Failed to save image for camera {serial_number} frame {frame_index}: {e}")
|
||||||
|
|
||||||
|
|
||||||
|
def save_images_from_cameras(
|
||||||
|
images_dir: Path,
|
||||||
|
serial_numbers: list[int] | None = None,
|
||||||
|
fps=None,
|
||||||
|
width=None,
|
||||||
|
height=None,
|
||||||
|
record_time_s=2,
|
||||||
|
mock=False,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Initializes all the cameras and saves images to the directory. Useful to visually identify the camera
|
||||||
|
associated to a given serial number.
|
||||||
|
"""
|
||||||
|
if serial_numbers is None or len(serial_numbers) == 0:
|
||||||
|
camera_infos = find_cameras(mock=mock)
|
||||||
|
serial_numbers = [cam["serial_number"] for cam in camera_infos]
|
||||||
|
|
||||||
|
if mock:
|
||||||
|
import tests.cameras.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
print("Connecting cameras")
|
||||||
|
cameras = []
|
||||||
|
for cam_sn in serial_numbers:
|
||||||
|
print(f"{cam_sn=}")
|
||||||
|
config = RealSenseCameraConfig(serial_number=cam_sn, fps=fps, width=width, height=height, mock=mock)
|
||||||
|
camera = RealSenseCamera(config)
|
||||||
|
camera.connect()
|
||||||
|
print(
|
||||||
|
f"RealSenseCamera({camera.serial_number}, fps={camera.fps}, width={camera.capture_width}, height={camera.capture_height}, color_mode={camera.color_mode})"
|
||||||
|
)
|
||||||
|
cameras.append(camera)
|
||||||
|
|
||||||
|
images_dir = Path(images_dir)
|
||||||
|
if images_dir.exists():
|
||||||
|
shutil.rmtree(
|
||||||
|
images_dir,
|
||||||
|
)
|
||||||
|
images_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
print(f"Saving images to {images_dir}")
|
||||||
|
frame_index = 0
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
try:
|
||||||
|
with concurrent.futures.ThreadPoolExecutor(max_workers=1) as executor:
|
||||||
|
while True:
|
||||||
|
now = time.perf_counter()
|
||||||
|
|
||||||
|
for camera in cameras:
|
||||||
|
# If we use async_read when fps is None, the loop will go full speed, and we will end up
|
||||||
|
# saving the same images from the cameras multiple times until the RAM/disk is full.
|
||||||
|
image = camera.read() if fps is None else camera.async_read()
|
||||||
|
if image is None:
|
||||||
|
print("No Frame")
|
||||||
|
|
||||||
|
bgr_converted_image = cv2.cvtColor(image, cv2.COLOR_RGB2BGR)
|
||||||
|
|
||||||
|
executor.submit(
|
||||||
|
save_image,
|
||||||
|
bgr_converted_image,
|
||||||
|
camera.serial_number,
|
||||||
|
frame_index,
|
||||||
|
images_dir,
|
||||||
|
)
|
||||||
|
|
||||||
|
if fps is not None:
|
||||||
|
dt_s = time.perf_counter() - now
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
if time.perf_counter() - start_time > record_time_s:
|
||||||
|
break
|
||||||
|
|
||||||
|
print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
|
||||||
|
|
||||||
|
frame_index += 1
|
||||||
|
finally:
|
||||||
|
print(f"Images have been saved to {images_dir}")
|
||||||
|
for camera in cameras:
|
||||||
|
camera.disconnect()
|
||||||
|
|
||||||
|
|
||||||
|
class RealSenseCamera(Camera):
|
||||||
|
"""
|
||||||
|
The RealSenseCamera class is similar to OpenCVCamera class but adds additional features for Intel Real Sense cameras:
|
||||||
|
- is instantiated with the serial number of the camera - won't randomly change as it can be the case of OpenCVCamera for Linux,
|
||||||
|
- can also be instantiated with the camera's name — if it's unique — using RealSenseCamera.init_from_name(),
|
||||||
|
- depth map can be returned.
|
||||||
|
|
||||||
|
To find the camera indices of your cameras, you can run our utility script that will save a few frames for each camera:
|
||||||
|
```bash
|
||||||
|
python lerobot/common/robot_devices/cameras/intelrealsense.py --images-dir outputs/images_from_intelrealsense_cameras
|
||||||
|
```
|
||||||
|
|
||||||
|
When an RealSenseCamera is instantiated, if no specific config is provided, the default fps, width, height and color_mode
|
||||||
|
of the given camera will be used.
|
||||||
|
|
||||||
|
Example of instantiating with a serial number:
|
||||||
|
```python
|
||||||
|
from lerobot.common.robot_devices.cameras.configs import RealSenseCameraConfig
|
||||||
|
|
||||||
|
config = RealSenseCameraConfig(serial_number=128422271347)
|
||||||
|
camera = RealSenseCamera(config)
|
||||||
|
camera.connect()
|
||||||
|
color_image = camera.read()
|
||||||
|
# when done using the camera, consider disconnecting
|
||||||
|
camera.disconnect()
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of instantiating with a name if it's unique:
|
||||||
|
```
|
||||||
|
config = RealSenseCameraConfig(name="Intel RealSense D405")
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of changing default fps, width, height and color_mode:
|
||||||
|
```python
|
||||||
|
config = RealSenseCameraConfig(serial_number=128422271347, fps=30, width=1280, height=720)
|
||||||
|
config = RealSenseCameraConfig(serial_number=128422271347, fps=90, width=640, height=480)
|
||||||
|
config = RealSenseCameraConfig(serial_number=128422271347, fps=90, width=640, height=480, color_mode="bgr")
|
||||||
|
# Note: might error out upon `camera.connect()` if these settings are not compatible with the camera
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of returning depth:
|
||||||
|
```python
|
||||||
|
config = RealSenseCameraConfig(serial_number=128422271347, use_depth=True)
|
||||||
|
camera = RealSenseCamera(config)
|
||||||
|
camera.connect()
|
||||||
|
color_image, depth_map = camera.read()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
config: RealSenseCameraConfig,
|
||||||
|
):
|
||||||
|
self.config = config
|
||||||
|
if config.name is not None:
|
||||||
|
self.serial_number = self.find_serial_number_from_name(config.name)
|
||||||
|
else:
|
||||||
|
self.serial_number = config.serial_number
|
||||||
|
|
||||||
|
# Store the raw (capture) resolution from the config.
|
||||||
|
self.capture_width = config.width
|
||||||
|
self.capture_height = config.height
|
||||||
|
|
||||||
|
# If rotated by ±90, swap width and height.
|
||||||
|
if config.rotation in [-90, 90]:
|
||||||
|
self.width = config.height
|
||||||
|
self.height = config.width
|
||||||
|
else:
|
||||||
|
self.width = config.width
|
||||||
|
self.height = config.height
|
||||||
|
|
||||||
|
self.fps = config.fps
|
||||||
|
self.channels = config.channels
|
||||||
|
self.color_mode = config.color_mode
|
||||||
|
self.use_depth = config.use_depth
|
||||||
|
self.force_hardware_reset = config.force_hardware_reset
|
||||||
|
self.mock = config.mock
|
||||||
|
|
||||||
|
self.camera = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.thread = None
|
||||||
|
self.stop_event = None
|
||||||
|
self.color_image = None
|
||||||
|
self.depth_map = None
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.cameras.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
self.rotation = None
|
||||||
|
if config.rotation == -90:
|
||||||
|
self.rotation = cv2.ROTATE_90_COUNTERCLOCKWISE
|
||||||
|
elif config.rotation == 90:
|
||||||
|
self.rotation = cv2.ROTATE_90_CLOCKWISE
|
||||||
|
elif config.rotation == 180:
|
||||||
|
self.rotation = cv2.ROTATE_180
|
||||||
|
|
||||||
|
def find_serial_number_from_name(self, name):
|
||||||
|
camera_infos = find_cameras()
|
||||||
|
camera_names = [cam["name"] for cam in camera_infos]
|
||||||
|
this_name_count = Counter(camera_names)[name]
|
||||||
|
if this_name_count > 1:
|
||||||
|
# TODO(aliberts): Test this with multiple identical cameras (Aloha)
|
||||||
|
raise ValueError(
|
||||||
|
f"Multiple {name} cameras have been detected. Please use their serial number to instantiate them."
|
||||||
|
)
|
||||||
|
|
||||||
|
name_to_serial_dict = {cam["name"]: cam["serial_number"] for cam in camera_infos}
|
||||||
|
cam_sn = name_to_serial_dict[name]
|
||||||
|
|
||||||
|
return cam_sn
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise DeviceAlreadyConnectedError(f"RealSenseCamera({self.serial_number}) is already connected.")
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.cameras.mock_pyrealsense2 as rs
|
||||||
|
else:
|
||||||
|
import pyrealsense2 as rs
|
||||||
|
|
||||||
|
config = rs.config()
|
||||||
|
config.enable_device(str(self.serial_number))
|
||||||
|
|
||||||
|
if self.fps and self.capture_width and self.capture_height:
|
||||||
|
# TODO(rcadene): can we set rgb8 directly?
|
||||||
|
config.enable_stream(
|
||||||
|
rs.stream.color, self.capture_width, self.capture_height, rs.format.rgb8, self.fps
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
config.enable_stream(rs.stream.color)
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
if self.fps and self.capture_width and self.capture_height:
|
||||||
|
config.enable_stream(
|
||||||
|
rs.stream.depth, self.capture_width, self.capture_height, rs.format.z16, self.fps
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
config.enable_stream(rs.stream.depth)
|
||||||
|
|
||||||
|
self.camera = rs.pipeline()
|
||||||
|
try:
|
||||||
|
profile = self.camera.start(config)
|
||||||
|
is_camera_open = True
|
||||||
|
except RuntimeError:
|
||||||
|
is_camera_open = False
|
||||||
|
traceback.print_exc()
|
||||||
|
|
||||||
|
# If the camera doesn't work, display the camera indices corresponding to
|
||||||
|
# valid cameras.
|
||||||
|
if not is_camera_open:
|
||||||
|
# Verify that the provided `serial_number` is valid before printing the traceback
|
||||||
|
camera_infos = find_cameras()
|
||||||
|
serial_numbers = [cam["serial_number"] for cam in camera_infos]
|
||||||
|
if self.serial_number not in serial_numbers:
|
||||||
|
raise ValueError(
|
||||||
|
f"`serial_number` is expected to be one of these available cameras {serial_numbers}, but {self.serial_number} is provided instead. "
|
||||||
|
"To find the serial number you should use, run `python lerobot/common/robot_devices/cameras/intelrealsense.py`."
|
||||||
|
)
|
||||||
|
|
||||||
|
raise OSError(f"Can't access RealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
color_stream = profile.get_stream(rs.stream.color)
|
||||||
|
color_profile = color_stream.as_video_stream_profile()
|
||||||
|
actual_fps = color_profile.fps()
|
||||||
|
actual_width = color_profile.width()
|
||||||
|
actual_height = color_profile.height()
|
||||||
|
|
||||||
|
# Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
|
||||||
|
if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
|
||||||
|
# Using `OSError` since it's a broad that encompasses issues related to device communication
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.fps=} for RealSenseCamera({self.serial_number}). Actual value is {actual_fps}."
|
||||||
|
)
|
||||||
|
if self.capture_width is not None and self.capture_width != actual_width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.capture_width=} for RealSenseCamera({self.serial_number}). Actual value is {actual_width}."
|
||||||
|
)
|
||||||
|
if self.capture_height is not None and self.capture_height != actual_height:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.capture_height=} for RealSenseCamera({self.serial_number}). Actual value is {actual_height}."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.fps = round(actual_fps)
|
||||||
|
self.capture_width = round(actual_width)
|
||||||
|
self.capture_height = round(actual_height)
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def read(self, temporary_color: str | None = None) -> np.ndarray | tuple[np.ndarray, np.ndarray]:
|
||||||
|
"""Read a frame from the camera returned in the format height x width x channels (e.g. 480 x 640 x 3)
|
||||||
|
of type `np.uint8`, contrarily to the pytorch format which is float channel first.
|
||||||
|
|
||||||
|
When `use_depth=True`, returns a tuple `(color_image, depth_map)` with a depth map in the format
|
||||||
|
height x width (e.g. 480 x 640) of type np.uint16.
|
||||||
|
|
||||||
|
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
||||||
|
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
||||||
|
"""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"RealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.cameras.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
frame = self.camera.wait_for_frames(timeout_ms=5000)
|
||||||
|
|
||||||
|
color_frame = frame.get_color_frame()
|
||||||
|
|
||||||
|
if not color_frame:
|
||||||
|
raise OSError(f"Can't capture color image from RealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
color_image = np.asanyarray(color_frame.get_data())
|
||||||
|
|
||||||
|
requested_color_mode = self.color_mode if temporary_color is None else temporary_color
|
||||||
|
if requested_color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
# IntelRealSense uses RGB format as default (red, green, blue).
|
||||||
|
if requested_color_mode == "bgr":
|
||||||
|
color_image = cv2.cvtColor(color_image, cv2.COLOR_RGB2BGR)
|
||||||
|
|
||||||
|
h, w, _ = color_image.shape
|
||||||
|
if h != self.capture_height or w != self.capture_width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
color_image = cv2.rotate(color_image, self.rotation)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the image
|
||||||
|
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the image was received
|
||||||
|
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
depth_frame = frame.get_depth_frame()
|
||||||
|
if not depth_frame:
|
||||||
|
raise OSError(f"Can't capture depth image from RealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
depth_map = np.asanyarray(depth_frame.get_data())
|
||||||
|
|
||||||
|
h, w = depth_map.shape
|
||||||
|
if h != self.capture_height or w != self.capture_width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't capture depth map with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
depth_map = cv2.rotate(depth_map, self.rotation)
|
||||||
|
|
||||||
|
return color_image, depth_map
|
||||||
|
else:
|
||||||
|
return color_image
|
||||||
|
|
||||||
|
def read_loop(self):
|
||||||
|
while not self.stop_event.is_set():
|
||||||
|
if self.use_depth:
|
||||||
|
self.color_image, self.depth_map = self.read()
|
||||||
|
else:
|
||||||
|
self.color_image = self.read()
|
||||||
|
|
||||||
|
def async_read(self):
|
||||||
|
"""Access the latest color image"""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"RealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.thread is None:
|
||||||
|
self.stop_event = threading.Event()
|
||||||
|
self.thread = Thread(target=self.read_loop, args=())
|
||||||
|
self.thread.daemon = True
|
||||||
|
self.thread.start()
|
||||||
|
|
||||||
|
num_tries = 0
|
||||||
|
while self.color_image is None:
|
||||||
|
# TODO(rcadene, aliberts): intelrealsense has diverged compared to opencv over here
|
||||||
|
num_tries += 1
|
||||||
|
time.sleep(1 / self.fps)
|
||||||
|
if num_tries > self.fps and (self.thread.ident is None or not self.thread.is_alive()):
|
||||||
|
raise Exception(
|
||||||
|
"The thread responsible for `self.async_read()` took too much time to start. There might be an issue. Verify that `self.thread.start()` has been called."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
return self.color_image, self.depth_map
|
||||||
|
else:
|
||||||
|
return self.color_image
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"RealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.thread is not None and self.thread.is_alive():
|
||||||
|
# wait for the thread to finish
|
||||||
|
self.stop_event.set()
|
||||||
|
self.thread.join()
|
||||||
|
self.thread = None
|
||||||
|
self.stop_event = None
|
||||||
|
|
||||||
|
self.camera.stop()
|
||||||
|
self.camera = None
|
||||||
|
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser(
|
||||||
|
description="Save a few frames using `RealSenseCamera` for all cameras connected to the computer, or a selected subset."
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--serial-numbers",
|
||||||
|
type=int,
|
||||||
|
nargs="*",
|
||||||
|
default=None,
|
||||||
|
help="List of serial numbers used to instantiate the `RealSenseCamera`. If not provided, find and use all available camera indices.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--fps",
|
||||||
|
type=int,
|
||||||
|
default=30,
|
||||||
|
help="Set the number of frames recorded per seconds for all cameras. If not provided, use the default fps of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--width",
|
||||||
|
type=str,
|
||||||
|
default=640,
|
||||||
|
help="Set the width for all cameras. If not provided, use the default width of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--height",
|
||||||
|
type=str,
|
||||||
|
default=480,
|
||||||
|
help="Set the height for all cameras. If not provided, use the default height of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--images-dir",
|
||||||
|
type=Path,
|
||||||
|
default="outputs/images_from_intelrealsense_cameras",
|
||||||
|
help="Set directory to save a few frames for each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--record-time-s",
|
||||||
|
type=float,
|
||||||
|
default=2.0,
|
||||||
|
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
save_images_from_cameras(**vars(args))
|
||||||
71
lerobot/common/cameras/intel/configuration_realsense.py
Normal file
71
lerobot/common/cameras/intel/configuration_realsense.py
Normal file
@@ -0,0 +1,71 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from dataclasses import dataclass
|
||||||
|
|
||||||
|
from ..configs import CameraConfig
|
||||||
|
|
||||||
|
|
||||||
|
@CameraConfig.register_subclass("intelrealsense")
|
||||||
|
@dataclass
|
||||||
|
class RealSenseCameraConfig(CameraConfig):
|
||||||
|
"""
|
||||||
|
Example of tested options for Intel Real Sense D405:
|
||||||
|
|
||||||
|
```python
|
||||||
|
RealSenseCameraConfig(128422271347, 30, 640, 480)
|
||||||
|
RealSenseCameraConfig(128422271347, 60, 640, 480)
|
||||||
|
RealSenseCameraConfig(128422271347, 90, 640, 480)
|
||||||
|
RealSenseCameraConfig(128422271347, 30, 1280, 720)
|
||||||
|
RealSenseCameraConfig(128422271347, 30, 640, 480, use_depth=True)
|
||||||
|
RealSenseCameraConfig(128422271347, 30, 640, 480, rotation=90)
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
name: str | None = None
|
||||||
|
serial_number: int | None = None
|
||||||
|
fps: int | None = None
|
||||||
|
width: int | None = None
|
||||||
|
height: int | None = None
|
||||||
|
color_mode: str = "rgb"
|
||||||
|
channels: int | None = None
|
||||||
|
use_depth: bool = False
|
||||||
|
force_hardware_reset: bool = True
|
||||||
|
rotation: int | None = None
|
||||||
|
mock: bool = False
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
# bool is stronger than is None, since it works with empty strings
|
||||||
|
if bool(self.name) and bool(self.serial_number):
|
||||||
|
raise ValueError(
|
||||||
|
f"One of them must be set: name or serial_number, but {self.name=} and {self.serial_number=} provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"`color_mode` is expected to be 'rgb' or 'bgr', but {self.color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.channels = 3
|
||||||
|
|
||||||
|
at_least_one_is_not_none = self.fps is not None or self.width is not None or self.height is not None
|
||||||
|
at_least_one_is_none = self.fps is None or self.width is None or self.height is None
|
||||||
|
if at_least_one_is_not_none and at_least_one_is_none:
|
||||||
|
raise ValueError(
|
||||||
|
"For `fps`, `width` and `height`, either all of them need to be set, or none of them, "
|
||||||
|
f"but {self.fps=}, {self.width=}, {self.height=} were provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation not in [-90, None, 90, 180]:
|
||||||
|
raise ValueError(f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})")
|
||||||
4
lerobot/common/cameras/opencv/__init__.py
Normal file
4
lerobot/common/cameras/opencv/__init__.py
Normal file
@@ -0,0 +1,4 @@
|
|||||||
|
from .camera_opencv import OpenCVCamera
|
||||||
|
from .configuration_opencv import OpenCVCameraConfig
|
||||||
|
|
||||||
|
__all__ = ["OpenCVCamera", "OpenCVCameraConfig"]
|
||||||
@@ -1,3 +1,17 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
This file contains utilities for recording frames from cameras. For more info look at `OpenCVCamera` docstring.
|
This file contains utilities for recording frames from cameras. For more info look at `OpenCVCamera` docstring.
|
||||||
"""
|
"""
|
||||||
@@ -9,21 +23,20 @@ import platform
|
|||||||
import shutil
|
import shutil
|
||||||
import threading
|
import threading
|
||||||
import time
|
import time
|
||||||
from dataclasses import dataclass, replace
|
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from threading import Thread
|
from threading import Thread
|
||||||
|
|
||||||
import cv2
|
|
||||||
import numpy as np
|
import numpy as np
|
||||||
from PIL import Image
|
from PIL import Image
|
||||||
|
|
||||||
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
from lerobot.common.errors import DeviceAlreadyConnectedError, DeviceNotConnectedError
|
||||||
|
from lerobot.common.utils.robot_utils import (
|
||||||
|
busy_wait,
|
||||||
|
)
|
||||||
from lerobot.common.utils.utils import capture_timestamp_utc
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
from lerobot.scripts.control_robot import busy_wait
|
|
||||||
|
|
||||||
# Use 1 thread to avoid blocking the main thread. Especially useful during data collection
|
from ..camera import Camera
|
||||||
# when other threads are used to save the images.
|
from .configuration_opencv import OpenCVCameraConfig
|
||||||
cv2.setNumThreads(1)
|
|
||||||
|
|
||||||
# The maximum opencv device index depends on your operating system. For instance,
|
# The maximum opencv device index depends on your operating system. For instance,
|
||||||
# if you have 3 cameras, they should be associated to index 0, 1, and 2. This is the case
|
# if you have 3 cameras, they should be associated to index 0, 1, and 2. This is the case
|
||||||
@@ -33,20 +46,44 @@ cv2.setNumThreads(1)
|
|||||||
MAX_OPENCV_INDEX = 60
|
MAX_OPENCV_INDEX = 60
|
||||||
|
|
||||||
|
|
||||||
def find_camera_indices(raise_when_empty=False, max_index_search_range=MAX_OPENCV_INDEX):
|
def find_cameras(raise_when_empty=False, max_index_search_range=MAX_OPENCV_INDEX, mock=False) -> list[dict]:
|
||||||
|
cameras = []
|
||||||
if platform.system() == "Linux":
|
if platform.system() == "Linux":
|
||||||
# Linux uses camera ports
|
|
||||||
print("Linux detected. Finding available camera indices through scanning '/dev/video*' ports")
|
print("Linux detected. Finding available camera indices through scanning '/dev/video*' ports")
|
||||||
possible_camera_ids = []
|
possible_ports = [str(port) for port in Path("/dev").glob("video*")]
|
||||||
for port in Path("/dev").glob("video*"):
|
ports = _find_cameras(possible_ports, mock=mock)
|
||||||
camera_idx = int(str(port).replace("/dev/video", ""))
|
for port in ports:
|
||||||
possible_camera_ids.append(camera_idx)
|
cameras.append(
|
||||||
|
{
|
||||||
|
"port": port,
|
||||||
|
"index": int(port.removeprefix("/dev/video")),
|
||||||
|
}
|
||||||
|
)
|
||||||
else:
|
else:
|
||||||
print(
|
print(
|
||||||
"Mac or Windows detected. Finding available camera indices through "
|
"Mac or Windows detected. Finding available camera indices through "
|
||||||
f"scanning all indices from 0 to {MAX_OPENCV_INDEX}"
|
f"scanning all indices from 0 to {MAX_OPENCV_INDEX}"
|
||||||
)
|
)
|
||||||
possible_camera_ids = range(max_index_search_range)
|
possible_indices = range(max_index_search_range)
|
||||||
|
indices = _find_cameras(possible_indices, mock=mock)
|
||||||
|
for index in indices:
|
||||||
|
cameras.append(
|
||||||
|
{
|
||||||
|
"port": None,
|
||||||
|
"index": index,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
return cameras
|
||||||
|
|
||||||
|
|
||||||
|
def _find_cameras(
|
||||||
|
possible_camera_ids: list[int | str], raise_when_empty=False, mock=False
|
||||||
|
) -> list[int | str]:
|
||||||
|
if mock:
|
||||||
|
import tests.cameras.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
camera_ids = []
|
camera_ids = []
|
||||||
for camera_idx in possible_camera_ids:
|
for camera_idx in possible_camera_ids:
|
||||||
@@ -67,6 +104,16 @@ def find_camera_indices(raise_when_empty=False, max_index_search_range=MAX_OPENC
|
|||||||
return camera_ids
|
return camera_ids
|
||||||
|
|
||||||
|
|
||||||
|
def is_valid_unix_path(path: str) -> bool:
|
||||||
|
"""Note: if 'path' points to a symlink, this will return True only if the target exists"""
|
||||||
|
p = Path(path)
|
||||||
|
return p.is_absolute() and p.exists()
|
||||||
|
|
||||||
|
|
||||||
|
def get_camera_index_from_unix_port(port: Path) -> int:
|
||||||
|
return int(str(port.resolve()).removeprefix("/dev/video"))
|
||||||
|
|
||||||
|
|
||||||
def save_image(img_array, camera_index, frame_index, images_dir):
|
def save_image(img_array, camera_index, frame_index, images_dir):
|
||||||
img = Image.fromarray(img_array)
|
img = Image.fromarray(img_array)
|
||||||
path = images_dir / f"camera_{camera_index:02d}_frame_{frame_index:06d}.png"
|
path = images_dir / f"camera_{camera_index:02d}_frame_{frame_index:06d}.png"
|
||||||
@@ -75,19 +122,31 @@ def save_image(img_array, camera_index, frame_index, images_dir):
|
|||||||
|
|
||||||
|
|
||||||
def save_images_from_cameras(
|
def save_images_from_cameras(
|
||||||
images_dir: Path, camera_ids: list[int] | None = None, fps=None, width=None, height=None, record_time_s=2
|
images_dir: Path,
|
||||||
|
camera_ids: list | None = None,
|
||||||
|
fps=None,
|
||||||
|
width=None,
|
||||||
|
height=None,
|
||||||
|
record_time_s=2,
|
||||||
|
mock=False,
|
||||||
):
|
):
|
||||||
if camera_ids is None:
|
"""
|
||||||
camera_ids = find_camera_indices()
|
Initializes all the cameras and saves images to the directory. Useful to visually identify the camera
|
||||||
|
associated to a given camera index.
|
||||||
|
"""
|
||||||
|
if camera_ids is None or len(camera_ids) == 0:
|
||||||
|
camera_infos = find_cameras(mock=mock)
|
||||||
|
camera_ids = [cam["index"] for cam in camera_infos]
|
||||||
|
|
||||||
print("Connecting cameras")
|
print("Connecting cameras")
|
||||||
cameras = []
|
cameras = []
|
||||||
for cam_idx in camera_ids:
|
for cam_idx in camera_ids:
|
||||||
camera = OpenCVCamera(cam_idx, fps=fps, width=width, height=height)
|
config = OpenCVCameraConfig(camera_index=cam_idx, fps=fps, width=width, height=height, mock=mock)
|
||||||
|
camera = OpenCVCamera(config)
|
||||||
camera.connect()
|
camera.connect()
|
||||||
print(
|
print(
|
||||||
f"OpenCVCamera({camera.camera_index}, fps={camera.fps}, width={camera.width}, "
|
f"OpenCVCamera({camera.camera_index}, fps={camera.fps}, width={camera.capture_width}, "
|
||||||
f"height={camera.height}, color_mode={camera.color_mode})"
|
f"height={camera.capture_height}, color_mode={camera.color_mode})"
|
||||||
)
|
)
|
||||||
cameras.append(camera)
|
cameras.append(camera)
|
||||||
|
|
||||||
@@ -101,7 +160,7 @@ def save_images_from_cameras(
|
|||||||
print(f"Saving images to {images_dir}")
|
print(f"Saving images to {images_dir}")
|
||||||
frame_index = 0
|
frame_index = 0
|
||||||
start_time = time.perf_counter()
|
start_time = time.perf_counter()
|
||||||
with concurrent.futures.ThreadPoolExecutor(max_workers=4) as executor:
|
with concurrent.futures.ThreadPoolExecutor(max_workers=1) as executor:
|
||||||
while True:
|
while True:
|
||||||
now = time.perf_counter()
|
now = time.perf_counter()
|
||||||
|
|
||||||
@@ -122,42 +181,17 @@ def save_images_from_cameras(
|
|||||||
dt_s = time.perf_counter() - now
|
dt_s = time.perf_counter() - now
|
||||||
busy_wait(1 / fps - dt_s)
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
|
||||||
|
|
||||||
if time.perf_counter() - start_time > record_time_s:
|
if time.perf_counter() - start_time > record_time_s:
|
||||||
break
|
break
|
||||||
|
|
||||||
print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
|
|
||||||
|
|
||||||
frame_index += 1
|
frame_index += 1
|
||||||
|
|
||||||
print(f"Images have been saved to {images_dir}")
|
print(f"Images have been saved to {images_dir}")
|
||||||
|
|
||||||
|
|
||||||
@dataclass
|
class OpenCVCamera(Camera):
|
||||||
class OpenCVCameraConfig:
|
|
||||||
"""
|
|
||||||
Example of tested options for Intel Real Sense D405:
|
|
||||||
|
|
||||||
```python
|
|
||||||
OpenCVCameraConfig(30, 640, 480)
|
|
||||||
OpenCVCameraConfig(60, 640, 480)
|
|
||||||
OpenCVCameraConfig(90, 640, 480)
|
|
||||||
OpenCVCameraConfig(30, 1280, 720)
|
|
||||||
```
|
|
||||||
"""
|
|
||||||
|
|
||||||
fps: int | None = None
|
|
||||||
width: int | None = None
|
|
||||||
height: int | None = None
|
|
||||||
color_mode: str = "rgb"
|
|
||||||
|
|
||||||
def __post_init__(self):
|
|
||||||
if self.color_mode not in ["rgb", "bgr"]:
|
|
||||||
raise ValueError(
|
|
||||||
f"Expected color_mode values are 'rgb' or 'bgr', but {self.color_mode} is provided."
|
|
||||||
)
|
|
||||||
|
|
||||||
|
|
||||||
class OpenCVCamera:
|
|
||||||
"""
|
"""
|
||||||
The OpenCVCamera class allows to efficiently record images from cameras. It relies on opencv2 to communicate
|
The OpenCVCamera class allows to efficiently record images from cameras. It relies on opencv2 to communicate
|
||||||
with the cameras. Most cameras are compatible. For more info, see the [Video I/O with OpenCV Overview](https://docs.opencv.org/4.x/d0/da7/videoio_overview.html).
|
with the cameras. Most cameras are compatible. For more info, see the [Video I/O with OpenCV Overview](https://docs.opencv.org/4.x/d0/da7/videoio_overview.html).
|
||||||
@@ -176,7 +210,10 @@ class OpenCVCamera:
|
|||||||
|
|
||||||
Example of usage:
|
Example of usage:
|
||||||
```python
|
```python
|
||||||
camera = OpenCVCamera(camera_index=0)
|
from lerobot.common.robot_devices.cameras.configs import OpenCVCameraConfig
|
||||||
|
|
||||||
|
config = OpenCVCameraConfig(camera_index=0)
|
||||||
|
camera = OpenCVCamera(config)
|
||||||
camera.connect()
|
camera.connect()
|
||||||
color_image = camera.read()
|
color_image = camera.read()
|
||||||
# when done using the camera, consider disconnecting
|
# when done using the camera, consider disconnecting
|
||||||
@@ -185,28 +222,45 @@ class OpenCVCamera:
|
|||||||
|
|
||||||
Example of changing default fps, width, height and color_mode:
|
Example of changing default fps, width, height and color_mode:
|
||||||
```python
|
```python
|
||||||
camera = OpenCVCamera(0, fps=30, width=1280, height=720)
|
config = OpenCVCameraConfig(camera_index=0, fps=30, width=1280, height=720)
|
||||||
camera = connect() # applies the settings, might error out if these settings are not compatible with the camera
|
config = OpenCVCameraConfig(camera_index=0, fps=90, width=640, height=480)
|
||||||
|
config = OpenCVCameraConfig(camera_index=0, fps=90, width=640, height=480, color_mode="bgr")
|
||||||
camera = OpenCVCamera(0, fps=90, width=640, height=480)
|
# Note: might error out open `camera.connect()` if these settings are not compatible with the camera
|
||||||
camera = connect()
|
|
||||||
|
|
||||||
camera = OpenCVCamera(0, fps=90, width=640, height=480, color_mode="bgr")
|
|
||||||
camera = connect()
|
|
||||||
```
|
```
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, camera_index: int, config: OpenCVCameraConfig | None = None, **kwargs):
|
def __init__(self, config: OpenCVCameraConfig):
|
||||||
if config is None:
|
self.config = config
|
||||||
config = OpenCVCameraConfig()
|
self.camera_index = config.camera_index
|
||||||
# Overwrite config arguments using kwargs
|
self.port = None
|
||||||
config = replace(config, **kwargs)
|
|
||||||
|
# Linux uses ports for connecting to cameras
|
||||||
|
if platform.system() == "Linux":
|
||||||
|
if isinstance(self.camera_index, int):
|
||||||
|
self.port = Path(f"/dev/video{self.camera_index}")
|
||||||
|
elif isinstance(self.camera_index, str) and is_valid_unix_path(self.camera_index):
|
||||||
|
self.port = Path(self.camera_index)
|
||||||
|
# Retrieve the camera index from a potentially symlinked path
|
||||||
|
self.camera_index = get_camera_index_from_unix_port(self.port)
|
||||||
|
else:
|
||||||
|
raise ValueError(f"Please check the provided camera_index: {self.camera_index}")
|
||||||
|
|
||||||
|
# Store the raw (capture) resolution from the config.
|
||||||
|
self.capture_width = config.width
|
||||||
|
self.capture_height = config.height
|
||||||
|
|
||||||
|
# If rotated by ±90, swap width and height.
|
||||||
|
if config.rotation in [-90, 90]:
|
||||||
|
self.width = config.height
|
||||||
|
self.height = config.width
|
||||||
|
else:
|
||||||
|
self.width = config.width
|
||||||
|
self.height = config.height
|
||||||
|
|
||||||
self.camera_index = camera_index
|
|
||||||
self.fps = config.fps
|
self.fps = config.fps
|
||||||
self.width = config.width
|
self.channels = config.channels
|
||||||
self.height = config.height
|
|
||||||
self.color_mode = config.color_mode
|
self.color_mode = config.color_mode
|
||||||
|
self.mock = config.mock
|
||||||
|
|
||||||
self.camera = None
|
self.camera = None
|
||||||
self.is_connected = False
|
self.is_connected = False
|
||||||
@@ -215,89 +269,121 @@ class OpenCVCamera:
|
|||||||
self.color_image = None
|
self.color_image = None
|
||||||
self.logs = {}
|
self.logs = {}
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.cameras.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
self.rotation = None
|
||||||
|
if config.rotation == -90:
|
||||||
|
self.rotation = cv2.ROTATE_90_COUNTERCLOCKWISE
|
||||||
|
elif config.rotation == 90:
|
||||||
|
self.rotation = cv2.ROTATE_90_CLOCKWISE
|
||||||
|
elif config.rotation == 180:
|
||||||
|
self.rotation = cv2.ROTATE_180
|
||||||
|
|
||||||
def connect(self):
|
def connect(self):
|
||||||
if self.is_connected:
|
if self.is_connected:
|
||||||
raise RobotDeviceAlreadyConnectedError(f"Camera {self.camera_index} is already connected.")
|
raise DeviceAlreadyConnectedError(f"OpenCVCamera({self.camera_index}) is already connected.")
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.cameras.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
# Use 1 thread to avoid blocking the main thread. Especially useful during data collection
|
||||||
|
# when other threads are used to save the images.
|
||||||
|
cv2.setNumThreads(1)
|
||||||
|
|
||||||
|
backend = (
|
||||||
|
cv2.CAP_V4L2
|
||||||
|
if platform.system() == "Linux"
|
||||||
|
else cv2.CAP_DSHOW
|
||||||
|
if platform.system() == "Windows"
|
||||||
|
else cv2.CAP_AVFOUNDATION
|
||||||
|
if platform.system() == "Darwin"
|
||||||
|
else cv2.CAP_ANY
|
||||||
|
)
|
||||||
|
|
||||||
|
camera_idx = f"/dev/video{self.camera_index}" if platform.system() == "Linux" else self.camera_index
|
||||||
# First create a temporary camera trying to access `camera_index`,
|
# First create a temporary camera trying to access `camera_index`,
|
||||||
# and verify it is a valid camera by calling `isOpened`.
|
# and verify it is a valid camera by calling `isOpened`.
|
||||||
|
tmp_camera = cv2.VideoCapture(camera_idx, backend)
|
||||||
if platform.system() == "Linux":
|
|
||||||
# Linux uses ports for connecting to cameras
|
|
||||||
tmp_camera = cv2.VideoCapture(f"/dev/video{self.camera_index}")
|
|
||||||
else:
|
|
||||||
tmp_camera = cv2.VideoCapture(self.camera_index)
|
|
||||||
|
|
||||||
is_camera_open = tmp_camera.isOpened()
|
is_camera_open = tmp_camera.isOpened()
|
||||||
# Release camera to make it accessible for `find_camera_indices`
|
# Release camera to make it accessible for `find_camera_indices`
|
||||||
|
tmp_camera.release()
|
||||||
del tmp_camera
|
del tmp_camera
|
||||||
|
|
||||||
# If the camera doesn't work, display the camera indices corresponding to
|
# If the camera doesn't work, display the camera indices corresponding to
|
||||||
# valid cameras.
|
# valid cameras.
|
||||||
if not is_camera_open:
|
if not is_camera_open:
|
||||||
# Verify that the provided `camera_index` is valid before printing the traceback
|
# Verify that the provided `camera_index` is valid before printing the traceback
|
||||||
available_cam_ids = find_camera_indices()
|
cameras_info = find_cameras()
|
||||||
|
available_cam_ids = [cam["index"] for cam in cameras_info]
|
||||||
if self.camera_index not in available_cam_ids:
|
if self.camera_index not in available_cam_ids:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"`camera_index` is expected to be one of these available cameras {available_cam_ids}, but {self.camera_index} is provided instead. "
|
f"`camera_index` is expected to be one of these available cameras {available_cam_ids}, but {self.camera_index} is provided instead. "
|
||||||
"To find the camera index you should use, run `python lerobot/common/robot_devices/cameras/opencv.py`."
|
"To find the camera index you should use, run `python lerobot/common/robot_devices/cameras/opencv.py`."
|
||||||
)
|
)
|
||||||
|
|
||||||
raise OSError(f"Can't access camera {self.camera_index}.")
|
raise OSError(f"Can't access OpenCVCamera({camera_idx}).")
|
||||||
|
|
||||||
# Secondly, create the camera that will be used downstream.
|
# Secondly, create the camera that will be used downstream.
|
||||||
# Note: For some unknown reason, calling `isOpened` blocks the camera which then
|
# Note: For some unknown reason, calling `isOpened` blocks the camera which then
|
||||||
# needs to be re-created.
|
# needs to be re-created.
|
||||||
if platform.system() == "Linux":
|
self.camera = cv2.VideoCapture(camera_idx, backend)
|
||||||
self.camera = cv2.VideoCapture(f"/dev/video{self.camera_index}")
|
|
||||||
else:
|
|
||||||
self.camera = cv2.VideoCapture(self.camera_index)
|
|
||||||
|
|
||||||
if self.fps is not None:
|
if self.fps is not None:
|
||||||
self.camera.set(cv2.CAP_PROP_FPS, self.fps)
|
self.camera.set(cv2.CAP_PROP_FPS, self.fps)
|
||||||
if self.width is not None:
|
if self.capture_width is not None:
|
||||||
self.camera.set(cv2.CAP_PROP_FRAME_WIDTH, self.width)
|
self.camera.set(cv2.CAP_PROP_FRAME_WIDTH, self.capture_width)
|
||||||
if self.height is not None:
|
if self.capture_height is not None:
|
||||||
self.camera.set(cv2.CAP_PROP_FRAME_HEIGHT, self.height)
|
self.camera.set(cv2.CAP_PROP_FRAME_HEIGHT, self.capture_height)
|
||||||
|
|
||||||
actual_fps = self.camera.get(cv2.CAP_PROP_FPS)
|
actual_fps = self.camera.get(cv2.CAP_PROP_FPS)
|
||||||
actual_width = self.camera.get(cv2.CAP_PROP_FRAME_WIDTH)
|
actual_width = self.camera.get(cv2.CAP_PROP_FRAME_WIDTH)
|
||||||
actual_height = self.camera.get(cv2.CAP_PROP_FRAME_HEIGHT)
|
actual_height = self.camera.get(cv2.CAP_PROP_FRAME_HEIGHT)
|
||||||
|
|
||||||
|
# Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
|
||||||
if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
|
if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
|
||||||
|
# Using `OSError` since it's a broad that encompasses issues related to device communication
|
||||||
raise OSError(
|
raise OSError(
|
||||||
f"Can't set {self.fps=} for camera {self.camera_index}. Actual value is {actual_fps}."
|
f"Can't set {self.fps=} for OpenCVCamera({self.camera_index}). Actual value is {actual_fps}."
|
||||||
)
|
)
|
||||||
if self.width is not None and self.width != actual_width:
|
if self.capture_width is not None and not math.isclose(
|
||||||
|
self.capture_width, actual_width, rel_tol=1e-3
|
||||||
|
):
|
||||||
raise OSError(
|
raise OSError(
|
||||||
f"Can't set {self.width=} for camera {self.camera_index}. Actual value is {actual_width}."
|
f"Can't set {self.capture_width=} for OpenCVCamera({self.camera_index}). Actual value is {actual_width}."
|
||||||
)
|
)
|
||||||
if self.height is not None and self.height != actual_height:
|
if self.capture_height is not None and not math.isclose(
|
||||||
|
self.capture_height, actual_height, rel_tol=1e-3
|
||||||
|
):
|
||||||
raise OSError(
|
raise OSError(
|
||||||
f"Can't set {self.height=} for camera {self.camera_index}. Actual value is {actual_height}."
|
f"Can't set {self.capture_height=} for OpenCVCamera({self.camera_index}). Actual value is {actual_height}."
|
||||||
)
|
)
|
||||||
|
|
||||||
self.fps = actual_fps
|
self.fps = round(actual_fps)
|
||||||
self.width = actual_width
|
self.capture_width = round(actual_width)
|
||||||
self.height = actual_height
|
self.capture_height = round(actual_height)
|
||||||
|
|
||||||
self.is_connected = True
|
self.is_connected = True
|
||||||
|
|
||||||
def read(self, temporary_color_mode: str | None = None) -> np.ndarray:
|
def read(self, temporary_color_mode: str | None = None) -> np.ndarray:
|
||||||
"""Read a frame from the camera returned in the format (height, width, channels)
|
"""Read a frame from the camera returned in the format (height, width, channels)
|
||||||
(e.g. (640, 480, 3)), contrarily to the pytorch format which is channel first.
|
(e.g. 480 x 640 x 3), contrarily to the pytorch format which is channel first.
|
||||||
|
|
||||||
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
||||||
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
||||||
"""
|
"""
|
||||||
if not self.is_connected:
|
if not self.is_connected:
|
||||||
raise RobotDeviceNotConnectedError(
|
raise DeviceNotConnectedError(
|
||||||
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
||||||
)
|
)
|
||||||
|
|
||||||
start_time = time.perf_counter()
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
ret, color_image = self.camera.read()
|
ret, color_image = self.camera.read()
|
||||||
|
|
||||||
if not ret:
|
if not ret:
|
||||||
raise OSError(f"Can't capture color image from camera {self.camera_index}.")
|
raise OSError(f"Can't capture color image from camera {self.camera_index}.")
|
||||||
|
|
||||||
@@ -308,33 +394,46 @@ class OpenCVCamera:
|
|||||||
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
||||||
)
|
)
|
||||||
|
|
||||||
# OpenCV uses BGR format as default (blue, green red) for all operations, including displaying images.
|
# OpenCV uses BGR format as default (blue, green, red) for all operations, including displaying images.
|
||||||
# However, Deep Learning framework such as LeRobot uses RGB format as default to train neural networks,
|
# However, Deep Learning framework such as LeRobot uses RGB format as default to train neural networks,
|
||||||
# so we convert the image color from BGR to RGB.
|
# so we convert the image color from BGR to RGB.
|
||||||
if requested_color_mode == "rgb":
|
if requested_color_mode == "rgb":
|
||||||
|
if self.mock:
|
||||||
|
import tests.cameras.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
color_image = cv2.cvtColor(color_image, cv2.COLOR_BGR2RGB)
|
color_image = cv2.cvtColor(color_image, cv2.COLOR_BGR2RGB)
|
||||||
|
|
||||||
h, w, _ = color_image.shape
|
h, w, _ = color_image.shape
|
||||||
if h != self.height or w != self.width:
|
if h != self.capture_height or w != self.capture_width:
|
||||||
raise OSError(
|
raise OSError(
|
||||||
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
)
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
color_image = cv2.rotate(color_image, self.rotation)
|
||||||
|
|
||||||
# log the number of seconds it took to read the image
|
# log the number of seconds it took to read the image
|
||||||
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
||||||
|
|
||||||
# log the utc time at which the image was received
|
# log the utc time at which the image was received
|
||||||
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
self.color_image = color_image
|
||||||
|
|
||||||
return color_image
|
return color_image
|
||||||
|
|
||||||
def read_loop(self):
|
def read_loop(self):
|
||||||
while self.stop_event is None or not self.stop_event.is_set():
|
while not self.stop_event.is_set():
|
||||||
self.color_image = self.read()
|
try:
|
||||||
|
self.color_image = self.read()
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error reading in thread: {e}")
|
||||||
|
|
||||||
def async_read(self):
|
def async_read(self):
|
||||||
if not self.is_connected:
|
if not self.is_connected:
|
||||||
raise RobotDeviceNotConnectedError(
|
raise DeviceNotConnectedError(
|
||||||
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -345,32 +444,29 @@ class OpenCVCamera:
|
|||||||
self.thread.start()
|
self.thread.start()
|
||||||
|
|
||||||
num_tries = 0
|
num_tries = 0
|
||||||
while self.color_image is None:
|
while True:
|
||||||
num_tries += 1
|
if self.color_image is not None:
|
||||||
time.sleep(1 / self.fps)
|
return self.color_image
|
||||||
if num_tries > self.fps and (self.thread.ident is None or not self.thread.is_alive()):
|
|
||||||
raise Exception(
|
|
||||||
"The thread responsible for `self.async_read()` took too much time to start. There might be an issue. Verify that `self.thread.start()` has been called."
|
|
||||||
)
|
|
||||||
|
|
||||||
return self.color_image
|
time.sleep(1 / self.fps)
|
||||||
|
num_tries += 1
|
||||||
|
if num_tries > self.fps * 2:
|
||||||
|
raise TimeoutError("Timed out waiting for async_read() to start.")
|
||||||
|
|
||||||
def disconnect(self):
|
def disconnect(self):
|
||||||
if not self.is_connected:
|
if not self.is_connected:
|
||||||
raise RobotDeviceNotConnectedError(
|
raise DeviceNotConnectedError(
|
||||||
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
||||||
)
|
)
|
||||||
|
|
||||||
if self.thread is not None and self.thread.is_alive():
|
if self.thread is not None:
|
||||||
# wait for the thread to finish
|
|
||||||
self.stop_event.set()
|
self.stop_event.set()
|
||||||
self.thread.join()
|
self.thread.join() # wait for the thread to finish
|
||||||
self.thread = None
|
self.thread = None
|
||||||
self.stop_event = None
|
self.stop_event = None
|
||||||
|
|
||||||
self.camera.release()
|
self.camera.release()
|
||||||
self.camera = None
|
self.camera = None
|
||||||
|
|
||||||
self.is_connected = False
|
self.is_connected = False
|
||||||
|
|
||||||
def __del__(self):
|
def __del__(self):
|
||||||
@@ -416,7 +512,7 @@ if __name__ == "__main__":
|
|||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
"--record-time-s",
|
"--record-time-s",
|
||||||
type=float,
|
type=float,
|
||||||
default=2.0,
|
default=4.0,
|
||||||
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
||||||
)
|
)
|
||||||
args = parser.parse_args()
|
args = parser.parse_args()
|
||||||
38
lerobot/common/cameras/opencv/configuration_opencv.py
Normal file
38
lerobot/common/cameras/opencv/configuration_opencv.py
Normal file
@@ -0,0 +1,38 @@
|
|||||||
|
from dataclasses import dataclass
|
||||||
|
|
||||||
|
from ..configs import CameraConfig
|
||||||
|
|
||||||
|
|
||||||
|
@CameraConfig.register_subclass("opencv")
|
||||||
|
@dataclass
|
||||||
|
class OpenCVCameraConfig(CameraConfig):
|
||||||
|
"""
|
||||||
|
Example of tested options for Intel Real Sense D405:
|
||||||
|
|
||||||
|
```python
|
||||||
|
OpenCVCameraConfig(0, 30, 640, 480)
|
||||||
|
OpenCVCameraConfig(0, 60, 640, 480)
|
||||||
|
OpenCVCameraConfig(0, 90, 640, 480)
|
||||||
|
OpenCVCameraConfig(0, 30, 1280, 720)
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
camera_index: int
|
||||||
|
fps: int | None = None
|
||||||
|
width: int | None = None
|
||||||
|
height: int | None = None
|
||||||
|
color_mode: str = "rgb"
|
||||||
|
channels: int | None = None
|
||||||
|
rotation: int | None = None
|
||||||
|
mock: bool = False
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
if self.color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"`color_mode` is expected to be 'rgb' or 'bgr', but {self.color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.channels = 3
|
||||||
|
|
||||||
|
if self.rotation not in [-90, None, 90, 180]:
|
||||||
|
raise ValueError(f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})")
|
||||||
21
lerobot/common/cameras/utils.py
Normal file
21
lerobot/common/cameras/utils.py
Normal file
@@ -0,0 +1,21 @@
|
|||||||
|
from .camera import Camera
|
||||||
|
from .configs import CameraConfig
|
||||||
|
|
||||||
|
|
||||||
|
def make_cameras_from_configs(camera_configs: dict[str, CameraConfig]) -> dict[str, Camera]:
|
||||||
|
cameras = {}
|
||||||
|
|
||||||
|
for key, cfg in camera_configs.items():
|
||||||
|
if cfg.type == "opencv":
|
||||||
|
from .opencv import OpenCVCamera
|
||||||
|
|
||||||
|
cameras[key] = OpenCVCamera(cfg)
|
||||||
|
|
||||||
|
elif cfg.type == "intelrealsense":
|
||||||
|
from .intel.camera_realsense import RealSenseCamera
|
||||||
|
|
||||||
|
cameras[key] = RealSenseCamera(cfg)
|
||||||
|
else:
|
||||||
|
raise ValueError(f"The motor type '{cfg.type}' is not valid.")
|
||||||
|
|
||||||
|
return cameras
|
||||||
52
lerobot/common/constants.py
Normal file
52
lerobot/common/constants.py
Normal file
@@ -0,0 +1,52 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
# keys
|
||||||
|
import os
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
from huggingface_hub.constants import HF_HOME
|
||||||
|
|
||||||
|
OBS_ENV_STATE = "observation.environment_state"
|
||||||
|
OBS_STATE = "observation.state"
|
||||||
|
OBS_IMAGE = "observation.image"
|
||||||
|
OBS_IMAGES = "observation.images"
|
||||||
|
ACTION = "action"
|
||||||
|
|
||||||
|
ROBOTS = "robots"
|
||||||
|
TELEOPERATORS = "teleoperators"
|
||||||
|
|
||||||
|
# files & directories
|
||||||
|
CHECKPOINTS_DIR = "checkpoints"
|
||||||
|
LAST_CHECKPOINT_LINK = "last"
|
||||||
|
PRETRAINED_MODEL_DIR = "pretrained_model"
|
||||||
|
TRAINING_STATE_DIR = "training_state"
|
||||||
|
RNG_STATE = "rng_state.safetensors"
|
||||||
|
TRAINING_STEP = "training_step.json"
|
||||||
|
OPTIMIZER_STATE = "optimizer_state.safetensors"
|
||||||
|
OPTIMIZER_PARAM_GROUPS = "optimizer_param_groups.json"
|
||||||
|
SCHEDULER_STATE = "scheduler_state.json"
|
||||||
|
|
||||||
|
if "LEROBOT_HOME" in os.environ:
|
||||||
|
raise ValueError(
|
||||||
|
f"You have a 'LEROBOT_HOME' environment variable set to '{os.getenv('LEROBOT_HOME')}'.\n"
|
||||||
|
"'LEROBOT_HOME' is deprecated, please use 'HF_LEROBOT_HOME' instead."
|
||||||
|
)
|
||||||
|
|
||||||
|
# cache dir
|
||||||
|
default_cache_path = Path(HF_HOME) / "lerobot"
|
||||||
|
HF_LEROBOT_HOME = Path(os.getenv("HF_LEROBOT_HOME", default_cache_path)).expanduser()
|
||||||
|
|
||||||
|
# calibration dir
|
||||||
|
default_calibration_path = HF_LEROBOT_HOME / ".calibration"
|
||||||
|
HF_LEROBOT_CALIBRATION = Path(os.getenv("HF_LEROBOT_CALIBRATION", default_calibration_path)).expanduser()
|
||||||
68
lerobot/common/datasets/backward_compatibility.py
Normal file
68
lerobot/common/datasets/backward_compatibility.py
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import packaging.version
|
||||||
|
|
||||||
|
V2_MESSAGE = """
|
||||||
|
The dataset you requested ({repo_id}) is in {version} format.
|
||||||
|
|
||||||
|
We introduced a new format since v2.0 which is not backward compatible with v1.x.
|
||||||
|
Please, use our conversion script. Modify the following command with your own task description:
|
||||||
|
```
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \\
|
||||||
|
--repo-id {repo_id} \\
|
||||||
|
--single-task "TASK DESCRIPTION." # <---- /!\\ Replace TASK DESCRIPTION /!\\
|
||||||
|
```
|
||||||
|
|
||||||
|
A few examples to replace TASK DESCRIPTION: "Pick up the blue cube and place it into the bin.", "Insert the
|
||||||
|
peg into the socket.", "Slide open the ziploc bag.", "Take the elevator to the 1st floor.", "Open the top
|
||||||
|
cabinet, store the pot inside it then close the cabinet.", "Push the T-shaped block onto the T-shaped
|
||||||
|
target.", "Grab the spray paint on the shelf and place it in the bin on top of the robot dog.", "Fold the
|
||||||
|
sweatshirt.", ...
|
||||||
|
|
||||||
|
If you encounter a problem, contact LeRobot maintainers on [Discord](https://discord.com/invite/s3KuuzsPFb)
|
||||||
|
or open an [issue on GitHub](https://github.com/huggingface/lerobot/issues/new/choose).
|
||||||
|
"""
|
||||||
|
|
||||||
|
V21_MESSAGE = """
|
||||||
|
The dataset you requested ({repo_id}) is in {version} format.
|
||||||
|
While current version of LeRobot is backward-compatible with it, the version of your dataset still uses global
|
||||||
|
stats instead of per-episode stats. Update your dataset stats to the new format using this command:
|
||||||
|
```
|
||||||
|
python lerobot/common/datasets/v21/convert_dataset_v20_to_v21.py --repo-id={repo_id}
|
||||||
|
```
|
||||||
|
|
||||||
|
If you encounter a problem, contact LeRobot maintainers on [Discord](https://discord.com/invite/s3KuuzsPFb)
|
||||||
|
or open an [issue on GitHub](https://github.com/huggingface/lerobot/issues/new/choose).
|
||||||
|
"""
|
||||||
|
|
||||||
|
FUTURE_MESSAGE = """
|
||||||
|
The dataset you requested ({repo_id}) is only available in {version} format.
|
||||||
|
As we cannot ensure forward compatibility with it, please update your current version of lerobot.
|
||||||
|
"""
|
||||||
|
|
||||||
|
|
||||||
|
class CompatibilityError(Exception): ...
|
||||||
|
|
||||||
|
|
||||||
|
class BackwardCompatibilityError(CompatibilityError):
|
||||||
|
def __init__(self, repo_id: str, version: packaging.version.Version):
|
||||||
|
message = V2_MESSAGE.format(repo_id=repo_id, version=version)
|
||||||
|
super().__init__(message)
|
||||||
|
|
||||||
|
|
||||||
|
class ForwardCompatibilityError(CompatibilityError):
|
||||||
|
def __init__(self, repo_id: str, version: packaging.version.Version):
|
||||||
|
message = FUTURE_MESSAGE.format(repo_id=repo_id, version=version)
|
||||||
|
super().__init__(message)
|
||||||
27
lerobot/common/datasets/card_template.md
Normal file
27
lerobot/common/datasets/card_template.md
Normal file
@@ -0,0 +1,27 @@
|
|||||||
|
---
|
||||||
|
# For reference on dataset card metadata, see the spec: https://github.com/huggingface/hub-docs/blob/main/datasetcard.md?plain=1
|
||||||
|
# Doc / guide: https://huggingface.co/docs/hub/datasets-cards
|
||||||
|
{{ card_data }}
|
||||||
|
---
|
||||||
|
|
||||||
|
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
|
||||||
|
|
||||||
|
## Dataset Description
|
||||||
|
|
||||||
|
{{ dataset_description | default("", true) }}
|
||||||
|
|
||||||
|
- **Homepage:** {{ url | default("[More Information Needed]", true)}}
|
||||||
|
- **Paper:** {{ paper | default("[More Information Needed]", true)}}
|
||||||
|
- **License:** {{ license | default("[More Information Needed]", true)}}
|
||||||
|
|
||||||
|
## Dataset Structure
|
||||||
|
|
||||||
|
{{ dataset_structure | default("[More Information Needed]", true)}}
|
||||||
|
|
||||||
|
## Citation
|
||||||
|
|
||||||
|
**BibTeX:**
|
||||||
|
|
||||||
|
```bibtex
|
||||||
|
{{ citation_bibtex | default("[More Information Needed]", true)}}
|
||||||
|
```
|
||||||
@@ -13,197 +13,164 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
from copy import deepcopy
|
import numpy as np
|
||||||
from math import ceil
|
|
||||||
|
|
||||||
import einops
|
from lerobot.common.datasets.utils import load_image_as_numpy
|
||||||
import torch
|
|
||||||
import tqdm
|
|
||||||
from datasets import Image
|
|
||||||
|
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame
|
|
||||||
|
|
||||||
|
|
||||||
def get_stats_einops_patterns(dataset, num_workers=0):
|
def estimate_num_samples(
|
||||||
"""These einops patterns will be used to aggregate batches and compute statistics.
|
dataset_len: int, min_num_samples: int = 100, max_num_samples: int = 10_000, power: float = 0.75
|
||||||
|
) -> int:
|
||||||
|
"""Heuristic to estimate the number of samples based on dataset size.
|
||||||
|
The power controls the sample growth relative to dataset size.
|
||||||
|
Lower the power for less number of samples.
|
||||||
|
|
||||||
Note: We assume the images are in channel first format
|
For default arguments, we have:
|
||||||
|
- from 1 to ~500, num_samples=100
|
||||||
|
- at 1000, num_samples=177
|
||||||
|
- at 2000, num_samples=299
|
||||||
|
- at 5000, num_samples=594
|
||||||
|
- at 10000, num_samples=1000
|
||||||
|
- at 20000, num_samples=1681
|
||||||
"""
|
"""
|
||||||
|
if dataset_len < min_num_samples:
|
||||||
|
min_num_samples = dataset_len
|
||||||
|
return max(min_num_samples, min(int(dataset_len**power), max_num_samples))
|
||||||
|
|
||||||
dataloader = torch.utils.data.DataLoader(
|
|
||||||
dataset,
|
|
||||||
num_workers=num_workers,
|
|
||||||
batch_size=2,
|
|
||||||
shuffle=False,
|
|
||||||
)
|
|
||||||
batch = next(iter(dataloader))
|
|
||||||
|
|
||||||
stats_patterns = {}
|
def sample_indices(data_len: int) -> list[int]:
|
||||||
for key, feats_type in dataset.features.items():
|
num_samples = estimate_num_samples(data_len)
|
||||||
# sanity check that tensors are not float64
|
return np.round(np.linspace(0, data_len - 1, num_samples)).astype(int).tolist()
|
||||||
assert batch[key].dtype != torch.float64
|
|
||||||
|
|
||||||
if isinstance(feats_type, (VideoFrame, Image)):
|
|
||||||
# sanity check that images are channel first
|
|
||||||
_, c, h, w = batch[key].shape
|
|
||||||
assert c < h and c < w, f"expect channel first images, but instead {batch[key].shape}"
|
|
||||||
|
|
||||||
# sanity check that images are float32 in range [0,1]
|
def auto_downsample_height_width(img: np.ndarray, target_size: int = 150, max_size_threshold: int = 300):
|
||||||
assert batch[key].dtype == torch.float32, f"expect torch.float32, but instead {batch[key].dtype=}"
|
_, height, width = img.shape
|
||||||
assert batch[key].max() <= 1, f"expect pixels lower than 1, but instead {batch[key].max()=}"
|
|
||||||
assert batch[key].min() >= 0, f"expect pixels greater than 1, but instead {batch[key].min()=}"
|
|
||||||
|
|
||||||
stats_patterns[key] = "b c h w -> c 1 1"
|
if max(width, height) < max_size_threshold:
|
||||||
elif batch[key].ndim == 2:
|
# no downsampling needed
|
||||||
stats_patterns[key] = "b c -> c "
|
return img
|
||||||
elif batch[key].ndim == 1:
|
|
||||||
stats_patterns[key] = "b -> 1"
|
downsample_factor = int(width / target_size) if width > height else int(height / target_size)
|
||||||
|
return img[:, ::downsample_factor, ::downsample_factor]
|
||||||
|
|
||||||
|
|
||||||
|
def sample_images(image_paths: list[str]) -> np.ndarray:
|
||||||
|
sampled_indices = sample_indices(len(image_paths))
|
||||||
|
|
||||||
|
images = None
|
||||||
|
for i, idx in enumerate(sampled_indices):
|
||||||
|
path = image_paths[idx]
|
||||||
|
# we load as uint8 to reduce memory usage
|
||||||
|
img = load_image_as_numpy(path, dtype=np.uint8, channel_first=True)
|
||||||
|
img = auto_downsample_height_width(img)
|
||||||
|
|
||||||
|
if images is None:
|
||||||
|
images = np.empty((len(sampled_indices), *img.shape), dtype=np.uint8)
|
||||||
|
|
||||||
|
images[i] = img
|
||||||
|
|
||||||
|
return images
|
||||||
|
|
||||||
|
|
||||||
|
def get_feature_stats(array: np.ndarray, axis: tuple, keepdims: bool) -> dict[str, np.ndarray]:
|
||||||
|
return {
|
||||||
|
"min": np.min(array, axis=axis, keepdims=keepdims),
|
||||||
|
"max": np.max(array, axis=axis, keepdims=keepdims),
|
||||||
|
"mean": np.mean(array, axis=axis, keepdims=keepdims),
|
||||||
|
"std": np.std(array, axis=axis, keepdims=keepdims),
|
||||||
|
"count": np.array([len(array)]),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def compute_episode_stats(episode_data: dict[str, list[str] | np.ndarray], features: dict) -> dict:
|
||||||
|
ep_stats = {}
|
||||||
|
for key, data in episode_data.items():
|
||||||
|
if features[key]["dtype"] == "string":
|
||||||
|
continue # HACK: we should receive np.arrays of strings
|
||||||
|
elif features[key]["dtype"] in ["image", "video"]:
|
||||||
|
ep_ft_array = sample_images(data) # data is a list of image paths
|
||||||
|
axes_to_reduce = (0, 2, 3) # keep channel dim
|
||||||
|
keepdims = True
|
||||||
else:
|
else:
|
||||||
raise ValueError(f"{key}, {feats_type}, {batch[key].shape}")
|
ep_ft_array = data # data is already a np.ndarray
|
||||||
|
axes_to_reduce = 0 # compute stats over the first axis
|
||||||
|
keepdims = data.ndim == 1 # keep as np.array
|
||||||
|
|
||||||
return stats_patterns
|
ep_stats[key] = get_feature_stats(ep_ft_array, axis=axes_to_reduce, keepdims=keepdims)
|
||||||
|
|
||||||
|
# finally, we normalize and remove batch dim for images
|
||||||
|
if features[key]["dtype"] in ["image", "video"]:
|
||||||
|
ep_stats[key] = {
|
||||||
|
k: v if k == "count" else np.squeeze(v / 255.0, axis=0) for k, v in ep_stats[key].items()
|
||||||
|
}
|
||||||
|
|
||||||
|
return ep_stats
|
||||||
|
|
||||||
|
|
||||||
def compute_stats(dataset, batch_size=32, num_workers=16, max_num_samples=None):
|
def _assert_type_and_shape(stats_list: list[dict[str, dict]]):
|
||||||
"""Compute mean/std and min/max statistics of all data keys in a LeRobotDataset."""
|
for i in range(len(stats_list)):
|
||||||
if max_num_samples is None:
|
for fkey in stats_list[i]:
|
||||||
max_num_samples = len(dataset)
|
for k, v in stats_list[i][fkey].items():
|
||||||
|
if not isinstance(v, np.ndarray):
|
||||||
# for more info on why we need to set the same number of workers, see `load_from_videos`
|
raise ValueError(
|
||||||
stats_patterns = get_stats_einops_patterns(dataset, num_workers)
|
f"Stats must be composed of numpy array, but key '{k}' of feature '{fkey}' is of type '{type(v)}' instead."
|
||||||
|
)
|
||||||
# mean and std will be computed incrementally while max and min will track the running value.
|
if v.ndim == 0:
|
||||||
mean, std, max, min = {}, {}, {}, {}
|
raise ValueError("Number of dimensions must be at least 1, and is 0 instead.")
|
||||||
for key in stats_patterns:
|
if k == "count" and v.shape != (1,):
|
||||||
mean[key] = torch.tensor(0.0).float()
|
raise ValueError(f"Shape of 'count' must be (1), but is {v.shape} instead.")
|
||||||
std[key] = torch.tensor(0.0).float()
|
if "image" in fkey and k != "count" and v.shape != (3, 1, 1):
|
||||||
max[key] = torch.tensor(-float("inf")).float()
|
raise ValueError(f"Shape of '{k}' must be (3,1,1), but is {v.shape} instead.")
|
||||||
min[key] = torch.tensor(float("inf")).float()
|
|
||||||
|
|
||||||
def create_seeded_dataloader(dataset, batch_size, seed):
|
|
||||||
generator = torch.Generator()
|
|
||||||
generator.manual_seed(seed)
|
|
||||||
dataloader = torch.utils.data.DataLoader(
|
|
||||||
dataset,
|
|
||||||
num_workers=num_workers,
|
|
||||||
batch_size=batch_size,
|
|
||||||
shuffle=True,
|
|
||||||
drop_last=False,
|
|
||||||
generator=generator,
|
|
||||||
)
|
|
||||||
return dataloader
|
|
||||||
|
|
||||||
# Note: Due to be refactored soon. The point of storing `first_batch` is to make sure we don't get
|
|
||||||
# surprises when rerunning the sampler.
|
|
||||||
first_batch = None
|
|
||||||
running_item_count = 0 # for online mean computation
|
|
||||||
dataloader = create_seeded_dataloader(dataset, batch_size, seed=1337)
|
|
||||||
for i, batch in enumerate(
|
|
||||||
tqdm.tqdm(dataloader, total=ceil(max_num_samples / batch_size), desc="Compute mean, min, max")
|
|
||||||
):
|
|
||||||
this_batch_size = len(batch["index"])
|
|
||||||
running_item_count += this_batch_size
|
|
||||||
if first_batch is None:
|
|
||||||
first_batch = deepcopy(batch)
|
|
||||||
for key, pattern in stats_patterns.items():
|
|
||||||
batch[key] = batch[key].float()
|
|
||||||
# Numerically stable update step for mean computation.
|
|
||||||
batch_mean = einops.reduce(batch[key], pattern, "mean")
|
|
||||||
# Hint: to update the mean we need x̄ₙ = (Nₙ₋₁x̄ₙ₋₁ + Bₙxₙ) / Nₙ, where the subscript represents
|
|
||||||
# the update step, N is the running item count, B is this batch size, x̄ is the running mean,
|
|
||||||
# and x is the current batch mean. Some rearrangement is then required to avoid risking
|
|
||||||
# numerical overflow. Another hint: Nₙ₋₁ = Nₙ - Bₙ. Rearrangement yields
|
|
||||||
# x̄ₙ = x̄ₙ₋₁ + Bₙ * (xₙ - x̄ₙ₋₁) / Nₙ
|
|
||||||
mean[key] = mean[key] + this_batch_size * (batch_mean - mean[key]) / running_item_count
|
|
||||||
max[key] = torch.maximum(max[key], einops.reduce(batch[key], pattern, "max"))
|
|
||||||
min[key] = torch.minimum(min[key], einops.reduce(batch[key], pattern, "min"))
|
|
||||||
|
|
||||||
if i == ceil(max_num_samples / batch_size) - 1:
|
|
||||||
break
|
|
||||||
|
|
||||||
first_batch_ = None
|
|
||||||
running_item_count = 0 # for online std computation
|
|
||||||
dataloader = create_seeded_dataloader(dataset, batch_size, seed=1337)
|
|
||||||
for i, batch in enumerate(
|
|
||||||
tqdm.tqdm(dataloader, total=ceil(max_num_samples / batch_size), desc="Compute std")
|
|
||||||
):
|
|
||||||
this_batch_size = len(batch["index"])
|
|
||||||
running_item_count += this_batch_size
|
|
||||||
# Sanity check to make sure the batches are still in the same order as before.
|
|
||||||
if first_batch_ is None:
|
|
||||||
first_batch_ = deepcopy(batch)
|
|
||||||
for key in stats_patterns:
|
|
||||||
assert torch.equal(first_batch_[key], first_batch[key])
|
|
||||||
for key, pattern in stats_patterns.items():
|
|
||||||
batch[key] = batch[key].float()
|
|
||||||
# Numerically stable update step for mean computation (where the mean is over squared
|
|
||||||
# residuals).See notes in the mean computation loop above.
|
|
||||||
batch_std = einops.reduce((batch[key] - mean[key]) ** 2, pattern, "mean")
|
|
||||||
std[key] = std[key] + this_batch_size * (batch_std - std[key]) / running_item_count
|
|
||||||
|
|
||||||
if i == ceil(max_num_samples / batch_size) - 1:
|
|
||||||
break
|
|
||||||
|
|
||||||
for key in stats_patterns:
|
|
||||||
std[key] = torch.sqrt(std[key])
|
|
||||||
|
|
||||||
stats = {}
|
|
||||||
for key in stats_patterns:
|
|
||||||
stats[key] = {
|
|
||||||
"mean": mean[key],
|
|
||||||
"std": std[key],
|
|
||||||
"max": max[key],
|
|
||||||
"min": min[key],
|
|
||||||
}
|
|
||||||
return stats
|
|
||||||
|
|
||||||
|
|
||||||
def aggregate_stats(ls_datasets) -> dict[str, torch.Tensor]:
|
def aggregate_feature_stats(stats_ft_list: list[dict[str, dict]]) -> dict[str, dict[str, np.ndarray]]:
|
||||||
"""Aggregate stats of multiple LeRobot datasets into one set of stats without recomputing from scratch.
|
"""Aggregates stats for a single feature."""
|
||||||
|
means = np.stack([s["mean"] for s in stats_ft_list])
|
||||||
|
variances = np.stack([s["std"] ** 2 for s in stats_ft_list])
|
||||||
|
counts = np.stack([s["count"] for s in stats_ft_list])
|
||||||
|
total_count = counts.sum(axis=0)
|
||||||
|
|
||||||
The final stats will have the union of all data keys from each of the datasets.
|
# Prepare weighted mean by matching number of dimensions
|
||||||
|
while counts.ndim < means.ndim:
|
||||||
|
counts = np.expand_dims(counts, axis=-1)
|
||||||
|
|
||||||
The final stats will have the union of all data keys from each of the datasets. For instance:
|
# Compute the weighted mean
|
||||||
- new_max = max(max_dataset_0, max_dataset_1, ...)
|
weighted_means = means * counts
|
||||||
|
total_mean = weighted_means.sum(axis=0) / total_count
|
||||||
|
|
||||||
|
# Compute the variance using the parallel algorithm
|
||||||
|
delta_means = means - total_mean
|
||||||
|
weighted_variances = (variances + delta_means**2) * counts
|
||||||
|
total_variance = weighted_variances.sum(axis=0) / total_count
|
||||||
|
|
||||||
|
return {
|
||||||
|
"min": np.min(np.stack([s["min"] for s in stats_ft_list]), axis=0),
|
||||||
|
"max": np.max(np.stack([s["max"] for s in stats_ft_list]), axis=0),
|
||||||
|
"mean": total_mean,
|
||||||
|
"std": np.sqrt(total_variance),
|
||||||
|
"count": total_count,
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def aggregate_stats(stats_list: list[dict[str, dict]]) -> dict[str, dict[str, np.ndarray]]:
|
||||||
|
"""Aggregate stats from multiple compute_stats outputs into a single set of stats.
|
||||||
|
|
||||||
|
The final stats will have the union of all data keys from each of the stats dicts.
|
||||||
|
|
||||||
|
For instance:
|
||||||
- new_min = min(min_dataset_0, min_dataset_1, ...)
|
- new_min = min(min_dataset_0, min_dataset_1, ...)
|
||||||
- new_mean = (mean of all data)
|
- new_max = max(max_dataset_0, max_dataset_1, ...)
|
||||||
|
- new_mean = (mean of all data, weighted by counts)
|
||||||
- new_std = (std of all data)
|
- new_std = (std of all data)
|
||||||
"""
|
"""
|
||||||
data_keys = set()
|
|
||||||
for dataset in ls_datasets:
|
_assert_type_and_shape(stats_list)
|
||||||
data_keys.update(dataset.stats.keys())
|
|
||||||
stats = {k: {} for k in data_keys}
|
data_keys = {key for stats in stats_list for key in stats}
|
||||||
for data_key in data_keys:
|
aggregated_stats = {key: {} for key in data_keys}
|
||||||
for stat_key in ["min", "max"]:
|
|
||||||
# compute `max(dataset_0["max"], dataset_1["max"], ...)`
|
for key in data_keys:
|
||||||
stats[data_key][stat_key] = einops.reduce(
|
stats_with_key = [stats[key] for stats in stats_list if key in stats]
|
||||||
torch.stack([d.stats[data_key][stat_key] for d in ls_datasets if data_key in d.stats], dim=0),
|
aggregated_stats[key] = aggregate_feature_stats(stats_with_key)
|
||||||
"n ... -> ...",
|
|
||||||
stat_key,
|
return aggregated_stats
|
||||||
)
|
|
||||||
total_samples = sum(d.num_samples for d in ls_datasets if data_key in d.stats)
|
|
||||||
# Compute the "sum" statistic by multiplying each mean by the number of samples in the respective
|
|
||||||
# dataset, then divide by total_samples to get the overall "mean".
|
|
||||||
# NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
|
|
||||||
# numerical overflow!
|
|
||||||
stats[data_key]["mean"] = sum(
|
|
||||||
d.stats[data_key]["mean"] * (d.num_samples / total_samples)
|
|
||||||
for d in ls_datasets
|
|
||||||
if data_key in d.stats
|
|
||||||
)
|
|
||||||
# The derivation for standard deviation is a little more involved but is much in the same spirit as
|
|
||||||
# the computation of the mean.
|
|
||||||
# Given two sets of data where the statistics are known:
|
|
||||||
# σ_combined = sqrt[ (n1 * (σ1^2 + d1^2) + n2 * (σ2^2 + d2^2)) / (n1 + n2) ]
|
|
||||||
# where d1 = μ1 - μ_combined, d2 = μ2 - μ_combined
|
|
||||||
# NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
|
|
||||||
# numerical overflow!
|
|
||||||
stats[data_key]["std"] = torch.sqrt(
|
|
||||||
sum(
|
|
||||||
(d.stats[data_key]["std"] ** 2 + (d.stats[data_key]["mean"] - stats[data_key]["mean"]) ** 2)
|
|
||||||
* (d.num_samples / total_samples)
|
|
||||||
for d in ls_datasets
|
|
||||||
if data_key in d.stats
|
|
||||||
)
|
|
||||||
)
|
|
||||||
return stats
|
|
||||||
|
|||||||
@@ -14,104 +14,105 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
import logging
|
import logging
|
||||||
|
from pprint import pformat
|
||||||
|
|
||||||
import torch
|
import torch
|
||||||
from omegaconf import ListConfig, OmegaConf
|
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, MultiLeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import (
|
||||||
from lerobot.common.datasets.transforms import get_image_transforms
|
LeRobotDataset,
|
||||||
|
LeRobotDatasetMetadata,
|
||||||
|
MultiLeRobotDataset,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.transforms import ImageTransforms
|
||||||
|
from lerobot.configs.policies import PreTrainedConfig
|
||||||
|
from lerobot.configs.train import TrainPipelineConfig
|
||||||
|
|
||||||
|
IMAGENET_STATS = {
|
||||||
|
"mean": [[[0.485]], [[0.456]], [[0.406]]], # (c,1,1)
|
||||||
|
"std": [[[0.229]], [[0.224]], [[0.225]]], # (c,1,1)
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
def resolve_delta_timestamps(cfg):
|
def resolve_delta_timestamps(
|
||||||
"""Resolves delta_timestamps config key (in-place) by using `eval`.
|
cfg: PreTrainedConfig, ds_meta: LeRobotDatasetMetadata
|
||||||
|
) -> dict[str, list] | None:
|
||||||
|
"""Resolves delta_timestamps by reading from the 'delta_indices' properties of the PreTrainedConfig.
|
||||||
|
|
||||||
Doesn't do anything if delta_timestamps is not specified or has already been resolve (as evidenced by
|
|
||||||
the data type of its values).
|
|
||||||
"""
|
|
||||||
delta_timestamps = cfg.training.get("delta_timestamps")
|
|
||||||
if delta_timestamps is not None:
|
|
||||||
for key in delta_timestamps:
|
|
||||||
if isinstance(delta_timestamps[key], str):
|
|
||||||
# TODO(rcadene, alexander-soare): remove `eval` to avoid exploit
|
|
||||||
cfg.training.delta_timestamps[key] = eval(delta_timestamps[key])
|
|
||||||
|
|
||||||
|
|
||||||
def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotDataset:
|
|
||||||
"""
|
|
||||||
Args:
|
Args:
|
||||||
cfg: A Hydra config as per the LeRobot config scheme.
|
cfg (PreTrainedConfig): The PreTrainedConfig to read delta_indices from.
|
||||||
split: Select the data subset used to create an instance of LeRobotDataset.
|
ds_meta (LeRobotDatasetMetadata): The dataset from which features and fps are used to build
|
||||||
All datasets hosted on [lerobot](https://huggingface.co/lerobot) contain only one subset: "train".
|
delta_timestamps against.
|
||||||
Thus, by default, `split="train"` selects all the available data. `split` aims to work like the
|
|
||||||
slicer in the hugging face datasets:
|
|
||||||
https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
|
|
||||||
As of now, it only supports `split="train[:n]"` to load the first n frames of the dataset or
|
|
||||||
`split="train[n:]"` to load the last n frames. For instance `split="train[:1000]"`.
|
|
||||||
Returns:
|
Returns:
|
||||||
The LeRobotDataset.
|
dict[str, list] | None: A dictionary of delta_timestamps, e.g.:
|
||||||
|
{
|
||||||
|
"observation.state": [-0.04, -0.02, 0]
|
||||||
|
"observation.action": [-0.02, 0, 0.02]
|
||||||
|
}
|
||||||
|
returns `None` if the the resulting dict is empty.
|
||||||
"""
|
"""
|
||||||
if not isinstance(cfg.dataset_repo_id, (str, ListConfig)):
|
delta_timestamps = {}
|
||||||
raise ValueError(
|
for key in ds_meta.features:
|
||||||
"Expected cfg.dataset_repo_id to be either a single string to load one dataset or a list of "
|
if key == "next.reward" and cfg.reward_delta_indices is not None:
|
||||||
"strings to load multiple datasets."
|
delta_timestamps[key] = [i / ds_meta.fps for i in cfg.reward_delta_indices]
|
||||||
|
if key == "action" and cfg.action_delta_indices is not None:
|
||||||
|
delta_timestamps[key] = [i / ds_meta.fps for i in cfg.action_delta_indices]
|
||||||
|
if key.startswith("observation.") and cfg.observation_delta_indices is not None:
|
||||||
|
delta_timestamps[key] = [i / ds_meta.fps for i in cfg.observation_delta_indices]
|
||||||
|
|
||||||
|
if len(delta_timestamps) == 0:
|
||||||
|
delta_timestamps = None
|
||||||
|
|
||||||
|
return delta_timestamps
|
||||||
|
|
||||||
|
|
||||||
|
def make_dataset(cfg: TrainPipelineConfig) -> LeRobotDataset | MultiLeRobotDataset:
|
||||||
|
"""Handles the logic of setting up delta timestamps and image transforms before creating a dataset.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
cfg (TrainPipelineConfig): A TrainPipelineConfig config which contains a DatasetConfig and a PreTrainedConfig.
|
||||||
|
|
||||||
|
Raises:
|
||||||
|
NotImplementedError: The MultiLeRobotDataset is currently deactivated.
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
LeRobotDataset | MultiLeRobotDataset
|
||||||
|
"""
|
||||||
|
image_transforms = (
|
||||||
|
ImageTransforms(cfg.dataset.image_transforms) if cfg.dataset.image_transforms.enable else None
|
||||||
|
)
|
||||||
|
|
||||||
|
if isinstance(cfg.dataset.repo_id, str):
|
||||||
|
ds_meta = LeRobotDatasetMetadata(
|
||||||
|
cfg.dataset.repo_id, root=cfg.dataset.root, revision=cfg.dataset.revision
|
||||||
)
|
)
|
||||||
|
delta_timestamps = resolve_delta_timestamps(cfg.policy, ds_meta)
|
||||||
# A soft check to warn if the environment matches the dataset. Don't check if we are using a real world env (dora).
|
|
||||||
if cfg.env.name != "dora":
|
|
||||||
if isinstance(cfg.dataset_repo_id, str):
|
|
||||||
dataset_repo_ids = [cfg.dataset_repo_id] # single dataset
|
|
||||||
else:
|
|
||||||
dataset_repo_ids = cfg.dataset_repo_id # multiple datasets
|
|
||||||
|
|
||||||
for dataset_repo_id in dataset_repo_ids:
|
|
||||||
if cfg.env.name not in dataset_repo_id:
|
|
||||||
logging.warning(
|
|
||||||
f"There might be a mismatch between your training dataset ({dataset_repo_id=}) and your "
|
|
||||||
f"environment ({cfg.env.name=})."
|
|
||||||
)
|
|
||||||
|
|
||||||
resolve_delta_timestamps(cfg)
|
|
||||||
|
|
||||||
image_transforms = None
|
|
||||||
if cfg.training.image_transforms.enable:
|
|
||||||
cfg_tf = cfg.training.image_transforms
|
|
||||||
image_transforms = get_image_transforms(
|
|
||||||
brightness_weight=cfg_tf.brightness.weight,
|
|
||||||
brightness_min_max=cfg_tf.brightness.min_max,
|
|
||||||
contrast_weight=cfg_tf.contrast.weight,
|
|
||||||
contrast_min_max=cfg_tf.contrast.min_max,
|
|
||||||
saturation_weight=cfg_tf.saturation.weight,
|
|
||||||
saturation_min_max=cfg_tf.saturation.min_max,
|
|
||||||
hue_weight=cfg_tf.hue.weight,
|
|
||||||
hue_min_max=cfg_tf.hue.min_max,
|
|
||||||
sharpness_weight=cfg_tf.sharpness.weight,
|
|
||||||
sharpness_min_max=cfg_tf.sharpness.min_max,
|
|
||||||
max_num_transforms=cfg_tf.max_num_transforms,
|
|
||||||
random_order=cfg_tf.random_order,
|
|
||||||
)
|
|
||||||
|
|
||||||
if isinstance(cfg.dataset_repo_id, str):
|
|
||||||
dataset = LeRobotDataset(
|
dataset = LeRobotDataset(
|
||||||
cfg.dataset_repo_id,
|
cfg.dataset.repo_id,
|
||||||
split=split,
|
root=cfg.dataset.root,
|
||||||
delta_timestamps=cfg.training.get("delta_timestamps"),
|
episodes=cfg.dataset.episodes,
|
||||||
|
delta_timestamps=delta_timestamps,
|
||||||
image_transforms=image_transforms,
|
image_transforms=image_transforms,
|
||||||
video_backend=cfg.video_backend,
|
revision=cfg.dataset.revision,
|
||||||
|
video_backend=cfg.dataset.video_backend,
|
||||||
)
|
)
|
||||||
else:
|
else:
|
||||||
|
raise NotImplementedError("The MultiLeRobotDataset isn't supported for now.")
|
||||||
dataset = MultiLeRobotDataset(
|
dataset = MultiLeRobotDataset(
|
||||||
cfg.dataset_repo_id,
|
cfg.dataset.repo_id,
|
||||||
split=split,
|
# TODO(aliberts): add proper support for multi dataset
|
||||||
delta_timestamps=cfg.training.get("delta_timestamps"),
|
# delta_timestamps=delta_timestamps,
|
||||||
image_transforms=image_transforms,
|
image_transforms=image_transforms,
|
||||||
video_backend=cfg.video_backend,
|
video_backend=cfg.dataset.video_backend,
|
||||||
|
)
|
||||||
|
logging.info(
|
||||||
|
"Multiple datasets were provided. Applied the following index mapping to the provided datasets: "
|
||||||
|
f"{pformat(dataset.repo_id_to_index, indent=2)}"
|
||||||
)
|
)
|
||||||
|
|
||||||
if cfg.get("override_dataset_stats"):
|
if cfg.dataset.use_imagenet_stats:
|
||||||
for key, stats_dict in cfg.override_dataset_stats.items():
|
for key in dataset.meta.camera_keys:
|
||||||
for stats_type, listconfig in stats_dict.items():
|
for stats_type, stats in IMAGENET_STATS.items():
|
||||||
# example of stats_type: min, max, mean, std
|
dataset.meta.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
|
||||||
stats = OmegaConf.to_container(listconfig, resolve=True)
|
|
||||||
dataset.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
|
|
||||||
|
|
||||||
return dataset
|
return dataset
|
||||||
|
|||||||
178
lerobot/common/datasets/image_writer.py
Normal file
178
lerobot/common/datasets/image_writer.py
Normal file
@@ -0,0 +1,178 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
import multiprocessing
|
||||||
|
import queue
|
||||||
|
import threading
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import PIL.Image
|
||||||
|
import torch
|
||||||
|
|
||||||
|
|
||||||
|
def safe_stop_image_writer(func):
|
||||||
|
def wrapper(*args, **kwargs):
|
||||||
|
try:
|
||||||
|
return func(*args, **kwargs)
|
||||||
|
except Exception as e:
|
||||||
|
dataset = kwargs.get("dataset")
|
||||||
|
image_writer = getattr(dataset, "image_writer", None) if dataset else None
|
||||||
|
if image_writer is not None:
|
||||||
|
print("Waiting for image writer to terminate...")
|
||||||
|
image_writer.stop()
|
||||||
|
raise e
|
||||||
|
|
||||||
|
return wrapper
|
||||||
|
|
||||||
|
|
||||||
|
def image_array_to_pil_image(image_array: np.ndarray, range_check: bool = True) -> PIL.Image.Image:
|
||||||
|
# TODO(aliberts): handle 1 channel and 4 for depth images
|
||||||
|
if image_array.ndim != 3:
|
||||||
|
raise ValueError(f"The array has {image_array.ndim} dimensions, but 3 is expected for an image.")
|
||||||
|
|
||||||
|
if image_array.shape[0] == 3:
|
||||||
|
# Transpose from pytorch convention (C, H, W) to (H, W, C)
|
||||||
|
image_array = image_array.transpose(1, 2, 0)
|
||||||
|
|
||||||
|
elif image_array.shape[-1] != 3:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"The image has {image_array.shape[-1]} channels, but 3 is required for now."
|
||||||
|
)
|
||||||
|
|
||||||
|
if image_array.dtype != np.uint8:
|
||||||
|
if range_check:
|
||||||
|
max_ = image_array.max().item()
|
||||||
|
min_ = image_array.min().item()
|
||||||
|
if max_ > 1.0 or min_ < 0.0:
|
||||||
|
raise ValueError(
|
||||||
|
"The image data type is float, which requires values in the range [0.0, 1.0]. "
|
||||||
|
f"However, the provided range is [{min_}, {max_}]. Please adjust the range or "
|
||||||
|
"provide a uint8 image with values in the range [0, 255]."
|
||||||
|
)
|
||||||
|
|
||||||
|
image_array = (image_array * 255).astype(np.uint8)
|
||||||
|
|
||||||
|
return PIL.Image.fromarray(image_array)
|
||||||
|
|
||||||
|
|
||||||
|
def write_image(image: np.ndarray | PIL.Image.Image, fpath: Path):
|
||||||
|
try:
|
||||||
|
if isinstance(image, np.ndarray):
|
||||||
|
img = image_array_to_pil_image(image)
|
||||||
|
elif isinstance(image, PIL.Image.Image):
|
||||||
|
img = image
|
||||||
|
else:
|
||||||
|
raise TypeError(f"Unsupported image type: {type(image)}")
|
||||||
|
img.save(fpath)
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error writing image {fpath}: {e}")
|
||||||
|
|
||||||
|
|
||||||
|
def worker_thread_loop(queue: queue.Queue):
|
||||||
|
while True:
|
||||||
|
item = queue.get()
|
||||||
|
if item is None:
|
||||||
|
queue.task_done()
|
||||||
|
break
|
||||||
|
image_array, fpath = item
|
||||||
|
write_image(image_array, fpath)
|
||||||
|
queue.task_done()
|
||||||
|
|
||||||
|
|
||||||
|
def worker_process(queue: queue.Queue, num_threads: int):
|
||||||
|
threads = []
|
||||||
|
for _ in range(num_threads):
|
||||||
|
t = threading.Thread(target=worker_thread_loop, args=(queue,))
|
||||||
|
t.daemon = True
|
||||||
|
t.start()
|
||||||
|
threads.append(t)
|
||||||
|
for t in threads:
|
||||||
|
t.join()
|
||||||
|
|
||||||
|
|
||||||
|
class AsyncImageWriter:
|
||||||
|
"""
|
||||||
|
This class abstract away the initialisation of processes or/and threads to
|
||||||
|
save images on disk asynchrounously, which is critical to control a robot and record data
|
||||||
|
at a high frame rate.
|
||||||
|
|
||||||
|
When `num_processes=0`, it creates a threads pool of size `num_threads`.
|
||||||
|
When `num_processes>0`, it creates processes pool of size `num_processes`, where each subprocess starts
|
||||||
|
their own threads pool of size `num_threads`.
|
||||||
|
|
||||||
|
The optimal number of processes and threads depends on your computer capabilities.
|
||||||
|
We advise to use 4 threads per camera with 0 processes. If the fps is not stable, try to increase or lower
|
||||||
|
the number of threads. If it is still not stable, try to use 1 subprocess, or more.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, num_processes: int = 0, num_threads: int = 1):
|
||||||
|
self.num_processes = num_processes
|
||||||
|
self.num_threads = num_threads
|
||||||
|
self.queue = None
|
||||||
|
self.threads = []
|
||||||
|
self.processes = []
|
||||||
|
self._stopped = False
|
||||||
|
|
||||||
|
if num_threads <= 0 and num_processes <= 0:
|
||||||
|
raise ValueError("Number of threads and processes must be greater than zero.")
|
||||||
|
|
||||||
|
if self.num_processes == 0:
|
||||||
|
# Use threading
|
||||||
|
self.queue = queue.Queue()
|
||||||
|
for _ in range(self.num_threads):
|
||||||
|
t = threading.Thread(target=worker_thread_loop, args=(self.queue,))
|
||||||
|
t.daemon = True
|
||||||
|
t.start()
|
||||||
|
self.threads.append(t)
|
||||||
|
else:
|
||||||
|
# Use multiprocessing
|
||||||
|
self.queue = multiprocessing.JoinableQueue()
|
||||||
|
for _ in range(self.num_processes):
|
||||||
|
p = multiprocessing.Process(target=worker_process, args=(self.queue, self.num_threads))
|
||||||
|
p.daemon = True
|
||||||
|
p.start()
|
||||||
|
self.processes.append(p)
|
||||||
|
|
||||||
|
def save_image(self, image: torch.Tensor | np.ndarray | PIL.Image.Image, fpath: Path):
|
||||||
|
if isinstance(image, torch.Tensor):
|
||||||
|
# Convert tensor to numpy array to minimize main process time
|
||||||
|
image = image.cpu().numpy()
|
||||||
|
self.queue.put((image, fpath))
|
||||||
|
|
||||||
|
def wait_until_done(self):
|
||||||
|
self.queue.join()
|
||||||
|
|
||||||
|
def stop(self):
|
||||||
|
if self._stopped:
|
||||||
|
return
|
||||||
|
|
||||||
|
if self.num_processes == 0:
|
||||||
|
for _ in self.threads:
|
||||||
|
self.queue.put(None)
|
||||||
|
for t in self.threads:
|
||||||
|
t.join()
|
||||||
|
else:
|
||||||
|
num_nones = self.num_processes * self.num_threads
|
||||||
|
for _ in range(num_nones):
|
||||||
|
self.queue.put(None)
|
||||||
|
for p in self.processes:
|
||||||
|
p.join()
|
||||||
|
if p.is_alive():
|
||||||
|
p.terminate()
|
||||||
|
self.queue.close()
|
||||||
|
self.queue.join_thread()
|
||||||
|
|
||||||
|
self._stopped = True
|
||||||
File diff suppressed because it is too large
Load Diff
@@ -187,7 +187,7 @@ class OnlineBuffer(torch.utils.data.Dataset):
|
|||||||
assert data[OnlineBuffer.INDEX_KEY][0].item() == 0
|
assert data[OnlineBuffer.INDEX_KEY][0].item() == 0
|
||||||
|
|
||||||
# Shift the incoming indices if necessary.
|
# Shift the incoming indices if necessary.
|
||||||
if self.num_samples > 0:
|
if self.num_frames > 0:
|
||||||
last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][next_index - 1]
|
last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][next_index - 1]
|
||||||
last_data_index = self._data[OnlineBuffer.INDEX_KEY][next_index - 1]
|
last_data_index = self._data[OnlineBuffer.INDEX_KEY][next_index - 1]
|
||||||
data[OnlineBuffer.EPISODE_INDEX_KEY] += last_episode_index + 1
|
data[OnlineBuffer.EPISODE_INDEX_KEY] += last_episode_index + 1
|
||||||
@@ -227,11 +227,11 @@ class OnlineBuffer(torch.utils.data.Dataset):
|
|||||||
)
|
)
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def num_samples(self) -> int:
|
def num_frames(self) -> int:
|
||||||
return np.count_nonzero(self._data[OnlineBuffer.OCCUPANCY_MASK_KEY])
|
return np.count_nonzero(self._data[OnlineBuffer.OCCUPANCY_MASK_KEY])
|
||||||
|
|
||||||
def __len__(self):
|
def __len__(self):
|
||||||
return self.num_samples
|
return self.num_frames
|
||||||
|
|
||||||
def _item_to_tensors(self, item: dict) -> dict:
|
def _item_to_tensors(self, item: dict) -> dict:
|
||||||
item_ = {}
|
item_ = {}
|
||||||
|
|||||||
@@ -1,56 +0,0 @@
|
|||||||
## Using / Updating `CODEBASE_VERSION` (for maintainers)
|
|
||||||
|
|
||||||
Since our dataset pushed to the hub are decoupled with the evolution of this repo, we ensure compatibility of
|
|
||||||
the datasets with our code, we use a `CODEBASE_VERSION` (defined in
|
|
||||||
lerobot/common/datasets/lerobot_dataset.py) variable.
|
|
||||||
|
|
||||||
For instance, [`lerobot/pusht`](https://huggingface.co/datasets/lerobot/pusht) has many versions to maintain backward compatibility between LeRobot codebase versions:
|
|
||||||
- [v1.0](https://huggingface.co/datasets/lerobot/pusht/tree/v1.0)
|
|
||||||
- [v1.1](https://huggingface.co/datasets/lerobot/pusht/tree/v1.1)
|
|
||||||
- [v1.2](https://huggingface.co/datasets/lerobot/pusht/tree/v1.2)
|
|
||||||
- [v1.3](https://huggingface.co/datasets/lerobot/pusht/tree/v1.3)
|
|
||||||
- [v1.4](https://huggingface.co/datasets/lerobot/pusht/tree/v1.4)
|
|
||||||
- [v1.5](https://huggingface.co/datasets/lerobot/pusht/tree/v1.5)
|
|
||||||
- [v1.6](https://huggingface.co/datasets/lerobot/pusht/tree/v1.6) <-- last version
|
|
||||||
- [main](https://huggingface.co/datasets/lerobot/pusht/tree/main) <-- points to the last version
|
|
||||||
|
|
||||||
Starting with v1.6, every dataset pushed to the hub or saved locally also have this version number in their
|
|
||||||
`info.json` metadata.
|
|
||||||
|
|
||||||
### Uploading a new dataset
|
|
||||||
If you are pushing a new dataset, you don't need to worry about any of the instructions below, nor to be
|
|
||||||
compatible with previous codebase versions. The `push_dataset_to_hub.py` script will automatically tag your
|
|
||||||
dataset with the current `CODEBASE_VERSION`.
|
|
||||||
|
|
||||||
### Updating an existing dataset
|
|
||||||
If you want to update an existing dataset, you need to change the `CODEBASE_VERSION` from `lerobot_dataset.py`
|
|
||||||
before running `push_dataset_to_hub.py`. This is especially useful if you introduce a breaking change
|
|
||||||
intentionally or not (i.e. something not backward compatible such as modifying the reward functions used,
|
|
||||||
deleting some frames at the end of an episode, etc.). That way, people running a previous version of the
|
|
||||||
codebase won't be affected by your change and backward compatibility is maintained.
|
|
||||||
|
|
||||||
However, you will need to update the version of ALL the other datasets so that they have the new
|
|
||||||
`CODEBASE_VERSION` as a branch in their hugging face dataset repository. Don't worry, there is an easy way
|
|
||||||
that doesn't require to run `push_dataset_to_hub.py`. You can just "branch-out" from the `main` branch on HF
|
|
||||||
dataset repo by running this script which corresponds to a `git checkout -b` (so no copy or upload needed):
|
|
||||||
|
|
||||||
```python
|
|
||||||
from huggingface_hub import HfApi
|
|
||||||
|
|
||||||
from lerobot import available_datasets
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
|
||||||
|
|
||||||
api = HfApi()
|
|
||||||
|
|
||||||
for repo_id in available_datasets:
|
|
||||||
dataset_info = api.list_repo_refs(repo_id, repo_type="dataset")
|
|
||||||
branches = [b.name for b in dataset_info.branches]
|
|
||||||
if CODEBASE_VERSION in branches:
|
|
||||||
print(f"{repo_id} already @{CODEBASE_VERSION}, skipping.")
|
|
||||||
continue
|
|
||||||
else:
|
|
||||||
# Now create a branch named after the new version by branching out from "main"
|
|
||||||
# which is expected to be the preceding version
|
|
||||||
api.create_branch(repo_id, repo_type="dataset", branch=CODEBASE_VERSION, revision="main")
|
|
||||||
print(f"{repo_id} successfully updated @{CODEBASE_VERSION}")
|
|
||||||
```
|
|
||||||
@@ -60,8 +60,8 @@ AVAILABLE_RAW_REPO_IDS = {
|
|||||||
"lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
|
"lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
|
"lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
|
"lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/pusht_raw": "pusht_zarr",
|
|
||||||
"lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
|
"lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
|
||||||
|
"lerobot-raw/pusht_raw": "pusht_zarr",
|
||||||
"lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
|
"lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
|
"lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
|
||||||
"lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
|
"lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
|
||||||
@@ -70,6 +70,74 @@ AVAILABLE_RAW_REPO_IDS = {
|
|||||||
"lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
|
"lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
|
||||||
"lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
|
"lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
|
||||||
"lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
|
"lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
|
||||||
|
"lerobot-raw/fractal20220817_data_raw": "openx_rlds.fractal20220817_data",
|
||||||
|
"lerobot-raw/kuka_raw": "openx_rlds.kuka",
|
||||||
|
"lerobot-raw/bridge_openx_raw": "openx_rlds.bridge_openx",
|
||||||
|
"lerobot-raw/taco_play_raw": "openx_rlds.taco_play",
|
||||||
|
"lerobot-raw/jaco_play_raw": "openx_rlds.jaco_play",
|
||||||
|
"lerobot-raw/berkeley_cable_routing_raw": "openx_rlds.berkeley_cable_routing",
|
||||||
|
"lerobot-raw/roboturk_raw": "openx_rlds.roboturk",
|
||||||
|
"lerobot-raw/nyu_door_opening_surprising_effectiveness_raw": "openx_rlds.nyu_door_opening_surprising_effectiveness",
|
||||||
|
"lerobot-raw/viola_raw": "openx_rlds.viola",
|
||||||
|
"lerobot-raw/berkeley_autolab_ur5_raw": "openx_rlds.berkeley_autolab_ur5",
|
||||||
|
"lerobot-raw/toto_raw": "openx_rlds.toto",
|
||||||
|
"lerobot-raw/language_table_raw": "openx_rlds.language_table",
|
||||||
|
"lerobot-raw/columbia_cairlab_pusht_real_raw": "openx_rlds.columbia_cairlab_pusht_real",
|
||||||
|
"lerobot-raw/stanford_kuka_multimodal_dataset_raw": "openx_rlds.stanford_kuka_multimodal_dataset",
|
||||||
|
"lerobot-raw/nyu_rot_dataset_raw": "openx_rlds.nyu_rot_dataset",
|
||||||
|
"lerobot-raw/io_ai_tech_raw": "openx_rlds.io_ai_tech",
|
||||||
|
"lerobot-raw/stanford_hydra_dataset_raw": "openx_rlds.stanford_hydra_dataset",
|
||||||
|
"lerobot-raw/austin_buds_dataset_raw": "openx_rlds.austin_buds_dataset",
|
||||||
|
"lerobot-raw/nyu_franka_play_dataset_raw": "openx_rlds.nyu_franka_play_dataset",
|
||||||
|
"lerobot-raw/maniskill_dataset_raw": "openx_rlds.maniskill_dataset",
|
||||||
|
"lerobot-raw/furniture_bench_dataset_raw": "openx_rlds.furniture_bench_dataset",
|
||||||
|
"lerobot-raw/cmu_franka_exploration_dataset_raw": "openx_rlds.cmu_franka_exploration_dataset",
|
||||||
|
"lerobot-raw/ucsd_kitchen_dataset_raw": "openx_rlds.ucsd_kitchen_dataset",
|
||||||
|
"lerobot-raw/ucsd_pick_and_place_dataset_raw": "openx_rlds.ucsd_pick_and_place_dataset",
|
||||||
|
"lerobot-raw/spoc_raw": "openx_rlds.spoc",
|
||||||
|
"lerobot-raw/austin_sailor_dataset_raw": "openx_rlds.austin_sailor_dataset",
|
||||||
|
"lerobot-raw/austin_sirius_dataset_raw": "openx_rlds.austin_sirius_dataset",
|
||||||
|
"lerobot-raw/bc_z_raw": "openx_rlds.bc_z",
|
||||||
|
"lerobot-raw/utokyo_pr2_opening_fridge_raw": "openx_rlds.utokyo_pr2_opening_fridge",
|
||||||
|
"lerobot-raw/utokyo_pr2_tabletop_manipulation_raw": "openx_rlds.utokyo_pr2_tabletop_manipulation",
|
||||||
|
"lerobot-raw/utokyo_xarm_pick_and_place_raw": "openx_rlds.utokyo_xarm_pick_and_place",
|
||||||
|
"lerobot-raw/utokyo_xarm_bimanual_raw": "openx_rlds.utokyo_xarm_bimanual",
|
||||||
|
"lerobot-raw/utokyo_saytap_raw": "openx_rlds.utokyo_saytap",
|
||||||
|
"lerobot-raw/robo_net_raw": "openx_rlds.robo_net",
|
||||||
|
"lerobot-raw/robo_set_raw": "openx_rlds.robo_set",
|
||||||
|
"lerobot-raw/berkeley_mvp_raw": "openx_rlds.berkeley_mvp",
|
||||||
|
"lerobot-raw/berkeley_rpt_raw": "openx_rlds.berkeley_rpt",
|
||||||
|
"lerobot-raw/kaist_nonprehensile_raw": "openx_rlds.kaist_nonprehensile",
|
||||||
|
"lerobot-raw/stanford_mask_vit_raw": "openx_rlds.stanford_mask_vit",
|
||||||
|
"lerobot-raw/tokyo_u_lsmo_raw": "openx_rlds.tokyo_u_lsmo",
|
||||||
|
"lerobot-raw/dlr_sara_pour_raw": "openx_rlds.dlr_sara_pour",
|
||||||
|
"lerobot-raw/dlr_sara_grid_clamp_raw": "openx_rlds.dlr_sara_grid_clamp",
|
||||||
|
"lerobot-raw/dlr_edan_shared_control_raw": "openx_rlds.dlr_edan_shared_control",
|
||||||
|
"lerobot-raw/asu_table_top_raw": "openx_rlds.asu_table_top",
|
||||||
|
"lerobot-raw/stanford_robocook_raw": "openx_rlds.stanford_robocook",
|
||||||
|
"lerobot-raw/imperialcollege_sawyer_wrist_cam_raw": "openx_rlds.imperialcollege_sawyer_wrist_cam",
|
||||||
|
"lerobot-raw/iamlab_cmu_pickup_insert_raw": "openx_rlds.iamlab_cmu_pickup_insert",
|
||||||
|
"lerobot-raw/uiuc_d3field_raw": "openx_rlds.uiuc_d3field",
|
||||||
|
"lerobot-raw/utaustin_mutex_raw": "openx_rlds.utaustin_mutex",
|
||||||
|
"lerobot-raw/berkeley_fanuc_manipulation_raw": "openx_rlds.berkeley_fanuc_manipulation",
|
||||||
|
"lerobot-raw/cmu_playing_with_food_raw": "openx_rlds.cmu_playing_with_food",
|
||||||
|
"lerobot-raw/cmu_play_fusion_raw": "openx_rlds.cmu_play_fusion",
|
||||||
|
"lerobot-raw/cmu_stretch_raw": "openx_rlds.cmu_stretch",
|
||||||
|
"lerobot-raw/berkeley_gnm_recon_raw": "openx_rlds.berkeley_gnm_recon",
|
||||||
|
"lerobot-raw/berkeley_gnm_cory_hall_raw": "openx_rlds.berkeley_gnm_cory_hall",
|
||||||
|
"lerobot-raw/berkeley_gnm_sac_son_raw": "openx_rlds.berkeley_gnm_sac_son",
|
||||||
|
"lerobot-raw/droid_raw": "openx_rlds.droid",
|
||||||
|
"lerobot-raw/droid_100_raw": "openx_rlds.droid100",
|
||||||
|
"lerobot-raw/fmb_raw": "openx_rlds.fmb",
|
||||||
|
"lerobot-raw/dobbe_raw": "openx_rlds.dobbe",
|
||||||
|
"lerobot-raw/usc_cloth_sim_raw": "openx_rlds.usc_cloth_sim",
|
||||||
|
"lerobot-raw/plex_robosuite_raw": "openx_rlds.plex_robosuite",
|
||||||
|
"lerobot-raw/conq_hose_manipulation_raw": "openx_rlds.conq_hose_manipulation",
|
||||||
|
"lerobot-raw/vima_raw": "openx_rlds.vima",
|
||||||
|
"lerobot-raw/robot_vqa_raw": "openx_rlds.robot_vqa",
|
||||||
|
"lerobot-raw/mimic_play_raw": "openx_rlds.mimic_play",
|
||||||
|
"lerobot-raw/tidybot_raw": "openx_rlds.tidybot",
|
||||||
|
"lerobot-raw/eth_agent_affordances_raw": "openx_rlds.eth_agent_affordances",
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -84,7 +152,7 @@ def download_raw(raw_dir: Path, repo_id: str):
|
|||||||
stacklevel=1,
|
stacklevel=1,
|
||||||
)
|
)
|
||||||
|
|
||||||
# Send warning if raw_dir isn't well formated
|
# Send warning if raw_dir isn't well formatted
|
||||||
if raw_dir.parts[-2] != user_id or raw_dir.parts[-1] != dataset_id:
|
if raw_dir.parts[-2] != user_id or raw_dir.parts[-1] != dataset_id:
|
||||||
warnings.warn(
|
warnings.warn(
|
||||||
f"""`raw_dir` ({raw_dir}) doesn't contain a community or user id `/` the name of the dataset that
|
f"""`raw_dir` ({raw_dir}) doesn't contain a community or user id `/` the name of the dataset that
|
||||||
@@ -110,7 +178,7 @@ def download_all_raw_datasets(data_dir: Path | None = None):
|
|||||||
def main():
|
def main():
|
||||||
parser = argparse.ArgumentParser(
|
parser = argparse.ArgumentParser(
|
||||||
description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
|
description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
|
||||||
non exhaustive list of available repositories to use in `--repo-id`: {AVAILABLE_RAW_REPO_IDS}""",
|
non exhaustive list of available repositories to use in `--repo-id`: {list(AVAILABLE_RAW_REPO_IDS.keys())}""",
|
||||||
)
|
)
|
||||||
|
|
||||||
parser.add_argument(
|
parser.add_argument(
|
||||||
|
|||||||
@@ -30,12 +30,12 @@ from PIL import Image as PILImage
|
|||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
concatenate_episodes,
|
concatenate_episodes,
|
||||||
get_default_encoding,
|
get_default_encoding,
|
||||||
save_images_concurrently,
|
save_images_concurrently,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|||||||
@@ -24,8 +24,11 @@ from datasets import Dataset, Features, Image, Value
|
|||||||
from PIL import Image as PILImage
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
from lerobot.common.datasets.utils import calculate_episode_data_index, hf_transform_to_torch
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.utils import hf_transform_to_torch
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame
|
from lerobot.common.datasets.video_utils import VideoFrame
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
@@ -26,8 +26,8 @@ import torch
|
|||||||
from datasets import Dataset, Features, Image, Sequence, Value
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import calculate_episode_data_index
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame
|
from lerobot.common.datasets.video_utils import VideoFrame
|
||||||
@@ -68,11 +68,11 @@ def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episod
|
|||||||
modality_df,
|
modality_df,
|
||||||
on="timestamp_utc",
|
on="timestamp_utc",
|
||||||
# "nearest" is the best option over "backward", since the latter can desynchronizes camera timestamps by
|
# "nearest" is the best option over "backward", since the latter can desynchronizes camera timestamps by
|
||||||
# matching timestamps that are too far appart, in order to fit the backward constraints. It's not the case for "nearest".
|
# matching timestamps that are too far apart, in order to fit the backward constraints. It's not the case for "nearest".
|
||||||
# However, note that "nearest" might synchronize the reference camera with other cameras on slightly future timestamps.
|
# However, note that "nearest" might synchronize the reference camera with other cameras on slightly future timestamps.
|
||||||
# are too far appart.
|
# are too far apart.
|
||||||
direction="nearest",
|
direction="nearest",
|
||||||
tolerance=pd.Timedelta(f"{1/fps} seconds"),
|
tolerance=pd.Timedelta(f"{1 / fps} seconds"),
|
||||||
)
|
)
|
||||||
# Remove rows with episode_index -1 which indicates data that correspond to in-between episodes
|
# Remove rows with episode_index -1 which indicates data that correspond to in-between episodes
|
||||||
df = df[df["episode_index"] != -1]
|
df = df[df["episode_index"] != -1]
|
||||||
@@ -126,7 +126,7 @@ def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episod
|
|||||||
videos_dir.parent.mkdir(parents=True, exist_ok=True)
|
videos_dir.parent.mkdir(parents=True, exist_ok=True)
|
||||||
videos_dir.symlink_to((raw_dir / "videos").absolute())
|
videos_dir.symlink_to((raw_dir / "videos").absolute())
|
||||||
|
|
||||||
# sanity check the video paths are well formated
|
# sanity check the video paths are well formatted
|
||||||
for key in df:
|
for key in df:
|
||||||
if "observation.images." not in key:
|
if "observation.images." not in key:
|
||||||
continue
|
continue
|
||||||
@@ -143,7 +143,7 @@ def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episod
|
|||||||
# it is the case for video_frame dictionary = [{"path": ..., "timestamp": ...}]
|
# it is the case for video_frame dictionary = [{"path": ..., "timestamp": ...}]
|
||||||
data_dict[key] = [video_frame[0] for video_frame in df[key].values]
|
data_dict[key] = [video_frame[0] for video_frame in df[key].values]
|
||||||
|
|
||||||
# sanity check the video path is well formated
|
# sanity check the video path is well formatted
|
||||||
video_path = videos_dir.parent / data_dict[key][0]["path"]
|
video_path = videos_dir.parent / data_dict[key][0]["path"]
|
||||||
if not video_path.exists():
|
if not video_path.exists():
|
||||||
raise ValueError(f"Video file not found in {video_path}")
|
raise ValueError(f"Video file not found in {video_path}")
|
||||||
|
|||||||
312
lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py
Normal file
312
lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py
Normal file
@@ -0,0 +1,312 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""
|
||||||
|
For all datasets in the RLDS format.
|
||||||
|
For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets.
|
||||||
|
|
||||||
|
NOTE: You need to install tensorflow and tensorflow_datasets before running this script.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
python lerobot/scripts/push_dataset_to_hub.py \
|
||||||
|
--raw-dir /path/to/data/bridge_dataset/1.0.0/ \
|
||||||
|
--repo-id your_hub/sampled_bridge_data_v2 \
|
||||||
|
--raw-format rlds \
|
||||||
|
--episodes 3 4 5 8 9
|
||||||
|
|
||||||
|
Exact dataset fps defined in openx/config.py, obtained from:
|
||||||
|
https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R
|
||||||
|
"""
|
||||||
|
|
||||||
|
import shutil
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import tensorflow as tf
|
||||||
|
import tensorflow_datasets as tfds
|
||||||
|
import torch
|
||||||
|
import tqdm
|
||||||
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
get_default_encoding,
|
||||||
|
save_images_concurrently,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.utils import (
|
||||||
|
hf_transform_to_torch,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|
||||||
|
np.set_printoptions(precision=2)
|
||||||
|
|
||||||
|
|
||||||
|
def tf_to_torch(data):
|
||||||
|
return torch.from_numpy(data.numpy())
|
||||||
|
|
||||||
|
|
||||||
|
def tf_img_convert(img):
|
||||||
|
if img.dtype == tf.string:
|
||||||
|
img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8)
|
||||||
|
elif img.dtype != tf.uint8:
|
||||||
|
raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}")
|
||||||
|
return img.numpy()
|
||||||
|
|
||||||
|
|
||||||
|
def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict:
|
||||||
|
"""
|
||||||
|
In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps"
|
||||||
|
entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the
|
||||||
|
trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`.
|
||||||
|
|
||||||
|
NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/
|
||||||
|
"""
|
||||||
|
steps = traj.pop("steps")
|
||||||
|
|
||||||
|
traj_len = tf.shape(tf.nest.flatten(steps)[0])[0]
|
||||||
|
|
||||||
|
# broadcast metadata to the length of the trajectory
|
||||||
|
metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj)
|
||||||
|
|
||||||
|
# put steps back in
|
||||||
|
assert "traj_metadata" not in steps
|
||||||
|
traj = {**steps, "traj_metadata": metadata}
|
||||||
|
|
||||||
|
assert "_len" not in traj
|
||||||
|
assert "_traj_index" not in traj
|
||||||
|
assert "_frame_index" not in traj
|
||||||
|
traj["_len"] = tf.repeat(traj_len, traj_len)
|
||||||
|
traj["_traj_index"] = tf.repeat(i, traj_len)
|
||||||
|
traj["_frame_index"] = tf.range(traj_len)
|
||||||
|
|
||||||
|
return traj
|
||||||
|
|
||||||
|
|
||||||
|
def load_from_raw(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int,
|
||||||
|
video: bool,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
raw_dir (Path): _description_
|
||||||
|
videos_dir (Path): _description_
|
||||||
|
fps (int): _description_
|
||||||
|
video (bool): _description_
|
||||||
|
episodes (list[int] | None, optional): _description_. Defaults to None.
|
||||||
|
"""
|
||||||
|
ds_builder = tfds.builder_from_directory(str(raw_dir))
|
||||||
|
dataset = ds_builder.as_dataset(
|
||||||
|
split="all",
|
||||||
|
decoders={"steps": tfds.decode.SkipDecoding()},
|
||||||
|
)
|
||||||
|
|
||||||
|
dataset_info = ds_builder.info
|
||||||
|
print("dataset_info: ", dataset_info)
|
||||||
|
|
||||||
|
ds_length = len(dataset)
|
||||||
|
dataset = dataset.take(ds_length)
|
||||||
|
# "flatten" the dataset as such we can apply trajectory level map() easily
|
||||||
|
# each [obs][key] has a shape of (frame_size, ...)
|
||||||
|
dataset = dataset.enumerate().map(_broadcast_metadata_rlds)
|
||||||
|
|
||||||
|
# we will apply the standardization transform if the dataset_name is provided
|
||||||
|
# if the dataset name is not provided and the goal is to convert any rlds formatted dataset
|
||||||
|
# search for 'image' keys in the observations
|
||||||
|
image_keys = []
|
||||||
|
state_keys = []
|
||||||
|
observation_info = dataset_info.features["steps"]["observation"]
|
||||||
|
for key in observation_info:
|
||||||
|
# check whether the key is for an image or a vector observation
|
||||||
|
if len(observation_info[key].shape) == 3:
|
||||||
|
# only adding uint8 images discards depth images
|
||||||
|
if observation_info[key].dtype == tf.uint8:
|
||||||
|
image_keys.append(key)
|
||||||
|
else:
|
||||||
|
state_keys.append(key)
|
||||||
|
|
||||||
|
lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None
|
||||||
|
|
||||||
|
print(" - image_keys: ", image_keys)
|
||||||
|
print(" - lang_key: ", lang_key)
|
||||||
|
|
||||||
|
it = iter(dataset)
|
||||||
|
|
||||||
|
ep_dicts = []
|
||||||
|
# Init temp path to save ep_dicts in case of crash
|
||||||
|
tmp_ep_dicts_dir = videos_dir.parent.joinpath("ep_dicts")
|
||||||
|
tmp_ep_dicts_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
# check if ep_dicts have already been saved in /tmp
|
||||||
|
starting_ep_idx = 0
|
||||||
|
saved_ep_dicts = [ep.__str__() for ep in tmp_ep_dicts_dir.iterdir()]
|
||||||
|
if len(saved_ep_dicts) > 0:
|
||||||
|
saved_ep_dicts.sort()
|
||||||
|
# get last ep_idx number
|
||||||
|
starting_ep_idx = int(saved_ep_dicts[-1][-13:-3]) + 1
|
||||||
|
for i in range(starting_ep_idx):
|
||||||
|
episode = next(it)
|
||||||
|
ep_dicts.append(torch.load(saved_ep_dicts[i]))
|
||||||
|
|
||||||
|
# if we user specified episodes, skip the ones not in the list
|
||||||
|
if episodes is not None:
|
||||||
|
if ds_length == 0:
|
||||||
|
raise ValueError("No episodes found.")
|
||||||
|
# convert episodes index to sorted list
|
||||||
|
episodes = sorted(episodes)
|
||||||
|
|
||||||
|
for ep_idx in tqdm.tqdm(range(starting_ep_idx, ds_length)):
|
||||||
|
episode = next(it)
|
||||||
|
|
||||||
|
# if user specified episodes, skip the ones not in the list
|
||||||
|
if episodes is not None:
|
||||||
|
if len(episodes) == 0:
|
||||||
|
break
|
||||||
|
if ep_idx == episodes[0]:
|
||||||
|
# process this episode
|
||||||
|
print(" selecting episode idx: ", ep_idx)
|
||||||
|
episodes.pop(0)
|
||||||
|
else:
|
||||||
|
continue # skip
|
||||||
|
|
||||||
|
num_frames = episode["action"].shape[0]
|
||||||
|
|
||||||
|
ep_dict = {}
|
||||||
|
for key in state_keys:
|
||||||
|
ep_dict[f"observation.{key}"] = tf_to_torch(episode["observation"][key])
|
||||||
|
|
||||||
|
ep_dict["action"] = tf_to_torch(episode["action"])
|
||||||
|
ep_dict["next.reward"] = tf_to_torch(episode["reward"]).float()
|
||||||
|
ep_dict["next.done"] = tf_to_torch(episode["is_last"])
|
||||||
|
ep_dict["is_terminal"] = tf_to_torch(episode["is_terminal"])
|
||||||
|
ep_dict["is_first"] = tf_to_torch(episode["is_first"])
|
||||||
|
ep_dict["discount"] = tf_to_torch(episode["discount"])
|
||||||
|
|
||||||
|
# If lang_key is present, convert the entire tensor at once
|
||||||
|
if lang_key is not None:
|
||||||
|
ep_dict["language_instruction"] = [x.numpy().decode("utf-8") for x in episode[lang_key]]
|
||||||
|
|
||||||
|
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||||
|
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
|
||||||
|
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||||
|
|
||||||
|
image_array_dict = {key: [] for key in image_keys}
|
||||||
|
|
||||||
|
for im_key in image_keys:
|
||||||
|
imgs = episode["observation"][im_key]
|
||||||
|
image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
|
||||||
|
|
||||||
|
# loop through all cameras
|
||||||
|
for im_key in image_keys:
|
||||||
|
img_key = f"observation.images.{im_key}"
|
||||||
|
imgs_array = image_array_dict[im_key]
|
||||||
|
imgs_array = np.array(imgs_array)
|
||||||
|
if video:
|
||||||
|
# save png images in temporary directory
|
||||||
|
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||||
|
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||||
|
|
||||||
|
# encode images to a mp4 video
|
||||||
|
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||||
|
video_path = videos_dir / fname
|
||||||
|
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||||
|
|
||||||
|
# clean temporary images directory
|
||||||
|
shutil.rmtree(tmp_imgs_dir)
|
||||||
|
|
||||||
|
# store the reference to the video frame
|
||||||
|
ep_dict[img_key] = [
|
||||||
|
{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||||
|
|
||||||
|
path_ep_dict = tmp_ep_dicts_dir.joinpath(
|
||||||
|
"ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt"
|
||||||
|
)
|
||||||
|
torch.save(ep_dict, path_ep_dict)
|
||||||
|
|
||||||
|
ep_dicts.append(ep_dict)
|
||||||
|
|
||||||
|
data_dict = concatenate_episodes(ep_dicts)
|
||||||
|
|
||||||
|
total_frames = data_dict["frame_index"].shape[0]
|
||||||
|
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||||
|
return data_dict
|
||||||
|
|
||||||
|
|
||||||
|
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||||
|
features = {}
|
||||||
|
|
||||||
|
for key in data_dict:
|
||||||
|
# check if vector state obs
|
||||||
|
if key.startswith("observation.") and "observation.images." not in key:
|
||||||
|
features[key] = Sequence(length=data_dict[key].shape[1], feature=Value(dtype="float32", id=None))
|
||||||
|
# check if image obs
|
||||||
|
elif "observation.images." in key:
|
||||||
|
if video:
|
||||||
|
features[key] = VideoFrame()
|
||||||
|
else:
|
||||||
|
features[key] = Image()
|
||||||
|
|
||||||
|
if "language_instruction" in data_dict:
|
||||||
|
features["language_instruction"] = Value(dtype="string", id=None)
|
||||||
|
|
||||||
|
features["action"] = Sequence(
|
||||||
|
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||||
|
)
|
||||||
|
|
||||||
|
features["is_terminal"] = Value(dtype="bool", id=None)
|
||||||
|
features["is_first"] = Value(dtype="bool", id=None)
|
||||||
|
features["discount"] = Value(dtype="float32", id=None)
|
||||||
|
|
||||||
|
features["episode_index"] = Value(dtype="int64", id=None)
|
||||||
|
features["frame_index"] = Value(dtype="int64", id=None)
|
||||||
|
features["timestamp"] = Value(dtype="float32", id=None)
|
||||||
|
features["next.reward"] = Value(dtype="float32", id=None)
|
||||||
|
features["next.done"] = Value(dtype="bool", id=None)
|
||||||
|
features["index"] = Value(dtype="int64", id=None)
|
||||||
|
|
||||||
|
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||||
|
hf_dataset.set_transform(hf_transform_to_torch)
|
||||||
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
|
def from_raw_to_lerobot_format(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int | None = None,
|
||||||
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
|
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||||
|
hf_dataset = to_hf_dataset(data_dict, video)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
|
"fps": fps,
|
||||||
|
"video": video,
|
||||||
|
}
|
||||||
|
if video:
|
||||||
|
info["encoding"] = get_default_encoding()
|
||||||
|
|
||||||
|
return hf_dataset, episode_data_index, info
|
||||||
@@ -27,12 +27,12 @@ from PIL import Image as PILImage
|
|||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
concatenate_episodes,
|
concatenate_episodes,
|
||||||
get_default_encoding,
|
get_default_encoding,
|
||||||
save_images_concurrently,
|
save_images_concurrently,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|||||||
@@ -28,12 +28,12 @@ from PIL import Image as PILImage
|
|||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
|
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
concatenate_episodes,
|
concatenate_episodes,
|
||||||
get_default_encoding,
|
get_default_encoding,
|
||||||
save_images_concurrently,
|
save_images_concurrently,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|||||||
@@ -16,7 +16,9 @@
|
|||||||
import inspect
|
import inspect
|
||||||
from concurrent.futures import ThreadPoolExecutor
|
from concurrent.futures import ThreadPoolExecutor
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
from typing import Dict
|
||||||
|
|
||||||
|
import datasets
|
||||||
import numpy
|
import numpy
|
||||||
import PIL
|
import PIL
|
||||||
import torch
|
import torch
|
||||||
@@ -72,3 +74,58 @@ def check_repo_id(repo_id: str) -> None:
|
|||||||
f"""`repo_id` is expected to contain a community or user id `/` the name of the dataset
|
f"""`repo_id` is expected to contain a community or user id `/` the name of the dataset
|
||||||
(e.g. 'lerobot/pusht'), but contains '{repo_id}'."""
|
(e.g. 'lerobot/pusht'), but contains '{repo_id}'."""
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
|
# TODO(aliberts): remove
|
||||||
|
def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torch.Tensor]:
|
||||||
|
"""
|
||||||
|
Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
|
||||||
|
|
||||||
|
Parameters:
|
||||||
|
- hf_dataset (datasets.Dataset): A HuggingFace dataset containing the episode index.
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
- episode_data_index: A dictionary containing the data index for each episode. The dictionary has two keys:
|
||||||
|
- "from": A tensor containing the starting index of each episode.
|
||||||
|
- "to": A tensor containing the ending index of each episode.
|
||||||
|
"""
|
||||||
|
episode_data_index = {"from": [], "to": []}
|
||||||
|
|
||||||
|
current_episode = None
|
||||||
|
"""
|
||||||
|
The episode_index is a list of integers, each representing the episode index of the corresponding example.
|
||||||
|
For instance, the following is a valid episode_index:
|
||||||
|
[0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 2]
|
||||||
|
|
||||||
|
Below, we iterate through the episode_index and populate the episode_data_index dictionary with the starting and
|
||||||
|
ending index of each episode. For the episode_index above, the episode_data_index dictionary will look like this:
|
||||||
|
{
|
||||||
|
"from": [0, 3, 7],
|
||||||
|
"to": [3, 7, 12]
|
||||||
|
}
|
||||||
|
"""
|
||||||
|
if len(hf_dataset) == 0:
|
||||||
|
episode_data_index = {
|
||||||
|
"from": torch.tensor([]),
|
||||||
|
"to": torch.tensor([]),
|
||||||
|
}
|
||||||
|
return episode_data_index
|
||||||
|
for idx, episode_idx in enumerate(hf_dataset["episode_index"]):
|
||||||
|
if episode_idx != current_episode:
|
||||||
|
# We encountered a new episode, so we append its starting location to the "from" list
|
||||||
|
episode_data_index["from"].append(idx)
|
||||||
|
# If this is not the first episode, we append the ending location of the previous episode to the "to" list
|
||||||
|
if current_episode is not None:
|
||||||
|
episode_data_index["to"].append(idx)
|
||||||
|
# Let's keep track of the current episode index
|
||||||
|
current_episode = episode_idx
|
||||||
|
else:
|
||||||
|
# We are still in the same episode, so there is nothing for us to do here
|
||||||
|
pass
|
||||||
|
# We have reached the end of the dataset, so we append the ending location of the last episode to the "to" list
|
||||||
|
episode_data_index["to"].append(idx + 1)
|
||||||
|
|
||||||
|
for k in ["from", "to"]:
|
||||||
|
episode_data_index[k] = torch.tensor(episode_data_index[k])
|
||||||
|
|
||||||
|
return episode_data_index
|
||||||
|
|||||||
@@ -27,12 +27,12 @@ from PIL import Image as PILImage
|
|||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
concatenate_episodes,
|
concatenate_episodes,
|
||||||
get_default_encoding,
|
get_default_encoding,
|
||||||
save_images_concurrently,
|
save_images_concurrently,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
calculate_episode_data_index,
|
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|||||||
@@ -14,7 +14,8 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
import collections
|
import collections
|
||||||
from typing import Any, Callable, Dict, Sequence
|
from dataclasses import dataclass, field
|
||||||
|
from typing import Any, Callable, Sequence
|
||||||
|
|
||||||
import torch
|
import torch
|
||||||
from torchvision.transforms import v2
|
from torchvision.transforms import v2
|
||||||
@@ -65,6 +66,8 @@ class RandomSubsetApply(Transform):
|
|||||||
self.n_subset = n_subset
|
self.n_subset = n_subset
|
||||||
self.random_order = random_order
|
self.random_order = random_order
|
||||||
|
|
||||||
|
self.selected_transforms = None
|
||||||
|
|
||||||
def forward(self, *inputs: Any) -> Any:
|
def forward(self, *inputs: Any) -> Any:
|
||||||
needs_unpacking = len(inputs) > 1
|
needs_unpacking = len(inputs) > 1
|
||||||
|
|
||||||
@@ -72,9 +75,9 @@ class RandomSubsetApply(Transform):
|
|||||||
if not self.random_order:
|
if not self.random_order:
|
||||||
selected_indices = selected_indices.sort().values
|
selected_indices = selected_indices.sort().values
|
||||||
|
|
||||||
selected_transforms = [self.transforms[i] for i in selected_indices]
|
self.selected_transforms = [self.transforms[i] for i in selected_indices]
|
||||||
|
|
||||||
for transform in selected_transforms:
|
for transform in self.selected_transforms:
|
||||||
outputs = transform(*inputs)
|
outputs = transform(*inputs)
|
||||||
inputs = outputs if needs_unpacking else (outputs,)
|
inputs = outputs if needs_unpacking else (outputs,)
|
||||||
|
|
||||||
@@ -129,69 +132,118 @@ class SharpnessJitter(Transform):
|
|||||||
|
|
||||||
return float(sharpness[0]), float(sharpness[1])
|
return float(sharpness[0]), float(sharpness[1])
|
||||||
|
|
||||||
def _generate_value(self, left: float, right: float) -> float:
|
def make_params(self, flat_inputs: list[Any]) -> dict[str, Any]:
|
||||||
return torch.empty(1).uniform_(left, right).item()
|
sharpness_factor = torch.empty(1).uniform_(self.sharpness[0], self.sharpness[1]).item()
|
||||||
|
return {"sharpness_factor": sharpness_factor}
|
||||||
|
|
||||||
def _transform(self, inpt: Any, params: Dict[str, Any]) -> Any:
|
def transform(self, inpt: Any, params: dict[str, Any]) -> Any:
|
||||||
sharpness_factor = self._generate_value(self.sharpness[0], self.sharpness[1])
|
sharpness_factor = params["sharpness_factor"]
|
||||||
return self._call_kernel(F.adjust_sharpness, inpt, sharpness_factor=sharpness_factor)
|
return self._call_kernel(F.adjust_sharpness, inpt, sharpness_factor=sharpness_factor)
|
||||||
|
|
||||||
|
|
||||||
def get_image_transforms(
|
@dataclass
|
||||||
brightness_weight: float = 1.0,
|
class ImageTransformConfig:
|
||||||
brightness_min_max: tuple[float, float] | None = None,
|
"""
|
||||||
contrast_weight: float = 1.0,
|
For each transform, the following parameters are available:
|
||||||
contrast_min_max: tuple[float, float] | None = None,
|
weight: This represents the multinomial probability (with no replacement)
|
||||||
saturation_weight: float = 1.0,
|
used for sampling the transform. If the sum of the weights is not 1,
|
||||||
saturation_min_max: tuple[float, float] | None = None,
|
they will be normalized.
|
||||||
hue_weight: float = 1.0,
|
type: The name of the class used. This is either a class available under torchvision.transforms.v2 or a
|
||||||
hue_min_max: tuple[float, float] | None = None,
|
custom transform defined here.
|
||||||
sharpness_weight: float = 1.0,
|
kwargs: Lower & upper bound respectively used for sampling the transform's parameter
|
||||||
sharpness_min_max: tuple[float, float] | None = None,
|
(following uniform distribution) when it's applied.
|
||||||
max_num_transforms: int | None = None,
|
"""
|
||||||
random_order: bool = False,
|
|
||||||
):
|
|
||||||
def check_value(name, weight, min_max):
|
|
||||||
if min_max is not None:
|
|
||||||
if len(min_max) != 2:
|
|
||||||
raise ValueError(
|
|
||||||
f"`{name}_min_max` is expected to be a tuple of 2 dimensions, but {min_max} provided."
|
|
||||||
)
|
|
||||||
if weight < 0.0:
|
|
||||||
raise ValueError(
|
|
||||||
f"`{name}_weight` is expected to be 0 or positive, but is negative ({weight})."
|
|
||||||
)
|
|
||||||
|
|
||||||
check_value("brightness", brightness_weight, brightness_min_max)
|
weight: float = 1.0
|
||||||
check_value("contrast", contrast_weight, contrast_min_max)
|
type: str = "Identity"
|
||||||
check_value("saturation", saturation_weight, saturation_min_max)
|
kwargs: dict[str, Any] = field(default_factory=dict)
|
||||||
check_value("hue", hue_weight, hue_min_max)
|
|
||||||
check_value("sharpness", sharpness_weight, sharpness_min_max)
|
|
||||||
|
|
||||||
weights = []
|
|
||||||
transforms = []
|
|
||||||
if brightness_min_max is not None and brightness_weight > 0.0:
|
|
||||||
weights.append(brightness_weight)
|
|
||||||
transforms.append(v2.ColorJitter(brightness=brightness_min_max))
|
|
||||||
if contrast_min_max is not None and contrast_weight > 0.0:
|
|
||||||
weights.append(contrast_weight)
|
|
||||||
transforms.append(v2.ColorJitter(contrast=contrast_min_max))
|
|
||||||
if saturation_min_max is not None and saturation_weight > 0.0:
|
|
||||||
weights.append(saturation_weight)
|
|
||||||
transforms.append(v2.ColorJitter(saturation=saturation_min_max))
|
|
||||||
if hue_min_max is not None and hue_weight > 0.0:
|
|
||||||
weights.append(hue_weight)
|
|
||||||
transforms.append(v2.ColorJitter(hue=hue_min_max))
|
|
||||||
if sharpness_min_max is not None and sharpness_weight > 0.0:
|
|
||||||
weights.append(sharpness_weight)
|
|
||||||
transforms.append(SharpnessJitter(sharpness=sharpness_min_max))
|
|
||||||
|
|
||||||
n_subset = len(transforms)
|
@dataclass
|
||||||
if max_num_transforms is not None:
|
class ImageTransformsConfig:
|
||||||
n_subset = min(n_subset, max_num_transforms)
|
"""
|
||||||
|
These transforms are all using standard torchvision.transforms.v2
|
||||||
|
You can find out how these transformations affect images here:
|
||||||
|
https://pytorch.org/vision/0.18/auto_examples/transforms/plot_transforms_illustrations.html
|
||||||
|
We use a custom RandomSubsetApply container to sample them.
|
||||||
|
"""
|
||||||
|
|
||||||
if n_subset == 0:
|
# Set this flag to `true` to enable transforms during training
|
||||||
return v2.Identity()
|
enable: bool = False
|
||||||
|
# This is the maximum number of transforms (sampled from these below) that will be applied to each frame.
|
||||||
|
# It's an integer in the interval [1, number_of_available_transforms].
|
||||||
|
max_num_transforms: int = 3
|
||||||
|
# By default, transforms are applied in Torchvision's suggested order (shown below).
|
||||||
|
# Set this to True to apply them in a random order.
|
||||||
|
random_order: bool = False
|
||||||
|
tfs: dict[str, ImageTransformConfig] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"brightness": ImageTransformConfig(
|
||||||
|
weight=1.0,
|
||||||
|
type="ColorJitter",
|
||||||
|
kwargs={"brightness": (0.8, 1.2)},
|
||||||
|
),
|
||||||
|
"contrast": ImageTransformConfig(
|
||||||
|
weight=1.0,
|
||||||
|
type="ColorJitter",
|
||||||
|
kwargs={"contrast": (0.8, 1.2)},
|
||||||
|
),
|
||||||
|
"saturation": ImageTransformConfig(
|
||||||
|
weight=1.0,
|
||||||
|
type="ColorJitter",
|
||||||
|
kwargs={"saturation": (0.5, 1.5)},
|
||||||
|
),
|
||||||
|
"hue": ImageTransformConfig(
|
||||||
|
weight=1.0,
|
||||||
|
type="ColorJitter",
|
||||||
|
kwargs={"hue": (-0.05, 0.05)},
|
||||||
|
),
|
||||||
|
"sharpness": ImageTransformConfig(
|
||||||
|
weight=1.0,
|
||||||
|
type="SharpnessJitter",
|
||||||
|
kwargs={"sharpness": (0.5, 1.5)},
|
||||||
|
),
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def make_transform_from_config(cfg: ImageTransformConfig):
|
||||||
|
if cfg.type == "Identity":
|
||||||
|
return v2.Identity(**cfg.kwargs)
|
||||||
|
elif cfg.type == "ColorJitter":
|
||||||
|
return v2.ColorJitter(**cfg.kwargs)
|
||||||
|
elif cfg.type == "SharpnessJitter":
|
||||||
|
return SharpnessJitter(**cfg.kwargs)
|
||||||
else:
|
else:
|
||||||
# TODO(rcadene, aliberts): add v2.ToDtype float16?
|
raise ValueError(f"Transform '{cfg.type}' is not valid.")
|
||||||
return RandomSubsetApply(transforms, p=weights, n_subset=n_subset, random_order=random_order)
|
|
||||||
|
|
||||||
|
class ImageTransforms(Transform):
|
||||||
|
"""A class to compose image transforms based on configuration."""
|
||||||
|
|
||||||
|
def __init__(self, cfg: ImageTransformsConfig) -> None:
|
||||||
|
super().__init__()
|
||||||
|
self._cfg = cfg
|
||||||
|
|
||||||
|
self.weights = []
|
||||||
|
self.transforms = {}
|
||||||
|
for tf_name, tf_cfg in cfg.tfs.items():
|
||||||
|
if tf_cfg.weight <= 0.0:
|
||||||
|
continue
|
||||||
|
|
||||||
|
self.transforms[tf_name] = make_transform_from_config(tf_cfg)
|
||||||
|
self.weights.append(tf_cfg.weight)
|
||||||
|
|
||||||
|
n_subset = min(len(self.transforms), cfg.max_num_transforms)
|
||||||
|
if n_subset == 0 or not cfg.enable:
|
||||||
|
self.tf = v2.Identity()
|
||||||
|
else:
|
||||||
|
self.tf = RandomSubsetApply(
|
||||||
|
transforms=list(self.transforms.values()),
|
||||||
|
p=self.weights,
|
||||||
|
n_subset=n_subset,
|
||||||
|
random_order=cfg.random_order,
|
||||||
|
)
|
||||||
|
|
||||||
|
def forward(self, *inputs: Any) -> Any:
|
||||||
|
return self.tf(*inputs)
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
884
lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py
Normal file
884
lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py
Normal file
@@ -0,0 +1,884 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This script is for internal use to convert all datasets under the 'lerobot' hub user account to v2.
|
||||||
|
|
||||||
|
Note: Since the original Aloha datasets don't use shadow motors, you need to comment those out in
|
||||||
|
lerobot/configs/robot/aloha.yaml before running this script.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import traceback
|
||||||
|
from pathlib import Path
|
||||||
|
from textwrap import dedent
|
||||||
|
|
||||||
|
from lerobot import available_datasets
|
||||||
|
from lerobot.common.datasets.v2.convert_dataset_v1_to_v2 import convert_dataset
|
||||||
|
from lerobot.common.robots.aloha.configuration_aloha import AlohaRobotConfig
|
||||||
|
|
||||||
|
LOCAL_DIR = Path("data/")
|
||||||
|
|
||||||
|
# spellchecker:off
|
||||||
|
ALOHA_MOBILE_INFO = {
|
||||||
|
"robot_config": AlohaRobotConfig(),
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://mobile-aloha.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.02117",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{fu2024mobile,
|
||||||
|
author = {Fu, Zipeng and Zhao, Tony Z. and Finn, Chelsea},
|
||||||
|
title = {Mobile ALOHA: Learning Bimanual Mobile Manipulation with Low-Cost Whole-Body Teleoperation},
|
||||||
|
booktitle = {arXiv},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
ALOHA_STATIC_INFO = {
|
||||||
|
"robot_config": AlohaRobotConfig(),
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://tonyzhaozh.github.io/aloha/",
|
||||||
|
"paper": "https://arxiv.org/abs/2304.13705",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{Zhao2023LearningFB,
|
||||||
|
title={Learning Fine-Grained Bimanual Manipulation with Low-Cost Hardware},
|
||||||
|
author={Tony Zhao and Vikash Kumar and Sergey Levine and Chelsea Finn},
|
||||||
|
journal={RSS},
|
||||||
|
year={2023},
|
||||||
|
volume={abs/2304.13705},
|
||||||
|
url={https://arxiv.org/abs/2304.13705}
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
PUSHT_INFO = {
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://diffusion-policy.cs.columbia.edu/",
|
||||||
|
"paper": "https://arxiv.org/abs/2303.04137v5",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{chi2024diffusionpolicy,
|
||||||
|
author = {Cheng Chi and Zhenjia Xu and Siyuan Feng and Eric Cousineau and Yilun Du and Benjamin Burchfiel and Russ Tedrake and Shuran Song},
|
||||||
|
title ={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||||
|
journal = {The International Journal of Robotics Research},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
XARM_INFO = {
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://www.nicklashansen.com/td-mpc/",
|
||||||
|
"paper": "https://arxiv.org/abs/2203.04955",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{Hansen2022tdmpc,
|
||||||
|
title={Temporal Difference Learning for Model Predictive Control},
|
||||||
|
author={Nicklas Hansen and Xiaolong Wang and Hao Su},
|
||||||
|
booktitle={ICML},
|
||||||
|
year={2022}
|
||||||
|
}
|
||||||
|
"""),
|
||||||
|
}
|
||||||
|
UNITREEH_INFO = {
|
||||||
|
"license": "apache-2.0",
|
||||||
|
}
|
||||||
|
|
||||||
|
DATASETS = {
|
||||||
|
"aloha_mobile_cabinet": {
|
||||||
|
"single_task": "Open the top cabinet, store the pot inside it then close the cabinet.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_chair": {
|
||||||
|
"single_task": "Push the chairs in front of the desk to place them against it.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_elevator": {
|
||||||
|
"single_task": "Take the elevator to the 1st floor.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_shrimp": {
|
||||||
|
"single_task": "Sauté the raw shrimp on both sides, then serve it in the bowl.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_wash_pan": {
|
||||||
|
"single_task": "Pick up the pan, rinse it in the sink and then place it in the drying rack.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_wipe_wine": {
|
||||||
|
"single_task": "Pick up the wet cloth on the faucet and use it to clean the spilled wine on the table and underneath the glass.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_battery": {
|
||||||
|
"single_task": "Place the battery into the slot of the remote controller.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_candy": {"single_task": "Pick up the candy and unwrap it.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_static_coffee": {
|
||||||
|
"single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray, then push the 'Hot Water' and 'Travel Mug' buttons.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_coffee_new": {
|
||||||
|
"single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_cups_open": {
|
||||||
|
"single_task": "Pick up the plastic cup and open its lid.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_fork_pick_up": {
|
||||||
|
"single_task": "Pick up the fork and place it on the plate.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_pingpong_test": {
|
||||||
|
"single_task": "Transfer one of the two balls in the right glass into the left glass, then transfer it back to the right glass.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_pro_pencil": {
|
||||||
|
"single_task": "Pick up the pencil with the right arm, hand it over to the left arm then place it back onto the table.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_screw_driver": {
|
||||||
|
"single_task": "Pick up the screwdriver with the right arm, hand it over to the left arm then place it into the cup.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_tape": {
|
||||||
|
"single_task": "Cut a small piece of tape from the tape dispenser then place it on the cardboard box's edge.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_thread_velcro": {
|
||||||
|
"single_task": "Pick up the velcro cable tie with the left arm, then insert the end of the velcro tie into the other end's loop with the right arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_towel": {
|
||||||
|
"single_task": "Pick up a piece of paper towel and place it on the spilled liquid.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_vinh_cup": {
|
||||||
|
"single_task": "Pick up the plastic cup with the right arm, then pop its lid open with the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_vinh_cup_left": {
|
||||||
|
"single_task": "Pick up the plastic cup with the left arm, then pop its lid open with the right arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_ziploc_slide": {"single_task": "Slide open the ziploc bag.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_scripted": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_scripted_image": {
|
||||||
|
"single_task": "Insert the peg into the socket.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_insertion_human": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_human_image": {
|
||||||
|
"single_task": "Insert the peg into the socket.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_scripted": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_scripted_image": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_human": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_human_image": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"pusht": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
|
||||||
|
"pusht_image": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
|
||||||
|
"unitreeh1_fold_clothes": {"single_task": "Fold the sweatshirt.", **UNITREEH_INFO},
|
||||||
|
"unitreeh1_rearrange_objects": {"single_task": "Put the object into the bin.", **UNITREEH_INFO},
|
||||||
|
"unitreeh1_two_robot_greeting": {
|
||||||
|
"single_task": "Greet the other robot with a high five.",
|
||||||
|
**UNITREEH_INFO,
|
||||||
|
},
|
||||||
|
"unitreeh1_warehouse": {
|
||||||
|
"single_task": "Grab the spray paint on the shelf and place it in the bin on top of the robot dog.",
|
||||||
|
**UNITREEH_INFO,
|
||||||
|
},
|
||||||
|
"xarm_lift_medium": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_replay": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_replay_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_push_medium": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_replay": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_replay_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"umi_cup_in_the_wild": {
|
||||||
|
"single_task": "Put the cup on the plate.",
|
||||||
|
"license": "apache-2.0",
|
||||||
|
},
|
||||||
|
"asu_table_top": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://link.springer.com/article/10.1007/s10514-023-10129-1",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{zhou2023modularity,
|
||||||
|
title={Modularity through Attention: Efficient Training and Transfer of Language-Conditioned Policies for Robot Manipulation},
|
||||||
|
author={Zhou, Yifan and Sonawani, Shubham and Phielipp, Mariano and Stepputtis, Simon and Amor, Heni},
|
||||||
|
booktitle={Conference on Robot Learning},
|
||||||
|
pages={1684--1695},
|
||||||
|
year={2023},
|
||||||
|
organization={PMLR}
|
||||||
|
}
|
||||||
|
@article{zhou2023learning,
|
||||||
|
title={Learning modular language-conditioned robot policies through attention},
|
||||||
|
author={Zhou, Yifan and Sonawani, Shubham and Phielipp, Mariano and Ben Amor, Heni and Stepputtis, Simon},
|
||||||
|
journal={Autonomous Robots},
|
||||||
|
pages={1--21},
|
||||||
|
year={2023},
|
||||||
|
publisher={Springer}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_buds_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/BUDS-website/",
|
||||||
|
"paper": "https://arxiv.org/abs/2109.13841",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{zhu2022bottom,
|
||||||
|
title={Bottom-Up Skill Discovery From Unsegmented Demonstrations for Long-Horizon Robot Manipulation},
|
||||||
|
author={Zhu, Yifeng and Stone, Peter and Zhu, Yuke},
|
||||||
|
journal={IEEE Robotics and Automation Letters},
|
||||||
|
volume={7},
|
||||||
|
number={2},
|
||||||
|
pages={4126--4133},
|
||||||
|
year={2022},
|
||||||
|
publisher={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_sailor_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/sailor/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.11435",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{nasiriany2022sailor,
|
||||||
|
title={Learning and Retrieval from Prior Data for Skill-based Imitation Learning},
|
||||||
|
author={Soroush Nasiriany and Tian Gao and Ajay Mandlekar and Yuke Zhu},
|
||||||
|
booktitle={Conference on Robot Learning (CoRL)},
|
||||||
|
year={2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_sirius_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/sirius/",
|
||||||
|
"paper": "https://arxiv.org/abs/2211.08416",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{liu2022robot,
|
||||||
|
title = {Robot Learning on the Job: Human-in-the-Loop Autonomy and Learning During Deployment},
|
||||||
|
author = {Huihan Liu and Soroush Nasiriany and Lance Zhang and Zhiyao Bao and Yuke Zhu},
|
||||||
|
booktitle = {Robotics: Science and Systems (RSS)},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_autolab_ur5": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://sites.google.com/view/berkeley-ur5/home",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{BerkeleyUR5Website,
|
||||||
|
title = {Berkeley {UR5} Demonstration Dataset},
|
||||||
|
author = {Lawrence Yunliang Chen and Simeon Adebola and Ken Goldberg},
|
||||||
|
howpublished = {https://sites.google.com/view/berkeley-ur5/home},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_cable_routing": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://sites.google.com/view/cablerouting/home",
|
||||||
|
"paper": "https://arxiv.org/abs/2307.08927",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{luo2023multistage,
|
||||||
|
author = {Jianlan Luo and Charles Xu and Xinyang Geng and Gilbert Feng and Kuan Fang and Liam Tan and Stefan Schaal and Sergey Levine},
|
||||||
|
title = {Multi-Stage Cable Routing through Hierarchical Imitation Learning},
|
||||||
|
journal = {arXiv pre-print},
|
||||||
|
year = {2023},
|
||||||
|
url = {https://arxiv.org/abs/2307.08927},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_fanuc_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/berkeley.edu/fanuc-manipulation",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{fanuc_manipulation2023,
|
||||||
|
title={Fanuc Manipulation: A Dataset for Learning-based Manipulation with FANUC Mate 200iD Robot},
|
||||||
|
author={Zhu, Xinghao and Tian, Ran and Xu, Chenfeng and Ding, Mingyu and Zhan, Wei and Tomizuka, Masayoshi},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_cory_hall": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/1709.10489",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{kahn2018self,
|
||||||
|
title={Self-supervised deep reinforcement learning with generalized computation graphs for robot navigation},
|
||||||
|
author={Kahn, Gregory and Villaflor, Adam and Ding, Bosen and Abbeel, Pieter and Levine, Sergey},
|
||||||
|
booktitle={2018 IEEE international conference on robotics and automation (ICRA)},
|
||||||
|
pages={5129--5136},
|
||||||
|
year={2018},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_recon": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/recon-robot",
|
||||||
|
"paper": "https://arxiv.org/abs/2104.05859",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{shah2021rapid,
|
||||||
|
title={Rapid Exploration for Open-World Navigation with Latent Goal Models},
|
||||||
|
author={Dhruv Shah and Benjamin Eysenbach and Nicholas Rhinehart and Sergey Levine},
|
||||||
|
booktitle={5th Annual Conference on Robot Learning },
|
||||||
|
year={2021},
|
||||||
|
url={https://openreview.net/forum?id=d_SWJhyKfVw}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_sac_son": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/SACSoN-review",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.01874",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{hirose2023sacson,
|
||||||
|
title={SACSoN: Scalable Autonomous Data Collection for Social Navigation},
|
||||||
|
author={Hirose, Noriaki and Shah, Dhruv and Sridhar, Ajay and Levine, Sergey},
|
||||||
|
journal={arXiv preprint arXiv:2306.01874},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_mvp": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/2203.06173",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@InProceedings{Radosavovic2022,
|
||||||
|
title = {Real-World Robot Learning with Masked Visual Pre-training},
|
||||||
|
author = {Ilija Radosavovic and Tete Xiao and Stephen James and Pieter Abbeel and Jitendra Malik and Trevor Darrell},
|
||||||
|
booktitle = {CoRL},
|
||||||
|
year = {2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_rpt": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.10007",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{Radosavovic2023,
|
||||||
|
title={Robot Learning with Sensorimotor Pre-training},
|
||||||
|
author={Ilija Radosavovic and Baifeng Shi and Letian Fu and Ken Goldberg and Trevor Darrell and Jitendra Malik},
|
||||||
|
year={2023},
|
||||||
|
journal={arXiv:2306.10007}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_franka_exploration_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://human-world-model.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2308.10901",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{mendonca2023structured,
|
||||||
|
title={Structured World Models from Human Videos},
|
||||||
|
author={Mendonca, Russell and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
journal={RSS},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_play_fusion": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://play-fusion.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2312.04549",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{chen2023playfusion,
|
||||||
|
title={PlayFusion: Skill Acquisition via Diffusion from Language-Annotated Play},
|
||||||
|
author={Chen, Lili and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
booktitle={CoRL},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_stretch": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://robo-affordances.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2304.08488",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{bahl2023affordances,
|
||||||
|
title={Affordances from Human Videos as a Versatile Representation for Robotics},
|
||||||
|
author={Bahl, Shikhar and Mendonca, Russell and Chen, Lili and Jain, Unnat and Pathak, Deepak},
|
||||||
|
booktitle={CVPR},
|
||||||
|
year={2023}
|
||||||
|
}
|
||||||
|
@article{mendonca2023structured,
|
||||||
|
title={Structured World Models from Human Videos},
|
||||||
|
author={Mendonca, Russell and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
journal={CoRL},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"columbia_cairlab_pusht_real": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://diffusion-policy.cs.columbia.edu/",
|
||||||
|
"paper": "https://arxiv.org/abs/2303.04137v5",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{chi2023diffusionpolicy,
|
||||||
|
title={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||||
|
author={Chi, Cheng and Feng, Siyuan and Du, Yilun and Xu, Zhenjia and Cousineau, Eric and Burchfiel, Benjamin and Song, Shuran},
|
||||||
|
booktitle={Proceedings of Robotics: Science and Systems (RSS)},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"conq_hose_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/conq-hose-manipulation-dataset/home",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{ConqHoseManipData,
|
||||||
|
author={Peter Mitrano and Dmitry Berenson},
|
||||||
|
title={Conq Hose Manipulation Dataset, v1.15.0},
|
||||||
|
year={2024},
|
||||||
|
howpublished={https://sites.google.com/view/conq-hose-manipulation-dataset}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_edan_shared_control": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://ieeexplore.ieee.org/document/9341156",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{vogel_edan_2020,
|
||||||
|
title = {EDAN - an EMG-Controlled Daily Assistant to Help People with Physical Disabilities},
|
||||||
|
language = {en},
|
||||||
|
booktitle = {2020 {IEEE}/{RSJ} {International} {Conference} on {Intelligent} {Robots} and {Systems} ({IROS})},
|
||||||
|
author = {Vogel, Jörn and Hagengruber, Annette and Iskandar, Maged and Quere, Gabriel and Leipscher, Ulrike and Bustamante, Samuel and Dietrich, Alexander and Hoeppner, Hannes and Leidner, Daniel and Albu-Schäffer, Alin},
|
||||||
|
year = {2020}
|
||||||
|
}
|
||||||
|
@inproceedings{quere_shared_2020,
|
||||||
|
address = {Paris, France},
|
||||||
|
title = {Shared {Control} {Templates} for {Assistive} {Robotics}},
|
||||||
|
language = {en},
|
||||||
|
booktitle = {2020 {IEEE} {International} {Conference} on {Robotics} and {Automation} ({ICRA})},
|
||||||
|
author = {Quere, Gabriel and Hagengruber, Annette and Iskandar, Maged and Bustamante, Samuel and Leidner, Daniel and Stulp, Freek and Vogel, Joern},
|
||||||
|
year = {2020},
|
||||||
|
pages = {7},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_sara_grid_clamp": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://www.researchsquare.com/article/rs-3289569/v1",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{padalkar2023guided,
|
||||||
|
title={A guided reinforcement learning approach using shared control templates for learning manipulation skills in the real world},
|
||||||
|
author={Padalkar, Abhishek and Quere, Gabriel and Raffin, Antonin and Silv{\'e}rio, Jo{\~a}o and Stulp, Freek},
|
||||||
|
journal={Research square preprint rs-3289569/v1},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_sara_pour": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://elib.dlr.de/193739/1/padalkar2023rlsct.pdf",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{padalkar2023guiding,
|
||||||
|
title={Guiding Reinforcement Learning with Shared Control Templates},
|
||||||
|
author={Padalkar, Abhishek and Quere, Gabriel and Steinmetz, Franz and Raffin, Antonin and Nieuwenhuisen, Matthias and Silv{\'e}rio, Jo{\~a}o and Stulp, Freek},
|
||||||
|
booktitle={40th IEEE International Conference on Robotics and Automation, ICRA 2023},
|
||||||
|
year={2023},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"droid_100": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://droid-dataset.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2403.12945",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{khazatsky2024droid,
|
||||||
|
title = {DROID: A Large-Scale In-The-Wild Robot Manipulation Dataset},
|
||||||
|
author = {Alexander Khazatsky and Karl Pertsch and Suraj Nair and Ashwin Balakrishna and Sudeep Dasari and Siddharth Karamcheti and Soroush Nasiriany and Mohan Kumar Srirama and Lawrence Yunliang Chen and Kirsty Ellis and Peter David Fagan and Joey Hejna and Masha Itkina and Marion Lepert and Yecheng Jason Ma and Patrick Tree Miller and Jimmy Wu and Suneel Belkhale and Shivin Dass and Huy Ha and Arhan Jain and Abraham Lee and Youngwoon Lee and Marius Memmel and Sungjae Park and Ilija Radosavovic and Kaiyuan Wang and Albert Zhan and Kevin Black and Cheng Chi and Kyle Beltran Hatch and Shan Lin and Jingpei Lu and Jean Mercat and Abdul Rehman and Pannag R Sanketi and Archit Sharma and Cody Simpson and Quan Vuong and Homer Rich Walke and Blake Wulfe and Ted Xiao and Jonathan Heewon Yang and Arefeh Yavary and Tony Z. Zhao and Christopher Agia and Rohan Baijal and Mateo Guaman Castro and Daphne Chen and Qiuyu Chen and Trinity Chung and Jaimyn Drake and Ethan Paul Foster and Jensen Gao and David Antonio Herrera and Minho Heo and Kyle Hsu and Jiaheng Hu and Donovon Jackson and Charlotte Le and Yunshuang Li and Kevin Lin and Roy Lin and Zehan Ma and Abhiram Maddukuri and Suvir Mirchandani and Daniel Morton and Tony Nguyen and Abigail O'Neill and Rosario Scalise and Derick Seale and Victor Son and Stephen Tian and Emi Tran and Andrew E. Wang and Yilin Wu and Annie Xie and Jingyun Yang and Patrick Yin and Yunchu Zhang and Osbert Bastani and Glen Berseth and Jeannette Bohg and Ken Goldberg and Abhinav Gupta and Abhishek Gupta and Dinesh Jayaraman and Joseph J Lim and Jitendra Malik and Roberto Martín-Martín and Subramanian Ramamoorthy and Dorsa Sadigh and Shuran Song and Jiajun Wu and Michael C. Yip and Yuke Zhu and Thomas Kollar and Sergey Levine and Chelsea Finn},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"fmb": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://functional-manipulation-benchmark.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.08553",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{luo2024fmb,
|
||||||
|
title={FMB: a Functional Manipulation Benchmark for Generalizable Robotic Learning},
|
||||||
|
author={Luo, Jianlan and Xu, Charles and Liu, Fangchen and Tan, Liam and Lin, Zipeng and Wu, Jeffrey and Abbeel, Pieter and Levine, Sergey},
|
||||||
|
journal={arXiv preprint arXiv:2401.08553},
|
||||||
|
year={2024}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"iamlab_cmu_pickup_insert": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://openreview.net/forum?id=WuBv9-IGDUA",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.14502",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{saxena2023multiresolution,
|
||||||
|
title={Multi-Resolution Sensing for Real-Time Control with Vision-Language Models},
|
||||||
|
author={Saumya Saxena and Mohit Sharma and Oliver Kroemer},
|
||||||
|
booktitle={7th Annual Conference on Robot Learning},
|
||||||
|
year={2023},
|
||||||
|
url={https://openreview.net/forum?id=WuBv9-IGDUA}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"imperialcollege_sawyer_wrist_cam": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
},
|
||||||
|
"jaco_play": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://github.com/clvrai/clvr_jaco_play_dataset",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@software{dass2023jacoplay,
|
||||||
|
author = {Dass, Shivin and Yapeter, Jullian and Zhang, Jesse and Zhang, Jiahui
|
||||||
|
and Pertsch, Karl and Nikolaidis, Stefanos and Lim, Joseph J.},
|
||||||
|
title = {CLVR Jaco Play Dataset},
|
||||||
|
url = {https://github.com/clvrai/clvr_jaco_play_dataset},
|
||||||
|
version = {1.0.0},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"kaist_nonprehensile": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://github.com/JaeHyung-Kim/rlds_dataset_builder",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{kimpre,
|
||||||
|
title={Pre-and post-contact policy decomposition for non-prehensile manipulation with zero-shot sim-to-real transfer},
|
||||||
|
author={Kim, Minchan and Han, Junhyek and Kim, Jaehyung and Kim, Beomjoon},
|
||||||
|
booktitle={2023 IEEE/RSJ International Conference on Intelligent Robots and Systems (IROS)},
|
||||||
|
year={2023},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_door_opening_surprising_effectiveness": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://jyopari.github.io/VINN/",
|
||||||
|
"paper": "https://arxiv.org/abs/2112.01511",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{pari2021surprising,
|
||||||
|
title={The Surprising Effectiveness of Representation Learning for Visual Imitation},
|
||||||
|
author={Jyothish Pari and Nur Muhammad Shafiullah and Sridhar Pandian Arunachalam and Lerrel Pinto},
|
||||||
|
year={2021},
|
||||||
|
eprint={2112.01511},
|
||||||
|
archivePrefix={arXiv},
|
||||||
|
primaryClass={cs.RO}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_franka_play_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://play-to-policy.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.10047",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{cui2022play,
|
||||||
|
title = {From Play to Policy: Conditional Behavior Generation from Uncurated Robot Data},
|
||||||
|
author = {Cui, Zichen Jeff and Wang, Yibin and Shafiullah, Nur Muhammad Mahi and Pinto, Lerrel},
|
||||||
|
journal = {arXiv preprint arXiv:2210.10047},
|
||||||
|
year = {2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_rot_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://rot-robot.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2206.15469",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{haldar2023watch,
|
||||||
|
title={Watch and match: Supercharging imitation with regularized optimal transport},
|
||||||
|
author={Haldar, Siddhant and Mathur, Vaibhav and Yarats, Denis and Pinto, Lerrel},
|
||||||
|
booktitle={Conference on Robot Learning},
|
||||||
|
pages={32--43},
|
||||||
|
year={2023},
|
||||||
|
organization={PMLR}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"roboturk": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://roboturk.stanford.edu/dataset_real.html",
|
||||||
|
"paper": "PAPER",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{mandlekar2019scaling,
|
||||||
|
title={Scaling robot supervision to hundreds of hours with roboturk: Robotic manipulation dataset through human reasoning and dexterity},
|
||||||
|
author={Mandlekar, Ajay and Booher, Jonathan and Spero, Max and Tung, Albert and Gupta, Anchit and Zhu, Yuke and Garg, Animesh and Savarese, Silvio and Fei-Fei, Li},
|
||||||
|
booktitle={2019 IEEE/RSJ International Conference on Intelligent Robots and Systems (IROS)},
|
||||||
|
pages={1048--1055},
|
||||||
|
year={2019},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_hydra_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/hydra-il-2023",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.17237",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{belkhale2023hydra,
|
||||||
|
title={HYDRA: Hybrid Robot Actions for Imitation Learning},
|
||||||
|
author={Belkhale, Suneel and Cui, Yuchen and Sadigh, Dorsa},
|
||||||
|
journal={arxiv},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_kuka_multimodal_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/visionandtouch",
|
||||||
|
"paper": "https://arxiv.org/abs/1810.10191",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{lee2019icra,
|
||||||
|
title={Making sense of vision and touch: Self-supervised learning of multimodal representations for contact-rich tasks},
|
||||||
|
author={Lee, Michelle A and Zhu, Yuke and Srinivasan, Krishnan and Shah, Parth and Savarese, Silvio and Fei-Fei, Li and Garg, Animesh and Bohg, Jeannette},
|
||||||
|
booktitle={2019 IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
year={2019},
|
||||||
|
url={https://arxiv.org/abs/1810.10191}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_robocook": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://hshi74.github.io/robocook/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.14447",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{shi2023robocook,
|
||||||
|
title={RoboCook: Long-Horizon Elasto-Plastic Object Manipulation with Diverse Tools},
|
||||||
|
author={Shi, Haochen and Xu, Huazhe and Clarke, Samuel and Li, Yunzhu and Wu, Jiajun},
|
||||||
|
journal={arXiv preprint arXiv:2306.14447},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"taco_play": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://www.kaggle.com/datasets/oiermees/taco-robot",
|
||||||
|
"paper": "https://arxiv.org/abs/2209.08959, https://arxiv.org/abs/2210.01911",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{rosete2022tacorl,
|
||||||
|
author = {Erick Rosete-Beas and Oier Mees and Gabriel Kalweit and Joschka Boedecker and Wolfram Burgard},
|
||||||
|
title = {Latent Plans for Task Agnostic Offline Reinforcement Learning},
|
||||||
|
journal = {Proceedings of the 6th Conference on Robot Learning (CoRL)},
|
||||||
|
year = {2022}
|
||||||
|
}
|
||||||
|
@inproceedings{mees23hulc2,
|
||||||
|
title={Grounding Language with Visual Affordances over Unstructured Data},
|
||||||
|
author={Oier Mees and Jessica Borja-Diaz and Wolfram Burgard},
|
||||||
|
booktitle = {Proceedings of the IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
year={2023},
|
||||||
|
address = {London, UK}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"tokyo_u_lsmo": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "URL",
|
||||||
|
"paper": "https://arxiv.org/abs/2107.05842",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@Article{Osa22,
|
||||||
|
author = {Takayuki Osa},
|
||||||
|
journal = {The International Journal of Robotics Research},
|
||||||
|
title = {Motion Planning by Learning the Solution Manifold in Trajectory Optimization},
|
||||||
|
year = {2022},
|
||||||
|
number = {3},
|
||||||
|
pages = {291--311},
|
||||||
|
volume = {41},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"toto": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://toto-benchmark.org/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.00942",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{zhou2023train,
|
||||||
|
author={Zhou, Gaoyue and Dean, Victoria and Srirama, Mohan Kumar and Rajeswaran, Aravind and Pari, Jyothish and Hatch, Kyle and Jain, Aryan and Yu, Tianhe and Abbeel, Pieter and Pinto, Lerrel and Finn, Chelsea and Gupta, Abhinav},
|
||||||
|
booktitle={2023 IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
title={Train Offline, Test Online: A Real Robot Learning Benchmark},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"ucsd_kitchen_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@ARTICLE{ucsd_kitchens,
|
||||||
|
author = {Ge Yan, Kris Wu, and Xiaolong Wang},
|
||||||
|
title = {{ucsd kitchens Dataset}},
|
||||||
|
year = {2023},
|
||||||
|
month = {August}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"ucsd_pick_and_place_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://owmcorl.github.io/#",
|
||||||
|
"paper": "https://arxiv.org/abs/2310.16029",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@preprint{Feng2023Finetuning,
|
||||||
|
title={Finetuning Offline World Models in the Real World},
|
||||||
|
author={Yunhai Feng, Nicklas Hansen, Ziyan Xiong, Chandramouli Rajagopalan, Xiaolong Wang},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"uiuc_d3field": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://robopil.github.io/d3fields/",
|
||||||
|
"paper": "https://arxiv.org/abs/2309.16118",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{wang2023d3field,
|
||||||
|
title={D^3Field: Dynamic 3D Descriptor Fields for Generalizable Robotic Manipulation},
|
||||||
|
author={Wang, Yixuan and Li, Zhuoran and Zhang, Mingtong and Driggs-Campbell, Katherine and Wu, Jiajun and Fei-Fei, Li and Li, Yunzhu},
|
||||||
|
journal={arXiv preprint arXiv:},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"usc_cloth_sim": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://uscresl.github.io/dmfd/",
|
||||||
|
"paper": "https://arxiv.org/abs/2207.10148",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{salhotra2022dmfd,
|
||||||
|
author={Salhotra, Gautam and Liu, I-Chun Arthur and Dominguez-Kuhne, Marcus and Sukhatme, Gaurav S.},
|
||||||
|
journal={IEEE Robotics and Automation Letters},
|
||||||
|
title={Learning Deformable Object Manipulation From Expert Demonstrations},
|
||||||
|
year={2022},
|
||||||
|
volume={7},
|
||||||
|
number={4},
|
||||||
|
pages={8775-8782},
|
||||||
|
doi={10.1109/LRA.2022.3187843}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utaustin_mutex": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/MUTEX/",
|
||||||
|
"paper": "https://arxiv.org/abs/2309.14320",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{shah2023mutex,
|
||||||
|
title={{MUTEX}: Learning Unified Policies from Multimodal Task Specifications},
|
||||||
|
author={Rutav Shah and Roberto Mart{\'\i}n-Mart{\'\i}n and Yuke Zhu},
|
||||||
|
booktitle={7th Annual Conference on Robot Learning},
|
||||||
|
year={2023},
|
||||||
|
url={https://openreview.net/forum?id=PwqiqaaEzJ}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_pr2_opening_fridge": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{oh2023pr2utokyodatasets,
|
||||||
|
author={Jihoon Oh and Naoaki Kanazawa and Kento Kawaharazuka},
|
||||||
|
title={X-Embodiment U-Tokyo PR2 Datasets},
|
||||||
|
year={2023},
|
||||||
|
url={https://github.com/ojh6404/rlds_dataset_builder},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_pr2_tabletop_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{oh2023pr2utokyodatasets,
|
||||||
|
author={Jihoon Oh and Naoaki Kanazawa and Kento Kawaharazuka},
|
||||||
|
title={X-Embodiment U-Tokyo PR2 Datasets},
|
||||||
|
year={2023},
|
||||||
|
url={https://github.com/ojh6404/rlds_dataset_builder},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_saytap": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://saytap.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.07580",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{saytap2023,
|
||||||
|
author = {Yujin Tang and Wenhao Yu and Jie Tan and Heiga Zen and Aleksandra Faust and
|
||||||
|
Tatsuya Harada},
|
||||||
|
title = {SayTap: Language to Quadrupedal Locomotion},
|
||||||
|
eprint = {arXiv:2306.07580},
|
||||||
|
url = {https://saytap.github.io},
|
||||||
|
note = {https://saytap.github.io},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_xarm_bimanual": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{matsushima2023weblab,
|
||||||
|
title={Weblab xArm Dataset},
|
||||||
|
author={Tatsuya Matsushima and Hiroki Furuta and Yusuke Iwasawa and Yutaka Matsuo},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_xarm_pick_and_place": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{matsushima2023weblab,
|
||||||
|
title={Weblab xArm Dataset},
|
||||||
|
author={Tatsuya Matsushima and Hiroki Furuta and Yusuke Iwasawa and Yutaka Matsuo},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"viola": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/VIOLA/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.11339",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{zhu2022viola,
|
||||||
|
title={VIOLA: Imitation Learning for Vision-Based Manipulation with Object Proposal Priors},
|
||||||
|
author={Zhu, Yifeng and Joshi, Abhishek and Stone, Peter and Zhu, Yuke},
|
||||||
|
journal={6th Annual Conference on Robot Learning (CoRL)},
|
||||||
|
year={2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
}
|
||||||
|
# spellchecker:on
|
||||||
|
|
||||||
|
|
||||||
|
def batch_convert():
|
||||||
|
status = {}
|
||||||
|
logfile = LOCAL_DIR / "conversion_log.txt"
|
||||||
|
assert set(DATASETS) == {id_.split("/")[1] for id_ in available_datasets}
|
||||||
|
for num, (name, kwargs) in enumerate(DATASETS.items()):
|
||||||
|
repo_id = f"lerobot/{name}"
|
||||||
|
print(f"\nConverting {repo_id} ({num}/{len(DATASETS)})")
|
||||||
|
print("---------------------------------------------------------")
|
||||||
|
try:
|
||||||
|
convert_dataset(repo_id, LOCAL_DIR, **kwargs)
|
||||||
|
status = f"{repo_id}: success."
|
||||||
|
with open(logfile, "a") as file:
|
||||||
|
file.write(status + "\n")
|
||||||
|
except Exception:
|
||||||
|
status = f"{repo_id}: failed\n {traceback.format_exc()}"
|
||||||
|
with open(logfile, "a") as file:
|
||||||
|
file.write(status + "\n")
|
||||||
|
continue
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
batch_convert()
|
||||||
664
lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py
Normal file
664
lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py
Normal file
@@ -0,0 +1,664 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This script will help you convert any LeRobot dataset already pushed to the hub from codebase version 1.6 to
|
||||||
|
2.0. You will be required to provide the 'tasks', which is a short but accurate description in plain English
|
||||||
|
for each of the task performed in the dataset. This will allow to easily train models with task-conditioning.
|
||||||
|
|
||||||
|
We support 3 different scenarios for these tasks (see instructions below):
|
||||||
|
1. Single task dataset: all episodes of your dataset have the same single task.
|
||||||
|
2. Single task episodes: the episodes of your dataset each contain a single task but they can differ from
|
||||||
|
one episode to the next.
|
||||||
|
3. Multi task episodes: episodes of your dataset may each contain several different tasks.
|
||||||
|
|
||||||
|
|
||||||
|
Can you can also provide a robot config .yaml file (not mandatory) to this script via the option
|
||||||
|
'--robot-config' so that it writes information about the robot (robot type, motors names) this dataset was
|
||||||
|
recorded with. For now, only Aloha/Koch type robots are supported with this option.
|
||||||
|
|
||||||
|
|
||||||
|
# 1. Single task dataset
|
||||||
|
If your dataset contains a single task, you can simply provide it directly via the CLI with the
|
||||||
|
'--single-task' option.
|
||||||
|
|
||||||
|
Examples:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/aloha_sim_insertion_human_image \
|
||||||
|
--single-task "Insert the peg into the socket." \
|
||||||
|
--robot-config lerobot/configs/robot/aloha.yaml \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id aliberts/koch_tutorial \
|
||||||
|
--single-task "Pick the Lego block and drop it in the box on the right." \
|
||||||
|
--robot-config lerobot/configs/robot/koch.yaml \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
# 2. Single task episodes
|
||||||
|
If your dataset is a multi-task dataset, you have two options to provide the tasks to this script:
|
||||||
|
|
||||||
|
- If your dataset already contains a language instruction column in its parquet file, you can simply provide
|
||||||
|
this column's name with the '--tasks-col' arg.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/stanford_kuka_multimodal_dataset \
|
||||||
|
--tasks-col "language_instruction" \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
- If your dataset doesn't contain a language instruction, you should provide the path to a .json file with the
|
||||||
|
'--tasks-path' arg. This file should have the following structure where keys correspond to each
|
||||||
|
episode_index in the dataset, and values are the language instruction for that episode.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```json
|
||||||
|
{
|
||||||
|
"0": "Do something",
|
||||||
|
"1": "Do something else",
|
||||||
|
"2": "Do something",
|
||||||
|
"3": "Go there",
|
||||||
|
...
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
# 3. Multi task episodes
|
||||||
|
If you have multiple tasks per episodes, your dataset should contain a language instruction column in its
|
||||||
|
parquet file, and you must provide this column's name with the '--tasks-col' arg.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/stanford_kuka_multimodal_dataset \
|
||||||
|
--tasks-col "language_instruction" \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import contextlib
|
||||||
|
import filecmp
|
||||||
|
import json
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import shutil
|
||||||
|
import subprocess
|
||||||
|
import tempfile
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import datasets
|
||||||
|
import pyarrow.compute as pc
|
||||||
|
import pyarrow.parquet as pq
|
||||||
|
import torch
|
||||||
|
from datasets import Dataset
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
from huggingface_hub.errors import EntryNotFoundError, HfHubHTTPError
|
||||||
|
from safetensors.torch import load_file
|
||||||
|
|
||||||
|
from lerobot.common.datasets.utils import (
|
||||||
|
DEFAULT_CHUNK_SIZE,
|
||||||
|
DEFAULT_PARQUET_PATH,
|
||||||
|
DEFAULT_VIDEO_PATH,
|
||||||
|
EPISODES_PATH,
|
||||||
|
INFO_PATH,
|
||||||
|
STATS_PATH,
|
||||||
|
TASKS_PATH,
|
||||||
|
create_branch,
|
||||||
|
create_lerobot_dataset_card,
|
||||||
|
flatten_dict,
|
||||||
|
get_safe_version,
|
||||||
|
load_json,
|
||||||
|
unflatten_dict,
|
||||||
|
write_json,
|
||||||
|
write_jsonlines,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.video_utils import (
|
||||||
|
VideoFrame, # noqa: F401
|
||||||
|
get_image_pixel_channels,
|
||||||
|
get_video_info,
|
||||||
|
)
|
||||||
|
from lerobot.common.robots import RobotConfig
|
||||||
|
from lerobot.common.robots.utils import make_robot_config
|
||||||
|
|
||||||
|
V16 = "v1.6"
|
||||||
|
V20 = "v2.0"
|
||||||
|
|
||||||
|
GITATTRIBUTES_REF = "aliberts/gitattributes_reference"
|
||||||
|
V1_VIDEO_FILE = "{video_key}_episode_{episode_index:06d}.mp4"
|
||||||
|
V1_INFO_PATH = "meta_data/info.json"
|
||||||
|
V1_STATS_PATH = "meta_data/stats.safetensors"
|
||||||
|
|
||||||
|
|
||||||
|
def parse_robot_config(robot_cfg: RobotConfig) -> tuple[str, dict]:
|
||||||
|
if robot_cfg.type in ["aloha", "koch"]:
|
||||||
|
state_names = [
|
||||||
|
f"{arm}_{motor}" if len(robot_cfg.follower_arms) > 1 else motor
|
||||||
|
for arm in robot_cfg.follower_arms
|
||||||
|
for motor in robot_cfg.follower_arms[arm].motors
|
||||||
|
]
|
||||||
|
action_names = [
|
||||||
|
# f"{arm}_{motor}" for arm in ["left", "right"] for motor in robot_cfg["leader_arms"][arm]["motors"]
|
||||||
|
f"{arm}_{motor}" if len(robot_cfg.leader_arms) > 1 else motor
|
||||||
|
for arm in robot_cfg.leader_arms
|
||||||
|
for motor in robot_cfg.leader_arms[arm].motors
|
||||||
|
]
|
||||||
|
# elif robot_cfg["robot_type"] == "stretch3": TODO
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(
|
||||||
|
"Please provide robot_config={'robot_type': ..., 'names': ...} directly to convert_dataset()."
|
||||||
|
)
|
||||||
|
|
||||||
|
return {
|
||||||
|
"robot_type": robot_cfg.type,
|
||||||
|
"names": {
|
||||||
|
"observation.state": state_names,
|
||||||
|
"observation.effort": state_names,
|
||||||
|
"action": action_names,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def convert_stats_to_json(v1_dir: Path, v2_dir: Path) -> None:
|
||||||
|
safetensor_path = v1_dir / V1_STATS_PATH
|
||||||
|
stats = load_file(safetensor_path)
|
||||||
|
serialized_stats = {key: value.tolist() for key, value in stats.items()}
|
||||||
|
serialized_stats = unflatten_dict(serialized_stats)
|
||||||
|
|
||||||
|
json_path = v2_dir / STATS_PATH
|
||||||
|
json_path.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with open(json_path, "w") as f:
|
||||||
|
json.dump(serialized_stats, f, indent=4)
|
||||||
|
|
||||||
|
# Sanity check
|
||||||
|
with open(json_path) as f:
|
||||||
|
stats_json = json.load(f)
|
||||||
|
|
||||||
|
stats_json = flatten_dict(stats_json)
|
||||||
|
stats_json = {key: torch.tensor(value) for key, value in stats_json.items()}
|
||||||
|
for key in stats:
|
||||||
|
torch.testing.assert_close(stats_json[key], stats[key])
|
||||||
|
|
||||||
|
|
||||||
|
def get_features_from_hf_dataset(
|
||||||
|
dataset: Dataset, robot_config: RobotConfig | None = None
|
||||||
|
) -> dict[str, list]:
|
||||||
|
robot_config = parse_robot_config(robot_config)
|
||||||
|
features = {}
|
||||||
|
for key, ft in dataset.features.items():
|
||||||
|
if isinstance(ft, datasets.Value):
|
||||||
|
dtype = ft.dtype
|
||||||
|
shape = (1,)
|
||||||
|
names = None
|
||||||
|
if isinstance(ft, datasets.Sequence):
|
||||||
|
assert isinstance(ft.feature, datasets.Value)
|
||||||
|
dtype = ft.feature.dtype
|
||||||
|
shape = (ft.length,)
|
||||||
|
motor_names = (
|
||||||
|
robot_config["names"][key] if robot_config else [f"motor_{i}" for i in range(ft.length)]
|
||||||
|
)
|
||||||
|
assert len(motor_names) == shape[0]
|
||||||
|
names = {"motors": motor_names}
|
||||||
|
elif isinstance(ft, datasets.Image):
|
||||||
|
dtype = "image"
|
||||||
|
image = dataset[0][key] # Assuming first row
|
||||||
|
channels = get_image_pixel_channels(image)
|
||||||
|
shape = (image.height, image.width, channels)
|
||||||
|
names = ["height", "width", "channels"]
|
||||||
|
elif ft._type == "VideoFrame":
|
||||||
|
dtype = "video"
|
||||||
|
shape = None # Add shape later
|
||||||
|
names = ["height", "width", "channels"]
|
||||||
|
|
||||||
|
features[key] = {
|
||||||
|
"dtype": dtype,
|
||||||
|
"shape": shape,
|
||||||
|
"names": names,
|
||||||
|
}
|
||||||
|
|
||||||
|
return features
|
||||||
|
|
||||||
|
|
||||||
|
def add_task_index_by_episodes(dataset: Dataset, tasks_by_episodes: dict) -> tuple[Dataset, list[str]]:
|
||||||
|
df = dataset.to_pandas()
|
||||||
|
tasks = list(set(tasks_by_episodes.values()))
|
||||||
|
tasks_to_task_index = {task: task_idx for task_idx, task in enumerate(tasks)}
|
||||||
|
episodes_to_task_index = {ep_idx: tasks_to_task_index[task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
df["task_index"] = df["episode_index"].map(episodes_to_task_index).astype(int)
|
||||||
|
|
||||||
|
features = dataset.features
|
||||||
|
features["task_index"] = datasets.Value(dtype="int64")
|
||||||
|
dataset = Dataset.from_pandas(df, features=features, split="train")
|
||||||
|
return dataset, tasks
|
||||||
|
|
||||||
|
|
||||||
|
def add_task_index_from_tasks_col(
|
||||||
|
dataset: Dataset, tasks_col: str
|
||||||
|
) -> tuple[Dataset, dict[str, list[str]], list[str]]:
|
||||||
|
df = dataset.to_pandas()
|
||||||
|
|
||||||
|
# HACK: This is to clean some of the instructions in our version of Open X datasets
|
||||||
|
prefix_to_clean = "tf.Tensor(b'"
|
||||||
|
suffix_to_clean = "', shape=(), dtype=string)"
|
||||||
|
df[tasks_col] = df[tasks_col].str.removeprefix(prefix_to_clean).str.removesuffix(suffix_to_clean)
|
||||||
|
|
||||||
|
# Create task_index col
|
||||||
|
tasks_by_episode = df.groupby("episode_index")[tasks_col].unique().apply(lambda x: x.tolist()).to_dict()
|
||||||
|
tasks = df[tasks_col].unique().tolist()
|
||||||
|
tasks_to_task_index = {task: idx for idx, task in enumerate(tasks)}
|
||||||
|
df["task_index"] = df[tasks_col].map(tasks_to_task_index).astype(int)
|
||||||
|
|
||||||
|
# Build the dataset back from df
|
||||||
|
features = dataset.features
|
||||||
|
features["task_index"] = datasets.Value(dtype="int64")
|
||||||
|
dataset = Dataset.from_pandas(df, features=features, split="train")
|
||||||
|
dataset = dataset.remove_columns(tasks_col)
|
||||||
|
|
||||||
|
return dataset, tasks, tasks_by_episode
|
||||||
|
|
||||||
|
|
||||||
|
def split_parquet_by_episodes(
|
||||||
|
dataset: Dataset,
|
||||||
|
total_episodes: int,
|
||||||
|
total_chunks: int,
|
||||||
|
output_dir: Path,
|
||||||
|
) -> list:
|
||||||
|
table = dataset.data.table
|
||||||
|
episode_lengths = []
|
||||||
|
for ep_chunk in range(total_chunks):
|
||||||
|
ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
|
||||||
|
ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
|
||||||
|
chunk_dir = "/".join(DEFAULT_PARQUET_PATH.split("/")[:-1]).format(episode_chunk=ep_chunk)
|
||||||
|
(output_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
|
||||||
|
for ep_idx in range(ep_chunk_start, ep_chunk_end):
|
||||||
|
ep_table = table.filter(pc.equal(table["episode_index"], ep_idx))
|
||||||
|
episode_lengths.insert(ep_idx, len(ep_table))
|
||||||
|
output_file = output_dir / DEFAULT_PARQUET_PATH.format(
|
||||||
|
episode_chunk=ep_chunk, episode_index=ep_idx
|
||||||
|
)
|
||||||
|
pq.write_table(ep_table, output_file)
|
||||||
|
|
||||||
|
return episode_lengths
|
||||||
|
|
||||||
|
|
||||||
|
def move_videos(
|
||||||
|
repo_id: str,
|
||||||
|
video_keys: list[str],
|
||||||
|
total_episodes: int,
|
||||||
|
total_chunks: int,
|
||||||
|
work_dir: Path,
|
||||||
|
clean_gittatributes: Path,
|
||||||
|
branch: str = "main",
|
||||||
|
) -> None:
|
||||||
|
"""
|
||||||
|
HACK: Since HfApi() doesn't provide a way to move files directly in a repo, this function will run git
|
||||||
|
commands to fetch git lfs video files references to move them into subdirectories without having to
|
||||||
|
actually download them.
|
||||||
|
"""
|
||||||
|
_lfs_clone(repo_id, work_dir, branch)
|
||||||
|
|
||||||
|
videos_moved = False
|
||||||
|
video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*.mp4")]
|
||||||
|
if len(video_files) == 0:
|
||||||
|
video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*/*/*.mp4")]
|
||||||
|
videos_moved = True # Videos have already been moved
|
||||||
|
|
||||||
|
assert len(video_files) == total_episodes * len(video_keys)
|
||||||
|
|
||||||
|
lfs_untracked_videos = _get_lfs_untracked_videos(work_dir, video_files)
|
||||||
|
|
||||||
|
current_gittatributes = work_dir / ".gitattributes"
|
||||||
|
if not filecmp.cmp(current_gittatributes, clean_gittatributes, shallow=False):
|
||||||
|
fix_gitattributes(work_dir, current_gittatributes, clean_gittatributes)
|
||||||
|
|
||||||
|
if lfs_untracked_videos:
|
||||||
|
fix_lfs_video_files_tracking(work_dir, video_files)
|
||||||
|
|
||||||
|
if videos_moved:
|
||||||
|
return
|
||||||
|
|
||||||
|
video_dirs = sorted(work_dir.glob("videos*/"))
|
||||||
|
for ep_chunk in range(total_chunks):
|
||||||
|
ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
|
||||||
|
ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
|
||||||
|
for vid_key in video_keys:
|
||||||
|
chunk_dir = "/".join(DEFAULT_VIDEO_PATH.split("/")[:-1]).format(
|
||||||
|
episode_chunk=ep_chunk, video_key=vid_key
|
||||||
|
)
|
||||||
|
(work_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
for ep_idx in range(ep_chunk_start, ep_chunk_end):
|
||||||
|
target_path = DEFAULT_VIDEO_PATH.format(
|
||||||
|
episode_chunk=ep_chunk, video_key=vid_key, episode_index=ep_idx
|
||||||
|
)
|
||||||
|
video_file = V1_VIDEO_FILE.format(video_key=vid_key, episode_index=ep_idx)
|
||||||
|
if len(video_dirs) == 1:
|
||||||
|
video_path = video_dirs[0] / video_file
|
||||||
|
else:
|
||||||
|
for dir in video_dirs:
|
||||||
|
if (dir / video_file).is_file():
|
||||||
|
video_path = dir / video_file
|
||||||
|
break
|
||||||
|
|
||||||
|
video_path.rename(work_dir / target_path)
|
||||||
|
|
||||||
|
commit_message = "Move video files into chunk subdirectories"
|
||||||
|
subprocess.run(["git", "add", "."], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "commit", "-m", commit_message], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def fix_lfs_video_files_tracking(work_dir: Path, lfs_untracked_videos: list[str]) -> None:
|
||||||
|
"""
|
||||||
|
HACK: This function fixes the tracking by git lfs which was not properly set on some repos. In that case,
|
||||||
|
there's no other option than to download the actual files and reupload them with lfs tracking.
|
||||||
|
"""
|
||||||
|
for i in range(0, len(lfs_untracked_videos), 100):
|
||||||
|
files = lfs_untracked_videos[i : i + 100]
|
||||||
|
try:
|
||||||
|
subprocess.run(["git", "rm", "--cached", *files], cwd=work_dir, capture_output=True, check=True)
|
||||||
|
except subprocess.CalledProcessError as e:
|
||||||
|
print("git rm --cached ERROR:")
|
||||||
|
print(e.stderr)
|
||||||
|
subprocess.run(["git", "add", *files], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
commit_message = "Track video files with git lfs"
|
||||||
|
subprocess.run(["git", "commit", "-m", commit_message], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def fix_gitattributes(work_dir: Path, current_gittatributes: Path, clean_gittatributes: Path) -> None:
|
||||||
|
shutil.copyfile(clean_gittatributes, current_gittatributes)
|
||||||
|
subprocess.run(["git", "add", ".gitattributes"], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "commit", "-m", "Fix .gitattributes"], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def _lfs_clone(repo_id: str, work_dir: Path, branch: str) -> None:
|
||||||
|
subprocess.run(["git", "lfs", "install"], cwd=work_dir, check=True)
|
||||||
|
repo_url = f"https://huggingface.co/datasets/{repo_id}"
|
||||||
|
env = {"GIT_LFS_SKIP_SMUDGE": "1"} # Prevent downloading LFS files
|
||||||
|
subprocess.run(
|
||||||
|
["git", "clone", "--branch", branch, "--single-branch", "--depth", "1", repo_url, str(work_dir)],
|
||||||
|
check=True,
|
||||||
|
env=env,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def _get_lfs_untracked_videos(work_dir: Path, video_files: list[str]) -> list[str]:
|
||||||
|
lfs_tracked_files = subprocess.run(
|
||||||
|
["git", "lfs", "ls-files", "-n"], cwd=work_dir, capture_output=True, text=True, check=True
|
||||||
|
)
|
||||||
|
lfs_tracked_files = set(lfs_tracked_files.stdout.splitlines())
|
||||||
|
return [f for f in video_files if f not in lfs_tracked_files]
|
||||||
|
|
||||||
|
|
||||||
|
def get_videos_info(repo_id: str, local_dir: Path, video_keys: list[str], branch: str) -> dict:
|
||||||
|
# Assumes first episode
|
||||||
|
video_files = [
|
||||||
|
DEFAULT_VIDEO_PATH.format(episode_chunk=0, video_key=vid_key, episode_index=0)
|
||||||
|
for vid_key in video_keys
|
||||||
|
]
|
||||||
|
hub_api = HfApi()
|
||||||
|
hub_api.snapshot_download(
|
||||||
|
repo_id=repo_id, repo_type="dataset", local_dir=local_dir, revision=branch, allow_patterns=video_files
|
||||||
|
)
|
||||||
|
videos_info_dict = {}
|
||||||
|
for vid_key, vid_path in zip(video_keys, video_files, strict=True):
|
||||||
|
videos_info_dict[vid_key] = get_video_info(local_dir / vid_path)
|
||||||
|
|
||||||
|
return videos_info_dict
|
||||||
|
|
||||||
|
|
||||||
|
def convert_dataset(
|
||||||
|
repo_id: str,
|
||||||
|
local_dir: Path,
|
||||||
|
single_task: str | None = None,
|
||||||
|
tasks_path: Path | None = None,
|
||||||
|
tasks_col: Path | None = None,
|
||||||
|
robot_config: RobotConfig | None = None,
|
||||||
|
test_branch: str | None = None,
|
||||||
|
**card_kwargs,
|
||||||
|
):
|
||||||
|
v1 = get_safe_version(repo_id, V16)
|
||||||
|
v1x_dir = local_dir / V16 / repo_id
|
||||||
|
v20_dir = local_dir / V20 / repo_id
|
||||||
|
v1x_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
v20_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
hub_api = HfApi()
|
||||||
|
hub_api.snapshot_download(
|
||||||
|
repo_id=repo_id, repo_type="dataset", revision=v1, local_dir=v1x_dir, ignore_patterns="videos*/"
|
||||||
|
)
|
||||||
|
branch = "main"
|
||||||
|
if test_branch:
|
||||||
|
branch = test_branch
|
||||||
|
create_branch(repo_id=repo_id, branch=test_branch, repo_type="dataset")
|
||||||
|
|
||||||
|
metadata_v1 = load_json(v1x_dir / V1_INFO_PATH)
|
||||||
|
dataset = datasets.load_dataset("parquet", data_dir=v1x_dir / "data", split="train")
|
||||||
|
features = get_features_from_hf_dataset(dataset, robot_config)
|
||||||
|
video_keys = [key for key, ft in features.items() if ft["dtype"] == "video"]
|
||||||
|
|
||||||
|
if single_task and "language_instruction" in dataset.column_names:
|
||||||
|
logging.warning(
|
||||||
|
"'single_task' provided but 'language_instruction' tasks_col found. Using 'language_instruction'.",
|
||||||
|
)
|
||||||
|
single_task = None
|
||||||
|
tasks_col = "language_instruction"
|
||||||
|
|
||||||
|
# Episodes & chunks
|
||||||
|
episode_indices = sorted(dataset.unique("episode_index"))
|
||||||
|
total_episodes = len(episode_indices)
|
||||||
|
assert episode_indices == list(range(total_episodes))
|
||||||
|
total_videos = total_episodes * len(video_keys)
|
||||||
|
total_chunks = total_episodes // DEFAULT_CHUNK_SIZE
|
||||||
|
if total_episodes % DEFAULT_CHUNK_SIZE != 0:
|
||||||
|
total_chunks += 1
|
||||||
|
|
||||||
|
# Tasks
|
||||||
|
if single_task:
|
||||||
|
tasks_by_episodes = {ep_idx: single_task for ep_idx in episode_indices}
|
||||||
|
dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
|
||||||
|
tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
elif tasks_path:
|
||||||
|
tasks_by_episodes = load_json(tasks_path)
|
||||||
|
tasks_by_episodes = {int(ep_idx): task for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
|
||||||
|
tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
elif tasks_col:
|
||||||
|
dataset, tasks, tasks_by_episodes = add_task_index_from_tasks_col(dataset, tasks_col)
|
||||||
|
else:
|
||||||
|
raise ValueError
|
||||||
|
|
||||||
|
assert set(tasks) == {task for ep_tasks in tasks_by_episodes.values() for task in ep_tasks}
|
||||||
|
tasks = [{"task_index": task_idx, "task": task} for task_idx, task in enumerate(tasks)]
|
||||||
|
write_jsonlines(tasks, v20_dir / TASKS_PATH)
|
||||||
|
features["task_index"] = {
|
||||||
|
"dtype": "int64",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
}
|
||||||
|
|
||||||
|
# Videos
|
||||||
|
if video_keys:
|
||||||
|
assert metadata_v1.get("video", False)
|
||||||
|
dataset = dataset.remove_columns(video_keys)
|
||||||
|
clean_gitattr = Path(
|
||||||
|
hub_api.hf_hub_download(
|
||||||
|
repo_id=GITATTRIBUTES_REF, repo_type="dataset", local_dir=local_dir, filename=".gitattributes"
|
||||||
|
)
|
||||||
|
).absolute()
|
||||||
|
with tempfile.TemporaryDirectory() as tmp_video_dir:
|
||||||
|
move_videos(
|
||||||
|
repo_id, video_keys, total_episodes, total_chunks, Path(tmp_video_dir), clean_gitattr, branch
|
||||||
|
)
|
||||||
|
videos_info = get_videos_info(repo_id, v1x_dir, video_keys=video_keys, branch=branch)
|
||||||
|
for key in video_keys:
|
||||||
|
features[key]["shape"] = (
|
||||||
|
videos_info[key].pop("video.height"),
|
||||||
|
videos_info[key].pop("video.width"),
|
||||||
|
videos_info[key].pop("video.channels"),
|
||||||
|
)
|
||||||
|
features[key]["video_info"] = videos_info[key]
|
||||||
|
assert math.isclose(videos_info[key]["video.fps"], metadata_v1["fps"], rel_tol=1e-3)
|
||||||
|
if "encoding" in metadata_v1:
|
||||||
|
assert videos_info[key]["video.pix_fmt"] == metadata_v1["encoding"]["pix_fmt"]
|
||||||
|
else:
|
||||||
|
assert metadata_v1.get("video", 0) == 0
|
||||||
|
videos_info = None
|
||||||
|
|
||||||
|
# Split data into 1 parquet file by episode
|
||||||
|
episode_lengths = split_parquet_by_episodes(dataset, total_episodes, total_chunks, v20_dir)
|
||||||
|
|
||||||
|
if robot_config is not None:
|
||||||
|
robot_type = robot_config.type
|
||||||
|
repo_tags = [robot_type]
|
||||||
|
else:
|
||||||
|
robot_type = "unknown"
|
||||||
|
repo_tags = None
|
||||||
|
|
||||||
|
# Episodes
|
||||||
|
episodes = [
|
||||||
|
{"episode_index": ep_idx, "tasks": tasks_by_episodes[ep_idx], "length": episode_lengths[ep_idx]}
|
||||||
|
for ep_idx in episode_indices
|
||||||
|
]
|
||||||
|
write_jsonlines(episodes, v20_dir / EPISODES_PATH)
|
||||||
|
|
||||||
|
# Assemble metadata v2.0
|
||||||
|
metadata_v2_0 = {
|
||||||
|
"codebase_version": V20,
|
||||||
|
"robot_type": robot_type,
|
||||||
|
"total_episodes": total_episodes,
|
||||||
|
"total_frames": len(dataset),
|
||||||
|
"total_tasks": len(tasks),
|
||||||
|
"total_videos": total_videos,
|
||||||
|
"total_chunks": total_chunks,
|
||||||
|
"chunks_size": DEFAULT_CHUNK_SIZE,
|
||||||
|
"fps": metadata_v1["fps"],
|
||||||
|
"splits": {"train": f"0:{total_episodes}"},
|
||||||
|
"data_path": DEFAULT_PARQUET_PATH,
|
||||||
|
"video_path": DEFAULT_VIDEO_PATH if video_keys else None,
|
||||||
|
"features": features,
|
||||||
|
}
|
||||||
|
write_json(metadata_v2_0, v20_dir / INFO_PATH)
|
||||||
|
convert_stats_to_json(v1x_dir, v20_dir)
|
||||||
|
card = create_lerobot_dataset_card(tags=repo_tags, dataset_info=metadata_v2_0, **card_kwargs)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="data", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta_data", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
hub_api.upload_folder(
|
||||||
|
repo_id=repo_id,
|
||||||
|
path_in_repo="data",
|
||||||
|
folder_path=v20_dir / "data",
|
||||||
|
repo_type="dataset",
|
||||||
|
revision=branch,
|
||||||
|
)
|
||||||
|
hub_api.upload_folder(
|
||||||
|
repo_id=repo_id,
|
||||||
|
path_in_repo="meta",
|
||||||
|
folder_path=v20_dir / "meta",
|
||||||
|
repo_type="dataset",
|
||||||
|
revision=branch,
|
||||||
|
)
|
||||||
|
|
||||||
|
card.push_to_hub(repo_id=repo_id, repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
if not test_branch:
|
||||||
|
create_branch(repo_id=repo_id, branch=V20, repo_type="dataset")
|
||||||
|
|
||||||
|
|
||||||
|
def main():
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
task_args = parser.add_mutually_exclusive_group(required=True)
|
||||||
|
|
||||||
|
parser.add_argument(
|
||||||
|
"--repo-id",
|
||||||
|
type=str,
|
||||||
|
required=True,
|
||||||
|
help="Repository identifier on Hugging Face: a community or a user name `/` the name of the dataset (e.g. `lerobot/pusht`, `cadene/aloha_sim_insertion_human`).",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--single-task",
|
||||||
|
type=str,
|
||||||
|
help="A short but accurate description of the single task performed in the dataset.",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--tasks-col",
|
||||||
|
type=str,
|
||||||
|
help="The name of the column containing language instructions",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--tasks-path",
|
||||||
|
type=Path,
|
||||||
|
help="The path to a .json file containing one language instruction for each episode_index",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--robot",
|
||||||
|
type=str,
|
||||||
|
default=None,
|
||||||
|
help="Robot config used for the dataset during conversion (e.g. 'koch', 'aloha', 'so100', etc.)",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--local-dir",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help="Local directory to store the dataset during conversion. Defaults to /tmp/lerobot_dataset_v2",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--license",
|
||||||
|
type=str,
|
||||||
|
default="apache-2.0",
|
||||||
|
help="Repo license. Must be one of https://huggingface.co/docs/hub/repositories-licenses. Defaults to mit.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--test-branch",
|
||||||
|
type=str,
|
||||||
|
default=None,
|
||||||
|
help="Repo branch to test your conversion first (e.g. 'v2.0.test')",
|
||||||
|
)
|
||||||
|
|
||||||
|
args = parser.parse_args()
|
||||||
|
if not args.local_dir:
|
||||||
|
args.local_dir = Path("/tmp/lerobot_dataset_v2")
|
||||||
|
|
||||||
|
if args.robot is not None:
|
||||||
|
robot_config = make_robot_config(args.robot)
|
||||||
|
|
||||||
|
del args.robot
|
||||||
|
|
||||||
|
convert_dataset(**vars(args), robot_config=robot_config)
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
main()
|
||||||
87
lerobot/common/datasets/v21/_remove_language_instruction.py
Normal file
87
lerobot/common/datasets/v21/_remove_language_instruction.py
Normal file
@@ -0,0 +1,87 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import logging
|
||||||
|
import traceback
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
from datasets import get_dataset_config_info
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
|
||||||
|
from lerobot import available_datasets
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDatasetMetadata
|
||||||
|
from lerobot.common.datasets.utils import INFO_PATH, write_info
|
||||||
|
from lerobot.common.datasets.v21.convert_dataset_v20_to_v21 import V20, SuppressWarnings
|
||||||
|
|
||||||
|
LOCAL_DIR = Path("data/")
|
||||||
|
|
||||||
|
hub_api = HfApi()
|
||||||
|
|
||||||
|
|
||||||
|
def fix_dataset(repo_id: str) -> str:
|
||||||
|
if not hub_api.revision_exists(repo_id, V20, repo_type="dataset"):
|
||||||
|
return f"{repo_id}: skipped (not in {V20})."
|
||||||
|
|
||||||
|
dataset_info = get_dataset_config_info(repo_id, "default")
|
||||||
|
with SuppressWarnings():
|
||||||
|
lerobot_metadata = LeRobotDatasetMetadata(repo_id, revision=V20, force_cache_sync=True)
|
||||||
|
|
||||||
|
meta_features = {key for key, ft in lerobot_metadata.features.items() if ft["dtype"] != "video"}
|
||||||
|
parquet_features = set(dataset_info.features)
|
||||||
|
|
||||||
|
diff_parquet_meta = parquet_features - meta_features
|
||||||
|
diff_meta_parquet = meta_features - parquet_features
|
||||||
|
|
||||||
|
if diff_parquet_meta:
|
||||||
|
raise ValueError(f"In parquet not in info.json: {parquet_features - meta_features}")
|
||||||
|
|
||||||
|
if not diff_meta_parquet:
|
||||||
|
return f"{repo_id}: skipped (no diff)"
|
||||||
|
|
||||||
|
if diff_meta_parquet:
|
||||||
|
logging.warning(f"In info.json not in parquet: {meta_features - parquet_features}")
|
||||||
|
assert diff_meta_parquet == {"language_instruction"}
|
||||||
|
lerobot_metadata.features.pop("language_instruction")
|
||||||
|
write_info(lerobot_metadata.info, lerobot_metadata.root)
|
||||||
|
commit_info = hub_api.upload_file(
|
||||||
|
path_or_fileobj=lerobot_metadata.root / INFO_PATH,
|
||||||
|
path_in_repo=INFO_PATH,
|
||||||
|
repo_id=repo_id,
|
||||||
|
repo_type="dataset",
|
||||||
|
revision=V20,
|
||||||
|
commit_message="Remove 'language_instruction'",
|
||||||
|
create_pr=True,
|
||||||
|
)
|
||||||
|
return f"{repo_id}: success - PR: {commit_info.pr_url}"
|
||||||
|
|
||||||
|
|
||||||
|
def batch_fix():
|
||||||
|
status = {}
|
||||||
|
LOCAL_DIR.mkdir(parents=True, exist_ok=True)
|
||||||
|
logfile = LOCAL_DIR / "fix_features_v20.txt"
|
||||||
|
for num, repo_id in enumerate(available_datasets):
|
||||||
|
print(f"\nConverting {repo_id} ({num}/{len(available_datasets)})")
|
||||||
|
print("---------------------------------------------------------")
|
||||||
|
try:
|
||||||
|
status = fix_dataset(repo_id)
|
||||||
|
except Exception:
|
||||||
|
status = f"{repo_id}: failed\n {traceback.format_exc()}"
|
||||||
|
|
||||||
|
logging.info(status)
|
||||||
|
with open(logfile, "a") as file:
|
||||||
|
file.write(status + "\n")
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
batch_fix()
|
||||||
@@ -0,0 +1,54 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This script is for internal use to convert all datasets under the 'lerobot' hub user account to v2.1.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import traceback
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
|
||||||
|
from lerobot import available_datasets
|
||||||
|
from lerobot.common.datasets.v21.convert_dataset_v20_to_v21 import V21, convert_dataset
|
||||||
|
|
||||||
|
LOCAL_DIR = Path("data/")
|
||||||
|
|
||||||
|
|
||||||
|
def batch_convert():
|
||||||
|
status = {}
|
||||||
|
LOCAL_DIR.mkdir(parents=True, exist_ok=True)
|
||||||
|
logfile = LOCAL_DIR / "conversion_log_v21.txt"
|
||||||
|
hub_api = HfApi()
|
||||||
|
for num, repo_id in enumerate(available_datasets):
|
||||||
|
print(f"\nConverting {repo_id} ({num}/{len(available_datasets)})")
|
||||||
|
print("---------------------------------------------------------")
|
||||||
|
try:
|
||||||
|
if hub_api.revision_exists(repo_id, V21, repo_type="dataset"):
|
||||||
|
status = f"{repo_id}: success (already in {V21})."
|
||||||
|
else:
|
||||||
|
convert_dataset(repo_id)
|
||||||
|
status = f"{repo_id}: success."
|
||||||
|
except Exception:
|
||||||
|
status = f"{repo_id}: failed\n {traceback.format_exc()}"
|
||||||
|
|
||||||
|
with open(logfile, "a") as file:
|
||||||
|
file.write(status + "\n")
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
batch_convert()
|
||||||
114
lerobot/common/datasets/v21/convert_dataset_v20_to_v21.py
Normal file
114
lerobot/common/datasets/v21/convert_dataset_v20_to_v21.py
Normal file
@@ -0,0 +1,114 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This script will help you convert any LeRobot dataset already pushed to the hub from codebase version 2.0 to
|
||||||
|
2.1. It will:
|
||||||
|
|
||||||
|
- Generate per-episodes stats and writes them in `episodes_stats.jsonl`
|
||||||
|
- Check consistency between these new stats and the old ones.
|
||||||
|
- Remove the deprecated `stats.json`.
|
||||||
|
- Update codebase_version in `info.json`.
|
||||||
|
- Push this new version to the hub on the 'main' branch and tags it with "v2.1".
|
||||||
|
|
||||||
|
Usage:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v21/convert_dataset_v20_to_v21.py \
|
||||||
|
--repo-id=aliberts/koch_tutorial
|
||||||
|
```
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import logging
|
||||||
|
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION, LeRobotDataset
|
||||||
|
from lerobot.common.datasets.utils import EPISODES_STATS_PATH, STATS_PATH, load_stats, write_info
|
||||||
|
from lerobot.common.datasets.v21.convert_stats import check_aggregate_stats, convert_stats
|
||||||
|
|
||||||
|
V20 = "v2.0"
|
||||||
|
V21 = "v2.1"
|
||||||
|
|
||||||
|
|
||||||
|
class SuppressWarnings:
|
||||||
|
def __enter__(self):
|
||||||
|
self.previous_level = logging.getLogger().getEffectiveLevel()
|
||||||
|
logging.getLogger().setLevel(logging.ERROR)
|
||||||
|
|
||||||
|
def __exit__(self, exc_type, exc_val, exc_tb):
|
||||||
|
logging.getLogger().setLevel(self.previous_level)
|
||||||
|
|
||||||
|
|
||||||
|
def convert_dataset(
|
||||||
|
repo_id: str,
|
||||||
|
branch: str | None = None,
|
||||||
|
num_workers: int = 4,
|
||||||
|
):
|
||||||
|
with SuppressWarnings():
|
||||||
|
dataset = LeRobotDataset(repo_id, revision=V20, force_cache_sync=True)
|
||||||
|
|
||||||
|
if (dataset.root / EPISODES_STATS_PATH).is_file():
|
||||||
|
(dataset.root / EPISODES_STATS_PATH).unlink()
|
||||||
|
|
||||||
|
convert_stats(dataset, num_workers=num_workers)
|
||||||
|
ref_stats = load_stats(dataset.root)
|
||||||
|
check_aggregate_stats(dataset, ref_stats)
|
||||||
|
|
||||||
|
dataset.meta.info["codebase_version"] = CODEBASE_VERSION
|
||||||
|
write_info(dataset.meta.info, dataset.root)
|
||||||
|
|
||||||
|
dataset.push_to_hub(branch=branch, tag_version=False, allow_patterns="meta/")
|
||||||
|
|
||||||
|
# delete old stats.json file
|
||||||
|
if (dataset.root / STATS_PATH).is_file:
|
||||||
|
(dataset.root / STATS_PATH).unlink()
|
||||||
|
|
||||||
|
hub_api = HfApi()
|
||||||
|
if hub_api.file_exists(
|
||||||
|
repo_id=dataset.repo_id, filename=STATS_PATH, revision=branch, repo_type="dataset"
|
||||||
|
):
|
||||||
|
hub_api.delete_file(
|
||||||
|
path_in_repo=STATS_PATH, repo_id=dataset.repo_id, revision=branch, repo_type="dataset"
|
||||||
|
)
|
||||||
|
|
||||||
|
hub_api.create_tag(repo_id, tag=CODEBASE_VERSION, revision=branch, repo_type="dataset")
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
parser.add_argument(
|
||||||
|
"--repo-id",
|
||||||
|
type=str,
|
||||||
|
required=True,
|
||||||
|
help="Repository identifier on Hugging Face: a community or a user name `/` the name of the dataset "
|
||||||
|
"(e.g. `lerobot/pusht`, `cadene/aloha_sim_insertion_human`).",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--branch",
|
||||||
|
type=str,
|
||||||
|
default=None,
|
||||||
|
help="Repo branch to push your dataset. Defaults to the main branch.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--num-workers",
|
||||||
|
type=int,
|
||||||
|
default=4,
|
||||||
|
help="Number of workers for parallelizing stats compute. Defaults to 4.",
|
||||||
|
)
|
||||||
|
|
||||||
|
args = parser.parse_args()
|
||||||
|
convert_dataset(**vars(args))
|
||||||
99
lerobot/common/datasets/v21/convert_stats.py
Normal file
99
lerobot/common/datasets/v21/convert_stats.py
Normal file
@@ -0,0 +1,99 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from concurrent.futures import ThreadPoolExecutor, as_completed
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
from tqdm import tqdm
|
||||||
|
|
||||||
|
from lerobot.common.datasets.compute_stats import aggregate_stats, get_feature_stats, sample_indices
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
from lerobot.common.datasets.utils import write_episode_stats
|
||||||
|
|
||||||
|
|
||||||
|
def sample_episode_video_frames(dataset: LeRobotDataset, episode_index: int, ft_key: str) -> np.ndarray:
|
||||||
|
ep_len = dataset.meta.episodes[episode_index]["length"]
|
||||||
|
sampled_indices = sample_indices(ep_len)
|
||||||
|
query_timestamps = dataset._get_query_timestamps(0.0, {ft_key: sampled_indices})
|
||||||
|
video_frames = dataset._query_videos(query_timestamps, episode_index)
|
||||||
|
return video_frames[ft_key].numpy()
|
||||||
|
|
||||||
|
|
||||||
|
def convert_episode_stats(dataset: LeRobotDataset, ep_idx: int):
|
||||||
|
ep_start_idx = dataset.episode_data_index["from"][ep_idx]
|
||||||
|
ep_end_idx = dataset.episode_data_index["to"][ep_idx]
|
||||||
|
ep_data = dataset.hf_dataset.select(range(ep_start_idx, ep_end_idx))
|
||||||
|
|
||||||
|
ep_stats = {}
|
||||||
|
for key, ft in dataset.features.items():
|
||||||
|
if ft["dtype"] == "video":
|
||||||
|
# We sample only for videos
|
||||||
|
ep_ft_data = sample_episode_video_frames(dataset, ep_idx, key)
|
||||||
|
else:
|
||||||
|
ep_ft_data = np.array(ep_data[key])
|
||||||
|
|
||||||
|
axes_to_reduce = (0, 2, 3) if ft["dtype"] in ["image", "video"] else 0
|
||||||
|
keepdims = True if ft["dtype"] in ["image", "video"] else ep_ft_data.ndim == 1
|
||||||
|
ep_stats[key] = get_feature_stats(ep_ft_data, axis=axes_to_reduce, keepdims=keepdims)
|
||||||
|
|
||||||
|
if ft["dtype"] in ["image", "video"]: # remove batch dim
|
||||||
|
ep_stats[key] = {
|
||||||
|
k: v if k == "count" else np.squeeze(v, axis=0) for k, v in ep_stats[key].items()
|
||||||
|
}
|
||||||
|
|
||||||
|
dataset.meta.episodes_stats[ep_idx] = ep_stats
|
||||||
|
|
||||||
|
|
||||||
|
def convert_stats(dataset: LeRobotDataset, num_workers: int = 0):
|
||||||
|
assert dataset.episodes is None
|
||||||
|
print("Computing episodes stats")
|
||||||
|
total_episodes = dataset.meta.total_episodes
|
||||||
|
if num_workers > 0:
|
||||||
|
with ThreadPoolExecutor(max_workers=num_workers) as executor:
|
||||||
|
futures = {
|
||||||
|
executor.submit(convert_episode_stats, dataset, ep_idx): ep_idx
|
||||||
|
for ep_idx in range(total_episodes)
|
||||||
|
}
|
||||||
|
for future in tqdm(as_completed(futures), total=total_episodes):
|
||||||
|
future.result()
|
||||||
|
else:
|
||||||
|
for ep_idx in tqdm(range(total_episodes)):
|
||||||
|
convert_episode_stats(dataset, ep_idx)
|
||||||
|
|
||||||
|
for ep_idx in tqdm(range(total_episodes)):
|
||||||
|
write_episode_stats(ep_idx, dataset.meta.episodes_stats[ep_idx], dataset.root)
|
||||||
|
|
||||||
|
|
||||||
|
def check_aggregate_stats(
|
||||||
|
dataset: LeRobotDataset,
|
||||||
|
reference_stats: dict[str, dict[str, np.ndarray]],
|
||||||
|
video_rtol_atol: tuple[float] = (1e-2, 1e-2),
|
||||||
|
default_rtol_atol: tuple[float] = (5e-6, 6e-5),
|
||||||
|
):
|
||||||
|
"""Verifies that the aggregated stats from episodes_stats are close to reference stats."""
|
||||||
|
agg_stats = aggregate_stats(list(dataset.meta.episodes_stats.values()))
|
||||||
|
for key, ft in dataset.features.items():
|
||||||
|
# These values might need some fine-tuning
|
||||||
|
if ft["dtype"] == "video":
|
||||||
|
# to account for image sub-sampling
|
||||||
|
rtol, atol = video_rtol_atol
|
||||||
|
else:
|
||||||
|
rtol, atol = default_rtol_atol
|
||||||
|
|
||||||
|
for stat, val in agg_stats[key].items():
|
||||||
|
if key in reference_stats and stat in reference_stats[key]:
|
||||||
|
err_msg = f"feature='{key}' stats='{stat}'"
|
||||||
|
np.testing.assert_allclose(
|
||||||
|
val, reference_stats[key][stat], rtol=rtol, atol=atol, err_msg=err_msg
|
||||||
|
)
|
||||||
@@ -13,6 +13,7 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
import json
|
||||||
import logging
|
import logging
|
||||||
import subprocess
|
import subprocess
|
||||||
import warnings
|
import warnings
|
||||||
@@ -25,47 +26,11 @@ import pyarrow as pa
|
|||||||
import torch
|
import torch
|
||||||
import torchvision
|
import torchvision
|
||||||
from datasets.features.features import register_feature
|
from datasets.features.features import register_feature
|
||||||
|
from PIL import Image
|
||||||
|
|
||||||
def load_from_videos(
|
|
||||||
item: dict[str, torch.Tensor],
|
|
||||||
video_frame_keys: list[str],
|
|
||||||
videos_dir: Path,
|
|
||||||
tolerance_s: float,
|
|
||||||
backend: str = "pyav",
|
|
||||||
):
|
|
||||||
"""Note: When using data workers (e.g. DataLoader with num_workers>0), do not call this function
|
|
||||||
in the main process (e.g. by using a second Dataloader with num_workers=0). It will result in a Segmentation Fault.
|
|
||||||
This probably happens because a memory reference to the video loader is created in the main process and a
|
|
||||||
subprocess fails to access it.
|
|
||||||
"""
|
|
||||||
# since video path already contains "videos" (e.g. videos_dir="data/videos", path="videos/episode_0.mp4")
|
|
||||||
data_dir = videos_dir.parent
|
|
||||||
|
|
||||||
for key in video_frame_keys:
|
|
||||||
if isinstance(item[key], list):
|
|
||||||
# load multiple frames at once (expected when delta_timestamps is not None)
|
|
||||||
timestamps = [frame["timestamp"] for frame in item[key]]
|
|
||||||
paths = [frame["path"] for frame in item[key]]
|
|
||||||
if len(set(paths)) > 1:
|
|
||||||
raise NotImplementedError("All video paths are expected to be the same for now.")
|
|
||||||
video_path = data_dir / paths[0]
|
|
||||||
|
|
||||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
|
|
||||||
item[key] = frames
|
|
||||||
else:
|
|
||||||
# load one frame
|
|
||||||
timestamps = [item[key]["timestamp"]]
|
|
||||||
video_path = data_dir / item[key]["path"]
|
|
||||||
|
|
||||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
|
|
||||||
item[key] = frames[0]
|
|
||||||
|
|
||||||
return item
|
|
||||||
|
|
||||||
|
|
||||||
def decode_video_frames_torchvision(
|
def decode_video_frames_torchvision(
|
||||||
video_path: str,
|
video_path: Path | str,
|
||||||
timestamps: list[float],
|
timestamps: list[float],
|
||||||
tolerance_s: float,
|
tolerance_s: float,
|
||||||
backend: str = "pyav",
|
backend: str = "pyav",
|
||||||
@@ -104,11 +69,11 @@ def decode_video_frames_torchvision(
|
|||||||
|
|
||||||
# set the first and last requested timestamps
|
# set the first and last requested timestamps
|
||||||
# Note: previous timestamps are usually loaded, since we need to access the previous key frame
|
# Note: previous timestamps are usually loaded, since we need to access the previous key frame
|
||||||
first_ts = timestamps[0]
|
first_ts = min(timestamps)
|
||||||
last_ts = timestamps[-1]
|
last_ts = max(timestamps)
|
||||||
|
|
||||||
# access closest key frame of the first requested frame
|
# access closest key frame of the first requested frame
|
||||||
# Note: closest key frame timestamp is usally smaller than `first_ts` (e.g. key frame can be the first frame of the video)
|
# Note: closest key frame timestamp is usually smaller than `first_ts` (e.g. key frame can be the first frame of the video)
|
||||||
# for details on what `seek` is doing see: https://pyav.basswood-io.com/docs/stable/api/container.html?highlight=inputcontainer#av.container.InputContainer.seek
|
# for details on what `seek` is doing see: https://pyav.basswood-io.com/docs/stable/api/container.html?highlight=inputcontainer#av.container.InputContainer.seek
|
||||||
reader.seek(first_ts, keyframes_only=keyframes_only)
|
reader.seek(first_ts, keyframes_only=keyframes_only)
|
||||||
|
|
||||||
@@ -163,8 +128,8 @@ def decode_video_frames_torchvision(
|
|||||||
|
|
||||||
|
|
||||||
def encode_video_frames(
|
def encode_video_frames(
|
||||||
imgs_dir: Path,
|
imgs_dir: Path | str,
|
||||||
video_path: Path,
|
video_path: Path | str,
|
||||||
fps: int,
|
fps: int,
|
||||||
vcodec: str = "libsvtav1",
|
vcodec: str = "libsvtav1",
|
||||||
pix_fmt: str = "yuv420p",
|
pix_fmt: str = "yuv420p",
|
||||||
@@ -247,3 +212,104 @@ with warnings.catch_warnings():
|
|||||||
)
|
)
|
||||||
# to make VideoFrame available in HuggingFace `datasets`
|
# to make VideoFrame available in HuggingFace `datasets`
|
||||||
register_feature(VideoFrame, "VideoFrame")
|
register_feature(VideoFrame, "VideoFrame")
|
||||||
|
|
||||||
|
|
||||||
|
def get_audio_info(video_path: Path | str) -> dict:
|
||||||
|
ffprobe_audio_cmd = [
|
||||||
|
"ffprobe",
|
||||||
|
"-v",
|
||||||
|
"error",
|
||||||
|
"-select_streams",
|
||||||
|
"a:0",
|
||||||
|
"-show_entries",
|
||||||
|
"stream=channels,codec_name,bit_rate,sample_rate,bit_depth,channel_layout,duration",
|
||||||
|
"-of",
|
||||||
|
"json",
|
||||||
|
str(video_path),
|
||||||
|
]
|
||||||
|
result = subprocess.run(ffprobe_audio_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True)
|
||||||
|
if result.returncode != 0:
|
||||||
|
raise RuntimeError(f"Error running ffprobe: {result.stderr}")
|
||||||
|
|
||||||
|
info = json.loads(result.stdout)
|
||||||
|
audio_stream_info = info["streams"][0] if info.get("streams") else None
|
||||||
|
if audio_stream_info is None:
|
||||||
|
return {"has_audio": False}
|
||||||
|
|
||||||
|
# Return the information, defaulting to None if no audio stream is present
|
||||||
|
return {
|
||||||
|
"has_audio": True,
|
||||||
|
"audio.channels": audio_stream_info.get("channels", None),
|
||||||
|
"audio.codec": audio_stream_info.get("codec_name", None),
|
||||||
|
"audio.bit_rate": int(audio_stream_info["bit_rate"]) if audio_stream_info.get("bit_rate") else None,
|
||||||
|
"audio.sample_rate": int(audio_stream_info["sample_rate"])
|
||||||
|
if audio_stream_info.get("sample_rate")
|
||||||
|
else None,
|
||||||
|
"audio.bit_depth": audio_stream_info.get("bit_depth", None),
|
||||||
|
"audio.channel_layout": audio_stream_info.get("channel_layout", None),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def get_video_info(video_path: Path | str) -> dict:
|
||||||
|
ffprobe_video_cmd = [
|
||||||
|
"ffprobe",
|
||||||
|
"-v",
|
||||||
|
"error",
|
||||||
|
"-select_streams",
|
||||||
|
"v:0",
|
||||||
|
"-show_entries",
|
||||||
|
"stream=r_frame_rate,width,height,codec_name,nb_frames,duration,pix_fmt",
|
||||||
|
"-of",
|
||||||
|
"json",
|
||||||
|
str(video_path),
|
||||||
|
]
|
||||||
|
result = subprocess.run(ffprobe_video_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True)
|
||||||
|
if result.returncode != 0:
|
||||||
|
raise RuntimeError(f"Error running ffprobe: {result.stderr}")
|
||||||
|
|
||||||
|
info = json.loads(result.stdout)
|
||||||
|
video_stream_info = info["streams"][0]
|
||||||
|
|
||||||
|
# Calculate fps from r_frame_rate
|
||||||
|
r_frame_rate = video_stream_info["r_frame_rate"]
|
||||||
|
num, denom = map(int, r_frame_rate.split("/"))
|
||||||
|
fps = num / denom
|
||||||
|
|
||||||
|
pixel_channels = get_video_pixel_channels(video_stream_info["pix_fmt"])
|
||||||
|
|
||||||
|
video_info = {
|
||||||
|
"video.fps": fps,
|
||||||
|
"video.height": video_stream_info["height"],
|
||||||
|
"video.width": video_stream_info["width"],
|
||||||
|
"video.channels": pixel_channels,
|
||||||
|
"video.codec": video_stream_info["codec_name"],
|
||||||
|
"video.pix_fmt": video_stream_info["pix_fmt"],
|
||||||
|
"video.is_depth_map": False,
|
||||||
|
**get_audio_info(video_path),
|
||||||
|
}
|
||||||
|
|
||||||
|
return video_info
|
||||||
|
|
||||||
|
|
||||||
|
def get_video_pixel_channels(pix_fmt: str) -> int:
|
||||||
|
if "gray" in pix_fmt or "depth" in pix_fmt or "monochrome" in pix_fmt:
|
||||||
|
return 1
|
||||||
|
elif "rgba" in pix_fmt or "yuva" in pix_fmt:
|
||||||
|
return 4
|
||||||
|
elif "rgb" in pix_fmt or "yuv" in pix_fmt:
|
||||||
|
return 3
|
||||||
|
else:
|
||||||
|
raise ValueError("Unknown format")
|
||||||
|
|
||||||
|
|
||||||
|
def get_image_pixel_channels(image: Image):
|
||||||
|
if image.mode == "L":
|
||||||
|
return 1 # Grayscale
|
||||||
|
elif image.mode == "LA":
|
||||||
|
return 2 # Grayscale + Alpha
|
||||||
|
elif image.mode == "RGB":
|
||||||
|
return 3 # RGB
|
||||||
|
elif image.mode == "RGBA":
|
||||||
|
return 4 # RGBA
|
||||||
|
else:
|
||||||
|
raise ValueError("Unknown format")
|
||||||
|
|||||||
15
lerobot/common/envs/__init__.py
Normal file
15
lerobot/common/envs/__init__.py
Normal file
@@ -0,0 +1,15 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from .configs import AlohaEnv, EnvConfig, PushtEnv, XarmEnv # noqa: F401
|
||||||
156
lerobot/common/envs/configs.py
Normal file
156
lerobot/common/envs/configs.py
Normal file
@@ -0,0 +1,156 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import abc
|
||||||
|
from dataclasses import dataclass, field
|
||||||
|
|
||||||
|
import draccus
|
||||||
|
|
||||||
|
from lerobot.common.constants import ACTION, OBS_ENV_STATE, OBS_IMAGE, OBS_IMAGES, OBS_STATE
|
||||||
|
from lerobot.configs.types import FeatureType, PolicyFeature
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class EnvConfig(draccus.ChoiceRegistry, abc.ABC):
|
||||||
|
task: str | None = None
|
||||||
|
fps: int = 30
|
||||||
|
features: dict[str, PolicyFeature] = field(default_factory=dict)
|
||||||
|
features_map: dict[str, str] = field(default_factory=dict)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def type(self) -> str:
|
||||||
|
return self.get_choice_name(self.__class__)
|
||||||
|
|
||||||
|
@abc.abstractproperty
|
||||||
|
def gym_kwargs(self) -> dict:
|
||||||
|
raise NotImplementedError()
|
||||||
|
|
||||||
|
|
||||||
|
@EnvConfig.register_subclass("aloha")
|
||||||
|
@dataclass
|
||||||
|
class AlohaEnv(EnvConfig):
|
||||||
|
task: str = "AlohaInsertion-v0"
|
||||||
|
fps: int = 50
|
||||||
|
episode_length: int = 400
|
||||||
|
obs_type: str = "pixels_agent_pos"
|
||||||
|
render_mode: str = "rgb_array"
|
||||||
|
features: dict[str, PolicyFeature] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"action": PolicyFeature(type=FeatureType.ACTION, shape=(14,)),
|
||||||
|
}
|
||||||
|
)
|
||||||
|
features_map: dict[str, str] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"action": ACTION,
|
||||||
|
"agent_pos": OBS_STATE,
|
||||||
|
"top": f"{OBS_IMAGE}.top",
|
||||||
|
"pixels/top": f"{OBS_IMAGES}.top",
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
if self.obs_type == "pixels":
|
||||||
|
self.features["top"] = PolicyFeature(type=FeatureType.VISUAL, shape=(480, 640, 3))
|
||||||
|
elif self.obs_type == "pixels_agent_pos":
|
||||||
|
self.features["agent_pos"] = PolicyFeature(type=FeatureType.STATE, shape=(14,))
|
||||||
|
self.features["pixels/top"] = PolicyFeature(type=FeatureType.VISUAL, shape=(480, 640, 3))
|
||||||
|
|
||||||
|
@property
|
||||||
|
def gym_kwargs(self) -> dict:
|
||||||
|
return {
|
||||||
|
"obs_type": self.obs_type,
|
||||||
|
"render_mode": self.render_mode,
|
||||||
|
"max_episode_steps": self.episode_length,
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@EnvConfig.register_subclass("pusht")
|
||||||
|
@dataclass
|
||||||
|
class PushtEnv(EnvConfig):
|
||||||
|
task: str = "PushT-v0"
|
||||||
|
fps: int = 10
|
||||||
|
episode_length: int = 300
|
||||||
|
obs_type: str = "pixels_agent_pos"
|
||||||
|
render_mode: str = "rgb_array"
|
||||||
|
visualization_width: int = 384
|
||||||
|
visualization_height: int = 384
|
||||||
|
features: dict[str, PolicyFeature] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"action": PolicyFeature(type=FeatureType.ACTION, shape=(2,)),
|
||||||
|
"agent_pos": PolicyFeature(type=FeatureType.STATE, shape=(2,)),
|
||||||
|
}
|
||||||
|
)
|
||||||
|
features_map: dict[str, str] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"action": ACTION,
|
||||||
|
"agent_pos": OBS_STATE,
|
||||||
|
"environment_state": OBS_ENV_STATE,
|
||||||
|
"pixels": OBS_IMAGE,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
if self.obs_type == "pixels_agent_pos":
|
||||||
|
self.features["pixels"] = PolicyFeature(type=FeatureType.VISUAL, shape=(384, 384, 3))
|
||||||
|
elif self.obs_type == "environment_state_agent_pos":
|
||||||
|
self.features["environment_state"] = PolicyFeature(type=FeatureType.ENV, shape=(16,))
|
||||||
|
|
||||||
|
@property
|
||||||
|
def gym_kwargs(self) -> dict:
|
||||||
|
return {
|
||||||
|
"obs_type": self.obs_type,
|
||||||
|
"render_mode": self.render_mode,
|
||||||
|
"visualization_width": self.visualization_width,
|
||||||
|
"visualization_height": self.visualization_height,
|
||||||
|
"max_episode_steps": self.episode_length,
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@EnvConfig.register_subclass("xarm")
|
||||||
|
@dataclass
|
||||||
|
class XarmEnv(EnvConfig):
|
||||||
|
task: str = "XarmLift-v0"
|
||||||
|
fps: int = 15
|
||||||
|
episode_length: int = 200
|
||||||
|
obs_type: str = "pixels_agent_pos"
|
||||||
|
render_mode: str = "rgb_array"
|
||||||
|
visualization_width: int = 384
|
||||||
|
visualization_height: int = 384
|
||||||
|
features: dict[str, PolicyFeature] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"action": PolicyFeature(type=FeatureType.ACTION, shape=(4,)),
|
||||||
|
"pixels": PolicyFeature(type=FeatureType.VISUAL, shape=(84, 84, 3)),
|
||||||
|
}
|
||||||
|
)
|
||||||
|
features_map: dict[str, str] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"action": ACTION,
|
||||||
|
"agent_pos": OBS_STATE,
|
||||||
|
"pixels": OBS_IMAGE,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
if self.obs_type == "pixels_agent_pos":
|
||||||
|
self.features["agent_pos"] = PolicyFeature(type=FeatureType.STATE, shape=(4,))
|
||||||
|
|
||||||
|
@property
|
||||||
|
def gym_kwargs(self) -> dict:
|
||||||
|
return {
|
||||||
|
"obs_type": self.obs_type,
|
||||||
|
"render_mode": self.render_mode,
|
||||||
|
"visualization_width": self.visualization_width,
|
||||||
|
"visualization_height": self.visualization_height,
|
||||||
|
"max_episode_steps": self.episode_length,
|
||||||
|
}
|
||||||
@@ -16,43 +16,54 @@
|
|||||||
import importlib
|
import importlib
|
||||||
|
|
||||||
import gymnasium as gym
|
import gymnasium as gym
|
||||||
from omegaconf import DictConfig
|
|
||||||
|
from lerobot.common.envs.configs import AlohaEnv, EnvConfig, PushtEnv, XarmEnv
|
||||||
|
|
||||||
|
|
||||||
def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv | None:
|
def make_env_config(env_type: str, **kwargs) -> EnvConfig:
|
||||||
"""Makes a gym vector environment according to the evaluation config.
|
if env_type == "aloha":
|
||||||
|
return AlohaEnv(**kwargs)
|
||||||
|
elif env_type == "pusht":
|
||||||
|
return PushtEnv(**kwargs)
|
||||||
|
elif env_type == "xarm":
|
||||||
|
return XarmEnv(**kwargs)
|
||||||
|
else:
|
||||||
|
raise ValueError(f"Policy type '{env_type}' is not available.")
|
||||||
|
|
||||||
n_envs can be used to override eval.batch_size in the configuration. Must be at least 1.
|
|
||||||
|
def make_env(cfg: EnvConfig, n_envs: int = 1, use_async_envs: bool = False) -> gym.vector.VectorEnv | None:
|
||||||
|
"""Makes a gym vector environment according to the config.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
cfg (EnvConfig): the config of the environment to instantiate.
|
||||||
|
n_envs (int, optional): The number of parallelized env to return. Defaults to 1.
|
||||||
|
use_async_envs (bool, optional): Whether to return an AsyncVectorEnv or a SyncVectorEnv. Defaults to
|
||||||
|
False.
|
||||||
|
|
||||||
|
Raises:
|
||||||
|
ValueError: if n_envs < 1
|
||||||
|
ModuleNotFoundError: If the requested env package is not installed
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
gym.vector.VectorEnv: The parallelized gym.env instance.
|
||||||
"""
|
"""
|
||||||
if n_envs is not None and n_envs < 1:
|
if n_envs < 1:
|
||||||
raise ValueError("`n_envs must be at least 1")
|
raise ValueError("`n_envs must be at least 1")
|
||||||
|
|
||||||
if cfg.env.name == "real_world":
|
package_name = f"gym_{cfg.type}"
|
||||||
return
|
|
||||||
|
|
||||||
package_name = f"gym_{cfg.env.name}"
|
|
||||||
|
|
||||||
try:
|
try:
|
||||||
importlib.import_module(package_name)
|
importlib.import_module(package_name)
|
||||||
except ModuleNotFoundError as e:
|
except ModuleNotFoundError as e:
|
||||||
print(
|
print(f"{package_name} is not installed. Please install it with `pip install 'lerobot[{cfg.type}]'`")
|
||||||
f"{package_name} is not installed. Please install it with `pip install 'lerobot[{cfg.env.name}]'`"
|
|
||||||
)
|
|
||||||
raise e
|
raise e
|
||||||
|
|
||||||
gym_handle = f"{package_name}/{cfg.env.task}"
|
gym_handle = f"{package_name}/{cfg.task}"
|
||||||
gym_kwgs = dict(cfg.env.get("gym", {}))
|
|
||||||
|
|
||||||
if cfg.env.get("episode_length"):
|
|
||||||
gym_kwgs["max_episode_steps"] = cfg.env.episode_length
|
|
||||||
|
|
||||||
# batched version of the env that returns an observation of shape (b, c)
|
# batched version of the env that returns an observation of shape (b, c)
|
||||||
env_cls = gym.vector.AsyncVectorEnv if cfg.eval.use_async_envs else gym.vector.SyncVectorEnv
|
env_cls = gym.vector.AsyncVectorEnv if use_async_envs else gym.vector.SyncVectorEnv
|
||||||
env = env_cls(
|
env = env_cls(
|
||||||
[
|
[lambda: gym.make(gym_handle, disable_env_checker=True, **cfg.gym_kwargs) for _ in range(n_envs)]
|
||||||
lambda: gym.make(gym_handle, disable_env_checker=True, **gym_kwgs)
|
|
||||||
for _ in range(n_envs if n_envs is not None else cfg.eval.batch_size)
|
|
||||||
]
|
|
||||||
)
|
)
|
||||||
|
|
||||||
return env
|
return env
|
||||||
|
|||||||
@@ -18,8 +18,13 @@ import numpy as np
|
|||||||
import torch
|
import torch
|
||||||
from torch import Tensor
|
from torch import Tensor
|
||||||
|
|
||||||
|
from lerobot.common.envs.configs import EnvConfig
|
||||||
|
from lerobot.common.utils.utils import get_channel_first_image_shape
|
||||||
|
from lerobot.configs.types import FeatureType, PolicyFeature
|
||||||
|
|
||||||
|
|
||||||
def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Tensor]:
|
def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Tensor]:
|
||||||
|
# TODO(aliberts, rcadene): refactor this to use features from the environment (no hardcoding)
|
||||||
"""Convert environment observation to LeRobot format observation.
|
"""Convert environment observation to LeRobot format observation.
|
||||||
Args:
|
Args:
|
||||||
observation: Dictionary of observation batches from a Gym vector environment.
|
observation: Dictionary of observation batches from a Gym vector environment.
|
||||||
@@ -35,11 +40,12 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
|
|||||||
imgs = {"observation.image": observations["pixels"]}
|
imgs = {"observation.image": observations["pixels"]}
|
||||||
|
|
||||||
for imgkey, img in imgs.items():
|
for imgkey, img in imgs.items():
|
||||||
|
# TODO(aliberts, rcadene): use transforms.ToTensor()?
|
||||||
img = torch.from_numpy(img)
|
img = torch.from_numpy(img)
|
||||||
|
|
||||||
# sanity check that images are channel last
|
# sanity check that images are channel last
|
||||||
_, h, w, c = img.shape
|
_, h, w, c = img.shape
|
||||||
assert c < h and c < w, f"expect channel first images, but instead {img.shape}"
|
assert c < h and c < w, f"expect channel last images, but instead got {img.shape=}"
|
||||||
|
|
||||||
# sanity check that images are uint8
|
# sanity check that images are uint8
|
||||||
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
||||||
@@ -60,3 +66,23 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
|
|||||||
# requirement for "agent_pos"
|
# requirement for "agent_pos"
|
||||||
return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
|
return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
|
||||||
return return_observations
|
return return_observations
|
||||||
|
|
||||||
|
|
||||||
|
def env_to_policy_features(env_cfg: EnvConfig) -> dict[str, PolicyFeature]:
|
||||||
|
# TODO(aliberts, rcadene): remove this hardcoding of keys and just use the nested keys as is
|
||||||
|
# (need to also refactor preprocess_observation and externalize normalization from policies)
|
||||||
|
policy_features = {}
|
||||||
|
for key, ft in env_cfg.features.items():
|
||||||
|
if ft.type is FeatureType.VISUAL:
|
||||||
|
if len(ft.shape) != 3:
|
||||||
|
raise ValueError(f"Number of dimensions of {key} != 3 (shape={ft.shape})")
|
||||||
|
|
||||||
|
shape = get_channel_first_image_shape(ft.shape)
|
||||||
|
feature = PolicyFeature(type=ft.type, shape=shape)
|
||||||
|
else:
|
||||||
|
feature = ft
|
||||||
|
|
||||||
|
policy_key = env_cfg.features_map[key]
|
||||||
|
policy_features[policy_key] = feature
|
||||||
|
|
||||||
|
return policy_features
|
||||||
|
|||||||
17
lerobot/common/errors.py
Normal file
17
lerobot/common/errors.py
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
class DeviceNotConnectedError(ConnectionError):
|
||||||
|
"""Exception raised when the device is not connected."""
|
||||||
|
|
||||||
|
def __init__(self, message="This device is not connected. Try calling `connect()` first."):
|
||||||
|
self.message = message
|
||||||
|
super().__init__(self.message)
|
||||||
|
|
||||||
|
|
||||||
|
class DeviceAlreadyConnectedError(ConnectionError):
|
||||||
|
"""Exception raised when the device is already connected."""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
message="This device is already connected. Try not calling `connect()` twice.",
|
||||||
|
):
|
||||||
|
self.message = message
|
||||||
|
super().__init__(self.message)
|
||||||
@@ -1,246 +0,0 @@
|
|||||||
#!/usr/bin/env python
|
|
||||||
|
|
||||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
"""Borrowed from https://github.com/fyhMer/fowm/blob/main/src/logger.py
|
|
||||||
|
|
||||||
# TODO(rcadene, alexander-soare): clean this file
|
|
||||||
"""
|
|
||||||
|
|
||||||
import logging
|
|
||||||
import os
|
|
||||||
import re
|
|
||||||
from glob import glob
|
|
||||||
from pathlib import Path
|
|
||||||
|
|
||||||
import torch
|
|
||||||
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE
|
|
||||||
from omegaconf import DictConfig, OmegaConf
|
|
||||||
from termcolor import colored
|
|
||||||
from torch.optim import Optimizer
|
|
||||||
from torch.optim.lr_scheduler import LRScheduler
|
|
||||||
|
|
||||||
from lerobot.common.policies.policy_protocol import Policy
|
|
||||||
from lerobot.common.utils.utils import get_global_random_state, set_global_random_state
|
|
||||||
|
|
||||||
|
|
||||||
def log_output_dir(out_dir):
|
|
||||||
logging.info(colored("Output dir:", "yellow", attrs=["bold"]) + f" {out_dir}")
|
|
||||||
|
|
||||||
|
|
||||||
def cfg_to_group(cfg: DictConfig, return_list: bool = False) -> list[str] | str:
|
|
||||||
"""Return a group name for logging. Optionally returns group name as list."""
|
|
||||||
lst = [
|
|
||||||
f"policy:{cfg.policy.name}",
|
|
||||||
f"dataset:{cfg.dataset_repo_id}",
|
|
||||||
f"env:{cfg.env.name}",
|
|
||||||
f"seed:{cfg.seed}",
|
|
||||||
]
|
|
||||||
return lst if return_list else "-".join(lst)
|
|
||||||
|
|
||||||
|
|
||||||
def get_wandb_run_id_from_filesystem(checkpoint_dir: Path) -> str:
|
|
||||||
# Get the WandB run ID.
|
|
||||||
paths = glob(str(checkpoint_dir / "../wandb/latest-run/run-*"))
|
|
||||||
if len(paths) != 1:
|
|
||||||
raise RuntimeError("Couldn't get the previous WandB run ID for run resumption.")
|
|
||||||
match = re.search(r"run-([^\.]+).wandb", paths[0].split("/")[-1])
|
|
||||||
if match is None:
|
|
||||||
raise RuntimeError("Couldn't get the previous WandB run ID for run resumption.")
|
|
||||||
wandb_run_id = match.groups(0)[0]
|
|
||||||
return wandb_run_id
|
|
||||||
|
|
||||||
|
|
||||||
class Logger:
|
|
||||||
"""Primary logger object. Logs either locally or using wandb.
|
|
||||||
|
|
||||||
The logger creates the following directory structure:
|
|
||||||
|
|
||||||
provided_log_dir
|
|
||||||
├── .hydra # hydra's configuration cache
|
|
||||||
├── checkpoints
|
|
||||||
│ ├── specific_checkpoint_name
|
|
||||||
│ │ ├── pretrained_model # Hugging Face pretrained model directory
|
|
||||||
│ │ │ ├── ...
|
|
||||||
│ │ └── training_state.pth # optimizer, scheduler, and random states + training step
|
|
||||||
| ├── another_specific_checkpoint_name
|
|
||||||
│ │ ├── ...
|
|
||||||
| ├── ...
|
|
||||||
│ └── last # a softlink to the last logged checkpoint
|
|
||||||
"""
|
|
||||||
|
|
||||||
pretrained_model_dir_name = "pretrained_model"
|
|
||||||
training_state_file_name = "training_state.pth"
|
|
||||||
|
|
||||||
def __init__(self, cfg: DictConfig, log_dir: str, wandb_job_name: str | None = None):
|
|
||||||
"""
|
|
||||||
Args:
|
|
||||||
log_dir: The directory to save all logs and training outputs to.
|
|
||||||
job_name: The WandB job name.
|
|
||||||
"""
|
|
||||||
self._cfg = cfg
|
|
||||||
self.log_dir = Path(log_dir)
|
|
||||||
self.log_dir.mkdir(parents=True, exist_ok=True)
|
|
||||||
self.checkpoints_dir = self.get_checkpoints_dir(log_dir)
|
|
||||||
self.last_checkpoint_dir = self.get_last_checkpoint_dir(log_dir)
|
|
||||||
self.last_pretrained_model_dir = self.get_last_pretrained_model_dir(log_dir)
|
|
||||||
|
|
||||||
# Set up WandB.
|
|
||||||
self._group = cfg_to_group(cfg)
|
|
||||||
project = cfg.get("wandb", {}).get("project")
|
|
||||||
entity = cfg.get("wandb", {}).get("entity")
|
|
||||||
enable_wandb = cfg.get("wandb", {}).get("enable", False)
|
|
||||||
run_offline = not enable_wandb or not project
|
|
||||||
if run_offline:
|
|
||||||
logging.info(colored("Logs will be saved locally.", "yellow", attrs=["bold"]))
|
|
||||||
self._wandb = None
|
|
||||||
else:
|
|
||||||
os.environ["WANDB_SILENT"] = "true"
|
|
||||||
import wandb
|
|
||||||
|
|
||||||
wandb_run_id = None
|
|
||||||
if cfg.resume:
|
|
||||||
wandb_run_id = get_wandb_run_id_from_filesystem(self.checkpoints_dir)
|
|
||||||
|
|
||||||
wandb.init(
|
|
||||||
id=wandb_run_id,
|
|
||||||
project=project,
|
|
||||||
entity=entity,
|
|
||||||
name=wandb_job_name,
|
|
||||||
notes=cfg.get("wandb", {}).get("notes"),
|
|
||||||
tags=cfg_to_group(cfg, return_list=True),
|
|
||||||
dir=log_dir,
|
|
||||||
config=OmegaConf.to_container(cfg, resolve=True),
|
|
||||||
# TODO(rcadene): try set to True
|
|
||||||
save_code=False,
|
|
||||||
# TODO(rcadene): split train and eval, and run async eval with job_type="eval"
|
|
||||||
job_type="train_eval",
|
|
||||||
resume="must" if cfg.resume else None,
|
|
||||||
)
|
|
||||||
print(colored("Logs will be synced with wandb.", "blue", attrs=["bold"]))
|
|
||||||
logging.info(f"Track this run --> {colored(wandb.run.get_url(), 'yellow', attrs=['bold'])}")
|
|
||||||
self._wandb = wandb
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_checkpoints_dir(cls, log_dir: str | Path) -> Path:
|
|
||||||
"""Given the log directory, get the sub-directory in which checkpoints will be saved."""
|
|
||||||
return Path(log_dir) / "checkpoints"
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_last_checkpoint_dir(cls, log_dir: str | Path) -> Path:
|
|
||||||
"""Given the log directory, get the sub-directory in which the last checkpoint will be saved."""
|
|
||||||
return cls.get_checkpoints_dir(log_dir) / "last"
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_last_pretrained_model_dir(cls, log_dir: str | Path) -> Path:
|
|
||||||
"""
|
|
||||||
Given the log directory, get the sub-directory in which the last checkpoint's pretrained weights will
|
|
||||||
be saved.
|
|
||||||
"""
|
|
||||||
return cls.get_last_checkpoint_dir(log_dir) / cls.pretrained_model_dir_name
|
|
||||||
|
|
||||||
def save_model(self, save_dir: Path, policy: Policy, wandb_artifact_name: str | None = None):
|
|
||||||
"""Save the weights of the Policy model using PyTorchModelHubMixin.
|
|
||||||
|
|
||||||
The weights are saved in a folder called "pretrained_model" under the checkpoint directory.
|
|
||||||
|
|
||||||
Optionally also upload the model to WandB.
|
|
||||||
"""
|
|
||||||
self.checkpoints_dir.mkdir(parents=True, exist_ok=True)
|
|
||||||
policy.save_pretrained(save_dir)
|
|
||||||
# Also save the full Hydra config for the env configuration.
|
|
||||||
OmegaConf.save(self._cfg, save_dir / "config.yaml")
|
|
||||||
if self._wandb and not self._cfg.wandb.disable_artifact:
|
|
||||||
# note wandb artifact does not accept ":" or "/" in its name
|
|
||||||
artifact = self._wandb.Artifact(wandb_artifact_name, type="model")
|
|
||||||
artifact.add_file(save_dir / SAFETENSORS_SINGLE_FILE)
|
|
||||||
self._wandb.log_artifact(artifact)
|
|
||||||
if self.last_checkpoint_dir.exists():
|
|
||||||
os.remove(self.last_checkpoint_dir)
|
|
||||||
|
|
||||||
def save_training_state(
|
|
||||||
self,
|
|
||||||
save_dir: Path,
|
|
||||||
train_step: int,
|
|
||||||
optimizer: Optimizer,
|
|
||||||
scheduler: LRScheduler | None,
|
|
||||||
):
|
|
||||||
"""Checkpoint the global training_step, optimizer state, scheduler state, and random state.
|
|
||||||
|
|
||||||
All of these are saved as "training_state.pth" under the checkpoint directory.
|
|
||||||
"""
|
|
||||||
training_state = {
|
|
||||||
"step": train_step,
|
|
||||||
"optimizer": optimizer.state_dict(),
|
|
||||||
**get_global_random_state(),
|
|
||||||
}
|
|
||||||
if scheduler is not None:
|
|
||||||
training_state["scheduler"] = scheduler.state_dict()
|
|
||||||
torch.save(training_state, save_dir / self.training_state_file_name)
|
|
||||||
|
|
||||||
def save_checkpont(
|
|
||||||
self,
|
|
||||||
train_step: int,
|
|
||||||
policy: Policy,
|
|
||||||
optimizer: Optimizer,
|
|
||||||
scheduler: LRScheduler | None,
|
|
||||||
identifier: str,
|
|
||||||
):
|
|
||||||
"""Checkpoint the model weights and the training state."""
|
|
||||||
checkpoint_dir = self.checkpoints_dir / str(identifier)
|
|
||||||
wandb_artifact_name = (
|
|
||||||
None
|
|
||||||
if self._wandb is None
|
|
||||||
else f"{self._group.replace(':', '_').replace('/', '_')}-{self._cfg.seed}-{identifier}"
|
|
||||||
)
|
|
||||||
self.save_model(
|
|
||||||
checkpoint_dir / self.pretrained_model_dir_name, policy, wandb_artifact_name=wandb_artifact_name
|
|
||||||
)
|
|
||||||
self.save_training_state(checkpoint_dir, train_step, optimizer, scheduler)
|
|
||||||
os.symlink(checkpoint_dir.absolute(), self.last_checkpoint_dir)
|
|
||||||
|
|
||||||
def load_last_training_state(self, optimizer: Optimizer, scheduler: LRScheduler | None) -> int:
|
|
||||||
"""
|
|
||||||
Given the last checkpoint in the logging directory, load the optimizer state, scheduler state, and
|
|
||||||
random state, and return the global training step.
|
|
||||||
"""
|
|
||||||
training_state = torch.load(self.last_checkpoint_dir / self.training_state_file_name)
|
|
||||||
optimizer.load_state_dict(training_state["optimizer"])
|
|
||||||
if scheduler is not None:
|
|
||||||
scheduler.load_state_dict(training_state["scheduler"])
|
|
||||||
elif "scheduler" in training_state:
|
|
||||||
raise ValueError(
|
|
||||||
"The checkpoint contains a scheduler state_dict, but no LRScheduler was provided."
|
|
||||||
)
|
|
||||||
# Small hack to get the expected keys: use `get_global_random_state`.
|
|
||||||
set_global_random_state({k: training_state[k] for k in get_global_random_state()})
|
|
||||||
return training_state["step"]
|
|
||||||
|
|
||||||
def log_dict(self, d, step, mode="train"):
|
|
||||||
assert mode in {"train", "eval"}
|
|
||||||
# TODO(alexander-soare): Add local text log.
|
|
||||||
if self._wandb is not None:
|
|
||||||
for k, v in d.items():
|
|
||||||
if not isinstance(v, (int, float, str)):
|
|
||||||
logging.warning(
|
|
||||||
f'WandB logging of key "{k}" was ignored as its type is not handled by this wrapper.'
|
|
||||||
)
|
|
||||||
continue
|
|
||||||
self._wandb.log({f"{mode}/{k}": v}, step=step)
|
|
||||||
|
|
||||||
def log_video(self, video_path: str, step: int, mode: str = "train"):
|
|
||||||
assert mode in {"train", "eval"}
|
|
||||||
assert self._wandb is not None
|
|
||||||
wandb_video = self._wandb.Video(video_path, fps=self._cfg.fps, format="mp4")
|
|
||||||
self._wandb.log({f"{mode}/video": wandb_video}, step=step)
|
|
||||||
3
lerobot/common/motors/__init__.py
Normal file
3
lerobot/common/motors/__init__.py
Normal file
@@ -0,0 +1,3 @@
|
|||||||
|
from .motors_bus import MotorsBus
|
||||||
|
|
||||||
|
__all__ = ["MotorsBus"]
|
||||||
41
lerobot/common/motors/configs.py
Normal file
41
lerobot/common/motors/configs.py
Normal file
@@ -0,0 +1,41 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import abc
|
||||||
|
from dataclasses import dataclass
|
||||||
|
|
||||||
|
import draccus
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class MotorsBusConfig(draccus.ChoiceRegistry, abc.ABC):
|
||||||
|
@property
|
||||||
|
def type(self) -> str:
|
||||||
|
return self.get_choice_name(self.__class__)
|
||||||
|
|
||||||
|
|
||||||
|
@MotorsBusConfig.register_subclass("dynamixel")
|
||||||
|
@dataclass
|
||||||
|
class DynamixelMotorsBusConfig(MotorsBusConfig):
|
||||||
|
port: str
|
||||||
|
motors: dict[str, tuple[int, str]]
|
||||||
|
mock: bool = False
|
||||||
|
|
||||||
|
|
||||||
|
@MotorsBusConfig.register_subclass("feetech")
|
||||||
|
@dataclass
|
||||||
|
class FeetechMotorsBusConfig(MotorsBusConfig):
|
||||||
|
port: str
|
||||||
|
motors: dict[str, tuple[int, str]]
|
||||||
|
mock: bool = False
|
||||||
4
lerobot/common/motors/dynamixel/__init__.py
Normal file
4
lerobot/common/motors/dynamixel/__init__.py
Normal file
@@ -0,0 +1,4 @@
|
|||||||
|
from .dynamixel import DynamixelMotorsBus, TorqueMode, set_operating_mode
|
||||||
|
from .dynamixel_calibration import run_arm_calibration
|
||||||
|
|
||||||
|
__all__ = ["DynamixelMotorsBus", "TorqueMode", "set_operating_mode", "run_arm_calibration"]
|
||||||
895
lerobot/common/motors/dynamixel/dynamixel.py
Normal file
895
lerobot/common/motors/dynamixel/dynamixel.py
Normal file
@@ -0,0 +1,895 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import enum
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from copy import deepcopy
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import tqdm
|
||||||
|
|
||||||
|
from lerobot.common.errors import DeviceAlreadyConnectedError, DeviceNotConnectedError
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
PROTOCOL_VERSION = 2.0
|
||||||
|
BAUDRATE = 1_000_000
|
||||||
|
TIMEOUT_MS = 1000
|
||||||
|
|
||||||
|
MAX_ID_RANGE = 252
|
||||||
|
|
||||||
|
# The following bounds define the lower and upper joints range (after calibration).
|
||||||
|
# For joints in degree (i.e. revolute joints), their nominal range is [-180, 180] degrees
|
||||||
|
# which corresponds to a half rotation on the left and half rotation on the right.
|
||||||
|
# Some joints might require higher range, so we allow up to [-270, 270] degrees until
|
||||||
|
# an error is raised.
|
||||||
|
LOWER_BOUND_DEGREE = -270
|
||||||
|
UPPER_BOUND_DEGREE = 270
|
||||||
|
# For joints in percentage (i.e. joints that move linearly like the prismatic joint of a gripper),
|
||||||
|
# their nominal range is [0, 100] %. For instance, for Aloha gripper, 0% is fully
|
||||||
|
# closed, and 100% is fully open. To account for slight calibration issue, we allow up to
|
||||||
|
# [-10, 110] until an error is raised.
|
||||||
|
LOWER_BOUND_LINEAR = -10
|
||||||
|
UPPER_BOUND_LINEAR = 110
|
||||||
|
|
||||||
|
HALF_TURN_DEGREE = 180
|
||||||
|
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xl330-m077
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xl330-m288
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xl430-w250
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xm430-w350
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xm540-w270
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xc430-w150
|
||||||
|
|
||||||
|
# data_name: (address, size_byte)
|
||||||
|
X_SERIES_CONTROL_TABLE = {
|
||||||
|
"Model_Number": (0, 2),
|
||||||
|
"Model_Information": (2, 4),
|
||||||
|
"Firmware_Version": (6, 1),
|
||||||
|
"ID": (7, 1),
|
||||||
|
"Baud_Rate": (8, 1),
|
||||||
|
"Return_Delay_Time": (9, 1),
|
||||||
|
"Drive_Mode": (10, 1),
|
||||||
|
"Operating_Mode": (11, 1),
|
||||||
|
"Secondary_ID": (12, 1),
|
||||||
|
"Protocol_Type": (13, 1),
|
||||||
|
"Homing_Offset": (20, 4),
|
||||||
|
"Moving_Threshold": (24, 4),
|
||||||
|
"Temperature_Limit": (31, 1),
|
||||||
|
"Max_Voltage_Limit": (32, 2),
|
||||||
|
"Min_Voltage_Limit": (34, 2),
|
||||||
|
"PWM_Limit": (36, 2),
|
||||||
|
"Current_Limit": (38, 2),
|
||||||
|
"Acceleration_Limit": (40, 4),
|
||||||
|
"Velocity_Limit": (44, 4),
|
||||||
|
"Max_Position_Limit": (48, 4),
|
||||||
|
"Min_Position_Limit": (52, 4),
|
||||||
|
"Shutdown": (63, 1),
|
||||||
|
"Torque_Enable": (64, 1),
|
||||||
|
"LED": (65, 1),
|
||||||
|
"Status_Return_Level": (68, 1),
|
||||||
|
"Registered_Instruction": (69, 1),
|
||||||
|
"Hardware_Error_Status": (70, 1),
|
||||||
|
"Velocity_I_Gain": (76, 2),
|
||||||
|
"Velocity_P_Gain": (78, 2),
|
||||||
|
"Position_D_Gain": (80, 2),
|
||||||
|
"Position_I_Gain": (82, 2),
|
||||||
|
"Position_P_Gain": (84, 2),
|
||||||
|
"Feedforward_2nd_Gain": (88, 2),
|
||||||
|
"Feedforward_1st_Gain": (90, 2),
|
||||||
|
"Bus_Watchdog": (98, 1),
|
||||||
|
"Goal_PWM": (100, 2),
|
||||||
|
"Goal_Current": (102, 2),
|
||||||
|
"Goal_Velocity": (104, 4),
|
||||||
|
"Profile_Acceleration": (108, 4),
|
||||||
|
"Profile_Velocity": (112, 4),
|
||||||
|
"Goal_Position": (116, 4),
|
||||||
|
"Realtime_Tick": (120, 2),
|
||||||
|
"Moving": (122, 1),
|
||||||
|
"Moving_Status": (123, 1),
|
||||||
|
"Present_PWM": (124, 2),
|
||||||
|
"Present_Current": (126, 2),
|
||||||
|
"Present_Velocity": (128, 4),
|
||||||
|
"Present_Position": (132, 4),
|
||||||
|
"Velocity_Trajectory": (136, 4),
|
||||||
|
"Position_Trajectory": (140, 4),
|
||||||
|
"Present_Input_Voltage": (144, 2),
|
||||||
|
"Present_Temperature": (146, 1),
|
||||||
|
}
|
||||||
|
|
||||||
|
X_SERIES_BAUDRATE_TABLE = {
|
||||||
|
0: 9_600,
|
||||||
|
1: 57_600,
|
||||||
|
2: 115_200,
|
||||||
|
3: 1_000_000,
|
||||||
|
4: 2_000_000,
|
||||||
|
5: 3_000_000,
|
||||||
|
6: 4_000_000,
|
||||||
|
}
|
||||||
|
|
||||||
|
CALIBRATION_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
CONVERT_UINT32_TO_INT32_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
|
||||||
|
MODEL_CONTROL_TABLE = {
|
||||||
|
"x_series": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xl330-m077": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xl330-m288": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xl430-w250": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xm430-w350": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xm540-w270": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xc430-w150": X_SERIES_CONTROL_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_RESOLUTION = {
|
||||||
|
"x_series": 4096,
|
||||||
|
"xl330-m077": 4096,
|
||||||
|
"xl330-m288": 4096,
|
||||||
|
"xl430-w250": 4096,
|
||||||
|
"xm430-w350": 4096,
|
||||||
|
"xm540-w270": 4096,
|
||||||
|
"xc430-w150": 4096,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_BAUDRATE_TABLE = {
|
||||||
|
"x_series": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xl330-m077": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xl330-m288": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xl430-w250": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xm430-w350": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xm540-w270": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xc430-w150": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
NUM_READ_RETRY = 10
|
||||||
|
NUM_WRITE_RETRY = 10
|
||||||
|
|
||||||
|
|
||||||
|
def convert_degrees_to_steps(degrees: float | np.ndarray, models: str | list[str]) -> np.ndarray:
|
||||||
|
"""This function converts the degree range to the step range for indicating motors rotation.
|
||||||
|
It assumes a motor achieves a full rotation by going from -180 degree position to +180.
|
||||||
|
The motor resolution (e.g. 4096) corresponds to the number of steps needed to achieve a full rotation.
|
||||||
|
"""
|
||||||
|
resolutions = [MODEL_RESOLUTION[model] for model in models]
|
||||||
|
steps = degrees / 180 * np.array(resolutions) / 2
|
||||||
|
steps = steps.astype(int)
|
||||||
|
return steps
|
||||||
|
|
||||||
|
|
||||||
|
def convert_to_bytes(value, bytes, mock=False):
|
||||||
|
if mock:
|
||||||
|
return value
|
||||||
|
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
# Note: No need to convert back into unsigned int, since this byte preprocessing
|
||||||
|
# already handles it for us.
|
||||||
|
if bytes == 1:
|
||||||
|
data = [
|
||||||
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 2:
|
||||||
|
data = [
|
||||||
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
dxl.DXL_HIBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 4:
|
||||||
|
data = [
|
||||||
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
dxl.DXL_HIBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
dxl.DXL_LOBYTE(dxl.DXL_HIWORD(value)),
|
||||||
|
dxl.DXL_HIBYTE(dxl.DXL_HIWORD(value)),
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"Value of the number of bytes to be sent is expected to be in [1, 2, 4], but "
|
||||||
|
f"{bytes} is provided instead."
|
||||||
|
)
|
||||||
|
return data
|
||||||
|
|
||||||
|
|
||||||
|
def get_group_sync_key(data_name, motor_names):
|
||||||
|
group_key = f"{data_name}_" + "_".join(motor_names)
|
||||||
|
return group_key
|
||||||
|
|
||||||
|
|
||||||
|
def get_result_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
rslt_name = f"{fn_name}_{group_key}"
|
||||||
|
return rslt_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_queue_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
queue_name = f"{fn_name}_{group_key}"
|
||||||
|
return queue_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_log_name(var_name, fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
log_name = f"{var_name}_{fn_name}_{group_key}"
|
||||||
|
return log_name
|
||||||
|
|
||||||
|
|
||||||
|
def assert_same_address(model_ctrl_table, motor_models, data_name):
|
||||||
|
all_addr = []
|
||||||
|
all_bytes = []
|
||||||
|
for model in motor_models:
|
||||||
|
addr, bytes = model_ctrl_table[model][data_name]
|
||||||
|
all_addr.append(addr)
|
||||||
|
all_bytes.append(bytes)
|
||||||
|
|
||||||
|
if len(set(all_addr)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different address for `data_name`='{data_name}' ({list(zip(motor_models, all_addr, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
if len(set(all_bytes)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different bytes representation for `data_name`='{data_name}' ({list(zip(motor_models, all_bytes, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
class TorqueMode(enum.Enum):
|
||||||
|
ENABLED = 1
|
||||||
|
DISABLED = 0
|
||||||
|
|
||||||
|
|
||||||
|
class DriveMode(enum.Enum):
|
||||||
|
NON_INVERTED = 0
|
||||||
|
INVERTED = 1
|
||||||
|
|
||||||
|
|
||||||
|
class CalibrationMode(enum.Enum):
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
DEGREE = 0
|
||||||
|
# Joints with linear motions (like gripper of Aloha) are expressed in nominal range of [0, 100]
|
||||||
|
LINEAR = 1
|
||||||
|
|
||||||
|
|
||||||
|
class JointOutOfRangeError(Exception):
|
||||||
|
def __init__(self, message="Joint is out of range"):
|
||||||
|
self.message = message
|
||||||
|
super().__init__(self.message)
|
||||||
|
|
||||||
|
|
||||||
|
class DynamixelMotorsBus:
|
||||||
|
"""
|
||||||
|
The DynamixelMotorsBus class allows to efficiently read and write to the attached motors. It relies on
|
||||||
|
the python dynamixel sdk to communicate with the motors. For more info, see the [Dynamixel SDK Documentation](https://emanual.robotis.com/docs/en/software/dynamixel/dynamixel_sdk/sample_code/python_read_write_protocol_2_0/#python-read-write-protocol-20).
|
||||||
|
|
||||||
|
A DynamixelMotorsBus instance requires a port (e.g. `DynamixelMotorsBus(port="/dev/tty.usbmodem575E0031751"`)).
|
||||||
|
To find the port, you can run our utility script:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
>>> Finding all available ports for the MotorBus.
|
||||||
|
>>> ['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
>>> Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
>>> The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751.
|
||||||
|
>>> Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of usage for 1 motor connected to the bus:
|
||||||
|
```python
|
||||||
|
motor_name = "gripper"
|
||||||
|
motor_index = 6
|
||||||
|
motor_model = "xl330-m288"
|
||||||
|
|
||||||
|
motors_bus = DynamixelMotorsBus(
|
||||||
|
port="/dev/tty.usbmodem575E0031751",
|
||||||
|
motors={motor_name: (motor_index, motor_model)},
|
||||||
|
)
|
||||||
|
motors_bus.connect()
|
||||||
|
|
||||||
|
position = motors_bus.read("Present_Position")
|
||||||
|
|
||||||
|
# move from a few motor steps as an example
|
||||||
|
few_steps = 30
|
||||||
|
motors_bus.write("Goal_Position", position + few_steps)
|
||||||
|
|
||||||
|
# when done, consider disconnecting
|
||||||
|
motors_bus.disconnect()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
port: str,
|
||||||
|
motors: dict[str, tuple[int, str]],
|
||||||
|
mock: bool = False,
|
||||||
|
):
|
||||||
|
self.port = port
|
||||||
|
self.motors = motors
|
||||||
|
self.mock = mock
|
||||||
|
|
||||||
|
self.model_ctrl_table = deepcopy(MODEL_CONTROL_TABLE)
|
||||||
|
self.model_resolution = deepcopy(MODEL_RESOLUTION)
|
||||||
|
|
||||||
|
self.port_handler = None
|
||||||
|
self.packet_handler = None
|
||||||
|
self.calibration = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise DeviceAlreadyConnectedError(
|
||||||
|
f"DynamixelMotorsBus({self.port}) is already connected. Do not call `motors_bus.connect()` twice."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
self.port_handler = dxl.PortHandler(self.port)
|
||||||
|
self.packet_handler = dxl.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
try:
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
except Exception:
|
||||||
|
traceback.print_exc()
|
||||||
|
print(
|
||||||
|
"\nTry running `python lerobot/scripts/find_motors_bus_port.py` to make sure you are using the correct port.\n"
|
||||||
|
)
|
||||||
|
raise
|
||||||
|
|
||||||
|
# Allow to read and write
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
self.port_handler.setPacketTimeoutMillis(TIMEOUT_MS)
|
||||||
|
|
||||||
|
def reconnect(self):
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
self.port_handler = dxl.PortHandler(self.port)
|
||||||
|
self.packet_handler = dxl.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def are_motors_configured(self):
|
||||||
|
# Only check the motor indices and not baudrate, since if the motor baudrates are incorrect,
|
||||||
|
# a ConnectionError will be raised anyway.
|
||||||
|
try:
|
||||||
|
return (self.motor_indices == self.read("ID")).all()
|
||||||
|
except ConnectionError as e:
|
||||||
|
print(e)
|
||||||
|
return False
|
||||||
|
|
||||||
|
def find_motor_indices(self, possible_ids=None, num_retry=2):
|
||||||
|
if possible_ids is None:
|
||||||
|
possible_ids = range(MAX_ID_RANGE)
|
||||||
|
|
||||||
|
indices = []
|
||||||
|
for idx in tqdm.tqdm(possible_ids):
|
||||||
|
try:
|
||||||
|
present_idx = self.read_with_motor_ids(self.motor_models, [idx], "ID", num_retry=num_retry)[0]
|
||||||
|
except ConnectionError:
|
||||||
|
continue
|
||||||
|
|
||||||
|
if idx != present_idx:
|
||||||
|
# sanity check
|
||||||
|
raise OSError(
|
||||||
|
"Motor index used to communicate through the bus is not the same as the one present in the motor memory. The motor memory might be damaged."
|
||||||
|
)
|
||||||
|
indices.append(idx)
|
||||||
|
|
||||||
|
return indices
|
||||||
|
|
||||||
|
def set_bus_baudrate(self, baudrate):
|
||||||
|
present_bus_baudrate = self.port_handler.getBaudRate()
|
||||||
|
if present_bus_baudrate != baudrate:
|
||||||
|
print(f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}.")
|
||||||
|
self.port_handler.setBaudRate(baudrate)
|
||||||
|
|
||||||
|
if self.port_handler.getBaudRate() != baudrate:
|
||||||
|
raise OSError("Failed to write bus baud rate.")
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_names(self) -> list[str]:
|
||||||
|
return list(self.motors.keys())
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_models(self) -> list[str]:
|
||||||
|
return [model for _, model in self.motors.values()]
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_indices(self) -> list[int]:
|
||||||
|
return [idx for idx, _ in self.motors.values()]
|
||||||
|
|
||||||
|
def set_calibration(self, calibration: dict[str, list]):
|
||||||
|
self.calibration = calibration
|
||||||
|
|
||||||
|
def apply_calibration_autocorrect(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function applies the calibration, automatically detects out of range errors for motors values and attempts to correct.
|
||||||
|
|
||||||
|
For more info, see docstring of `apply_calibration` and `autocorrect_calibration`.
|
||||||
|
"""
|
||||||
|
try:
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
except JointOutOfRangeError as e:
|
||||||
|
print(e)
|
||||||
|
self.autocorrect_calibration(values, motor_names)
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
|
||||||
|
a "zero position" at 0 degree.
|
||||||
|
|
||||||
|
Note: We say "nominal degree range" since the motors can take values outside this range. For instance, 190 degrees, if the motor
|
||||||
|
rotate more than a half a turn from the zero position. However, most motors can't rotate more than 180 degrees and will stay in this range.
|
||||||
|
|
||||||
|
Joints values are original in [0, 2**32[ (unsigned int32). Each motor are expected to complete a full rotation
|
||||||
|
when given a goal position that is + or - their resolution. For instance, dynamixel xl330-m077 have a resolution of 4096, and
|
||||||
|
at any position in their original range, let's say the position 56734, they complete a full rotation clockwise by moving to 60830,
|
||||||
|
or anticlockwise by moving to 52638. The position in the original range is arbitrary and might change a lot between each motor.
|
||||||
|
To harmonize between motors of the same model, different robots, or even models of different brands, we propose to work
|
||||||
|
in the centered nominal degree range ]-180, 180[.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Update direction of rotation of the motor to match between leader and follower.
|
||||||
|
# In fact, the motor of the leader for a given joint can be assembled in an
|
||||||
|
# opposite direction in term of rotation than the motor of the follower on the same joint.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from range [-2**31, 2**31] to
|
||||||
|
# nominal range [-resolution//2, resolution//2] (e.g. [-2048, 2048])
|
||||||
|
values[i] += homing_offset
|
||||||
|
|
||||||
|
# Convert from range [-resolution//2, resolution//2] to
|
||||||
|
# universal float32 centered degree range [-180, 180]
|
||||||
|
# (e.g. 2048 / (4096 // 2) * 180 = 180)
|
||||||
|
values[i] = values[i] / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_DEGREE) or (values[i] > UPPER_BOUND_DEGREE):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [-{HALF_TURN_DEGREE}, {HALF_TURN_DEGREE}] degrees (a full rotation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_DEGREE}, {UPPER_BOUND_DEGREE}] degrees to account for joints that can rotate a bit more, "
|
||||||
|
f"but present value is {values[i]} degree. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial 360 degrees jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Rescale the present position to a nominal range [0, 100] %,
|
||||||
|
# useful for joints with linear motions like Aloha gripper
|
||||||
|
values[i] = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_LINEAR) or (values[i] > UPPER_BOUND_LINEAR):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [0, 100] % (a full linear translation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_LINEAR}, {UPPER_BOUND_LINEAR}] % to account for some imprecision during calibration, "
|
||||||
|
f"but present value is {values[i]} %. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def autocorrect_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function automatically detects issues with values of motors after calibration, and correct for these issues.
|
||||||
|
|
||||||
|
Some motors might have values outside of expected maximum bounds after calibration.
|
||||||
|
For instance, for a joint in degree, its value can be outside [-270, 270] degrees, which is totally unexpected given
|
||||||
|
a nominal range of [-180, 180] degrees, which represents half a turn to the left or right starting from zero position.
|
||||||
|
|
||||||
|
Known issues:
|
||||||
|
#1: Motor value randomly shifts of a full turn, caused by hardware/connection errors.
|
||||||
|
#2: Motor internal homing offset is shifted by a full turn, caused by using default calibration (e.g Aloha).
|
||||||
|
#3: motor internal homing offset is shifted by less or more than a full turn, caused by using default calibration
|
||||||
|
or by human error during manual calibration.
|
||||||
|
|
||||||
|
Issues #1 and #2 can be solved by shifting the calibration homing offset by a full turn.
|
||||||
|
Issue #3 will be visually detected by user and potentially captured by the safety feature `max_relative_target`,
|
||||||
|
that will slow down the motor, raise an error asking to recalibrate. Manual recalibrating will solve the issue.
|
||||||
|
|
||||||
|
Note: A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Update direction of rotation of the motor to match between leader and follower.
|
||||||
|
# In fact, the motor of the leader for a given joint can be assembled in an
|
||||||
|
# opposite direction in term of rotation than the motor of the follower on the same joint.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from initial range to range [-180, 180] degrees
|
||||||
|
calib_val = (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
in_range = (calib_val > LOWER_BOUND_DEGREE) and (calib_val < UPPER_BOUND_DEGREE)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [-180, 180] degrees
|
||||||
|
# values[i] = (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
# - HALF_TURN_DEGREE <= (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE <= HALF_TURN_DEGREE
|
||||||
|
# (- (resolution // 2) - values[i] - homing_offset) / resolution <= factor <= ((resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
low_factor = (-(resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
upp_factor = ((resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from initial range to range [0, 100] in %
|
||||||
|
calib_val = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
in_range = (calib_val > LOWER_BOUND_LINEAR) and (calib_val < UPPER_BOUND_LINEAR)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [0, 100] %
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos + resolution * factor - start_pos - resolution * factor) * 100
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100
|
||||||
|
# 0 <= (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100 <= 100
|
||||||
|
# (start_pos - values[i]) / resolution <= factor <= (end_pos - values[i]) / resolution
|
||||||
|
low_factor = (start_pos - values[i]) / resolution
|
||||||
|
upp_factor = (end_pos - values[i]) / resolution
|
||||||
|
|
||||||
|
if not in_range:
|
||||||
|
# Get first integer between the two bounds
|
||||||
|
if low_factor < upp_factor:
|
||||||
|
factor = math.ceil(low_factor)
|
||||||
|
|
||||||
|
if factor > upp_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
else:
|
||||||
|
factor = math.ceil(upp_factor)
|
||||||
|
|
||||||
|
if factor > low_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
in_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
in_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
|
||||||
|
logging.warning(
|
||||||
|
f"Auto-correct calibration of motor '{name}' by shifting value by {abs(factor)} full turns, "
|
||||||
|
f"from '{out_of_range_str}' to '{in_range_str}'."
|
||||||
|
)
|
||||||
|
|
||||||
|
# A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
self.calibration["homing_offset"][calib_idx] += resolution * factor
|
||||||
|
|
||||||
|
def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Inverse of `apply_calibration`."""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Convert from nominal 0-centered degree range [-180, 180] to
|
||||||
|
# 0-centered resolution range (e.g. [-2048, 2048] for resolution=4096)
|
||||||
|
values[i] = values[i] / HALF_TURN_DEGREE * (resolution // 2)
|
||||||
|
|
||||||
|
# Subtract the homing offsets to come back to actual motor range of values
|
||||||
|
# which can be arbitrary.
|
||||||
|
values[i] -= homing_offset
|
||||||
|
|
||||||
|
# Remove drive mode, which is the rotation direction of the motor, to come back to
|
||||||
|
# actual motor rotation direction which can be arbitrary.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from nominal lnear range of [0, 100] % to
|
||||||
|
# actual motor range of values which can be arbitrary.
|
||||||
|
values[i] = values[i] / 100 * (end_pos - start_pos) + start_pos
|
||||||
|
|
||||||
|
values = np.round(values).astype(np.int32)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
return_list = True
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
return_list = False
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, self.motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = dxl.GroupSyncRead(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx in motor_ids:
|
||||||
|
group.addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txRxPacket()
|
||||||
|
if comm == dxl.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = group.getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
if return_list:
|
||||||
|
return values
|
||||||
|
else:
|
||||||
|
return values[0]
|
||||||
|
|
||||||
|
def read(self, data_name, motor_names: str | list[str] | None = None):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"DynamixelMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
if data_name not in self.group_readers:
|
||||||
|
# create new group reader
|
||||||
|
self.group_readers[group_key] = dxl.GroupSyncRead(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
for idx in motor_ids:
|
||||||
|
self.group_readers[group_key].addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(NUM_READ_RETRY):
|
||||||
|
comm = self.group_readers[group_key].txRxPacket()
|
||||||
|
if comm == dxl.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = self.group_readers[group_key].getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
# Convert to signed int to use range [-2048, 2048] for our motor positions.
|
||||||
|
if data_name in CONVERT_UINT32_TO_INT32_REQUIRED:
|
||||||
|
values = values.astype(np.int32)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.apply_calibration_autocorrect(values, motor_names)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the data from the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the data was received
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "read", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
if not isinstance(values, list):
|
||||||
|
values = [values]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = dxl.GroupSyncWrite(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
group.addParam(idx, data)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txPacket()
|
||||||
|
if comm == dxl.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
def write(self, data_name, values: int | float | np.ndarray, motor_names: str | list[str] | None = None):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"DynamixelMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
if isinstance(values, (int, float, np.integer)):
|
||||||
|
values = [int(values)] * len(motor_names)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.revert_calibration(values, motor_names)
|
||||||
|
|
||||||
|
values = values.tolist()
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
init_group = data_name not in self.group_readers
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key] = dxl.GroupSyncWrite(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key].addParam(idx, data)
|
||||||
|
else:
|
||||||
|
self.group_writers[group_key].changeParam(idx, data)
|
||||||
|
|
||||||
|
comm = self.group_writers[group_key].txPacket()
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
# log the number of seconds it took to write the data to the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "write", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# TODO(rcadene): should we log the time before sending the write command?
|
||||||
|
# log the utc time when the write has been completed
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "write", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"DynamixelMotorsBus({self.port}) is not connected. Try running `motors_bus.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.port_handler is not None:
|
||||||
|
self.port_handler.closePort()
|
||||||
|
self.port_handler = None
|
||||||
|
|
||||||
|
self.packet_handler = None
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
|
|
||||||
|
|
||||||
|
def set_operating_mode(arm: DynamixelMotorsBus):
|
||||||
|
if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
|
||||||
|
raise ValueError("To run set robot preset, the torque must be disabled on all motors.")
|
||||||
|
|
||||||
|
# Use 'extended position mode' for all motors except gripper, because in joint mode the servos can't
|
||||||
|
# rotate more than 360 degrees (from 0 to 4095) And some mistake can happen while assembling the arm,
|
||||||
|
# you could end up with a servo with a position 0 or 4095 at a crucial point See [
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/x_series/#operating-mode11]
|
||||||
|
all_motors_except_gripper = [name for name in arm.motor_names if name != "gripper"]
|
||||||
|
if len(all_motors_except_gripper) > 0:
|
||||||
|
# 4 corresponds to Extended Position on Koch motors
|
||||||
|
arm.write("Operating_Mode", 4, all_motors_except_gripper)
|
||||||
|
|
||||||
|
# Use 'position control current based' for gripper to be limited by the limit of the current.
|
||||||
|
# For the follower gripper, it means it can grasp an object without forcing too much even tho,
|
||||||
|
# it's goal position is a complete grasp (both gripper fingers are ordered to join and reach a touch).
|
||||||
|
# For the leader gripper, it means we can use it as a physical trigger, since we can force with our finger
|
||||||
|
# to make it move, and it will move back to its original target position when we release the force.
|
||||||
|
# 5 corresponds to Current Controlled Position on Koch gripper motors "xl330-m077, xl330-m288"
|
||||||
|
arm.write("Operating_Mode", 5, "gripper")
|
||||||
144
lerobot/common/motors/dynamixel/dynamixel_calibration.py
Normal file
144
lerobot/common/motors/dynamixel/dynamixel_calibration.py
Normal file
@@ -0,0 +1,144 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""Logic to calibrate a robot arm built with dynamixel motors"""
|
||||||
|
# TODO(rcadene, aliberts): move this logic into the robot code when refactoring
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
|
||||||
|
from ..motors_bus import MotorsBus
|
||||||
|
from .dynamixel import (
|
||||||
|
CalibrationMode,
|
||||||
|
TorqueMode,
|
||||||
|
convert_degrees_to_steps,
|
||||||
|
)
|
||||||
|
|
||||||
|
URL_TEMPLATE = (
|
||||||
|
"https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
|
||||||
|
)
|
||||||
|
|
||||||
|
# The following positions are provided in nominal degree range ]-180, +180[
|
||||||
|
# For more info on these constants, see comments in the code where they get used.
|
||||||
|
ZERO_POSITION_DEGREE = 0
|
||||||
|
ROTATED_POSITION_DEGREE = 90
|
||||||
|
|
||||||
|
|
||||||
|
def assert_drive_mode(drive_mode):
|
||||||
|
# `drive_mode` is in [0,1] with 0 means original rotation direction for the motor, and 1 means inverted.
|
||||||
|
if not np.all(np.isin(drive_mode, [0, 1])):
|
||||||
|
raise ValueError(f"`drive_mode` contains values other than 0 or 1: ({drive_mode})")
|
||||||
|
|
||||||
|
|
||||||
|
def apply_drive_mode(position, drive_mode):
|
||||||
|
assert_drive_mode(drive_mode)
|
||||||
|
# Convert `drive_mode` from [0, 1] with 0 indicates original rotation direction and 1 inverted,
|
||||||
|
# to [-1, 1] with 1 indicates original rotation direction and -1 inverted.
|
||||||
|
signed_drive_mode = -(drive_mode * 2 - 1)
|
||||||
|
position *= signed_drive_mode
|
||||||
|
return position
|
||||||
|
|
||||||
|
|
||||||
|
def compute_nearest_rounded_position(position, models):
|
||||||
|
delta_turn = convert_degrees_to_steps(ROTATED_POSITION_DEGREE, models)
|
||||||
|
nearest_pos = np.round(position.astype(float) / delta_turn) * delta_turn
|
||||||
|
return nearest_pos.astype(position.dtype)
|
||||||
|
|
||||||
|
|
||||||
|
def run_arm_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
|
||||||
|
"""This function ensures that a neural network trained on data collected on a given robot
|
||||||
|
can work on another robot. For instance before calibration, setting a same goal position
|
||||||
|
for each motor of two different robots will get two very different positions. But after calibration,
|
||||||
|
the two robots will move to the same position.To this end, this function computes the homing offset
|
||||||
|
and the drive mode for each motor of a given robot.
|
||||||
|
|
||||||
|
Homing offset is used to shift the motor position to a ]-2048, +2048[ nominal range (when the motor uses 2048 steps
|
||||||
|
to complete a half a turn). This range is set around an arbitrary "zero position" corresponding to all motor positions
|
||||||
|
being 0. During the calibration process, you will need to manually move the robot to this "zero position".
|
||||||
|
|
||||||
|
Drive mode is used to invert the rotation direction of the motor. This is useful when some motors have been assembled
|
||||||
|
in the opposite orientation for some robots. During the calibration process, you will need to manually move the robot
|
||||||
|
to the "rotated position".
|
||||||
|
|
||||||
|
After calibration, the homing offsets and drive modes are stored in a cache.
|
||||||
|
|
||||||
|
Example of usage:
|
||||||
|
```python
|
||||||
|
run_arm_calibration(arm, "koch", "left", "follower")
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
|
||||||
|
raise ValueError("To run calibration, the torque must be disabled on all motors.")
|
||||||
|
|
||||||
|
print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
|
||||||
|
|
||||||
|
print("\nMove arm to zero position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="zero"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
# We arbitrarily chose our zero target position to be a straight horizontal position with gripper upwards and closed.
|
||||||
|
# It is easy to identify and all motors are in a "quarter turn" position. Once calibration is done, this position will
|
||||||
|
# correspond to every motor angle being 0. If you set all 0 as Goal Position, the arm will move in this position.
|
||||||
|
zero_target_pos = convert_degrees_to_steps(ZERO_POSITION_DEGREE, arm.motor_models)
|
||||||
|
|
||||||
|
# Compute homing offset so that `present_position + homing_offset ~= target_position`.
|
||||||
|
zero_pos = arm.read("Present_Position")
|
||||||
|
zero_nearest_pos = compute_nearest_rounded_position(zero_pos, arm.motor_models)
|
||||||
|
homing_offset = zero_target_pos - zero_nearest_pos
|
||||||
|
|
||||||
|
# The rotated target position corresponds to a rotation of a quarter turn from the zero position.
|
||||||
|
# This allows to identify the rotation direction of each motor.
|
||||||
|
# For instance, if the motor rotates 90 degree, and its value is -90 after applying the homing offset, then we know its rotation direction
|
||||||
|
# is inverted. However, for the calibration being successful, we need everyone to follow the same target position.
|
||||||
|
# Sometimes, there is only one possible rotation direction. For instance, if the gripper is closed, there is only one direction which
|
||||||
|
# corresponds to opening the gripper. When the rotation direction is ambiguous, we arbitrarily rotate clockwise from the point of view
|
||||||
|
# of the previous motor in the kinetic chain.
|
||||||
|
print("\nMove arm to rotated target position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rotated"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
rotated_target_pos = convert_degrees_to_steps(ROTATED_POSITION_DEGREE, arm.motor_models)
|
||||||
|
|
||||||
|
# Find drive mode by rotating each motor by a quarter of a turn.
|
||||||
|
# Drive mode indicates if the motor rotation direction should be inverted (=1) or not (=0).
|
||||||
|
rotated_pos = arm.read("Present_Position")
|
||||||
|
drive_mode = (rotated_pos < zero_pos).astype(np.int32)
|
||||||
|
|
||||||
|
# Re-compute homing offset to take into account drive mode
|
||||||
|
rotated_drived_pos = apply_drive_mode(rotated_pos, drive_mode)
|
||||||
|
rotated_nearest_pos = compute_nearest_rounded_position(rotated_drived_pos, arm.motor_models)
|
||||||
|
homing_offset = rotated_target_pos - rotated_nearest_pos
|
||||||
|
|
||||||
|
print("\nMove arm to rest position")
|
||||||
|
print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rest"))
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
print()
|
||||||
|
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
calib_mode = [CalibrationMode.DEGREE.name] * len(arm.motor_names)
|
||||||
|
|
||||||
|
# TODO(rcadene): make type of joints (DEGREE or LINEAR) configurable from yaml?
|
||||||
|
if robot_type in ["aloha"] and "gripper" in arm.motor_names:
|
||||||
|
# Joints with linear motions (like gripper of Aloha) are expressed in nominal range of [0, 100]
|
||||||
|
calib_idx = arm.motor_names.index("gripper")
|
||||||
|
calib_mode[calib_idx] = CalibrationMode.LINEAR.name
|
||||||
|
|
||||||
|
calib_data = {
|
||||||
|
"homing_offset": homing_offset.tolist(),
|
||||||
|
"drive_mode": drive_mode.tolist(),
|
||||||
|
"start_pos": zero_pos.tolist(),
|
||||||
|
"end_pos": rotated_pos.tolist(),
|
||||||
|
"calib_mode": calib_mode,
|
||||||
|
"motor_names": arm.motor_names,
|
||||||
|
}
|
||||||
|
return calib_data
|
||||||
9
lerobot/common/motors/feetech/__init__.py
Normal file
9
lerobot/common/motors/feetech/__init__.py
Normal file
@@ -0,0 +1,9 @@
|
|||||||
|
from .feetech import FeetechMotorsBus, TorqueMode
|
||||||
|
from .feetech_calibration import apply_feetech_offsets_from_calibration, run_full_arm_calibration
|
||||||
|
|
||||||
|
__all__ = [
|
||||||
|
"FeetechMotorsBus",
|
||||||
|
"TorqueMode",
|
||||||
|
"apply_feetech_offsets_from_calibration",
|
||||||
|
"run_full_arm_calibration",
|
||||||
|
]
|
||||||
730
lerobot/common/motors/feetech/feetech.py
Normal file
730
lerobot/common/motors/feetech/feetech.py
Normal file
@@ -0,0 +1,730 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import enum
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from copy import deepcopy
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import tqdm
|
||||||
|
|
||||||
|
from lerobot.common.errors import DeviceAlreadyConnectedError, DeviceNotConnectedError
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
PROTOCOL_VERSION = 0
|
||||||
|
BAUDRATE = 1_000_000
|
||||||
|
TIMEOUT_MS = 1000
|
||||||
|
|
||||||
|
MAX_ID_RANGE = 252
|
||||||
|
|
||||||
|
# For joints in percentage (i.e. joints that move linearly like the prismatic joint of a gripper),
|
||||||
|
# their nominal range is [0, 100] %. For instance, for Aloha gripper, 0% is fully
|
||||||
|
# closed, and 100% is fully open. To account for slight calibration issue, we allow up to
|
||||||
|
# [-10, 110] until an error is raised.
|
||||||
|
LOWER_BOUND_LINEAR = -10
|
||||||
|
UPPER_BOUND_LINEAR = 110
|
||||||
|
|
||||||
|
HALF_TURN_DEGREE = 180
|
||||||
|
|
||||||
|
# See this link for STS3215 Memory Table:
|
||||||
|
# https://docs.google.com/spreadsheets/d/1GVs7W1VS1PqdhA1nW-abeyAHhTUxKUdR/edit?usp=sharing&ouid=116566590112741600240&rtpof=true&sd=true
|
||||||
|
# data_name: (address, size_byte)
|
||||||
|
SCS_SERIES_CONTROL_TABLE = {
|
||||||
|
"Model": (3, 2),
|
||||||
|
"ID": (5, 1),
|
||||||
|
"Baud_Rate": (6, 1),
|
||||||
|
"Return_Delay": (7, 1),
|
||||||
|
"Response_Status_Level": (8, 1),
|
||||||
|
"Min_Angle_Limit": (9, 2),
|
||||||
|
"Max_Angle_Limit": (11, 2),
|
||||||
|
"Max_Temperature_Limit": (13, 1),
|
||||||
|
"Max_Voltage_Limit": (14, 1),
|
||||||
|
"Min_Voltage_Limit": (15, 1),
|
||||||
|
"Max_Torque_Limit": (16, 2),
|
||||||
|
"Phase": (18, 1),
|
||||||
|
"Unloading_Condition": (19, 1),
|
||||||
|
"LED_Alarm_Condition": (20, 1),
|
||||||
|
"P_Coefficient": (21, 1),
|
||||||
|
"D_Coefficient": (22, 1),
|
||||||
|
"I_Coefficient": (23, 1),
|
||||||
|
"Minimum_Startup_Force": (24, 2),
|
||||||
|
"CW_Dead_Zone": (26, 1),
|
||||||
|
"CCW_Dead_Zone": (27, 1),
|
||||||
|
"Protection_Current": (28, 2),
|
||||||
|
"Angular_Resolution": (30, 1),
|
||||||
|
"Offset": (31, 2),
|
||||||
|
"Mode": (33, 1),
|
||||||
|
"Protective_Torque": (34, 1),
|
||||||
|
"Protection_Time": (35, 1),
|
||||||
|
"Overload_Torque": (36, 1),
|
||||||
|
"Speed_closed_loop_P_proportional_coefficient": (37, 1),
|
||||||
|
"Over_Current_Protection_Time": (38, 1),
|
||||||
|
"Velocity_closed_loop_I_integral_coefficient": (39, 1),
|
||||||
|
"Torque_Enable": (40, 1),
|
||||||
|
"Acceleration": (41, 1),
|
||||||
|
"Goal_Position": (42, 2),
|
||||||
|
"Goal_Time": (44, 2),
|
||||||
|
"Goal_Speed": (46, 2),
|
||||||
|
"Torque_Limit": (48, 2),
|
||||||
|
"Lock": (55, 1),
|
||||||
|
"Present_Position": (56, 2),
|
||||||
|
"Present_Speed": (58, 2),
|
||||||
|
"Present_Load": (60, 2),
|
||||||
|
"Present_Voltage": (62, 1),
|
||||||
|
"Present_Temperature": (63, 1),
|
||||||
|
"Status": (65, 1),
|
||||||
|
"Moving": (66, 1),
|
||||||
|
"Present_Current": (69, 2),
|
||||||
|
# Not in the Memory Table
|
||||||
|
"Maximum_Acceleration": (85, 2),
|
||||||
|
}
|
||||||
|
|
||||||
|
SCS_SERIES_BAUDRATE_TABLE = {
|
||||||
|
0: 1_000_000,
|
||||||
|
1: 500_000,
|
||||||
|
2: 250_000,
|
||||||
|
3: 128_000,
|
||||||
|
4: 115_200,
|
||||||
|
5: 57_600,
|
||||||
|
6: 38_400,
|
||||||
|
7: 19_200,
|
||||||
|
}
|
||||||
|
|
||||||
|
CALIBRATION_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
|
||||||
|
MODEL_CONTROL_TABLE = {
|
||||||
|
"scs_series": SCS_SERIES_CONTROL_TABLE,
|
||||||
|
"sts3215": SCS_SERIES_CONTROL_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_RESOLUTION = {
|
||||||
|
"scs_series": 4096,
|
||||||
|
"sts3215": 4096,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_BAUDRATE_TABLE = {
|
||||||
|
"scs_series": SCS_SERIES_BAUDRATE_TABLE,
|
||||||
|
"sts3215": SCS_SERIES_BAUDRATE_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
# High number of retries is needed for feetech compared to dynamixel motors.
|
||||||
|
NUM_READ_RETRY = 20
|
||||||
|
NUM_WRITE_RETRY = 20
|
||||||
|
|
||||||
|
|
||||||
|
def convert_ticks_to_degrees(ticks, model):
|
||||||
|
resolutions = MODEL_RESOLUTION[model]
|
||||||
|
# Convert the ticks to degrees
|
||||||
|
return ticks * (360.0 / resolutions)
|
||||||
|
|
||||||
|
|
||||||
|
def convert_degrees_to_ticks(degrees, model):
|
||||||
|
resolutions = MODEL_RESOLUTION[model]
|
||||||
|
# Convert degrees to motor ticks
|
||||||
|
return int(degrees * (resolutions / 360.0))
|
||||||
|
|
||||||
|
|
||||||
|
def adjusted_to_homing_ticks(raw_motor_ticks: int, model: str, motorbus, motor_id: int) -> int:
|
||||||
|
"""
|
||||||
|
Takes a raw reading [0..(res-1)] (e.g. 0..4095) and shifts it so that '2048'
|
||||||
|
becomes 0 in the homed coordinate system ([-2048..+2047] for 4096 resolution).
|
||||||
|
"""
|
||||||
|
resolutions = MODEL_RESOLUTION[model]
|
||||||
|
|
||||||
|
# Shift raw ticks by half-resolution so 2048 -> 0, then wrap [0..res-1].
|
||||||
|
ticks = (raw_motor_ticks - (resolutions // 2)) % resolutions
|
||||||
|
|
||||||
|
# If above halfway, fold it into negative territory => [-2048..+2047].
|
||||||
|
if ticks > (resolutions // 2):
|
||||||
|
ticks -= resolutions
|
||||||
|
|
||||||
|
# Flip sign if drive_mode is set.
|
||||||
|
drive_mode = 0
|
||||||
|
if motorbus.calibration is not None:
|
||||||
|
drive_mode = motorbus.calibration["drive_mode"][motor_id - 1]
|
||||||
|
|
||||||
|
if drive_mode:
|
||||||
|
ticks *= -1
|
||||||
|
|
||||||
|
return ticks
|
||||||
|
|
||||||
|
|
||||||
|
def adjusted_to_motor_ticks(adjusted_pos: int, model: str, motorbus, motor_id: int) -> int:
|
||||||
|
"""
|
||||||
|
Inverse of adjusted_to_homing_ticks(). Takes a 'homed' position in [-2048..+2047]
|
||||||
|
and recovers the raw [0..(res-1)] ticks with 2048 as midpoint.
|
||||||
|
"""
|
||||||
|
# Flip sign if drive_mode was set.
|
||||||
|
drive_mode = 0
|
||||||
|
if motorbus.calibration is not None:
|
||||||
|
drive_mode = motorbus.calibration["drive_mode"][motor_id - 1]
|
||||||
|
|
||||||
|
if drive_mode:
|
||||||
|
adjusted_pos *= -1
|
||||||
|
|
||||||
|
resolutions = MODEL_RESOLUTION[model]
|
||||||
|
|
||||||
|
# Shift by +half-resolution and wrap into [0..res-1].
|
||||||
|
# This undoes the earlier shift by -half-resolution.
|
||||||
|
ticks = (adjusted_pos + (resolutions // 2)) % resolutions
|
||||||
|
|
||||||
|
return ticks
|
||||||
|
|
||||||
|
|
||||||
|
def convert_to_bytes(value, bytes, mock=False):
|
||||||
|
if mock:
|
||||||
|
return value
|
||||||
|
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
# Note: No need to convert back into unsigned int, since this byte preprocessing
|
||||||
|
# already handles it for us.
|
||||||
|
if bytes == 1:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 2:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 4:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_HIWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_HIWORD(value)),
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"Value of the number of bytes to be sent is expected to be in [1, 2, 4], but "
|
||||||
|
f"{bytes} is provided instead."
|
||||||
|
)
|
||||||
|
return data
|
||||||
|
|
||||||
|
|
||||||
|
def get_group_sync_key(data_name, motor_names):
|
||||||
|
group_key = f"{data_name}_" + "_".join(motor_names)
|
||||||
|
return group_key
|
||||||
|
|
||||||
|
|
||||||
|
def get_result_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
rslt_name = f"{fn_name}_{group_key}"
|
||||||
|
return rslt_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_queue_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
queue_name = f"{fn_name}_{group_key}"
|
||||||
|
return queue_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_log_name(var_name, fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
log_name = f"{var_name}_{fn_name}_{group_key}"
|
||||||
|
return log_name
|
||||||
|
|
||||||
|
|
||||||
|
def assert_same_address(model_ctrl_table, motor_models, data_name):
|
||||||
|
all_addr = []
|
||||||
|
all_bytes = []
|
||||||
|
for model in motor_models:
|
||||||
|
addr, bytes = model_ctrl_table[model][data_name]
|
||||||
|
all_addr.append(addr)
|
||||||
|
all_bytes.append(bytes)
|
||||||
|
|
||||||
|
if len(set(all_addr)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different address for `data_name`='{data_name}' ({list(zip(motor_models, all_addr, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
if len(set(all_bytes)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different bytes representation for `data_name`='{data_name}' ({list(zip(motor_models, all_bytes, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
class TorqueMode(enum.Enum):
|
||||||
|
ENABLED = 1
|
||||||
|
DISABLED = 0
|
||||||
|
|
||||||
|
|
||||||
|
class DriveMode(enum.Enum):
|
||||||
|
NON_INVERTED = 0
|
||||||
|
INVERTED = 1
|
||||||
|
|
||||||
|
|
||||||
|
class CalibrationMode(enum.Enum):
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
DEGREE = 0
|
||||||
|
# Joints with linear motions (like gripper of Aloha) are expressed in nominal range of [0, 100]
|
||||||
|
LINEAR = 1
|
||||||
|
|
||||||
|
|
||||||
|
class JointOutOfRangeError(Exception):
|
||||||
|
def __init__(self, message="Joint is out of range"):
|
||||||
|
self.message = message
|
||||||
|
super().__init__(self.message)
|
||||||
|
|
||||||
|
|
||||||
|
class FeetechMotorsBus:
|
||||||
|
"""
|
||||||
|
The FeetechMotorsBus class allows to efficiently read and write to the attached motors. It relies on
|
||||||
|
the python feetech sdk to communicate with the motors. For more info, see the [feetech SDK Documentation](https://emanual.robotis.com/docs/en/software/feetech/feetech_sdk/sample_code/python_read_write_protocol_2_0/#python-read-write-protocol-20).
|
||||||
|
|
||||||
|
A FeetechMotorsBus instance requires a port (e.g. `FeetechMotorsBus(port="/dev/tty.usbmodem575E0031751"`)).
|
||||||
|
To find the port, you can run our utility script:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
>>> Finding all available ports for the MotorsBus.
|
||||||
|
>>> ['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
>>> Remove the usb cable from your FeetechMotorsBus and press Enter when done.
|
||||||
|
>>> The port of this FeetechMotorsBus is /dev/tty.usbmodem575E0031751.
|
||||||
|
>>> Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of usage for 1 motor connected to the bus:
|
||||||
|
```python
|
||||||
|
motor_name = "gripper"
|
||||||
|
motor_index = 6
|
||||||
|
motor_model = "sts3215"
|
||||||
|
|
||||||
|
motors_bus = FeetechMotorsBus(
|
||||||
|
port="/dev/tty.usbmodem575E0031751",
|
||||||
|
motors={motor_name: (motor_index, motor_model)},
|
||||||
|
)
|
||||||
|
motors_bus.connect()
|
||||||
|
|
||||||
|
position = motors_bus.read("Present_Position")
|
||||||
|
|
||||||
|
# move from a few motor steps as an example
|
||||||
|
few_steps = 30
|
||||||
|
motors_bus.write("Goal_Position", position + few_steps)
|
||||||
|
|
||||||
|
# when done, consider disconnecting
|
||||||
|
motors_bus.disconnect()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
port: str,
|
||||||
|
motors: dict[str, tuple[int, str]],
|
||||||
|
mock: bool = False,
|
||||||
|
):
|
||||||
|
self.port = port
|
||||||
|
self.motors = motors
|
||||||
|
self.mock = mock
|
||||||
|
|
||||||
|
self.model_ctrl_table = deepcopy(MODEL_CONTROL_TABLE)
|
||||||
|
self.model_resolution = deepcopy(MODEL_RESOLUTION)
|
||||||
|
|
||||||
|
self.port_handler = None
|
||||||
|
self.packet_handler = None
|
||||||
|
self.calibration = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise DeviceAlreadyConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is already connected. Do not call `motors_bus.connect()` twice."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
self.port_handler = scs.PortHandler(self.port)
|
||||||
|
self.packet_handler = scs.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
try:
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
except Exception:
|
||||||
|
traceback.print_exc()
|
||||||
|
print(
|
||||||
|
"\nTry running `python lerobot/scripts/find_motors_bus_port.py` to make sure you are using the correct port.\n"
|
||||||
|
)
|
||||||
|
raise
|
||||||
|
|
||||||
|
# Allow to read and write
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
self.port_handler.setPacketTimeoutMillis(TIMEOUT_MS)
|
||||||
|
|
||||||
|
def reconnect(self):
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
self.port_handler = scs.PortHandler(self.port)
|
||||||
|
self.packet_handler = scs.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def are_motors_configured(self):
|
||||||
|
# Only check the motor indices and not baudrate, since if the motor baudrates are incorrect,
|
||||||
|
# a ConnectionError will be raised anyway.
|
||||||
|
try:
|
||||||
|
return (self.motor_indices == self.read("ID")).all()
|
||||||
|
except ConnectionError as e:
|
||||||
|
print(e)
|
||||||
|
return False
|
||||||
|
|
||||||
|
def find_motor_indices(self, possible_ids=None, num_retry=2):
|
||||||
|
if possible_ids is None:
|
||||||
|
possible_ids = range(MAX_ID_RANGE)
|
||||||
|
|
||||||
|
indices = []
|
||||||
|
for idx in tqdm.tqdm(possible_ids):
|
||||||
|
try:
|
||||||
|
present_idx = self.read_with_motor_ids(self.motor_models, [idx], "ID", num_retry=num_retry)[0]
|
||||||
|
except ConnectionError:
|
||||||
|
continue
|
||||||
|
|
||||||
|
if idx != present_idx:
|
||||||
|
# sanity check
|
||||||
|
raise OSError(
|
||||||
|
"Motor index used to communicate through the bus is not the same as the one present in the motor memory. The motor memory might be damaged."
|
||||||
|
)
|
||||||
|
indices.append(idx)
|
||||||
|
|
||||||
|
return indices
|
||||||
|
|
||||||
|
def set_bus_baudrate(self, baudrate):
|
||||||
|
present_bus_baudrate = self.port_handler.getBaudRate()
|
||||||
|
if present_bus_baudrate != baudrate:
|
||||||
|
print(f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}.")
|
||||||
|
self.port_handler.setBaudRate(baudrate)
|
||||||
|
|
||||||
|
if self.port_handler.getBaudRate() != baudrate:
|
||||||
|
raise OSError("Failed to write bus baud rate.")
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_names(self) -> list[str]:
|
||||||
|
return list(self.motors.keys())
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_models(self) -> list[str]:
|
||||||
|
return [model for _, model in self.motors.values()]
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_indices(self) -> list[int]:
|
||||||
|
return [idx for idx, _ in self.motors.values()]
|
||||||
|
|
||||||
|
def set_calibration(self, calibration: dict[str, list]):
|
||||||
|
self.calibration = calibration
|
||||||
|
|
||||||
|
def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
|
||||||
|
# Convert raw motor ticks to homed ticks, then convert the homed ticks to degrees
|
||||||
|
values[i] = adjusted_to_homing_ticks(values[i], model, self, motor_idx)
|
||||||
|
values[i] = convert_ticks_to_degrees(values[i], model)
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Rescale the present position to a nominal range [0, 100] %,
|
||||||
|
# useful for joints with linear motions like Aloha gripper
|
||||||
|
values[i] = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_LINEAR) or (values[i] > UPPER_BOUND_LINEAR):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [0, 100] % (a full linear translation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_LINEAR}, {UPPER_BOUND_LINEAR}] % to account for some imprecision during calibration, "
|
||||||
|
f"but present value is {values[i]} %. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Inverse of `apply_calibration`."""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
|
||||||
|
# Convert degrees to homed ticks, then convert the homed ticks to raw ticks
|
||||||
|
values[i] = convert_degrees_to_ticks(values[i], model)
|
||||||
|
values[i] = adjusted_to_motor_ticks(values[i], model, self, motor_idx)
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from nominal lnear range of [0, 100] % to
|
||||||
|
# actual motor range of values which can be arbitrary.
|
||||||
|
values[i] = values[i] / 100 * (end_pos - start_pos) + start_pos
|
||||||
|
|
||||||
|
values = np.round(values).astype(np.int32)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
return_list = True
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
return_list = False
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, self.motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = scs.GroupSyncRead(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx in motor_ids:
|
||||||
|
group.addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txRxPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = group.getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
if return_list:
|
||||||
|
return values
|
||||||
|
else:
|
||||||
|
return values[0]
|
||||||
|
|
||||||
|
def read(self, data_name, motor_names: str | list[str] | None = None):
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
if data_name not in self.group_readers:
|
||||||
|
# Very Important to flush the buffer!
|
||||||
|
self.port_handler.ser.reset_output_buffer()
|
||||||
|
self.port_handler.ser.reset_input_buffer()
|
||||||
|
|
||||||
|
# Create new group reader
|
||||||
|
self.group_readers[group_key] = scs.GroupSyncRead(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
for idx in motor_ids:
|
||||||
|
self.group_readers[group_key].addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(NUM_READ_RETRY):
|
||||||
|
comm = self.group_readers[group_key].txRxPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = self.group_readers[group_key].getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the data from the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the data was received
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "read", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
if not isinstance(values, list):
|
||||||
|
values = [values]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = scs.GroupSyncWrite(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
group.addParam(idx, data)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
def write(self, data_name, values: int | float | np.ndarray, motor_names: str | list[str] | None = None):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.motors.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
if isinstance(values, (int, float, np.integer)):
|
||||||
|
values = [int(values)] * len(motor_names)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.revert_calibration(values, motor_names)
|
||||||
|
|
||||||
|
values = values.tolist()
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
init_group = data_name not in self.group_readers
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key] = scs.GroupSyncWrite(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key].addParam(idx, data)
|
||||||
|
else:
|
||||||
|
self.group_writers[group_key].changeParam(idx, data)
|
||||||
|
|
||||||
|
comm = self.group_writers[group_key].txPacket()
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
# log the number of seconds it took to write the data to the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "write", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# TODO(rcadene): should we log the time before sending the write command?
|
||||||
|
# log the utc time when the write has been completed
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "write", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise DeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. Try running `motors_bus.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.port_handler is not None:
|
||||||
|
self.port_handler.closePort()
|
||||||
|
self.port_handler = None
|
||||||
|
|
||||||
|
self.packet_handler = None
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
254
lerobot/common/motors/feetech/feetech_calibration.py
Normal file
254
lerobot/common/motors/feetech/feetech_calibration.py
Normal file
@@ -0,0 +1,254 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
import numpy as np
|
||||||
|
|
||||||
|
from ..motors_bus import MotorsBus
|
||||||
|
from .feetech import (
|
||||||
|
CalibrationMode,
|
||||||
|
FeetechMotorsBus,
|
||||||
|
TorqueMode,
|
||||||
|
)
|
||||||
|
|
||||||
|
URL_TEMPLATE = (
|
||||||
|
"https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def disable_torque(arm: MotorsBus):
|
||||||
|
if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
|
||||||
|
raise ValueError("To run calibration, the torque must be disabled on all motors.")
|
||||||
|
|
||||||
|
|
||||||
|
def get_calibration_modes(arm: MotorsBus):
|
||||||
|
"""Returns calibration modes for each motor (DEGREE for rotational, LINEAR for gripper)."""
|
||||||
|
return [
|
||||||
|
CalibrationMode.LINEAR.name if name == "gripper" else CalibrationMode.DEGREE.name
|
||||||
|
for name in arm.motor_names
|
||||||
|
]
|
||||||
|
|
||||||
|
|
||||||
|
def reset_offset(motor_id, motor_bus):
|
||||||
|
# Open the write lock, changes to EEPROM do NOT persist yet
|
||||||
|
motor_bus.write("Lock", 1)
|
||||||
|
|
||||||
|
# Set offset to 0
|
||||||
|
motor_name = motor_bus.motor_names[motor_id - 1]
|
||||||
|
motor_bus.write("Offset", 0, motor_names=[motor_name])
|
||||||
|
|
||||||
|
# Close the write lock, changes to EEPROM do persist
|
||||||
|
motor_bus.write("Lock", 0)
|
||||||
|
|
||||||
|
# Confirm that the offset is zero by reading it back
|
||||||
|
confirmed_offset = motor_bus.read("Offset")[motor_id - 1]
|
||||||
|
print(f"Offset for motor {motor_id} reset to: {confirmed_offset}")
|
||||||
|
return confirmed_offset
|
||||||
|
|
||||||
|
|
||||||
|
def calibrate_homing_motor(motor_id, motor_bus):
|
||||||
|
reset_offset(motor_id, motor_bus)
|
||||||
|
|
||||||
|
home_ticks = motor_bus.read("Present_Position")[motor_id - 1] # Read index starts at 0
|
||||||
|
print(f"Encoder offset (present position in homing position): {home_ticks}")
|
||||||
|
|
||||||
|
return home_ticks
|
||||||
|
|
||||||
|
|
||||||
|
def calibrate_linear_motor(motor_id, motor_bus):
|
||||||
|
motor_names = motor_bus.motor_names
|
||||||
|
motor_name = motor_names[motor_id - 1]
|
||||||
|
|
||||||
|
reset_offset(motor_id, motor_bus)
|
||||||
|
|
||||||
|
input(f"Close the {motor_name}, then press Enter...")
|
||||||
|
start_pos = motor_bus.read("Present_Position")[motor_id - 1] # Read index starts ar 0
|
||||||
|
print(f" [Motor {motor_id}] start position recorded: {start_pos}")
|
||||||
|
|
||||||
|
input(f"Open the {motor_name} fully, then press Enter...")
|
||||||
|
end_pos = motor_bus.read("Present_Position")[motor_id - 1] # Read index starts ar 0
|
||||||
|
print(f" [Motor {motor_id}] end position recorded: {end_pos}")
|
||||||
|
|
||||||
|
return start_pos, end_pos
|
||||||
|
|
||||||
|
|
||||||
|
def single_motor_calibration(arm: MotorsBus, motor_id: int):
|
||||||
|
"""Calibrates a single motor and returns its calibration data for updating the calibration file."""
|
||||||
|
|
||||||
|
disable_torque(arm)
|
||||||
|
print(f"\n--- Calibrating Motor {motor_id} ---")
|
||||||
|
|
||||||
|
start_pos = 0
|
||||||
|
end_pos = 0
|
||||||
|
encoder_offset = 0
|
||||||
|
|
||||||
|
if motor_id == 6:
|
||||||
|
start_pos, end_pos = calibrate_linear_motor(motor_id, arm)
|
||||||
|
else:
|
||||||
|
input("Move the motor to (zero) position, then press Enter...")
|
||||||
|
encoder_offset = calibrate_homing_motor(motor_id, arm)
|
||||||
|
|
||||||
|
print(f"Calibration for motor ID:{motor_id} done.")
|
||||||
|
|
||||||
|
# Create a calibration dictionary for the single motor
|
||||||
|
calib_dict = {
|
||||||
|
"homing_offset": int(encoder_offset),
|
||||||
|
"drive_mode": 0,
|
||||||
|
"start_pos": int(start_pos),
|
||||||
|
"end_pos": int(end_pos),
|
||||||
|
"calib_mode": get_calibration_modes(arm)[motor_id - 1],
|
||||||
|
"motor_name": arm.motor_names[motor_id - 1],
|
||||||
|
}
|
||||||
|
|
||||||
|
return calib_dict
|
||||||
|
|
||||||
|
|
||||||
|
def run_full_arm_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
|
||||||
|
"""
|
||||||
|
Runs a full calibration process for all motors in a robotic arm.
|
||||||
|
|
||||||
|
This function calibrates each motor in the arm, determining encoder offsets and
|
||||||
|
start/end positions for linear and rotational motors. The calibration data is then
|
||||||
|
stored in a dictionary for later use.
|
||||||
|
|
||||||
|
**Calibration Process:**
|
||||||
|
- The user is prompted to move the arm to its homing position before starting.
|
||||||
|
- Motors with rotational motion are calibrated using a homing method.
|
||||||
|
- Linear actuators (e.g., grippers) are calibrated separately.
|
||||||
|
- Encoder offsets, start positions, and end positions are recorded.
|
||||||
|
|
||||||
|
**Example Usage:**
|
||||||
|
```python
|
||||||
|
run_full_arm_calibration(arm, "so100", "left", "follower")
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
disable_torque(arm)
|
||||||
|
|
||||||
|
print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
|
||||||
|
|
||||||
|
print("\nMove arm to homing position (middle)")
|
||||||
|
print(
|
||||||
|
"See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="zero")
|
||||||
|
) # TODO(pepijn): replace with new instruction homing pos (all motors in middle) in tutorial
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
start_positions = np.zeros(len(arm.motor_indices))
|
||||||
|
end_positions = np.zeros(len(arm.motor_indices))
|
||||||
|
encoder_offsets = np.zeros(len(arm.motor_indices))
|
||||||
|
|
||||||
|
modes = get_calibration_modes(arm)
|
||||||
|
|
||||||
|
for i, motor_id in enumerate(arm.motor_indices):
|
||||||
|
if modes[i] == CalibrationMode.DEGREE.name:
|
||||||
|
encoder_offsets[i] = calibrate_homing_motor(motor_id, arm)
|
||||||
|
start_positions[i] = 0
|
||||||
|
end_positions[i] = 0
|
||||||
|
|
||||||
|
for i, motor_id in enumerate(arm.motor_indices):
|
||||||
|
if modes[i] == CalibrationMode.LINEAR.name:
|
||||||
|
start_positions[i], end_positions[i] = calibrate_linear_motor(motor_id, arm)
|
||||||
|
encoder_offsets[i] = 0
|
||||||
|
|
||||||
|
print("\nMove arm to rest position")
|
||||||
|
input("Press Enter to continue...")
|
||||||
|
|
||||||
|
print(f"\n calibration of {robot_type} {arm_name} {arm_type} done!")
|
||||||
|
|
||||||
|
# Force drive_mode values (can be static)
|
||||||
|
drive_modes = [0, 1, 0, 0, 1, 0]
|
||||||
|
|
||||||
|
calib_dict = {
|
||||||
|
"homing_offset": encoder_offsets.astype(int).tolist(),
|
||||||
|
"drive_mode": drive_modes,
|
||||||
|
"start_pos": start_positions.astype(int).tolist(),
|
||||||
|
"end_pos": end_positions.astype(int).tolist(),
|
||||||
|
"calib_mode": get_calibration_modes(arm),
|
||||||
|
"motor_names": arm.motor_names,
|
||||||
|
}
|
||||||
|
return calib_dict
|
||||||
|
|
||||||
|
|
||||||
|
def run_full_auto_arm_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
|
||||||
|
"""TODO(pepijn): Add this method later as extra
|
||||||
|
Example of usage:
|
||||||
|
```python
|
||||||
|
run_full_auto_arm_calibration(arm, "so100", "left", "follower")
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
|
||||||
|
|
||||||
|
|
||||||
|
def apply_feetech_offsets_from_calibration(motorsbus: FeetechMotorsBus, calibration_dict: dict):
|
||||||
|
"""
|
||||||
|
Reads 'calibration_dict' containing 'homing_offset' and 'motor_names',
|
||||||
|
then writes each motor's offset to the servo's internal Offset (0x1F) in EPROM.
|
||||||
|
|
||||||
|
This version is modified so each homed position (originally 0) will now read
|
||||||
|
2047, i.e. 180° away from 0 in the 4096-count circle. Offsets are permanently
|
||||||
|
stored in EEPROM, so the servo's Present_Position is hardware-shifted even
|
||||||
|
after power cycling.
|
||||||
|
|
||||||
|
Steps:
|
||||||
|
1) Subtract 2047 from the old offset (so 0 -> 2047).
|
||||||
|
2) Clamp to [-2047..+2047].
|
||||||
|
3) Encode sign bit and magnitude into a 12-bit number.
|
||||||
|
"""
|
||||||
|
|
||||||
|
homing_offsets = calibration_dict["homing_offset"]
|
||||||
|
motor_names = calibration_dict["motor_names"]
|
||||||
|
start_pos = calibration_dict["start_pos"]
|
||||||
|
|
||||||
|
# Open the write lock, changes to EEPROM do NOT persist yet
|
||||||
|
motorsbus.write("Lock", 1)
|
||||||
|
|
||||||
|
# For each motor, set the 'Offset' parameter
|
||||||
|
for m_name, old_offset in zip(motor_names, homing_offsets, strict=False):
|
||||||
|
# If bus doesn’t have a motor named m_name, skip
|
||||||
|
if m_name not in motorsbus.motors:
|
||||||
|
print(f"Warning: '{m_name}' not found in motorsbus.motors; skipping offset.")
|
||||||
|
continue
|
||||||
|
|
||||||
|
if m_name == "gripper":
|
||||||
|
old_offset = start_pos # If gripper set the offset to the start position of the gripper
|
||||||
|
continue
|
||||||
|
|
||||||
|
# Shift the offset so the homed position reads 2047
|
||||||
|
new_offset = old_offset - 2047
|
||||||
|
|
||||||
|
# Clamp to [-2047..+2047]
|
||||||
|
if new_offset > 2047:
|
||||||
|
new_offset = 2047
|
||||||
|
print(
|
||||||
|
f"Warning: '{new_offset}' is getting clamped because its larger then 2047; This should not happen!"
|
||||||
|
)
|
||||||
|
elif new_offset < -2047:
|
||||||
|
new_offset = -2047
|
||||||
|
print(
|
||||||
|
f"Warning: '{new_offset}' is getting clamped because its smaller then -2047; This should not happen!"
|
||||||
|
)
|
||||||
|
|
||||||
|
# Determine the direction (sign) bit and magnitude
|
||||||
|
direction_bit = 1 if new_offset < 0 else 0
|
||||||
|
magnitude = abs(new_offset)
|
||||||
|
|
||||||
|
# Combine sign bit (bit 11) with the magnitude (bits 0..10)
|
||||||
|
servo_offset = (direction_bit << 11) | magnitude
|
||||||
|
|
||||||
|
# Write offset to servo
|
||||||
|
motorsbus.write("Offset", servo_offset, motor_names=m_name)
|
||||||
|
print(
|
||||||
|
f"Set offset for {m_name}: "
|
||||||
|
f"old_offset={old_offset}, new_offset={new_offset}, servo_encoded={magnitude} + direction={direction_bit}"
|
||||||
|
)
|
||||||
|
|
||||||
|
motorsbus.write("Lock", 0)
|
||||||
|
print("Offsets have been saved to EEPROM successfully.")
|
||||||
46
lerobot/common/motors/motors_bus.py
Normal file
46
lerobot/common/motors/motors_bus.py
Normal file
@@ -0,0 +1,46 @@
|
|||||||
|
import abc
|
||||||
|
|
||||||
|
|
||||||
|
class MotorsBus(abc.ABC):
|
||||||
|
"""The main LeRobot class for implementing motors buses."""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
motors: dict[str, tuple[int, str]],
|
||||||
|
):
|
||||||
|
self.motors = motors
|
||||||
|
|
||||||
|
def __len__(self):
|
||||||
|
return len(self.motors)
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def connect(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def reconnect(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def set_calibration(self, calibration: dict[str, list]):
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def apply_calibration(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def revert_calibration(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def read(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def write(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def disconnect(self):
|
||||||
|
pass
|
||||||
56
lerobot/common/motors/utils.py
Normal file
56
lerobot/common/motors/utils.py
Normal file
@@ -0,0 +1,56 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from .configs import MotorsBusConfig
|
||||||
|
from .motors_bus import MotorsBus
|
||||||
|
|
||||||
|
|
||||||
|
def make_motors_buses_from_configs(motors_bus_configs: dict[str, MotorsBusConfig]) -> list[MotorsBus]:
|
||||||
|
motors_buses = {}
|
||||||
|
|
||||||
|
for key, cfg in motors_bus_configs.items():
|
||||||
|
if cfg.type == "dynamixel":
|
||||||
|
from .dynamixel import DynamixelMotorsBus
|
||||||
|
|
||||||
|
motors_buses[key] = DynamixelMotorsBus(cfg)
|
||||||
|
|
||||||
|
elif cfg.type == "feetech":
|
||||||
|
from lerobot.common.motors.feetech.feetech import FeetechMotorsBus
|
||||||
|
|
||||||
|
motors_buses[key] = FeetechMotorsBus(cfg)
|
||||||
|
|
||||||
|
else:
|
||||||
|
raise ValueError(f"The motor type '{cfg.type}' is not valid.")
|
||||||
|
|
||||||
|
return motors_buses
|
||||||
|
|
||||||
|
|
||||||
|
def make_motors_bus(motor_type: str, **kwargs) -> MotorsBus:
|
||||||
|
if motor_type == "dynamixel":
|
||||||
|
from .configs import DynamixelMotorsBusConfig
|
||||||
|
from .dynamixel import DynamixelMotorsBus
|
||||||
|
|
||||||
|
config = DynamixelMotorsBusConfig(**kwargs)
|
||||||
|
return DynamixelMotorsBus(config)
|
||||||
|
|
||||||
|
elif motor_type == "feetech":
|
||||||
|
from feetech import FeetechMotorsBus
|
||||||
|
|
||||||
|
from .configs import FeetechMotorsBusConfig
|
||||||
|
|
||||||
|
config = FeetechMotorsBusConfig(**kwargs)
|
||||||
|
return FeetechMotorsBus(config)
|
||||||
|
|
||||||
|
else:
|
||||||
|
raise ValueError(f"The motor type '{motor_type}' is not valid.")
|
||||||
15
lerobot/common/optim/__init__.py
Normal file
15
lerobot/common/optim/__init__.py
Normal file
@@ -0,0 +1,15 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from .optimizers import OptimizerConfig as OptimizerConfig
|
||||||
40
lerobot/common/optim/factory.py
Normal file
40
lerobot/common/optim/factory.py
Normal file
@@ -0,0 +1,40 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
|
||||||
|
from torch.optim import Optimizer
|
||||||
|
from torch.optim.lr_scheduler import LRScheduler
|
||||||
|
|
||||||
|
from lerobot.common.policies.pretrained import PreTrainedPolicy
|
||||||
|
from lerobot.configs.train import TrainPipelineConfig
|
||||||
|
|
||||||
|
|
||||||
|
def make_optimizer_and_scheduler(
|
||||||
|
cfg: TrainPipelineConfig, policy: PreTrainedPolicy
|
||||||
|
) -> tuple[Optimizer, LRScheduler | None]:
|
||||||
|
"""Generates the optimizer and scheduler based on configs.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
cfg (TrainPipelineConfig): The training config that contains optimizer and scheduler configs
|
||||||
|
policy (PreTrainedPolicy): The policy config from which parameters and presets must be taken from.
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
tuple[Optimizer, LRScheduler | None]: The couple (Optimizer, Scheduler). Scheduler can be `None`.
|
||||||
|
"""
|
||||||
|
params = policy.get_optim_params() if cfg.use_policy_training_preset else policy.parameters()
|
||||||
|
optimizer = cfg.optimizer.build(params)
|
||||||
|
lr_scheduler = cfg.scheduler.build(optimizer, cfg.steps) if cfg.scheduler is not None else None
|
||||||
|
return optimizer, lr_scheduler
|
||||||
118
lerobot/common/optim/optimizers.py
Normal file
118
lerobot/common/optim/optimizers.py
Normal file
@@ -0,0 +1,118 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
import abc
|
||||||
|
from dataclasses import asdict, dataclass
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import draccus
|
||||||
|
import torch
|
||||||
|
from safetensors.torch import load_file, save_file
|
||||||
|
|
||||||
|
from lerobot.common.constants import (
|
||||||
|
OPTIMIZER_PARAM_GROUPS,
|
||||||
|
OPTIMIZER_STATE,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.utils import flatten_dict, unflatten_dict, write_json
|
||||||
|
from lerobot.common.utils.io_utils import deserialize_json_into_object
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class OptimizerConfig(draccus.ChoiceRegistry, abc.ABC):
|
||||||
|
lr: float
|
||||||
|
weight_decay: float
|
||||||
|
grad_clip_norm: float
|
||||||
|
|
||||||
|
@property
|
||||||
|
def type(self) -> str:
|
||||||
|
return self.get_choice_name(self.__class__)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def default_choice_name(cls) -> str | None:
|
||||||
|
return "adam"
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def build(self) -> torch.optim.Optimizer:
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
|
||||||
|
@OptimizerConfig.register_subclass("adam")
|
||||||
|
@dataclass
|
||||||
|
class AdamConfig(OptimizerConfig):
|
||||||
|
lr: float = 1e-3
|
||||||
|
betas: tuple[float, float] = (0.9, 0.999)
|
||||||
|
eps: float = 1e-8
|
||||||
|
weight_decay: float = 0.0
|
||||||
|
grad_clip_norm: float = 10.0
|
||||||
|
|
||||||
|
def build(self, params: dict) -> torch.optim.Optimizer:
|
||||||
|
kwargs = asdict(self)
|
||||||
|
kwargs.pop("grad_clip_norm")
|
||||||
|
return torch.optim.Adam(params, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
@OptimizerConfig.register_subclass("adamw")
|
||||||
|
@dataclass
|
||||||
|
class AdamWConfig(OptimizerConfig):
|
||||||
|
lr: float = 1e-3
|
||||||
|
betas: tuple[float, float] = (0.9, 0.999)
|
||||||
|
eps: float = 1e-8
|
||||||
|
weight_decay: float = 1e-2
|
||||||
|
grad_clip_norm: float = 10.0
|
||||||
|
|
||||||
|
def build(self, params: dict) -> torch.optim.Optimizer:
|
||||||
|
kwargs = asdict(self)
|
||||||
|
kwargs.pop("grad_clip_norm")
|
||||||
|
return torch.optim.AdamW(params, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
@OptimizerConfig.register_subclass("sgd")
|
||||||
|
@dataclass
|
||||||
|
class SGDConfig(OptimizerConfig):
|
||||||
|
lr: float = 1e-3
|
||||||
|
momentum: float = 0.0
|
||||||
|
dampening: float = 0.0
|
||||||
|
nesterov: bool = False
|
||||||
|
weight_decay: float = 0.0
|
||||||
|
grad_clip_norm: float = 10.0
|
||||||
|
|
||||||
|
def build(self, params: dict) -> torch.optim.Optimizer:
|
||||||
|
kwargs = asdict(self)
|
||||||
|
kwargs.pop("grad_clip_norm")
|
||||||
|
return torch.optim.SGD(params, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
def save_optimizer_state(optimizer: torch.optim.Optimizer, save_dir: Path) -> None:
|
||||||
|
state = optimizer.state_dict()
|
||||||
|
param_groups = state.pop("param_groups")
|
||||||
|
flat_state = flatten_dict(state)
|
||||||
|
save_file(flat_state, save_dir / OPTIMIZER_STATE)
|
||||||
|
write_json(param_groups, save_dir / OPTIMIZER_PARAM_GROUPS)
|
||||||
|
|
||||||
|
|
||||||
|
def load_optimizer_state(optimizer: torch.optim.Optimizer, save_dir: Path) -> torch.optim.Optimizer:
|
||||||
|
current_state_dict = optimizer.state_dict()
|
||||||
|
flat_state = load_file(save_dir / OPTIMIZER_STATE)
|
||||||
|
state = unflatten_dict(flat_state)
|
||||||
|
loaded_state_dict = {"state": {int(k): v for k, v in state["state"].items()}}
|
||||||
|
|
||||||
|
if "param_groups" in current_state_dict:
|
||||||
|
param_groups = deserialize_json_into_object(
|
||||||
|
save_dir / OPTIMIZER_PARAM_GROUPS, current_state_dict["param_groups"]
|
||||||
|
)
|
||||||
|
loaded_state_dict["param_groups"] = param_groups
|
||||||
|
|
||||||
|
optimizer.load_state_dict(loaded_state_dict)
|
||||||
|
return optimizer
|
||||||
122
lerobot/common/optim/schedulers.py
Normal file
122
lerobot/common/optim/schedulers.py
Normal file
@@ -0,0 +1,122 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
import abc
|
||||||
|
import math
|
||||||
|
from dataclasses import asdict, dataclass
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import draccus
|
||||||
|
from torch.optim import Optimizer
|
||||||
|
from torch.optim.lr_scheduler import LambdaLR, LRScheduler
|
||||||
|
|
||||||
|
from lerobot.common.constants import SCHEDULER_STATE
|
||||||
|
from lerobot.common.datasets.utils import write_json
|
||||||
|
from lerobot.common.utils.io_utils import deserialize_json_into_object
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class LRSchedulerConfig(draccus.ChoiceRegistry, abc.ABC):
|
||||||
|
num_warmup_steps: int
|
||||||
|
|
||||||
|
@property
|
||||||
|
def type(self) -> str:
|
||||||
|
return self.get_choice_name(self.__class__)
|
||||||
|
|
||||||
|
@abc.abstractmethod
|
||||||
|
def build(self, optimizer: Optimizer, num_training_steps: int) -> LRScheduler | None:
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
|
||||||
|
@LRSchedulerConfig.register_subclass("diffuser")
|
||||||
|
@dataclass
|
||||||
|
class DiffuserSchedulerConfig(LRSchedulerConfig):
|
||||||
|
name: str = "cosine"
|
||||||
|
num_warmup_steps: int | None = None
|
||||||
|
|
||||||
|
def build(self, optimizer: Optimizer, num_training_steps: int) -> LambdaLR:
|
||||||
|
from diffusers.optimization import get_scheduler
|
||||||
|
|
||||||
|
kwargs = {**asdict(self), "num_training_steps": num_training_steps, "optimizer": optimizer}
|
||||||
|
return get_scheduler(**kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
@LRSchedulerConfig.register_subclass("vqbet")
|
||||||
|
@dataclass
|
||||||
|
class VQBeTSchedulerConfig(LRSchedulerConfig):
|
||||||
|
num_warmup_steps: int
|
||||||
|
num_vqvae_training_steps: int
|
||||||
|
num_cycles: float = 0.5
|
||||||
|
|
||||||
|
def build(self, optimizer: Optimizer, num_training_steps: int) -> LambdaLR:
|
||||||
|
def lr_lambda(current_step):
|
||||||
|
if current_step < self.num_vqvae_training_steps:
|
||||||
|
return float(1)
|
||||||
|
else:
|
||||||
|
adjusted_step = current_step - self.num_vqvae_training_steps
|
||||||
|
if adjusted_step < self.num_warmup_steps:
|
||||||
|
return float(adjusted_step) / float(max(1, self.num_warmup_steps))
|
||||||
|
progress = float(adjusted_step - self.num_warmup_steps) / float(
|
||||||
|
max(1, num_training_steps - self.num_warmup_steps)
|
||||||
|
)
|
||||||
|
return max(0.0, 0.5 * (1.0 + math.cos(math.pi * float(self.num_cycles) * 2.0 * progress)))
|
||||||
|
|
||||||
|
return LambdaLR(optimizer, lr_lambda, -1)
|
||||||
|
|
||||||
|
|
||||||
|
@LRSchedulerConfig.register_subclass("cosine_decay_with_warmup")
|
||||||
|
@dataclass
|
||||||
|
class CosineDecayWithWarmupSchedulerConfig(LRSchedulerConfig):
|
||||||
|
"""Used by Physical Intelligence to train Pi0"""
|
||||||
|
|
||||||
|
num_warmup_steps: int
|
||||||
|
num_decay_steps: int
|
||||||
|
peak_lr: float
|
||||||
|
decay_lr: float
|
||||||
|
|
||||||
|
def build(self, optimizer: Optimizer, num_training_steps: int) -> LambdaLR:
|
||||||
|
del num_training_steps
|
||||||
|
|
||||||
|
def lr_lambda(current_step):
|
||||||
|
def linear_warmup_schedule(current_step):
|
||||||
|
if current_step <= 0:
|
||||||
|
return 1 / (self.num_warmup_steps + 1)
|
||||||
|
frac = 1 - current_step / self.num_warmup_steps
|
||||||
|
return (1 / (self.num_warmup_steps + 1) - 1) * frac + 1
|
||||||
|
|
||||||
|
def cosine_decay_schedule(current_step):
|
||||||
|
step = min(current_step, self.num_decay_steps)
|
||||||
|
cosine_decay = 0.5 * (1 + math.cos(math.pi * step / self.num_decay_steps))
|
||||||
|
alpha = self.decay_lr / self.peak_lr
|
||||||
|
decayed = (1 - alpha) * cosine_decay + alpha
|
||||||
|
return decayed
|
||||||
|
|
||||||
|
if current_step < self.num_warmup_steps:
|
||||||
|
return linear_warmup_schedule(current_step)
|
||||||
|
|
||||||
|
return cosine_decay_schedule(current_step)
|
||||||
|
|
||||||
|
return LambdaLR(optimizer, lr_lambda, -1)
|
||||||
|
|
||||||
|
|
||||||
|
def save_scheduler_state(scheduler: LRScheduler, save_dir: Path) -> None:
|
||||||
|
state_dict = scheduler.state_dict()
|
||||||
|
write_json(state_dict, save_dir / SCHEDULER_STATE)
|
||||||
|
|
||||||
|
|
||||||
|
def load_scheduler_state(scheduler: LRScheduler, save_dir: Path) -> LRScheduler:
|
||||||
|
state_dict = deserialize_json_into_object(save_dir / SCHEDULER_STATE, scheduler.state_dict())
|
||||||
|
scheduler.load_state_dict(state_dict)
|
||||||
|
return scheduler
|
||||||
19
lerobot/common/policies/__init__.py
Normal file
19
lerobot/common/policies/__init__.py
Normal file
@@ -0,0 +1,19 @@
|
|||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from .act.configuration_act import ACTConfig as ACTConfig
|
||||||
|
from .diffusion.configuration_diffusion import DiffusionConfig as DiffusionConfig
|
||||||
|
from .pi0.configuration_pi0 import PI0Config as PI0Config
|
||||||
|
from .tdmpc.configuration_tdmpc import TDMPCConfig as TDMPCConfig
|
||||||
|
from .vqbet.configuration_vqbet import VQBeTConfig as VQBeTConfig
|
||||||
@@ -15,9 +15,14 @@
|
|||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
from dataclasses import dataclass, field
|
from dataclasses import dataclass, field
|
||||||
|
|
||||||
|
from lerobot.common.optim.optimizers import AdamWConfig
|
||||||
|
from lerobot.configs.policies import PreTrainedConfig
|
||||||
|
from lerobot.configs.types import NormalizationMode
|
||||||
|
|
||||||
|
|
||||||
|
@PreTrainedConfig.register_subclass("act")
|
||||||
@dataclass
|
@dataclass
|
||||||
class ACTConfig:
|
class ACTConfig(PreTrainedConfig):
|
||||||
"""Configuration class for the Action Chunking Transformers policy.
|
"""Configuration class for the Action Chunking Transformers policy.
|
||||||
|
|
||||||
Defaults are configured for training on bimanual Aloha tasks like "insertion" or "transfer".
|
Defaults are configured for training on bimanual Aloha tasks like "insertion" or "transfer".
|
||||||
@@ -59,7 +64,7 @@ class ACTConfig:
|
|||||||
output_normalization_modes: Similar dictionary as `normalize_input_modes`, but to unnormalize to the
|
output_normalization_modes: Similar dictionary as `normalize_input_modes`, but to unnormalize to the
|
||||||
original scale. Note that this is also used for normalizing the training targets.
|
original scale. Note that this is also used for normalizing the training targets.
|
||||||
vision_backbone: Name of the torchvision resnet backbone to use for encoding images.
|
vision_backbone: Name of the torchvision resnet backbone to use for encoding images.
|
||||||
pretrained_backbone_weights: Pretrained weights from torchvision to initalize the backbone.
|
pretrained_backbone_weights: Pretrained weights from torchvision to initialize the backbone.
|
||||||
`None` means no pretrained weights.
|
`None` means no pretrained weights.
|
||||||
replace_final_stride_with_dilation: Whether to replace the ResNet's final 2x2 stride with a dilated
|
replace_final_stride_with_dilation: Whether to replace the ResNet's final 2x2 stride with a dilated
|
||||||
convolution.
|
convolution.
|
||||||
@@ -90,28 +95,11 @@ class ACTConfig:
|
|||||||
chunk_size: int = 100
|
chunk_size: int = 100
|
||||||
n_action_steps: int = 100
|
n_action_steps: int = 100
|
||||||
|
|
||||||
input_shapes: dict[str, list[int]] = field(
|
normalization_mapping: dict[str, NormalizationMode] = field(
|
||||||
default_factory=lambda: {
|
default_factory=lambda: {
|
||||||
"observation.images.top": [3, 480, 640],
|
"VISUAL": NormalizationMode.MEAN_STD,
|
||||||
"observation.state": [14],
|
"STATE": NormalizationMode.MEAN_STD,
|
||||||
}
|
"ACTION": NormalizationMode.MEAN_STD,
|
||||||
)
|
|
||||||
output_shapes: dict[str, list[int]] = field(
|
|
||||||
default_factory=lambda: {
|
|
||||||
"action": [14],
|
|
||||||
}
|
|
||||||
)
|
|
||||||
|
|
||||||
# Normalization / Unnormalization
|
|
||||||
input_normalization_modes: dict[str, str] = field(
|
|
||||||
default_factory=lambda: {
|
|
||||||
"observation.images.top": "mean_std",
|
|
||||||
"observation.state": "mean_std",
|
|
||||||
}
|
|
||||||
)
|
|
||||||
output_normalization_modes: dict[str, str] = field(
|
|
||||||
default_factory=lambda: {
|
|
||||||
"action": "mean_std",
|
|
||||||
}
|
}
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -144,7 +132,14 @@ class ACTConfig:
|
|||||||
dropout: float = 0.1
|
dropout: float = 0.1
|
||||||
kl_weight: float = 10.0
|
kl_weight: float = 10.0
|
||||||
|
|
||||||
|
# Training preset
|
||||||
|
optimizer_lr: float = 1e-5
|
||||||
|
optimizer_weight_decay: float = 1e-4
|
||||||
|
optimizer_lr_backbone: float = 1e-5
|
||||||
|
|
||||||
def __post_init__(self):
|
def __post_init__(self):
|
||||||
|
super().__post_init__()
|
||||||
|
|
||||||
"""Input validation (not exhaustive)."""
|
"""Input validation (not exhaustive)."""
|
||||||
if not self.vision_backbone.startswith("resnet"):
|
if not self.vision_backbone.startswith("resnet"):
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
@@ -164,8 +159,28 @@ class ACTConfig:
|
|||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"Multiple observation steps not handled yet. Got `nobs_steps={self.n_obs_steps}`"
|
f"Multiple observation steps not handled yet. Got `nobs_steps={self.n_obs_steps}`"
|
||||||
)
|
)
|
||||||
if (
|
|
||||||
not any(k.startswith("observation.image") for k in self.input_shapes)
|
def get_optimizer_preset(self) -> AdamWConfig:
|
||||||
and "observation.environment_state" not in self.input_shapes
|
return AdamWConfig(
|
||||||
):
|
lr=self.optimizer_lr,
|
||||||
|
weight_decay=self.optimizer_weight_decay,
|
||||||
|
)
|
||||||
|
|
||||||
|
def get_scheduler_preset(self) -> None:
|
||||||
|
return None
|
||||||
|
|
||||||
|
def validate_features(self) -> None:
|
||||||
|
if not self.image_features and not self.env_state_feature:
|
||||||
raise ValueError("You must provide at least one image or the environment state among the inputs.")
|
raise ValueError("You must provide at least one image or the environment state among the inputs.")
|
||||||
|
|
||||||
|
@property
|
||||||
|
def observation_delta_indices(self) -> None:
|
||||||
|
return None
|
||||||
|
|
||||||
|
@property
|
||||||
|
def action_delta_indices(self) -> list:
|
||||||
|
return list(range(self.chunk_size))
|
||||||
|
|
||||||
|
@property
|
||||||
|
def reward_delta_indices(self) -> None:
|
||||||
|
return None
|
||||||
|
|||||||
@@ -29,32 +29,27 @@ import numpy as np
|
|||||||
import torch
|
import torch
|
||||||
import torch.nn.functional as F # noqa: N812
|
import torch.nn.functional as F # noqa: N812
|
||||||
import torchvision
|
import torchvision
|
||||||
from huggingface_hub import PyTorchModelHubMixin
|
|
||||||
from torch import Tensor, nn
|
from torch import Tensor, nn
|
||||||
from torchvision.models._utils import IntermediateLayerGetter
|
from torchvision.models._utils import IntermediateLayerGetter
|
||||||
from torchvision.ops.misc import FrozenBatchNorm2d
|
from torchvision.ops.misc import FrozenBatchNorm2d
|
||||||
|
|
||||||
from lerobot.common.policies.act.configuration_act import ACTConfig
|
from lerobot.common.policies.act.configuration_act import ACTConfig
|
||||||
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||||
|
from lerobot.common.policies.pretrained import PreTrainedPolicy
|
||||||
|
|
||||||
|
|
||||||
class ACTPolicy(
|
class ACTPolicy(PreTrainedPolicy):
|
||||||
nn.Module,
|
|
||||||
PyTorchModelHubMixin,
|
|
||||||
library_name="lerobot",
|
|
||||||
repo_url="https://github.com/huggingface/lerobot",
|
|
||||||
tags=["robotics", "act"],
|
|
||||||
):
|
|
||||||
"""
|
"""
|
||||||
Action Chunking Transformer Policy as per Learning Fine-Grained Bimanual Manipulation with Low-Cost
|
Action Chunking Transformer Policy as per Learning Fine-Grained Bimanual Manipulation with Low-Cost
|
||||||
Hardware (paper: https://arxiv.org/abs/2304.13705, code: https://github.com/tonyzhaozh/act)
|
Hardware (paper: https://arxiv.org/abs/2304.13705, code: https://github.com/tonyzhaozh/act)
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
config_class = ACTConfig
|
||||||
name = "act"
|
name = "act"
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
config: ACTConfig | None = None,
|
config: ACTConfig,
|
||||||
dataset_stats: dict[str, dict[str, Tensor]] | None = None,
|
dataset_stats: dict[str, dict[str, Tensor]] | None = None,
|
||||||
):
|
):
|
||||||
"""
|
"""
|
||||||
@@ -64,30 +59,46 @@ class ACTPolicy(
|
|||||||
dataset_stats: Dataset statistics to be used for normalization. If not passed here, it is expected
|
dataset_stats: Dataset statistics to be used for normalization. If not passed here, it is expected
|
||||||
that they will be passed with a call to `load_state_dict` before the policy is used.
|
that they will be passed with a call to `load_state_dict` before the policy is used.
|
||||||
"""
|
"""
|
||||||
super().__init__()
|
super().__init__(config)
|
||||||
if config is None:
|
config.validate_features()
|
||||||
config = ACTConfig()
|
self.config = config
|
||||||
self.config: ACTConfig = config
|
|
||||||
|
|
||||||
self.normalize_inputs = Normalize(
|
self.normalize_inputs = Normalize(config.input_features, config.normalization_mapping, dataset_stats)
|
||||||
config.input_shapes, config.input_normalization_modes, dataset_stats
|
|
||||||
)
|
|
||||||
self.normalize_targets = Normalize(
|
self.normalize_targets = Normalize(
|
||||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
config.output_features, config.normalization_mapping, dataset_stats
|
||||||
)
|
)
|
||||||
self.unnormalize_outputs = Unnormalize(
|
self.unnormalize_outputs = Unnormalize(
|
||||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
config.output_features, config.normalization_mapping, dataset_stats
|
||||||
)
|
)
|
||||||
|
|
||||||
self.model = ACT(config)
|
self.model = ACT(config)
|
||||||
|
|
||||||
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
|
||||||
|
|
||||||
if config.temporal_ensemble_coeff is not None:
|
if config.temporal_ensemble_coeff is not None:
|
||||||
self.temporal_ensembler = ACTTemporalEnsembler(config.temporal_ensemble_coeff, config.chunk_size)
|
self.temporal_ensembler = ACTTemporalEnsembler(config.temporal_ensemble_coeff, config.chunk_size)
|
||||||
|
|
||||||
self.reset()
|
self.reset()
|
||||||
|
|
||||||
|
def get_optim_params(self) -> dict:
|
||||||
|
# TODO(aliberts, rcadene): As of now, lr_backbone == lr
|
||||||
|
# Should we remove this and just `return self.parameters()`?
|
||||||
|
return [
|
||||||
|
{
|
||||||
|
"params": [
|
||||||
|
p
|
||||||
|
for n, p in self.named_parameters()
|
||||||
|
if not n.startswith("model.backbone") and p.requires_grad
|
||||||
|
]
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"params": [
|
||||||
|
p
|
||||||
|
for n, p in self.named_parameters()
|
||||||
|
if n.startswith("model.backbone") and p.requires_grad
|
||||||
|
],
|
||||||
|
"lr": self.config.optimizer_lr_backbone,
|
||||||
|
},
|
||||||
|
]
|
||||||
|
|
||||||
def reset(self):
|
def reset(self):
|
||||||
"""This should be called whenever the environment is reset."""
|
"""This should be called whenever the environment is reset."""
|
||||||
if self.config.temporal_ensemble_coeff is not None:
|
if self.config.temporal_ensemble_coeff is not None:
|
||||||
@@ -106,9 +117,11 @@ class ACTPolicy(
|
|||||||
self.eval()
|
self.eval()
|
||||||
|
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
if len(self.expected_image_keys) > 0:
|
if self.config.image_features:
|
||||||
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
batch["observation.images"] = torch.stack(
|
||||||
|
[batch[key] for key in self.config.image_features], dim=-4
|
||||||
|
)
|
||||||
|
|
||||||
# If we are doing temporal ensembling, do online updates where we keep track of the number of actions
|
# If we are doing temporal ensembling, do online updates where we keep track of the number of actions
|
||||||
# we are ensembling over.
|
# we are ensembling over.
|
||||||
@@ -131,12 +144,14 @@ class ACTPolicy(
|
|||||||
self._action_queue.extend(actions.transpose(0, 1))
|
self._action_queue.extend(actions.transpose(0, 1))
|
||||||
return self._action_queue.popleft()
|
return self._action_queue.popleft()
|
||||||
|
|
||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> tuple[Tensor, dict]:
|
||||||
"""Run the batch through the model and compute the loss for training or validation."""
|
"""Run the batch through the model and compute the loss for training or validation."""
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
if len(self.expected_image_keys) > 0:
|
if self.config.image_features:
|
||||||
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
batch["observation.images"] = torch.stack(
|
||||||
|
[batch[key] for key in self.config.image_features], dim=-4
|
||||||
|
)
|
||||||
batch = self.normalize_targets(batch)
|
batch = self.normalize_targets(batch)
|
||||||
actions_hat, (mu_hat, log_sigma_x2_hat) = self.model(batch)
|
actions_hat, (mu_hat, log_sigma_x2_hat) = self.model(batch)
|
||||||
|
|
||||||
@@ -154,11 +169,11 @@ class ACTPolicy(
|
|||||||
(-0.5 * (1 + log_sigma_x2_hat - mu_hat.pow(2) - (log_sigma_x2_hat).exp())).sum(-1).mean()
|
(-0.5 * (1 + log_sigma_x2_hat - mu_hat.pow(2) - (log_sigma_x2_hat).exp())).sum(-1).mean()
|
||||||
)
|
)
|
||||||
loss_dict["kld_loss"] = mean_kld.item()
|
loss_dict["kld_loss"] = mean_kld.item()
|
||||||
loss_dict["loss"] = l1_loss + mean_kld * self.config.kl_weight
|
loss = l1_loss + mean_kld * self.config.kl_weight
|
||||||
else:
|
else:
|
||||||
loss_dict["loss"] = l1_loss
|
loss = l1_loss
|
||||||
|
|
||||||
return loss_dict
|
return loss, loss_dict
|
||||||
|
|
||||||
|
|
||||||
class ACTTemporalEnsembler:
|
class ACTTemporalEnsembler:
|
||||||
@@ -288,31 +303,30 @@ class ACT(nn.Module):
|
|||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, config: ACTConfig):
|
def __init__(self, config: ACTConfig):
|
||||||
super().__init__()
|
|
||||||
self.config = config
|
|
||||||
# BERT style VAE encoder with input tokens [cls, robot_state, *action_sequence].
|
# BERT style VAE encoder with input tokens [cls, robot_state, *action_sequence].
|
||||||
# The cls token forms parameters of the latent's distribution (like this [*means, *log_variances]).
|
# The cls token forms parameters of the latent's distribution (like this [*means, *log_variances]).
|
||||||
self.use_robot_state = "observation.state" in config.input_shapes
|
super().__init__()
|
||||||
self.use_images = any(k.startswith("observation.image") for k in config.input_shapes)
|
self.config = config
|
||||||
self.use_env_state = "observation.environment_state" in config.input_shapes
|
|
||||||
if self.config.use_vae:
|
if self.config.use_vae:
|
||||||
self.vae_encoder = ACTEncoder(config)
|
self.vae_encoder = ACTEncoder(config, is_vae_encoder=True)
|
||||||
self.vae_encoder_cls_embed = nn.Embedding(1, config.dim_model)
|
self.vae_encoder_cls_embed = nn.Embedding(1, config.dim_model)
|
||||||
# Projection layer for joint-space configuration to hidden dimension.
|
# Projection layer for joint-space configuration to hidden dimension.
|
||||||
if self.use_robot_state:
|
if self.config.robot_state_feature:
|
||||||
self.vae_encoder_robot_state_input_proj = nn.Linear(
|
self.vae_encoder_robot_state_input_proj = nn.Linear(
|
||||||
config.input_shapes["observation.state"][0], config.dim_model
|
self.config.robot_state_feature.shape[0], config.dim_model
|
||||||
)
|
)
|
||||||
# Projection layer for action (joint-space target) to hidden dimension.
|
# Projection layer for action (joint-space target) to hidden dimension.
|
||||||
self.vae_encoder_action_input_proj = nn.Linear(
|
self.vae_encoder_action_input_proj = nn.Linear(
|
||||||
config.output_shapes["action"][0], config.dim_model
|
self.config.action_feature.shape[0],
|
||||||
|
config.dim_model,
|
||||||
)
|
)
|
||||||
# Projection layer from the VAE encoder's output to the latent distribution's parameter space.
|
# Projection layer from the VAE encoder's output to the latent distribution's parameter space.
|
||||||
self.vae_encoder_latent_output_proj = nn.Linear(config.dim_model, config.latent_dim * 2)
|
self.vae_encoder_latent_output_proj = nn.Linear(config.dim_model, config.latent_dim * 2)
|
||||||
# Fixed sinusoidal positional embedding for the input to the VAE encoder. Unsqueeze for batch
|
# Fixed sinusoidal positional embedding for the input to the VAE encoder. Unsqueeze for batch
|
||||||
# dimension.
|
# dimension.
|
||||||
num_input_token_encoder = 1 + config.chunk_size
|
num_input_token_encoder = 1 + config.chunk_size
|
||||||
if self.use_robot_state:
|
if self.config.robot_state_feature:
|
||||||
num_input_token_encoder += 1
|
num_input_token_encoder += 1
|
||||||
self.register_buffer(
|
self.register_buffer(
|
||||||
"vae_encoder_pos_enc",
|
"vae_encoder_pos_enc",
|
||||||
@@ -320,7 +334,7 @@ class ACT(nn.Module):
|
|||||||
)
|
)
|
||||||
|
|
||||||
# Backbone for image feature extraction.
|
# Backbone for image feature extraction.
|
||||||
if self.use_images:
|
if self.config.image_features:
|
||||||
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
||||||
replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
|
replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
|
||||||
weights=config.pretrained_backbone_weights,
|
weights=config.pretrained_backbone_weights,
|
||||||
@@ -337,27 +351,27 @@ class ACT(nn.Module):
|
|||||||
|
|
||||||
# Transformer encoder input projections. The tokens will be structured like
|
# Transformer encoder input projections. The tokens will be structured like
|
||||||
# [latent, (robot_state), (env_state), (image_feature_map_pixels)].
|
# [latent, (robot_state), (env_state), (image_feature_map_pixels)].
|
||||||
if self.use_robot_state:
|
if self.config.robot_state_feature:
|
||||||
self.encoder_robot_state_input_proj = nn.Linear(
|
self.encoder_robot_state_input_proj = nn.Linear(
|
||||||
config.input_shapes["observation.state"][0], config.dim_model
|
self.config.robot_state_feature.shape[0], config.dim_model
|
||||||
)
|
)
|
||||||
if self.use_env_state:
|
if self.config.env_state_feature:
|
||||||
self.encoder_env_state_input_proj = nn.Linear(
|
self.encoder_env_state_input_proj = nn.Linear(
|
||||||
config.input_shapes["observation.environment_state"][0], config.dim_model
|
self.config.env_state_feature.shape[0], config.dim_model
|
||||||
)
|
)
|
||||||
self.encoder_latent_input_proj = nn.Linear(config.latent_dim, config.dim_model)
|
self.encoder_latent_input_proj = nn.Linear(config.latent_dim, config.dim_model)
|
||||||
if self.use_images:
|
if self.config.image_features:
|
||||||
self.encoder_img_feat_input_proj = nn.Conv2d(
|
self.encoder_img_feat_input_proj = nn.Conv2d(
|
||||||
backbone_model.fc.in_features, config.dim_model, kernel_size=1
|
backbone_model.fc.in_features, config.dim_model, kernel_size=1
|
||||||
)
|
)
|
||||||
# Transformer encoder positional embeddings.
|
# Transformer encoder positional embeddings.
|
||||||
n_1d_tokens = 1 # for the latent
|
n_1d_tokens = 1 # for the latent
|
||||||
if self.use_robot_state:
|
if self.config.robot_state_feature:
|
||||||
n_1d_tokens += 1
|
n_1d_tokens += 1
|
||||||
if self.use_env_state:
|
if self.config.env_state_feature:
|
||||||
n_1d_tokens += 1
|
n_1d_tokens += 1
|
||||||
self.encoder_1d_feature_pos_embed = nn.Embedding(n_1d_tokens, config.dim_model)
|
self.encoder_1d_feature_pos_embed = nn.Embedding(n_1d_tokens, config.dim_model)
|
||||||
if self.use_images:
|
if self.config.image_features:
|
||||||
self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(config.dim_model // 2)
|
self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(config.dim_model // 2)
|
||||||
|
|
||||||
# Transformer decoder.
|
# Transformer decoder.
|
||||||
@@ -365,7 +379,7 @@ class ACT(nn.Module):
|
|||||||
self.decoder_pos_embed = nn.Embedding(config.chunk_size, config.dim_model)
|
self.decoder_pos_embed = nn.Embedding(config.chunk_size, config.dim_model)
|
||||||
|
|
||||||
# Final action regression head on the output of the transformer's decoder.
|
# Final action regression head on the output of the transformer's decoder.
|
||||||
self.action_head = nn.Linear(config.dim_model, config.output_shapes["action"][0])
|
self.action_head = nn.Linear(config.dim_model, self.config.action_feature.shape[0])
|
||||||
|
|
||||||
self._reset_parameters()
|
self._reset_parameters()
|
||||||
|
|
||||||
@@ -380,13 +394,13 @@ class ACT(nn.Module):
|
|||||||
|
|
||||||
`batch` should have the following structure:
|
`batch` should have the following structure:
|
||||||
{
|
{
|
||||||
"observation.state" (optional): (B, state_dim) batch of robot states.
|
[robot_state_feature] (optional): (B, state_dim) batch of robot states.
|
||||||
|
|
||||||
"observation.images": (B, n_cameras, C, H, W) batch of images.
|
[image_features]: (B, n_cameras, C, H, W) batch of images.
|
||||||
AND/OR
|
AND/OR
|
||||||
"observation.environment_state": (B, env_dim) batch of environment states.
|
[env_state_feature]: (B, env_dim) batch of environment states.
|
||||||
|
|
||||||
"action" (optional, only if training with VAE): (B, chunk_size, action dim) batch of actions.
|
[action_feature] (optional, only if training with VAE): (B, chunk_size, action dim) batch of actions.
|
||||||
}
|
}
|
||||||
|
|
||||||
Returns:
|
Returns:
|
||||||
@@ -395,9 +409,9 @@ class ACT(nn.Module):
|
|||||||
latent dimension.
|
latent dimension.
|
||||||
"""
|
"""
|
||||||
if self.config.use_vae and self.training:
|
if self.config.use_vae and self.training:
|
||||||
assert (
|
assert "action" in batch, (
|
||||||
"action" in batch
|
"actions must be provided when using the variational objective in training mode."
|
||||||
), "actions must be provided when using the variational objective in training mode."
|
)
|
||||||
|
|
||||||
batch_size = (
|
batch_size = (
|
||||||
batch["observation.images"]
|
batch["observation.images"]
|
||||||
@@ -411,12 +425,12 @@ class ACT(nn.Module):
|
|||||||
cls_embed = einops.repeat(
|
cls_embed = einops.repeat(
|
||||||
self.vae_encoder_cls_embed.weight, "1 d -> b 1 d", b=batch_size
|
self.vae_encoder_cls_embed.weight, "1 d -> b 1 d", b=batch_size
|
||||||
) # (B, 1, D)
|
) # (B, 1, D)
|
||||||
if self.use_robot_state:
|
if self.config.robot_state_feature:
|
||||||
robot_state_embed = self.vae_encoder_robot_state_input_proj(batch["observation.state"])
|
robot_state_embed = self.vae_encoder_robot_state_input_proj(batch["observation.state"])
|
||||||
robot_state_embed = robot_state_embed.unsqueeze(1) # (B, 1, D)
|
robot_state_embed = robot_state_embed.unsqueeze(1) # (B, 1, D)
|
||||||
action_embed = self.vae_encoder_action_input_proj(batch["action"]) # (B, S, D)
|
action_embed = self.vae_encoder_action_input_proj(batch["action"]) # (B, S, D)
|
||||||
|
|
||||||
if self.use_robot_state:
|
if self.config.robot_state_feature:
|
||||||
vae_encoder_input = [cls_embed, robot_state_embed, action_embed] # (B, S+2, D)
|
vae_encoder_input = [cls_embed, robot_state_embed, action_embed] # (B, S+2, D)
|
||||||
else:
|
else:
|
||||||
vae_encoder_input = [cls_embed, action_embed]
|
vae_encoder_input = [cls_embed, action_embed]
|
||||||
@@ -430,7 +444,7 @@ class ACT(nn.Module):
|
|||||||
# sequence depending whether we use the input states or not (cls and robot state)
|
# sequence depending whether we use the input states or not (cls and robot state)
|
||||||
# False means not a padding token.
|
# False means not a padding token.
|
||||||
cls_joint_is_pad = torch.full(
|
cls_joint_is_pad = torch.full(
|
||||||
(batch_size, 2 if self.use_robot_state else 1),
|
(batch_size, 2 if self.config.robot_state_feature else 1),
|
||||||
False,
|
False,
|
||||||
device=batch["observation.state"].device,
|
device=batch["observation.state"].device,
|
||||||
)
|
)
|
||||||
@@ -463,16 +477,16 @@ class ACT(nn.Module):
|
|||||||
encoder_in_tokens = [self.encoder_latent_input_proj(latent_sample)]
|
encoder_in_tokens = [self.encoder_latent_input_proj(latent_sample)]
|
||||||
encoder_in_pos_embed = list(self.encoder_1d_feature_pos_embed.weight.unsqueeze(1))
|
encoder_in_pos_embed = list(self.encoder_1d_feature_pos_embed.weight.unsqueeze(1))
|
||||||
# Robot state token.
|
# Robot state token.
|
||||||
if self.use_robot_state:
|
if self.config.robot_state_feature:
|
||||||
encoder_in_tokens.append(self.encoder_robot_state_input_proj(batch["observation.state"]))
|
encoder_in_tokens.append(self.encoder_robot_state_input_proj(batch["observation.state"]))
|
||||||
# Environment state token.
|
# Environment state token.
|
||||||
if self.use_env_state:
|
if self.config.env_state_feature:
|
||||||
encoder_in_tokens.append(
|
encoder_in_tokens.append(
|
||||||
self.encoder_env_state_input_proj(batch["observation.environment_state"])
|
self.encoder_env_state_input_proj(batch["observation.environment_state"])
|
||||||
)
|
)
|
||||||
|
|
||||||
# Camera observation features and positional embeddings.
|
# Camera observation features and positional embeddings.
|
||||||
if self.use_images:
|
if self.config.image_features:
|
||||||
all_cam_features = []
|
all_cam_features = []
|
||||||
all_cam_pos_embeds = []
|
all_cam_pos_embeds = []
|
||||||
|
|
||||||
@@ -521,9 +535,11 @@ class ACT(nn.Module):
|
|||||||
class ACTEncoder(nn.Module):
|
class ACTEncoder(nn.Module):
|
||||||
"""Convenience module for running multiple encoder layers, maybe followed by normalization."""
|
"""Convenience module for running multiple encoder layers, maybe followed by normalization."""
|
||||||
|
|
||||||
def __init__(self, config: ACTConfig):
|
def __init__(self, config: ACTConfig, is_vae_encoder: bool = False):
|
||||||
super().__init__()
|
super().__init__()
|
||||||
self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(config.n_encoder_layers)])
|
self.is_vae_encoder = is_vae_encoder
|
||||||
|
num_layers = config.n_vae_encoder_layers if self.is_vae_encoder else config.n_encoder_layers
|
||||||
|
self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(num_layers)])
|
||||||
self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
|
self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
|
||||||
|
|
||||||
def forward(
|
def forward(
|
||||||
|
|||||||
@@ -16,9 +16,15 @@
|
|||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
from dataclasses import dataclass, field
|
from dataclasses import dataclass, field
|
||||||
|
|
||||||
|
from lerobot.common.optim.optimizers import AdamConfig
|
||||||
|
from lerobot.common.optim.schedulers import DiffuserSchedulerConfig
|
||||||
|
from lerobot.configs.policies import PreTrainedConfig
|
||||||
|
from lerobot.configs.types import NormalizationMode
|
||||||
|
|
||||||
|
|
||||||
|
@PreTrainedConfig.register_subclass("diffusion")
|
||||||
@dataclass
|
@dataclass
|
||||||
class DiffusionConfig:
|
class DiffusionConfig(PreTrainedConfig):
|
||||||
"""Configuration class for DiffusionPolicy.
|
"""Configuration class for DiffusionPolicy.
|
||||||
|
|
||||||
Defaults are configured for training with PushT providing proprioceptive and single camera observations.
|
Defaults are configured for training with PushT providing proprioceptive and single camera observations.
|
||||||
@@ -62,11 +68,12 @@ class DiffusionConfig:
|
|||||||
within the image size. If None, no cropping is done.
|
within the image size. If None, no cropping is done.
|
||||||
crop_is_random: Whether the crop should be random at training time (it's always a center crop in eval
|
crop_is_random: Whether the crop should be random at training time (it's always a center crop in eval
|
||||||
mode).
|
mode).
|
||||||
pretrained_backbone_weights: Pretrained weights from torchvision to initalize the backbone.
|
pretrained_backbone_weights: Pretrained weights from torchvision to initialize the backbone.
|
||||||
`None` means no pretrained weights.
|
`None` means no pretrained weights.
|
||||||
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
||||||
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
||||||
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
||||||
|
use_separate_rgb_encoders_per_camera: Whether to use a separate RGB encoder for each camera view.
|
||||||
down_dims: Feature dimension for each stage of temporal downsampling in the diffusion modeling Unet.
|
down_dims: Feature dimension for each stage of temporal downsampling in the diffusion modeling Unet.
|
||||||
You may provide a variable number of dimensions, therefore also controlling the degree of
|
You may provide a variable number of dimensions, therefore also controlling the degree of
|
||||||
downsampling.
|
downsampling.
|
||||||
@@ -92,7 +99,7 @@ class DiffusionConfig:
|
|||||||
num_inference_steps: Number of reverse diffusion steps to use at inference time (steps are evenly
|
num_inference_steps: Number of reverse diffusion steps to use at inference time (steps are evenly
|
||||||
spaced). If not provided, this defaults to be the same as `num_train_timesteps`.
|
spaced). If not provided, this defaults to be the same as `num_train_timesteps`.
|
||||||
do_mask_loss_for_padding: Whether to mask the loss when there are copy-padded actions. See
|
do_mask_loss_for_padding: Whether to mask the loss when there are copy-padded actions. See
|
||||||
`LeRobotDataset` and `load_previous_and_future_frames` for mor information. Note, this defaults
|
`LeRobotDataset` and `load_previous_and_future_frames` for more information. Note, this defaults
|
||||||
to False as the original Diffusion Policy implementation does the same.
|
to False as the original Diffusion Policy implementation does the same.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
@@ -101,26 +108,17 @@ class DiffusionConfig:
|
|||||||
horizon: int = 16
|
horizon: int = 16
|
||||||
n_action_steps: int = 8
|
n_action_steps: int = 8
|
||||||
|
|
||||||
input_shapes: dict[str, list[int]] = field(
|
normalization_mapping: dict[str, NormalizationMode] = field(
|
||||||
default_factory=lambda: {
|
default_factory=lambda: {
|
||||||
"observation.image": [3, 96, 96],
|
"VISUAL": NormalizationMode.MEAN_STD,
|
||||||
"observation.state": [2],
|
"STATE": NormalizationMode.MIN_MAX,
|
||||||
}
|
"ACTION": NormalizationMode.MIN_MAX,
|
||||||
)
|
|
||||||
output_shapes: dict[str, list[int]] = field(
|
|
||||||
default_factory=lambda: {
|
|
||||||
"action": [2],
|
|
||||||
}
|
}
|
||||||
)
|
)
|
||||||
|
|
||||||
# Normalization / Unnormalization
|
# The original implementation doesn't sample frames for the last 7 steps,
|
||||||
input_normalization_modes: dict[str, str] = field(
|
# which avoids excessive padding and leads to improved training results.
|
||||||
default_factory=lambda: {
|
drop_n_last_frames: int = 7 # horizon - n_action_steps - n_obs_steps + 1
|
||||||
"observation.image": "mean_std",
|
|
||||||
"observation.state": "min_max",
|
|
||||||
}
|
|
||||||
)
|
|
||||||
output_normalization_modes: dict[str, str] = field(default_factory=lambda: {"action": "min_max"})
|
|
||||||
|
|
||||||
# Architecture / modeling.
|
# Architecture / modeling.
|
||||||
# Vision backbone.
|
# Vision backbone.
|
||||||
@@ -130,6 +128,7 @@ class DiffusionConfig:
|
|||||||
pretrained_backbone_weights: str | None = None
|
pretrained_backbone_weights: str | None = None
|
||||||
use_group_norm: bool = True
|
use_group_norm: bool = True
|
||||||
spatial_softmax_num_keypoints: int = 32
|
spatial_softmax_num_keypoints: int = 32
|
||||||
|
use_separate_rgb_encoder_per_camera: bool = False
|
||||||
# Unet.
|
# Unet.
|
||||||
down_dims: tuple[int, ...] = (512, 1024, 2048)
|
down_dims: tuple[int, ...] = (512, 1024, 2048)
|
||||||
kernel_size: int = 5
|
kernel_size: int = 5
|
||||||
@@ -152,39 +151,23 @@ class DiffusionConfig:
|
|||||||
# Loss computation
|
# Loss computation
|
||||||
do_mask_loss_for_padding: bool = False
|
do_mask_loss_for_padding: bool = False
|
||||||
|
|
||||||
|
# Training presets
|
||||||
|
optimizer_lr: float = 1e-4
|
||||||
|
optimizer_betas: tuple = (0.95, 0.999)
|
||||||
|
optimizer_eps: float = 1e-8
|
||||||
|
optimizer_weight_decay: float = 1e-6
|
||||||
|
scheduler_name: str = "cosine"
|
||||||
|
scheduler_warmup_steps: int = 500
|
||||||
|
|
||||||
def __post_init__(self):
|
def __post_init__(self):
|
||||||
|
super().__post_init__()
|
||||||
|
|
||||||
"""Input validation (not exhaustive)."""
|
"""Input validation (not exhaustive)."""
|
||||||
if not self.vision_backbone.startswith("resnet"):
|
if not self.vision_backbone.startswith("resnet"):
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||||
)
|
)
|
||||||
|
|
||||||
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
|
||||||
|
|
||||||
if len(image_keys) == 0 and "observation.environment_state" not in self.input_shapes:
|
|
||||||
raise ValueError("You must provide at least one image or the environment state among the inputs.")
|
|
||||||
|
|
||||||
if len(image_keys) > 0:
|
|
||||||
if self.crop_shape is not None:
|
|
||||||
for image_key in image_keys:
|
|
||||||
if (
|
|
||||||
self.crop_shape[0] > self.input_shapes[image_key][1]
|
|
||||||
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
|
||||||
):
|
|
||||||
raise ValueError(
|
|
||||||
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
|
||||||
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
|
||||||
"`input_shapes[{image_key}]`."
|
|
||||||
)
|
|
||||||
# Check that all input images have the same shape.
|
|
||||||
first_image_key = next(iter(image_keys))
|
|
||||||
for image_key in image_keys:
|
|
||||||
if self.input_shapes[image_key] != self.input_shapes[first_image_key]:
|
|
||||||
raise ValueError(
|
|
||||||
f"`input_shapes[{image_key}]` does not match `input_shapes[{first_image_key}]`, but we "
|
|
||||||
"expect all image shapes to match."
|
|
||||||
)
|
|
||||||
|
|
||||||
supported_prediction_types = ["epsilon", "sample"]
|
supported_prediction_types = ["epsilon", "sample"]
|
||||||
if self.prediction_type not in supported_prediction_types:
|
if self.prediction_type not in supported_prediction_types:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
@@ -196,3 +179,59 @@ class DiffusionConfig:
|
|||||||
f"`noise_scheduler_type` must be one of {supported_noise_schedulers}. "
|
f"`noise_scheduler_type` must be one of {supported_noise_schedulers}. "
|
||||||
f"Got {self.noise_scheduler_type}."
|
f"Got {self.noise_scheduler_type}."
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# Check that the horizon size and U-Net downsampling is compatible.
|
||||||
|
# U-Net downsamples by 2 with each stage.
|
||||||
|
downsampling_factor = 2 ** len(self.down_dims)
|
||||||
|
if self.horizon % downsampling_factor != 0:
|
||||||
|
raise ValueError(
|
||||||
|
"The horizon should be an integer multiple of the downsampling factor (which is determined "
|
||||||
|
f"by `len(down_dims)`). Got {self.horizon=} and {self.down_dims=}"
|
||||||
|
)
|
||||||
|
|
||||||
|
def get_optimizer_preset(self) -> AdamConfig:
|
||||||
|
return AdamConfig(
|
||||||
|
lr=self.optimizer_lr,
|
||||||
|
betas=self.optimizer_betas,
|
||||||
|
eps=self.optimizer_eps,
|
||||||
|
weight_decay=self.optimizer_weight_decay,
|
||||||
|
)
|
||||||
|
|
||||||
|
def get_scheduler_preset(self) -> DiffuserSchedulerConfig:
|
||||||
|
return DiffuserSchedulerConfig(
|
||||||
|
name=self.scheduler_name,
|
||||||
|
num_warmup_steps=self.scheduler_warmup_steps,
|
||||||
|
)
|
||||||
|
|
||||||
|
def validate_features(self) -> None:
|
||||||
|
if len(self.image_features) == 0 and self.env_state_feature is None:
|
||||||
|
raise ValueError("You must provide at least one image or the environment state among the inputs.")
|
||||||
|
|
||||||
|
if self.crop_shape is not None:
|
||||||
|
for key, image_ft in self.image_features.items():
|
||||||
|
if self.crop_shape[0] > image_ft.shape[1] or self.crop_shape[1] > image_ft.shape[2]:
|
||||||
|
raise ValueError(
|
||||||
|
f"`crop_shape` should fit within the images shapes. Got {self.crop_shape} "
|
||||||
|
f"for `crop_shape` and {image_ft.shape} for "
|
||||||
|
f"`{key}`."
|
||||||
|
)
|
||||||
|
|
||||||
|
# Check that all input images have the same shape.
|
||||||
|
first_image_key, first_image_ft = next(iter(self.image_features.items()))
|
||||||
|
for key, image_ft in self.image_features.items():
|
||||||
|
if image_ft.shape != first_image_ft.shape:
|
||||||
|
raise ValueError(
|
||||||
|
f"`{key}` does not match `{first_image_key}`, but we expect all image shapes to match."
|
||||||
|
)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def observation_delta_indices(self) -> list:
|
||||||
|
return list(range(1 - self.n_obs_steps, 1))
|
||||||
|
|
||||||
|
@property
|
||||||
|
def action_delta_indices(self) -> list:
|
||||||
|
return list(range(1 - self.n_obs_steps, 1 - self.n_obs_steps + self.horizon))
|
||||||
|
|
||||||
|
@property
|
||||||
|
def reward_delta_indices(self) -> None:
|
||||||
|
return None
|
||||||
|
|||||||
@@ -31,35 +31,32 @@ import torch.nn.functional as F # noqa: N812
|
|||||||
import torchvision
|
import torchvision
|
||||||
from diffusers.schedulers.scheduling_ddim import DDIMScheduler
|
from diffusers.schedulers.scheduling_ddim import DDIMScheduler
|
||||||
from diffusers.schedulers.scheduling_ddpm import DDPMScheduler
|
from diffusers.schedulers.scheduling_ddpm import DDPMScheduler
|
||||||
from huggingface_hub import PyTorchModelHubMixin
|
|
||||||
from torch import Tensor, nn
|
from torch import Tensor, nn
|
||||||
|
|
||||||
|
from lerobot.common.constants import OBS_ENV_STATE, OBS_STATE
|
||||||
from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
|
from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
|
||||||
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||||
|
from lerobot.common.policies.pretrained import PreTrainedPolicy
|
||||||
from lerobot.common.policies.utils import (
|
from lerobot.common.policies.utils import (
|
||||||
get_device_from_parameters,
|
get_device_from_parameters,
|
||||||
get_dtype_from_parameters,
|
get_dtype_from_parameters,
|
||||||
|
get_output_shape,
|
||||||
populate_queues,
|
populate_queues,
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
class DiffusionPolicy(
|
class DiffusionPolicy(PreTrainedPolicy):
|
||||||
nn.Module,
|
|
||||||
PyTorchModelHubMixin,
|
|
||||||
library_name="lerobot",
|
|
||||||
repo_url="https://github.com/huggingface/lerobot",
|
|
||||||
tags=["robotics", "diffusion-policy"],
|
|
||||||
):
|
|
||||||
"""
|
"""
|
||||||
Diffusion Policy as per "Diffusion Policy: Visuomotor Policy Learning via Action Diffusion"
|
Diffusion Policy as per "Diffusion Policy: Visuomotor Policy Learning via Action Diffusion"
|
||||||
(paper: https://arxiv.org/abs/2303.04137, code: https://github.com/real-stanford/diffusion_policy).
|
(paper: https://arxiv.org/abs/2303.04137, code: https://github.com/real-stanford/diffusion_policy).
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
config_class = DiffusionConfig
|
||||||
name = "diffusion"
|
name = "diffusion"
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
config: DiffusionConfig | None = None,
|
config: DiffusionConfig,
|
||||||
dataset_stats: dict[str, dict[str, Tensor]] | None = None,
|
dataset_stats: dict[str, dict[str, Tensor]] | None = None,
|
||||||
):
|
):
|
||||||
"""
|
"""
|
||||||
@@ -69,18 +66,16 @@ class DiffusionPolicy(
|
|||||||
dataset_stats: Dataset statistics to be used for normalization. If not passed here, it is expected
|
dataset_stats: Dataset statistics to be used for normalization. If not passed here, it is expected
|
||||||
that they will be passed with a call to `load_state_dict` before the policy is used.
|
that they will be passed with a call to `load_state_dict` before the policy is used.
|
||||||
"""
|
"""
|
||||||
super().__init__()
|
super().__init__(config)
|
||||||
if config is None:
|
config.validate_features()
|
||||||
config = DiffusionConfig()
|
|
||||||
self.config = config
|
self.config = config
|
||||||
self.normalize_inputs = Normalize(
|
|
||||||
config.input_shapes, config.input_normalization_modes, dataset_stats
|
self.normalize_inputs = Normalize(config.input_features, config.normalization_mapping, dataset_stats)
|
||||||
)
|
|
||||||
self.normalize_targets = Normalize(
|
self.normalize_targets = Normalize(
|
||||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
config.output_features, config.normalization_mapping, dataset_stats
|
||||||
)
|
)
|
||||||
self.unnormalize_outputs = Unnormalize(
|
self.unnormalize_outputs = Unnormalize(
|
||||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
config.output_features, config.normalization_mapping, dataset_stats
|
||||||
)
|
)
|
||||||
|
|
||||||
# queues are populated during rollout of the policy, they contain the n latest observations and actions
|
# queues are populated during rollout of the policy, they contain the n latest observations and actions
|
||||||
@@ -88,20 +83,20 @@ class DiffusionPolicy(
|
|||||||
|
|
||||||
self.diffusion = DiffusionModel(config)
|
self.diffusion = DiffusionModel(config)
|
||||||
|
|
||||||
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
|
||||||
self.use_env_state = "observation.environment_state" in config.input_shapes
|
|
||||||
|
|
||||||
self.reset()
|
self.reset()
|
||||||
|
|
||||||
|
def get_optim_params(self) -> dict:
|
||||||
|
return self.diffusion.parameters()
|
||||||
|
|
||||||
def reset(self):
|
def reset(self):
|
||||||
"""Clear observation and action queues. Should be called on `env.reset()`"""
|
"""Clear observation and action queues. Should be called on `env.reset()`"""
|
||||||
self._queues = {
|
self._queues = {
|
||||||
"observation.state": deque(maxlen=self.config.n_obs_steps),
|
"observation.state": deque(maxlen=self.config.n_obs_steps),
|
||||||
"action": deque(maxlen=self.config.n_action_steps),
|
"action": deque(maxlen=self.config.n_action_steps),
|
||||||
}
|
}
|
||||||
if len(self.expected_image_keys) > 0:
|
if self.config.image_features:
|
||||||
self._queues["observation.images"] = deque(maxlen=self.config.n_obs_steps)
|
self._queues["observation.images"] = deque(maxlen=self.config.n_obs_steps)
|
||||||
if self.use_env_state:
|
if self.config.env_state_feature:
|
||||||
self._queues["observation.environment_state"] = deque(maxlen=self.config.n_obs_steps)
|
self._queues["observation.environment_state"] = deque(maxlen=self.config.n_obs_steps)
|
||||||
|
|
||||||
@torch.no_grad
|
@torch.no_grad
|
||||||
@@ -127,9 +122,11 @@ class DiffusionPolicy(
|
|||||||
actually measured from the first observation which (if `n_obs_steps` > 1) happened in the past.
|
actually measured from the first observation which (if `n_obs_steps` > 1) happened in the past.
|
||||||
"""
|
"""
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
if len(self.expected_image_keys) > 0:
|
if self.config.image_features:
|
||||||
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
batch["observation.images"] = torch.stack(
|
||||||
|
[batch[key] for key in self.config.image_features], dim=-4
|
||||||
|
)
|
||||||
# Note: It's important that this happens after stacking the images into a single key.
|
# Note: It's important that this happens after stacking the images into a single key.
|
||||||
self._queues = populate_queues(self._queues, batch)
|
self._queues = populate_queues(self._queues, batch)
|
||||||
|
|
||||||
@@ -146,15 +143,18 @@ class DiffusionPolicy(
|
|||||||
action = self._queues["action"].popleft()
|
action = self._queues["action"].popleft()
|
||||||
return action
|
return action
|
||||||
|
|
||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> tuple[Tensor, None]:
|
||||||
"""Run the batch through the model and compute the loss for training or validation."""
|
"""Run the batch through the model and compute the loss for training or validation."""
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
if len(self.expected_image_keys) > 0:
|
if self.config.image_features:
|
||||||
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
batch["observation.images"] = torch.stack(
|
||||||
|
[batch[key] for key in self.config.image_features], dim=-4
|
||||||
|
)
|
||||||
batch = self.normalize_targets(batch)
|
batch = self.normalize_targets(batch)
|
||||||
loss = self.diffusion.compute_loss(batch)
|
loss = self.diffusion.compute_loss(batch)
|
||||||
return {"loss": loss}
|
# no output_dict so returning None
|
||||||
|
return loss, None
|
||||||
|
|
||||||
|
|
||||||
def _make_noise_scheduler(name: str, **kwargs: dict) -> DDPMScheduler | DDIMScheduler:
|
def _make_noise_scheduler(name: str, **kwargs: dict) -> DDPMScheduler | DDIMScheduler:
|
||||||
@@ -176,17 +176,18 @@ class DiffusionModel(nn.Module):
|
|||||||
self.config = config
|
self.config = config
|
||||||
|
|
||||||
# Build observation encoders (depending on which observations are provided).
|
# Build observation encoders (depending on which observations are provided).
|
||||||
global_cond_dim = config.input_shapes["observation.state"][0]
|
global_cond_dim = self.config.robot_state_feature.shape[0]
|
||||||
num_images = len([k for k in config.input_shapes if k.startswith("observation.image")])
|
if self.config.image_features:
|
||||||
self._use_images = False
|
num_images = len(self.config.image_features)
|
||||||
self._use_env_state = False
|
if self.config.use_separate_rgb_encoder_per_camera:
|
||||||
if num_images > 0:
|
encoders = [DiffusionRgbEncoder(config) for _ in range(num_images)]
|
||||||
self._use_images = True
|
self.rgb_encoder = nn.ModuleList(encoders)
|
||||||
self.rgb_encoder = DiffusionRgbEncoder(config)
|
global_cond_dim += encoders[0].feature_dim * num_images
|
||||||
global_cond_dim += self.rgb_encoder.feature_dim * num_images
|
else:
|
||||||
if "observation.environment_state" in config.input_shapes:
|
self.rgb_encoder = DiffusionRgbEncoder(config)
|
||||||
self._use_env_state = True
|
global_cond_dim += self.rgb_encoder.feature_dim * num_images
|
||||||
global_cond_dim += config.input_shapes["observation.environment_state"][0]
|
if self.config.env_state_feature:
|
||||||
|
global_cond_dim += self.config.env_state_feature.shape[0]
|
||||||
|
|
||||||
self.unet = DiffusionConditionalUnet1d(config, global_cond_dim=global_cond_dim * config.n_obs_steps)
|
self.unet = DiffusionConditionalUnet1d(config, global_cond_dim=global_cond_dim * config.n_obs_steps)
|
||||||
|
|
||||||
@@ -215,7 +216,7 @@ class DiffusionModel(nn.Module):
|
|||||||
|
|
||||||
# Sample prior.
|
# Sample prior.
|
||||||
sample = torch.randn(
|
sample = torch.randn(
|
||||||
size=(batch_size, self.config.horizon, self.config.output_shapes["action"][0]),
|
size=(batch_size, self.config.horizon, self.config.action_feature.shape[0]),
|
||||||
dtype=dtype,
|
dtype=dtype,
|
||||||
device=device,
|
device=device,
|
||||||
generator=generator,
|
generator=generator,
|
||||||
@@ -237,22 +238,38 @@ class DiffusionModel(nn.Module):
|
|||||||
|
|
||||||
def _prepare_global_conditioning(self, batch: dict[str, Tensor]) -> Tensor:
|
def _prepare_global_conditioning(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
"""Encode image features and concatenate them all together along with the state vector."""
|
"""Encode image features and concatenate them all together along with the state vector."""
|
||||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
batch_size, n_obs_steps = batch[OBS_STATE].shape[:2]
|
||||||
global_cond_feats = [batch["observation.state"]]
|
global_cond_feats = [batch[OBS_STATE]]
|
||||||
# Extract image feature (first combine batch, sequence, and camera index dims).
|
# Extract image features.
|
||||||
if self._use_images:
|
if self.config.image_features:
|
||||||
img_features = self.rgb_encoder(
|
if self.config.use_separate_rgb_encoder_per_camera:
|
||||||
einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
|
# Combine batch and sequence dims while rearranging to make the camera index dimension first.
|
||||||
)
|
images_per_camera = einops.rearrange(batch["observation.images"], "b s n ... -> n (b s) ...")
|
||||||
# Separate batch dim and sequence dim back out. The camera index dim gets absorbed into the
|
img_features_list = torch.cat(
|
||||||
# feature dim (effectively concatenating the camera features).
|
[
|
||||||
img_features = einops.rearrange(
|
encoder(images)
|
||||||
img_features, "(b s n) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
|
for encoder, images in zip(self.rgb_encoder, images_per_camera, strict=True)
|
||||||
)
|
]
|
||||||
|
)
|
||||||
|
# Separate batch and sequence dims back out. The camera index dim gets absorbed into the
|
||||||
|
# feature dim (effectively concatenating the camera features).
|
||||||
|
img_features = einops.rearrange(
|
||||||
|
img_features_list, "(n b s) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
# Combine batch, sequence, and "which camera" dims before passing to shared encoder.
|
||||||
|
img_features = self.rgb_encoder(
|
||||||
|
einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
|
||||||
|
)
|
||||||
|
# Separate batch dim and sequence dim back out. The camera index dim gets absorbed into the
|
||||||
|
# feature dim (effectively concatenating the camera features).
|
||||||
|
img_features = einops.rearrange(
|
||||||
|
img_features, "(b s n) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
|
||||||
|
)
|
||||||
global_cond_feats.append(img_features)
|
global_cond_feats.append(img_features)
|
||||||
|
|
||||||
if self._use_env_state:
|
if self.config.env_state_feature:
|
||||||
global_cond_feats.append(batch["observation.environment_state"])
|
global_cond_feats.append(batch[OBS_ENV_STATE])
|
||||||
|
|
||||||
# Concatenate features then flatten to (B, global_cond_dim).
|
# Concatenate features then flatten to (B, global_cond_dim).
|
||||||
return torch.cat(global_cond_feats, dim=-1).flatten(start_dim=1)
|
return torch.cat(global_cond_feats, dim=-1).flatten(start_dim=1)
|
||||||
@@ -422,7 +439,7 @@ class SpatialSoftmax(nn.Module):
|
|||||||
|
|
||||||
|
|
||||||
class DiffusionRgbEncoder(nn.Module):
|
class DiffusionRgbEncoder(nn.Module):
|
||||||
"""Encoder an RGB image into a 1D feature vector.
|
"""Encodes an RGB image into a 1D feature vector.
|
||||||
|
|
||||||
Includes the ability to normalize and crop the image first.
|
Includes the ability to normalize and crop the image first.
|
||||||
"""
|
"""
|
||||||
@@ -461,19 +478,16 @@ class DiffusionRgbEncoder(nn.Module):
|
|||||||
|
|
||||||
# Set up pooling and final layers.
|
# Set up pooling and final layers.
|
||||||
# Use a dry run to get the feature map shape.
|
# Use a dry run to get the feature map shape.
|
||||||
# The dummy input should take the number of image channels from `config.input_shapes` and it should
|
# The dummy input should take the number of image channels from `config.image_features` and it should
|
||||||
# use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
|
# use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
|
||||||
# height and width from `config.input_shapes`.
|
# height and width from `config.image_features`.
|
||||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
|
||||||
# Note: we have a check in the config class to make sure all images have the same shape.
|
# Note: we have a check in the config class to make sure all images have the same shape.
|
||||||
image_key = image_keys[0]
|
images_shape = next(iter(config.image_features.values())).shape
|
||||||
dummy_input_h_w = (
|
dummy_shape_h_w = config.crop_shape if config.crop_shape is not None else images_shape[1:]
|
||||||
config.crop_shape if config.crop_shape is not None else config.input_shapes[image_key][1:]
|
dummy_shape = (1, images_shape[0], *dummy_shape_h_w)
|
||||||
)
|
feature_map_shape = get_output_shape(self.backbone, dummy_shape)[1:]
|
||||||
dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *dummy_input_h_w))
|
|
||||||
with torch.inference_mode():
|
|
||||||
dummy_feature_map = self.backbone(dummy_input)
|
|
||||||
feature_map_shape = tuple(dummy_feature_map.shape[1:])
|
|
||||||
self.pool = SpatialSoftmax(feature_map_shape, num_kp=config.spatial_softmax_num_keypoints)
|
self.pool = SpatialSoftmax(feature_map_shape, num_kp=config.spatial_softmax_num_keypoints)
|
||||||
self.feature_dim = config.spatial_softmax_num_keypoints * 2
|
self.feature_dim = config.spatial_softmax_num_keypoints * 2
|
||||||
self.out = nn.Linear(config.spatial_softmax_num_keypoints * 2, self.feature_dim)
|
self.out = nn.Linear(config.spatial_softmax_num_keypoints * 2, self.feature_dim)
|
||||||
@@ -590,7 +604,7 @@ class DiffusionConditionalUnet1d(nn.Module):
|
|||||||
|
|
||||||
# In channels / out channels for each downsampling block in the Unet's encoder. For the decoder, we
|
# In channels / out channels for each downsampling block in the Unet's encoder. For the decoder, we
|
||||||
# just reverse these.
|
# just reverse these.
|
||||||
in_out = [(config.output_shapes["action"][0], config.down_dims[0])] + list(
|
in_out = [(config.action_feature.shape[0], config.down_dims[0])] + list(
|
||||||
zip(config.down_dims[:-1], config.down_dims[1:], strict=True)
|
zip(config.down_dims[:-1], config.down_dims[1:], strict=True)
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -645,7 +659,7 @@ class DiffusionConditionalUnet1d(nn.Module):
|
|||||||
|
|
||||||
self.final_conv = nn.Sequential(
|
self.final_conv = nn.Sequential(
|
||||||
DiffusionConv1dBlock(config.down_dims[0], config.down_dims[0], kernel_size=config.kernel_size),
|
DiffusionConv1dBlock(config.down_dims[0], config.down_dims[0], kernel_size=config.kernel_size),
|
||||||
nn.Conv1d(config.down_dims[0], config.output_shapes["action"][0], 1),
|
nn.Conv1d(config.down_dims[0], config.action_feature.shape[0], 1),
|
||||||
)
|
)
|
||||||
|
|
||||||
def forward(self, x: Tensor, timestep: Tensor | int, global_cond=None) -> Tensor:
|
def forward(self, x: Tensor, timestep: Tensor | int, global_cond=None) -> Tensor:
|
||||||
|
|||||||
@@ -13,99 +13,138 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
import inspect
|
|
||||||
import logging
|
import logging
|
||||||
|
|
||||||
from omegaconf import DictConfig, OmegaConf
|
from torch import nn
|
||||||
|
|
||||||
from lerobot.common.policies.policy_protocol import Policy
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDatasetMetadata
|
||||||
from lerobot.common.utils.utils import get_safe_torch_device
|
from lerobot.common.datasets.utils import dataset_to_policy_features
|
||||||
|
from lerobot.common.envs.configs import EnvConfig
|
||||||
|
from lerobot.common.envs.utils import env_to_policy_features
|
||||||
|
from lerobot.common.policies.act.configuration_act import ACTConfig
|
||||||
|
from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
|
||||||
|
from lerobot.common.policies.pi0.configuration_pi0 import PI0Config
|
||||||
|
from lerobot.common.policies.pretrained import PreTrainedPolicy
|
||||||
|
from lerobot.common.policies.tdmpc.configuration_tdmpc import TDMPCConfig
|
||||||
|
from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
|
||||||
|
from lerobot.configs.policies import PreTrainedConfig
|
||||||
|
from lerobot.configs.types import FeatureType
|
||||||
|
|
||||||
|
|
||||||
def _policy_cfg_from_hydra_cfg(policy_cfg_class, hydra_cfg):
|
def get_policy_class(name: str) -> PreTrainedPolicy:
|
||||||
expected_kwargs = set(inspect.signature(policy_cfg_class).parameters)
|
|
||||||
if not set(hydra_cfg.policy).issuperset(expected_kwargs):
|
|
||||||
logging.warning(
|
|
||||||
f"Hydra config is missing arguments: {set(expected_kwargs).difference(hydra_cfg.policy)}"
|
|
||||||
)
|
|
||||||
|
|
||||||
# OmegaConf.to_container returns lists where sequences are found, but our dataclasses use tuples to avoid
|
|
||||||
# issues with mutable defaults. This filter changes all lists to tuples.
|
|
||||||
def list_to_tuple(item):
|
|
||||||
return tuple(item) if isinstance(item, list) else item
|
|
||||||
|
|
||||||
policy_cfg = policy_cfg_class(
|
|
||||||
**{
|
|
||||||
k: list_to_tuple(v)
|
|
||||||
for k, v in OmegaConf.to_container(hydra_cfg.policy, resolve=True).items()
|
|
||||||
if k in expected_kwargs
|
|
||||||
}
|
|
||||||
)
|
|
||||||
return policy_cfg
|
|
||||||
|
|
||||||
|
|
||||||
def get_policy_and_config_classes(name: str) -> tuple[Policy, object]:
|
|
||||||
"""Get the policy's class and config class given a name (matching the policy class' `name` attribute)."""
|
"""Get the policy's class and config class given a name (matching the policy class' `name` attribute)."""
|
||||||
if name == "tdmpc":
|
if name == "tdmpc":
|
||||||
from lerobot.common.policies.tdmpc.configuration_tdmpc import TDMPCConfig
|
|
||||||
from lerobot.common.policies.tdmpc.modeling_tdmpc import TDMPCPolicy
|
from lerobot.common.policies.tdmpc.modeling_tdmpc import TDMPCPolicy
|
||||||
|
|
||||||
return TDMPCPolicy, TDMPCConfig
|
return TDMPCPolicy
|
||||||
elif name == "diffusion":
|
elif name == "diffusion":
|
||||||
from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
|
|
||||||
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||||
|
|
||||||
return DiffusionPolicy, DiffusionConfig
|
return DiffusionPolicy
|
||||||
elif name == "act":
|
elif name == "act":
|
||||||
from lerobot.common.policies.act.configuration_act import ACTConfig
|
|
||||||
from lerobot.common.policies.act.modeling_act import ACTPolicy
|
from lerobot.common.policies.act.modeling_act import ACTPolicy
|
||||||
|
|
||||||
return ACTPolicy, ACTConfig
|
return ACTPolicy
|
||||||
elif name == "vqbet":
|
elif name == "vqbet":
|
||||||
from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
|
|
||||||
from lerobot.common.policies.vqbet.modeling_vqbet import VQBeTPolicy
|
from lerobot.common.policies.vqbet.modeling_vqbet import VQBeTPolicy
|
||||||
|
|
||||||
return VQBeTPolicy, VQBeTConfig
|
return VQBeTPolicy
|
||||||
|
elif name == "pi0":
|
||||||
|
from lerobot.common.policies.pi0.modeling_pi0 import PI0Policy
|
||||||
|
|
||||||
|
return PI0Policy
|
||||||
else:
|
else:
|
||||||
raise NotImplementedError(f"Policy with name {name} is not implemented.")
|
raise NotImplementedError(f"Policy with name {name} is not implemented.")
|
||||||
|
|
||||||
|
|
||||||
|
def make_policy_config(policy_type: str, **kwargs) -> PreTrainedConfig:
|
||||||
|
if policy_type == "tdmpc":
|
||||||
|
return TDMPCConfig(**kwargs)
|
||||||
|
elif policy_type == "diffusion":
|
||||||
|
return DiffusionConfig(**kwargs)
|
||||||
|
elif policy_type == "act":
|
||||||
|
return ACTConfig(**kwargs)
|
||||||
|
elif policy_type == "vqbet":
|
||||||
|
return VQBeTConfig(**kwargs)
|
||||||
|
elif policy_type == "pi0":
|
||||||
|
return PI0Config(**kwargs)
|
||||||
|
else:
|
||||||
|
raise ValueError(f"Policy type '{policy_type}' is not available.")
|
||||||
|
|
||||||
|
|
||||||
def make_policy(
|
def make_policy(
|
||||||
hydra_cfg: DictConfig, pretrained_policy_name_or_path: str | None = None, dataset_stats=None
|
cfg: PreTrainedConfig,
|
||||||
) -> Policy:
|
ds_meta: LeRobotDatasetMetadata | None = None,
|
||||||
|
env_cfg: EnvConfig | None = None,
|
||||||
|
) -> PreTrainedPolicy:
|
||||||
"""Make an instance of a policy class.
|
"""Make an instance of a policy class.
|
||||||
|
|
||||||
|
This function exists because (for now) we need to parse features from either a dataset or an environment
|
||||||
|
in order to properly dimension and instantiate a policy for that dataset or environment.
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
hydra_cfg: A parsed Hydra configuration (see scripts). If `pretrained_policy_name_or_path` is
|
cfg (PreTrainedConfig): The config of the policy to make. If `pretrained_path` is set, the policy will
|
||||||
provided, only `hydra_cfg.policy.name` is used while everything else is ignored.
|
be loaded with the weights from that path.
|
||||||
pretrained_policy_name_or_path: Either the repo ID of a model hosted on the Hub or a path to a
|
ds_meta (LeRobotDatasetMetadata | None, optional): Dataset metadata to take input/output shapes and
|
||||||
directory containing weights saved using `Policy.save_pretrained`. Note that providing this
|
statistics to use for (un)normalization of inputs/outputs in the policy. Defaults to None.
|
||||||
argument overrides everything in `hydra_cfg.policy` apart from `hydra_cfg.policy.name`.
|
env_cfg (EnvConfig | None, optional): The config of a gym environment to parse features from. Must be
|
||||||
dataset_stats: Dataset statistics to use for (un)normalization of inputs/outputs in the policy. Must
|
provided if ds_meta is not. Defaults to None.
|
||||||
be provided when initializing a new policy, and must not be provided when loading a pretrained
|
|
||||||
policy. Therefore, this argument is mutually exclusive with `pretrained_policy_name_or_path`.
|
Raises:
|
||||||
|
ValueError: Either ds_meta or env and env_cfg must be provided.
|
||||||
|
NotImplementedError: if the policy.type is 'vqbet' and the policy device 'mps' (due to an incompatibility)
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
PreTrainedPolicy: _description_
|
||||||
"""
|
"""
|
||||||
if not (pretrained_policy_name_or_path is None) ^ (dataset_stats is None):
|
if bool(ds_meta) == bool(env_cfg):
|
||||||
raise ValueError(
|
raise ValueError("Either one of a dataset metadata or a sim env must be provided.")
|
||||||
"Exactly one of `pretrained_policy_name_or_path` and `dataset_stats` must be provided."
|
|
||||||
|
# NOTE: Currently, if you try to run vqbet with mps backend, you'll get this error.
|
||||||
|
# TODO(aliberts, rcadene): Implement a check_backend_compatibility in policies?
|
||||||
|
# NotImplementedError: The operator 'aten::unique_dim' is not currently implemented for the MPS device. If
|
||||||
|
# you want this op to be added in priority during the prototype phase of this feature, please comment on
|
||||||
|
# https://github.com/pytorch/pytorch/issues/77764. As a temporary fix, you can set the environment
|
||||||
|
# variable `PYTORCH_ENABLE_MPS_FALLBACK=1` to use the CPU as a fallback for this op. WARNING: this will be
|
||||||
|
# slower than running natively on MPS.
|
||||||
|
if cfg.type == "vqbet" and cfg.device == "mps":
|
||||||
|
raise NotImplementedError(
|
||||||
|
"Current implementation of VQBeT does not support `mps` backend. "
|
||||||
|
"Please use `cpu` or `cuda` backend."
|
||||||
)
|
)
|
||||||
|
|
||||||
policy_cls, policy_cfg_class = get_policy_and_config_classes(hydra_cfg.policy.name)
|
policy_cls = get_policy_class(cfg.type)
|
||||||
|
|
||||||
policy_cfg = _policy_cfg_from_hydra_cfg(policy_cfg_class, hydra_cfg)
|
kwargs = {}
|
||||||
if pretrained_policy_name_or_path is None:
|
if ds_meta is not None:
|
||||||
# Make a fresh policy.
|
features = dataset_to_policy_features(ds_meta.features)
|
||||||
policy = policy_cls(policy_cfg, dataset_stats)
|
kwargs["dataset_stats"] = ds_meta.stats
|
||||||
else:
|
else:
|
||||||
|
if not cfg.pretrained_path:
|
||||||
|
logging.warning(
|
||||||
|
"You are instantiating a policy from scratch and its features are parsed from an environment "
|
||||||
|
"rather than a dataset. Normalization modules inside the policy will have infinite values "
|
||||||
|
"by default without stats from a dataset."
|
||||||
|
)
|
||||||
|
features = env_to_policy_features(env_cfg)
|
||||||
|
|
||||||
|
cfg.output_features = {key: ft for key, ft in features.items() if ft.type is FeatureType.ACTION}
|
||||||
|
cfg.input_features = {key: ft for key, ft in features.items() if key not in cfg.output_features}
|
||||||
|
kwargs["config"] = cfg
|
||||||
|
|
||||||
|
if cfg.pretrained_path:
|
||||||
# Load a pretrained policy and override the config if needed (for example, if there are inference-time
|
# Load a pretrained policy and override the config if needed (for example, if there are inference-time
|
||||||
# hyperparameters that we want to vary).
|
# hyperparameters that we want to vary).
|
||||||
# TODO(alexander-soare): This hack makes use of huggingface_hub's tooling to load the policy with,
|
kwargs["pretrained_name_or_path"] = cfg.pretrained_path
|
||||||
# pretrained weights which are then loaded into a fresh policy with the desired config. This PR in
|
policy = policy_cls.from_pretrained(**kwargs)
|
||||||
# huggingface_hub should make it possible to avoid the hack:
|
else:
|
||||||
# https://github.com/huggingface/huggingface_hub/pull/2274.
|
# Make a fresh policy.
|
||||||
policy = policy_cls(policy_cfg)
|
policy = policy_cls(**kwargs)
|
||||||
policy.load_state_dict(policy_cls.from_pretrained(pretrained_policy_name_or_path).state_dict())
|
|
||||||
|
|
||||||
policy.to(get_safe_torch_device(hydra_cfg.device))
|
policy.to(cfg.device)
|
||||||
|
assert isinstance(policy, nn.Module)
|
||||||
|
|
||||||
|
# policy = torch.compile(policy, mode="reduce-overhead")
|
||||||
|
|
||||||
return policy
|
return policy
|
||||||
|
|||||||
@@ -13,13 +13,16 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
import numpy as np
|
||||||
import torch
|
import torch
|
||||||
from torch import Tensor, nn
|
from torch import Tensor, nn
|
||||||
|
|
||||||
|
from lerobot.configs.types import FeatureType, NormalizationMode, PolicyFeature
|
||||||
|
|
||||||
|
|
||||||
def create_stats_buffers(
|
def create_stats_buffers(
|
||||||
shapes: dict[str, list[int]],
|
features: dict[str, PolicyFeature],
|
||||||
modes: dict[str, str],
|
norm_map: dict[str, NormalizationMode],
|
||||||
stats: dict[str, dict[str, Tensor]] | None = None,
|
stats: dict[str, dict[str, Tensor]] | None = None,
|
||||||
) -> dict[str, dict[str, nn.ParameterDict]]:
|
) -> dict[str, dict[str, nn.ParameterDict]]:
|
||||||
"""
|
"""
|
||||||
@@ -34,12 +37,16 @@ def create_stats_buffers(
|
|||||||
"""
|
"""
|
||||||
stats_buffers = {}
|
stats_buffers = {}
|
||||||
|
|
||||||
for key, mode in modes.items():
|
for key, ft in features.items():
|
||||||
assert mode in ["mean_std", "min_max"]
|
norm_mode = norm_map.get(ft.type, NormalizationMode.IDENTITY)
|
||||||
|
if norm_mode is NormalizationMode.IDENTITY:
|
||||||
|
continue
|
||||||
|
|
||||||
shape = tuple(shapes[key])
|
assert isinstance(norm_mode, NormalizationMode)
|
||||||
|
|
||||||
if "image" in key:
|
shape = tuple(ft.shape)
|
||||||
|
|
||||||
|
if ft.type is FeatureType.VISUAL:
|
||||||
# sanity checks
|
# sanity checks
|
||||||
assert len(shape) == 3, f"number of dimensions of {key} != 3 ({shape=}"
|
assert len(shape) == 3, f"number of dimensions of {key} != 3 ({shape=}"
|
||||||
c, h, w = shape
|
c, h, w = shape
|
||||||
@@ -52,7 +59,7 @@ def create_stats_buffers(
|
|||||||
# we assert they are not infinity anymore.
|
# we assert they are not infinity anymore.
|
||||||
|
|
||||||
buffer = {}
|
buffer = {}
|
||||||
if mode == "mean_std":
|
if norm_mode is NormalizationMode.MEAN_STD:
|
||||||
mean = torch.ones(shape, dtype=torch.float32) * torch.inf
|
mean = torch.ones(shape, dtype=torch.float32) * torch.inf
|
||||||
std = torch.ones(shape, dtype=torch.float32) * torch.inf
|
std = torch.ones(shape, dtype=torch.float32) * torch.inf
|
||||||
buffer = nn.ParameterDict(
|
buffer = nn.ParameterDict(
|
||||||
@@ -61,7 +68,7 @@ def create_stats_buffers(
|
|||||||
"std": nn.Parameter(std, requires_grad=False),
|
"std": nn.Parameter(std, requires_grad=False),
|
||||||
}
|
}
|
||||||
)
|
)
|
||||||
elif mode == "min_max":
|
elif norm_mode is NormalizationMode.MIN_MAX:
|
||||||
min = torch.ones(shape, dtype=torch.float32) * torch.inf
|
min = torch.ones(shape, dtype=torch.float32) * torch.inf
|
||||||
max = torch.ones(shape, dtype=torch.float32) * torch.inf
|
max = torch.ones(shape, dtype=torch.float32) * torch.inf
|
||||||
buffer = nn.ParameterDict(
|
buffer = nn.ParameterDict(
|
||||||
@@ -71,17 +78,29 @@ def create_stats_buffers(
|
|||||||
}
|
}
|
||||||
)
|
)
|
||||||
|
|
||||||
if stats is not None:
|
# TODO(aliberts, rcadene): harmonize this to only use one framework (np or torch)
|
||||||
# Note: The clone is needed to make sure that the logic in save_pretrained doesn't see duplicated
|
if stats:
|
||||||
# tensors anywhere (for example, when we use the same stats for normalization and
|
if isinstance(stats[key]["mean"], np.ndarray):
|
||||||
# unnormalization). See the logic here
|
if norm_mode is NormalizationMode.MEAN_STD:
|
||||||
# https://github.com/huggingface/safetensors/blob/079781fd0dc455ba0fe851e2b4507c33d0c0d407/bindings/python/py_src/safetensors/torch.py#L97.
|
buffer["mean"].data = torch.from_numpy(stats[key]["mean"]).to(dtype=torch.float32)
|
||||||
if mode == "mean_std":
|
buffer["std"].data = torch.from_numpy(stats[key]["std"]).to(dtype=torch.float32)
|
||||||
buffer["mean"].data = stats[key]["mean"].clone()
|
elif norm_mode is NormalizationMode.MIN_MAX:
|
||||||
buffer["std"].data = stats[key]["std"].clone()
|
buffer["min"].data = torch.from_numpy(stats[key]["min"]).to(dtype=torch.float32)
|
||||||
elif mode == "min_max":
|
buffer["max"].data = torch.from_numpy(stats[key]["max"]).to(dtype=torch.float32)
|
||||||
buffer["min"].data = stats[key]["min"].clone()
|
elif isinstance(stats[key]["mean"], torch.Tensor):
|
||||||
buffer["max"].data = stats[key]["max"].clone()
|
# Note: The clone is needed to make sure that the logic in save_pretrained doesn't see duplicated
|
||||||
|
# tensors anywhere (for example, when we use the same stats for normalization and
|
||||||
|
# unnormalization). See the logic here
|
||||||
|
# https://github.com/huggingface/safetensors/blob/079781fd0dc455ba0fe851e2b4507c33d0c0d407/bindings/python/py_src/safetensors/torch.py#L97.
|
||||||
|
if norm_mode is NormalizationMode.MEAN_STD:
|
||||||
|
buffer["mean"].data = stats[key]["mean"].clone().to(dtype=torch.float32)
|
||||||
|
buffer["std"].data = stats[key]["std"].clone().to(dtype=torch.float32)
|
||||||
|
elif norm_mode is NormalizationMode.MIN_MAX:
|
||||||
|
buffer["min"].data = stats[key]["min"].clone().to(dtype=torch.float32)
|
||||||
|
buffer["max"].data = stats[key]["max"].clone().to(dtype=torch.float32)
|
||||||
|
else:
|
||||||
|
type_ = type(stats[key]["mean"])
|
||||||
|
raise ValueError(f"np.ndarray or torch.Tensor expected, but type is '{type_}' instead.")
|
||||||
|
|
||||||
stats_buffers[key] = buffer
|
stats_buffers[key] = buffer
|
||||||
return stats_buffers
|
return stats_buffers
|
||||||
@@ -99,8 +118,8 @@ class Normalize(nn.Module):
|
|||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
shapes: dict[str, list[int]],
|
features: dict[str, PolicyFeature],
|
||||||
modes: dict[str, str],
|
norm_map: dict[str, NormalizationMode],
|
||||||
stats: dict[str, dict[str, Tensor]] | None = None,
|
stats: dict[str, dict[str, Tensor]] | None = None,
|
||||||
):
|
):
|
||||||
"""
|
"""
|
||||||
@@ -122,10 +141,10 @@ class Normalize(nn.Module):
|
|||||||
dataset is not needed to get the stats, since they are already in the policy state_dict.
|
dataset is not needed to get the stats, since they are already in the policy state_dict.
|
||||||
"""
|
"""
|
||||||
super().__init__()
|
super().__init__()
|
||||||
self.shapes = shapes
|
self.features = features
|
||||||
self.modes = modes
|
self.norm_map = norm_map
|
||||||
self.stats = stats
|
self.stats = stats
|
||||||
stats_buffers = create_stats_buffers(shapes, modes, stats)
|
stats_buffers = create_stats_buffers(features, norm_map, stats)
|
||||||
for key, buffer in stats_buffers.items():
|
for key, buffer in stats_buffers.items():
|
||||||
setattr(self, "buffer_" + key.replace(".", "_"), buffer)
|
setattr(self, "buffer_" + key.replace(".", "_"), buffer)
|
||||||
|
|
||||||
@@ -133,16 +152,24 @@ class Normalize(nn.Module):
|
|||||||
@torch.no_grad
|
@torch.no_grad
|
||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||||
batch = dict(batch) # shallow copy avoids mutating the input batch
|
batch = dict(batch) # shallow copy avoids mutating the input batch
|
||||||
for key, mode in self.modes.items():
|
for key, ft in self.features.items():
|
||||||
|
if key not in batch:
|
||||||
|
# FIXME(aliberts, rcadene): This might lead to silent fail!
|
||||||
|
continue
|
||||||
|
|
||||||
|
norm_mode = self.norm_map.get(ft.type, NormalizationMode.IDENTITY)
|
||||||
|
if norm_mode is NormalizationMode.IDENTITY:
|
||||||
|
continue
|
||||||
|
|
||||||
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
||||||
|
|
||||||
if mode == "mean_std":
|
if norm_mode is NormalizationMode.MEAN_STD:
|
||||||
mean = buffer["mean"]
|
mean = buffer["mean"]
|
||||||
std = buffer["std"]
|
std = buffer["std"]
|
||||||
assert not torch.isinf(mean).any(), _no_stats_error_str("mean")
|
assert not torch.isinf(mean).any(), _no_stats_error_str("mean")
|
||||||
assert not torch.isinf(std).any(), _no_stats_error_str("std")
|
assert not torch.isinf(std).any(), _no_stats_error_str("std")
|
||||||
batch[key] = (batch[key] - mean) / (std + 1e-8)
|
batch[key] = (batch[key] - mean) / (std + 1e-8)
|
||||||
elif mode == "min_max":
|
elif norm_mode is NormalizationMode.MIN_MAX:
|
||||||
min = buffer["min"]
|
min = buffer["min"]
|
||||||
max = buffer["max"]
|
max = buffer["max"]
|
||||||
assert not torch.isinf(min).any(), _no_stats_error_str("min")
|
assert not torch.isinf(min).any(), _no_stats_error_str("min")
|
||||||
@@ -152,7 +179,7 @@ class Normalize(nn.Module):
|
|||||||
# normalize to [-1, 1]
|
# normalize to [-1, 1]
|
||||||
batch[key] = batch[key] * 2 - 1
|
batch[key] = batch[key] * 2 - 1
|
||||||
else:
|
else:
|
||||||
raise ValueError(mode)
|
raise ValueError(norm_mode)
|
||||||
return batch
|
return batch
|
||||||
|
|
||||||
|
|
||||||
@@ -164,8 +191,8 @@ class Unnormalize(nn.Module):
|
|||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
shapes: dict[str, list[int]],
|
features: dict[str, PolicyFeature],
|
||||||
modes: dict[str, str],
|
norm_map: dict[str, NormalizationMode],
|
||||||
stats: dict[str, dict[str, Tensor]] | None = None,
|
stats: dict[str, dict[str, Tensor]] | None = None,
|
||||||
):
|
):
|
||||||
"""
|
"""
|
||||||
@@ -187,11 +214,11 @@ class Unnormalize(nn.Module):
|
|||||||
dataset is not needed to get the stats, since they are already in the policy state_dict.
|
dataset is not needed to get the stats, since they are already in the policy state_dict.
|
||||||
"""
|
"""
|
||||||
super().__init__()
|
super().__init__()
|
||||||
self.shapes = shapes
|
self.features = features
|
||||||
self.modes = modes
|
self.norm_map = norm_map
|
||||||
self.stats = stats
|
self.stats = stats
|
||||||
# `self.buffer_observation_state["mean"]` contains `torch.tensor(state_dim)`
|
# `self.buffer_observation_state["mean"]` contains `torch.tensor(state_dim)`
|
||||||
stats_buffers = create_stats_buffers(shapes, modes, stats)
|
stats_buffers = create_stats_buffers(features, norm_map, stats)
|
||||||
for key, buffer in stats_buffers.items():
|
for key, buffer in stats_buffers.items():
|
||||||
setattr(self, "buffer_" + key.replace(".", "_"), buffer)
|
setattr(self, "buffer_" + key.replace(".", "_"), buffer)
|
||||||
|
|
||||||
@@ -199,16 +226,23 @@ class Unnormalize(nn.Module):
|
|||||||
@torch.no_grad
|
@torch.no_grad
|
||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||||
batch = dict(batch) # shallow copy avoids mutating the input batch
|
batch = dict(batch) # shallow copy avoids mutating the input batch
|
||||||
for key, mode in self.modes.items():
|
for key, ft in self.features.items():
|
||||||
|
if key not in batch:
|
||||||
|
continue
|
||||||
|
|
||||||
|
norm_mode = self.norm_map.get(ft.type, NormalizationMode.IDENTITY)
|
||||||
|
if norm_mode is NormalizationMode.IDENTITY:
|
||||||
|
continue
|
||||||
|
|
||||||
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
||||||
|
|
||||||
if mode == "mean_std":
|
if norm_mode is NormalizationMode.MEAN_STD:
|
||||||
mean = buffer["mean"]
|
mean = buffer["mean"]
|
||||||
std = buffer["std"]
|
std = buffer["std"]
|
||||||
assert not torch.isinf(mean).any(), _no_stats_error_str("mean")
|
assert not torch.isinf(mean).any(), _no_stats_error_str("mean")
|
||||||
assert not torch.isinf(std).any(), _no_stats_error_str("std")
|
assert not torch.isinf(std).any(), _no_stats_error_str("std")
|
||||||
batch[key] = batch[key] * std + mean
|
batch[key] = batch[key] * std + mean
|
||||||
elif mode == "min_max":
|
elif norm_mode is NormalizationMode.MIN_MAX:
|
||||||
min = buffer["min"]
|
min = buffer["min"]
|
||||||
max = buffer["max"]
|
max = buffer["max"]
|
||||||
assert not torch.isinf(min).any(), _no_stats_error_str("min")
|
assert not torch.isinf(min).any(), _no_stats_error_str("min")
|
||||||
@@ -216,5 +250,5 @@ class Unnormalize(nn.Module):
|
|||||||
batch[key] = (batch[key] + 1) / 2
|
batch[key] = (batch[key] + 1) / 2
|
||||||
batch[key] = batch[key] * (max - min) + min
|
batch[key] = batch[key] * (max - min) + min
|
||||||
else:
|
else:
|
||||||
raise ValueError(mode)
|
raise ValueError(norm_mode)
|
||||||
return batch
|
return batch
|
||||||
|
|||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user