Compare commits
230 Commits
thomwolf_2
...
user/miche
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
36714a14a7 | ||
|
|
68b8e274dd | ||
|
|
1a7b4ec890 | ||
|
|
1c9eccd279 | ||
|
|
7551260104 | ||
|
|
95758cb867 | ||
|
|
2ecc34ceb9 | ||
|
|
8598e80718 | ||
|
|
6fa3e5f9ad | ||
|
|
b7bd13570f | ||
|
|
f899edb57f | ||
|
|
17ec837a7a | ||
|
|
9e3c8461ca | ||
|
|
1f23ef7889 | ||
|
|
41219fe81e | ||
|
|
5081c145dc | ||
|
|
25b88f3b86 | ||
|
|
d711e20b5f | ||
|
|
700f00c014 | ||
|
|
584cad808e | ||
|
|
d8a1758122 | ||
|
|
1df9ee4f2d | ||
|
|
5b4a7aa81d | ||
|
|
ef8d943e54 | ||
|
|
42a038173f | ||
|
|
546719137a | ||
|
|
3ffe0cf0f4 | ||
|
|
ff82367c62 | ||
|
|
ff47c0b0d3 | ||
|
|
befa1fe9af | ||
|
|
446f434a8e | ||
|
|
2f3370e42f | ||
|
|
7ae368e983 | ||
|
|
36711d766a | ||
|
|
c9e50bb9b1 | ||
|
|
95de8e273d | ||
|
|
b07d95f0dd | ||
|
|
d9a70376d8 | ||
|
|
0c32008466 | ||
|
|
c462a478c7 | ||
|
|
459f22ed30 | ||
|
|
dc086dc21f | ||
|
|
b9217b06db | ||
|
|
6868c88ef1 | ||
|
|
a1d16fb400 | ||
|
|
a7db3959f5 | ||
|
|
b5f89439ff | ||
|
|
d51374ce12 | ||
|
|
b63738674c | ||
|
|
12525242ce | ||
|
|
7d5a9530f7 | ||
|
|
e0527b4a6b | ||
|
|
efb1982eec | ||
|
|
2211209be5 | ||
|
|
506821c7df | ||
|
|
f1c8bfe01e | ||
|
|
7c89bd1018 | ||
|
|
367dfe51c6 | ||
|
|
e856ffc91e | ||
|
|
9aabe212ea | ||
|
|
42618f4bd6 | ||
|
|
36576c958f | ||
|
|
322a78a378 | ||
|
|
d75b44f89f | ||
|
|
1fb03d4cf2 | ||
|
|
7d2970fdfe | ||
|
|
8105efb338 | ||
|
|
c1d4bf4b63 | ||
|
|
86df8a433d | ||
|
|
956c547254 | ||
|
|
be965019bd | ||
|
|
a0a50de8c9 | ||
|
|
c86dace4c2 | ||
|
|
472a7f58ad | ||
|
|
068efce3f8 | ||
|
|
df7310ea40 | ||
|
|
100f54ee07 | ||
|
|
c2f7af3339 | ||
|
|
a1b5d0faf2 | ||
|
|
d6498150bf | ||
|
|
31c34a4a49 | ||
|
|
b1cfb6a710 | ||
|
|
4a43c83522 | ||
|
|
0a4e9e25d0 | ||
|
|
3bb5ed5e91 | ||
|
|
c5bca1cf0f | ||
|
|
35de91ef2b | ||
|
|
ee306e2f9b | ||
|
|
bae3b02928 | ||
|
|
5b4adc00bb | ||
|
|
22fbc9ea4a | ||
|
|
ca74a13d61 | ||
|
|
18a4598986 | ||
|
|
dc54d357ca | ||
|
|
08ec971086 | ||
|
|
b53d6e0ff2 | ||
|
|
70b652f791 | ||
|
|
7b68bfb73b | ||
|
|
7e0f20fbf2 | ||
|
|
def42ff487 | ||
|
|
c9af8e36a7 | ||
|
|
ed66c92383 | ||
|
|
668d493bf9 | ||
|
|
67f4d7ea7a | ||
|
|
4b0c88ff8e | ||
|
|
b19fef9d18 | ||
|
|
1612e00e63 | ||
|
|
c3bc136420 | ||
|
|
1020bc3108 | ||
|
|
7fcf638c0d | ||
|
|
e35546f58e | ||
|
|
1aa8d4ac91 | ||
|
|
66f8736598 | ||
|
|
4c41f6fcc6 | ||
|
|
44f9b21e74 | ||
|
|
03f49ceaf0 | ||
|
|
8e7d6970ea | ||
|
|
286bca37cc | ||
|
|
a2c181992a | ||
|
|
32eb0cec8f | ||
|
|
96c7052777 | ||
|
|
975c1c25c3 | ||
|
|
20f466768e | ||
|
|
8af693548e | ||
|
|
963738d983 | ||
|
|
e0df56de62 | ||
|
|
538455a965 | ||
|
|
172809a502 | ||
|
|
55e4ff6742 | ||
|
|
07e8716315 | ||
|
|
114870d703 | ||
|
|
2efee45ef1 | ||
|
|
c351e1fff9 | ||
|
|
cd0fc261c0 | ||
|
|
77478d50e5 | ||
|
|
97b1feb0b3 | ||
|
|
c29e70e5a1 | ||
|
|
d5b669634a | ||
|
|
1a343c3591 | ||
|
|
26f97cfd17 | ||
|
|
72f402d44b | ||
|
|
92573486a8 | ||
|
|
c712d68f6a | ||
|
|
f431a08efa | ||
|
|
beaa427504 | ||
|
|
a88dd602d9 | ||
|
|
6c0324f467 | ||
|
|
a60d27b132 | ||
|
|
9c463661c1 | ||
|
|
4255655618 | ||
|
|
f17d9a2ba1 | ||
|
|
9ff829a3a1 | ||
|
|
d6516f0e03 | ||
|
|
b0b8612eff | ||
|
|
1072a055db | ||
|
|
9c9f5cac90 | ||
|
|
9d0c6fe419 | ||
|
|
54ac25cfc9 | ||
|
|
150a292795 | ||
|
|
429a463aff | ||
|
|
27ba2951d1 | ||
|
|
b2896d38f5 | ||
|
|
c0da806232 | ||
|
|
114e09f570 | ||
|
|
04a995e7d1 | ||
|
|
4806336816 | ||
|
|
1ce418e4a1 | ||
|
|
eb4c505cff | ||
|
|
aad59e6b6b | ||
|
|
9ce98bb93c | ||
|
|
97086cdcdf | ||
|
|
9c7649f140 | ||
|
|
a2592a5563 | ||
|
|
b5ad79a7d3 | ||
|
|
996468bcce | ||
|
|
f98200297d | ||
|
|
86bbd16d43 | ||
|
|
0f6e0f6d74 | ||
|
|
fc3e545e03 | ||
|
|
b98ea415c1 | ||
|
|
bbe9057225 | ||
|
|
8c4643687c | ||
|
|
fab037f78d | ||
|
|
03d647269e | ||
|
|
2252b42337 | ||
|
|
bc6384bb80 | ||
|
|
8df7e63d61 | ||
|
|
7a3cb1ad34 | ||
|
|
f8a6574698 | ||
|
|
abbb1d2367 | ||
|
|
0b21210d72 | ||
|
|
461d5472d3 | ||
|
|
c75ea789a8 | ||
|
|
ee200e86cb | ||
|
|
8865e19c12 | ||
|
|
5f5efe7cb9 | ||
|
|
c0101f0948 | ||
|
|
5e54e39795 | ||
|
|
5ffcb48a9a | ||
|
|
471eab3d7e | ||
|
|
64425d5e00 | ||
|
|
e410e5d711 | ||
|
|
cc2f6e7404 | ||
|
|
a4d77b99f0 | ||
|
|
7bd5ab16d1 | ||
|
|
74362ac453 | ||
|
|
964f9e86d6 | ||
|
|
7a5fc76b9f | ||
|
|
342f429f1c | ||
|
|
7d1542cae1 | ||
|
|
9aa4cdb976 | ||
|
|
2abef3bef9 | ||
|
|
48951662f2 | ||
|
|
56199fb76f | ||
|
|
11f1cb5dc9 | ||
|
|
b72d574891 | ||
|
|
15dd682714 | ||
|
|
e28fa2344c | ||
|
|
a92d79fff2 | ||
|
|
125bd93e29 | ||
|
|
c38f535c9f | ||
|
|
ff8f6aa6cd | ||
|
|
1cf050d412 | ||
|
|
54c9776bde | ||
|
|
a06598678c | ||
|
|
055a6f60c6 | ||
|
|
e54d6ea1eb | ||
|
|
1eb4bfe2e4 | ||
|
|
21f222fa1d | ||
|
|
33362dbd17 |
68
.cache/calibration/aloha_default/left_follower.json
Normal file
68
.cache/calibration/aloha_default/left_follower.json
Normal file
@@ -0,0 +1,68 @@
|
||||
{
|
||||
"homing_offset": [
|
||||
2048,
|
||||
3072,
|
||||
3072,
|
||||
-1024,
|
||||
-1024,
|
||||
2048,
|
||||
-2048,
|
||||
2048,
|
||||
-2048
|
||||
],
|
||||
"drive_mode": [
|
||||
1,
|
||||
1,
|
||||
1,
|
||||
0,
|
||||
0,
|
||||
1,
|
||||
0,
|
||||
1,
|
||||
0
|
||||
],
|
||||
"start_pos": [
|
||||
2015,
|
||||
3058,
|
||||
3061,
|
||||
1071,
|
||||
1071,
|
||||
2035,
|
||||
2152,
|
||||
2029,
|
||||
2499
|
||||
],
|
||||
"end_pos": [
|
||||
-1008,
|
||||
-1963,
|
||||
-1966,
|
||||
2141,
|
||||
2143,
|
||||
-971,
|
||||
3043,
|
||||
-1077,
|
||||
3144
|
||||
],
|
||||
"calib_mode": [
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"LINEAR"
|
||||
],
|
||||
"motor_names": [
|
||||
"waist",
|
||||
"shoulder",
|
||||
"shoulder_shadow",
|
||||
"elbow",
|
||||
"elbow_shadow",
|
||||
"forearm_roll",
|
||||
"wrist_angle",
|
||||
"wrist_rotate",
|
||||
"gripper"
|
||||
]
|
||||
}
|
||||
68
.cache/calibration/aloha_default/left_leader.json
Normal file
68
.cache/calibration/aloha_default/left_leader.json
Normal file
@@ -0,0 +1,68 @@
|
||||
{
|
||||
"homing_offset": [
|
||||
2048,
|
||||
3072,
|
||||
3072,
|
||||
-1024,
|
||||
-1024,
|
||||
2048,
|
||||
-2048,
|
||||
2048,
|
||||
-1024
|
||||
],
|
||||
"drive_mode": [
|
||||
1,
|
||||
1,
|
||||
1,
|
||||
0,
|
||||
0,
|
||||
1,
|
||||
0,
|
||||
1,
|
||||
0
|
||||
],
|
||||
"start_pos": [
|
||||
2035,
|
||||
3024,
|
||||
3019,
|
||||
979,
|
||||
981,
|
||||
1982,
|
||||
2166,
|
||||
2124,
|
||||
1968
|
||||
],
|
||||
"end_pos": [
|
||||
-990,
|
||||
-2017,
|
||||
-2015,
|
||||
2078,
|
||||
2076,
|
||||
-1030,
|
||||
3117,
|
||||
-1016,
|
||||
2556
|
||||
],
|
||||
"calib_mode": [
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"LINEAR"
|
||||
],
|
||||
"motor_names": [
|
||||
"waist",
|
||||
"shoulder",
|
||||
"shoulder_shadow",
|
||||
"elbow",
|
||||
"elbow_shadow",
|
||||
"forearm_roll",
|
||||
"wrist_angle",
|
||||
"wrist_rotate",
|
||||
"gripper"
|
||||
]
|
||||
}
|
||||
68
.cache/calibration/aloha_default/right_follower.json
Normal file
68
.cache/calibration/aloha_default/right_follower.json
Normal file
@@ -0,0 +1,68 @@
|
||||
{
|
||||
"homing_offset": [
|
||||
2048,
|
||||
3072,
|
||||
3072,
|
||||
-1024,
|
||||
-1024,
|
||||
2048,
|
||||
-2048,
|
||||
2048,
|
||||
-2048
|
||||
],
|
||||
"drive_mode": [
|
||||
1,
|
||||
1,
|
||||
1,
|
||||
0,
|
||||
0,
|
||||
1,
|
||||
0,
|
||||
1,
|
||||
0
|
||||
],
|
||||
"start_pos": [
|
||||
2056,
|
||||
2895,
|
||||
2896,
|
||||
1191,
|
||||
1190,
|
||||
2018,
|
||||
2051,
|
||||
2056,
|
||||
2509
|
||||
],
|
||||
"end_pos": [
|
||||
-1040,
|
||||
-2004,
|
||||
-2006,
|
||||
2126,
|
||||
2127,
|
||||
-1010,
|
||||
3050,
|
||||
-1117,
|
||||
3143
|
||||
],
|
||||
"calib_mode": [
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"LINEAR"
|
||||
],
|
||||
"motor_names": [
|
||||
"waist",
|
||||
"shoulder",
|
||||
"shoulder_shadow",
|
||||
"elbow",
|
||||
"elbow_shadow",
|
||||
"forearm_roll",
|
||||
"wrist_angle",
|
||||
"wrist_rotate",
|
||||
"gripper"
|
||||
]
|
||||
}
|
||||
68
.cache/calibration/aloha_default/right_leader.json
Normal file
68
.cache/calibration/aloha_default/right_leader.json
Normal file
@@ -0,0 +1,68 @@
|
||||
{
|
||||
"homing_offset": [
|
||||
2048,
|
||||
3072,
|
||||
3072,
|
||||
-1024,
|
||||
-1024,
|
||||
2048,
|
||||
-2048,
|
||||
2048,
|
||||
-2048
|
||||
],
|
||||
"drive_mode": [
|
||||
1,
|
||||
1,
|
||||
1,
|
||||
0,
|
||||
0,
|
||||
1,
|
||||
0,
|
||||
1,
|
||||
0
|
||||
],
|
||||
"start_pos": [
|
||||
2068,
|
||||
3034,
|
||||
3030,
|
||||
1038,
|
||||
1041,
|
||||
1991,
|
||||
1948,
|
||||
2090,
|
||||
1985
|
||||
],
|
||||
"end_pos": [
|
||||
-1025,
|
||||
-2014,
|
||||
-2015,
|
||||
2058,
|
||||
2060,
|
||||
-955,
|
||||
3091,
|
||||
-940,
|
||||
2576
|
||||
],
|
||||
"calib_mode": [
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"DEGREE",
|
||||
"LINEAR"
|
||||
],
|
||||
"motor_names": [
|
||||
"waist",
|
||||
"shoulder",
|
||||
"shoulder_shadow",
|
||||
"elbow",
|
||||
"elbow_shadow",
|
||||
"forearm_roll",
|
||||
"wrist_angle",
|
||||
"wrist_rotate",
|
||||
"gripper"
|
||||
]
|
||||
}
|
||||
@@ -65,7 +65,6 @@ htmlcov/
|
||||
.nox/
|
||||
.coverage
|
||||
.coverage.*
|
||||
.cache
|
||||
nosetests.xml
|
||||
coverage.xml
|
||||
*.cover
|
||||
@@ -73,6 +72,11 @@ coverage.xml
|
||||
.hypothesis/
|
||||
.pytest_cache/
|
||||
|
||||
# Ignore .cache except calibration
|
||||
.cache/*
|
||||
!.cache/calibration/
|
||||
!.cache/calibration/**
|
||||
|
||||
# Translations
|
||||
*.mo
|
||||
*.pot
|
||||
|
||||
2
.gitattributes
vendored
2
.gitattributes
vendored
@@ -3,4 +3,4 @@
|
||||
*.safetensors filter=lfs diff=lfs merge=lfs -text
|
||||
*.mp4 filter=lfs diff=lfs merge=lfs -text
|
||||
*.arrow filter=lfs diff=lfs merge=lfs -text
|
||||
*.json filter=lfs diff=lfs merge=lfs -text
|
||||
*.json !text !filter !merge !diff
|
||||
|
||||
2
.github/PULL_REQUEST_TEMPLATE.md
vendored
2
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -21,7 +21,7 @@ Provide a simple way for the reviewer to try out your changes.
|
||||
|
||||
Examples:
|
||||
```bash
|
||||
DATA_DIR=tests/data pytest -sx tests/test_stuff.py::test_something
|
||||
pytest -sx tests/test_stuff.py::test_something
|
||||
```
|
||||
```bash
|
||||
python lerobot/scripts/train.py --some.option=true
|
||||
|
||||
52
.github/workflows/build-docker-images.yml
vendored
52
.github/workflows/build-docker-images.yml
vendored
@@ -14,20 +14,14 @@ env:
|
||||
jobs:
|
||||
latest-cpu:
|
||||
name: CPU
|
||||
runs-on: ubuntu-latest
|
||||
runs-on:
|
||||
group: aws-general-8-plus
|
||||
steps:
|
||||
- name: Cleanup disk
|
||||
- name: Install Git LFS
|
||||
run: |
|
||||
sudo df -h
|
||||
# sudo ls -l /usr/local/lib/
|
||||
# sudo ls -l /usr/share/
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo rm -rf /usr/local/lib/android
|
||||
sudo rm -rf /usr/share/dotnet
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo df -h
|
||||
sudo apt-get update
|
||||
sudo apt-get install git-lfs
|
||||
git lfs install
|
||||
|
||||
- name: Set up Docker Buildx
|
||||
uses: docker/setup-buildx-action@v3
|
||||
@@ -55,20 +49,15 @@ jobs:
|
||||
|
||||
latest-cuda:
|
||||
name: GPU
|
||||
runs-on: ubuntu-latest
|
||||
runs-on:
|
||||
group: aws-general-8-plus
|
||||
steps:
|
||||
- name: Cleanup disk
|
||||
- name: Install Git LFS
|
||||
run: |
|
||||
sudo df -h
|
||||
# sudo ls -l /usr/local/lib/
|
||||
# sudo ls -l /usr/share/
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo rm -rf /usr/local/lib/android
|
||||
sudo rm -rf /usr/share/dotnet
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo df -h
|
||||
sudo apt-get update
|
||||
sudo apt-get install git-lfs
|
||||
git lfs install
|
||||
|
||||
- name: Set up Docker Buildx
|
||||
uses: docker/setup-buildx-action@v3
|
||||
|
||||
@@ -95,20 +84,9 @@ jobs:
|
||||
|
||||
latest-cuda-dev:
|
||||
name: GPU Dev
|
||||
runs-on: ubuntu-latest
|
||||
runs-on:
|
||||
group: aws-general-8-plus
|
||||
steps:
|
||||
- name: Cleanup disk
|
||||
run: |
|
||||
sudo df -h
|
||||
# sudo ls -l /usr/local/lib/
|
||||
# sudo ls -l /usr/share/
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo rm -rf /usr/local/lib/android
|
||||
sudo rm -rf /usr/share/dotnet
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo df -h
|
||||
- name: Set up Docker Buildx
|
||||
uses: docker/setup-buildx-action@v3
|
||||
|
||||
|
||||
14
.github/workflows/nightly-tests.yml
vendored
14
.github/workflows/nightly-tests.yml
vendored
@@ -7,16 +7,15 @@ on:
|
||||
schedule:
|
||||
- cron: "0 2 * * *"
|
||||
|
||||
env:
|
||||
DATA_DIR: tests/data
|
||||
# env:
|
||||
# SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
|
||||
|
||||
jobs:
|
||||
run_all_tests_cpu:
|
||||
name: CPU
|
||||
strategy:
|
||||
fail-fast: false
|
||||
runs-on: ubuntu-latest
|
||||
runs-on:
|
||||
group: aws-general-8-plus
|
||||
container:
|
||||
image: huggingface/lerobot-cpu:latest
|
||||
options: --shm-size "16gb"
|
||||
@@ -29,13 +28,9 @@ jobs:
|
||||
working-directory: /lerobot
|
||||
steps:
|
||||
- name: Tests
|
||||
env:
|
||||
DATA_DIR: tests/data
|
||||
run: pytest -v --cov=./lerobot --disable-warnings tests
|
||||
|
||||
- name: Tests end-to-end
|
||||
env:
|
||||
DATA_DIR: tests/data
|
||||
run: make test-end-to-end
|
||||
|
||||
|
||||
@@ -43,7 +38,8 @@ jobs:
|
||||
name: GPU
|
||||
strategy:
|
||||
fail-fast: false
|
||||
runs-on: [single-gpu, nvidia-gpu, t4, ci]
|
||||
runs-on:
|
||||
group: aws-g6-4xlarge-plus
|
||||
env:
|
||||
CUDA_VISIBLE_DEVICES: "0"
|
||||
TEST_TYPE: "single_gpu"
|
||||
|
||||
30
.github/workflows/quality.yml
vendored
30
.github/workflows/quality.yml
vendored
@@ -50,7 +50,35 @@ jobs:
|
||||
uses: actions/checkout@v3
|
||||
|
||||
- name: Install poetry
|
||||
run: pipx install poetry
|
||||
run: pipx install "poetry<2.0.0"
|
||||
|
||||
- name: Poetry check
|
||||
run: poetry check
|
||||
|
||||
|
||||
poetry_relax:
|
||||
name: Poetry relax
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Checkout Repository
|
||||
uses: actions/checkout@v3
|
||||
|
||||
- name: Install poetry
|
||||
run: pipx install "poetry<2.0.0"
|
||||
|
||||
- name: Install poetry-relax
|
||||
run: poetry self add poetry-relax
|
||||
|
||||
- name: Poetry relax
|
||||
id: poetry_relax
|
||||
run: |
|
||||
output=$(poetry relax --check 2>&1)
|
||||
if echo "$output" | grep -q "Proposing updates"; then
|
||||
echo "$output"
|
||||
echo ""
|
||||
echo "Some dependencies have caret '^' version requirement added by poetry by default."
|
||||
echo "Please replace them with '>='. You can do this by hand or use poetry-relax to do this."
|
||||
exit 1
|
||||
else
|
||||
echo "$output"
|
||||
fi
|
||||
|
||||
16
.github/workflows/test-docker-build.yml
vendored
16
.github/workflows/test-docker-build.yml
vendored
@@ -42,26 +42,14 @@ jobs:
|
||||
build_modified_dockerfiles:
|
||||
name: Build modified Docker images
|
||||
needs: get_changed_files
|
||||
runs-on: ubuntu-latest
|
||||
runs-on:
|
||||
group: aws-general-8-plus
|
||||
if: ${{ needs.get_changed_files.outputs.matrix }} != ''
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
docker-file: ${{ fromJson(needs.get_changed_files.outputs.matrix) }}
|
||||
steps:
|
||||
- name: Cleanup disk
|
||||
run: |
|
||||
sudo df -h
|
||||
# sudo ls -l /usr/local/lib/
|
||||
# sudo ls -l /usr/share/
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo rm -rf /usr/local/lib/android
|
||||
sudo rm -rf /usr/share/dotnet
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo df -h
|
||||
|
||||
- name: Set up Docker Buildx
|
||||
uses: docker/setup-buildx-action@v3
|
||||
|
||||
|
||||
79
.github/workflows/test.yml
vendored
79
.github/workflows/test.yml
vendored
@@ -10,6 +10,8 @@ on:
|
||||
- "examples/**"
|
||||
- ".github/**"
|
||||
- "poetry.lock"
|
||||
- "Makefile"
|
||||
- ".cache/**"
|
||||
push:
|
||||
branches:
|
||||
- main
|
||||
@@ -19,27 +21,32 @@ on:
|
||||
- "examples/**"
|
||||
- ".github/**"
|
||||
- "poetry.lock"
|
||||
- "Makefile"
|
||||
- ".cache/**"
|
||||
|
||||
jobs:
|
||||
pytest:
|
||||
name: Pytest
|
||||
runs-on: ubuntu-latest
|
||||
env:
|
||||
DATA_DIR: tests/data
|
||||
MUJOCO_GL: egl
|
||||
steps:
|
||||
- uses: actions/checkout@v4
|
||||
with:
|
||||
lfs: true # Ensure LFS files are pulled
|
||||
|
||||
- name: Install EGL
|
||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
|
||||
- name: Install apt dependencies
|
||||
# portaudio19-dev is needed to install pyaudio
|
||||
run: |
|
||||
sudo apt-get update && \
|
||||
sudo apt-get install -y libegl1-mesa-dev ffmpeg portaudio19-dev
|
||||
|
||||
- name: Install poetry
|
||||
run: |
|
||||
pipx install poetry && poetry config virtualenvs.in-project true
|
||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||
|
||||
# TODO(rcadene, aliberts): python 3.12 seems to be used in the tests, not python 3.10
|
||||
- name: Set up Python 3.10
|
||||
uses: actions/setup-python@v5
|
||||
with:
|
||||
@@ -58,23 +65,25 @@ jobs:
|
||||
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
||||
&& rm -rf tests/outputs outputs
|
||||
|
||||
|
||||
pytest-minimal:
|
||||
name: Pytest (minimal install)
|
||||
runs-on: ubuntu-latest
|
||||
env:
|
||||
DATA_DIR: tests/data
|
||||
MUJOCO_GL: egl
|
||||
steps:
|
||||
- uses: actions/checkout@v4
|
||||
with:
|
||||
lfs: true # Ensure LFS files are pulled
|
||||
|
||||
- name: Install apt dependencies
|
||||
run: sudo apt-get update && sudo apt-get install -y ffmpeg
|
||||
|
||||
- name: Install poetry
|
||||
run: |
|
||||
pipx install poetry && poetry config virtualenvs.in-project true
|
||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||
|
||||
# TODO(rcadene, aliberts): python 3.12 seems to be used in the tests, not python 3.10
|
||||
- name: Set up Python 3.10
|
||||
uses: actions/setup-python@v5
|
||||
with:
|
||||
@@ -92,37 +101,39 @@ jobs:
|
||||
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
||||
&& rm -rf tests/outputs outputs
|
||||
|
||||
# TODO(aliberts, rcadene): redesign after v2 migration / removing hydra
|
||||
# end-to-end:
|
||||
# name: End-to-end
|
||||
# runs-on: ubuntu-latest
|
||||
# env:
|
||||
# MUJOCO_GL: egl
|
||||
# steps:
|
||||
# - uses: actions/checkout@v4
|
||||
# with:
|
||||
# lfs: true # Ensure LFS files are pulled
|
||||
|
||||
end-to-end:
|
||||
name: End-to-end
|
||||
runs-on: ubuntu-latest
|
||||
env:
|
||||
DATA_DIR: tests/data
|
||||
MUJOCO_GL: egl
|
||||
steps:
|
||||
- uses: actions/checkout@v4
|
||||
with:
|
||||
lfs: true # Ensure LFS files are pulled
|
||||
# - name: Install apt dependencies
|
||||
# # portaudio19-dev is needed to install pyaudio
|
||||
# run: |
|
||||
# sudo apt-get update && \
|
||||
# sudo apt-get install -y libegl1-mesa-dev portaudio19-dev
|
||||
|
||||
- name: Install EGL
|
||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
|
||||
# - name: Install poetry
|
||||
# run: |
|
||||
# pipx install poetry && poetry config virtualenvs.in-project true
|
||||
# echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||
|
||||
- name: Install poetry
|
||||
run: |
|
||||
pipx install poetry && poetry config virtualenvs.in-project true
|
||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||
# - name: Set up Python 3.10
|
||||
# uses: actions/setup-python@v5
|
||||
# with:
|
||||
# python-version: "3.10"
|
||||
# cache: "poetry"
|
||||
|
||||
- name: Set up Python 3.10
|
||||
uses: actions/setup-python@v5
|
||||
with:
|
||||
python-version: "3.10"
|
||||
cache: "poetry"
|
||||
# - name: Install poetry dependencies
|
||||
# run: |
|
||||
# poetry install --all-extras
|
||||
|
||||
- name: Install poetry dependencies
|
||||
run: |
|
||||
poetry install --all-extras
|
||||
|
||||
- name: Test end-to-end
|
||||
run: |
|
||||
make test-end-to-end \
|
||||
&& rm -rf outputs
|
||||
# - name: Test end-to-end
|
||||
# run: |
|
||||
# make test-end-to-end \
|
||||
# && rm -rf outputs
|
||||
|
||||
20
.github/workflows/trufflehog.yml
vendored
Normal file
20
.github/workflows/trufflehog.yml
vendored
Normal file
@@ -0,0 +1,20 @@
|
||||
on:
|
||||
push:
|
||||
|
||||
name: Secret Leaks
|
||||
|
||||
permissions:
|
||||
contents: read
|
||||
|
||||
jobs:
|
||||
trufflehog:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Checkout code
|
||||
uses: actions/checkout@v4
|
||||
with:
|
||||
fetch-depth: 0
|
||||
- name: Secret Scanning
|
||||
uses: trufflesecurity/trufflehog@main
|
||||
with:
|
||||
extra_args: --only-verified
|
||||
8
.gitignore
vendored
8
.gitignore
vendored
@@ -66,7 +66,6 @@ htmlcov/
|
||||
.nox/
|
||||
.coverage
|
||||
.coverage.*
|
||||
.cache
|
||||
nosetests.xml
|
||||
coverage.xml
|
||||
*.cover
|
||||
@@ -74,6 +73,11 @@ coverage.xml
|
||||
.hypothesis/
|
||||
.pytest_cache/
|
||||
|
||||
# Ignore .cache except calibration
|
||||
.cache/*
|
||||
!.cache/calibration/
|
||||
!.cache/calibration/**
|
||||
|
||||
# Translations
|
||||
*.mo
|
||||
*.pot
|
||||
@@ -121,8 +125,8 @@ celerybeat.pid
|
||||
# Environments
|
||||
.env
|
||||
.venv
|
||||
env/
|
||||
venv/
|
||||
ENV/
|
||||
env.bak/
|
||||
venv.bak/
|
||||
|
||||
|
||||
@@ -3,7 +3,7 @@ default_language_version:
|
||||
python: python3.10
|
||||
repos:
|
||||
- repo: https://github.com/pre-commit/pre-commit-hooks
|
||||
rev: v4.6.0
|
||||
rev: v5.0.0
|
||||
hooks:
|
||||
- id: check-added-large-files
|
||||
- id: debug-statements
|
||||
@@ -14,11 +14,12 @@ repos:
|
||||
- id: end-of-file-fixer
|
||||
- id: trailing-whitespace
|
||||
- repo: https://github.com/asottile/pyupgrade
|
||||
rev: v3.15.2
|
||||
rev: v3.19.0
|
||||
hooks:
|
||||
- id: pyupgrade
|
||||
exclude: '^(.*_pb2_grpc\.py|.*_pb2\.py$)'
|
||||
- repo: https://github.com/astral-sh/ruff-pre-commit
|
||||
rev: v0.4.3
|
||||
rev: v0.8.2
|
||||
hooks:
|
||||
- id: ruff
|
||||
args: [--fix]
|
||||
@@ -31,3 +32,7 @@ repos:
|
||||
args:
|
||||
- "--check"
|
||||
- "--no-update"
|
||||
- repo: https://github.com/gitleaks/gitleaks
|
||||
rev: v8.21.2
|
||||
hooks:
|
||||
- id: gitleaks
|
||||
|
||||
@@ -20,7 +20,7 @@ Some of the ways you can contribute to 🤗 LeRobot:
|
||||
* Contributing to the examples or to the documentation.
|
||||
* Submitting issues related to bugs or desired new features.
|
||||
|
||||
Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](remi.cadene@huggingface.co).
|
||||
Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](mailto:remi.cadene@huggingface.co).
|
||||
|
||||
If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/orgs/huggingface/projects/46)
|
||||
|
||||
@@ -267,7 +267,7 @@ We use `pytest` in order to run the tests. From the root of the
|
||||
repository, here's how to run tests with `pytest` for the library:
|
||||
|
||||
```bash
|
||||
DATA_DIR="tests/data" python -m pytest -sv ./tests
|
||||
python -m pytest -sv ./tests
|
||||
```
|
||||
|
||||
|
||||
|
||||
31
Makefile
31
Makefile
@@ -5,7 +5,7 @@ PYTHON_PATH := $(shell which python)
|
||||
# If Poetry is installed, redefine PYTHON_PATH to use the Poetry-managed Python
|
||||
POETRY_CHECK := $(shell command -v poetry)
|
||||
ifneq ($(POETRY_CHECK),)
|
||||
PYTHON_PATH := $(shell poetry run which python)
|
||||
PYTHON_PATH := $(shell poetry run which python)
|
||||
endif
|
||||
|
||||
export PATH := $(dir $(PYTHON_PATH)):$(PATH)
|
||||
@@ -26,6 +26,7 @@ test-end-to-end:
|
||||
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-train
|
||||
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-eval
|
||||
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train
|
||||
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train-with-online
|
||||
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-eval
|
||||
${MAKE} DEVICE=$(DEVICE) test-default-ete-eval
|
||||
${MAKE} DEVICE=$(DEVICE) test-act-pusht-tutorial
|
||||
@@ -46,6 +47,7 @@ test-act-ete-train:
|
||||
policy.n_action_steps=20 \
|
||||
policy.chunk_size=20 \
|
||||
training.batch_size=2 \
|
||||
training.image_transforms.enable=true \
|
||||
hydra.run.dir=tests/outputs/act/
|
||||
|
||||
test-act-ete-eval:
|
||||
@@ -73,6 +75,7 @@ test-act-ete-train-amp:
|
||||
policy.chunk_size=20 \
|
||||
training.batch_size=2 \
|
||||
hydra.run.dir=tests/outputs/act_amp/ \
|
||||
training.image_transforms.enable=true \
|
||||
use_amp=true
|
||||
|
||||
test-act-ete-eval-amp:
|
||||
@@ -100,6 +103,7 @@ test-diffusion-ete-train:
|
||||
training.save_checkpoint=true \
|
||||
training.save_freq=2 \
|
||||
training.batch_size=2 \
|
||||
training.image_transforms.enable=true \
|
||||
hydra.run.dir=tests/outputs/diffusion/
|
||||
|
||||
test-diffusion-ete-eval:
|
||||
@@ -110,7 +114,6 @@ test-diffusion-ete-eval:
|
||||
env.episode_length=8 \
|
||||
device=$(DEVICE) \
|
||||
|
||||
# TODO(alexander-soare): Restore online_steps to 2 when it is reinstated.
|
||||
test-tdmpc-ete-train:
|
||||
python lerobot/scripts/train.py \
|
||||
policy=tdmpc \
|
||||
@@ -127,8 +130,31 @@ test-tdmpc-ete-train:
|
||||
training.save_checkpoint=true \
|
||||
training.save_freq=2 \
|
||||
training.batch_size=2 \
|
||||
training.image_transforms.enable=true \
|
||||
hydra.run.dir=tests/outputs/tdmpc/
|
||||
|
||||
test-tdmpc-ete-train-with-online:
|
||||
python lerobot/scripts/train.py \
|
||||
env=pusht \
|
||||
env.gym.obs_type=environment_state_agent_pos \
|
||||
policy=tdmpc_pusht_keypoints \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
env.episode_length=10 \
|
||||
device=$(DEVICE) \
|
||||
training.offline_steps=2 \
|
||||
training.online_steps=20 \
|
||||
training.save_checkpoint=false \
|
||||
training.save_freq=10 \
|
||||
training.batch_size=2 \
|
||||
training.online_rollout_n_episodes=2 \
|
||||
training.online_rollout_batch_size=2 \
|
||||
training.online_steps_between_rollouts=10 \
|
||||
training.online_buffer_capacity=15 \
|
||||
eval.use_async_envs=true \
|
||||
hydra.run.dir=tests/outputs/tdmpc_online/
|
||||
|
||||
|
||||
test-tdmpc-ete-eval:
|
||||
python lerobot/scripts/eval.py \
|
||||
-p tests/outputs/tdmpc/checkpoints/000002/pretrained_model \
|
||||
@@ -159,5 +185,6 @@ test-act-pusht-tutorial:
|
||||
training.save_model=true \
|
||||
training.save_freq=2 \
|
||||
training.batch_size=2 \
|
||||
training.image_transforms.enable=true \
|
||||
hydra.run.dir=tests/outputs/act_pusht/
|
||||
rm lerobot/configs/policy/created_by_Makefile.yaml
|
||||
|
||||
154
README.md
154
README.md
@@ -22,8 +22,22 @@
|
||||
|
||||
</div>
|
||||
|
||||
<h2 align="center">
|
||||
<p><a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">New robot in town: SO-100</a></p>
|
||||
</h2>
|
||||
|
||||
<div align="center">
|
||||
<img src="media/so100/leader_follower.webp?raw=true" alt="SO-100 leader and follower arms" title="SO-100 leader and follower arms" width="50%">
|
||||
<p>We just added a new tutorial on how to build a more affordable robot, at the price of $110 per arm!</p>
|
||||
<p>Teach it new skills by showing it a few moves with just a laptop.</p>
|
||||
<p>Then watch your homemade robot act autonomously 🤯</p>
|
||||
<p>Follow the link to the <a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">full tutorial for SO-100</a>.</p>
|
||||
</div>
|
||||
|
||||
<br/>
|
||||
|
||||
<h3 align="center">
|
||||
<p>State-of-the-art Machine Learning for real-world robotics</p>
|
||||
<p>LeRobot: State-of-the-art AI for real-world robotics</p>
|
||||
</h3>
|
||||
|
||||
---
|
||||
@@ -41,9 +55,9 @@
|
||||
|
||||
<table>
|
||||
<tr>
|
||||
<td><img src="http://remicadene.com/assets/gif/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
|
||||
<td><img src="http://remicadene.com/assets/gif/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
|
||||
<td><img src="http://remicadene.com/assets/gif/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
|
||||
<td><img src="media/gym/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
|
||||
<td><img src="media/gym/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
|
||||
<td><img src="media/gym/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td align="center">ACT policy on ALOHA env</td>
|
||||
@@ -54,27 +68,30 @@
|
||||
|
||||
### Acknowledgment
|
||||
|
||||
- Thanks to Tony Zaho, Zipeng Fu and colleagues for open sourcing ACT policy, ALOHA environments and datasets. Ours are adapted from [ALOHA](https://tonyzhaozh.github.io/aloha) and [Mobile ALOHA](https://mobile-aloha.github.io).
|
||||
- Thanks to Tony Zhao, Zipeng Fu and colleagues for open sourcing ACT policy, ALOHA environments and datasets. Ours are adapted from [ALOHA](https://tonyzhaozh.github.io/aloha) and [Mobile ALOHA](https://mobile-aloha.github.io).
|
||||
- Thanks to Cheng Chi, Zhenjia Xu and colleagues for open sourcing Diffusion policy, Pusht environment and datasets, as well as UMI datasets. Ours are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu) and [UMI Gripper](https://umi-gripper.github.io).
|
||||
- Thanks to Nicklas Hansen, Yunhai Feng and colleagues for open sourcing TDMPC policy, Simxarm environments and datasets. Ours are adapted from [TDMPC](https://github.com/nicklashansen/tdmpc) and [FOWM](https://www.yunhaifeng.com/FOWM).
|
||||
- Thanks to Antonio Loquercio and Ashish Kumar for their early support.
|
||||
- Thanks to [Seungjae (Jay) Lee](https://sjlee.cc/), [Mahi Shafiullah](https://mahis.life/) and colleagues for open sourcing [VQ-BeT](https://sjlee.cc/vq-bet/) policy and helping us adapt the codebase to our repository. The policy is adapted from [VQ-BeT repo](https://github.com/jayLEE0301/vq_bet_official).
|
||||
|
||||
|
||||
## Installation
|
||||
|
||||
Download our source code:
|
||||
```bash
|
||||
git clone https://github.com/huggingface/lerobot.git && cd lerobot
|
||||
git clone https://github.com/huggingface/lerobot.git
|
||||
cd lerobot
|
||||
```
|
||||
|
||||
Create a virtual environment with Python 3.10 and activate it, e.g. with [`miniconda`](https://docs.anaconda.com/free/miniconda/index.html):
|
||||
```bash
|
||||
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||
conda create -y -n lerobot python=3.10
|
||||
conda activate lerobot
|
||||
```
|
||||
|
||||
Install 🤗 LeRobot:
|
||||
```bash
|
||||
pip install .
|
||||
pip install -e .
|
||||
```
|
||||
|
||||
> **NOTE:** Depending on your platform, If you encounter any build errors during this step
|
||||
@@ -88,7 +105,7 @@ For simulations, 🤗 LeRobot comes with gymnasium environments that can be inst
|
||||
|
||||
For instance, to install 🤗 LeRobot with aloha and pusht, use:
|
||||
```bash
|
||||
pip install ".[aloha, pusht]"
|
||||
pip install -e ".[aloha, pusht]"
|
||||
```
|
||||
|
||||
To use [Weights and Biases](https://docs.wandb.ai/quickstart) for experiment tracking, log in with
|
||||
@@ -113,10 +130,12 @@ wandb login
|
||||
| | ├── datasets # various datasets of human demonstrations: aloha, pusht, xarm
|
||||
| | ├── envs # various sim environments: aloha, pusht, xarm
|
||||
| | ├── policies # various policies: act, diffusion, tdmpc
|
||||
| | ├── robot_devices # various real devices: dynamixel motors, opencv cameras, koch robots
|
||||
| | └── utils # various utilities
|
||||
| └── scripts # contains functions to execute via command line
|
||||
| ├── eval.py # load policy and evaluate it on an environment
|
||||
| ├── train.py # train a policy via imitation learning and/or reinforcement learning
|
||||
| ├── control_robot.py # teleoperate a real robot, record data, run a policy
|
||||
| ├── push_dataset_to_hub.py # convert your dataset into LeRobot dataset format and upload it to the Hugging Face hub
|
||||
| └── visualize_dataset.py # load a dataset and render its demonstrations
|
||||
├── outputs # contains results of scripts execution: logs, videos, model checkpoints
|
||||
@@ -125,7 +144,7 @@ wandb login
|
||||
|
||||
### Visualize datasets
|
||||
|
||||
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically download data from the Hugging Face hub.
|
||||
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically downloads data from the Hugging Face hub.
|
||||
|
||||
You can also locally visualize episodes from a dataset on the hub by executing our script from the command line:
|
||||
```bash
|
||||
@@ -134,10 +153,12 @@ python lerobot/scripts/visualize_dataset.py \
|
||||
--episode-index 0
|
||||
```
|
||||
|
||||
or from a dataset in a local folder with the root `DATA_DIR` environment variable
|
||||
or from a dataset in a local folder with the `root` option and the `--local-files-only` (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
|
||||
```bash
|
||||
DATA_DIR='./my_local_data_dir' python lerobot/scripts/visualize_dataset.py \
|
||||
python lerobot/scripts/visualize_dataset.py \
|
||||
--repo-id lerobot/pusht \
|
||||
--root ./my_local_data_dir \
|
||||
--local-files-only 1 \
|
||||
--episode-index 0
|
||||
```
|
||||
|
||||
@@ -151,48 +172,48 @@ Our script can also visualize datasets stored on a distant server. See `python l
|
||||
|
||||
### The `LeRobotDataset` format
|
||||
|
||||
A dataset in `LeRobotDataset` format is very simple to use. It can be loaded from a repository on the Hugging Face hub or a local folder simply with e.g. `dataset = LeRobotDataset("lerobot/aloha_static_coffee")` and can be indexed into like any Hugging Face and Pytorch dataset. For instance `dataset[0]` will retrieve a sample of the dataset observations and actions in pytorch tensors format ready to be fed to a model.
|
||||
A dataset in `LeRobotDataset` format is very simple to use. It can be loaded from a repository on the Hugging Face hub or a local folder simply with e.g. `dataset = LeRobotDataset("lerobot/aloha_static_coffee")` and can be indexed into like any Hugging Face and PyTorch dataset. For instance `dataset[0]` will retrieve a single temporal frame from the dataset containing observation(s) and an action as PyTorch tensors ready to be fed to a model.
|
||||
|
||||
A specificity of `LeRobotDataset` is that we can retrieve several frames for one sample query. By setting `delta_timestamps` to a list of delta timestamps, e.g. `delta_timestamps = {"observation.image": [-1, -0.5, -0.2, 0]}` one can retrieve, for each query, 4 images including one at -1 second before the current time step, the two others at -0.5 second and -0.2, and the final one at the current time step (0 second). See example [1_load_lerobot_dataset.py](examples/1_load_lerobot_dataset.py) for more details on `delta_timestamps`.
|
||||
A specificity of `LeRobotDataset` is that, rather than retrieving a single frame by its index, we can retrieve several frames based on their temporal relationship with the indexed frame, by setting `delta_timestamps` to a list of relative times with respect to the indexed frame. For example, with `delta_timestamps = {"observation.image": [-1, -0.5, -0.2, 0]}` one can retrieve, for a given index, 4 frames: 3 "previous" frames 1 second, 0.5 seconds, and 0.2 seconds before the indexed frame, and the indexed frame itself (corresponding to the 0 entry). See example [1_load_lerobot_dataset.py](examples/1_load_lerobot_dataset.py) for more details on `delta_timestamps`.
|
||||
|
||||
Under the hood, the `LeRobotDataset` format makes use of several ways to serialize data which can be useful to understand if you plan to work more closely with this format. We tried to make a flexible yet simple dataset format that would cover most type of features and specificities present in reinforcement learning and robotics, in simulation and in real-world, with a focus on cameras and robot states.
|
||||
Under the hood, the `LeRobotDataset` format makes use of several ways to serialize data which can be useful to understand if you plan to work more closely with this format. We tried to make a flexible yet simple dataset format that would cover most type of features and specificities present in reinforcement learning and robotics, in simulation and in real-world, with a focus on cameras and robot states but easily extended to other types of sensory inputs as long as they can be represented by a tensor.
|
||||
|
||||
Here are the important details and internal structure organization of a typical `LeRobotDataset` instantiated with `dataset = LeRobotDataset("lerobot/aloha_static_coffee")`. The exact features will change from dataset to dataset but not the main aspects:
|
||||
|
||||
```
|
||||
dataset attributes:
|
||||
├ hf_dataset: a Hugging Face dataset (backed by Arrow/parquet). Typical features example:
|
||||
│ ├ observation.images.cam_high: VideoFrame
|
||||
│ │ VideoFrame = {'path': path to a mp4 video, 'timestamp': float32 timestamp in the video}
|
||||
│ ├ observation.state: List of float32: position of an arm joints (for instance)
|
||||
│ ├ observation.images.cam_high (VideoFrame):
|
||||
│ │ VideoFrame = {'path': path to a mp4 video, 'timestamp' (float32): timestamp in the video}
|
||||
│ ├ observation.state (list of float32): position of an arm joints (for instance)
|
||||
│ ... (more observations)
|
||||
│ ├ action: List of float32
|
||||
│ ├ episode_index: int64: index of the episode for this sample
|
||||
│ ├ frame_index: int64: index of the frame for this sample in the episode ; starts at 0 for each episode
|
||||
│ ├ timestamp: float32: timestamp in the episode
|
||||
│ ├ next.done: bool: indicates the end of en episode ; True for the last frame in each episode
|
||||
│ └ index: int64: general index in the whole dataset
|
||||
│ ├ action (list of float32): goal position of an arm joints (for instance)
|
||||
│ ├ episode_index (int64): index of the episode for this sample
|
||||
│ ├ frame_index (int64): index of the frame for this sample in the episode ; starts at 0 for each episode
|
||||
│ ├ timestamp (float32): timestamp in the episode
|
||||
│ ├ next.done (bool): indicates the end of en episode ; True for the last frame in each episode
|
||||
│ └ index (int64): general index in the whole dataset
|
||||
├ episode_data_index: contains 2 tensors with the start and end indices of each episode
|
||||
│ ├ from: 1D int64 tensor of first frame index for each episode: shape (num episodes,) starts with 0
|
||||
│ └ to: 1D int64 tensor of last frame index for each episode: shape (num episodes,)
|
||||
│ ├ from (1D int64 tensor): first frame index for each episode — shape (num episodes,) starts with 0
|
||||
│ └ to: (1D int64 tensor): last frame index for each episode — shape (num episodes,)
|
||||
├ stats: a dictionary of statistics (max, mean, min, std) for each feature in the dataset, for instance
|
||||
│ ├ observation.images.cam_high: {'max': tensor with same number of dimensions (e.g. `(c, 1, 1)` for images, `(c,)` for states), etc.}
|
||||
│ ...
|
||||
├ info: a dictionary of metadata on the dataset
|
||||
│ ├ fps: float - frame per second the dataset is recorded/synchronized to
|
||||
│ └ video: bool - indicates if frames are encoded in mp4 video files to save space or stored as png files
|
||||
├ videos_dir: path to where the mp4 videos or png images are stored/accessed
|
||||
└ camera_keys: List of string: the keys to access camera features in the item returned by the dataset (e.g. `["observation.images.cam_high", ...]`)
|
||||
│ ├ codebase_version (str): this is to keep track of the codebase version the dataset was created with
|
||||
│ ├ fps (float): frame per second the dataset is recorded/synchronized to
|
||||
│ ├ video (bool): indicates if frames are encoded in mp4 video files to save space or stored as png files
|
||||
│ └ encoding (dict): if video, this documents the main options that were used with ffmpeg to encode the videos
|
||||
├ videos_dir (Path): where the mp4 videos or png images are stored/accessed
|
||||
└ camera_keys (list of string): the keys to access camera features in the item returned by the dataset (e.g. `["observation.images.cam_high", ...]`)
|
||||
```
|
||||
|
||||
A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
|
||||
- hf_dataset stored using Hugging Face datasets library serialization to parquet
|
||||
- videos are stored in mp4 format to save space or png files
|
||||
- episode_data_index saved using `safetensor` tensor serializtion format
|
||||
- stats saved using `safetensor` tensor serializtion format
|
||||
- info are saved using JSON
|
||||
- videos are stored in mp4 format to save space
|
||||
- metadata are stored in plain json/jsonl files
|
||||
|
||||
Dataset can uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can set the `DATA_DIR` environment variable to you root dataset folder as illustrated in the above section on dataset visualization.
|
||||
Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can use the `local_files_only` argument and specify its location with the `root` argument if it's not in the default `~/.cache/huggingface/lerobot` location.
|
||||
|
||||
### Evaluate a pretrained policy
|
||||
|
||||
@@ -246,13 +267,20 @@ checkpoints
|
||||
│ └── training_state.pth # optimizer/scheduler/rng state and training step
|
||||
```
|
||||
|
||||
To resume training from a checkpoint, you can add these to the `train.py` python command:
|
||||
```bash
|
||||
hydra.run.dir=your/original/experiment/dir resume=true
|
||||
```
|
||||
|
||||
It will load the pretrained model, optimizer and scheduler states for training. For more information please see our tutorial on training resumption [here](https://github.com/huggingface/lerobot/blob/main/examples/5_resume_training.md).
|
||||
|
||||
To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding:
|
||||
|
||||
```bash
|
||||
wandb.enable=true
|
||||
```
|
||||
|
||||
A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser:
|
||||
A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser. Please also check [here](https://github.com/huggingface/lerobot/blob/main/examples/4_train_policy_with_script.md#typical-logs-and-metrics) for the explanation of some commonly used metrics in logs.
|
||||
|
||||

|
||||
|
||||
@@ -281,13 +309,13 @@ To add a dataset to the hub, you need to login using a write-access token, which
|
||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||
```
|
||||
|
||||
Then move your dataset folder in `data` directory (e.g. `data/aloha_static_pingpong_test`), and push your dataset to the hub with:
|
||||
Then point to your raw dataset folder (e.g. `data/aloha_static_pingpong_test_raw`), and push your dataset to the hub with:
|
||||
```bash
|
||||
python lerobot/scripts/push_dataset_to_hub.py \
|
||||
--data-dir data \
|
||||
--dataset-id aloha_static_pingpong_test \
|
||||
--raw-format aloha_hdf5 \
|
||||
--community-id lerobot
|
||||
--raw-dir data/aloha_static_pingpong_test_raw \
|
||||
--out-dir data \
|
||||
--repo-id lerobot/aloha_static_pingpong_test \
|
||||
--raw-format aloha_hdf5
|
||||
```
|
||||
|
||||
See `python lerobot/scripts/push_dataset_to_hub.py --help` for more instructions.
|
||||
@@ -339,7 +367,7 @@ with profile(
|
||||
## Citation
|
||||
|
||||
If you want, you can cite this work with:
|
||||
```
|
||||
```bibtex
|
||||
@misc{cadene2024lerobot,
|
||||
author = {Cadene, Remi and Alibert, Simon and Soare, Alexander and Gallouedec, Quentin and Zouitine, Adil and Wolf, Thomas},
|
||||
title = {LeRobot: State-of-the-art Machine Learning for Real-World Robotics in Pytorch},
|
||||
@@ -347,3 +375,45 @@ If you want, you can cite this work with:
|
||||
year = {2024}
|
||||
}
|
||||
```
|
||||
|
||||
Additionally, if you are using any of the particular policy architecture, pretrained models, or datasets, it is recommended to cite the original authors of the work as they appear below:
|
||||
|
||||
- [Diffusion Policy](https://diffusion-policy.cs.columbia.edu)
|
||||
```bibtex
|
||||
@article{chi2024diffusionpolicy,
|
||||
author = {Cheng Chi and Zhenjia Xu and Siyuan Feng and Eric Cousineau and Yilun Du and Benjamin Burchfiel and Russ Tedrake and Shuran Song},
|
||||
title ={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||
journal = {The International Journal of Robotics Research},
|
||||
year = {2024},
|
||||
}
|
||||
```
|
||||
- [ACT or ALOHA](https://tonyzhaozh.github.io/aloha)
|
||||
```bibtex
|
||||
@article{zhao2023learning,
|
||||
title={Learning fine-grained bimanual manipulation with low-cost hardware},
|
||||
author={Zhao, Tony Z and Kumar, Vikash and Levine, Sergey and Finn, Chelsea},
|
||||
journal={arXiv preprint arXiv:2304.13705},
|
||||
year={2023}
|
||||
}
|
||||
```
|
||||
|
||||
- [TDMPC](https://www.nicklashansen.com/td-mpc/)
|
||||
|
||||
```bibtex
|
||||
@inproceedings{Hansen2022tdmpc,
|
||||
title={Temporal Difference Learning for Model Predictive Control},
|
||||
author={Nicklas Hansen and Xiaolong Wang and Hao Su},
|
||||
booktitle={ICML},
|
||||
year={2022}
|
||||
}
|
||||
```
|
||||
|
||||
- [VQ-BeT](https://sjlee.cc/vq-bet/)
|
||||
```bibtex
|
||||
@article{lee2024behavior,
|
||||
title={Behavior generation with latent actions},
|
||||
author={Lee, Seungjae and Wang, Yibin and Etukuru, Haritheja and Kim, H Jin and Shafiullah, Nur Muhammad Mahi and Pinto, Lerrel},
|
||||
journal={arXiv preprint arXiv:2403.03181},
|
||||
year={2024}
|
||||
}
|
||||
```
|
||||
|
||||
271
benchmarks/video/README.md
Normal file
271
benchmarks/video/README.md
Normal file
@@ -0,0 +1,271 @@
|
||||
# Video benchmark
|
||||
|
||||
|
||||
## Questions
|
||||
What is the optimal trade-off between:
|
||||
- maximizing loading time with random access,
|
||||
- minimizing memory space on disk,
|
||||
- maximizing success rate of policies,
|
||||
- compatibility across devices/platforms for decoding videos (e.g. video players, web browsers).
|
||||
|
||||
How to encode videos?
|
||||
- Which video codec (`-vcodec`) to use? h264, h265, AV1?
|
||||
- What pixel format to use (`-pix_fmt`)? `yuv444p` or `yuv420p`?
|
||||
- How much compression (`-crf`)? No compression with `0`, intermediate compression with `25` or extreme with `50+`?
|
||||
- Which frequency to chose for key frames (`-g`)? A key frame every `10` frames?
|
||||
|
||||
How to decode videos?
|
||||
- Which `decoder`? `torchvision`, `torchaudio`, `ffmpegio`, `decord`, or `nvc`?
|
||||
- What scenarios to use for the requesting timestamps during benchmark? (`timestamps_mode`)
|
||||
|
||||
|
||||
## Variables
|
||||
**Image content & size**
|
||||
We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an apartment, or in a factory, or outdoor, or with lots of moving objects in the scene, etc. Similarly, loading times might not vary linearly with the image size (resolution).
|
||||
For these reasons, we run this benchmark on four representative datasets:
|
||||
- `lerobot/pusht_image`: (96 x 96 pixels) simulation with simple geometric shapes, fixed camera.
|
||||
- `aliberts/aloha_mobile_shrimp_image`: (480 x 640 pixels) real-world indoor, moving camera.
|
||||
- `aliberts/paris_street`: (720 x 1280 pixels) real-world outdoor, moving camera.
|
||||
- `aliberts/kitchen`: (1080 x 1920 pixels) real-world indoor, fixed camera.
|
||||
|
||||
Note: The datasets used for this benchmark need to be image datasets, not video datasets.
|
||||
|
||||
**Data augmentations**
|
||||
We might revisit this benchmark and find better settings if we train our policies with various data augmentations to make them more robust (e.g. robust to color changes, compression, etc.).
|
||||
|
||||
### Encoding parameters
|
||||
| parameter | values |
|
||||
|-------------|--------------------------------------------------------------|
|
||||
| **vcodec** | `libx264`, `libx265`, `libsvtav1` |
|
||||
| **pix_fmt** | `yuv444p`, `yuv420p` |
|
||||
| **g** | `1`, `2`, `3`, `4`, `5`, `6`, `10`, `15`, `20`, `40`, `None` |
|
||||
| **crf** | `0`, `5`, `10`, `15`, `20`, `25`, `30`, `40`, `50`, `None` |
|
||||
|
||||
Note that `crf` value might be interpreted differently by various video codecs. In other words, the same value used with one codec doesn't necessarily translate into the same compression level with another codec. In fact, the default value (`None`) isn't the same amongst the different video codecs. Importantly, it is also the case for many other ffmpeg arguments like `g` which specifies the frequency of the key frames.
|
||||
|
||||
For a comprehensive list and documentation of these parameters, see the ffmpeg documentation depending on the video codec used:
|
||||
- h264: https://trac.ffmpeg.org/wiki/Encode/H.264
|
||||
- h265: https://trac.ffmpeg.org/wiki/Encode/H.265
|
||||
- AV1: https://trac.ffmpeg.org/wiki/Encode/AV1
|
||||
|
||||
### Decoding parameters
|
||||
**Decoder**
|
||||
We tested two video decoding backends from torchvision:
|
||||
- `pyav` (default)
|
||||
- `video_reader` (requires to build torchvision from source)
|
||||
|
||||
**Requested timestamps**
|
||||
Given the way video decoding works, once a keyframe has been loaded, the decoding of subsequent frames is fast.
|
||||
This of course is affected by the `-g` parameter during encoding, which specifies the frequency of the keyframes. Given our typical use cases in robotics policies which might request a few timestamps in different random places, we want to replicate these use cases with the following scenarios:
|
||||
- `1_frame`: 1 frame,
|
||||
- `2_frames`: 2 consecutive frames (e.g. `[t, t + 1 / fps]`),
|
||||
- `6_frames`: 6 consecutive frames (e.g. `[t + i / fps for i in range(6)]`)
|
||||
|
||||
Note that this differs significantly from a typical use case like watching a movie, in which every frame is loaded sequentially from the beginning to the end and it's acceptable to have big values for `-g`.
|
||||
|
||||
Additionally, because some policies might request single timestamps that are a few frames apart, we also have the following scenario:
|
||||
- `2_frames_4_space`: 2 frames with 4 consecutive frames of spacing in between (e.g `[t, t + 5 / fps]`),
|
||||
|
||||
However, due to how video decoding is implemented with `pyav`, we don't have access to an accurate seek so in practice this scenario is essentially the same as `6_frames` since all 6 frames between `t` and `t + 5 / fps` will be decoded.
|
||||
|
||||
|
||||
## Metrics
|
||||
**Data compression ratio (lower is better)**
|
||||
`video_images_size_ratio` is the ratio of the memory space on disk taken by the encoded video over the memory space taken by the original images. For instance, `video_images_size_ratio=25%` means that the video takes 4 times less memory space on disk compared to the original images.
|
||||
|
||||
**Loading time ratio (lower is better)**
|
||||
`video_images_load_time_ratio` is the ratio of the time it takes to decode frames from the video at a given timestamps over the time it takes to load the exact same original images. Lower is better. For instance, `video_images_load_time_ratio=200%` means that decoding from video is 2 times slower than loading the original images.
|
||||
|
||||
**Average Mean Square Error (lower is better)**
|
||||
`avg_mse` is the average mean square error between each decoded frame and its corresponding original image over all requested timestamps, and also divided by the number of pixels in the image to be comparable when switching to different image sizes.
|
||||
|
||||
**Average Peak Signal to Noise Ratio (higher is better)**
|
||||
`avg_psnr` measures the ratio between the maximum possible power of a signal and the power of corrupting noise that affects the fidelity of its representation. Higher PSNR indicates better quality.
|
||||
|
||||
**Average Structural Similarity Index Measure (higher is better)**
|
||||
`avg_ssim` evaluates the perceived quality of images by comparing luminance, contrast, and structure. SSIM values range from -1 to 1, where 1 indicates perfect similarity.
|
||||
|
||||
One aspect that can't be measured here with those metrics is the compatibility of the encoding across platforms, in particular on web browser, for visualization purposes.
|
||||
h264, h265 and AV1 are all commonly used codecs and should not pose an issue. However, the chroma subsampling (`pix_fmt`) format might affect compatibility:
|
||||
- `yuv420p` is more widely supported across various platforms, including web browsers.
|
||||
- `yuv444p` offers higher color fidelity but might not be supported as broadly.
|
||||
|
||||
|
||||
<!-- **Loss of a pretrained policy (higher is better)** (not available)
|
||||
`loss_pretrained` is the result of evaluating with the selected encoding/decoding settings a policy pretrained on original images. It is easier to understand than `avg_l2_error`.
|
||||
|
||||
**Success rate after retraining (higher is better)** (not available)
|
||||
`success_rate` is the result of training and evaluating a policy with the selected encoding/decoding settings. It is the most difficult metric to get but also the very best. -->
|
||||
|
||||
|
||||
## How the benchmark works
|
||||
The benchmark evaluates both encoding and decoding of video frames on the first episode of each dataset.
|
||||
|
||||
**Encoding:** for each `vcodec` and `pix_fmt` pair, we use a default value for `g` and `crf` upon which we change a single value (either `g` or `crf`) to one of the specified values (we don't test every combination of those as this would be computationally too heavy).
|
||||
This gives a unique set of encoding parameters which is used to encode the episode.
|
||||
|
||||
**Decoding:** Then, for each of those unique encodings, we iterate through every combination of the decoding parameters `backend` and `timestamps_mode`. For each of them, we record the metrics of a number of samples (given by `--num-samples`). This is parallelized for efficiency and the number of processes can be controlled with `--num-workers`. Ideally, it's best to have a `--num-samples` that is divisible by `--num-workers`.
|
||||
|
||||
Intermediate results saved for each `vcodec` and `pix_fmt` combination in csv tables.
|
||||
These are then all concatenated to a single table ready for analysis.
|
||||
|
||||
## Caveats
|
||||
We tried to measure the most impactful parameters for both encoding and decoding. However, for computational reasons we can't test out every combination.
|
||||
|
||||
Additional encoding parameters exist that are not included in this benchmark. In particular:
|
||||
- `-preset` which allows for selecting encoding presets. This represents a collection of options that will provide a certain encoding speed to compression ratio. By leaving this parameter unspecified, it is considered to be `medium` for libx264 and libx265 and `8` for libsvtav1.
|
||||
- `-tune` which allows to optimize the encoding for certains aspects (e.g. film quality, fast decoding, etc.).
|
||||
|
||||
See the documentation mentioned above for more detailed info on these settings and for a more comprehensive list of other parameters.
|
||||
|
||||
Similarly on the decoding side, other decoders exist but are not implemented in our current benchmark. To name a few:
|
||||
- `torchaudio`
|
||||
- `ffmpegio`
|
||||
- `decord`
|
||||
- `nvc`
|
||||
|
||||
Note as well that since we are mostly interested in the performance at decoding time (also because encoding is done only once before uploading a dataset), we did not measure encoding times nor have any metrics regarding encoding.
|
||||
However, besides the necessity to build ffmpeg from source, encoding did not pose any issue and it didn't take a significant amount of time during this benchmark.
|
||||
|
||||
|
||||
## Install
|
||||
Building ffmpeg from source is required to include libx265 and libaom/libsvtav1 (av1) video codecs ([compilation guide](https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu)).
|
||||
|
||||
**Note:** While you still need to build torchvision with a conda-installed `ffmpeg<4.3` to use the `video_reader` decoder (as described in [#220](https://github.com/huggingface/lerobot/pull/220)), you also need another version which is custom-built with all the video codecs for encoding. For the script to then use that version, you can prepend the command above with `PATH="$HOME/bin:$PATH"`, which is where ffmpeg should be built.
|
||||
|
||||
|
||||
## Adding a video decoder
|
||||
Right now, we're only benchmarking the two video decoder available with torchvision: `pyav` and `video_reader`.
|
||||
You can easily add a new decoder to benchmark by adding it to this function in the script:
|
||||
```diff
|
||||
def decode_video_frames(
|
||||
video_path: str,
|
||||
timestamps: list[float],
|
||||
tolerance_s: float,
|
||||
backend: str,
|
||||
) -> torch.Tensor:
|
||||
if backend in ["pyav", "video_reader"]:
|
||||
return decode_video_frames_torchvision(
|
||||
video_path, timestamps, tolerance_s, backend
|
||||
)
|
||||
+ elif backend == ["your_decoder"]:
|
||||
+ return your_decoder_function(
|
||||
+ video_path, timestamps, tolerance_s, backend
|
||||
+ )
|
||||
else:
|
||||
raise NotImplementedError(backend)
|
||||
```
|
||||
|
||||
|
||||
## Example
|
||||
For a quick run, you can try these parameters:
|
||||
```bash
|
||||
python benchmark/video/run_video_benchmark.py \
|
||||
--output-dir outputs/video_benchmark \
|
||||
--repo-ids \
|
||||
lerobot/pusht_image \
|
||||
aliberts/aloha_mobile_shrimp_image \
|
||||
--vcodec libx264 libx265 \
|
||||
--pix-fmt yuv444p yuv420p \
|
||||
--g 2 20 None \
|
||||
--crf 10 40 None \
|
||||
--timestamps-modes 1_frame 2_frames \
|
||||
--backends pyav video_reader \
|
||||
--num-samples 5 \
|
||||
--num-workers 5 \
|
||||
--save-frames 0
|
||||
```
|
||||
|
||||
|
||||
## Results
|
||||
|
||||
### Reproduce
|
||||
We ran the benchmark with the following parameters:
|
||||
```bash
|
||||
# h264 and h265 encodings
|
||||
python benchmark/video/run_video_benchmark.py \
|
||||
--output-dir outputs/video_benchmark \
|
||||
--repo-ids \
|
||||
lerobot/pusht_image \
|
||||
aliberts/aloha_mobile_shrimp_image \
|
||||
aliberts/paris_street \
|
||||
aliberts/kitchen \
|
||||
--vcodec libx264 libx265 \
|
||||
--pix-fmt yuv444p yuv420p \
|
||||
--g 1 2 3 4 5 6 10 15 20 40 None \
|
||||
--crf 0 5 10 15 20 25 30 40 50 None \
|
||||
--timestamps-modes 1_frame 2_frames 6_frames \
|
||||
--backends pyav video_reader \
|
||||
--num-samples 50 \
|
||||
--num-workers 5 \
|
||||
--save-frames 1
|
||||
|
||||
# av1 encoding (only compatible with yuv420p and pyav decoder)
|
||||
python benchmark/video/run_video_benchmark.py \
|
||||
--output-dir outputs/video_benchmark \
|
||||
--repo-ids \
|
||||
lerobot/pusht_image \
|
||||
aliberts/aloha_mobile_shrimp_image \
|
||||
aliberts/paris_street \
|
||||
aliberts/kitchen \
|
||||
--vcodec libsvtav1 \
|
||||
--pix-fmt yuv420p \
|
||||
--g 1 2 3 4 5 6 10 15 20 40 None \
|
||||
--crf 0 5 10 15 20 25 30 40 50 None \
|
||||
--timestamps-modes 1_frame 2_frames 6_frames \
|
||||
--backends pyav \
|
||||
--num-samples 50 \
|
||||
--num-workers 5 \
|
||||
--save-frames 1
|
||||
```
|
||||
|
||||
The full results are available [here](https://docs.google.com/spreadsheets/d/1OYJB43Qu8fC26k_OyoMFgGBBKfQRCi4BIuYitQnq3sw/edit?usp=sharing)
|
||||
|
||||
|
||||
### Parameters selected for LeRobotDataset
|
||||
Considering these results, we chose what we think is the best set of encoding parameter:
|
||||
- vcodec: `libsvtav1`
|
||||
- pix-fmt: `yuv420p`
|
||||
- g: `2`
|
||||
- crf: `30`
|
||||
|
||||
Since we're using av1 encoding, we're choosing the `pyav` decoder as `video_reader` does not support it (and `pyav` doesn't require a custom build of `torchvision`).
|
||||
|
||||
### Summary
|
||||
|
||||
These tables show the results for `g=2` and `crf=30`, using `timestamps-modes=6_frames` and `backend=pyav`
|
||||
|
||||
| video_images_size_ratio | vcodec | pix_fmt | | | |
|
||||
|------------------------------------|------------|---------|-----------|-----------|-----------|
|
||||
| | libx264 | | libx265 | | libsvtav1 |
|
||||
| repo_id | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||
| lerobot/pusht_image | **16.97%** | 17.58% | 18.57% | 18.86% | 22.06% |
|
||||
| aliberts/aloha_mobile_shrimp_image | 2.14% | 2.11% | 1.38% | **1.37%** | 5.59% |
|
||||
| aliberts/paris_street | 2.12% | 2.13% | **1.54%** | **1.54%** | 4.43% |
|
||||
| aliberts/kitchen | 1.40% | 1.39% | **1.00%** | **1.00%** | 2.52% |
|
||||
|
||||
| video_images_load_time_ratio | vcodec | pix_fmt | | | |
|
||||
|------------------------------------|---------|---------|----------|---------|-----------|
|
||||
| | libx264 | | libx265 | | libsvtav1 |
|
||||
| repo_id | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||
| lerobot/pusht_image | 6.45 | 5.19 | **1.90** | 2.12 | 2.47 |
|
||||
| aliberts/aloha_mobile_shrimp_image | 11.80 | 7.92 | 0.71 | 0.85 | **0.48** |
|
||||
| aliberts/paris_street | 2.21 | 2.05 | 0.36 | 0.49 | **0.30** |
|
||||
| aliberts/kitchen | 1.46 | 1.46 | 0.28 | 0.51 | **0.26** |
|
||||
|
||||
| | | vcodec | pix_fmt | | | |
|
||||
|------------------------------------|----------|----------|--------------|----------|-----------|--------------|
|
||||
| | | libx264 | | libx265 | | libsvtav1 |
|
||||
| repo_id | metric | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||
| lerobot/pusht_image | avg_mse | 2.90E-04 | **2.03E-04** | 3.13E-04 | 2.29E-04 | 2.19E-04 |
|
||||
| | avg_psnr | 35.44 | 37.07 | 35.49 | **37.30** | 37.20 |
|
||||
| | avg_ssim | 98.28% | **98.85%** | 98.31% | 98.84% | 98.72% |
|
||||
| aliberts/aloha_mobile_shrimp_image | avg_mse | 2.76E-04 | 2.59E-04 | 3.17E-04 | 3.06E-04 | **1.30E-04** |
|
||||
| | avg_psnr | 35.91 | 36.21 | 35.88 | 36.09 | **40.17** |
|
||||
| | avg_ssim | 95.19% | 95.18% | 95.00% | 95.05% | **97.73%** |
|
||||
| aliberts/paris_street | avg_mse | 6.89E-04 | 6.70E-04 | 4.03E-03 | 4.02E-03 | **3.09E-04** |
|
||||
| | avg_psnr | 33.48 | 33.68 | 32.05 | 32.15 | **35.40** |
|
||||
| | avg_ssim | 93.76% | 93.75% | 89.46% | 89.46% | **95.46%** |
|
||||
| aliberts/kitchen | avg_mse | 2.50E-04 | 2.24E-04 | 4.28E-04 | 4.18E-04 | **1.53E-04** |
|
||||
| | avg_psnr | 36.73 | 37.33 | 36.56 | 36.75 | **39.12** |
|
||||
| | avg_ssim | 95.47% | 95.58% | 95.52% | 95.53% | **96.82%** |
|
||||
90
benchmarks/video/capture_camera_feed.py
Normal file
90
benchmarks/video/capture_camera_feed.py
Normal file
@@ -0,0 +1,90 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""Capture video feed from a camera as raw images."""
|
||||
|
||||
import argparse
|
||||
import datetime as dt
|
||||
from pathlib import Path
|
||||
|
||||
import cv2
|
||||
|
||||
|
||||
def display_and_save_video_stream(output_dir: Path, fps: int, width: int, height: int):
|
||||
now = dt.datetime.now()
|
||||
capture_dir = output_dir / f"{now:%Y-%m-%d}" / f"{now:%H-%M-%S}"
|
||||
if not capture_dir.exists():
|
||||
capture_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
# Opens the default webcam
|
||||
cap = cv2.VideoCapture(0)
|
||||
if not cap.isOpened():
|
||||
print("Error: Could not open video stream.")
|
||||
return
|
||||
|
||||
cap.set(cv2.CAP_PROP_FPS, fps)
|
||||
cap.set(cv2.CAP_PROP_FRAME_WIDTH, width)
|
||||
cap.set(cv2.CAP_PROP_FRAME_HEIGHT, height)
|
||||
|
||||
frame_index = 0
|
||||
while True:
|
||||
ret, frame = cap.read()
|
||||
|
||||
if not ret:
|
||||
print("Error: Could not read frame.")
|
||||
break
|
||||
|
||||
cv2.imshow("Video Stream", frame)
|
||||
cv2.imwrite(str(capture_dir / f"frame_{frame_index:06d}.png"), frame)
|
||||
frame_index += 1
|
||||
|
||||
# Break the loop on 'q' key press
|
||||
if cv2.waitKey(1) & 0xFF == ord("q"):
|
||||
break
|
||||
|
||||
# Release the capture and destroy all windows
|
||||
cap.release()
|
||||
cv2.destroyAllWindows()
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
parser = argparse.ArgumentParser()
|
||||
|
||||
parser.add_argument(
|
||||
"--output-dir",
|
||||
type=Path,
|
||||
default=Path("outputs/cam_capture/"),
|
||||
help="Directory where the capture images are written. A subfolder named with the current date & time will be created inside it for each capture.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--fps",
|
||||
type=int,
|
||||
default=30,
|
||||
help="Frames Per Second of the capture.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--width",
|
||||
type=int,
|
||||
default=1280,
|
||||
help="Width of the captured images.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--height",
|
||||
type=int,
|
||||
default=720,
|
||||
help="Height of the captured images.",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
display_and_save_video_stream(**vars(args))
|
||||
538
benchmarks/video/run_video_benchmark.py
Normal file
538
benchmarks/video/run_video_benchmark.py
Normal file
@@ -0,0 +1,538 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""Assess the performance of video decoding in various configurations.
|
||||
|
||||
This script will benchmark different video encoding and decoding parameters.
|
||||
See the provided README.md or run `python benchmark/video/run_video_benchmark.py --help` for usage info.
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import datetime as dt
|
||||
import random
|
||||
import shutil
|
||||
from collections import OrderedDict
|
||||
from concurrent.futures import ThreadPoolExecutor, as_completed
|
||||
from pathlib import Path
|
||||
|
||||
import einops
|
||||
import numpy as np
|
||||
import pandas as pd
|
||||
import PIL
|
||||
import torch
|
||||
from skimage.metrics import (
|
||||
mean_squared_error,
|
||||
peak_signal_noise_ratio,
|
||||
structural_similarity,
|
||||
)
|
||||
from tqdm import tqdm
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.video_utils import (
|
||||
decode_video_frames_torchvision,
|
||||
encode_video_frames,
|
||||
)
|
||||
from lerobot.common.utils.benchmark import TimeBenchmark
|
||||
|
||||
BASE_ENCODING = OrderedDict(
|
||||
[
|
||||
("vcodec", "libx264"),
|
||||
("pix_fmt", "yuv444p"),
|
||||
("g", 2),
|
||||
("crf", None),
|
||||
# TODO(aliberts): Add fastdecode
|
||||
# ("fastdecode", 0),
|
||||
]
|
||||
)
|
||||
|
||||
|
||||
# TODO(rcadene, aliberts): move to `utils.py` folder when we want to refactor
|
||||
def parse_int_or_none(value) -> int | None:
|
||||
if value.lower() == "none":
|
||||
return None
|
||||
try:
|
||||
return int(value)
|
||||
except ValueError as e:
|
||||
raise argparse.ArgumentTypeError(f"Invalid int or None: {value}") from e
|
||||
|
||||
|
||||
def check_datasets_formats(repo_ids: list) -> None:
|
||||
for repo_id in repo_ids:
|
||||
dataset = LeRobotDataset(repo_id)
|
||||
if dataset.video:
|
||||
raise ValueError(
|
||||
f"Use only image dataset for running this benchmark. Video dataset provided: {repo_id}"
|
||||
)
|
||||
|
||||
|
||||
def get_directory_size(directory: Path) -> int:
|
||||
total_size = 0
|
||||
for item in directory.rglob("*"):
|
||||
if item.is_file():
|
||||
total_size += item.stat().st_size
|
||||
return total_size
|
||||
|
||||
|
||||
def load_original_frames(
|
||||
imgs_dir: Path, timestamps: list[float], fps: int
|
||||
) -> torch.Tensor:
|
||||
frames = []
|
||||
for ts in timestamps:
|
||||
idx = int(ts * fps)
|
||||
frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
||||
frame = torch.from_numpy(np.array(frame))
|
||||
frame = frame.type(torch.float32) / 255
|
||||
frame = einops.rearrange(frame, "h w c -> c h w")
|
||||
frames.append(frame)
|
||||
return torch.stack(frames)
|
||||
|
||||
|
||||
def save_decoded_frames(
|
||||
imgs_dir: Path,
|
||||
save_dir: Path,
|
||||
frames: torch.Tensor,
|
||||
timestamps: list[float],
|
||||
fps: int,
|
||||
) -> None:
|
||||
if save_dir.exists() and len(list(save_dir.glob("frame_*.png"))) == len(timestamps):
|
||||
return
|
||||
|
||||
save_dir.mkdir(parents=True, exist_ok=True)
|
||||
for i, ts in enumerate(timestamps):
|
||||
idx = int(ts * fps)
|
||||
frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
|
||||
PIL.Image.fromarray(frame_hwc).save(save_dir / f"frame_{idx:06d}_decoded.png")
|
||||
shutil.copyfile(
|
||||
imgs_dir / f"frame_{idx:06d}.png",
|
||||
save_dir / f"frame_{idx:06d}_original.png",
|
||||
)
|
||||
|
||||
|
||||
def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
|
||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||
if imgs_dir.exists() and len(list(imgs_dir.glob("frame_*.png"))) == ep_num_images:
|
||||
return
|
||||
|
||||
imgs_dir.mkdir(parents=True, exist_ok=True)
|
||||
hf_dataset = dataset.hf_dataset.with_format(None)
|
||||
|
||||
# We only save images from the first camera
|
||||
img_keys = [
|
||||
key for key in hf_dataset.features if key.startswith("observation.image")
|
||||
]
|
||||
imgs_dataset = hf_dataset.select_columns(img_keys[0])
|
||||
|
||||
for i, item in enumerate(
|
||||
tqdm(
|
||||
imgs_dataset,
|
||||
desc=f"saving {dataset.repo_id} first episode images",
|
||||
leave=False,
|
||||
)
|
||||
):
|
||||
img = item[img_keys[0]]
|
||||
img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
|
||||
|
||||
if i >= ep_num_images - 1:
|
||||
break
|
||||
|
||||
|
||||
def sample_timestamps(
|
||||
timestamps_mode: str, ep_num_images: int, fps: int
|
||||
) -> list[float]:
|
||||
# Start at 5 to allow for 2_frames_4_space and 6_frames
|
||||
idx = random.randint(5, ep_num_images - 1)
|
||||
match timestamps_mode:
|
||||
case "1_frame":
|
||||
frame_indexes = [idx]
|
||||
case "2_frames":
|
||||
frame_indexes = [idx - 1, idx]
|
||||
case "2_frames_4_space":
|
||||
frame_indexes = [idx - 5, idx]
|
||||
case "6_frames":
|
||||
frame_indexes = [idx - i for i in range(6)][::-1]
|
||||
case _:
|
||||
raise ValueError(timestamps_mode)
|
||||
|
||||
return [idx / fps for idx in frame_indexes]
|
||||
|
||||
|
||||
def decode_video_frames(
|
||||
video_path: str,
|
||||
timestamps: list[float],
|
||||
tolerance_s: float,
|
||||
backend: str,
|
||||
) -> torch.Tensor:
|
||||
if backend in ["pyav", "video_reader"]:
|
||||
return decode_video_frames_torchvision(
|
||||
video_path, timestamps, tolerance_s, backend
|
||||
)
|
||||
else:
|
||||
raise NotImplementedError(backend)
|
||||
|
||||
|
||||
def benchmark_decoding(
|
||||
imgs_dir: Path,
|
||||
video_path: Path,
|
||||
timestamps_mode: str,
|
||||
backend: str,
|
||||
ep_num_images: int,
|
||||
fps: int,
|
||||
num_samples: int = 50,
|
||||
num_workers: int = 4,
|
||||
save_frames: bool = False,
|
||||
) -> dict:
|
||||
def process_sample(sample: int):
|
||||
time_benchmark = TimeBenchmark()
|
||||
timestamps = sample_timestamps(timestamps_mode, ep_num_images, fps)
|
||||
num_frames = len(timestamps)
|
||||
result = {
|
||||
"psnr_values": [],
|
||||
"ssim_values": [],
|
||||
"mse_values": [],
|
||||
}
|
||||
|
||||
with time_benchmark:
|
||||
frames = decode_video_frames(
|
||||
video_path, timestamps=timestamps, tolerance_s=5e-1, backend=backend
|
||||
)
|
||||
result["load_time_video_ms"] = time_benchmark.result_ms / num_frames
|
||||
|
||||
with time_benchmark:
|
||||
original_frames = load_original_frames(imgs_dir, timestamps, fps)
|
||||
result["load_time_images_ms"] = time_benchmark.result_ms / num_frames
|
||||
|
||||
frames_np, original_frames_np = frames.numpy(), original_frames.numpy()
|
||||
for i in range(num_frames):
|
||||
result["mse_values"].append(
|
||||
mean_squared_error(original_frames_np[i], frames_np[i])
|
||||
)
|
||||
result["psnr_values"].append(
|
||||
peak_signal_noise_ratio(
|
||||
original_frames_np[i], frames_np[i], data_range=1.0
|
||||
)
|
||||
)
|
||||
result["ssim_values"].append(
|
||||
structural_similarity(
|
||||
original_frames_np[i], frames_np[i], data_range=1.0, channel_axis=0
|
||||
)
|
||||
)
|
||||
|
||||
if save_frames and sample == 0:
|
||||
save_dir = video_path.with_suffix("") / f"{timestamps_mode}_{backend}"
|
||||
save_decoded_frames(imgs_dir, save_dir, frames, timestamps, fps)
|
||||
|
||||
return result
|
||||
|
||||
load_times_video_ms = []
|
||||
load_times_images_ms = []
|
||||
mse_values = []
|
||||
psnr_values = []
|
||||
ssim_values = []
|
||||
|
||||
# A sample is a single set of decoded frames specified by timestamps_mode (e.g. a single frame, 2 frames, etc.).
|
||||
# For each sample, we record metrics (loading time and quality metrics) which are then averaged over all samples.
|
||||
# As these samples are independent, we run them in parallel threads to speed up the benchmark.
|
||||
with ThreadPoolExecutor(max_workers=num_workers) as executor:
|
||||
futures = [executor.submit(process_sample, i) for i in range(num_samples)]
|
||||
for future in tqdm(
|
||||
as_completed(futures), total=num_samples, desc="samples", leave=False
|
||||
):
|
||||
result = future.result()
|
||||
load_times_video_ms.append(result["load_time_video_ms"])
|
||||
load_times_images_ms.append(result["load_time_images_ms"])
|
||||
psnr_values.extend(result["psnr_values"])
|
||||
ssim_values.extend(result["ssim_values"])
|
||||
mse_values.extend(result["mse_values"])
|
||||
|
||||
avg_load_time_video_ms = float(np.array(load_times_video_ms).mean())
|
||||
avg_load_time_images_ms = float(np.array(load_times_images_ms).mean())
|
||||
video_images_load_time_ratio = avg_load_time_video_ms / avg_load_time_images_ms
|
||||
|
||||
return {
|
||||
"avg_load_time_video_ms": avg_load_time_video_ms,
|
||||
"avg_load_time_images_ms": avg_load_time_images_ms,
|
||||
"video_images_load_time_ratio": video_images_load_time_ratio,
|
||||
"avg_mse": float(np.mean(mse_values)),
|
||||
"avg_psnr": float(np.mean(psnr_values)),
|
||||
"avg_ssim": float(np.mean(ssim_values)),
|
||||
}
|
||||
|
||||
|
||||
def benchmark_encoding_decoding(
|
||||
dataset: LeRobotDataset,
|
||||
video_path: Path,
|
||||
imgs_dir: Path,
|
||||
encoding_cfg: dict,
|
||||
decoding_cfg: dict,
|
||||
num_samples: int,
|
||||
num_workers: int,
|
||||
save_frames: bool,
|
||||
overwrite: bool = False,
|
||||
seed: int = 1337,
|
||||
) -> list[dict]:
|
||||
fps = dataset.fps
|
||||
|
||||
if overwrite or not video_path.is_file():
|
||||
tqdm.write(f"encoding {video_path}")
|
||||
encode_video_frames(
|
||||
imgs_dir=imgs_dir,
|
||||
video_path=video_path,
|
||||
fps=fps,
|
||||
vcodec=encoding_cfg["vcodec"],
|
||||
pix_fmt=encoding_cfg["pix_fmt"],
|
||||
g=encoding_cfg.get("g"),
|
||||
crf=encoding_cfg.get("crf"),
|
||||
# fast_decode=encoding_cfg.get("fastdecode"),
|
||||
overwrite=True,
|
||||
)
|
||||
|
||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||
width, height = tuple(dataset[0][dataset.meta.camera_keys[0]].shape[-2:])
|
||||
num_pixels = width * height
|
||||
video_size_bytes = video_path.stat().st_size
|
||||
images_size_bytes = get_directory_size(imgs_dir)
|
||||
video_images_size_ratio = video_size_bytes / images_size_bytes
|
||||
|
||||
random.seed(seed)
|
||||
benchmark_table = []
|
||||
for timestamps_mode in tqdm(
|
||||
decoding_cfg["timestamps_modes"],
|
||||
desc="decodings (timestamps_modes)",
|
||||
leave=False,
|
||||
):
|
||||
for backend in tqdm(
|
||||
decoding_cfg["backends"], desc="decodings (backends)", leave=False
|
||||
):
|
||||
benchmark_row = benchmark_decoding(
|
||||
imgs_dir,
|
||||
video_path,
|
||||
timestamps_mode,
|
||||
backend,
|
||||
ep_num_images,
|
||||
fps,
|
||||
num_samples,
|
||||
num_workers,
|
||||
save_frames,
|
||||
)
|
||||
benchmark_row.update(
|
||||
**{
|
||||
"repo_id": dataset.repo_id,
|
||||
"resolution": f"{width} x {height}",
|
||||
"num_pixels": num_pixels,
|
||||
"video_size_bytes": video_size_bytes,
|
||||
"images_size_bytes": images_size_bytes,
|
||||
"video_images_size_ratio": video_images_size_ratio,
|
||||
"timestamps_mode": timestamps_mode,
|
||||
"backend": backend,
|
||||
},
|
||||
**encoding_cfg,
|
||||
)
|
||||
benchmark_table.append(benchmark_row)
|
||||
|
||||
return benchmark_table
|
||||
|
||||
|
||||
def main(
|
||||
output_dir: Path,
|
||||
repo_ids: list[str],
|
||||
vcodec: list[str],
|
||||
pix_fmt: list[str],
|
||||
g: list[int],
|
||||
crf: list[int],
|
||||
# fastdecode: list[int],
|
||||
timestamps_modes: list[str],
|
||||
backends: list[str],
|
||||
num_samples: int,
|
||||
num_workers: int,
|
||||
save_frames: bool,
|
||||
):
|
||||
check_datasets_formats(repo_ids)
|
||||
encoding_benchmarks = {
|
||||
"g": g,
|
||||
"crf": crf,
|
||||
# "fastdecode": fastdecode,
|
||||
}
|
||||
decoding_benchmarks = {
|
||||
"timestamps_modes": timestamps_modes,
|
||||
"backends": backends,
|
||||
}
|
||||
headers = ["repo_id", "resolution", "num_pixels"]
|
||||
headers += list(BASE_ENCODING.keys())
|
||||
headers += [
|
||||
"timestamps_mode",
|
||||
"backend",
|
||||
"video_size_bytes",
|
||||
"images_size_bytes",
|
||||
"video_images_size_ratio",
|
||||
"avg_load_time_video_ms",
|
||||
"avg_load_time_images_ms",
|
||||
"video_images_load_time_ratio",
|
||||
"avg_mse",
|
||||
"avg_psnr",
|
||||
"avg_ssim",
|
||||
]
|
||||
file_paths = []
|
||||
for video_codec in tqdm(vcodec, desc="encodings (vcodec)"):
|
||||
for pixel_format in tqdm(pix_fmt, desc="encodings (pix_fmt)", leave=False):
|
||||
benchmark_table = []
|
||||
for repo_id in tqdm(repo_ids, desc="encodings (datasets)", leave=False):
|
||||
dataset = LeRobotDataset(repo_id)
|
||||
imgs_dir = output_dir / "images" / dataset.repo_id.replace("/", "_")
|
||||
# We only use the first episode
|
||||
save_first_episode(imgs_dir, dataset)
|
||||
for key, values in tqdm(
|
||||
encoding_benchmarks.items(), desc="encodings (g, crf)", leave=False
|
||||
):
|
||||
for value in tqdm(values, desc=f"encodings ({key})", leave=False):
|
||||
encoding_cfg = BASE_ENCODING.copy()
|
||||
encoding_cfg["vcodec"] = video_codec
|
||||
encoding_cfg["pix_fmt"] = pixel_format
|
||||
encoding_cfg[key] = value
|
||||
args_path = Path(
|
||||
"_".join(str(value) for value in encoding_cfg.values())
|
||||
)
|
||||
video_path = (
|
||||
output_dir
|
||||
/ "videos"
|
||||
/ args_path
|
||||
/ f"{repo_id.replace('/', '_')}.mp4"
|
||||
)
|
||||
benchmark_table += benchmark_encoding_decoding(
|
||||
dataset,
|
||||
video_path,
|
||||
imgs_dir,
|
||||
encoding_cfg,
|
||||
decoding_benchmarks,
|
||||
num_samples,
|
||||
num_workers,
|
||||
save_frames,
|
||||
)
|
||||
|
||||
# Save intermediate results
|
||||
benchmark_df = pd.DataFrame(benchmark_table, columns=headers)
|
||||
now = dt.datetime.now()
|
||||
csv_path = (
|
||||
output_dir
|
||||
/ f"{now:%Y-%m-%d}_{now:%H-%M-%S}_{video_codec}_{pixel_format}_{num_samples}-samples.csv"
|
||||
)
|
||||
benchmark_df.to_csv(csv_path, header=True, index=False)
|
||||
file_paths.append(csv_path)
|
||||
del benchmark_df
|
||||
|
||||
# Concatenate all results
|
||||
df_list = [pd.read_csv(csv_path) for csv_path in file_paths]
|
||||
concatenated_df = pd.concat(df_list, ignore_index=True)
|
||||
concatenated_path = (
|
||||
output_dir / f"{now:%Y-%m-%d}_{now:%H-%M-%S}_all_{num_samples}-samples.csv"
|
||||
)
|
||||
concatenated_df.to_csv(concatenated_path, header=True, index=False)
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument(
|
||||
"--output-dir",
|
||||
type=Path,
|
||||
default=Path("outputs/video_benchmark"),
|
||||
help="Directory where the video benchmark outputs are written.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--repo-ids",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=[
|
||||
"lerobot/pusht_image",
|
||||
"aliberts/aloha_mobile_shrimp_image",
|
||||
"aliberts/paris_street",
|
||||
"aliberts/kitchen",
|
||||
],
|
||||
help="Datasets repo-ids to test against. First episodes only are used. Must be images.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--vcodec",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=["libx264", "libx265", "libsvtav1"],
|
||||
help="Video codecs to be tested",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--pix-fmt",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=["yuv444p", "yuv420p"],
|
||||
help="Pixel formats (chroma subsampling) to be tested",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--g",
|
||||
type=parse_int_or_none,
|
||||
nargs="*",
|
||||
default=[1, 2, 3, 4, 5, 6, 10, 15, 20, 40, 100, None],
|
||||
help="Group of pictures sizes to be tested.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--crf",
|
||||
type=parse_int_or_none,
|
||||
nargs="*",
|
||||
default=[0, 5, 10, 15, 20, 25, 30, 40, 50, None],
|
||||
help="Constant rate factors to be tested.",
|
||||
)
|
||||
# parser.add_argument(
|
||||
# "--fastdecode",
|
||||
# type=int,
|
||||
# nargs="*",
|
||||
# default=[0, 1],
|
||||
# help="Use the fastdecode tuning option. 0 disables it. "
|
||||
# "For libx264 and libx265, only 1 is possible. "
|
||||
# "For libsvtav1, 1, 2 or 3 are possible values with a higher number meaning a faster decoding optimization",
|
||||
# )
|
||||
parser.add_argument(
|
||||
"--timestamps-modes",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=[
|
||||
"1_frame",
|
||||
"2_frames",
|
||||
"2_frames_4_space",
|
||||
"6_frames",
|
||||
],
|
||||
help="Timestamps scenarios to be tested.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--backends",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=["pyav", "video_reader"],
|
||||
help="Torchvision decoding backend to be tested.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--num-samples",
|
||||
type=int,
|
||||
default=50,
|
||||
help="Number of samples for each encoding x decoding config.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--num-workers",
|
||||
type=int,
|
||||
default=10,
|
||||
help="Number of processes for parallelized sample processing.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--save-frames",
|
||||
type=int,
|
||||
default=0,
|
||||
help="Whether to save decoded frames or not. Enter a non-zero number for true.",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
main(**vars(args))
|
||||
18
checkport.py
Normal file
18
checkport.py
Normal file
@@ -0,0 +1,18 @@
|
||||
import socket
|
||||
|
||||
|
||||
def check_port(host, port):
|
||||
s = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
|
||||
try:
|
||||
s.connect((host, port))
|
||||
print(f"Connection successful to {host}:{port}!")
|
||||
except Exception as e:
|
||||
print(f"Connection failed to {host}:{port}: {e}")
|
||||
finally:
|
||||
s.close()
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
host = "127.0.0.1" # or "localhost"
|
||||
port = 51350
|
||||
check_port(host, port)
|
||||
@@ -8,7 +8,8 @@ ARG DEBIAN_FRONTEND=noninteractive
|
||||
# Install apt dependencies
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
build-essential cmake \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||
speech-dispatcher \
|
||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||
|
||||
# Create virtual environment
|
||||
@@ -21,7 +22,7 @@ RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
||||
COPY . /lerobot
|
||||
WORKDIR /lerobot
|
||||
RUN pip install --upgrade --no-cache-dir pip
|
||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht]" \
|
||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]" \
|
||||
--extra-index-url https://download.pytorch.org/whl/cpu
|
||||
|
||||
# Set EGL as the rendering backend for MuJoCo
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
FROM nvidia/cuda:12.4.1-base-ubuntu22.04
|
||||
FROM nvidia/cuda:12.2.2-devel-ubuntu22.04
|
||||
|
||||
# Configure image
|
||||
ARG PYTHON_VERSION=3.10
|
||||
@@ -8,14 +8,42 @@ ARG DEBIAN_FRONTEND=noninteractive
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
build-essential cmake \
|
||||
git git-lfs openssh-client \
|
||||
nano vim less util-linux \
|
||||
nano vim less util-linux tree \
|
||||
htop atop nvtop \
|
||||
sed gawk grep curl wget \
|
||||
sed gawk grep curl wget zip unzip \
|
||||
tcpdump sysstat screen tmux \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
||||
speech-dispatcher \
|
||||
python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
|
||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||
|
||||
# Install ffmpeg build dependencies. See:
|
||||
# https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu
|
||||
# TODO(aliberts): create image to build dependencies from source instead
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
autoconf automake yasm \
|
||||
libass-dev \
|
||||
libfreetype6-dev \
|
||||
libgnutls28-dev \
|
||||
libunistring-dev \
|
||||
libmp3lame-dev \
|
||||
libtool \
|
||||
libvorbis-dev \
|
||||
meson \
|
||||
ninja-build \
|
||||
pkg-config \
|
||||
texinfo \
|
||||
yasm \
|
||||
zlib1g-dev \
|
||||
nasm \
|
||||
libx264-dev \
|
||||
libx265-dev libnuma-dev \
|
||||
libvpx-dev \
|
||||
libfdk-aac-dev \
|
||||
libopus-dev \
|
||||
libsvtav1-dev libsvtav1enc-dev libsvtav1dec-dev \
|
||||
libdav1d-dev
|
||||
|
||||
# Install gh cli tool
|
||||
RUN (type -p wget >/dev/null || (apt update && apt-get install wget -y)) \
|
||||
&& mkdir -p -m 755 /etc/apt/keyrings \
|
||||
|
||||
11
docker/lerobot-gpu-mani-skill/Dockerfile
Normal file
11
docker/lerobot-gpu-mani-skill/Dockerfile
Normal file
@@ -0,0 +1,11 @@
|
||||
FROM huggingface/lerobot-gpu:latest
|
||||
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
libvulkan1 vulkan-tools \
|
||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||
|
||||
RUN pip install --upgrade --no-cache-dir pip
|
||||
RUN pip install --no-cache-dir ".[mani-skill]"
|
||||
|
||||
# Set EGL as the rendering backend for MuJoCo
|
||||
ENV MUJOCO_GL="egl"
|
||||
@@ -8,8 +8,9 @@ ARG DEBIAN_FRONTEND=noninteractive
|
||||
# Install apt dependencies
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
build-essential cmake \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
||||
python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||
speech-dispatcher \
|
||||
python${PYTHON_VERSION}-dev python${PYTHON_VERSION}-venv \
|
||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||
|
||||
|
||||
@@ -23,7 +24,7 @@ RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
||||
COPY . /lerobot
|
||||
WORKDIR /lerobot
|
||||
RUN pip install --upgrade --no-cache-dir pip
|
||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht]"
|
||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]"
|
||||
|
||||
# Set EGL as the rendering backend for MuJoCo
|
||||
ENV MUJOCO_GL="egl"
|
||||
|
||||
296
examples/10_use_so100.md
Normal file
296
examples/10_use_so100.md
Normal file
@@ -0,0 +1,296 @@
|
||||
# Using the [SO-100](https://github.com/TheRobotStudio/SO-ARM100) with LeRobot
|
||||
|
||||
|
||||
## A. Source the parts
|
||||
|
||||
Follow this [README](https://github.com/TheRobotStudio/SO-ARM100). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
|
||||
|
||||
**Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
|
||||
|
||||
## B. Install LeRobot
|
||||
|
||||
On your computer:
|
||||
|
||||
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||
```bash
|
||||
mkdir -p ~/miniconda3
|
||||
# Linux:
|
||||
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||
# Mac M-series:
|
||||
# curl https://repo.anaconda.com/miniconda/Miniconda3-latest-MacOSX-arm64.sh -o ~/miniconda3/miniconda.sh
|
||||
# Mac Intel:
|
||||
# curl https://repo.anaconda.com/miniconda/Miniconda3-latest-MacOSX-x86_64.sh -o ~/miniconda3/miniconda.sh
|
||||
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||
rm ~/miniconda3/miniconda.sh
|
||||
~/miniconda3/bin/conda init bash
|
||||
```
|
||||
|
||||
2. Restart shell or `source ~/.bashrc` (*Mac*: `source ~/.bash_profile`) or `source ~/.zshrc` if you're using zshell
|
||||
|
||||
3. Create and activate a fresh conda environment for lerobot
|
||||
```bash
|
||||
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||
```
|
||||
|
||||
4. Clone LeRobot:
|
||||
```bash
|
||||
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||
```
|
||||
|
||||
5. Install LeRobot with dependencies for the feetech motors:
|
||||
```bash
|
||||
cd ~/lerobot && pip install -e ".[feetech]"
|
||||
```
|
||||
|
||||
*For Linux only (not Mac)*: install extra dependencies for recording datasets:
|
||||
```bash
|
||||
conda install -y -c conda-forge ffmpeg
|
||||
pip uninstall -y opencv-python
|
||||
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||
```
|
||||
|
||||
## C. Configure the motors
|
||||
|
||||
### 1. Find the USB ports associated to each arm
|
||||
|
||||
Designate one bus servo adapter and 6 motors for your leader arm, and similarly the other bus servo adapter and 6 motors for the follower arm.
|
||||
|
||||
#### a. Run the script to find ports
|
||||
|
||||
Follow Step 1 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I), which illustrates the use of our scripts below.
|
||||
|
||||
To find the port for each bus servo adapter, run the utility script:
|
||||
```bash
|
||||
python lerobot/scripts/find_motors_bus_port.py
|
||||
```
|
||||
|
||||
#### b. Example outputs
|
||||
|
||||
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
||||
```
|
||||
Finding all available ports for the MotorBus.
|
||||
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||
|
||||
[...Disconnect leader arm and press Enter...]
|
||||
|
||||
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
|
||||
Reconnect the usb cable.
|
||||
```
|
||||
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
||||
```
|
||||
Finding all available ports for the MotorBus.
|
||||
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||
|
||||
[...Disconnect follower arm and press Enter...]
|
||||
|
||||
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
|
||||
Reconnect the usb cable.
|
||||
```
|
||||
|
||||
#### c. Troubleshooting
|
||||
On Linux, you might need to give access to the USB ports by running:
|
||||
```bash
|
||||
sudo chmod 666 /dev/ttyACM0
|
||||
sudo chmod 666 /dev/ttyACM1
|
||||
```
|
||||
|
||||
#### d. Update YAML file
|
||||
|
||||
Now that you have the ports, modify the *port* sections in `so100.yaml`
|
||||
|
||||
### 2. Configure the motors
|
||||
|
||||
#### a. Set IDs for all 12 motors
|
||||
Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
|
||||
```bash
|
||||
python lerobot/scripts/configure_motor.py \
|
||||
--port /dev/tty.usbmodem58760432961 \
|
||||
--brand feetech \
|
||||
--model sts3215 \
|
||||
--baudrate 1000000 \
|
||||
--ID 1
|
||||
```
|
||||
|
||||
*Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).*
|
||||
|
||||
Then unplug your motor and plug the second motor and set its ID to 2.
|
||||
```bash
|
||||
python lerobot/scripts/configure_motor.py \
|
||||
--port /dev/tty.usbmodem58760432961 \
|
||||
--brand feetech \
|
||||
--model sts3215 \
|
||||
--baudrate 1000000 \
|
||||
--ID 2
|
||||
```
|
||||
|
||||
Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
|
||||
|
||||
|
||||
#### b. Remove the gears of the 6 leader motors
|
||||
|
||||
Follow step 2 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=248). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
|
||||
|
||||
#### c. Add motor horn to all 12 motors
|
||||
Follow step 3 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=569). For SO-100, you need to align the holes on the motor horn to the motor spline to be approximately 1:30, 4:30, 7:30 and 10:30.
|
||||
Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
|
||||
|
||||
## D. Assemble the arms
|
||||
|
||||
Follow step 4 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=610). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
|
||||
|
||||
## E. Calibrate
|
||||
|
||||
Next, you'll need to calibrate your SO-100 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one SO-100 robot to work on another.
|
||||
|
||||
#### a. Manual calibration of follower arm
|
||||
/!\ Contrarily to step 6 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=724) which illustrates the auto calibration, we will actually do manual calibration of follower for now.
|
||||
|
||||
You will need to move the follower arm to these positions sequentially:
|
||||
|
||||
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||
|---|---|---|
|
||||
| <img src="../media/so100/follower_zero.webp?raw=true" alt="SO-100 follower arm zero position" title="SO-100 follower arm zero position" style="width:100%;"> | <img src="../media/so100/follower_rotated.webp?raw=true" alt="SO-100 follower arm rotated position" title="SO-100 follower arm rotated position" style="width:100%;"> | <img src="../media/so100/follower_rest.webp?raw=true" alt="SO-100 follower arm rest position" title="SO-100 follower arm rest position" style="width:100%;"> |
|
||||
|
||||
Make sure both arms are connected and run this script to launch manual calibration:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py calibrate \
|
||||
--robot-path lerobot/configs/robot/so100.yaml \
|
||||
--robot-overrides '~cameras' --arms main_follower
|
||||
```
|
||||
|
||||
#### b. Manual calibration of leader arm
|
||||
Follow step 6 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=724) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
|
||||
|
||||
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||
|---|---|---|
|
||||
| <img src="../media/so100/leader_zero.webp?raw=true" alt="SO-100 leader arm zero position" title="SO-100 leader arm zero position" style="width:100%;"> | <img src="../media/so100/leader_rotated.webp?raw=true" alt="SO-100 leader arm rotated position" title="SO-100 leader arm rotated position" style="width:100%;"> | <img src="../media/so100/leader_rest.webp?raw=true" alt="SO-100 leader arm rest position" title="SO-100 leader arm rest position" style="width:100%;"> |
|
||||
|
||||
Run this script to launch manual calibration:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py calibrate \
|
||||
--robot-path lerobot/configs/robot/so100.yaml \
|
||||
--robot-overrides '~cameras' --arms main_leader
|
||||
```
|
||||
|
||||
## F. Teleoperate
|
||||
|
||||
**Simple teleop**
|
||||
Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py teleoperate \
|
||||
--robot-path lerobot/configs/robot/so100.yaml \
|
||||
--robot-overrides '~cameras' \
|
||||
--display-cameras 0
|
||||
```
|
||||
|
||||
|
||||
#### a. Teleop with displaying cameras
|
||||
Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py teleoperate \
|
||||
--robot-path lerobot/configs/robot/so100.yaml
|
||||
```
|
||||
|
||||
## G. Record a dataset
|
||||
|
||||
Once you're familiar with teleoperation, you can record your first dataset with SO-100.
|
||||
|
||||
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||
```bash
|
||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||
```
|
||||
|
||||
Store your Hugging Face repository name in a variable to run these commands:
|
||||
```bash
|
||||
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||
echo $HF_USER
|
||||
```
|
||||
|
||||
Record 2 episodes and upload your dataset to the hub:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py record \
|
||||
--robot-path lerobot/configs/robot/so100.yaml \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/so100_test \
|
||||
--tags so100 tutorial \
|
||||
--warmup-time-s 5 \
|
||||
--episode-time-s 40 \
|
||||
--reset-time-s 10 \
|
||||
--num-episodes 2 \
|
||||
--push-to-hub 1
|
||||
```
|
||||
|
||||
## H. Visualize a dataset
|
||||
|
||||
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||
```bash
|
||||
echo ${HF_USER}/so100_test
|
||||
```
|
||||
|
||||
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||
```bash
|
||||
python lerobot/scripts/visualize_dataset_html.py \
|
||||
--repo-id ${HF_USER}/so100_test
|
||||
```
|
||||
|
||||
## I. Replay an episode
|
||||
|
||||
Now try to replay the first episode on your robot:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py replay \
|
||||
--robot-path lerobot/configs/robot/so100.yaml \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/so100_test \
|
||||
--episode 0
|
||||
```
|
||||
|
||||
## J. Train a policy
|
||||
|
||||
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||
```bash
|
||||
python lerobot/scripts/train.py \
|
||||
dataset_repo_id=${HF_USER}/so100_test \
|
||||
policy=act_so100_real \
|
||||
env=so100_real \
|
||||
hydra.run.dir=outputs/train/act_so100_test \
|
||||
hydra.job.name=act_so100_test \
|
||||
device=cuda \
|
||||
wandb.enable=true
|
||||
```
|
||||
|
||||
Let's explain it:
|
||||
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/so100_test`.
|
||||
2. We provided the policy with `policy=act_so100_real`. This loads configurations from [`lerobot/configs/policy/act_so100_real.yaml`](../lerobot/configs/policy/act_so100_real.yaml). Importantly, this policy uses 2 cameras as input `laptop`, `phone`.
|
||||
3. We provided an environment as argument with `env=so100_real`. This loads configurations from [`lerobot/configs/env/so100_real.yaml`](../lerobot/configs/env/so100_real.yaml).
|
||||
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
|
||||
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||
|
||||
Training should take several hours. You will find checkpoints in `outputs/train/act_so100_test/checkpoints`.
|
||||
|
||||
## K. Evaluate your policy
|
||||
|
||||
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py record \
|
||||
--robot-path lerobot/configs/robot/so100.yaml \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/eval_act_so100_test \
|
||||
--tags so100 tutorial eval \
|
||||
--warmup-time-s 5 \
|
||||
--episode-time-s 40 \
|
||||
--reset-time-s 10 \
|
||||
--num-episodes 10 \
|
||||
-p outputs/train/act_so100_test/checkpoints/last/pretrained_model
|
||||
```
|
||||
|
||||
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_so100_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_so100_test`).
|
||||
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_so100_test`).
|
||||
|
||||
## L. More Information
|
||||
|
||||
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
|
||||
|
||||
If you have any question or need help, please reach out on Discord in the channel [`#so100-arm`](https://discord.com/channels/1216765309076115607/1237741463832363039).
|
||||
275
examples/11_use_moss.md
Normal file
275
examples/11_use_moss.md
Normal file
@@ -0,0 +1,275 @@
|
||||
This tutorial explains how to use [Moss v1](https://github.com/jess-moss/moss-robot-arms) with LeRobot.
|
||||
|
||||
## Source the parts
|
||||
|
||||
Follow this [README](https://github.com/jess-moss/moss-robot-arms). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
|
||||
|
||||
**Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
|
||||
|
||||
## Install LeRobot
|
||||
|
||||
On your computer:
|
||||
|
||||
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||
```bash
|
||||
mkdir -p ~/miniconda3
|
||||
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||
rm ~/miniconda3/miniconda.sh
|
||||
~/miniconda3/bin/conda init bash
|
||||
```
|
||||
|
||||
2. Restart shell or `source ~/.bashrc`
|
||||
|
||||
3. Create and activate a fresh conda environment for lerobot
|
||||
```bash
|
||||
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||
```
|
||||
|
||||
4. Clone LeRobot:
|
||||
```bash
|
||||
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||
```
|
||||
|
||||
5. Install LeRobot with dependencies for the feetech motors:
|
||||
```bash
|
||||
cd ~/lerobot && pip install -e ".[feetech]"
|
||||
```
|
||||
|
||||
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||
```bash
|
||||
conda install -y -c conda-forge ffmpeg
|
||||
pip uninstall -y opencv-python
|
||||
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||
```
|
||||
|
||||
## Configure the motors
|
||||
|
||||
Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the use of our scripts below.
|
||||
|
||||
**Find USB ports associated to your arms**
|
||||
To find the correct ports for each arm, run the utility script twice:
|
||||
```bash
|
||||
python lerobot/scripts/find_motors_bus_port.py
|
||||
```
|
||||
|
||||
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
||||
```
|
||||
Finding all available ports for the MotorBus.
|
||||
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||
|
||||
[...Disconnect leader arm and press Enter...]
|
||||
|
||||
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
|
||||
Reconnect the usb cable.
|
||||
```
|
||||
|
||||
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
||||
```
|
||||
Finding all available ports for the MotorBus.
|
||||
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||
|
||||
[...Disconnect follower arm and press Enter...]
|
||||
|
||||
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
|
||||
Reconnect the usb cable.
|
||||
```
|
||||
|
||||
Troubleshooting: On Linux, you might need to give access to the USB ports by running:
|
||||
```bash
|
||||
sudo chmod 666 /dev/ttyACM0
|
||||
sudo chmod 666 /dev/ttyACM1
|
||||
```
|
||||
|
||||
**Configure your motors**
|
||||
Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
|
||||
```bash
|
||||
python lerobot/scripts/configure_motor.py \
|
||||
--port /dev/tty.usbmodem58760432961 \
|
||||
--brand feetech \
|
||||
--model sts3215 \
|
||||
--baudrate 1000000 \
|
||||
--ID 1
|
||||
```
|
||||
|
||||
Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).
|
||||
|
||||
Then unplug your motor and plug the second motor and set its ID to 2.
|
||||
```bash
|
||||
python lerobot/scripts/configure_motor.py \
|
||||
--port /dev/tty.usbmodem58760432961 \
|
||||
--brand feetech \
|
||||
--model sts3215 \
|
||||
--baudrate 1000000 \
|
||||
--ID 2
|
||||
```
|
||||
|
||||
Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
|
||||
|
||||
**Remove the gears of the 6 leader motors**
|
||||
Follow step 2 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
|
||||
|
||||
**Add motor horn to the motors**
|
||||
Follow step 3 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). For Moss v1, you need to align the holes on the motor horn to the motor spline to be approximately 3, 6, 9 and 12 o'clock.
|
||||
Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
|
||||
|
||||
## Assemble the arms
|
||||
|
||||
Follow step 4 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
|
||||
|
||||
## Calibrate
|
||||
|
||||
Next, you'll need to calibrate your Moss v1 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one Moss v1 robot to work on another.
|
||||
|
||||
**Manual calibration of follower arm**
|
||||
/!\ Contrarily to step 6 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the auto calibration, we will actually do manual calibration of follower for now.
|
||||
|
||||
You will need to move the follower arm to these positions sequentially:
|
||||
|
||||
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||
|---|---|---|
|
||||
| <img src="../media/moss/follower_zero.webp?raw=true" alt="Moss v1 follower arm zero position" title="Moss v1 follower arm zero position" style="width:100%;"> | <img src="../media/moss/follower_rotated.webp?raw=true" alt="Moss v1 follower arm rotated position" title="Moss v1 follower arm rotated position" style="width:100%;"> | <img src="../media/moss/follower_rest.webp?raw=true" alt="Moss v1 follower arm rest position" title="Moss v1 follower arm rest position" style="width:100%;"> |
|
||||
|
||||
Make sure both arms are connected and run this script to launch manual calibration:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py calibrate \
|
||||
--robot-path lerobot/configs/robot/moss.yaml \
|
||||
--robot-overrides '~cameras' --arms main_follower
|
||||
```
|
||||
|
||||
**Manual calibration of leader arm**
|
||||
Follow step 6 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
|
||||
|
||||
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||
|---|---|---|
|
||||
| <img src="../media/moss/leader_zero.webp?raw=true" alt="Moss v1 leader arm zero position" title="Moss v1 leader arm zero position" style="width:100%;"> | <img src="../media/moss/leader_rotated.webp?raw=true" alt="Moss v1 leader arm rotated position" title="Moss v1 leader arm rotated position" style="width:100%;"> | <img src="../media/moss/leader_rest.webp?raw=true" alt="Moss v1 leader arm rest position" title="Moss v1 leader arm rest position" style="width:100%;"> |
|
||||
|
||||
Run this script to launch manual calibration:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py calibrate \
|
||||
--robot-path lerobot/configs/robot/moss.yaml \
|
||||
--robot-overrides '~cameras' --arms main_leader
|
||||
```
|
||||
|
||||
## Teleoperate
|
||||
|
||||
**Simple teleop**
|
||||
Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py teleoperate \
|
||||
--robot-path lerobot/configs/robot/moss.yaml \
|
||||
--robot-overrides '~cameras' \
|
||||
--display-cameras 0
|
||||
```
|
||||
|
||||
|
||||
**Teleop with displaying cameras**
|
||||
Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py teleoperate \
|
||||
--robot-path lerobot/configs/robot/moss.yaml
|
||||
```
|
||||
|
||||
## Record a dataset
|
||||
|
||||
Once you're familiar with teleoperation, you can record your first dataset with Moss v1.
|
||||
|
||||
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||
```bash
|
||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||
```
|
||||
|
||||
Store your Hugging Face repository name in a variable to run these commands:
|
||||
```bash
|
||||
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||
echo $HF_USER
|
||||
```
|
||||
|
||||
Record 2 episodes and upload your dataset to the hub:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py record \
|
||||
--robot-path lerobot/configs/robot/moss.yaml \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/moss_test \
|
||||
--tags moss tutorial \
|
||||
--warmup-time-s 5 \
|
||||
--episode-time-s 40 \
|
||||
--reset-time-s 10 \
|
||||
--num-episodes 2 \
|
||||
--push-to-hub 1
|
||||
```
|
||||
|
||||
## Visualize a dataset
|
||||
|
||||
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||
```bash
|
||||
echo ${HF_USER}/moss_test
|
||||
```
|
||||
|
||||
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||
```bash
|
||||
python lerobot/scripts/visualize_dataset_html.py \
|
||||
--repo-id ${HF_USER}/moss_test
|
||||
```
|
||||
|
||||
## Replay an episode
|
||||
|
||||
Now try to replay the first episode on your robot:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py replay \
|
||||
--robot-path lerobot/configs/robot/moss.yaml \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/moss_test \
|
||||
--episode 0
|
||||
```
|
||||
|
||||
## Train a policy
|
||||
|
||||
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||
```bash
|
||||
python lerobot/scripts/train.py \
|
||||
dataset_repo_id=${HF_USER}/moss_test \
|
||||
policy=act_moss_real \
|
||||
env=moss_real \
|
||||
hydra.run.dir=outputs/train/act_moss_test \
|
||||
hydra.job.name=act_moss_test \
|
||||
device=cuda \
|
||||
wandb.enable=true
|
||||
```
|
||||
|
||||
Let's explain it:
|
||||
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/moss_test`.
|
||||
2. We provided the policy with `policy=act_moss_real`. This loads configurations from [`lerobot/configs/policy/act_moss_real.yaml`](../lerobot/configs/policy/act_moss_real.yaml). Importantly, this policy uses 2 cameras as input `laptop`, `phone`.
|
||||
3. We provided an environment as argument with `env=moss_real`. This loads configurations from [`lerobot/configs/env/moss_real.yaml`](../lerobot/configs/env/moss_real.yaml).
|
||||
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
|
||||
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||
|
||||
Training should take several hours. You will find checkpoints in `outputs/train/act_moss_test/checkpoints`.
|
||||
|
||||
## Evaluate your policy
|
||||
|
||||
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py record \
|
||||
--robot-path lerobot/configs/robot/moss.yaml \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/eval_act_moss_test \
|
||||
--tags moss tutorial eval \
|
||||
--warmup-time-s 5 \
|
||||
--episode-time-s 40 \
|
||||
--reset-time-s 10 \
|
||||
--num-episodes 10 \
|
||||
-p outputs/train/act_moss_test/checkpoints/last/pretrained_model
|
||||
```
|
||||
|
||||
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_moss_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_moss_test`).
|
||||
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_moss_test`).
|
||||
|
||||
## More
|
||||
|
||||
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
|
||||
|
||||
If you have any question or need help, please reach out on Discord in the channel [`#moss-arm`](https://discord.com/channels/1216765309076115607/1275374638985252925).
|
||||
94
examples/12_train_hilserl_classifier.md
Normal file
94
examples/12_train_hilserl_classifier.md
Normal file
@@ -0,0 +1,94 @@
|
||||
# Training a HIL-SERL Reward Classifier with LeRobot
|
||||
|
||||
This tutorial provides step-by-step instructions for training a reward classifier using LeRobot.
|
||||
|
||||
---
|
||||
|
||||
## Training Script Overview
|
||||
|
||||
LeRobot includes a ready-to-use training script located at [`lerobot/scripts/train_hilserl_classifier.py`](../../lerobot/scripts/train_hilserl_classifier.py). Here's an outline of its workflow:
|
||||
|
||||
1. **Configuration Loading**
|
||||
The script uses Hydra to load a configuration file for subsequent steps. (Details on Hydra follow below.)
|
||||
|
||||
2. **Dataset Initialization**
|
||||
It loads a `LeRobotDataset` containing images and rewards. To optimize performance, a weighted random sampler is used to balance class sampling.
|
||||
|
||||
3. **Classifier Initialization**
|
||||
A lightweight classification head is built on top of a frozen, pretrained image encoder from HuggingFace. The classifier outputs either:
|
||||
- A single probability (binary classification), or
|
||||
- Logits (multi-class classification).
|
||||
|
||||
4. **Training Loop Execution**
|
||||
The script performs:
|
||||
- Forward and backward passes,
|
||||
- Optimization steps,
|
||||
- Periodic logging, evaluation, and checkpoint saving.
|
||||
|
||||
---
|
||||
|
||||
## Configuring with Hydra
|
||||
|
||||
For detailed information about Hydra usage, refer to [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md). However, note that training the reward classifier differs slightly and requires a separate configuration file.
|
||||
|
||||
### Config File Setup
|
||||
|
||||
The default `default.yaml` cannot launch the reward classifier training directly. Instead, you need a configuration file like [`lerobot/configs/policy/hilserl_classifier.yaml`](../../lerobot/configs/policy/hilserl_classifier.yaml), with the following adjustment:
|
||||
|
||||
Replace the `dataset_repo_id` field with the identifier for your dataset, which contains images and sparse rewards:
|
||||
|
||||
```yaml
|
||||
# Example: lerobot/configs/policy/reward_classifier.yaml
|
||||
dataset_repo_id: "my_dataset_repo_id"
|
||||
## Typical logs and metrics
|
||||
```
|
||||
When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
|
||||
|
||||
After that, you will see training log like this one:
|
||||
|
||||
```
|
||||
[2024-11-29 18:26:36,999][root][INFO] -
|
||||
Epoch 5/5
|
||||
Training: 82%|██████████████████████████████████████████████████████████████████████████████▋ | 91/111 [00:50<00:09, 2.04it/s, loss=0.2999, acc=69.99%]
|
||||
```
|
||||
|
||||
or evaluation log like:
|
||||
|
||||
```
|
||||
Validation: 100%|████████████████████████████████████████████████████████████████████████████████████████████████████████████████████████| 28/28 [00:20<00:00, 1.37it/s]
|
||||
```
|
||||
|
||||
### Metrics Tracking with Weights & Biases (WandB)
|
||||
|
||||
If `wandb.enable` is set to `true`, the training and evaluation logs will also be saved in WandB. This allows you to track key metrics in real-time, including:
|
||||
|
||||
- **Training Metrics**:
|
||||
- `train/accuracy`
|
||||
- `train/loss`
|
||||
- `train/dataloading_s`
|
||||
- **Evaluation Metrics**:
|
||||
- `eval/accuracy`
|
||||
- `eval/loss`
|
||||
- `eval/eval_s`
|
||||
|
||||
#### Additional Features
|
||||
|
||||
You can also log sample predictions during evaluation. Each logged sample will include:
|
||||
|
||||
- The **input image**.
|
||||
- The **predicted label**.
|
||||
- The **true label**.
|
||||
- The **classifier's "confidence" (logits/probability)**.
|
||||
|
||||
These logs can be useful for diagnosing and debugging performance issues.
|
||||
|
||||
|
||||
#### Generate protobuf files
|
||||
|
||||
```bash
|
||||
python -m grpc_tools.protoc \
|
||||
-I lerobot/scripts/server \
|
||||
--python_out=lerobot/scripts/server \
|
||||
--grpc_python_out=lerobot/scripts/server \
|
||||
lerobot/scripts/server/hilserl.proto
|
||||
```
|
||||
@@ -3,78 +3,128 @@ This script demonstrates the use of `LeRobotDataset` class for handling and proc
|
||||
It illustrates how to load datasets, manipulate them, and apply transformations suitable for machine learning tasks in PyTorch.
|
||||
|
||||
Features included in this script:
|
||||
- Loading a dataset and accessing its properties.
|
||||
- Filtering data by episode number.
|
||||
- Converting tensor data for visualization.
|
||||
- Saving video files from dataset frames.
|
||||
- Viewing a dataset's metadata and exploring its properties.
|
||||
- Loading an existing dataset from the hub or a subset of it.
|
||||
- Accessing frames by episode number.
|
||||
- Using advanced dataset features like timestamp-based frame selection.
|
||||
- Demonstrating compatibility with PyTorch DataLoader for batch processing.
|
||||
|
||||
The script ends with examples of how to batch process data using PyTorch's DataLoader.
|
||||
"""
|
||||
|
||||
from pathlib import Path
|
||||
from pprint import pprint
|
||||
|
||||
import imageio
|
||||
import torch
|
||||
from huggingface_hub import HfApi
|
||||
|
||||
import lerobot
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.lerobot_dataset import (
|
||||
LeRobotDataset,
|
||||
LeRobotDatasetMetadata,
|
||||
)
|
||||
|
||||
# We ported a number of existing datasets ourselves, use this to see the list:
|
||||
print("List of available datasets:")
|
||||
pprint(lerobot.available_datasets)
|
||||
|
||||
# Let's take one for this example
|
||||
repo_id = "lerobot/pusht"
|
||||
# You can also browse through the datasets created/ported by the community on the hub using the hub api:
|
||||
hub_api = HfApi()
|
||||
repo_ids = [
|
||||
info.id
|
||||
for info in hub_api.list_datasets(task_categories="robotics", tags=["LeRobot"])
|
||||
]
|
||||
pprint(repo_ids)
|
||||
|
||||
# You can easily load a dataset from a Hugging Face repository
|
||||
# Or simply explore them in your web browser directly at:
|
||||
# https://huggingface.co/datasets?other=LeRobot
|
||||
|
||||
# Let's take this one for this example
|
||||
repo_id = "lerobot/aloha_mobile_cabinet"
|
||||
# We can have a look and fetch its metadata to know more about it:
|
||||
ds_meta = LeRobotDatasetMetadata(repo_id)
|
||||
|
||||
# By instantiating just this class, you can quickly access useful information about the content and the
|
||||
# structure of the dataset without downloading the actual data yet (only metadata files — which are
|
||||
# lightweight).
|
||||
print(f"Total number of episodes: {ds_meta.total_episodes}")
|
||||
print(
|
||||
f"Average number of frames per episode: {ds_meta.total_frames / ds_meta.total_episodes:.3f}"
|
||||
)
|
||||
print(f"Frames per second used during data collection: {ds_meta.fps}")
|
||||
print(f"Robot type: {ds_meta.robot_type}")
|
||||
print(f"keys to access images from cameras: {ds_meta.camera_keys=}\n")
|
||||
|
||||
print("Tasks:")
|
||||
print(ds_meta.tasks)
|
||||
print("Features:")
|
||||
pprint(ds_meta.features)
|
||||
|
||||
# You can also get a short summary by simply printing the object:
|
||||
print(ds_meta)
|
||||
|
||||
# You can then load the actual dataset from the hub.
|
||||
# Either load any subset of episodes:
|
||||
dataset = LeRobotDataset(repo_id, episodes=[0, 10, 11, 23])
|
||||
|
||||
# And see how many frames you have:
|
||||
print(f"Selected episodes: {dataset.episodes}")
|
||||
print(f"Number of episodes selected: {dataset.num_episodes}")
|
||||
print(f"Number of frames selected: {dataset.num_frames}")
|
||||
|
||||
# Or simply load the entire dataset:
|
||||
dataset = LeRobotDataset(repo_id)
|
||||
print(f"Number of episodes selected: {dataset.num_episodes}")
|
||||
print(f"Number of frames selected: {dataset.num_frames}")
|
||||
|
||||
# LeRobotDataset is actually a thin wrapper around an underlying Hugging Face dataset
|
||||
# (see https://huggingface.co/docs/datasets/index for more information).
|
||||
print(dataset)
|
||||
# The previous metadata class is contained in the 'meta' attribute of the dataset:
|
||||
print(dataset.meta)
|
||||
|
||||
# LeRobotDataset actually wraps an underlying Hugging Face dataset
|
||||
# (see https://huggingface.co/docs/datasets for more information).
|
||||
print(dataset.hf_dataset)
|
||||
|
||||
# And provides additional utilities for robotics and compatibility with Pytorch
|
||||
print(f"\naverage number of frames per episode: {dataset.num_samples / dataset.num_episodes:.3f}")
|
||||
print(f"frames per second used during data collection: {dataset.fps=}")
|
||||
print(f"keys to access images from cameras: {dataset.camera_keys=}\n")
|
||||
|
||||
# Access frame indexes associated to first episode
|
||||
# LeRobot datasets also subclasses PyTorch datasets so you can do everything you know and love from working
|
||||
# with the latter, like iterating through the dataset.
|
||||
# The __getitem__ iterates over the frames of the dataset. Since our datasets are also structured by
|
||||
# episodes, you can access the frame indices of any episode using the episode_data_index. Here, we access
|
||||
# frame indices associated to the first episode:
|
||||
episode_index = 0
|
||||
from_idx = dataset.episode_data_index["from"][episode_index].item()
|
||||
to_idx = dataset.episode_data_index["to"][episode_index].item()
|
||||
|
||||
# LeRobot datasets actually subclass PyTorch datasets so you can do everything you know and love from working
|
||||
# with the latter, like iterating through the dataset. Here we grab all the image frames.
|
||||
frames = [dataset[idx]["observation.image"] for idx in range(from_idx, to_idx)]
|
||||
# Then we grab all the image frames from the first camera:
|
||||
camera_key = dataset.meta.camera_keys[0]
|
||||
frames = [dataset[idx][camera_key] for idx in range(from_idx, to_idx)]
|
||||
|
||||
# Video frames are now float32 in range [0,1] channel first (c,h,w) to follow pytorch convention. To visualize
|
||||
# them, we convert to uint8 in range [0,255]
|
||||
frames = [(frame * 255).type(torch.uint8) for frame in frames]
|
||||
# and to channel last (h,w,c).
|
||||
frames = [frame.permute((1, 2, 0)).numpy() for frame in frames]
|
||||
# The objects returned by the dataset are all torch.Tensors
|
||||
print(type(frames[0]))
|
||||
print(frames[0].shape)
|
||||
|
||||
# Finally, we save the frames to a mp4 video for visualization.
|
||||
Path("outputs/examples/1_load_lerobot_dataset").mkdir(parents=True, exist_ok=True)
|
||||
imageio.mimsave("outputs/examples/1_load_lerobot_dataset/episode_0.mp4", frames, fps=dataset.fps)
|
||||
# Since we're using pytorch, the shape is in pytorch, channel-first convention (c, h, w).
|
||||
# We can compare this shape with the information available for that feature
|
||||
pprint(dataset.features[camera_key])
|
||||
# In particular:
|
||||
print(dataset.features[camera_key]["shape"])
|
||||
# The shape is in (h, w, c) which is a more universal format.
|
||||
|
||||
# For many machine learning applications we need to load the history of past observations or trajectories of
|
||||
# future actions. Our datasets can load previous and future frames for each key/modality, using timestamps
|
||||
# differences with the current loaded frame. For instance:
|
||||
delta_timestamps = {
|
||||
# loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
|
||||
"observation.image": [-1, -0.5, -0.20, 0],
|
||||
# loads 8 state vectors: 1.5 seconds before, 1 second before, ... 20 ms, 10 ms, and current frame
|
||||
"observation.state": [-1.5, -1, -0.5, -0.20, -0.10, -0.02, -0.01, 0],
|
||||
camera_key: [-1, -0.5, -0.20, 0],
|
||||
# loads 8 state vectors: 1.5 seconds before, 1 second before, ... 200 ms, 100 ms, and current frame
|
||||
"observation.state": [-1.5, -1, -0.5, -0.20, -0.10, 0],
|
||||
# loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
|
||||
"action": [t / dataset.fps for t in range(64)],
|
||||
}
|
||||
# Note that in any case, these delta_timestamps values need to be multiples of (1/fps) so that added to any
|
||||
# timestamp, you still get a valid timestamp.
|
||||
|
||||
dataset = LeRobotDataset(repo_id, delta_timestamps=delta_timestamps)
|
||||
print(f"\n{dataset[0]['observation.image'].shape=}") # (4,c,h,w)
|
||||
print(f"{dataset[0]['observation.state'].shape=}") # (8,c)
|
||||
print(f"{dataset[0]['action'].shape=}\n") # (64,c)
|
||||
print(f"\n{dataset[0][camera_key].shape=}") # (4, c, h, w)
|
||||
print(f"{dataset[0]['observation.state'].shape=}") # (6, c)
|
||||
print(f"{dataset[0]['action'].shape=}\n") # (64, c)
|
||||
|
||||
# Finally, our datasets are fully compatible with PyTorch dataloaders and samplers because they are just
|
||||
# PyTorch datasets.
|
||||
@@ -84,8 +134,9 @@ dataloader = torch.utils.data.DataLoader(
|
||||
batch_size=32,
|
||||
shuffle=True,
|
||||
)
|
||||
|
||||
for batch in dataloader:
|
||||
print(f"{batch['observation.image'].shape=}") # (32,4,c,h,w)
|
||||
print(f"{batch['observation.state'].shape=}") # (32,8,c)
|
||||
print(f"{batch['action'].shape=}") # (32,64,c)
|
||||
print(f"{batch[camera_key].shape=}") # (32, 4, c, h, w)
|
||||
print(f"{batch['observation.state'].shape=}") # (32, 5, c)
|
||||
print(f"{batch['action'].shape=}") # (32, 64, c)
|
||||
break
|
||||
|
||||
@@ -18,8 +18,6 @@ from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||
output_directory = Path("outputs/eval/example_pusht_diffusion")
|
||||
output_directory.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
device = torch.device("cuda")
|
||||
|
||||
# Download the diffusion policy for pusht environment
|
||||
pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
|
||||
# OR uncomment the following to evaluate a policy from the local outputs/train folder.
|
||||
@@ -27,6 +25,19 @@ pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
|
||||
|
||||
policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
|
||||
policy.eval()
|
||||
|
||||
# Check if GPU is available
|
||||
if torch.cuda.is_available():
|
||||
device = torch.device("cuda")
|
||||
print("GPU is available. Device set to:", device)
|
||||
else:
|
||||
device = torch.device("cpu")
|
||||
print(
|
||||
f"GPU is not available. Device set to: {device}. Inference will be slower than on GPU."
|
||||
)
|
||||
# Decrease the number of reverse-diffusion steps (trades off a bit of quality for 10x speed)
|
||||
policy.diffusion.num_inference_steps = 10
|
||||
|
||||
policy.to(device)
|
||||
|
||||
# Initialize evaluation environment to render two observation types:
|
||||
|
||||
@@ -31,7 +31,24 @@ delta_timestamps = {
|
||||
# Load the previous action (-0.1), the next action to be executed (0.0),
|
||||
# and 14 future actions with a 0.1 seconds spacing. All these actions will be
|
||||
# used to supervise the policy.
|
||||
"action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
|
||||
"action": [
|
||||
-0.1,
|
||||
0.0,
|
||||
0.1,
|
||||
0.2,
|
||||
0.3,
|
||||
0.4,
|
||||
0.5,
|
||||
0.6,
|
||||
0.7,
|
||||
0.8,
|
||||
0.9,
|
||||
1.0,
|
||||
1.1,
|
||||
1.2,
|
||||
1.3,
|
||||
1.4,
|
||||
],
|
||||
}
|
||||
dataset = LeRobotDataset("lerobot/pusht", delta_timestamps=delta_timestamps)
|
||||
|
||||
@@ -40,7 +57,7 @@ dataset = LeRobotDataset("lerobot/pusht", delta_timestamps=delta_timestamps)
|
||||
# For this example, no arguments need to be passed because the defaults are set up for PushT.
|
||||
# If you're doing something different, you will likely need to change at least some of the defaults.
|
||||
cfg = DiffusionConfig()
|
||||
policy = DiffusionPolicy(cfg, dataset_stats=dataset.stats)
|
||||
policy = DiffusionPolicy(cfg, dataset_stats=dataset.meta.stats)
|
||||
policy.train()
|
||||
policy.to(device)
|
||||
|
||||
|
||||
@@ -46,7 +46,7 @@ defaults:
|
||||
- policy: diffusion
|
||||
```
|
||||
|
||||
This logic tells Hydra to incorporate configuration parameters from `env/pusht.yaml` and `policy/diffusion.yaml`. _Note: Be aware of the order as any configuration parameters with the same name will be overidden. Thus, `default.yaml` is overriden by `env/pusht.yaml` which is overidden by `policy/diffusion.yaml`_.
|
||||
This logic tells Hydra to incorporate configuration parameters from `env/pusht.yaml` and `policy/diffusion.yaml`. _Note: Be aware of the order as any configuration parameters with the same name will be overidden. Thus, `default.yaml` is overridden by `env/pusht.yaml` which is overidden by `policy/diffusion.yaml`_.
|
||||
|
||||
Then, `default.yaml` also contains common configuration parameters such as `device: cuda` or `use_amp: false` (for enabling fp16 training). Some other parameters are set to `???` which indicates that they are expected to be set in additional yaml files. For instance, `training.offline_steps: ???` in `default.yaml` is set to `200000` in `diffusion.yaml`.
|
||||
|
||||
@@ -170,6 +170,36 @@ python lerobot/scripts/train.py --config-dir outputs/train/my_experiment/checkpo
|
||||
|
||||
Note that you may still use the regular syntax for config parameter overrides (eg: by adding `training.offline_steps=200000`).
|
||||
|
||||
## Typical logs and metrics
|
||||
|
||||
When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
|
||||
|
||||
After that, you will see training log like this one:
|
||||
|
||||
```
|
||||
INFO 2024-08-14 13:35:12 ts/train.py:192 step:0 smpl:64 ep:1 epch:0.00 loss:1.112 grdn:15.387 lr:2.0e-07 updt_s:1.738 data_s:4.774
|
||||
```
|
||||
|
||||
or evaluation log like:
|
||||
|
||||
```
|
||||
INFO 2024-08-14 13:38:45 ts/train.py:226 step:100 smpl:6K ep:52 epch:0.25 ∑rwrd:20.693 success:0.0% eval_s:120.266
|
||||
```
|
||||
|
||||
These logs will also be saved in wandb if `wandb.enable` is set to `true`. Here are the meaning of some abbreviations:
|
||||
|
||||
- `smpl`: number of samples seen during training.
|
||||
- `ep`: number of episodes seen during training. An episode contains multiple samples in a complete manipulation task.
|
||||
- `epch`: number of time all unique samples are seen (epoch).
|
||||
- `grdn`: gradient norm.
|
||||
- `∑rwrd`: compute the sum of rewards in every evaluation episode and then take an average of them.
|
||||
- `success`: average success rate of eval episodes. Reward and success are usually different except for the sparsing reward setting, where reward=1 only when the task is completed successfully.
|
||||
- `eval_s`: time to evaluate the policy in the environment, in second.
|
||||
- `updt_s`: time to update the network parameters, in second.
|
||||
- `data_s`: time to load a batch of data, in second.
|
||||
|
||||
Some metrics are useful for initial performance profiling. For example, if you find the current GPU utilization is low via the `nvidia-smi` command and `data_s` sometimes is too high, you may need to modify batch size or number of dataloading workers to accelerate dataloading. We also recommend [pytorch profiler](https://github.com/huggingface/lerobot?tab=readme-ov-file#improve-your-code-with-profiling) for detailed performance probing.
|
||||
|
||||
---
|
||||
|
||||
So far we've seen how to train Diffusion Policy for PushT and ACT for ALOHA. Now, what if we want to train ACT for PushT? Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
||||
|
||||
57
examples/6_add_image_transforms.py
Normal file
57
examples/6_add_image_transforms.py
Normal file
@@ -0,0 +1,57 @@
|
||||
"""
|
||||
This script demonstrates how to use torchvision's image transformation with LeRobotDataset for data
|
||||
augmentation purposes. The transformations are passed to the dataset as an argument upon creation, and
|
||||
transforms are applied to the observation images before they are returned in the dataset's __getitem__.
|
||||
"""
|
||||
|
||||
from pathlib import Path
|
||||
|
||||
from torchvision.transforms import ToPILImage, v2
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
|
||||
dataset_repo_id = "lerobot/aloha_static_screw_driver"
|
||||
|
||||
# Create a LeRobotDataset with no transformations
|
||||
dataset = LeRobotDataset(dataset_repo_id, episodes=[0])
|
||||
# This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
|
||||
|
||||
# Get the index of the first observation in the first episode
|
||||
first_idx = dataset.episode_data_index["from"][0].item()
|
||||
|
||||
# Get the frame corresponding to the first camera
|
||||
frame = dataset[first_idx][dataset.meta.camera_keys[0]]
|
||||
|
||||
|
||||
# Define the transformations
|
||||
transforms = v2.Compose(
|
||||
[
|
||||
v2.ColorJitter(brightness=(0.5, 1.5)),
|
||||
v2.ColorJitter(contrast=(0.5, 1.5)),
|
||||
v2.ColorJitter(hue=(-0.1, 0.1)),
|
||||
v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
|
||||
]
|
||||
)
|
||||
|
||||
# Create another LeRobotDataset with the defined transformations
|
||||
transformed_dataset = LeRobotDataset(
|
||||
dataset_repo_id, episodes=[0], image_transforms=transforms
|
||||
)
|
||||
|
||||
# Get a frame from the transformed dataset
|
||||
transformed_frame = transformed_dataset[first_idx][
|
||||
transformed_dataset.meta.camera_keys[0]
|
||||
]
|
||||
|
||||
# Create a directory to store output images
|
||||
output_dir = Path("outputs/image_transforms")
|
||||
output_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
# Save the original frame
|
||||
to_pil = ToPILImage()
|
||||
to_pil(frame).save(output_dir / "original_frame.png", quality=100)
|
||||
print(f"Original frame saved to {output_dir / 'original_frame.png'}.")
|
||||
|
||||
# Save the transformed frame
|
||||
to_pil(transformed_frame).save(output_dir / "transformed_frame.png", quality=100)
|
||||
print(f"Transformed frame saved to {output_dir / 'transformed_frame.png'}.")
|
||||
1013
examples/7_get_started_with_real_robot.md
Normal file
1013
examples/7_get_started_with_real_robot.md
Normal file
File diff suppressed because it is too large
Load Diff
156
examples/8_use_stretch.md
Normal file
156
examples/8_use_stretch.md
Normal file
@@ -0,0 +1,156 @@
|
||||
This tutorial explains how to use [Stretch 3](https://hello-robot.com/stretch-3-product) with LeRobot.
|
||||
|
||||
## Setup
|
||||
|
||||
Familiarize yourself with Stretch by following its [tutorials](https://docs.hello-robot.com/0.3/getting_started/hello_robot/) (recommended).
|
||||
|
||||
To use LeRobot on Stretch, 3 options are available:
|
||||
- [tethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#tethered-setup)
|
||||
- [untethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#untethered-setup)
|
||||
- ssh directly into Stretch (you will first need to install and configure openssh-server on stretch using one of the two above setups)
|
||||
|
||||
|
||||
## Install LeRobot
|
||||
|
||||
On Stretch's CLI, follow these steps:
|
||||
|
||||
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||
```bash
|
||||
mkdir -p ~/miniconda3
|
||||
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||
rm ~/miniconda3/miniconda.sh
|
||||
~/miniconda3/bin/conda init bash
|
||||
```
|
||||
|
||||
2. Comment out these lines in `~/.profile` (this can mess up paths used by conda and ~/.local/bin should already be in your PATH)
|
||||
```
|
||||
# set PATH so it includes user's private bin if it exists
|
||||
if [ -d "$HOME/.local/bin" ] ; then
|
||||
PATH="$HOME/.local/bin:$PATH"
|
||||
fi
|
||||
```
|
||||
|
||||
3. Restart shell or `source ~/.bashrc`
|
||||
|
||||
4. Create and activate a fresh conda environment for lerobot
|
||||
```bash
|
||||
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||
```
|
||||
|
||||
5. Clone LeRobot:
|
||||
```bash
|
||||
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||
```
|
||||
|
||||
6. Install LeRobot with stretch dependencies:
|
||||
```bash
|
||||
cd ~/lerobot && pip install -e ".[stretch]"
|
||||
```
|
||||
|
||||
> **Note:** If you get this message, you can ignore it: `ERROR: pip's dependency resolver does not currently take into account all the packages that are installed.`
|
||||
|
||||
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||
```bash
|
||||
conda install -y -c conda-forge ffmpeg
|
||||
pip uninstall -y opencv-python
|
||||
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||
```
|
||||
|
||||
7. Run a [system check](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#system-check) to make sure your robot is ready:
|
||||
```bash
|
||||
stretch_system_check.py
|
||||
```
|
||||
|
||||
> **Note:** You may need to free the "robot process" after booting Stretch by running `stretch_free_robot_process.py`. For more info this Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#turning-off-gamepad-teleoperation).
|
||||
|
||||
You should get something like this:
|
||||
```bash
|
||||
For use with S T R E T C H (R) from Hello Robot Inc.
|
||||
---------------------------------------------------------------------
|
||||
|
||||
Model = Stretch 3
|
||||
Tool = DexWrist 3 w/ Gripper
|
||||
Serial Number = stretch-se3-3054
|
||||
|
||||
---- Checking Hardware ----
|
||||
[Pass] Comms are ready
|
||||
[Pass] Actuators are ready
|
||||
[Warn] Sensors not ready (IMU AZ = -10.19 out of range -10.1 to -9.5)
|
||||
[Pass] Battery voltage is 13.6 V
|
||||
|
||||
---- Checking Software ----
|
||||
[Pass] Ubuntu 22.04 is ready
|
||||
[Pass] All APT pkgs are setup correctly
|
||||
[Pass] Firmware is up-to-date
|
||||
[Pass] Python pkgs are up-to-date
|
||||
[Pass] ROS2 Humble is ready
|
||||
```
|
||||
|
||||
## Teleoperate, record a dataset and run a policy
|
||||
|
||||
**Calibrate (Optional)**
|
||||
Before operating Stretch, you need to [home](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#homing) it first. Be mindful about giving Stretch some space as this procedure will move the robot's arm and gripper. Now run this command:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py calibrate \
|
||||
--robot-path lerobot/configs/robot/stretch.yaml
|
||||
```
|
||||
This is equivalent to running `stretch_robot_home.py`
|
||||
|
||||
> **Note:** If you run any of the LeRobot scripts below and Stretch is not poperly homed, it will automatically home/calibrate first.
|
||||
|
||||
**Teleoperate**
|
||||
Before trying teleoperation, you need activate the gamepad controller by pressing the middle button. For more info, see Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/hello_robot/#gamepad-teleoperation).
|
||||
|
||||
Now try out teleoperation (see above documentation to learn about the gamepad controls):
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py teleoperate \
|
||||
--robot-path lerobot/configs/robot/stretch.yaml
|
||||
```
|
||||
This is essentially the same as running `stretch_gamepad_teleop.py`
|
||||
|
||||
**Record a dataset**
|
||||
Once you're familiar with the gamepad controls and after a bit of practice, you can try to record your first dataset with Stretch.
|
||||
|
||||
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||
```bash
|
||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||
```
|
||||
|
||||
Store your Hugging Face repository name in a variable to run these commands:
|
||||
```bash
|
||||
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||
echo $HF_USER
|
||||
```
|
||||
|
||||
Record one episode:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py record \
|
||||
--robot-path lerobot/configs/robot/stretch.yaml \
|
||||
--fps 20 \
|
||||
--repo-id ${HF_USER}/stretch_test \
|
||||
--tags stretch tutorial \
|
||||
--warmup-time-s 3 \
|
||||
--episode-time-s 40 \
|
||||
--reset-time-s 10 \
|
||||
--num-episodes 1 \
|
||||
--push-to-hub 0
|
||||
```
|
||||
|
||||
> **Note:** If you're using ssh to connect to Stretch and run this script, you won't be able to visualize its cameras feed (though they will still be recording). To see the cameras stream, use [tethered](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#tethered-setup) or [untethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#untethered-setup).
|
||||
|
||||
**Replay an episode**
|
||||
Now try to replay this episode (make sure the robot's initial position is the same):
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py replay \
|
||||
--robot-path lerobot/configs/robot/stretch.yaml \
|
||||
--fps 20 \
|
||||
--repo-id ${HF_USER}/stretch_test \
|
||||
--episode 0
|
||||
```
|
||||
|
||||
Follow [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) to train a policy on your data and run inference on your robot. You will need to adapt the code for Stretch.
|
||||
|
||||
> TODO(rcadene, aliberts): Add already setup environment and policy yaml configuration files
|
||||
|
||||
If you need help, please reach out on Discord in the channel `#stretch3-mobile-arm`.
|
||||
174
examples/9_use_aloha.md
Normal file
174
examples/9_use_aloha.md
Normal file
@@ -0,0 +1,174 @@
|
||||
This tutorial explains how to use [Aloha and Aloha 2 stationary](https://www.trossenrobotics.com/aloha-stationary) with LeRobot.
|
||||
|
||||
## Setup
|
||||
|
||||
Follow the [documentation from Trossen Robotics](https://docs.trossenrobotics.com/aloha_docs/getting_started/stationary/hardware_setup.html) for setting up the hardware and plugging the 4 arms and 4 cameras to your computer.
|
||||
|
||||
|
||||
## Install LeRobot
|
||||
|
||||
On your computer:
|
||||
|
||||
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||
```bash
|
||||
mkdir -p ~/miniconda3
|
||||
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||
rm ~/miniconda3/miniconda.sh
|
||||
~/miniconda3/bin/conda init bash
|
||||
```
|
||||
|
||||
2. Restart shell or `source ~/.bashrc`
|
||||
|
||||
3. Create and activate a fresh conda environment for lerobot
|
||||
```bash
|
||||
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||
```
|
||||
|
||||
4. Clone LeRobot:
|
||||
```bash
|
||||
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||
```
|
||||
|
||||
5. Install LeRobot with dependencies for the Aloha motors (dynamixel) and cameras (intelrealsense):
|
||||
```bash
|
||||
cd ~/lerobot && pip install -e ".[dynamixel, intelrealsense]"
|
||||
```
|
||||
|
||||
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||
```bash
|
||||
conda install -y -c conda-forge ffmpeg
|
||||
pip uninstall -y opencv-python
|
||||
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||
```
|
||||
|
||||
## Teleoperate
|
||||
|
||||
**/!\ FOR SAFETY, READ THIS /!\**
|
||||
Teleoperation consists in manually operating the leader arms to move the follower arms. Importantly:
|
||||
1. Make sure your leader arms are in the same position as the follower arms, so that the follower arms don't move too fast to match the leader arms,
|
||||
2. Our code assumes that your robot has been assembled following Trossen Robotics instructions. This allows us to skip calibration, as we use the pre-defined calibration files in `.cache/calibration/aloha_default`. If you replace a motor, make sure you follow the exact instructions from Trossen Robotics.
|
||||
|
||||
By running the following code, you can start your first **SAFE** teleoperation:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py teleoperate \
|
||||
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||
--robot-overrides max_relative_target=5
|
||||
```
|
||||
|
||||
By adding `--robot-overrides max_relative_target=5`, we override the default value for `max_relative_target` defined in `lerobot/configs/robot/aloha.yaml`. It is expected to be `5` to limit the magnitude of the movement for more safety, but the teleoperation won't be smooth. When you feel confident, you can disable this limit by adding `--robot-overrides max_relative_target=null` to the command line:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py teleoperate \
|
||||
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||
--robot-overrides max_relative_target=null
|
||||
```
|
||||
|
||||
## Record a dataset
|
||||
|
||||
Once you're familiar with teleoperation, you can record your first dataset with Aloha.
|
||||
|
||||
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||
```bash
|
||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||
```
|
||||
|
||||
Store your Hugging Face repository name in a variable to run these commands:
|
||||
```bash
|
||||
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||
echo $HF_USER
|
||||
```
|
||||
|
||||
Record 2 episodes and upload your dataset to the hub:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py record \
|
||||
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||
--robot-overrides max_relative_target=null \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/aloha_test \
|
||||
--tags aloha tutorial \
|
||||
--warmup-time-s 5 \
|
||||
--episode-time-s 40 \
|
||||
--reset-time-s 10 \
|
||||
--num-episodes 2 \
|
||||
--push-to-hub 1
|
||||
```
|
||||
|
||||
## Visualize a dataset
|
||||
|
||||
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||
```bash
|
||||
echo ${HF_USER}/aloha_test
|
||||
```
|
||||
|
||||
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||
```bash
|
||||
python lerobot/scripts/visualize_dataset_html.py \
|
||||
--repo-id ${HF_USER}/aloha_test
|
||||
```
|
||||
|
||||
## Replay an episode
|
||||
|
||||
**/!\ FOR SAFETY, READ THIS /!\**
|
||||
Replay consists in automatically replaying the sequence of actions (i.e. goal positions for your motors) recorded in a given dataset episode. Make sure the current initial position of your robot is similar to the one in your episode, so that your follower arms don't move too fast to go to the first goal positions. For safety, you might want to add `--robot-overrides max_relative_target=5` to your command line as explained above.
|
||||
|
||||
Now try to replay the first episode on your robot:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py replay \
|
||||
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||
--robot-overrides max_relative_target=null \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/aloha_test \
|
||||
--episode 0
|
||||
```
|
||||
|
||||
## Train a policy
|
||||
|
||||
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||
```bash
|
||||
python lerobot/scripts/train.py \
|
||||
dataset_repo_id=${HF_USER}/aloha_test \
|
||||
policy=act_aloha_real \
|
||||
env=aloha_real \
|
||||
hydra.run.dir=outputs/train/act_aloha_test \
|
||||
hydra.job.name=act_aloha_test \
|
||||
device=cuda \
|
||||
wandb.enable=true
|
||||
```
|
||||
|
||||
Let's explain it:
|
||||
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/aloha_test`.
|
||||
2. We provided the policy with `policy=act_aloha_real`. This loads configurations from [`lerobot/configs/policy/act_aloha_real.yaml`](../lerobot/configs/policy/act_aloha_real.yaml). Importantly, this policy uses 4 cameras as input `cam_right_wrist`, `cam_left_wrist`, `cam_high`, and `cam_low`.
|
||||
3. We provided an environment as argument with `env=aloha_real`. This loads configurations from [`lerobot/configs/env/aloha_real.yaml`](../lerobot/configs/env/aloha_real.yaml). Note: this yaml defines 18 dimensions for the `state_dim` and `action_dim`, corresponding to 18 motors, not 14 motors as used in previous Aloha work. This is because, we include the `shoulder_shadow` and `elbow_shadow` motors for simplicity.
|
||||
4. We provided `device=cuda` since we are training on a Nvidia GPU.
|
||||
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||
|
||||
Training should take several hours. You will find checkpoints in `outputs/train/act_aloha_test/checkpoints`.
|
||||
|
||||
## Evaluate your policy
|
||||
|
||||
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||
```bash
|
||||
python lerobot/scripts/control_robot.py record \
|
||||
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||
--robot-overrides max_relative_target=null \
|
||||
--fps 30 \
|
||||
--repo-id ${HF_USER}/eval_act_aloha_test \
|
||||
--tags aloha tutorial eval \
|
||||
--warmup-time-s 5 \
|
||||
--episode-time-s 40 \
|
||||
--reset-time-s 10 \
|
||||
--num-episodes 10 \
|
||||
--num-image-writer-processes 1 \
|
||||
-p outputs/train/act_aloha_test/checkpoints/last/pretrained_model
|
||||
```
|
||||
|
||||
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_aloha_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_aloha_test`).
|
||||
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_aloha_test`).
|
||||
3. We use `--num-image-writer-processes 1` instead of the default value (`0`). On our computer, using a dedicated process to write images from the 4 cameras on disk allows to reach constent 30 fps during inference. Feel free to explore different values for `--num-image-writer-processes`.
|
||||
|
||||
## More
|
||||
|
||||
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth explaination.
|
||||
|
||||
If you have any question or need help, please reach out on Discord in the channel `#aloha-arm`.
|
||||
@@ -80,7 +80,7 @@ policy:
|
||||
n_vae_encoder_layers: 4
|
||||
|
||||
# Inference.
|
||||
temporal_ensemble_momentum: null
|
||||
temporal_ensemble_coeff: null
|
||||
|
||||
# Training and loss computation.
|
||||
dropout: 0.1
|
||||
|
||||
@@ -14,7 +14,10 @@ from pathlib import Path
|
||||
import torch
|
||||
from huggingface_hub import snapshot_download
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.lerobot_dataset import (
|
||||
LeRobotDataset,
|
||||
LeRobotDatasetMetadata,
|
||||
)
|
||||
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||
|
||||
device = torch.device("cuda")
|
||||
@@ -37,29 +40,44 @@ delta_timestamps = {
|
||||
# Load the previous action (-0.1), the next action to be executed (0.0),
|
||||
# and 14 future actions with a 0.1 seconds spacing. All these actions will be
|
||||
# used to calculate the loss.
|
||||
"action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
|
||||
"action": [
|
||||
-0.1,
|
||||
0.0,
|
||||
0.1,
|
||||
0.2,
|
||||
0.3,
|
||||
0.4,
|
||||
0.5,
|
||||
0.6,
|
||||
0.7,
|
||||
0.8,
|
||||
0.9,
|
||||
1.0,
|
||||
1.1,
|
||||
1.2,
|
||||
1.3,
|
||||
1.4,
|
||||
],
|
||||
}
|
||||
|
||||
# Load the last 10% of episodes of the dataset as a validation set.
|
||||
# - Load full dataset
|
||||
full_dataset = LeRobotDataset("lerobot/pusht", split="train")
|
||||
# - Calculate train and val subsets
|
||||
num_train_episodes = math.floor(full_dataset.num_episodes * 90 / 100)
|
||||
num_val_episodes = full_dataset.num_episodes - num_train_episodes
|
||||
print(f"Number of episodes in full dataset: {full_dataset.num_episodes}")
|
||||
print(f"Number of episodes in training dataset (90% subset): {num_train_episodes}")
|
||||
print(f"Number of episodes in validation dataset (10% subset): {num_val_episodes}")
|
||||
# - Get first frame index of the validation set
|
||||
first_val_frame_index = full_dataset.episode_data_index["from"][num_train_episodes].item()
|
||||
# - Load frames subset belonging to validation set using the `split` argument.
|
||||
# It utilizes the `datasets` library's syntax for slicing datasets.
|
||||
# For more information on the Slice API, please see:
|
||||
# https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
|
||||
# - Load dataset metadata
|
||||
dataset_metadata = LeRobotDatasetMetadata("lerobot/pusht")
|
||||
# - Calculate train and val episodes
|
||||
total_episodes = dataset_metadata.total_episodes
|
||||
episodes = list(range(dataset_metadata.total_episodes))
|
||||
num_train_episodes = math.floor(total_episodes * 90 / 100)
|
||||
train_episodes = episodes[:num_train_episodes]
|
||||
val_episodes = episodes[num_train_episodes:]
|
||||
print(f"Number of episodes in full dataset: {total_episodes}")
|
||||
print(f"Number of episodes in training dataset (90% subset): {len(train_episodes)}")
|
||||
print(f"Number of episodes in validation dataset (10% subset): {len(val_episodes)}")
|
||||
# - Load train an val datasets
|
||||
train_dataset = LeRobotDataset(
|
||||
"lerobot/pusht", split=f"train[:{first_val_frame_index}]", delta_timestamps=delta_timestamps
|
||||
"lerobot/pusht", episodes=train_episodes, delta_timestamps=delta_timestamps
|
||||
)
|
||||
val_dataset = LeRobotDataset(
|
||||
"lerobot/pusht", split=f"train[{first_val_frame_index}:]", delta_timestamps=delta_timestamps
|
||||
"lerobot/pusht", episodes=val_episodes, delta_timestamps=delta_timestamps
|
||||
)
|
||||
print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
|
||||
print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
|
||||
|
||||
228
examples/port_datasets/pusht_zarr.py
Normal file
228
examples/port_datasets/pusht_zarr.py
Normal file
@@ -0,0 +1,228 @@
|
||||
import shutil
|
||||
from pathlib import Path
|
||||
|
||||
import numpy as np
|
||||
import torch
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LEROBOT_HOME, LeRobotDataset
|
||||
from lerobot.common.datasets.push_dataset_to_hub._download_raw import download_raw
|
||||
|
||||
PUSHT_TASK = "Push the T-shaped blue block onto the T-shaped green target surface."
|
||||
PUSHT_FEATURES = {
|
||||
"observation.state": {
|
||||
"dtype": "float32",
|
||||
"shape": (2,),
|
||||
"names": {
|
||||
"axes": ["x", "y"],
|
||||
},
|
||||
},
|
||||
"action": {
|
||||
"dtype": "float32",
|
||||
"shape": (2,),
|
||||
"names": {
|
||||
"axes": ["x", "y"],
|
||||
},
|
||||
},
|
||||
"next.reward": {
|
||||
"dtype": "float32",
|
||||
"shape": (1,),
|
||||
"names": None,
|
||||
},
|
||||
"next.success": {
|
||||
"dtype": "bool",
|
||||
"shape": (1,),
|
||||
"names": None,
|
||||
},
|
||||
"observation.environment_state": {
|
||||
"dtype": "float32",
|
||||
"shape": (16,),
|
||||
"names": [
|
||||
"keypoints",
|
||||
],
|
||||
},
|
||||
"observation.image": {
|
||||
"dtype": None,
|
||||
"shape": (3, 96, 96),
|
||||
"names": [
|
||||
"channel",
|
||||
"height",
|
||||
"width",
|
||||
],
|
||||
},
|
||||
}
|
||||
|
||||
|
||||
def build_features(mode: str) -> dict:
|
||||
features = PUSHT_FEATURES
|
||||
if mode == "keypoints":
|
||||
features.pop("observation.image")
|
||||
else:
|
||||
features.pop("observation.environment_state")
|
||||
features["observation.image"]["dtype"] = mode
|
||||
|
||||
return features
|
||||
|
||||
|
||||
def load_raw_dataset(zarr_path: Path):
|
||||
try:
|
||||
from lerobot.common.datasets.push_dataset_to_hub._diffusion_policy_replay_buffer import (
|
||||
ReplayBuffer as DiffusionPolicyReplayBuffer,
|
||||
)
|
||||
except ModuleNotFoundError as e:
|
||||
print(
|
||||
"`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`"
|
||||
)
|
||||
raise e
|
||||
|
||||
zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
|
||||
return zarr_data
|
||||
|
||||
|
||||
def calculate_coverage(zarr_data):
|
||||
try:
|
||||
import pymunk
|
||||
from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
|
||||
except ModuleNotFoundError as e:
|
||||
print(
|
||||
"`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`"
|
||||
)
|
||||
raise e
|
||||
|
||||
block_pos = zarr_data["state"][:, 2:4]
|
||||
block_angle = zarr_data["state"][:, 4]
|
||||
|
||||
num_frames = len(block_pos)
|
||||
|
||||
coverage = np.zeros((num_frames,))
|
||||
# 8 keypoints with 2 coords each
|
||||
keypoints = np.zeros((num_frames, 16))
|
||||
|
||||
# Set x, y, theta (in radians)
|
||||
goal_pos_angle = np.array([256, 256, np.pi / 4])
|
||||
goal_body = PushTEnv.get_goal_pose_body(goal_pos_angle)
|
||||
|
||||
for i in range(num_frames):
|
||||
space = pymunk.Space()
|
||||
space.gravity = 0, 0
|
||||
space.damping = 0
|
||||
|
||||
# Add walls.
|
||||
walls = [
|
||||
PushTEnv.add_segment(space, (5, 506), (5, 5), 2),
|
||||
PushTEnv.add_segment(space, (5, 5), (506, 5), 2),
|
||||
PushTEnv.add_segment(space, (506, 5), (506, 506), 2),
|
||||
PushTEnv.add_segment(space, (5, 506), (506, 506), 2),
|
||||
]
|
||||
space.add(*walls)
|
||||
|
||||
block_body, block_shapes = PushTEnv.add_tee(
|
||||
space, block_pos[i].tolist(), block_angle[i].item()
|
||||
)
|
||||
goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
|
||||
block_geom = pymunk_to_shapely(block_body, block_body.shapes)
|
||||
intersection_area = goal_geom.intersection(block_geom).area
|
||||
goal_area = goal_geom.area
|
||||
coverage[i] = intersection_area / goal_area
|
||||
keypoints[i] = torch.from_numpy(PushTEnv.get_keypoints(block_shapes).flatten())
|
||||
|
||||
return coverage, keypoints
|
||||
|
||||
|
||||
def calculate_success(coverage: float, success_threshold: float):
|
||||
return coverage > success_threshold
|
||||
|
||||
|
||||
def calculate_reward(coverage: float, success_threshold: float):
|
||||
return np.clip(coverage / success_threshold, 0, 1)
|
||||
|
||||
|
||||
def main(raw_dir: Path, repo_id: str, mode: str = "video", push_to_hub: bool = True):
|
||||
if mode not in ["video", "image", "keypoints"]:
|
||||
raise ValueError(mode)
|
||||
|
||||
if (LEROBOT_HOME / repo_id).exists():
|
||||
shutil.rmtree(LEROBOT_HOME / repo_id)
|
||||
|
||||
if not raw_dir.exists():
|
||||
download_raw(raw_dir, repo_id="lerobot-raw/pusht_raw")
|
||||
|
||||
zarr_data = load_raw_dataset(zarr_path=raw_dir / "pusht_cchi_v7_replay.zarr")
|
||||
|
||||
env_state = zarr_data["state"][:]
|
||||
agent_pos = env_state[:, :2]
|
||||
|
||||
action = zarr_data["action"][:]
|
||||
image = zarr_data["img"] # (b, h, w, c)
|
||||
|
||||
episode_data_index = {
|
||||
"from": np.concatenate(([0], zarr_data.meta["episode_ends"][:-1])),
|
||||
"to": zarr_data.meta["episode_ends"],
|
||||
}
|
||||
|
||||
# Calculate success and reward based on the overlapping area
|
||||
# of the T-object and the T-area.
|
||||
coverage, keypoints = calculate_coverage(zarr_data)
|
||||
success = calculate_success(coverage, success_threshold=0.95)
|
||||
reward = calculate_reward(coverage, success_threshold=0.95)
|
||||
|
||||
features = build_features(mode)
|
||||
dataset = LeRobotDataset.create(
|
||||
repo_id=repo_id,
|
||||
fps=10,
|
||||
robot_type="2d pointer",
|
||||
features=features,
|
||||
image_writer_threads=4,
|
||||
)
|
||||
episodes = range(len(episode_data_index["from"]))
|
||||
for ep_idx in episodes:
|
||||
from_idx = episode_data_index["from"][ep_idx]
|
||||
to_idx = episode_data_index["to"][ep_idx]
|
||||
num_frames = to_idx - from_idx
|
||||
|
||||
for frame_idx in range(num_frames):
|
||||
i = from_idx + frame_idx
|
||||
frame = {
|
||||
"action": torch.from_numpy(action[i]),
|
||||
# Shift reward and success by +1 until the last item of the episode
|
||||
"next.reward": reward[i + (frame_idx < num_frames - 1)],
|
||||
"next.success": success[i + (frame_idx < num_frames - 1)],
|
||||
}
|
||||
|
||||
frame["observation.state"] = torch.from_numpy(agent_pos[i])
|
||||
|
||||
if mode == "keypoints":
|
||||
frame["observation.environment_state"] = torch.from_numpy(keypoints[i])
|
||||
else:
|
||||
frame["observation.image"] = torch.from_numpy(image[i])
|
||||
|
||||
dataset.add_frame(frame)
|
||||
|
||||
dataset.save_episode(task=PUSHT_TASK)
|
||||
|
||||
dataset.consolidate()
|
||||
|
||||
if push_to_hub:
|
||||
dataset.push_to_hub()
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
# To try this script, modify the repo id with your own HuggingFace user (e.g cadene/pusht)
|
||||
repo_id = "lerobot/pusht"
|
||||
|
||||
modes = ["video", "image", "keypoints"]
|
||||
# Uncomment if you want to try with a specific mode
|
||||
# modes = ["video"]
|
||||
# modes = ["image"]
|
||||
# modes = ["keypoints"]
|
||||
|
||||
raw_dir = Path("data/lerobot-raw/pusht_raw")
|
||||
for mode in modes:
|
||||
if mode in ["image", "keypoints"]:
|
||||
repo_id += f"_{mode}"
|
||||
|
||||
# download and load raw dataset, create LeRobotDataset, populate it, push to hub
|
||||
main(raw_dir, repo_id=repo_id, mode=mode)
|
||||
|
||||
# Uncomment if you want to load the local dataset and explore it
|
||||
# dataset = LeRobotDataset(repo_id=repo_id, local_files_only=True)
|
||||
# breakpoint()
|
||||
@@ -1,89 +0,0 @@
|
||||
# Using `lerobot` on a real world arm
|
||||
|
||||
|
||||
In this example, we'll be using `lerobot` on a real world arm to:
|
||||
- record a dataset in the `lerobot` format
|
||||
- (soon) train a policy on it
|
||||
- (soon) run the policy in the real-world
|
||||
|
||||
## Which robotic arm to use
|
||||
|
||||
In this example we're using the [open-source low-cost arm from Alexander Koch](https://github.com/AlexanderKoch-Koch/low_cost_robot) in the specific setup of:
|
||||
- having 6 servos per arm, i.e. using the elbow-to-wrist extension
|
||||
- adding two cameras around it, one on top and one in the front
|
||||
- having a teleoperation arm as well (build the leader and the follower arms in A. Koch repo, both with elbow-to-wrist extensions)
|
||||
|
||||
I'm using these cameras (but the setup should not be sensitive to the exact cameras you're using):
|
||||
- C922 Pro Stream Webcam
|
||||
- Intel(R) RealSense D455 (using only the RGB input)
|
||||
|
||||
|
||||
In general, this example should be very easily extendable to any type of arm using Dynamixel servos with at least one camera by changing a couple of configuration in the gym env.
|
||||
|
||||
## Install the example
|
||||
|
||||
Follow these steps:
|
||||
- install `lerobot`
|
||||
- install the Dynamixel-sdk: ` pip install dynamixel-sdk`
|
||||
|
||||
## Usage
|
||||
|
||||
### 0 - record examples
|
||||
|
||||
Run the `record_training_data.py` example, selecting the duration and number of episodes you want to record, e.g.
|
||||
```
|
||||
DATA_DIR='./data' python record_training_data.py \
|
||||
--repo-id=thomwolf/blue_red_sort \
|
||||
--num-episodes=50 \
|
||||
--num-frames=400
|
||||
```
|
||||
|
||||
TODO:
|
||||
- various length episodes
|
||||
- being able to drop episodes
|
||||
- checking uploading to the hub
|
||||
|
||||
### 1 - visualize the dataset
|
||||
|
||||
Use the standard dataset visualization script pointing it to the right folder:
|
||||
```
|
||||
DATA_DIR='./data' python ../../lerobot/scripts/visualize_dataset.py \
|
||||
--repo-id thomwolf/blue_red_sort \
|
||||
--episode-index 0
|
||||
```
|
||||
|
||||
### 2 - Train a policy
|
||||
|
||||
From the example directory let's run this command to train a model using ACT
|
||||
|
||||
```
|
||||
DATA_DIR='./data' python ../../lerobot/scripts/train.py \
|
||||
device=cuda \
|
||||
hydra.searchpath=[file://./train_config/] \
|
||||
hydra.run.dir=./outputs/train/blue_red_sort \
|
||||
dataset_repo_id=thomwolf/blue_red_sort \
|
||||
env=gym_real_world \
|
||||
policy=act_real_world \
|
||||
wandb.enable=false
|
||||
```
|
||||
|
||||
### 3 - Evaluate the policy in the real world
|
||||
|
||||
From the example directory let's run this command to evaluate our policy.
|
||||
The configuration for running the policy is in the checkpoint of the model.
|
||||
You can override parameters as follow:
|
||||
|
||||
```
|
||||
python run_policy.py \
|
||||
-p ./outputs/train/blue_red_sort/checkpoints/last/pretrained_model/
|
||||
env.episode_length=1000
|
||||
```
|
||||
|
||||
|
||||
## Convert a hdf5 dataset recorded with the original ACT repo
|
||||
|
||||
You can convert a dataset from the raw data format of HDF5 files like in: https://github.com/tonyzhaozh/act with the following command:
|
||||
|
||||
```
|
||||
python ./lerobot/scripts/push_dataset_to_hub.py
|
||||
```
|
||||
@@ -1,840 +0,0 @@
|
||||
{
|
||||
"cells": [
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 48,
|
||||
"metadata": {},
|
||||
"outputs": [],
|
||||
"source": [
|
||||
"import torch\n",
|
||||
"from safetensors.torch import load_file, save_file\n",
|
||||
"from pprint import pprint"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 52,
|
||||
"metadata": {},
|
||||
"outputs": [],
|
||||
"source": [
|
||||
"original_ckpt_path = \"/home/thomwolf/Documents/Github/ACT/checkpoints/blue_red_sort/policy_last.ckpt\"\n",
|
||||
"converted_ckpt_path = \"/home/thomwolf/Documents/Github/ACT/checkpoints/blue_red_sort/model.safetensors\"\n",
|
||||
"\n",
|
||||
"comparison_main_path = \"/home/thomwolf/Documents/Github/lerobot/examples/real_robot_example/outputs/train/blue_red_debug_no_masking/checkpoints/last/pretrained_model/\"\n",
|
||||
"comparison_safetensor_path = comparison_main_path + \"model.safetensors\"\n",
|
||||
"comparison_config_json_path = comparison_main_path + \"config.json\"\n",
|
||||
"comparison_config_yaml_path = comparison_main_path + \"config.yaml\""
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 28,
|
||||
"metadata": {},
|
||||
"outputs": [],
|
||||
"source": [
|
||||
"a = torch.load(original_ckpt_path)"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 6,
|
||||
"metadata": {},
|
||||
"outputs": [],
|
||||
"source": [
|
||||
"b = load_file(comparison_safetensor_path)"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 17,
|
||||
"metadata": {},
|
||||
"outputs": [
|
||||
{
|
||||
"name": "stdout",
|
||||
"output_type": "stream",
|
||||
"text": [
|
||||
"['model.action_head.bias',\n",
|
||||
" 'model.action_head.weight',\n",
|
||||
" 'model.backbone.bn1.bias',\n",
|
||||
" 'model.backbone.bn1.running_mean',\n",
|
||||
" 'model.backbone.bn1.running_var',\n",
|
||||
" 'model.backbone.bn1.weight',\n",
|
||||
" 'model.backbone.conv1.weight',\n",
|
||||
" 'model.backbone.layer1.0.bn1.bias',\n",
|
||||
" 'model.backbone.layer1.0.bn1.running_mean',\n",
|
||||
" 'model.backbone.layer1.0.bn1.running_var',\n",
|
||||
" 'model.backbone.layer1.0.bn1.weight',\n",
|
||||
" 'model.backbone.layer1.0.bn2.bias',\n",
|
||||
" 'model.backbone.layer1.0.bn2.running_mean',\n",
|
||||
" 'model.backbone.layer1.0.bn2.running_var',\n",
|
||||
" 'model.backbone.layer1.0.bn2.weight',\n",
|
||||
" 'model.backbone.layer1.0.conv1.weight',\n",
|
||||
" 'model.backbone.layer1.0.conv2.weight',\n",
|
||||
" 'model.backbone.layer1.1.bn1.bias',\n",
|
||||
" 'model.backbone.layer1.1.bn1.running_mean',\n",
|
||||
" 'model.backbone.layer1.1.bn1.running_var',\n",
|
||||
" 'model.backbone.layer1.1.bn1.weight',\n",
|
||||
" 'model.backbone.layer1.1.bn2.bias',\n",
|
||||
" 'model.backbone.layer1.1.bn2.running_mean',\n",
|
||||
" 'model.backbone.layer1.1.bn2.running_var',\n",
|
||||
" 'model.backbone.layer1.1.bn2.weight',\n",
|
||||
" 'model.backbone.layer1.1.conv1.weight',\n",
|
||||
" 'model.backbone.layer1.1.conv2.weight',\n",
|
||||
" 'model.backbone.layer2.0.bn1.bias',\n",
|
||||
" 'model.backbone.layer2.0.bn1.running_mean',\n",
|
||||
" 'model.backbone.layer2.0.bn1.running_var',\n",
|
||||
" 'model.backbone.layer2.0.bn1.weight',\n",
|
||||
" 'model.backbone.layer2.0.bn2.bias',\n",
|
||||
" 'model.backbone.layer2.0.bn2.running_mean',\n",
|
||||
" 'model.backbone.layer2.0.bn2.running_var',\n",
|
||||
" 'model.backbone.layer2.0.bn2.weight',\n",
|
||||
" 'model.backbone.layer2.0.conv1.weight',\n",
|
||||
" 'model.backbone.layer2.0.conv2.weight',\n",
|
||||
" 'model.backbone.layer2.0.downsample.0.weight',\n",
|
||||
" 'model.backbone.layer2.0.downsample.1.bias',\n",
|
||||
" 'model.backbone.layer2.0.downsample.1.running_mean',\n",
|
||||
" 'model.backbone.layer2.0.downsample.1.running_var',\n",
|
||||
" 'model.backbone.layer2.0.downsample.1.weight',\n",
|
||||
" 'model.backbone.layer2.1.bn1.bias',\n",
|
||||
" 'model.backbone.layer2.1.bn1.running_mean',\n",
|
||||
" 'model.backbone.layer2.1.bn1.running_var',\n",
|
||||
" 'model.backbone.layer2.1.bn1.weight',\n",
|
||||
" 'model.backbone.layer2.1.bn2.bias',\n",
|
||||
" 'model.backbone.layer2.1.bn2.running_mean',\n",
|
||||
" 'model.backbone.layer2.1.bn2.running_var',\n",
|
||||
" 'model.backbone.layer2.1.bn2.weight',\n",
|
||||
" 'model.backbone.layer2.1.conv1.weight',\n",
|
||||
" 'model.backbone.layer2.1.conv2.weight',\n",
|
||||
" 'model.backbone.layer3.0.bn1.bias',\n",
|
||||
" 'model.backbone.layer3.0.bn1.running_mean',\n",
|
||||
" 'model.backbone.layer3.0.bn1.running_var',\n",
|
||||
" 'model.backbone.layer3.0.bn1.weight',\n",
|
||||
" 'model.backbone.layer3.0.bn2.bias',\n",
|
||||
" 'model.backbone.layer3.0.bn2.running_mean',\n",
|
||||
" 'model.backbone.layer3.0.bn2.running_var',\n",
|
||||
" 'model.backbone.layer3.0.bn2.weight',\n",
|
||||
" 'model.backbone.layer3.0.conv1.weight',\n",
|
||||
" 'model.backbone.layer3.0.conv2.weight',\n",
|
||||
" 'model.backbone.layer3.0.downsample.0.weight',\n",
|
||||
" 'model.backbone.layer3.0.downsample.1.bias',\n",
|
||||
" 'model.backbone.layer3.0.downsample.1.running_mean',\n",
|
||||
" 'model.backbone.layer3.0.downsample.1.running_var',\n",
|
||||
" 'model.backbone.layer3.0.downsample.1.weight',\n",
|
||||
" 'model.backbone.layer3.1.bn1.bias',\n",
|
||||
" 'model.backbone.layer3.1.bn1.running_mean',\n",
|
||||
" 'model.backbone.layer3.1.bn1.running_var',\n",
|
||||
" 'model.backbone.layer3.1.bn1.weight',\n",
|
||||
" 'model.backbone.layer3.1.bn2.bias',\n",
|
||||
" 'model.backbone.layer3.1.bn2.running_mean',\n",
|
||||
" 'model.backbone.layer3.1.bn2.running_var',\n",
|
||||
" 'model.backbone.layer3.1.bn2.weight',\n",
|
||||
" 'model.backbone.layer3.1.conv1.weight',\n",
|
||||
" 'model.backbone.layer3.1.conv2.weight',\n",
|
||||
" 'model.backbone.layer4.0.bn1.bias',\n",
|
||||
" 'model.backbone.layer4.0.bn1.running_mean',\n",
|
||||
" 'model.backbone.layer4.0.bn1.running_var',\n",
|
||||
" 'model.backbone.layer4.0.bn1.weight',\n",
|
||||
" 'model.backbone.layer4.0.bn2.bias',\n",
|
||||
" 'model.backbone.layer4.0.bn2.running_mean',\n",
|
||||
" 'model.backbone.layer4.0.bn2.running_var',\n",
|
||||
" 'model.backbone.layer4.0.bn2.weight',\n",
|
||||
" 'model.backbone.layer4.0.conv1.weight',\n",
|
||||
" 'model.backbone.layer4.0.conv2.weight',\n",
|
||||
" 'model.backbone.layer4.0.downsample.0.weight',\n",
|
||||
" 'model.backbone.layer4.0.downsample.1.bias',\n",
|
||||
" 'model.backbone.layer4.0.downsample.1.running_mean',\n",
|
||||
" 'model.backbone.layer4.0.downsample.1.running_var',\n",
|
||||
" 'model.backbone.layer4.0.downsample.1.weight',\n",
|
||||
" 'model.backbone.layer4.1.bn1.bias',\n",
|
||||
" 'model.backbone.layer4.1.bn1.running_mean',\n",
|
||||
" 'model.backbone.layer4.1.bn1.running_var',\n",
|
||||
" 'model.backbone.layer4.1.bn1.weight',\n",
|
||||
" 'model.backbone.layer4.1.bn2.bias',\n",
|
||||
" 'model.backbone.layer4.1.bn2.running_mean',\n",
|
||||
" 'model.backbone.layer4.1.bn2.running_var',\n",
|
||||
" 'model.backbone.layer4.1.bn2.weight',\n",
|
||||
" 'model.backbone.layer4.1.conv1.weight',\n",
|
||||
" 'model.backbone.layer4.1.conv2.weight',\n",
|
||||
" 'model.decoder.layers.0.linear1.bias',\n",
|
||||
" 'model.decoder.layers.0.linear1.weight',\n",
|
||||
" 'model.decoder.layers.0.linear2.bias',\n",
|
||||
" 'model.decoder.layers.0.linear2.weight',\n",
|
||||
" 'model.decoder.layers.0.multihead_attn.in_proj_bias',\n",
|
||||
" 'model.decoder.layers.0.multihead_attn.in_proj_weight',\n",
|
||||
" 'model.decoder.layers.0.multihead_attn.out_proj.bias',\n",
|
||||
" 'model.decoder.layers.0.multihead_attn.out_proj.weight',\n",
|
||||
" 'model.decoder.layers.0.norm1.bias',\n",
|
||||
" 'model.decoder.layers.0.norm1.weight',\n",
|
||||
" 'model.decoder.layers.0.norm2.bias',\n",
|
||||
" 'model.decoder.layers.0.norm2.weight',\n",
|
||||
" 'model.decoder.layers.0.norm3.bias',\n",
|
||||
" 'model.decoder.layers.0.norm3.weight',\n",
|
||||
" 'model.decoder.layers.0.self_attn.in_proj_bias',\n",
|
||||
" 'model.decoder.layers.0.self_attn.in_proj_weight',\n",
|
||||
" 'model.decoder.layers.0.self_attn.out_proj.bias',\n",
|
||||
" 'model.decoder.layers.0.self_attn.out_proj.weight',\n",
|
||||
" 'model.decoder_pos_embed.weight',\n",
|
||||
" 'model.encoder.layers.0.linear1.bias',\n",
|
||||
" 'model.encoder.layers.0.linear1.weight',\n",
|
||||
" 'model.encoder.layers.0.linear2.bias',\n",
|
||||
" 'model.encoder.layers.0.linear2.weight',\n",
|
||||
" 'model.encoder.layers.0.norm1.bias',\n",
|
||||
" 'model.encoder.layers.0.norm1.weight',\n",
|
||||
" 'model.encoder.layers.0.norm2.bias',\n",
|
||||
" 'model.encoder.layers.0.norm2.weight',\n",
|
||||
" 'model.encoder.layers.0.self_attn.in_proj_bias',\n",
|
||||
" 'model.encoder.layers.0.self_attn.in_proj_weight',\n",
|
||||
" 'model.encoder.layers.0.self_attn.out_proj.bias',\n",
|
||||
" 'model.encoder.layers.0.self_attn.out_proj.weight',\n",
|
||||
" 'model.encoder.layers.1.linear1.bias',\n",
|
||||
" 'model.encoder.layers.1.linear1.weight',\n",
|
||||
" 'model.encoder.layers.1.linear2.bias',\n",
|
||||
" 'model.encoder.layers.1.linear2.weight',\n",
|
||||
" 'model.encoder.layers.1.norm1.bias',\n",
|
||||
" 'model.encoder.layers.1.norm1.weight',\n",
|
||||
" 'model.encoder.layers.1.norm2.bias',\n",
|
||||
" 'model.encoder.layers.1.norm2.weight',\n",
|
||||
" 'model.encoder.layers.1.self_attn.in_proj_bias',\n",
|
||||
" 'model.encoder.layers.1.self_attn.in_proj_weight',\n",
|
||||
" 'model.encoder.layers.1.self_attn.out_proj.bias',\n",
|
||||
" 'model.encoder.layers.1.self_attn.out_proj.weight',\n",
|
||||
" 'model.encoder.layers.2.linear1.bias',\n",
|
||||
" 'model.encoder.layers.2.linear1.weight',\n",
|
||||
" 'model.encoder.layers.2.linear2.bias',\n",
|
||||
" 'model.encoder.layers.2.linear2.weight',\n",
|
||||
" 'model.encoder.layers.2.norm1.bias',\n",
|
||||
" 'model.encoder.layers.2.norm1.weight',\n",
|
||||
" 'model.encoder.layers.2.norm2.bias',\n",
|
||||
" 'model.encoder.layers.2.norm2.weight',\n",
|
||||
" 'model.encoder.layers.2.self_attn.in_proj_bias',\n",
|
||||
" 'model.encoder.layers.2.self_attn.in_proj_weight',\n",
|
||||
" 'model.encoder.layers.2.self_attn.out_proj.bias',\n",
|
||||
" 'model.encoder.layers.2.self_attn.out_proj.weight',\n",
|
||||
" 'model.encoder.layers.3.linear1.bias',\n",
|
||||
" 'model.encoder.layers.3.linear1.weight',\n",
|
||||
" 'model.encoder.layers.3.linear2.bias',\n",
|
||||
" 'model.encoder.layers.3.linear2.weight',\n",
|
||||
" 'model.encoder.layers.3.norm1.bias',\n",
|
||||
" 'model.encoder.layers.3.norm1.weight',\n",
|
||||
" 'model.encoder.layers.3.norm2.bias',\n",
|
||||
" 'model.encoder.layers.3.norm2.weight',\n",
|
||||
" 'model.encoder.layers.3.self_attn.in_proj_bias',\n",
|
||||
" 'model.encoder.layers.3.self_attn.in_proj_weight',\n",
|
||||
" 'model.encoder.layers.3.self_attn.out_proj.bias',\n",
|
||||
" 'model.encoder.layers.3.self_attn.out_proj.weight',\n",
|
||||
" 'model.encoder_img_feat_input_proj.bias',\n",
|
||||
" 'model.encoder_img_feat_input_proj.weight',\n",
|
||||
" 'model.encoder_latent_input_proj.bias',\n",
|
||||
" 'model.encoder_latent_input_proj.weight',\n",
|
||||
" 'model.encoder_robot_and_latent_pos_embed.weight',\n",
|
||||
" 'model.encoder_robot_state_input_proj.bias',\n",
|
||||
" 'model.encoder_robot_state_input_proj.weight',\n",
|
||||
" 'model.vae_encoder.layers.0.linear1.bias',\n",
|
||||
" 'model.vae_encoder.layers.0.linear1.weight',\n",
|
||||
" 'model.vae_encoder.layers.0.linear2.bias',\n",
|
||||
" 'model.vae_encoder.layers.0.linear2.weight',\n",
|
||||
" 'model.vae_encoder.layers.0.norm1.bias',\n",
|
||||
" 'model.vae_encoder.layers.0.norm1.weight',\n",
|
||||
" 'model.vae_encoder.layers.0.norm2.bias',\n",
|
||||
" 'model.vae_encoder.layers.0.norm2.weight',\n",
|
||||
" 'model.vae_encoder.layers.0.self_attn.in_proj_bias',\n",
|
||||
" 'model.vae_encoder.layers.0.self_attn.in_proj_weight',\n",
|
||||
" 'model.vae_encoder.layers.0.self_attn.out_proj.bias',\n",
|
||||
" 'model.vae_encoder.layers.0.self_attn.out_proj.weight',\n",
|
||||
" 'model.vae_encoder.layers.1.linear1.bias',\n",
|
||||
" 'model.vae_encoder.layers.1.linear1.weight',\n",
|
||||
" 'model.vae_encoder.layers.1.linear2.bias',\n",
|
||||
" 'model.vae_encoder.layers.1.linear2.weight',\n",
|
||||
" 'model.vae_encoder.layers.1.norm1.bias',\n",
|
||||
" 'model.vae_encoder.layers.1.norm1.weight',\n",
|
||||
" 'model.vae_encoder.layers.1.norm2.bias',\n",
|
||||
" 'model.vae_encoder.layers.1.norm2.weight',\n",
|
||||
" 'model.vae_encoder.layers.1.self_attn.in_proj_bias',\n",
|
||||
" 'model.vae_encoder.layers.1.self_attn.in_proj_weight',\n",
|
||||
" 'model.vae_encoder.layers.1.self_attn.out_proj.bias',\n",
|
||||
" 'model.vae_encoder.layers.1.self_attn.out_proj.weight',\n",
|
||||
" 'model.vae_encoder.layers.2.linear1.bias',\n",
|
||||
" 'model.vae_encoder.layers.2.linear1.weight',\n",
|
||||
" 'model.vae_encoder.layers.2.linear2.bias',\n",
|
||||
" 'model.vae_encoder.layers.2.linear2.weight',\n",
|
||||
" 'model.vae_encoder.layers.2.norm1.bias',\n",
|
||||
" 'model.vae_encoder.layers.2.norm1.weight',\n",
|
||||
" 'model.vae_encoder.layers.2.norm2.bias',\n",
|
||||
" 'model.vae_encoder.layers.2.norm2.weight',\n",
|
||||
" 'model.vae_encoder.layers.2.self_attn.in_proj_bias',\n",
|
||||
" 'model.vae_encoder.layers.2.self_attn.in_proj_weight',\n",
|
||||
" 'model.vae_encoder.layers.2.self_attn.out_proj.bias',\n",
|
||||
" 'model.vae_encoder.layers.2.self_attn.out_proj.weight',\n",
|
||||
" 'model.vae_encoder.layers.3.linear1.bias',\n",
|
||||
" 'model.vae_encoder.layers.3.linear1.weight',\n",
|
||||
" 'model.vae_encoder.layers.3.linear2.bias',\n",
|
||||
" 'model.vae_encoder.layers.3.linear2.weight',\n",
|
||||
" 'model.vae_encoder.layers.3.norm1.bias',\n",
|
||||
" 'model.vae_encoder.layers.3.norm1.weight',\n",
|
||||
" 'model.vae_encoder.layers.3.norm2.bias',\n",
|
||||
" 'model.vae_encoder.layers.3.norm2.weight',\n",
|
||||
" 'model.vae_encoder.layers.3.self_attn.in_proj_bias',\n",
|
||||
" 'model.vae_encoder.layers.3.self_attn.in_proj_weight',\n",
|
||||
" 'model.vae_encoder.layers.3.self_attn.out_proj.bias',\n",
|
||||
" 'model.vae_encoder.layers.3.self_attn.out_proj.weight',\n",
|
||||
" 'model.vae_encoder_action_input_proj.bias',\n",
|
||||
" 'model.vae_encoder_action_input_proj.weight',\n",
|
||||
" 'model.vae_encoder_cls_embed.weight',\n",
|
||||
" 'model.vae_encoder_latent_output_proj.bias',\n",
|
||||
" 'model.vae_encoder_latent_output_proj.weight',\n",
|
||||
" 'model.vae_encoder_pos_enc',\n",
|
||||
" 'model.vae_encoder_robot_state_input_proj.bias',\n",
|
||||
" 'model.vae_encoder_robot_state_input_proj.weight',\n",
|
||||
" 'normalize_inputs.buffer_observation_images_front.mean',\n",
|
||||
" 'normalize_inputs.buffer_observation_images_front.std',\n",
|
||||
" 'normalize_inputs.buffer_observation_images_top.mean',\n",
|
||||
" 'normalize_inputs.buffer_observation_images_top.std',\n",
|
||||
" 'normalize_inputs.buffer_observation_state.mean',\n",
|
||||
" 'normalize_inputs.buffer_observation_state.std',\n",
|
||||
" 'normalize_targets.buffer_action.mean',\n",
|
||||
" 'normalize_targets.buffer_action.std',\n",
|
||||
" 'unnormalize_outputs.buffer_action.mean',\n",
|
||||
" 'unnormalize_outputs.buffer_action.std']\n"
|
||||
]
|
||||
}
|
||||
],
|
||||
"source": [
|
||||
"dest = list(b.keys())\n",
|
||||
"pprint(dest)"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 29,
|
||||
"metadata": {},
|
||||
"outputs": [
|
||||
{
|
||||
"name": "stdout",
|
||||
"output_type": "stream",
|
||||
"text": [
|
||||
"['model.pos_table',\n",
|
||||
" 'model.transformer.encoder.layers.0.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.encoder.layers.0.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.encoder.layers.0.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.encoder.layers.0.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.encoder.layers.0.linear1.weight',\n",
|
||||
" 'model.transformer.encoder.layers.0.linear1.bias',\n",
|
||||
" 'model.transformer.encoder.layers.0.linear2.weight',\n",
|
||||
" 'model.transformer.encoder.layers.0.linear2.bias',\n",
|
||||
" 'model.transformer.encoder.layers.0.norm1.weight',\n",
|
||||
" 'model.transformer.encoder.layers.0.norm1.bias',\n",
|
||||
" 'model.transformer.encoder.layers.0.norm2.weight',\n",
|
||||
" 'model.transformer.encoder.layers.0.norm2.bias',\n",
|
||||
" 'model.transformer.encoder.layers.1.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.encoder.layers.1.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.encoder.layers.1.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.encoder.layers.1.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.encoder.layers.1.linear1.weight',\n",
|
||||
" 'model.transformer.encoder.layers.1.linear1.bias',\n",
|
||||
" 'model.transformer.encoder.layers.1.linear2.weight',\n",
|
||||
" 'model.transformer.encoder.layers.1.linear2.bias',\n",
|
||||
" 'model.transformer.encoder.layers.1.norm1.weight',\n",
|
||||
" 'model.transformer.encoder.layers.1.norm1.bias',\n",
|
||||
" 'model.transformer.encoder.layers.1.norm2.weight',\n",
|
||||
" 'model.transformer.encoder.layers.1.norm2.bias',\n",
|
||||
" 'model.transformer.encoder.layers.2.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.encoder.layers.2.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.encoder.layers.2.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.encoder.layers.2.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.encoder.layers.2.linear1.weight',\n",
|
||||
" 'model.transformer.encoder.layers.2.linear1.bias',\n",
|
||||
" 'model.transformer.encoder.layers.2.linear2.weight',\n",
|
||||
" 'model.transformer.encoder.layers.2.linear2.bias',\n",
|
||||
" 'model.transformer.encoder.layers.2.norm1.weight',\n",
|
||||
" 'model.transformer.encoder.layers.2.norm1.bias',\n",
|
||||
" 'model.transformer.encoder.layers.2.norm2.weight',\n",
|
||||
" 'model.transformer.encoder.layers.2.norm2.bias',\n",
|
||||
" 'model.transformer.encoder.layers.3.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.encoder.layers.3.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.encoder.layers.3.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.encoder.layers.3.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.encoder.layers.3.linear1.weight',\n",
|
||||
" 'model.transformer.encoder.layers.3.linear1.bias',\n",
|
||||
" 'model.transformer.encoder.layers.3.linear2.weight',\n",
|
||||
" 'model.transformer.encoder.layers.3.linear2.bias',\n",
|
||||
" 'model.transformer.encoder.layers.3.norm1.weight',\n",
|
||||
" 'model.transformer.encoder.layers.3.norm1.bias',\n",
|
||||
" 'model.transformer.encoder.layers.3.norm2.weight',\n",
|
||||
" 'model.transformer.encoder.layers.3.norm2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.multihead_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.multihead_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.multihead_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.multihead_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.linear1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.linear1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.linear2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.linear2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.norm1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.norm1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.norm2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.norm2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.0.norm3.weight',\n",
|
||||
" 'model.transformer.decoder.layers.0.norm3.bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.multihead_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.multihead_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.multihead_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.multihead_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.linear1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.linear1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.linear2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.linear2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.norm1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.norm1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.norm2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.norm2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.1.norm3.weight',\n",
|
||||
" 'model.transformer.decoder.layers.1.norm3.bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.multihead_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.multihead_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.multihead_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.multihead_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.linear1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.linear1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.linear2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.linear2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.norm1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.norm1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.norm2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.norm2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.2.norm3.weight',\n",
|
||||
" 'model.transformer.decoder.layers.2.norm3.bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.multihead_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.multihead_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.multihead_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.multihead_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.linear1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.linear1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.linear2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.linear2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.norm1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.norm1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.norm2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.norm2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.3.norm3.weight',\n",
|
||||
" 'model.transformer.decoder.layers.3.norm3.bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.multihead_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.multihead_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.multihead_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.multihead_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.linear1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.linear1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.linear2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.linear2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.norm1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.norm1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.norm2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.norm2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.4.norm3.weight',\n",
|
||||
" 'model.transformer.decoder.layers.4.norm3.bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.multihead_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.multihead_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.multihead_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.multihead_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.linear1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.linear1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.linear2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.linear2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.norm1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.norm1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.norm2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.norm2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.5.norm3.weight',\n",
|
||||
" 'model.transformer.decoder.layers.5.norm3.bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.self_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.self_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.self_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.self_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.multihead_attn.in_proj_weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.multihead_attn.in_proj_bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.multihead_attn.out_proj.weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.multihead_attn.out_proj.bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.linear1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.linear1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.linear2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.linear2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.norm1.weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.norm1.bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.norm2.weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.norm2.bias',\n",
|
||||
" 'model.transformer.decoder.layers.6.norm3.weight',\n",
|
||||
" 'model.transformer.decoder.layers.6.norm3.bias',\n",
|
||||
" 'model.transformer.decoder.norm.weight',\n",
|
||||
" 'model.transformer.decoder.norm.bias',\n",
|
||||
" 'model.encoder.layers.0.self_attn.in_proj_weight',\n",
|
||||
" 'model.encoder.layers.0.self_attn.in_proj_bias',\n",
|
||||
" 'model.encoder.layers.0.self_attn.out_proj.weight',\n",
|
||||
" 'model.encoder.layers.0.self_attn.out_proj.bias',\n",
|
||||
" 'model.encoder.layers.0.linear1.weight',\n",
|
||||
" 'model.encoder.layers.0.linear1.bias',\n",
|
||||
" 'model.encoder.layers.0.linear2.weight',\n",
|
||||
" 'model.encoder.layers.0.linear2.bias',\n",
|
||||
" 'model.encoder.layers.0.norm1.weight',\n",
|
||||
" 'model.encoder.layers.0.norm1.bias',\n",
|
||||
" 'model.encoder.layers.0.norm2.weight',\n",
|
||||
" 'model.encoder.layers.0.norm2.bias',\n",
|
||||
" 'model.encoder.layers.1.self_attn.in_proj_weight',\n",
|
||||
" 'model.encoder.layers.1.self_attn.in_proj_bias',\n",
|
||||
" 'model.encoder.layers.1.self_attn.out_proj.weight',\n",
|
||||
" 'model.encoder.layers.1.self_attn.out_proj.bias',\n",
|
||||
" 'model.encoder.layers.1.linear1.weight',\n",
|
||||
" 'model.encoder.layers.1.linear1.bias',\n",
|
||||
" 'model.encoder.layers.1.linear2.weight',\n",
|
||||
" 'model.encoder.layers.1.linear2.bias',\n",
|
||||
" 'model.encoder.layers.1.norm1.weight',\n",
|
||||
" 'model.encoder.layers.1.norm1.bias',\n",
|
||||
" 'model.encoder.layers.1.norm2.weight',\n",
|
||||
" 'model.encoder.layers.1.norm2.bias',\n",
|
||||
" 'model.encoder.layers.2.self_attn.in_proj_weight',\n",
|
||||
" 'model.encoder.layers.2.self_attn.in_proj_bias',\n",
|
||||
" 'model.encoder.layers.2.self_attn.out_proj.weight',\n",
|
||||
" 'model.encoder.layers.2.self_attn.out_proj.bias',\n",
|
||||
" 'model.encoder.layers.2.linear1.weight',\n",
|
||||
" 'model.encoder.layers.2.linear1.bias',\n",
|
||||
" 'model.encoder.layers.2.linear2.weight',\n",
|
||||
" 'model.encoder.layers.2.linear2.bias',\n",
|
||||
" 'model.encoder.layers.2.norm1.weight',\n",
|
||||
" 'model.encoder.layers.2.norm1.bias',\n",
|
||||
" 'model.encoder.layers.2.norm2.weight',\n",
|
||||
" 'model.encoder.layers.2.norm2.bias',\n",
|
||||
" 'model.encoder.layers.3.self_attn.in_proj_weight',\n",
|
||||
" 'model.encoder.layers.3.self_attn.in_proj_bias',\n",
|
||||
" 'model.encoder.layers.3.self_attn.out_proj.weight',\n",
|
||||
" 'model.encoder.layers.3.self_attn.out_proj.bias',\n",
|
||||
" 'model.encoder.layers.3.linear1.weight',\n",
|
||||
" 'model.encoder.layers.3.linear1.bias',\n",
|
||||
" 'model.encoder.layers.3.linear2.weight',\n",
|
||||
" 'model.encoder.layers.3.linear2.bias',\n",
|
||||
" 'model.encoder.layers.3.norm1.weight',\n",
|
||||
" 'model.encoder.layers.3.norm1.bias',\n",
|
||||
" 'model.encoder.layers.3.norm2.weight',\n",
|
||||
" 'model.encoder.layers.3.norm2.bias',\n",
|
||||
" 'model.action_head.weight',\n",
|
||||
" 'model.action_head.bias',\n",
|
||||
" 'model.is_pad_head.weight',\n",
|
||||
" 'model.is_pad_head.bias',\n",
|
||||
" 'model.query_embed.weight',\n",
|
||||
" 'model.input_proj.weight',\n",
|
||||
" 'model.input_proj.bias',\n",
|
||||
" 'model.backbones.0.0.body.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.conv2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn2.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn2.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn2.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer1.0.bn2.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.conv2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn2.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn2.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn2.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer1.1.bn2.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.conv2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn2.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn2.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn2.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.bn2.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.downsample.0.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.downsample.1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.downsample.1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.downsample.1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.downsample.1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer2.0.downsample.1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.conv2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn2.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn2.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn2.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer2.1.bn2.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.conv2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn2.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn2.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn2.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.bn2.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.downsample.0.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.downsample.1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.downsample.1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.downsample.1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.downsample.1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer3.0.downsample.1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.conv2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn2.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn2.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn2.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer3.1.bn2.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.conv2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn2.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn2.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn2.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.bn2.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.downsample.0.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.downsample.1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.downsample.1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.downsample.1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.downsample.1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer4.0.downsample.1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.conv1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn1.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn1.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn1.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn1.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn1.num_batches_tracked',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.conv2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn2.weight',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn2.bias',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn2.running_mean',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn2.running_var',\n",
|
||||
" 'model.backbones.0.0.body.layer4.1.bn2.num_batches_tracked',\n",
|
||||
" 'model.input_proj_robot_state.weight',\n",
|
||||
" 'model.input_proj_robot_state.bias',\n",
|
||||
" 'model.cls_embed.weight',\n",
|
||||
" 'model.encoder_action_proj.weight',\n",
|
||||
" 'model.encoder_action_proj.bias',\n",
|
||||
" 'model.encoder_joint_proj.weight',\n",
|
||||
" 'model.encoder_joint_proj.bias',\n",
|
||||
" 'model.latent_proj.weight',\n",
|
||||
" 'model.latent_proj.bias',\n",
|
||||
" 'model.latent_out_proj.weight',\n",
|
||||
" 'model.latent_out_proj.bias',\n",
|
||||
" 'model.additional_pos_embed.weight']\n"
|
||||
]
|
||||
}
|
||||
],
|
||||
"source": [
|
||||
"orig = list(a.keys())\n",
|
||||
"pprint(orig)"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 45,
|
||||
"metadata": {},
|
||||
"outputs": [],
|
||||
"source": [
|
||||
"a = torch.load(original_ckpt_path)\n",
|
||||
"\n",
|
||||
"to_remove_startswith = ['model.transformer.decoder.layers.1.',\n",
|
||||
" 'model.transformer.decoder.layers.2.',\n",
|
||||
" 'model.transformer.decoder.layers.3.',\n",
|
||||
" 'model.transformer.decoder.layers.4.',\n",
|
||||
" 'model.transformer.decoder.layers.5.',\n",
|
||||
" 'model.transformer.decoder.layers.6.',\n",
|
||||
" 'model.transformer.decoder.norm.',\n",
|
||||
" 'model.is_pad_head']\n",
|
||||
"\n",
|
||||
"to_remove_in = ['num_batches_tracked',]\n",
|
||||
"\n",
|
||||
"conv = {}\n",
|
||||
"\n",
|
||||
"keys = list(a.keys())\n",
|
||||
"for k in keys:\n",
|
||||
" if any(k.startswith(tr) for tr in to_remove_startswith):\n",
|
||||
" a.pop(k)\n",
|
||||
" continue\n",
|
||||
" if any(tr in k for tr in to_remove_in):\n",
|
||||
" a.pop(k)\n",
|
||||
" continue\n",
|
||||
" if k.startswith('model.transformer.encoder.layers.'):\n",
|
||||
" conv[k.replace('transformer.', '')] = a.pop(k)\n",
|
||||
" if k.startswith('model.transformer.decoder.layers.0.'):\n",
|
||||
" conv[k.replace('transformer.', '')] = a.pop(k)\n",
|
||||
" if k.startswith('model.encoder.layers.'):\n",
|
||||
" conv[k.replace('encoder.', 'vae_encoder.')] = a.pop(k)\n",
|
||||
" if k.startswith('model.action_head.'):\n",
|
||||
" conv[k] = a.pop(k)\n",
|
||||
" if k.startswith('model.pos_table'):\n",
|
||||
" conv[k.replace('pos_table', 'vae_encoder_pos_enc')] = a.pop(k)\n",
|
||||
" if k.startswith('model.query_embed.'):\n",
|
||||
" conv[k.replace('query_embed', 'decoder_pos_embed')] = a.pop(k)\n",
|
||||
" if k.startswith('model.input_proj.'):\n",
|
||||
" conv[k.replace('input_proj.', 'encoder_img_feat_input_proj.')] = a.pop(k)\n",
|
||||
" if k.startswith('model.input_proj_robot_state.'):\n",
|
||||
" conv[k.replace('input_proj_robot_state.', 'encoder_robot_state_input_proj.')] = a.pop(k)\n",
|
||||
" if k.startswith('model.backbones.0.0.body.'):\n",
|
||||
" conv[k.replace('backbones.0.0.body', 'backbone')] = a.pop(k)\n",
|
||||
" if k.startswith('model.cls_embed.'):\n",
|
||||
" conv[k.replace('cls_embed', 'vae_encoder_cls_embed')] = a.pop(k)\n",
|
||||
" if k.startswith('model.encoder_action_proj.'):\n",
|
||||
" conv[k.replace('encoder_action_proj', 'vae_encoder_action_input_proj')] = a.pop(k)\n",
|
||||
" if k.startswith('model.encoder_joint_proj.'):\n",
|
||||
" conv[k.replace('encoder_joint_proj', 'vae_encoder_robot_state_input_proj')] = a.pop(k)\n",
|
||||
" if k.startswith('model.latent_proj.'):\n",
|
||||
" conv[k.replace('latent_proj', 'vae_encoder_latent_output_proj')] = a.pop(k)\n",
|
||||
" if k.startswith('model.latent_out_proj.'):\n",
|
||||
" conv[k.replace('latent_out_proj', 'encoder_latent_input_proj')] = a.pop(k)\n",
|
||||
" if k.startswith('model.additional_pos_embed.'):\n",
|
||||
" conv[k.replace('additional_pos_embed', 'encoder_robot_and_latent_pos_embed')] = a.pop(k)"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 46,
|
||||
"metadata": {},
|
||||
"outputs": [
|
||||
{
|
||||
"data": {
|
||||
"text/plain": [
|
||||
"OrderedDict()"
|
||||
]
|
||||
},
|
||||
"execution_count": 46,
|
||||
"metadata": {},
|
||||
"output_type": "execute_result"
|
||||
}
|
||||
],
|
||||
"source": [
|
||||
"a"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 47,
|
||||
"metadata": {},
|
||||
"outputs": [],
|
||||
"source": [
|
||||
"for k, v in conv.items():\n",
|
||||
" assert b[k].shape == v.shape\n",
|
||||
" b[k] = v"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 53,
|
||||
"metadata": {},
|
||||
"outputs": [],
|
||||
"source": [
|
||||
"save_file(b, converted_ckpt_path)"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 54,
|
||||
"metadata": {},
|
||||
"outputs": [
|
||||
{
|
||||
"data": {
|
||||
"text/plain": [
|
||||
"'/home/thomwolf/Documents/Github/ACT/checkpoints/blue_red_sort/config.yaml'"
|
||||
]
|
||||
},
|
||||
"execution_count": 54,
|
||||
"metadata": {},
|
||||
"output_type": "execute_result"
|
||||
}
|
||||
],
|
||||
"source": [
|
||||
"# Now also copy the config files\n",
|
||||
"import shutil\n",
|
||||
"shutil.copy(comparison_config_json_path, converted_ckpt_path.replace('model.safetensors', 'config.json'))\n",
|
||||
"shutil.copy(comparison_config_yaml_path, converted_ckpt_path.replace('model.safetensors', 'config.yaml'))"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": null,
|
||||
"metadata": {},
|
||||
"outputs": [],
|
||||
"source": []
|
||||
}
|
||||
],
|
||||
"metadata": {
|
||||
"kernelspec": {
|
||||
"display_name": "lerobot",
|
||||
"language": "python",
|
||||
"name": "python3"
|
||||
},
|
||||
"language_info": {
|
||||
"codemirror_mode": {
|
||||
"name": "ipython",
|
||||
"version": 3
|
||||
},
|
||||
"file_extension": ".py",
|
||||
"mimetype": "text/x-python",
|
||||
"name": "python",
|
||||
"nbconvert_exporter": "python",
|
||||
"pygments_lexer": "ipython3",
|
||||
"version": "3.10.14"
|
||||
}
|
||||
},
|
||||
"nbformat": 4,
|
||||
"nbformat_minor": 2
|
||||
}
|
||||
@@ -1,8 +0,0 @@
|
||||
from gymnasium.envs.registration import register
|
||||
|
||||
register(
|
||||
id="gym_real_world/RealEnv-v0",
|
||||
entry_point="gym_real_world.gym_environment:RealEnv",
|
||||
max_episode_steps=300,
|
||||
nondeterministic=True,
|
||||
)
|
||||
@@ -1,363 +0,0 @@
|
||||
# ruff: noqa
|
||||
"""From Alexander Koch low_cost_robot codebase at https://github.com/AlexanderKoch-Koch/low_cost_robot
|
||||
Dynamixel class to control the dynamixel servos
|
||||
"""
|
||||
|
||||
from __future__ import annotations
|
||||
|
||||
import enum
|
||||
import math
|
||||
import os
|
||||
from dataclasses import dataclass
|
||||
|
||||
import numpy as np
|
||||
from dynamixel_sdk import * # Uses Dynamixel SDK library
|
||||
|
||||
|
||||
def pos2pwm(pos: np.ndarray) -> np.ndarray:
|
||||
"""
|
||||
:param pos: numpy array of joint positions in range [-pi, pi]
|
||||
:return: numpy array of pwm values in range [0, 4096]
|
||||
"""
|
||||
return ((pos / 3.14 + 1.0) * 2048).astype(np.int64)
|
||||
|
||||
|
||||
def pwm2pos(pwm: np.ndarray) -> np.ndarray:
|
||||
"""
|
||||
:param pwm: numpy array of pwm values in range [0, 4096]
|
||||
:return: numpy array of joint positions in range [-pi, pi]
|
||||
"""
|
||||
return (pwm / 2048 - 1) * 3.14
|
||||
|
||||
|
||||
def pwm2vel(pwm: np.ndarray) -> np.ndarray:
|
||||
"""
|
||||
:param pwm: numpy array of pwm/s joint velocities
|
||||
:return: numpy array of rad/s joint velocities
|
||||
"""
|
||||
return pwm * 3.14 / 2048
|
||||
|
||||
|
||||
def vel2pwm(vel: np.ndarray) -> np.ndarray:
|
||||
"""
|
||||
:param vel: numpy array of rad/s joint velocities
|
||||
:return: numpy array of pwm/s joint velocities
|
||||
"""
|
||||
return (vel * 2048 / 3.14).astype(np.int64)
|
||||
|
||||
|
||||
class ReadAttribute(enum.Enum):
|
||||
TEMPERATURE = 146
|
||||
VOLTAGE = 145
|
||||
VELOCITY = 128
|
||||
POSITION = 132
|
||||
CURRENT = 126
|
||||
PWM = 124
|
||||
HARDWARE_ERROR_STATUS = 70
|
||||
HOMING_OFFSET = 20
|
||||
BAUDRATE = 8
|
||||
|
||||
|
||||
class OperatingMode(enum.Enum):
|
||||
VELOCITY = 1
|
||||
POSITION = 3
|
||||
CURRENT_CONTROLLED_POSITION = 5
|
||||
PWM = 16
|
||||
UNKNOWN = -1
|
||||
|
||||
|
||||
class Dynamixel:
|
||||
ADDR_TORQUE_ENABLE = 64
|
||||
ADDR_GOAL_POSITION = 116
|
||||
ADDR_VELOCITY_LIMIT = 44
|
||||
ADDR_GOAL_PWM = 100
|
||||
OPERATING_MODE_ADDR = 11
|
||||
POSITION_I = 82
|
||||
POSITION_P = 84
|
||||
ADDR_ID = 7
|
||||
|
||||
@dataclass
|
||||
class Config:
|
||||
def instantiate(self):
|
||||
return Dynamixel(self)
|
||||
|
||||
baudrate: int = 57600
|
||||
protocol_version: float = 2.0
|
||||
device_name: str = "" # /dev/tty.usbserial-1120'
|
||||
dynamixel_id: int = 1
|
||||
|
||||
def __init__(self, config: Config):
|
||||
self.config = config
|
||||
self.connect()
|
||||
|
||||
def connect(self):
|
||||
if self.config.device_name == "":
|
||||
for port_name in os.listdir("/dev"):
|
||||
if "ttyUSB" in port_name or "ttyACM" in port_name:
|
||||
self.config.device_name = "/dev/" + port_name
|
||||
print(f"using device {self.config.device_name}")
|
||||
self.portHandler = PortHandler(self.config.device_name)
|
||||
# self.portHandler.LA
|
||||
self.packetHandler = PacketHandler(self.config.protocol_version)
|
||||
if not self.portHandler.openPort():
|
||||
raise Exception(f"Failed to open port {self.config.device_name}")
|
||||
|
||||
if not self.portHandler.setBaudRate(self.config.baudrate):
|
||||
raise Exception(f"failed to set baudrate to {self.config.baudrate}")
|
||||
|
||||
# self.operating_mode = OperatingMode.UNKNOWN
|
||||
# self.torque_enabled = False
|
||||
# self._disable_torque()
|
||||
|
||||
self.operating_modes = [None for _ in range(32)]
|
||||
self.torque_enabled = [None for _ in range(32)]
|
||||
return True
|
||||
|
||||
def disconnect(self):
|
||||
self.portHandler.closePort()
|
||||
|
||||
def set_goal_position(self, motor_id, goal_position):
|
||||
# if self.operating_modes[motor_id] is not OperatingMode.POSITION:
|
||||
# self._disable_torque(motor_id)
|
||||
# self.set_operating_mode(motor_id, OperatingMode.POSITION)
|
||||
|
||||
# if not self.torque_enabled[motor_id]:
|
||||
# self._enable_torque(motor_id)
|
||||
|
||||
# self._enable_torque(motor_id)
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write4ByteTxRx(
|
||||
self.portHandler, motor_id, self.ADDR_GOAL_POSITION, goal_position
|
||||
)
|
||||
# self._process_response(dxl_comm_result, dxl_error)
|
||||
# print(f'set position of motor {motor_id} to {goal_position}')
|
||||
|
||||
def set_pwm_value(self, motor_id: int, pwm_value, tries=3):
|
||||
if self.operating_modes[motor_id] is not OperatingMode.PWM:
|
||||
self._disable_torque(motor_id)
|
||||
self.set_operating_mode(motor_id, OperatingMode.PWM)
|
||||
|
||||
if not self.torque_enabled[motor_id]:
|
||||
self._enable_torque(motor_id)
|
||||
# print(f'enabling torque')
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write2ByteTxRx(
|
||||
self.portHandler, motor_id, self.ADDR_GOAL_PWM, pwm_value
|
||||
)
|
||||
# self._process_response(dxl_comm_result, dxl_error)
|
||||
# print(f'set pwm of motor {motor_id} to {pwm_value}')
|
||||
if dxl_comm_result != COMM_SUCCESS:
|
||||
if tries <= 1:
|
||||
raise ConnectionError(f"dxl_comm_result: {self.packetHandler.getTxRxResult(dxl_comm_result)}")
|
||||
else:
|
||||
print(f"dynamixel pwm setting failure trying again with {tries - 1} tries")
|
||||
self.set_pwm_value(motor_id, pwm_value, tries=tries - 1)
|
||||
elif dxl_error != 0:
|
||||
print(f"dxl error {dxl_error}")
|
||||
raise ConnectionError(f"dynamixel error: {self.packetHandler.getTxRxResult(dxl_error)}")
|
||||
|
||||
def read_temperature(self, motor_id: int):
|
||||
return self._read_value(motor_id, ReadAttribute.TEMPERATURE, 1)
|
||||
|
||||
def read_velocity(self, motor_id: int):
|
||||
pos = self._read_value(motor_id, ReadAttribute.VELOCITY, 4)
|
||||
if pos > 2**31:
|
||||
pos -= 2**32
|
||||
# print(f'read position {pos} for motor {motor_id}')
|
||||
return pos
|
||||
|
||||
def read_position(self, motor_id: int):
|
||||
pos = self._read_value(motor_id, ReadAttribute.POSITION, 4)
|
||||
if pos > 2**31:
|
||||
pos -= 2**32
|
||||
# print(f'read position {pos} for motor {motor_id}')
|
||||
return pos
|
||||
|
||||
def read_position_degrees(self, motor_id: int) -> float:
|
||||
return (self.read_position(motor_id) / 4096) * 360
|
||||
|
||||
def read_position_radians(self, motor_id: int) -> float:
|
||||
return (self.read_position(motor_id) / 4096) * 2 * math.pi
|
||||
|
||||
def read_current(self, motor_id: int):
|
||||
current = self._read_value(motor_id, ReadAttribute.CURRENT, 2)
|
||||
if current > 2**15:
|
||||
current -= 2**16
|
||||
return current
|
||||
|
||||
def read_present_pwm(self, motor_id: int):
|
||||
return self._read_value(motor_id, ReadAttribute.PWM, 2)
|
||||
|
||||
def read_hardware_error_status(self, motor_id: int):
|
||||
return self._read_value(motor_id, ReadAttribute.HARDWARE_ERROR_STATUS, 1)
|
||||
|
||||
def disconnect(self):
|
||||
self.portHandler.closePort()
|
||||
|
||||
def set_id(self, old_id, new_id, use_broadcast_id: bool = False):
|
||||
"""
|
||||
sets the id of the dynamixel servo
|
||||
@param old_id: current id of the servo
|
||||
@param new_id: new id
|
||||
@param use_broadcast_id: set ids of all connected dynamixels if True.
|
||||
If False, change only servo with self.config.id
|
||||
@return:
|
||||
"""
|
||||
if use_broadcast_id:
|
||||
current_id = 254
|
||||
else:
|
||||
current_id = old_id
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write1ByteTxRx(
|
||||
self.portHandler, current_id, self.ADDR_ID, new_id
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, old_id)
|
||||
self.config.id = id
|
||||
|
||||
def _enable_torque(self, motor_id):
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write1ByteTxRx(
|
||||
self.portHandler, motor_id, self.ADDR_TORQUE_ENABLE, 1
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
self.torque_enabled[motor_id] = True
|
||||
|
||||
def _disable_torque(self, motor_id):
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write1ByteTxRx(
|
||||
self.portHandler, motor_id, self.ADDR_TORQUE_ENABLE, 0
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
self.torque_enabled[motor_id] = False
|
||||
|
||||
def _process_response(self, dxl_comm_result: int, dxl_error: int, motor_id: int):
|
||||
if dxl_comm_result != COMM_SUCCESS:
|
||||
raise ConnectionError(
|
||||
f"dxl_comm_result for motor {motor_id}: {self.packetHandler.getTxRxResult(dxl_comm_result)}"
|
||||
)
|
||||
elif dxl_error != 0:
|
||||
print(f"dxl error {dxl_error}")
|
||||
raise ConnectionError(
|
||||
f"dynamixel error for motor {motor_id}: {self.packetHandler.getTxRxResult(dxl_error)}"
|
||||
)
|
||||
|
||||
def set_operating_mode(self, motor_id: int, operating_mode: OperatingMode):
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write2ByteTxRx(
|
||||
self.portHandler, motor_id, self.OPERATING_MODE_ADDR, operating_mode.value
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
self.operating_modes[motor_id] = operating_mode
|
||||
|
||||
def set_pwm_limit(self, motor_id: int, limit: int):
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write2ByteTxRx(self.portHandler, motor_id, 36, limit)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
|
||||
def set_velocity_limit(self, motor_id: int, velocity_limit):
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write4ByteTxRx(
|
||||
self.portHandler, motor_id, self.ADDR_VELOCITY_LIMIT, velocity_limit
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
|
||||
def set_P(self, motor_id: int, P: int):
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write2ByteTxRx(
|
||||
self.portHandler, motor_id, self.POSITION_P, P
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
|
||||
def set_I(self, motor_id: int, I: int):
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write2ByteTxRx(
|
||||
self.portHandler, motor_id, self.POSITION_I, I
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
|
||||
def read_home_offset(self, motor_id: int):
|
||||
self._disable_torque(motor_id)
|
||||
# dxl_comm_result, dxl_error = self.packetHandler.write4ByteTxRx(self.portHandler, motor_id,
|
||||
# ReadAttribute.HOMING_OFFSET.value, home_position)
|
||||
home_offset = self._read_value(motor_id, ReadAttribute.HOMING_OFFSET, 4)
|
||||
# self._process_response(dxl_comm_result, dxl_error)
|
||||
self._enable_torque(motor_id)
|
||||
return home_offset
|
||||
|
||||
def set_home_offset(self, motor_id: int, home_position: int):
|
||||
self._disable_torque(motor_id)
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write4ByteTxRx(
|
||||
self.portHandler, motor_id, ReadAttribute.HOMING_OFFSET.value, home_position
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
self._enable_torque(motor_id)
|
||||
|
||||
def set_baudrate(self, motor_id: int, baudrate):
|
||||
# translate baudrate into dynamixel baudrate setting id
|
||||
if baudrate == 57600:
|
||||
baudrate_id = 1
|
||||
elif baudrate == 1_000_000:
|
||||
baudrate_id = 3
|
||||
elif baudrate == 2_000_000:
|
||||
baudrate_id = 4
|
||||
elif baudrate == 3_000_000:
|
||||
baudrate_id = 5
|
||||
elif baudrate == 4_000_000:
|
||||
baudrate_id = 6
|
||||
else:
|
||||
raise Exception("baudrate not implemented")
|
||||
|
||||
self._disable_torque(motor_id)
|
||||
dxl_comm_result, dxl_error = self.packetHandler.write1ByteTxRx(
|
||||
self.portHandler, motor_id, ReadAttribute.BAUDRATE.value, baudrate_id
|
||||
)
|
||||
self._process_response(dxl_comm_result, dxl_error, motor_id)
|
||||
|
||||
def _read_value(self, motor_id, attribute: ReadAttribute, num_bytes: int, tries=10):
|
||||
try:
|
||||
if num_bytes == 1:
|
||||
value, dxl_comm_result, dxl_error = self.packetHandler.read1ByteTxRx(
|
||||
self.portHandler, motor_id, attribute.value
|
||||
)
|
||||
elif num_bytes == 2:
|
||||
value, dxl_comm_result, dxl_error = self.packetHandler.read2ByteTxRx(
|
||||
self.portHandler, motor_id, attribute.value
|
||||
)
|
||||
elif num_bytes == 4:
|
||||
value, dxl_comm_result, dxl_error = self.packetHandler.read4ByteTxRx(
|
||||
self.portHandler, motor_id, attribute.value
|
||||
)
|
||||
except Exception:
|
||||
if tries == 0:
|
||||
raise Exception
|
||||
else:
|
||||
return self._read_value(motor_id, attribute, num_bytes, tries=tries - 1)
|
||||
if dxl_comm_result != COMM_SUCCESS:
|
||||
if tries <= 1:
|
||||
# print("%s" % self.packetHandler.getTxRxResult(dxl_comm_result))
|
||||
raise ConnectionError(f"dxl_comm_result {dxl_comm_result} for servo {motor_id} value {value}")
|
||||
else:
|
||||
print(f"dynamixel read failure for servo {motor_id} trying again with {tries - 1} tries")
|
||||
time.sleep(0.02)
|
||||
return self._read_value(motor_id, attribute, num_bytes, tries=tries - 1)
|
||||
elif dxl_error != 0: # # print("%s" % self.packetHandler.getRxPacketError(dxl_error))
|
||||
# raise ConnectionError(f'dxl_error {dxl_error} binary ' + "{0:b}".format(37))
|
||||
if tries == 0 and dxl_error != 128:
|
||||
raise Exception(f"Failed to read value from motor {motor_id} error is {dxl_error}")
|
||||
else:
|
||||
return self._read_value(motor_id, attribute, num_bytes, tries=tries - 1)
|
||||
return value
|
||||
|
||||
def set_home_position(self, motor_id: int):
|
||||
print(f"setting home position for motor {motor_id}")
|
||||
self.set_home_offset(motor_id, 0)
|
||||
current_position = self.read_position(motor_id)
|
||||
print(f"position before {current_position}")
|
||||
self.set_home_offset(motor_id, -current_position)
|
||||
# dynamixel.set_home_offset(motor_id, -4096)
|
||||
# dynamixel.set_home_offset(motor_id, -4294964109)
|
||||
current_position = self.read_position(motor_id)
|
||||
# print(f'signed position {current_position - 2** 32}')
|
||||
print(f"position after {current_position}")
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
dynamixel = Dynamixel.Config(baudrate=1_000_000, device_name="/dev/tty.usbmodem57380045631").instantiate()
|
||||
motor_id = 1
|
||||
pos = dynamixel.read_position(motor_id)
|
||||
for i in range(10):
|
||||
s = time.monotonic()
|
||||
pos = dynamixel.read_position(motor_id)
|
||||
delta = time.monotonic() - s
|
||||
print(f"read position took {delta}")
|
||||
print(f"position {pos}")
|
||||
@@ -1,192 +0,0 @@
|
||||
import time
|
||||
from unittest.mock import MagicMock
|
||||
|
||||
import cv2
|
||||
import gymnasium as gym
|
||||
import numpy as np
|
||||
from gymnasium import spaces
|
||||
|
||||
from .dynamixel import pos2pwm, pwm2pos
|
||||
from .robot import Robot
|
||||
|
||||
FPS = 30
|
||||
|
||||
CAMERAS_SHAPES = {
|
||||
"images.high": (480, 640, 3),
|
||||
"images.low": (480, 640, 3),
|
||||
}
|
||||
|
||||
CAMERAS_PORTS = {
|
||||
"images.high": "/dev/video6",
|
||||
"images.low": "/dev/video0",
|
||||
}
|
||||
|
||||
LEADER_PORT = "/dev/ttyACM1"
|
||||
FOLLOWER_PORT = "/dev/ttyACM0"
|
||||
|
||||
MockRobot = MagicMock()
|
||||
MockRobot.read_position = MagicMock()
|
||||
MockRobot.read_position.return_value = np.array([0.0, 1.0, 2.0, 3.0, 4.0, 5.0])
|
||||
|
||||
MockCamera = MagicMock()
|
||||
MockCamera.isOpened = MagicMock(return_value=True)
|
||||
MockCamera.read = MagicMock(return_value=(True, np.zeros((480, 640, 3), dtype=np.uint8)))
|
||||
|
||||
|
||||
def capture_image(cam, cam_width, cam_height):
|
||||
# Capture a single frame
|
||||
_, frame = cam.read()
|
||||
image = cv2.cvtColor(frame, cv2.COLOR_BGR2RGB)
|
||||
# # Define your crop coordinates (top left corner and bottom right corner)
|
||||
# x1, y1 = 400, 0 # Example starting coordinates (top left of the crop rectangle)
|
||||
# x2, y2 = 1600, 900 # Example ending coordinates (bottom right of the crop rectangle)
|
||||
# # Crop the image
|
||||
# image = image[y1:y2, x1:x2]
|
||||
# Resize the image
|
||||
image = cv2.resize(image, (cam_width, cam_height), interpolation=cv2.INTER_AREA)
|
||||
|
||||
return image
|
||||
|
||||
|
||||
class RealEnv(gym.Env):
|
||||
metadata = {}
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
record: bool = False,
|
||||
num_joints: int = 6,
|
||||
cameras_shapes: dict = CAMERAS_SHAPES,
|
||||
cameras_ports: dict = CAMERAS_PORTS,
|
||||
follower_port: str = FOLLOWER_PORT,
|
||||
leader_port: str = LEADER_PORT,
|
||||
warmup_steps: int = 100,
|
||||
trigger_torque=70,
|
||||
fps: int = FPS,
|
||||
fps_tolerance: float = 0.1,
|
||||
mock: bool = False,
|
||||
):
|
||||
self.num_joints = num_joints
|
||||
self.cameras_shapes = cameras_shapes
|
||||
self.cameras_ports = cameras_ports
|
||||
self.warmup_steps = warmup_steps
|
||||
assert len(self.cameras_shapes) == len(self.cameras_ports), "Number of cameras and shapes must match."
|
||||
|
||||
self.follower_port = follower_port
|
||||
self.leader_port = leader_port
|
||||
self.record = record
|
||||
self.fps = fps
|
||||
self.fps_tolerance = fps_tolerance
|
||||
|
||||
# Initialize the robot
|
||||
self.follower = Robot(device_name=self.follower_port) if not mock else MockRobot
|
||||
if self.record:
|
||||
self.leader = Robot(device_name=self.leader_port) if not mock else MockRobot
|
||||
self.leader.set_trigger_torque(trigger_torque)
|
||||
|
||||
# Initialize the cameras - sorted by camera names
|
||||
self.cameras = {}
|
||||
for cn, p in sorted(self.cameras_ports.items()):
|
||||
self.cameras[cn] = cv2.VideoCapture(p) if not mock else MockCamera
|
||||
if not self.cameras[cn].isOpened():
|
||||
raise OSError(
|
||||
f"Cannot open camera port {p} for {cn}."
|
||||
f" Make sure the camera is connected and the port is correct."
|
||||
f"Also check you are not spinning several instances of the same environment (eval.batch_size)"
|
||||
)
|
||||
|
||||
# Specify gym action and observation spaces
|
||||
observation_space = {}
|
||||
|
||||
if self.num_joints > 0:
|
||||
observation_space["agent_pos"] = spaces.Box(
|
||||
low=-1000.0,
|
||||
high=1000.0,
|
||||
shape=(num_joints,),
|
||||
dtype=np.float64,
|
||||
)
|
||||
if self.record:
|
||||
observation_space["leader_pos"] = spaces.Box(
|
||||
low=-1000.0,
|
||||
high=1000.0,
|
||||
shape=(num_joints,),
|
||||
dtype=np.float64,
|
||||
)
|
||||
|
||||
if self.cameras_shapes:
|
||||
for cn, hwc_shape in self.cameras_shapes.items():
|
||||
# Assumes images are unsigned int8 in [0,255]
|
||||
observation_space[cn] = spaces.Box(
|
||||
low=0,
|
||||
high=255,
|
||||
# height x width x channels (e.g. 480 x 640 x 3)
|
||||
shape=hwc_shape,
|
||||
dtype=np.uint8,
|
||||
)
|
||||
|
||||
self.observation_space = spaces.Dict(observation_space)
|
||||
self.action_space = spaces.Box(low=-1, high=1, shape=(num_joints,), dtype=np.float32)
|
||||
|
||||
self._observation = {}
|
||||
self._terminated = False
|
||||
self.timestamps = []
|
||||
|
||||
def _get_obs(self):
|
||||
qpos = self.follower.read_position()
|
||||
self._observation["agent_pos"] = pwm2pos(qpos)
|
||||
for cn, c in self.cameras.items():
|
||||
self._observation[cn] = capture_image(c, self.cameras_shapes[cn][1], self.cameras_shapes[cn][0])
|
||||
|
||||
if self.record:
|
||||
action = self.leader.read_position()
|
||||
self._observation["leader_pos"] = pwm2pos(action)
|
||||
|
||||
def reset(self, seed: int | None = None):
|
||||
# Reset the robot and sync the leader and follower if we are recording
|
||||
for _ in range(self.warmup_steps):
|
||||
self._get_obs()
|
||||
if self.record:
|
||||
self.follower.set_goal_pos(pos2pwm(self._observation["leader_pos"]))
|
||||
self._terminated = False
|
||||
info = {}
|
||||
self.timestamps = []
|
||||
return self._observation, info
|
||||
|
||||
def step(self, action: np.ndarray = None):
|
||||
if self.timestamps:
|
||||
# wait the right amount of time to stay at the desired fps
|
||||
time.sleep(max(0, 1 / self.fps - (time.time() - self.timestamps[-1])))
|
||||
|
||||
self.timestamps.append(time.time())
|
||||
|
||||
# Get the observation
|
||||
self._get_obs()
|
||||
if self.record:
|
||||
# Teleoperate the leader
|
||||
self.follower.set_goal_pos(pos2pwm(self._observation["leader_pos"]))
|
||||
else:
|
||||
# Apply the action to the follower
|
||||
self.follower.set_goal_pos(pos2pwm(action))
|
||||
|
||||
reward = 0
|
||||
terminated = truncated = self._terminated
|
||||
info = {"timestamp": self.timestamps[-1] - self.timestamps[0], "fps_error": False}
|
||||
|
||||
# Check if we are able to keep up with the desired fps
|
||||
if len(self.timestamps) > 1 and (self.timestamps[-1] - self.timestamps[-2]) > 1 / (
|
||||
self.fps - self.fps_tolerance
|
||||
):
|
||||
print(
|
||||
f"Error: recording fps {1 / (self.timestamps[-1] - self.timestamps[-2]):.5f} is lower"
|
||||
f" than min admited fps {(self.fps - self.fps_tolerance):.5f}"
|
||||
f" at frame {len(self.timestamps)}"
|
||||
)
|
||||
info["fps_error"] = True
|
||||
|
||||
return self._observation, reward, terminated, truncated, info
|
||||
|
||||
def render(self): ...
|
||||
|
||||
def close(self):
|
||||
self.follower._disable_torque()
|
||||
if self.record:
|
||||
self.leader._disable_torque()
|
||||
@@ -1,168 +0,0 @@
|
||||
# ruff: noqa
|
||||
"""From Alexander Koch low_cost_robot codebase at https://github.com/AlexanderKoch-Koch/low_cost_robot
|
||||
Class to control the robot using dynamixel servos.
|
||||
"""
|
||||
|
||||
from enum import Enum, auto
|
||||
from typing import Union
|
||||
|
||||
import numpy as np
|
||||
from dynamixel_sdk import DXL_HIBYTE, DXL_HIWORD, DXL_LOBYTE, DXL_LOWORD, GroupSyncRead, GroupSyncWrite
|
||||
|
||||
from .dynamixel import Dynamixel, OperatingMode, ReadAttribute
|
||||
|
||||
|
||||
class MotorControlType(Enum):
|
||||
PWM = auto()
|
||||
POSITION_CONTROL = auto()
|
||||
DISABLED = auto()
|
||||
UNKNOWN = auto()
|
||||
|
||||
|
||||
class Robot:
|
||||
def __init__(self, device_name: str, baudrate=1_000_000, servo_ids=[1, 2, 3, 4, 5, 6]) -> None:
|
||||
self.servo_ids = servo_ids
|
||||
self.dynamixel = Dynamixel.Config(baudrate=baudrate, device_name=device_name).instantiate()
|
||||
self._init_motors()
|
||||
|
||||
def _init_motors(self):
|
||||
self.position_reader = GroupSyncRead(
|
||||
self.dynamixel.portHandler, self.dynamixel.packetHandler, ReadAttribute.POSITION.value, 4
|
||||
)
|
||||
for id in self.servo_ids:
|
||||
self.position_reader.addParam(id)
|
||||
|
||||
self.velocity_reader = GroupSyncRead(
|
||||
self.dynamixel.portHandler, self.dynamixel.packetHandler, ReadAttribute.VELOCITY.value, 4
|
||||
)
|
||||
for id in self.servo_ids:
|
||||
self.velocity_reader.addParam(id)
|
||||
|
||||
self.pos_writer = GroupSyncWrite(
|
||||
self.dynamixel.portHandler, self.dynamixel.packetHandler, self.dynamixel.ADDR_GOAL_POSITION, 4
|
||||
)
|
||||
for id in self.servo_ids:
|
||||
self.pos_writer.addParam(id, [2048])
|
||||
|
||||
self.pwm_writer = GroupSyncWrite(
|
||||
self.dynamixel.portHandler, self.dynamixel.packetHandler, self.dynamixel.ADDR_GOAL_PWM, 2
|
||||
)
|
||||
for id in self.servo_ids:
|
||||
self.pwm_writer.addParam(id, [2048])
|
||||
self._disable_torque()
|
||||
self.motor_control_state = MotorControlType.DISABLED
|
||||
|
||||
def read_position(self, tries=2):
|
||||
"""
|
||||
Reads the joint positions of the robot. 2048 is the center position. 0 and 4096 are 180 degrees in each direction.
|
||||
:param tries: maximum number of tries to read the position
|
||||
:return: list of joint positions in range [0, 4096]
|
||||
"""
|
||||
result = self.position_reader.txRxPacket()
|
||||
if result != 0:
|
||||
if tries > 0:
|
||||
return self.read_position(tries=tries - 1)
|
||||
else:
|
||||
print("failed to read position!!!!!!!!!!!!!!!!!!!!!!!!!!!!!")
|
||||
positions = []
|
||||
for id in self.servo_ids:
|
||||
position = self.position_reader.getData(id, ReadAttribute.POSITION.value, 4)
|
||||
if position > 2**31:
|
||||
position -= 2**32
|
||||
positions.append(position)
|
||||
return np.array(positions)
|
||||
|
||||
def read_velocity(self):
|
||||
"""
|
||||
Reads the joint velocities of the robot.
|
||||
:return: list of joint velocities,
|
||||
"""
|
||||
self.velocity_reader.txRxPacket()
|
||||
velocties = []
|
||||
for id in self.servo_ids:
|
||||
velocity = self.velocity_reader.getData(id, ReadAttribute.VELOCITY.value, 4)
|
||||
if velocity > 2**31:
|
||||
velocity -= 2**32
|
||||
velocties.append(velocity)
|
||||
return np.array(velocties)
|
||||
|
||||
def set_goal_pos(self, action):
|
||||
"""
|
||||
:param action: list or numpy array of target joint positions in range [0, 4096]
|
||||
"""
|
||||
if self.motor_control_state is not MotorControlType.POSITION_CONTROL:
|
||||
self._set_position_control()
|
||||
for i, motor_id in enumerate(self.servo_ids):
|
||||
data_write = [
|
||||
DXL_LOBYTE(DXL_LOWORD(action[i])),
|
||||
DXL_HIBYTE(DXL_LOWORD(action[i])),
|
||||
DXL_LOBYTE(DXL_HIWORD(action[i])),
|
||||
DXL_HIBYTE(DXL_HIWORD(action[i])),
|
||||
]
|
||||
self.pos_writer.changeParam(motor_id, data_write)
|
||||
|
||||
self.pos_writer.txPacket()
|
||||
|
||||
def set_pwm(self, action):
|
||||
"""
|
||||
Sets the pwm values for the servos.
|
||||
:param action: list or numpy array of pwm values in range [0, 885]
|
||||
"""
|
||||
if self.motor_control_state is not MotorControlType.PWM:
|
||||
self._set_pwm_control()
|
||||
for i, motor_id in enumerate(self.servo_ids):
|
||||
data_write = [
|
||||
DXL_LOBYTE(DXL_LOWORD(action[i])),
|
||||
DXL_HIBYTE(DXL_LOWORD(action[i])),
|
||||
]
|
||||
self.pwm_writer.changeParam(motor_id, data_write)
|
||||
|
||||
self.pwm_writer.txPacket()
|
||||
|
||||
def set_trigger_torque(self, torque: int):
|
||||
"""
|
||||
Sets a constant torque torque for the last servo in the chain. This is useful for the trigger of the leader arm
|
||||
"""
|
||||
self.dynamixel._enable_torque(self.servo_ids[-1])
|
||||
self.dynamixel.set_pwm_value(self.servo_ids[-1], torque)
|
||||
|
||||
def limit_pwm(self, limit: Union[int, list, np.ndarray]):
|
||||
"""
|
||||
Limits the pwm values for the servos in for position control
|
||||
@param limit: 0 ~ 885
|
||||
@return:
|
||||
"""
|
||||
if isinstance(limit, int):
|
||||
limits = [
|
||||
limit,
|
||||
] * 5
|
||||
else:
|
||||
limits = limit
|
||||
self._disable_torque()
|
||||
for motor_id, limit in zip(self.servo_ids, limits, strict=False):
|
||||
self.dynamixel.set_pwm_limit(motor_id, limit)
|
||||
self._enable_torque()
|
||||
|
||||
def _disable_torque(self):
|
||||
print(f"disabling torque for servos {self.servo_ids}")
|
||||
for motor_id in self.servo_ids:
|
||||
self.dynamixel._disable_torque(motor_id)
|
||||
|
||||
def _enable_torque(self):
|
||||
print(f"enabling torque for servos {self.servo_ids}")
|
||||
for motor_id in self.servo_ids:
|
||||
self.dynamixel._enable_torque(motor_id)
|
||||
|
||||
def _set_pwm_control(self):
|
||||
self._disable_torque()
|
||||
for motor_id in self.servo_ids:
|
||||
self.dynamixel.set_operating_mode(motor_id, OperatingMode.PWM)
|
||||
self._enable_torque()
|
||||
self.motor_control_state = MotorControlType.PWM
|
||||
|
||||
def _set_position_control(self):
|
||||
self._disable_torque()
|
||||
for motor_id in self.servo_ids:
|
||||
self.dynamixel.set_operating_mode(motor_id, OperatingMode.POSITION)
|
||||
self._enable_torque()
|
||||
self.motor_control_state = MotorControlType.POSITION_CONTROL
|
||||
@@ -1,237 +0,0 @@
|
||||
"""This script demonstrates how to record a LeRobot dataset of training data
|
||||
using a very simple gym environment (see in examples/real_robot_example/gym_real_world/gym_environment.py).
|
||||
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import copy
|
||||
import os
|
||||
from pathlib import Path
|
||||
|
||||
import gym_real_world # noqa: F401
|
||||
import gymnasium as gym
|
||||
import numpy as np
|
||||
import torch
|
||||
from datasets import Dataset, Features, Sequence, Value
|
||||
from omegaconf import OmegaConf
|
||||
from tqdm import tqdm
|
||||
|
||||
from lerobot.common.datasets.compute_stats import compute_stats
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION, DATA_DIR, LeRobotDataset
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.utils import (
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
from lerobot.scripts.push_dataset_to_hub import push_meta_data_to_hub, push_videos_to_hub, save_meta_data
|
||||
|
||||
# parse the repo_id name via command line
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument("--repo-id", type=str, default="thomwolf/blue_red_sort")
|
||||
parser.add_argument("--num-episodes", type=int, default=2)
|
||||
parser.add_argument("--num-frames", type=int, default=400)
|
||||
parser.add_argument("--num-workers", type=int, default=16)
|
||||
parser.add_argument("--keep-last", action="store_true")
|
||||
parser.add_argument("--data_dir", type=str, default=None)
|
||||
parser.add_argument("--push-to-hub", action="store_true")
|
||||
parser.add_argument("--fps", type=int, default=30, help="Frames per second of the recording.")
|
||||
parser.add_argument(
|
||||
"--fps_tolerance",
|
||||
type=float,
|
||||
default=0.5,
|
||||
help="Tolerance in fps for the recording before dropping episodes.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--revision", type=str, default=CODEBASE_VERSION, help="Codebase version used to generate the dataset."
|
||||
)
|
||||
parser.add_argument("--gym-config", type=str, default=None, help="Path to the gym config file.")
|
||||
parser.add_argument("--mock_robot", action="store_true")
|
||||
args = parser.parse_args()
|
||||
|
||||
repo_id = args.repo_id
|
||||
num_episodes = args.num_episodes
|
||||
num_frames = args.num_frames
|
||||
revision = args.revision
|
||||
fps = args.fps
|
||||
fps_tolerance = args.fps_tolerance
|
||||
|
||||
out_data = DATA_DIR / repo_id if args.data_dir is None else Path(args.data_dir)
|
||||
|
||||
# During data collection, frames are stored as png images in `images_dir`
|
||||
images_dir = out_data / "images"
|
||||
# After data collection, png images of each episode are encoded into a mp4 file stored in `videos_dir`
|
||||
videos_dir = out_data / "videos"
|
||||
meta_data_dir = out_data / "meta_data"
|
||||
|
||||
gym_config = None
|
||||
if args.config is not None:
|
||||
gym_config = OmegaConf.load(args.config)
|
||||
|
||||
# Create image and video directories
|
||||
if not os.path.exists(images_dir):
|
||||
os.makedirs(images_dir, exist_ok=True)
|
||||
if not os.path.exists(videos_dir):
|
||||
os.makedirs(videos_dir, exist_ok=True)
|
||||
|
||||
if __name__ == "__main__":
|
||||
# Create the gym environment - check the kwargs in gym_real_world/gym_environment.py
|
||||
gym_handle = "gym_real_world/RealEnv-v0"
|
||||
gym_kwargs = {}
|
||||
if gym_config is not None:
|
||||
gym_kwargs = OmegaConf.to_container(gym_config.gym_kwargs)
|
||||
env = gym.make(
|
||||
gym_handle, disable_env_checker=True, record=True, fps=fps, fps_tolerance=fps_tolerance, mock=True
|
||||
)
|
||||
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
ep_fps = []
|
||||
id_from = 0
|
||||
id_to = 0
|
||||
os.system('spd-say "gym environment created"')
|
||||
|
||||
ep_idx = 0
|
||||
while ep_idx < num_episodes:
|
||||
# bring the follower to the leader and start camera
|
||||
env.reset()
|
||||
|
||||
os.system(f'spd-say "go {ep_idx}"')
|
||||
# init buffers
|
||||
obs_replay = {k: [] for k in env.observation_space}
|
||||
|
||||
drop_episode = False
|
||||
timestamps = []
|
||||
for _ in tqdm(range(num_frames)):
|
||||
# Apply the next action
|
||||
observation, _, _, _, info = env.step(action=None)
|
||||
# images_stacked = np.hstack(list(observation['pixels'].values()))
|
||||
# images_stacked = cv2.cvtColor(images_stacked, cv2.COLOR_RGB2BGR)
|
||||
# cv2.imshow('frame', images_stacked)
|
||||
|
||||
if info["fps_error"]:
|
||||
os.system(f'spd-say "Error fps too low, dropping episode {ep_idx}"')
|
||||
drop_episode = True
|
||||
break
|
||||
|
||||
# store data
|
||||
for key in observation:
|
||||
obs_replay[key].append(copy.deepcopy(observation[key]))
|
||||
timestamps.append(info["timestamp"])
|
||||
|
||||
# if cv2.waitKey(1) & 0xFF == ord('q'):
|
||||
# break
|
||||
|
||||
os.system('spd-say "stop"')
|
||||
|
||||
if not drop_episode:
|
||||
os.system(f'spd-say "saving episode {ep_idx}"')
|
||||
ep_dict = {}
|
||||
# store images in png and create the video
|
||||
for img_key in env.cameras:
|
||||
save_images_concurrently(
|
||||
obs_replay[img_key],
|
||||
images_dir / f"{img_key}_episode_{ep_idx:06d}",
|
||||
args.num_workers,
|
||||
)
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
# store the reference to the video frame
|
||||
ep_dict[f"observation.{img_key}"] = [
|
||||
{"path": f"videos/{fname}", "timestamp": tstp} for tstp in timestamps
|
||||
]
|
||||
|
||||
state = torch.tensor(np.array(obs_replay["agent_pos"]))
|
||||
action = torch.tensor(np.array(obs_replay["leader_pos"]))
|
||||
next_done = torch.zeros(num_frames, dtype=torch.bool)
|
||||
next_done[-1] = True
|
||||
|
||||
ep_dict["observation.state"] = state
|
||||
ep_dict["action"] = action
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.tensor(timestamps)
|
||||
ep_dict["next.done"] = next_done
|
||||
ep_fps.append(num_frames / timestamps[-1])
|
||||
ep_dicts.append(ep_dict)
|
||||
print(f"Episode {ep_idx} done, fps: {ep_fps[-1]:.2f}")
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(
|
||||
id_from + num_frames if args.keep_last else id_from + num_frames - 1
|
||||
)
|
||||
|
||||
id_to = id_from + num_frames if args.keep_last else id_from + num_frames - 1
|
||||
id_from = id_to
|
||||
|
||||
ep_idx += 1
|
||||
|
||||
env.close()
|
||||
|
||||
os.system('spd-say "encode video frames"')
|
||||
for ep_idx in range(num_episodes):
|
||||
for img_key in env.cameras:
|
||||
# If necessary, we may want to encode the video
|
||||
# with variable frame rate: https://superuser.com/questions/1661901/encoding-video-from-vfr-still-images
|
||||
encode_video_frames(
|
||||
images_dir / f"{img_key}_episode_{ep_idx:06d}",
|
||||
videos_dir / f"{img_key}_episode_{ep_idx:06d}.mp4",
|
||||
ep_fps[ep_idx],
|
||||
)
|
||||
|
||||
os.system('spd-say "concatenate episodes"')
|
||||
data_dict = concatenate_episodes(
|
||||
ep_dicts, drop_episodes_last_frame=not args.keep_last
|
||||
) # Since our fps varies we are sometimes off tolerance for the last frame
|
||||
|
||||
features = {}
|
||||
|
||||
keys = [key for key in data_dict if "observation.images." in key]
|
||||
for key in keys:
|
||||
features[key] = VideoFrame()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
features["episode_index"] = Value(dtype="int64", id=None)
|
||||
features["frame_index"] = Value(dtype="int64", id=None)
|
||||
features["timestamp"] = Value(dtype="float32", id=None)
|
||||
features["next.done"] = Value(dtype="bool", id=None)
|
||||
features["index"] = Value(dtype="int64", id=None)
|
||||
|
||||
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||
hf_dataset.set_transform(hf_transform_to_torch)
|
||||
|
||||
info = {
|
||||
"fps": sum(ep_fps) / len(ep_fps), # to have a good tolerance in data processing for the slowest video
|
||||
"video": 1,
|
||||
}
|
||||
|
||||
os.system('spd-say "from preloaded"')
|
||||
lerobot_dataset = LeRobotDataset.from_preloaded(
|
||||
repo_id=repo_id,
|
||||
version=revision,
|
||||
hf_dataset=hf_dataset,
|
||||
episode_data_index=episode_data_index,
|
||||
info=info,
|
||||
videos_dir=videos_dir,
|
||||
)
|
||||
os.system('spd-say "compute stats"')
|
||||
stats = compute_stats(lerobot_dataset)
|
||||
|
||||
os.system('spd-say "save to disk"')
|
||||
hf_dataset = hf_dataset.with_format(None) # to remove transforms that cant be saved
|
||||
hf_dataset.save_to_disk(str(out_data / "train"))
|
||||
|
||||
save_meta_data(info, stats, episode_data_index, meta_data_dir)
|
||||
|
||||
if args.push_to_hub:
|
||||
hf_dataset.push_to_hub(repo_id, token=True, revision="main")
|
||||
hf_dataset.push_to_hub(repo_id, token=True, revision=revision)
|
||||
|
||||
push_meta_data_to_hub(repo_id, meta_data_dir, revision="main")
|
||||
push_meta_data_to_hub(repo_id, meta_data_dir, revision=revision)
|
||||
|
||||
push_videos_to_hub(repo_id, videos_dir, revision="main")
|
||||
push_videos_to_hub(repo_id, videos_dir, revision=revision)
|
||||
@@ -1,60 +0,0 @@
|
||||
import argparse
|
||||
import logging
|
||||
from pathlib import Path
|
||||
|
||||
import gym_real_world # noqa: F401
|
||||
import gymnasium as gym # noqa: F401
|
||||
from huggingface_hub import snapshot_download
|
||||
from huggingface_hub.utils._errors import RepositoryNotFoundError
|
||||
from huggingface_hub.utils._validators import HFValidationError
|
||||
|
||||
from lerobot.common.utils.utils import init_logging
|
||||
from lerobot.scripts.eval import eval
|
||||
|
||||
if __name__ == "__main__":
|
||||
init_logging()
|
||||
|
||||
parser = argparse.ArgumentParser(
|
||||
description=__doc__, formatter_class=argparse.RawDescriptionHelpFormatter
|
||||
)
|
||||
group = parser.add_mutually_exclusive_group(required=True)
|
||||
group.add_argument(
|
||||
"-p",
|
||||
"--pretrained-policy-name-or-path",
|
||||
help=(
|
||||
"Either the repo ID of a model hosted on the Hub or a path to a directory containing weights "
|
||||
"saved using `Policy.save_pretrained`. If not provided, the policy is initialized from scratch "
|
||||
"(useful for debugging). This argument is mutually exclusive with `--config`."
|
||||
),
|
||||
)
|
||||
parser.add_argument("--revision", help="Optionally provide the Hugging Face Hub revision ID.")
|
||||
parser.add_argument(
|
||||
"overrides",
|
||||
nargs="*",
|
||||
help="Any key=value arguments to override config values (use dots for.nested=overrides)",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
|
||||
try:
|
||||
pretrained_policy_path = Path(
|
||||
snapshot_download(args.pretrained_policy_name_or_path, revision=args.revision)
|
||||
)
|
||||
except (HFValidationError, RepositoryNotFoundError) as e:
|
||||
if isinstance(e, HFValidationError):
|
||||
error_message = (
|
||||
"The provided pretrained_policy_name_or_path is not a valid Hugging Face Hub repo ID."
|
||||
)
|
||||
else:
|
||||
error_message = (
|
||||
"The provided pretrained_policy_name_or_path was not found on the Hugging Face Hub."
|
||||
)
|
||||
|
||||
logging.warning(f"{error_message} Treating it as a local directory.")
|
||||
pretrained_policy_path = Path(args.pretrained_policy_name_or_path)
|
||||
if not pretrained_policy_path.is_dir() or not pretrained_policy_path.exists():
|
||||
raise ValueError(
|
||||
"The provided pretrained_policy_name_or_path is not a valid/existing Hugging Face Hub "
|
||||
"repo ID, nor is it an existing local directory."
|
||||
)
|
||||
|
||||
eval(pretrained_policy_path=pretrained_policy_path, config_overrides=args.overrides)
|
||||
@@ -1,19 +0,0 @@
|
||||
# @package _global_
|
||||
|
||||
fps: 30
|
||||
|
||||
env:
|
||||
name: real_world
|
||||
task: RealEnv-v0
|
||||
state_dim: 6
|
||||
action_dim: 6
|
||||
fps: ${fps}
|
||||
episode_length: 200
|
||||
real_world: true
|
||||
gym:
|
||||
cameras_shapes:
|
||||
images.high: [480, 640, 3]
|
||||
images.low: [480, 640, 3]
|
||||
cameras_ports:
|
||||
images.high: /dev/video6
|
||||
images.low: /dev/video0
|
||||
@@ -1,19 +0,0 @@
|
||||
# @package _global_
|
||||
|
||||
fps: 30
|
||||
|
||||
env:
|
||||
name: real_world
|
||||
task: RealEnv-v0
|
||||
state_dim: 6
|
||||
action_dim: 6
|
||||
fps: ${fps}
|
||||
episode_length: 200
|
||||
real_world: true
|
||||
gym:
|
||||
cameras_shapes:
|
||||
images.top: [480, 640, 3]
|
||||
images.front: [480, 640, 3]
|
||||
cameras_ports:
|
||||
images.top: /dev/video6
|
||||
images.front: /dev/video0
|
||||
@@ -27,6 +27,9 @@ Example:
|
||||
print(lerobot.available_real_world_datasets)
|
||||
print(lerobot.available_policies)
|
||||
print(lerobot.available_policies_per_env)
|
||||
print(lerobot.available_robots)
|
||||
print(lerobot.available_cameras)
|
||||
print(lerobot.available_motors)
|
||||
```
|
||||
|
||||
When implementing a new dataset loadable with LeRobotDataset follow these steps:
|
||||
@@ -70,6 +73,8 @@ available_datasets_per_env = {
|
||||
"lerobot/aloha_sim_transfer_cube_human_image",
|
||||
"lerobot/aloha_sim_transfer_cube_scripted_image",
|
||||
],
|
||||
# TODO(alexander-soare): Add "lerobot/pusht_keypoints". Right now we can't because this is too tightly
|
||||
# coupled with tests.
|
||||
"pusht": ["lerobot/pusht", "lerobot/pusht_image"],
|
||||
"xarm": [
|
||||
"lerobot/xarm_lift_medium",
|
||||
@@ -123,30 +128,113 @@ available_real_world_datasets = [
|
||||
"lerobot/aloha_static_vinh_cup_left",
|
||||
"lerobot/aloha_static_ziploc_slide",
|
||||
"lerobot/umi_cup_in_the_wild",
|
||||
"lerobot/unitreeh1_fold_clothes",
|
||||
"lerobot/unitreeh1_rearrange_objects",
|
||||
"lerobot/unitreeh1_two_robot_greeting",
|
||||
"lerobot/unitreeh1_warehouse",
|
||||
"lerobot/nyu_rot_dataset",
|
||||
"lerobot/utokyo_saytap",
|
||||
"lerobot/imperialcollege_sawyer_wrist_cam",
|
||||
"lerobot/utokyo_xarm_bimanual",
|
||||
"lerobot/tokyo_u_lsmo",
|
||||
"lerobot/utokyo_pr2_opening_fridge",
|
||||
"lerobot/cmu_franka_exploration_dataset",
|
||||
"lerobot/cmu_stretch",
|
||||
"lerobot/asu_table_top",
|
||||
"lerobot/utokyo_pr2_tabletop_manipulation",
|
||||
"lerobot/utokyo_xarm_pick_and_place",
|
||||
"lerobot/ucsd_kitchen_dataset",
|
||||
"lerobot/austin_buds_dataset",
|
||||
"lerobot/dlr_sara_grid_clamp",
|
||||
"lerobot/conq_hose_manipulation",
|
||||
"lerobot/columbia_cairlab_pusht_real",
|
||||
"lerobot/dlr_sara_pour",
|
||||
"lerobot/dlr_edan_shared_control",
|
||||
"lerobot/ucsd_pick_and_place_dataset",
|
||||
"lerobot/berkeley_cable_routing",
|
||||
"lerobot/nyu_franka_play_dataset",
|
||||
"lerobot/austin_sirius_dataset",
|
||||
"lerobot/cmu_play_fusion",
|
||||
"lerobot/berkeley_gnm_sac_son",
|
||||
"lerobot/nyu_door_opening_surprising_effectiveness",
|
||||
"lerobot/berkeley_fanuc_manipulation",
|
||||
"lerobot/jaco_play",
|
||||
"lerobot/viola",
|
||||
"lerobot/kaist_nonprehensile",
|
||||
"lerobot/berkeley_mvp",
|
||||
"lerobot/uiuc_d3field",
|
||||
"lerobot/berkeley_gnm_recon",
|
||||
"lerobot/austin_sailor_dataset",
|
||||
"lerobot/utaustin_mutex",
|
||||
"lerobot/roboturk",
|
||||
"lerobot/stanford_hydra_dataset",
|
||||
"lerobot/berkeley_autolab_ur5",
|
||||
"lerobot/stanford_robocook",
|
||||
"lerobot/toto",
|
||||
"lerobot/fmb",
|
||||
"lerobot/droid_100",
|
||||
"lerobot/berkeley_rpt",
|
||||
"lerobot/stanford_kuka_multimodal_dataset",
|
||||
"lerobot/iamlab_cmu_pickup_insert",
|
||||
"lerobot/taco_play",
|
||||
"lerobot/berkeley_gnm_cory_hall",
|
||||
"lerobot/usc_cloth_sim",
|
||||
]
|
||||
|
||||
available_datasets = list(
|
||||
itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets)
|
||||
available_datasets = sorted(
|
||||
set(
|
||||
itertools.chain(
|
||||
*available_datasets_per_env.values(), available_real_world_datasets
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
# lists all available policies from `lerobot/common/policies` by their class attribute: `name`.
|
||||
# lists all available policies from `lerobot/common/policies`
|
||||
available_policies = [
|
||||
"act",
|
||||
"diffusion",
|
||||
"tdmpc",
|
||||
"vqbet",
|
||||
]
|
||||
|
||||
# lists all available robots from `lerobot/common/robot_devices/robots`
|
||||
available_robots = [
|
||||
"koch",
|
||||
"koch_bimanual",
|
||||
"aloha",
|
||||
"so100",
|
||||
"moss",
|
||||
]
|
||||
|
||||
# lists all available cameras from `lerobot/common/robot_devices/cameras`
|
||||
available_cameras = [
|
||||
"opencv",
|
||||
"intelrealsense",
|
||||
]
|
||||
|
||||
# lists all available motors from `lerobot/common/robot_devices/motors`
|
||||
available_motors = [
|
||||
"dynamixel",
|
||||
"feetech",
|
||||
]
|
||||
|
||||
# keys and values refer to yaml files
|
||||
available_policies_per_env = {
|
||||
"aloha": ["act"],
|
||||
"pusht": ["diffusion"],
|
||||
"pusht": ["diffusion", "vqbet"],
|
||||
"xarm": ["tdmpc"],
|
||||
"dora_aloha_real": ["act_real"],
|
||||
"koch_real": ["act_koch_real"],
|
||||
"aloha_real": ["act_aloha_real"],
|
||||
"dora_aloha_real": ["act_aloha_real"],
|
||||
}
|
||||
|
||||
env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
|
||||
env_task_pairs = [
|
||||
(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks
|
||||
]
|
||||
env_dataset_pairs = [
|
||||
(env, dataset) for env, datasets in available_datasets_per_env.items() for dataset in datasets
|
||||
(env, dataset)
|
||||
for env, datasets in available_datasets_per_env.items()
|
||||
for dataset in datasets
|
||||
]
|
||||
env_dataset_policy_triplets = [
|
||||
(env, dataset, policy)
|
||||
|
||||
@@ -1,334 +0,0 @@
|
||||
# Video benchmark
|
||||
|
||||
|
||||
## Questions
|
||||
|
||||
What is the optimal trade-off between:
|
||||
- maximizing loading time with random access,
|
||||
- minimizing memory space on disk,
|
||||
- maximizing success rate of policies?
|
||||
|
||||
How to encode videos?
|
||||
- How much compression (`-crf`)? Low compression with `0`, normal compression with `20` or extreme with `56`?
|
||||
- What pixel format to use (`-pix_fmt`)? `yuv444p` or `yuv420p`?
|
||||
- How many key frames (`-g`)? A key frame every `10` frames?
|
||||
|
||||
How to decode videos?
|
||||
- Which `decoder`? `torchvision`, `torchaudio`, `ffmpegio`, `decord`, or `nvc`?
|
||||
|
||||
## Metrics
|
||||
|
||||
**Percentage of data compression (higher is better)**
|
||||
`compression_factor` is the ratio of the memory space on disk taken by the original images to encode, to the memory space taken by the encoded video. For instance, `compression_factor=4` means that the video takes 4 times less memory space on disk compared to the original images.
|
||||
|
||||
**Percentage of loading time (higher is better)**
|
||||
`load_time_factor` is the ratio of the time it takes to load original images at given timestamps, to the time it takes to decode the exact same frames from the video. Higher is better. For instance, `load_time_factor=0.5` means that decoding from video is 2 times slower than loading the original images.
|
||||
|
||||
**Average L2 error per pixel (lower is better)**
|
||||
`avg_per_pixel_l2_error` is the average L2 error between each decoded frame and its corresponding original image over all requested timestamps, and also divided by the number of pixels in the image to be comparable when switching to different image sizes.
|
||||
|
||||
**Loss of a pretrained policy (higher is better)** (not available)
|
||||
`loss_pretrained` is the result of evaluating with the selected encoding/decoding settings a policy pretrained on original images. It is easier to understand than `avg_l2_error`.
|
||||
|
||||
**Success rate after retraining (higher is better)** (not available)
|
||||
`success_rate` is the result of training and evaluating a policy with the selected encoding/decoding settings. It is the most difficult metric to get but also the very best.
|
||||
|
||||
|
||||
## Variables
|
||||
|
||||
**Image content**
|
||||
We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an appartment, or in a factory, or outdoor, etc. Hence, we run this benchmark on two datasets: `pusht` (simulation) and `umi` (real-world outdoor).
|
||||
|
||||
**Requested timestamps**
|
||||
In this benchmark, we focus on the loading time of random access, so we are not interested in sequentially loading all frames of a video like in a movie. However, the number of consecutive timestamps requested and their spacing can greatly affect the `load_time_factor`. In fact, it is expected to get faster loading time by decoding a large number of consecutive frames from a video, than to load the same data from individual images. To reflect our robotics use case, we consider a few settings:
|
||||
- `single_frame`: 1 frame,
|
||||
- `2_frames`: 2 consecutive frames (e.g. `[t, t + 1 / fps]`),
|
||||
- `2_frames_4_space`: 2 consecutive frames with 4 frames of spacing (e.g `[t, t + 4 / fps]`),
|
||||
|
||||
**Data augmentations**
|
||||
We might revisit this benchmark and find better settings if we train our policies with various data augmentations to make them more robust (e.g. robust to color changes, compression, etc.).
|
||||
|
||||
|
||||
## Results
|
||||
|
||||
**`decoder`**
|
||||
| repo_id | decoder | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | <span style="color: #32CD32;">torchvision</span> | 0.166 | 0.0000119 |
|
||||
| lerobot/pusht | ffmpegio | 0.009 | 0.0001182 |
|
||||
| lerobot/pusht | torchaudio | 0.138 | 0.0000359 |
|
||||
| lerobot/umi_cup_in_the_wild | <span style="color: #32CD32;">torchvision</span> | 0.174 | 0.0000174 |
|
||||
| lerobot/umi_cup_in_the_wild | ffmpegio | 0.010 | 0.0000735 |
|
||||
| lerobot/umi_cup_in_the_wild | torchaudio | 0.154 | 0.0000340 |
|
||||
|
||||
### `1_frame`
|
||||
|
||||
**`pix_fmt`**
|
||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | yuv420p | 3.788 | 0.224 | 0.0000760 |
|
||||
| lerobot/pusht | yuv444p | 3.646 | 0.185 | 0.0000443 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.388 | 0.0000469 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.329 | 0.0000397 |
|
||||
|
||||
**`g`**
|
||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 1 | 2.543 | 0.204 | 0.0000556 |
|
||||
| lerobot/pusht | 2 | 3.646 | 0.182 | 0.0000443 |
|
||||
| lerobot/pusht | 3 | 4.431 | 0.174 | 0.0000450 |
|
||||
| lerobot/pusht | 4 | 5.103 | 0.163 | 0.0000448 |
|
||||
| lerobot/pusht | 5 | 5.625 | 0.163 | 0.0000436 |
|
||||
| lerobot/pusht | 6 | 5.974 | 0.155 | 0.0000427 |
|
||||
| lerobot/pusht | 10 | 6.814 | 0.130 | 0.0000410 |
|
||||
| lerobot/pusht | 15 | 7.431 | 0.105 | 0.0000406 |
|
||||
| lerobot/pusht | 20 | 7.662 | 0.097 | 0.0000400 |
|
||||
| lerobot/pusht | 40 | 8.163 | 0.061 | 0.0000405 |
|
||||
| lerobot/pusht | 100 | 8.761 | 0.039 | 0.0000422 |
|
||||
| lerobot/pusht | None | 8.909 | 0.024 | 0.0000431 |
|
||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.444 | 0.0000601 |
|
||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.345 | 0.0000397 |
|
||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.282 | 0.0000416 |
|
||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.271 | 0.0000415 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.260 | 0.0000415 |
|
||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.249 | 0.0000415 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.195 | 0.0000399 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.169 | 0.0000394 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.140 | 0.0000390 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.096 | 0.0000384 |
|
||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.046 | 0.0000390 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.022 | 0.0000400 |
|
||||
|
||||
**`crf`**
|
||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 0 | 1.699 | 0.175 | 0.0000035 |
|
||||
| lerobot/pusht | 5 | 1.409 | 0.181 | 0.0000080 |
|
||||
| lerobot/pusht | 10 | 1.842 | 0.172 | 0.0000123 |
|
||||
| lerobot/pusht | 15 | 2.322 | 0.187 | 0.0000211 |
|
||||
| lerobot/pusht | 20 | 3.050 | 0.181 | 0.0000346 |
|
||||
| lerobot/pusht | None | 3.646 | 0.189 | 0.0000443 |
|
||||
| lerobot/pusht | 25 | 3.969 | 0.186 | 0.0000521 |
|
||||
| lerobot/pusht | 30 | 5.687 | 0.184 | 0.0000850 |
|
||||
| lerobot/pusht | 40 | 10.818 | 0.193 | 0.0001726 |
|
||||
| lerobot/pusht | 50 | 18.185 | 0.183 | 0.0002606 |
|
||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.165 | 0.0000056 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.171 | 0.0000111 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.212 | 0.0000153 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.261 | 0.0000218 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.312 | 0.0000317 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.339 | 0.0000397 |
|
||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.297 | 0.0000452 |
|
||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.406 | 0.0000629 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.468 | 0.0001184 |
|
||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.515 | 0.0001879 |
|
||||
|
||||
**best**
|
||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | 3.646 | 0.188 | 0.0000443 |
|
||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.339 | 0.0000397 |
|
||||
|
||||
### `2_frames`
|
||||
|
||||
**`pix_fmt`**
|
||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | yuv420p | 3.788 | 0.314 | 0.0000799 |
|
||||
| lerobot/pusht | yuv444p | 3.646 | 0.303 | 0.0000496 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.642 | 0.0000503 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.529 | 0.0000436 |
|
||||
|
||||
**`g`**
|
||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 1 | 2.543 | 0.308 | 0.0000599 |
|
||||
| lerobot/pusht | 2 | 3.646 | 0.279 | 0.0000496 |
|
||||
| lerobot/pusht | 3 | 4.431 | 0.259 | 0.0000498 |
|
||||
| lerobot/pusht | 4 | 5.103 | 0.243 | 0.0000501 |
|
||||
| lerobot/pusht | 5 | 5.625 | 0.235 | 0.0000492 |
|
||||
| lerobot/pusht | 6 | 5.974 | 0.230 | 0.0000481 |
|
||||
| lerobot/pusht | 10 | 6.814 | 0.194 | 0.0000468 |
|
||||
| lerobot/pusht | 15 | 7.431 | 0.152 | 0.0000460 |
|
||||
| lerobot/pusht | 20 | 7.662 | 0.151 | 0.0000455 |
|
||||
| lerobot/pusht | 40 | 8.163 | 0.095 | 0.0000454 |
|
||||
| lerobot/pusht | 100 | 8.761 | 0.062 | 0.0000472 |
|
||||
| lerobot/pusht | None | 8.909 | 0.037 | 0.0000479 |
|
||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.638 | 0.0000625 |
|
||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.537 | 0.0000436 |
|
||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.493 | 0.0000437 |
|
||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.458 | 0.0000446 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.438 | 0.0000445 |
|
||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.424 | 0.0000444 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.345 | 0.0000435 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.313 | 0.0000417 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.264 | 0.0000421 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.185 | 0.0000414 |
|
||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.090 | 0.0000420 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.042 | 0.0000424 |
|
||||
|
||||
**`crf`**
|
||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 0 | 1.699 | 0.302 | 0.0000097 |
|
||||
| lerobot/pusht | 5 | 1.409 | 0.287 | 0.0000142 |
|
||||
| lerobot/pusht | 10 | 1.842 | 0.283 | 0.0000184 |
|
||||
| lerobot/pusht | 15 | 2.322 | 0.305 | 0.0000268 |
|
||||
| lerobot/pusht | 20 | 3.050 | 0.285 | 0.0000402 |
|
||||
| lerobot/pusht | None | 3.646 | 0.285 | 0.0000496 |
|
||||
| lerobot/pusht | 25 | 3.969 | 0.293 | 0.0000572 |
|
||||
| lerobot/pusht | 30 | 5.687 | 0.293 | 0.0000893 |
|
||||
| lerobot/pusht | 40 | 10.818 | 0.319 | 0.0001762 |
|
||||
| lerobot/pusht | 50 | 18.185 | 0.304 | 0.0002626 |
|
||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.235 | 0.0000112 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.261 | 0.0000166 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.333 | 0.0000207 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.406 | 0.0000267 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.489 | 0.0000361 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.537 | 0.0000436 |
|
||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.578 | 0.0000487 |
|
||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.453 | 0.0000655 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.767 | 0.0001192 |
|
||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.816 | 0.0001881 |
|
||||
|
||||
**best**
|
||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | 3.646 | 0.283 | 0.0000496 |
|
||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.543 | 0.0000436 |
|
||||
|
||||
### `2_frames_4_space`
|
||||
|
||||
**`pix_fmt`**
|
||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | yuv420p | 3.788 | 0.257 | 0.0000855 |
|
||||
| lerobot/pusht | yuv444p | 3.646 | 0.261 | 0.0000556 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.493 | 0.0000476 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.371 | 0.0000404 |
|
||||
|
||||
**`g`**
|
||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 1 | 2.543 | 0.226 | 0.0000670 |
|
||||
| lerobot/pusht | 2 | 3.646 | 0.222 | 0.0000556 |
|
||||
| lerobot/pusht | 3 | 4.431 | 0.217 | 0.0000567 |
|
||||
| lerobot/pusht | 4 | 5.103 | 0.204 | 0.0000555 |
|
||||
| lerobot/pusht | 5 | 5.625 | 0.179 | 0.0000556 |
|
||||
| lerobot/pusht | 6 | 5.974 | 0.188 | 0.0000544 |
|
||||
| lerobot/pusht | 10 | 6.814 | 0.160 | 0.0000531 |
|
||||
| lerobot/pusht | 15 | 7.431 | 0.150 | 0.0000521 |
|
||||
| lerobot/pusht | 20 | 7.662 | 0.123 | 0.0000519 |
|
||||
| lerobot/pusht | 40 | 8.163 | 0.092 | 0.0000519 |
|
||||
| lerobot/pusht | 100 | 8.761 | 0.053 | 0.0000533 |
|
||||
| lerobot/pusht | None | 8.909 | 0.034 | 0.0000541 |
|
||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.409 | 0.0000607 |
|
||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.381 | 0.0000404 |
|
||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.355 | 0.0000418 |
|
||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.346 | 0.0000425 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.354 | 0.0000419 |
|
||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.336 | 0.0000419 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.314 | 0.0000402 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.269 | 0.0000397 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.246 | 0.0000395 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.171 | 0.0000390 |
|
||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.091 | 0.0000399 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.043 | 0.0000409 |
|
||||
|
||||
**`crf`**
|
||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 0 | 1.699 | 0.212 | 0.0000193 |
|
||||
| lerobot/pusht | 5 | 1.409 | 0.211 | 0.0000232 |
|
||||
| lerobot/pusht | 10 | 1.842 | 0.199 | 0.0000270 |
|
||||
| lerobot/pusht | 15 | 2.322 | 0.198 | 0.0000347 |
|
||||
| lerobot/pusht | 20 | 3.050 | 0.211 | 0.0000469 |
|
||||
| lerobot/pusht | None | 3.646 | 0.206 | 0.0000556 |
|
||||
| lerobot/pusht | 25 | 3.969 | 0.210 | 0.0000626 |
|
||||
| lerobot/pusht | 30 | 5.687 | 0.223 | 0.0000927 |
|
||||
| lerobot/pusht | 40 | 10.818 | 0.227 | 0.0001763 |
|
||||
| lerobot/pusht | 50 | 18.185 | 0.223 | 0.0002625 |
|
||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.147 | 0.0000071 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.182 | 0.0000125 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.222 | 0.0000166 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.270 | 0.0000229 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.325 | 0.0000326 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.362 | 0.0000404 |
|
||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.390 | 0.0000459 |
|
||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.437 | 0.0000633 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.499 | 0.0001186 |
|
||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.564 | 0.0001879 |
|
||||
|
||||
**best**
|
||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | 3.646 | 0.224 | 0.0000556 |
|
||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.368 | 0.0000404 |
|
||||
|
||||
### `6_frames`
|
||||
|
||||
**`pix_fmt`**
|
||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | yuv420p | 3.788 | 0.660 | 0.0000839 |
|
||||
| lerobot/pusht | yuv444p | 3.646 | 0.546 | 0.0000542 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 1.225 | 0.0000497 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.908 | 0.0000428 |
|
||||
|
||||
**`g`**
|
||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 1 | 2.543 | 0.552 | 0.0000646 |
|
||||
| lerobot/pusht | 2 | 3.646 | 0.534 | 0.0000542 |
|
||||
| lerobot/pusht | 3 | 4.431 | 0.563 | 0.0000546 |
|
||||
| lerobot/pusht | 4 | 5.103 | 0.537 | 0.0000545 |
|
||||
| lerobot/pusht | 5 | 5.625 | 0.477 | 0.0000532 |
|
||||
| lerobot/pusht | 6 | 5.974 | 0.515 | 0.0000530 |
|
||||
| lerobot/pusht | 10 | 6.814 | 0.410 | 0.0000512 |
|
||||
| lerobot/pusht | 15 | 7.431 | 0.405 | 0.0000503 |
|
||||
| lerobot/pusht | 20 | 7.662 | 0.345 | 0.0000500 |
|
||||
| lerobot/pusht | 40 | 8.163 | 0.247 | 0.0000496 |
|
||||
| lerobot/pusht | 100 | 8.761 | 0.147 | 0.0000510 |
|
||||
| lerobot/pusht | None | 8.909 | 0.100 | 0.0000519 |
|
||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.997 | 0.0000620 |
|
||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.911 | 0.0000428 |
|
||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.869 | 0.0000433 |
|
||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.874 | 0.0000438 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.864 | 0.0000439 |
|
||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.834 | 0.0000440 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.781 | 0.0000421 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.679 | 0.0000411 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.652 | 0.0000410 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.465 | 0.0000404 |
|
||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.245 | 0.0000413 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.116 | 0.0000417 |
|
||||
|
||||
**`crf`**
|
||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 0 | 1.699 | 0.534 | 0.0000163 |
|
||||
| lerobot/pusht | 5 | 1.409 | 0.524 | 0.0000205 |
|
||||
| lerobot/pusht | 10 | 1.842 | 0.510 | 0.0000245 |
|
||||
| lerobot/pusht | 15 | 2.322 | 0.512 | 0.0000324 |
|
||||
| lerobot/pusht | 20 | 3.050 | 0.508 | 0.0000452 |
|
||||
| lerobot/pusht | None | 3.646 | 0.518 | 0.0000542 |
|
||||
| lerobot/pusht | 25 | 3.969 | 0.534 | 0.0000616 |
|
||||
| lerobot/pusht | 30 | 5.687 | 0.530 | 0.0000927 |
|
||||
| lerobot/pusht | 40 | 10.818 | 0.552 | 0.0001777 |
|
||||
| lerobot/pusht | 50 | 18.185 | 0.564 | 0.0002644 |
|
||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.401 | 0.0000101 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.499 | 0.0000156 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.599 | 0.0000197 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.704 | 0.0000258 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.834 | 0.0000352 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.925 | 0.0000428 |
|
||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.978 | 0.0000480 |
|
||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 1.088 | 0.0000648 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 1.324 | 0.0001190 |
|
||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 1.436 | 0.0001880 |
|
||||
|
||||
**best**
|
||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | 3.646 | 0.546 | 0.0000542 |
|
||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.934 | 0.0000428 |
|
||||
@@ -1,372 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import json
|
||||
import random
|
||||
import shutil
|
||||
import subprocess
|
||||
import time
|
||||
from pathlib import Path
|
||||
|
||||
import einops
|
||||
import numpy
|
||||
import PIL
|
||||
import torch
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.video_utils import (
|
||||
decode_video_frames_torchvision,
|
||||
)
|
||||
|
||||
|
||||
def get_directory_size(directory):
|
||||
total_size = 0
|
||||
# Iterate over all files and subdirectories recursively
|
||||
for item in directory.rglob("*"):
|
||||
if item.is_file():
|
||||
# Add the file size to the total
|
||||
total_size += item.stat().st_size
|
||||
return total_size
|
||||
|
||||
|
||||
def run_video_benchmark(
|
||||
output_dir,
|
||||
cfg,
|
||||
timestamps_mode,
|
||||
seed=1337,
|
||||
):
|
||||
output_dir = Path(output_dir)
|
||||
if output_dir.exists():
|
||||
shutil.rmtree(output_dir)
|
||||
output_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
repo_id = cfg["repo_id"]
|
||||
|
||||
# TODO(rcadene): rewrite with hardcoding of original images and episodes
|
||||
dataset = LeRobotDataset(repo_id)
|
||||
|
||||
# Get fps
|
||||
fps = dataset.fps
|
||||
|
||||
# we only load first episode
|
||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||
|
||||
# Save/Load image directory for the first episode
|
||||
imgs_dir = Path(f"tmp/data/images/{repo_id}/observation.image_episode_000000")
|
||||
if not imgs_dir.exists():
|
||||
imgs_dir.mkdir(parents=True, exist_ok=True)
|
||||
hf_dataset = dataset.hf_dataset.with_format(None)
|
||||
imgs_dataset = hf_dataset.select_columns("observation.image")
|
||||
|
||||
for i, item in enumerate(imgs_dataset):
|
||||
img = item["observation.image"]
|
||||
img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
|
||||
|
||||
if i >= ep_num_images - 1:
|
||||
break
|
||||
|
||||
sum_original_frames_size_bytes = get_directory_size(imgs_dir)
|
||||
|
||||
# Encode images into video
|
||||
video_path = output_dir / "episode_0.mp4"
|
||||
|
||||
g = cfg.get("g")
|
||||
crf = cfg.get("crf")
|
||||
pix_fmt = cfg["pix_fmt"]
|
||||
|
||||
cmd = f"ffmpeg -r {fps} "
|
||||
cmd += "-f image2 "
|
||||
cmd += "-loglevel error "
|
||||
cmd += f"-i {str(imgs_dir / 'frame_%06d.png')} "
|
||||
cmd += "-vcodec libx264 "
|
||||
if g is not None:
|
||||
cmd += f"-g {g} " # ensures at least 1 keyframe every 10 frames
|
||||
# cmd += "-keyint_min 10 " set a minimum of 10 frames between 2 key frames
|
||||
# cmd += "-sc_threshold 0 " disable scene change detection to lower the number of key frames
|
||||
if crf is not None:
|
||||
cmd += f"-crf {crf} "
|
||||
cmd += f"-pix_fmt {pix_fmt} "
|
||||
cmd += f"{str(video_path)}"
|
||||
subprocess.run(cmd.split(" "), check=True)
|
||||
|
||||
video_size_bytes = video_path.stat().st_size
|
||||
|
||||
# Set decoder
|
||||
|
||||
decoder = cfg["decoder"]
|
||||
decoder_kwgs = cfg["decoder_kwgs"]
|
||||
device = cfg["device"]
|
||||
|
||||
if decoder == "torchvision":
|
||||
decode_frames_fn = decode_video_frames_torchvision
|
||||
else:
|
||||
raise ValueError(decoder)
|
||||
|
||||
# Estimate average loading time
|
||||
|
||||
def load_original_frames(imgs_dir, timestamps):
|
||||
frames = []
|
||||
for ts in timestamps:
|
||||
idx = int(ts * fps)
|
||||
frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
||||
frame = torch.from_numpy(numpy.array(frame))
|
||||
frame = frame.type(torch.float32) / 255
|
||||
frame = einops.rearrange(frame, "h w c -> c h w")
|
||||
frames.append(frame)
|
||||
return frames
|
||||
|
||||
list_avg_load_time = []
|
||||
list_avg_load_time_from_images = []
|
||||
per_pixel_l2_errors = []
|
||||
|
||||
random.seed(seed)
|
||||
|
||||
for t in range(50):
|
||||
# test loading 2 frames that are 4 frames appart, which might be a common setting
|
||||
ts = random.randint(fps, ep_num_images - fps) / fps
|
||||
|
||||
if timestamps_mode == "1_frame":
|
||||
timestamps = [ts]
|
||||
elif timestamps_mode == "2_frames":
|
||||
timestamps = [ts - 1 / fps, ts]
|
||||
elif timestamps_mode == "2_frames_4_space":
|
||||
timestamps = [ts - 4 / fps, ts]
|
||||
elif timestamps_mode == "6_frames":
|
||||
timestamps = [ts - i / fps for i in range(6)][::-1]
|
||||
else:
|
||||
raise ValueError(timestamps_mode)
|
||||
|
||||
num_frames = len(timestamps)
|
||||
|
||||
start_time_s = time.monotonic()
|
||||
frames = decode_frames_fn(
|
||||
video_path, timestamps=timestamps, tolerance_s=1e-4, device=device, **decoder_kwgs
|
||||
)
|
||||
avg_load_time = (time.monotonic() - start_time_s) / num_frames
|
||||
list_avg_load_time.append(avg_load_time)
|
||||
|
||||
start_time_s = time.monotonic()
|
||||
original_frames = load_original_frames(imgs_dir, timestamps)
|
||||
avg_load_time_from_images = (time.monotonic() - start_time_s) / num_frames
|
||||
list_avg_load_time_from_images.append(avg_load_time_from_images)
|
||||
|
||||
# Estimate average L2 error between original frames and decoded frames
|
||||
for i, ts in enumerate(timestamps):
|
||||
# are_close = torch.allclose(frames[i], original_frames[i], atol=0.02)
|
||||
num_pixels = original_frames[i].numel()
|
||||
per_pixel_l2_error = torch.norm(frames[i] - original_frames[i], p=2).item() / num_pixels
|
||||
|
||||
# save decoded frames
|
||||
if t == 0:
|
||||
frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
|
||||
PIL.Image.fromarray(frame_hwc).save(output_dir / f"frame_{i:06d}.png")
|
||||
|
||||
# save original_frames
|
||||
idx = int(ts * fps)
|
||||
if t == 0:
|
||||
original_frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
||||
original_frame.save(output_dir / f"original_frame_{i:06d}.png")
|
||||
|
||||
per_pixel_l2_errors.append(per_pixel_l2_error)
|
||||
|
||||
avg_load_time = float(numpy.array(list_avg_load_time).mean())
|
||||
avg_load_time_from_images = float(numpy.array(list_avg_load_time_from_images).mean())
|
||||
avg_per_pixel_l2_error = float(numpy.array(per_pixel_l2_errors).mean())
|
||||
|
||||
# Save benchmark info
|
||||
|
||||
info = {
|
||||
"sum_original_frames_size_bytes": sum_original_frames_size_bytes,
|
||||
"video_size_bytes": video_size_bytes,
|
||||
"avg_load_time_from_images": avg_load_time_from_images,
|
||||
"avg_load_time": avg_load_time,
|
||||
"compression_factor": sum_original_frames_size_bytes / video_size_bytes,
|
||||
"load_time_factor": avg_load_time_from_images / avg_load_time,
|
||||
"avg_per_pixel_l2_error": avg_per_pixel_l2_error,
|
||||
}
|
||||
|
||||
with open(output_dir / "info.json", "w") as f:
|
||||
json.dump(info, f)
|
||||
|
||||
return info
|
||||
|
||||
|
||||
def display_markdown_table(headers, rows):
|
||||
for i, row in enumerate(rows):
|
||||
new_row = []
|
||||
for col in row:
|
||||
if col is None:
|
||||
new_col = "None"
|
||||
elif isinstance(col, float):
|
||||
new_col = f"{col:.3f}"
|
||||
if new_col == "0.000":
|
||||
new_col = f"{col:.7f}"
|
||||
elif isinstance(col, int):
|
||||
new_col = f"{col}"
|
||||
else:
|
||||
new_col = col
|
||||
new_row.append(new_col)
|
||||
rows[i] = new_row
|
||||
|
||||
header_line = "| " + " | ".join(headers) + " |"
|
||||
separator_line = "| " + " | ".join(["---" for _ in headers]) + " |"
|
||||
body_lines = ["| " + " | ".join(row) + " |" for row in rows]
|
||||
markdown_table = "\n".join([header_line, separator_line] + body_lines)
|
||||
print(markdown_table)
|
||||
print()
|
||||
|
||||
|
||||
def load_info(out_dir):
|
||||
with open(out_dir / "info.json") as f:
|
||||
info = json.load(f)
|
||||
return info
|
||||
|
||||
|
||||
def main():
|
||||
out_dir = Path("tmp/run_video_benchmark")
|
||||
dry_run = False
|
||||
repo_ids = ["lerobot/pusht", "lerobot/umi_cup_in_the_wild"]
|
||||
timestamps_modes = [
|
||||
"1_frame",
|
||||
"2_frames",
|
||||
"2_frames_4_space",
|
||||
"6_frames",
|
||||
]
|
||||
for timestamps_mode in timestamps_modes:
|
||||
bench_dir = out_dir / timestamps_mode
|
||||
|
||||
print(f"### `{timestamps_mode}`")
|
||||
print()
|
||||
|
||||
print("**`pix_fmt`**")
|
||||
headers = ["repo_id", "pix_fmt", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
||||
rows = []
|
||||
for repo_id in repo_ids:
|
||||
for pix_fmt in ["yuv420p", "yuv444p"]:
|
||||
cfg = {
|
||||
"repo_id": repo_id,
|
||||
# video encoding
|
||||
"g": 2,
|
||||
"crf": None,
|
||||
"pix_fmt": pix_fmt,
|
||||
# video decoding
|
||||
"device": "cpu",
|
||||
"decoder": "torchvision",
|
||||
"decoder_kwgs": {},
|
||||
}
|
||||
if not dry_run:
|
||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_{pix_fmt}", cfg, timestamps_mode)
|
||||
info = load_info(bench_dir / repo_id / f"torchvision_{pix_fmt}")
|
||||
rows.append(
|
||||
[
|
||||
repo_id,
|
||||
pix_fmt,
|
||||
info["compression_factor"],
|
||||
info["load_time_factor"],
|
||||
info["avg_per_pixel_l2_error"],
|
||||
]
|
||||
)
|
||||
display_markdown_table(headers, rows)
|
||||
|
||||
print("**`g`**")
|
||||
headers = ["repo_id", "g", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
||||
rows = []
|
||||
for repo_id in repo_ids:
|
||||
for g in [1, 2, 3, 4, 5, 6, 10, 15, 20, 40, 100, None]:
|
||||
cfg = {
|
||||
"repo_id": repo_id,
|
||||
# video encoding
|
||||
"g": g,
|
||||
"pix_fmt": "yuv444p",
|
||||
# video decoding
|
||||
"device": "cpu",
|
||||
"decoder": "torchvision",
|
||||
"decoder_kwgs": {},
|
||||
}
|
||||
if not dry_run:
|
||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_g_{g}", cfg, timestamps_mode)
|
||||
info = load_info(bench_dir / repo_id / f"torchvision_g_{g}")
|
||||
rows.append(
|
||||
[
|
||||
repo_id,
|
||||
g,
|
||||
info["compression_factor"],
|
||||
info["load_time_factor"],
|
||||
info["avg_per_pixel_l2_error"],
|
||||
]
|
||||
)
|
||||
display_markdown_table(headers, rows)
|
||||
|
||||
print("**`crf`**")
|
||||
headers = ["repo_id", "crf", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
||||
rows = []
|
||||
for repo_id in repo_ids:
|
||||
for crf in [0, 5, 10, 15, 20, None, 25, 30, 40, 50]:
|
||||
cfg = {
|
||||
"repo_id": repo_id,
|
||||
# video encoding
|
||||
"g": 2,
|
||||
"crf": crf,
|
||||
"pix_fmt": "yuv444p",
|
||||
# video decoding
|
||||
"device": "cpu",
|
||||
"decoder": "torchvision",
|
||||
"decoder_kwgs": {},
|
||||
}
|
||||
if not dry_run:
|
||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_crf_{crf}", cfg, timestamps_mode)
|
||||
info = load_info(bench_dir / repo_id / f"torchvision_crf_{crf}")
|
||||
rows.append(
|
||||
[
|
||||
repo_id,
|
||||
crf,
|
||||
info["compression_factor"],
|
||||
info["load_time_factor"],
|
||||
info["avg_per_pixel_l2_error"],
|
||||
]
|
||||
)
|
||||
display_markdown_table(headers, rows)
|
||||
|
||||
print("**best**")
|
||||
headers = ["repo_id", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
||||
rows = []
|
||||
for repo_id in repo_ids:
|
||||
cfg = {
|
||||
"repo_id": repo_id,
|
||||
# video encoding
|
||||
"g": 2,
|
||||
"crf": None,
|
||||
"pix_fmt": "yuv444p",
|
||||
# video decoding
|
||||
"device": "cpu",
|
||||
"decoder": "torchvision",
|
||||
"decoder_kwgs": {},
|
||||
}
|
||||
if not dry_run:
|
||||
run_video_benchmark(bench_dir / repo_id / "torchvision_best", cfg, timestamps_mode)
|
||||
info = load_info(bench_dir / repo_id / "torchvision_best")
|
||||
rows.append(
|
||||
[
|
||||
repo_id,
|
||||
info["compression_factor"],
|
||||
info["load_time_factor"],
|
||||
info["avg_per_pixel_l2_error"],
|
||||
]
|
||||
)
|
||||
display_markdown_table(headers, rows)
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
main()
|
||||
27
lerobot/common/datasets/card_template.md
Normal file
27
lerobot/common/datasets/card_template.md
Normal file
@@ -0,0 +1,27 @@
|
||||
---
|
||||
# For reference on dataset card metadata, see the spec: https://github.com/huggingface/hub-docs/blob/main/datasetcard.md?plain=1
|
||||
# Doc / guide: https://huggingface.co/docs/hub/datasets-cards
|
||||
{{ card_data }}
|
||||
---
|
||||
|
||||
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
|
||||
|
||||
## Dataset Description
|
||||
|
||||
{{ dataset_description | default("", true) }}
|
||||
|
||||
- **Homepage:** {{ url | default("[More Information Needed]", true)}}
|
||||
- **Paper:** {{ paper | default("[More Information Needed]", true)}}
|
||||
- **License:** {{ license | default("[More Information Needed]", true)}}
|
||||
|
||||
## Dataset Structure
|
||||
|
||||
{{ dataset_structure | default("[More Information Needed]", true)}}
|
||||
|
||||
## Citation
|
||||
|
||||
**BibTeX:**
|
||||
|
||||
```bibtex
|
||||
{{ citation_bibtex | default("[More Information Needed]", true)}}
|
||||
```
|
||||
@@ -19,9 +19,6 @@ from math import ceil
|
||||
import einops
|
||||
import torch
|
||||
import tqdm
|
||||
from datasets import Image
|
||||
|
||||
from lerobot.common.datasets.video_utils import VideoFrame
|
||||
|
||||
|
||||
def get_stats_einops_patterns(dataset, num_workers=0):
|
||||
@@ -39,19 +36,29 @@ def get_stats_einops_patterns(dataset, num_workers=0):
|
||||
batch = next(iter(dataloader))
|
||||
|
||||
stats_patterns = {}
|
||||
for key, feats_type in dataset.features.items():
|
||||
|
||||
for key in dataset.features:
|
||||
# sanity check that tensors are not float64
|
||||
assert batch[key].dtype != torch.float64
|
||||
|
||||
if isinstance(feats_type, (VideoFrame, Image)):
|
||||
# if isinstance(feats_type, (VideoFrame, Image)):
|
||||
if key in dataset.meta.camera_keys:
|
||||
# sanity check that images are channel first
|
||||
_, c, h, w = batch[key].shape
|
||||
assert c < h and c < w, f"expect channel first images, but instead {batch[key].shape}"
|
||||
assert (
|
||||
c < h and c < w
|
||||
), f"expect channel first images, but instead {batch[key].shape}"
|
||||
|
||||
# sanity check that images are float32 in range [0,1]
|
||||
assert batch[key].dtype == torch.float32, f"expect torch.float32, but instead {batch[key].dtype=}"
|
||||
assert batch[key].max() <= 1, f"expect pixels lower than 1, but instead {batch[key].max()=}"
|
||||
assert batch[key].min() >= 0, f"expect pixels greater than 1, but instead {batch[key].min()=}"
|
||||
assert (
|
||||
batch[key].dtype == torch.float32
|
||||
), f"expect torch.float32, but instead {batch[key].dtype=}"
|
||||
assert (
|
||||
batch[key].max() <= 1
|
||||
), f"expect pixels lower than 1, but instead {batch[key].max()=}"
|
||||
assert (
|
||||
batch[key].min() >= 0
|
||||
), f"expect pixels greater than 1, but instead {batch[key].min()=}"
|
||||
|
||||
stats_patterns[key] = "b c h w -> c 1 1"
|
||||
elif batch[key].ndim == 2:
|
||||
@@ -59,12 +66,12 @@ def get_stats_einops_patterns(dataset, num_workers=0):
|
||||
elif batch[key].ndim == 1:
|
||||
stats_patterns[key] = "b -> 1"
|
||||
else:
|
||||
raise ValueError(f"{key}, {feats_type}, {batch[key].shape}")
|
||||
raise ValueError(f"{key}, {batch[key].shape}")
|
||||
|
||||
return stats_patterns
|
||||
|
||||
|
||||
def compute_stats(dataset, batch_size=32, num_workers=16, max_num_samples=None):
|
||||
def compute_stats(dataset, batch_size=8, num_workers=8, max_num_samples=None):
|
||||
"""Compute mean/std and min/max statistics of all data keys in a LeRobotDataset."""
|
||||
if max_num_samples is None:
|
||||
max_num_samples = len(dataset)
|
||||
@@ -99,7 +106,11 @@ def compute_stats(dataset, batch_size=32, num_workers=16, max_num_samples=None):
|
||||
running_item_count = 0 # for online mean computation
|
||||
dataloader = create_seeded_dataloader(dataset, batch_size, seed=1337)
|
||||
for i, batch in enumerate(
|
||||
tqdm.tqdm(dataloader, total=ceil(max_num_samples / batch_size), desc="Compute mean, min, max")
|
||||
tqdm.tqdm(
|
||||
dataloader,
|
||||
total=ceil(max_num_samples / batch_size),
|
||||
desc="Compute mean, min, max",
|
||||
)
|
||||
):
|
||||
this_batch_size = len(batch["index"])
|
||||
running_item_count += this_batch_size
|
||||
@@ -114,9 +125,16 @@ def compute_stats(dataset, batch_size=32, num_workers=16, max_num_samples=None):
|
||||
# and x is the current batch mean. Some rearrangement is then required to avoid risking
|
||||
# numerical overflow. Another hint: Nₙ₋₁ = Nₙ - Bₙ. Rearrangement yields
|
||||
# x̄ₙ = x̄ₙ₋₁ + Bₙ * (xₙ - x̄ₙ₋₁) / Nₙ
|
||||
mean[key] = mean[key] + this_batch_size * (batch_mean - mean[key]) / running_item_count
|
||||
max[key] = torch.maximum(max[key], einops.reduce(batch[key], pattern, "max"))
|
||||
min[key] = torch.minimum(min[key], einops.reduce(batch[key], pattern, "min"))
|
||||
mean[key] = (
|
||||
mean[key]
|
||||
+ this_batch_size * (batch_mean - mean[key]) / running_item_count
|
||||
)
|
||||
max[key] = torch.maximum(
|
||||
max[key], einops.reduce(batch[key], pattern, "max")
|
||||
)
|
||||
min[key] = torch.minimum(
|
||||
min[key], einops.reduce(batch[key], pattern, "min")
|
||||
)
|
||||
|
||||
if i == ceil(max_num_samples / batch_size) - 1:
|
||||
break
|
||||
@@ -125,7 +143,9 @@ def compute_stats(dataset, batch_size=32, num_workers=16, max_num_samples=None):
|
||||
running_item_count = 0 # for online std computation
|
||||
dataloader = create_seeded_dataloader(dataset, batch_size, seed=1337)
|
||||
for i, batch in enumerate(
|
||||
tqdm.tqdm(dataloader, total=ceil(max_num_samples / batch_size), desc="Compute std")
|
||||
tqdm.tqdm(
|
||||
dataloader, total=ceil(max_num_samples / batch_size), desc="Compute std"
|
||||
)
|
||||
):
|
||||
this_batch_size = len(batch["index"])
|
||||
running_item_count += this_batch_size
|
||||
@@ -139,7 +159,9 @@ def compute_stats(dataset, batch_size=32, num_workers=16, max_num_samples=None):
|
||||
# Numerically stable update step for mean computation (where the mean is over squared
|
||||
# residuals).See notes in the mean computation loop above.
|
||||
batch_std = einops.reduce((batch[key] - mean[key]) ** 2, pattern, "mean")
|
||||
std[key] = std[key] + this_batch_size * (batch_std - std[key]) / running_item_count
|
||||
std[key] = (
|
||||
std[key] + this_batch_size * (batch_std - std[key]) / running_item_count
|
||||
)
|
||||
|
||||
if i == ceil(max_num_samples / batch_size) - 1:
|
||||
break
|
||||
@@ -171,39 +193,51 @@ def aggregate_stats(ls_datasets) -> dict[str, torch.Tensor]:
|
||||
"""
|
||||
data_keys = set()
|
||||
for dataset in ls_datasets:
|
||||
data_keys.update(dataset.stats.keys())
|
||||
data_keys.update(dataset.meta.stats.keys())
|
||||
stats = {k: {} for k in data_keys}
|
||||
for data_key in data_keys:
|
||||
for stat_key in ["min", "max"]:
|
||||
# compute `max(dataset_0["max"], dataset_1["max"], ...)`
|
||||
stats[data_key][stat_key] = einops.reduce(
|
||||
torch.stack([d.stats[data_key][stat_key] for d in ls_datasets if data_key in d.stats], dim=0),
|
||||
torch.stack(
|
||||
[
|
||||
ds.meta.stats[data_key][stat_key]
|
||||
for ds in ls_datasets
|
||||
if data_key in ds.meta.stats
|
||||
],
|
||||
dim=0,
|
||||
),
|
||||
"n ... -> ...",
|
||||
stat_key,
|
||||
)
|
||||
total_samples = sum(d.num_samples for d in ls_datasets if data_key in d.stats)
|
||||
total_samples = sum(
|
||||
d.num_frames for d in ls_datasets if data_key in d.meta.stats
|
||||
)
|
||||
# Compute the "sum" statistic by multiplying each mean by the number of samples in the respective
|
||||
# dataset, then divide by total_samples to get the overall "mean".
|
||||
# NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
|
||||
# NOTE: the brackets around (d.num_frames / total_samples) are needed tor minimize the risk of
|
||||
# numerical overflow!
|
||||
stats[data_key]["mean"] = sum(
|
||||
d.stats[data_key]["mean"] * (d.num_samples / total_samples)
|
||||
d.meta.stats[data_key]["mean"] * (d.num_frames / total_samples)
|
||||
for d in ls_datasets
|
||||
if data_key in d.stats
|
||||
if data_key in d.meta.stats
|
||||
)
|
||||
# The derivation for standard deviation is a little more involved but is much in the same spirit as
|
||||
# the computation of the mean.
|
||||
# Given two sets of data where the statistics are known:
|
||||
# σ_combined = sqrt[ (n1 * (σ1^2 + d1^2) + n2 * (σ2^2 + d2^2)) / (n1 + n2) ]
|
||||
# where d1 = μ1 - μ_combined, d2 = μ2 - μ_combined
|
||||
# NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
|
||||
# NOTE: the brackets around (d.num_frames / total_samples) are needed tor minimize the risk of
|
||||
# numerical overflow!
|
||||
stats[data_key]["std"] = torch.sqrt(
|
||||
sum(
|
||||
(d.stats[data_key]["std"] ** 2 + (d.stats[data_key]["mean"] - stats[data_key]["mean"]) ** 2)
|
||||
* (d.num_samples / total_samples)
|
||||
(
|
||||
d.meta.stats[data_key]["std"] ** 2
|
||||
+ (d.meta.stats[data_key]["mean"] - stats[data_key]["mean"]) ** 2
|
||||
)
|
||||
* (d.num_frames / total_samples)
|
||||
for d in ls_datasets
|
||||
if data_key in d.stats
|
||||
if data_key in d.meta.stats
|
||||
)
|
||||
)
|
||||
return stats
|
||||
|
||||
@@ -19,6 +19,7 @@ import torch
|
||||
from omegaconf import ListConfig, OmegaConf
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, MultiLeRobotDataset
|
||||
from lerobot.common.datasets.transforms import get_image_transforms
|
||||
|
||||
|
||||
def resolve_delta_timestamps(cfg):
|
||||
@@ -56,7 +57,7 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
|
||||
)
|
||||
|
||||
# A soft check to warn if the environment matches the dataset. Don't check if we are using a real world env (dora).
|
||||
if not cfg.env.real_world:
|
||||
if cfg.env.name != "dora":
|
||||
if isinstance(cfg.dataset_repo_id, str):
|
||||
dataset_repo_ids = [cfg.dataset_repo_id] # single dataset
|
||||
else:
|
||||
@@ -71,17 +72,62 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
|
||||
|
||||
resolve_delta_timestamps(cfg)
|
||||
|
||||
# TODO(rcadene): add data augmentations
|
||||
image_transforms = None
|
||||
if cfg.training.image_transforms.enable:
|
||||
default_tf = OmegaConf.create(
|
||||
{
|
||||
"brightness": {"weight": 0.0, "min_max": None},
|
||||
"contrast": {"weight": 0.0, "min_max": None},
|
||||
"saturation": {"weight": 0.0, "min_max": None},
|
||||
"hue": {"weight": 0.0, "min_max": None},
|
||||
"sharpness": {"weight": 0.0, "min_max": None},
|
||||
"max_num_transforms": None,
|
||||
"random_order": False,
|
||||
"image_size": None,
|
||||
"interpolation": None,
|
||||
"image_mean": None,
|
||||
"image_std": None,
|
||||
}
|
||||
)
|
||||
cfg_tf = OmegaConf.merge(
|
||||
OmegaConf.create(default_tf), cfg.training.image_transforms
|
||||
)
|
||||
|
||||
image_transforms = get_image_transforms(
|
||||
brightness_weight=cfg_tf.brightness.weight,
|
||||
brightness_min_max=cfg_tf.brightness.min_max,
|
||||
contrast_weight=cfg_tf.contrast.weight,
|
||||
contrast_min_max=cfg_tf.contrast.min_max,
|
||||
saturation_weight=cfg_tf.saturation.weight,
|
||||
saturation_min_max=cfg_tf.saturation.min_max,
|
||||
hue_weight=cfg_tf.hue.weight,
|
||||
hue_min_max=cfg_tf.hue.min_max,
|
||||
sharpness_weight=cfg_tf.sharpness.weight,
|
||||
sharpness_min_max=cfg_tf.sharpness.min_max,
|
||||
max_num_transforms=cfg_tf.max_num_transforms,
|
||||
random_order=cfg_tf.random_order,
|
||||
image_size=(cfg_tf.image_size.height, cfg_tf.image_size.width)
|
||||
if cfg_tf.image_size
|
||||
else None,
|
||||
interpolation=cfg_tf.interpolation,
|
||||
image_mean=cfg_tf.image_mean,
|
||||
image_std=cfg_tf.image_std,
|
||||
)
|
||||
|
||||
if isinstance(cfg.dataset_repo_id, str):
|
||||
# TODO (aliberts): add 'episodes' arg from config after removing hydra
|
||||
dataset = LeRobotDataset(
|
||||
cfg.dataset_repo_id,
|
||||
split=split,
|
||||
delta_timestamps=cfg.training.get("delta_timestamps"),
|
||||
image_transforms=image_transforms,
|
||||
video_backend=cfg.video_backend,
|
||||
)
|
||||
else:
|
||||
dataset = MultiLeRobotDataset(
|
||||
cfg.dataset_repo_id, split=split, delta_timestamps=cfg.training.get("delta_timestamps")
|
||||
cfg.dataset_repo_id,
|
||||
delta_timestamps=cfg.training.get("delta_timestamps"),
|
||||
image_transforms=image_transforms,
|
||||
video_backend=cfg.video_backend,
|
||||
)
|
||||
|
||||
if cfg.get("override_dataset_stats"):
|
||||
@@ -89,6 +135,8 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
|
||||
for stats_type, listconfig in stats_dict.items():
|
||||
# example of stats_type: min, max, mean, std
|
||||
stats = OmegaConf.to_container(listconfig, resolve=True)
|
||||
dataset.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
|
||||
dataset.meta.stats[key][stats_type] = torch.tensor(
|
||||
stats, dtype=torch.float32
|
||||
)
|
||||
|
||||
return dataset
|
||||
|
||||
166
lerobot/common/datasets/image_writer.py
Normal file
166
lerobot/common/datasets/image_writer.py
Normal file
@@ -0,0 +1,166 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import multiprocessing
|
||||
import queue
|
||||
import threading
|
||||
from pathlib import Path
|
||||
|
||||
import numpy as np
|
||||
import PIL.Image
|
||||
import torch
|
||||
|
||||
|
||||
def safe_stop_image_writer(func):
|
||||
def wrapper(*args, **kwargs):
|
||||
try:
|
||||
return func(*args, **kwargs)
|
||||
except Exception as e:
|
||||
dataset = kwargs.get("dataset")
|
||||
image_writer = getattr(dataset, "image_writer", None) if dataset else None
|
||||
if image_writer is not None:
|
||||
print("Waiting for image writer to terminate...")
|
||||
image_writer.stop()
|
||||
raise e
|
||||
|
||||
return wrapper
|
||||
|
||||
|
||||
def image_array_to_image(image_array: np.ndarray) -> PIL.Image.Image:
|
||||
# TODO(aliberts): handle 1 channel and 4 for depth images
|
||||
if image_array.ndim == 3 and image_array.shape[0] in [1, 3]:
|
||||
# Transpose from pytorch convention (C, H, W) to (H, W, C)
|
||||
image_array = image_array.transpose(1, 2, 0)
|
||||
if image_array.dtype != np.uint8:
|
||||
# Assume the image is in [0, 1] range for floating-point data
|
||||
image_array = np.clip(image_array, 0, 1)
|
||||
image_array = (image_array * 255).astype(np.uint8)
|
||||
return PIL.Image.fromarray(image_array)
|
||||
|
||||
|
||||
def write_image(image: np.ndarray | PIL.Image.Image, fpath: Path):
|
||||
try:
|
||||
if isinstance(image, np.ndarray):
|
||||
img = image_array_to_image(image)
|
||||
elif isinstance(image, PIL.Image.Image):
|
||||
img = image
|
||||
else:
|
||||
raise TypeError(f"Unsupported image type: {type(image)}")
|
||||
img.save(fpath)
|
||||
except Exception as e:
|
||||
print(f"Error writing image {fpath}: {e}")
|
||||
|
||||
|
||||
def worker_thread_loop(queue: queue.Queue):
|
||||
while True:
|
||||
item = queue.get()
|
||||
if item is None:
|
||||
queue.task_done()
|
||||
break
|
||||
image_array, fpath = item
|
||||
write_image(image_array, fpath)
|
||||
queue.task_done()
|
||||
|
||||
|
||||
def worker_process(queue: queue.Queue, num_threads: int):
|
||||
threads = []
|
||||
for _ in range(num_threads):
|
||||
t = threading.Thread(target=worker_thread_loop, args=(queue,))
|
||||
t.daemon = True
|
||||
t.start()
|
||||
threads.append(t)
|
||||
for t in threads:
|
||||
t.join()
|
||||
|
||||
|
||||
class AsyncImageWriter:
|
||||
"""
|
||||
This class abstract away the initialisation of processes or/and threads to
|
||||
save images on disk asynchrounously, which is critical to control a robot and record data
|
||||
at a high frame rate.
|
||||
|
||||
When `num_processes=0`, it creates a threads pool of size `num_threads`.
|
||||
When `num_processes>0`, it creates processes pool of size `num_processes`, where each subprocess starts
|
||||
their own threads pool of size `num_threads`.
|
||||
|
||||
The optimal number of processes and threads depends on your computer capabilities.
|
||||
We advise to use 4 threads per camera with 0 processes. If the fps is not stable, try to increase or lower
|
||||
the number of threads. If it is still not stable, try to use 1 subprocess, or more.
|
||||
"""
|
||||
|
||||
def __init__(self, num_processes: int = 0, num_threads: int = 1):
|
||||
self.num_processes = num_processes
|
||||
self.num_threads = num_threads
|
||||
self.queue = None
|
||||
self.threads = []
|
||||
self.processes = []
|
||||
self._stopped = False
|
||||
|
||||
if num_threads <= 0 and num_processes <= 0:
|
||||
raise ValueError(
|
||||
"Number of threads and processes must be greater than zero."
|
||||
)
|
||||
|
||||
if self.num_processes == 0:
|
||||
# Use threading
|
||||
self.queue = queue.Queue()
|
||||
for _ in range(self.num_threads):
|
||||
t = threading.Thread(target=worker_thread_loop, args=(self.queue,))
|
||||
t.daemon = True
|
||||
t.start()
|
||||
self.threads.append(t)
|
||||
else:
|
||||
# Use multiprocessing
|
||||
self.queue = multiprocessing.JoinableQueue()
|
||||
for _ in range(self.num_processes):
|
||||
p = multiprocessing.Process(
|
||||
target=worker_process, args=(self.queue, self.num_threads)
|
||||
)
|
||||
p.daemon = True
|
||||
p.start()
|
||||
self.processes.append(p)
|
||||
|
||||
def save_image(
|
||||
self, image: torch.Tensor | np.ndarray | PIL.Image.Image, fpath: Path
|
||||
):
|
||||
if isinstance(image, torch.Tensor):
|
||||
# Convert tensor to numpy array to minimize main process time
|
||||
image = image.cpu().numpy()
|
||||
self.queue.put((image, fpath))
|
||||
|
||||
def wait_until_done(self):
|
||||
self.queue.join()
|
||||
|
||||
def stop(self):
|
||||
if self._stopped:
|
||||
return
|
||||
|
||||
if self.num_processes == 0:
|
||||
for _ in self.threads:
|
||||
self.queue.put(None)
|
||||
for t in self.threads:
|
||||
t.join()
|
||||
else:
|
||||
num_nones = self.num_processes * self.num_threads
|
||||
for _ in range(num_nones):
|
||||
self.queue.put(None)
|
||||
for p in self.processes:
|
||||
p.join()
|
||||
if p.is_alive():
|
||||
p.terminate()
|
||||
self.queue.close()
|
||||
self.queue.join_thread()
|
||||
|
||||
self._stopped = True
|
||||
File diff suppressed because it is too large
Load Diff
421
lerobot/common/datasets/online_buffer.py
Normal file
421
lerobot/common/datasets/online_buffer.py
Normal file
@@ -0,0 +1,421 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""An online buffer for the online training loop in train.py
|
||||
|
||||
Note to maintainers: This duplicates some logic from LeRobotDataset and EpisodeAwareSampler. We should
|
||||
consider converging to one approach. Here we have opted to use numpy.memmap to back the data buffer. It's much
|
||||
faster than using HuggingFace Datasets as there's no conversion to an intermediate non-python object. Also it
|
||||
supports in-place slicing and mutation which is very handy for a dynamic buffer.
|
||||
"""
|
||||
|
||||
import os
|
||||
from pathlib import Path
|
||||
from typing import Any
|
||||
|
||||
import numpy as np
|
||||
import torch
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
|
||||
|
||||
def _make_memmap_safe(**kwargs) -> np.memmap:
|
||||
"""Make a numpy memmap with checks on available disk space first.
|
||||
|
||||
Expected kwargs are: "filename", "dtype" (must by np.dtype), "mode" and "shape"
|
||||
|
||||
For information on dtypes:
|
||||
https://numpy.org/doc/stable/reference/arrays.dtypes.html#arrays-dtypes-constructing
|
||||
"""
|
||||
if kwargs["mode"].startswith("w"):
|
||||
required_space = kwargs["dtype"].itemsize * np.prod(kwargs["shape"]) # bytes
|
||||
stats = os.statvfs(Path(kwargs["filename"]).parent)
|
||||
available_space = stats.f_bavail * stats.f_frsize # bytes
|
||||
if required_space >= available_space * 0.8:
|
||||
raise RuntimeError(
|
||||
f"You're about to take up {required_space} of {available_space} bytes available."
|
||||
)
|
||||
return np.memmap(**kwargs)
|
||||
|
||||
|
||||
class OnlineBuffer(torch.utils.data.Dataset):
|
||||
"""FIFO data buffer for the online training loop in train.py.
|
||||
|
||||
Follows the protocol of LeRobotDataset as much as is required to have it be used by the online training
|
||||
loop in the same way that a LeRobotDataset would be used.
|
||||
|
||||
The underlying data structure will have data inserted in a circular fashion. Always insert after the
|
||||
last index, and when you reach the end, wrap around to the start.
|
||||
|
||||
The data is stored in a numpy memmap.
|
||||
"""
|
||||
|
||||
NEXT_INDEX_KEY = "_next_index"
|
||||
OCCUPANCY_MASK_KEY = "_occupancy_mask"
|
||||
INDEX_KEY = "index"
|
||||
FRAME_INDEX_KEY = "frame_index"
|
||||
EPISODE_INDEX_KEY = "episode_index"
|
||||
TIMESTAMP_KEY = "timestamp"
|
||||
IS_PAD_POSTFIX = "_is_pad"
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
write_dir: str | Path,
|
||||
data_spec: dict[str, Any] | None,
|
||||
buffer_capacity: int | None,
|
||||
fps: float | None = None,
|
||||
delta_timestamps: dict[str, list[float]] | dict[str, np.ndarray] | None = None,
|
||||
):
|
||||
"""
|
||||
The online buffer can be provided from scratch or you can load an existing online buffer by passing
|
||||
a `write_dir` associated with an existing buffer.
|
||||
|
||||
Args:
|
||||
write_dir: Where to keep the numpy memmap files. One memmap file will be stored for each data key.
|
||||
Note that if the files already exist, they are opened in read-write mode (used for training
|
||||
resumption.)
|
||||
data_spec: A mapping from data key to data specification, like {data_key: {"shape": tuple[int],
|
||||
"dtype": np.dtype}}. This should include all the data that you wish to record into the buffer,
|
||||
but note that "index", "frame_index" and "episode_index" are already accounted for by this
|
||||
class, so you don't need to include them.
|
||||
buffer_capacity: How many frames should be stored in the buffer as a maximum. Be aware of your
|
||||
system's available disk space when choosing this.
|
||||
fps: Same as the fps concept in LeRobot dataset. Here it needs to be provided for the
|
||||
delta_timestamps logic. You can pass None if you are not using delta_timestamps.
|
||||
delta_timestamps: Same as the delta_timestamps concept in LeRobotDataset. This is internally
|
||||
converted to dict[str, np.ndarray] for optimization purposes.
|
||||
|
||||
"""
|
||||
self.set_delta_timestamps(delta_timestamps)
|
||||
self._fps = fps
|
||||
# Tolerance in seconds used to discard loaded frames when their timestamps are not close enough from
|
||||
# the requested frames. It is only used when `delta_timestamps` is provided.
|
||||
# minus 1e-4 to account for possible numerical error
|
||||
self.tolerance_s = 1 / self.fps - 1e-4 if fps is not None else None
|
||||
self._buffer_capacity = buffer_capacity
|
||||
data_spec = self._make_data_spec(data_spec, buffer_capacity)
|
||||
Path(write_dir).mkdir(parents=True, exist_ok=True)
|
||||
self._data = {}
|
||||
for k, v in data_spec.items():
|
||||
self._data[k] = _make_memmap_safe(
|
||||
filename=Path(write_dir) / k,
|
||||
dtype=v["dtype"] if v is not None else None,
|
||||
mode="r+" if (Path(write_dir) / k).exists() else "w+",
|
||||
shape=tuple(v["shape"]) if v is not None else None,
|
||||
)
|
||||
|
||||
@property
|
||||
def delta_timestamps(self) -> dict[str, np.ndarray] | None:
|
||||
return self._delta_timestamps
|
||||
|
||||
def set_delta_timestamps(self, value: dict[str, list[float]] | None):
|
||||
"""Set delta_timestamps converting the values to numpy arrays.
|
||||
|
||||
The conversion is for an optimization in the __getitem__. The loop is much slower if the arrays
|
||||
need to be converted into numpy arrays.
|
||||
"""
|
||||
if value is not None:
|
||||
self._delta_timestamps = {k: np.array(v) for k, v in value.items()}
|
||||
else:
|
||||
self._delta_timestamps = None
|
||||
|
||||
def _make_data_spec(
|
||||
self, data_spec: dict[str, Any], buffer_capacity: int
|
||||
) -> dict[str, dict[str, Any]]:
|
||||
"""Makes the data spec for np.memmap."""
|
||||
if any(k.startswith("_") for k in data_spec):
|
||||
raise ValueError(
|
||||
"data_spec keys should not start with '_'. This prefix is reserved for internal logic."
|
||||
)
|
||||
preset_keys = {
|
||||
OnlineBuffer.INDEX_KEY,
|
||||
OnlineBuffer.FRAME_INDEX_KEY,
|
||||
OnlineBuffer.EPISODE_INDEX_KEY,
|
||||
OnlineBuffer.TIMESTAMP_KEY,
|
||||
}
|
||||
if len(intersection := set(data_spec).intersection(preset_keys)) > 0:
|
||||
raise ValueError(
|
||||
f"data_spec should not contain any of {preset_keys} as these are handled internally. "
|
||||
f"The provided data_spec has {intersection}."
|
||||
)
|
||||
complete_data_spec = {
|
||||
# _next_index will be a pointer to the next index that we should start filling from when we add
|
||||
# more data.
|
||||
OnlineBuffer.NEXT_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": ()},
|
||||
# Since the memmap is initialized with all-zeros, this keeps track of which indices are occupied
|
||||
# with real data rather than the dummy initialization.
|
||||
OnlineBuffer.OCCUPANCY_MASK_KEY: {
|
||||
"dtype": np.dtype("?"),
|
||||
"shape": (buffer_capacity,),
|
||||
},
|
||||
OnlineBuffer.INDEX_KEY: {
|
||||
"dtype": np.dtype("int64"),
|
||||
"shape": (buffer_capacity,),
|
||||
},
|
||||
OnlineBuffer.FRAME_INDEX_KEY: {
|
||||
"dtype": np.dtype("int64"),
|
||||
"shape": (buffer_capacity,),
|
||||
},
|
||||
OnlineBuffer.EPISODE_INDEX_KEY: {
|
||||
"dtype": np.dtype("int64"),
|
||||
"shape": (buffer_capacity,),
|
||||
},
|
||||
OnlineBuffer.TIMESTAMP_KEY: {
|
||||
"dtype": np.dtype("float64"),
|
||||
"shape": (buffer_capacity,),
|
||||
},
|
||||
}
|
||||
for k, v in data_spec.items():
|
||||
complete_data_spec[k] = {
|
||||
"dtype": v["dtype"],
|
||||
"shape": (buffer_capacity, *v["shape"]),
|
||||
}
|
||||
return complete_data_spec
|
||||
|
||||
def add_data(self, data: dict[str, np.ndarray]):
|
||||
"""Add new data to the buffer, which could potentially mean shifting old data out.
|
||||
|
||||
The new data should contain all the frames (in order) of any number of episodes. The indices should
|
||||
start from 0 (note to the developer: this can easily be generalized). See the `rollout` and
|
||||
`eval_policy` functions in `eval.py` for more information on how the data is constructed.
|
||||
|
||||
Shift the incoming data index and episode_index to continue on from the last frame. Note that this
|
||||
will be done in place!
|
||||
"""
|
||||
if len(missing_keys := (set(self.data_keys).difference(set(data)))) > 0:
|
||||
raise ValueError(f"Missing data keys: {missing_keys}")
|
||||
new_data_length = len(data[self.data_keys[0]])
|
||||
if not all(len(data[k]) == new_data_length for k in self.data_keys):
|
||||
raise ValueError("All data items should have the same length")
|
||||
|
||||
next_index = self._data[OnlineBuffer.NEXT_INDEX_KEY]
|
||||
|
||||
# Sanity check to make sure that the new data indices start from 0.
|
||||
assert data[OnlineBuffer.EPISODE_INDEX_KEY][0].item() == 0
|
||||
assert data[OnlineBuffer.INDEX_KEY][0].item() == 0
|
||||
|
||||
# Shift the incoming indices if necessary.
|
||||
if self.num_frames > 0:
|
||||
last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][
|
||||
next_index - 1
|
||||
]
|
||||
last_data_index = self._data[OnlineBuffer.INDEX_KEY][next_index - 1]
|
||||
data[OnlineBuffer.EPISODE_INDEX_KEY] += last_episode_index + 1
|
||||
data[OnlineBuffer.INDEX_KEY] += last_data_index + 1
|
||||
|
||||
# Insert the new data starting from next_index. It may be necessary to wrap around to the start.
|
||||
n_surplus = max(0, new_data_length - (self._buffer_capacity - next_index))
|
||||
for k in self.data_keys:
|
||||
if n_surplus == 0:
|
||||
slc = slice(next_index, next_index + new_data_length)
|
||||
self._data[k][slc] = data[k]
|
||||
self._data[OnlineBuffer.OCCUPANCY_MASK_KEY][slc] = True
|
||||
else:
|
||||
self._data[k][next_index:] = data[k][:-n_surplus]
|
||||
self._data[OnlineBuffer.OCCUPANCY_MASK_KEY][next_index:] = True
|
||||
self._data[k][:n_surplus] = data[k][-n_surplus:]
|
||||
if n_surplus == 0:
|
||||
self._data[OnlineBuffer.NEXT_INDEX_KEY] = next_index + new_data_length
|
||||
else:
|
||||
self._data[OnlineBuffer.NEXT_INDEX_KEY] = n_surplus
|
||||
|
||||
@property
|
||||
def data_keys(self) -> list[str]:
|
||||
keys = set(self._data)
|
||||
keys.remove(OnlineBuffer.OCCUPANCY_MASK_KEY)
|
||||
keys.remove(OnlineBuffer.NEXT_INDEX_KEY)
|
||||
return sorted(keys)
|
||||
|
||||
@property
|
||||
def fps(self) -> float | None:
|
||||
return self._fps
|
||||
|
||||
@property
|
||||
def num_episodes(self) -> int:
|
||||
return len(
|
||||
np.unique(
|
||||
self._data[OnlineBuffer.EPISODE_INDEX_KEY][
|
||||
self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]
|
||||
]
|
||||
)
|
||||
)
|
||||
|
||||
@property
|
||||
def num_frames(self) -> int:
|
||||
return np.count_nonzero(self._data[OnlineBuffer.OCCUPANCY_MASK_KEY])
|
||||
|
||||
def __len__(self):
|
||||
return self.num_frames
|
||||
|
||||
def _item_to_tensors(self, item: dict) -> dict:
|
||||
item_ = {}
|
||||
for k, v in item.items():
|
||||
if isinstance(v, torch.Tensor):
|
||||
item_[k] = v
|
||||
elif isinstance(v, np.ndarray):
|
||||
item_[k] = torch.from_numpy(v)
|
||||
else:
|
||||
item_[k] = torch.tensor(v)
|
||||
return item_
|
||||
|
||||
def __getitem__(self, idx: int) -> dict[str, torch.Tensor]:
|
||||
if idx >= len(self) or idx < -len(self):
|
||||
raise IndexError
|
||||
|
||||
item = {k: v[idx] for k, v in self._data.items() if not k.startswith("_")}
|
||||
|
||||
if self.delta_timestamps is None:
|
||||
return self._item_to_tensors(item)
|
||||
|
||||
episode_index = item[OnlineBuffer.EPISODE_INDEX_KEY]
|
||||
current_ts = item[OnlineBuffer.TIMESTAMP_KEY]
|
||||
episode_data_indices = np.where(
|
||||
np.bitwise_and(
|
||||
self._data[OnlineBuffer.EPISODE_INDEX_KEY] == episode_index,
|
||||
self._data[OnlineBuffer.OCCUPANCY_MASK_KEY],
|
||||
)
|
||||
)[0]
|
||||
episode_timestamps = self._data[OnlineBuffer.TIMESTAMP_KEY][
|
||||
episode_data_indices
|
||||
]
|
||||
|
||||
for data_key in self.delta_timestamps:
|
||||
# Note: The logic in this loop is copied from `load_previous_and_future_frames`.
|
||||
# Get timestamps used as query to retrieve data of previous/future frames.
|
||||
query_ts = current_ts + self.delta_timestamps[data_key]
|
||||
|
||||
# Compute distances between each query timestamp and all timestamps of all the frames belonging to
|
||||
# the episode.
|
||||
dist = np.abs(query_ts[:, None] - episode_timestamps[None, :])
|
||||
argmin_ = np.argmin(dist, axis=1)
|
||||
min_ = dist[np.arange(dist.shape[0]), argmin_]
|
||||
|
||||
is_pad = min_ > self.tolerance_s
|
||||
|
||||
# Check violated query timestamps are all outside the episode range.
|
||||
assert (
|
||||
(query_ts[is_pad] < episode_timestamps[0])
|
||||
| (episode_timestamps[-1] < query_ts[is_pad])
|
||||
).all(), (
|
||||
f"One or several timestamps unexpectedly violate the tolerance ({min_} > {self.tolerance_s=}"
|
||||
") inside the episode range."
|
||||
)
|
||||
|
||||
# Load frames for this data key.
|
||||
item[data_key] = self._data[data_key][episode_data_indices[argmin_]]
|
||||
|
||||
item[f"{data_key}{OnlineBuffer.IS_PAD_POSTFIX}"] = is_pad
|
||||
|
||||
return self._item_to_tensors(item)
|
||||
|
||||
def get_data_by_key(self, key: str) -> torch.Tensor:
|
||||
"""Returns all data for a given data key as a Tensor."""
|
||||
return torch.from_numpy(
|
||||
self._data[key][self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]]
|
||||
)
|
||||
|
||||
|
||||
def compute_sampler_weights(
|
||||
offline_dataset: LeRobotDataset,
|
||||
offline_drop_n_last_frames: int = 0,
|
||||
online_dataset: OnlineBuffer | None = None,
|
||||
online_sampling_ratio: float | None = None,
|
||||
online_drop_n_last_frames: int = 0,
|
||||
) -> torch.Tensor:
|
||||
"""Compute the sampling weights for the online training dataloader in train.py.
|
||||
|
||||
Args:
|
||||
offline_dataset: The LeRobotDataset used for offline pre-training.
|
||||
online_drop_n_last_frames: Number of frames to drop from the end of each offline dataset episode.
|
||||
online_dataset: The OnlineBuffer used in online training.
|
||||
online_sampling_ratio: The proportion of data that should be sampled from the online dataset. If an
|
||||
online dataset is provided, this value must also be provided.
|
||||
online_drop_n_first_frames: See `offline_drop_n_last_frames`. This is the same, but for the online
|
||||
dataset.
|
||||
Returns:
|
||||
Tensor of weights for [offline_dataset; online_dataset], normalized to 1.
|
||||
|
||||
Notes to maintainers:
|
||||
- This duplicates some logic from EpisodeAwareSampler. We should consider converging to one approach.
|
||||
- When used with `torch.utils.data.WeightedRandomSampler`, it could completely replace
|
||||
`EpisodeAwareSampler` as the online dataset related arguments are optional. The only missing feature
|
||||
is the ability to turn shuffling off.
|
||||
- Options `drop_first_n_frames` and `episode_indices_to_use` can be added easily. They were not
|
||||
included here to avoid adding complexity.
|
||||
"""
|
||||
if len(offline_dataset) == 0 and (
|
||||
online_dataset is None or len(online_dataset) == 0
|
||||
):
|
||||
raise ValueError(
|
||||
"At least one of `offline_dataset` or `online_dataset` should be contain data."
|
||||
)
|
||||
if (online_dataset is None) ^ (online_sampling_ratio is None):
|
||||
raise ValueError(
|
||||
"`online_dataset` and `online_sampling_ratio` must be provided together or not at all."
|
||||
)
|
||||
offline_sampling_ratio = (
|
||||
0 if online_sampling_ratio is None else 1 - online_sampling_ratio
|
||||
)
|
||||
|
||||
weights = []
|
||||
|
||||
if len(offline_dataset) > 0:
|
||||
offline_data_mask_indices = []
|
||||
for start_index, end_index in zip(
|
||||
offline_dataset.episode_data_index["from"],
|
||||
offline_dataset.episode_data_index["to"],
|
||||
strict=True,
|
||||
):
|
||||
offline_data_mask_indices.extend(
|
||||
range(start_index.item(), end_index.item() - offline_drop_n_last_frames)
|
||||
)
|
||||
offline_data_mask = torch.zeros(len(offline_dataset), dtype=torch.bool)
|
||||
offline_data_mask[torch.tensor(offline_data_mask_indices)] = True
|
||||
weights.append(
|
||||
torch.full(
|
||||
size=(len(offline_dataset),),
|
||||
fill_value=offline_sampling_ratio / offline_data_mask.sum(),
|
||||
)
|
||||
* offline_data_mask
|
||||
)
|
||||
|
||||
if online_dataset is not None and len(online_dataset) > 0:
|
||||
online_data_mask_indices = []
|
||||
episode_indices = online_dataset.get_data_by_key("episode_index")
|
||||
for episode_idx in torch.unique(episode_indices):
|
||||
where_episode = torch.where(episode_indices == episode_idx)
|
||||
start_index = where_episode[0][0]
|
||||
end_index = where_episode[0][-1] + 1
|
||||
online_data_mask_indices.extend(
|
||||
range(start_index.item(), end_index.item() - online_drop_n_last_frames)
|
||||
)
|
||||
online_data_mask = torch.zeros(len(online_dataset), dtype=torch.bool)
|
||||
online_data_mask[torch.tensor(online_data_mask_indices)] = True
|
||||
weights.append(
|
||||
torch.full(
|
||||
size=(len(online_dataset),),
|
||||
fill_value=online_sampling_ratio / online_data_mask.sum(),
|
||||
)
|
||||
* online_data_mask
|
||||
)
|
||||
|
||||
weights = torch.cat(weights)
|
||||
|
||||
if weights.sum() == 0:
|
||||
weights += 1 / len(weights)
|
||||
else:
|
||||
weights /= weights.sum()
|
||||
|
||||
return weights
|
||||
@@ -0,0 +1,56 @@
|
||||
## Using / Updating `CODEBASE_VERSION` (for maintainers)
|
||||
|
||||
Since our dataset pushed to the hub are decoupled with the evolution of this repo, we ensure compatibility of
|
||||
the datasets with our code, we use a `CODEBASE_VERSION` (defined in
|
||||
lerobot/common/datasets/lerobot_dataset.py) variable.
|
||||
|
||||
For instance, [`lerobot/pusht`](https://huggingface.co/datasets/lerobot/pusht) has many versions to maintain backward compatibility between LeRobot codebase versions:
|
||||
- [v1.0](https://huggingface.co/datasets/lerobot/pusht/tree/v1.0)
|
||||
- [v1.1](https://huggingface.co/datasets/lerobot/pusht/tree/v1.1)
|
||||
- [v1.2](https://huggingface.co/datasets/lerobot/pusht/tree/v1.2)
|
||||
- [v1.3](https://huggingface.co/datasets/lerobot/pusht/tree/v1.3)
|
||||
- [v1.4](https://huggingface.co/datasets/lerobot/pusht/tree/v1.4)
|
||||
- [v1.5](https://huggingface.co/datasets/lerobot/pusht/tree/v1.5)
|
||||
- [v1.6](https://huggingface.co/datasets/lerobot/pusht/tree/v1.6) <-- last version
|
||||
- [main](https://huggingface.co/datasets/lerobot/pusht/tree/main) <-- points to the last version
|
||||
|
||||
Starting with v1.6, every dataset pushed to the hub or saved locally also have this version number in their
|
||||
`info.json` metadata.
|
||||
|
||||
### Uploading a new dataset
|
||||
If you are pushing a new dataset, you don't need to worry about any of the instructions below, nor to be
|
||||
compatible with previous codebase versions. The `push_dataset_to_hub.py` script will automatically tag your
|
||||
dataset with the current `CODEBASE_VERSION`.
|
||||
|
||||
### Updating an existing dataset
|
||||
If you want to update an existing dataset, you need to change the `CODEBASE_VERSION` from `lerobot_dataset.py`
|
||||
before running `push_dataset_to_hub.py`. This is especially useful if you introduce a breaking change
|
||||
intentionally or not (i.e. something not backward compatible such as modifying the reward functions used,
|
||||
deleting some frames at the end of an episode, etc.). That way, people running a previous version of the
|
||||
codebase won't be affected by your change and backward compatibility is maintained.
|
||||
|
||||
However, you will need to update the version of ALL the other datasets so that they have the new
|
||||
`CODEBASE_VERSION` as a branch in their hugging face dataset repository. Don't worry, there is an easy way
|
||||
that doesn't require to run `push_dataset_to_hub.py`. You can just "branch-out" from the `main` branch on HF
|
||||
dataset repo by running this script which corresponds to a `git checkout -b` (so no copy or upload needed):
|
||||
|
||||
```python
|
||||
from huggingface_hub import HfApi
|
||||
|
||||
from lerobot import available_datasets
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
|
||||
api = HfApi()
|
||||
|
||||
for repo_id in available_datasets:
|
||||
dataset_info = api.list_repo_refs(repo_id, repo_type="dataset")
|
||||
branches = [b.name for b in dataset_info.branches]
|
||||
if CODEBASE_VERSION in branches:
|
||||
print(f"{repo_id} already @{CODEBASE_VERSION}, skipping.")
|
||||
continue
|
||||
else:
|
||||
# Now create a branch named after the new version by branching out from "main"
|
||||
# which is expected to be the preceding version
|
||||
api.create_branch(repo_id, repo_type="dataset", branch=CODEBASE_VERSION, revision="main")
|
||||
print(f"{repo_id} successfully updated @{CODEBASE_VERSION}")
|
||||
```
|
||||
@@ -37,10 +37,16 @@ def check_chunks_compatible(chunks: tuple, shape: tuple):
|
||||
assert c > 0
|
||||
|
||||
|
||||
def rechunk_recompress_array(group, name, chunks=None, chunk_length=None, compressor=None, tmp_key="_temp"):
|
||||
def rechunk_recompress_array(
|
||||
group, name, chunks=None, chunk_length=None, compressor=None, tmp_key="_temp"
|
||||
):
|
||||
old_arr = group[name]
|
||||
if chunks is None:
|
||||
chunks = (chunk_length,) + old_arr.chunks[1:] if chunk_length is not None else old_arr.chunks
|
||||
chunks = (
|
||||
(chunk_length,) + old_arr.chunks[1:]
|
||||
if chunk_length is not None
|
||||
else old_arr.chunks
|
||||
)
|
||||
check_chunks_compatible(chunks, old_arr.shape)
|
||||
|
||||
if compressor is None:
|
||||
@@ -82,13 +88,18 @@ def get_optimal_chunks(shape, dtype, target_chunk_bytes=2e6, max_chunk_length=No
|
||||
for i in range(len(shape) - 1):
|
||||
this_chunk_bytes = itemsize * np.prod(rshape[:i])
|
||||
next_chunk_bytes = itemsize * np.prod(rshape[: i + 1])
|
||||
if this_chunk_bytes <= target_chunk_bytes and next_chunk_bytes > target_chunk_bytes:
|
||||
if (
|
||||
this_chunk_bytes <= target_chunk_bytes
|
||||
and next_chunk_bytes > target_chunk_bytes
|
||||
):
|
||||
split_idx = i
|
||||
|
||||
rchunks = rshape[:split_idx]
|
||||
item_chunk_bytes = itemsize * np.prod(rshape[:split_idx])
|
||||
this_max_chunk_length = rshape[split_idx]
|
||||
next_chunk_length = min(this_max_chunk_length, math.ceil(target_chunk_bytes / item_chunk_bytes))
|
||||
next_chunk_length = min(
|
||||
this_max_chunk_length, math.ceil(target_chunk_bytes / item_chunk_bytes)
|
||||
)
|
||||
rchunks.append(next_chunk_length)
|
||||
len_diff = len(shape) - len(rchunks)
|
||||
rchunks.extend([1] * len_diff)
|
||||
@@ -124,7 +135,13 @@ class ReplayBuffer:
|
||||
root.require_group("data", overwrite=False)
|
||||
meta = root.require_group("meta", overwrite=False)
|
||||
if "episode_ends" not in meta:
|
||||
meta.zeros("episode_ends", shape=(0,), dtype=np.int64, compressor=None, overwrite=False)
|
||||
meta.zeros(
|
||||
"episode_ends",
|
||||
shape=(0,),
|
||||
dtype=np.int64,
|
||||
compressor=None,
|
||||
overwrite=False,
|
||||
)
|
||||
return cls(root=root)
|
||||
|
||||
@classmethod
|
||||
@@ -193,7 +210,11 @@ class ReplayBuffer:
|
||||
root = zarr.group(store=store)
|
||||
# copy without recompression
|
||||
n_copied, n_skipped, n_bytes_copied = zarr.copy_store(
|
||||
source=src_store, dest=store, source_path="/meta", dest_path="/meta", if_exists=if_exists
|
||||
source=src_store,
|
||||
dest=store,
|
||||
source_path="/meta",
|
||||
dest_path="/meta",
|
||||
if_exists=if_exists,
|
||||
)
|
||||
data_group = root.create_group("data", overwrite=True)
|
||||
if keys is None:
|
||||
@@ -201,7 +222,9 @@ class ReplayBuffer:
|
||||
for key in keys:
|
||||
value = src_root["data"][key]
|
||||
cks = cls._resolve_array_chunks(chunks=chunks, key=key, array=value)
|
||||
cpr = cls._resolve_array_compressor(compressors=compressors, key=key, array=value)
|
||||
cpr = cls._resolve_array_compressor(
|
||||
compressors=compressors, key=key, array=value
|
||||
)
|
||||
if cks == value.chunks and cpr == value.compressor:
|
||||
# copy without recompression
|
||||
this_path = "/data/" + key
|
||||
@@ -286,13 +309,17 @@ class ReplayBuffer:
|
||||
meta_group = root.create_group("meta", overwrite=True)
|
||||
# save meta, no chunking
|
||||
for key, value in self.root["meta"].items():
|
||||
_ = meta_group.array(name=key, data=value, shape=value.shape, chunks=value.shape)
|
||||
_ = meta_group.array(
|
||||
name=key, data=value, shape=value.shape, chunks=value.shape
|
||||
)
|
||||
|
||||
# save data, chunk
|
||||
data_group = root.create_group("data", overwrite=True)
|
||||
for key, value in self.root["data"].items():
|
||||
cks = self._resolve_array_chunks(chunks=chunks, key=key, array=value)
|
||||
cpr = self._resolve_array_compressor(compressors=compressors, key=key, array=value)
|
||||
cpr = self._resolve_array_compressor(
|
||||
compressors=compressors, key=key, array=value
|
||||
)
|
||||
if isinstance(value, zarr.Array):
|
||||
if cks == value.chunks and cpr == value.compressor:
|
||||
# copy without recompression
|
||||
@@ -339,13 +366,19 @@ class ReplayBuffer:
|
||||
@staticmethod
|
||||
def resolve_compressor(compressor="default"):
|
||||
if compressor == "default":
|
||||
compressor = numcodecs.Blosc(cname="lz4", clevel=5, shuffle=numcodecs.Blosc.NOSHUFFLE)
|
||||
compressor = numcodecs.Blosc(
|
||||
cname="lz4", clevel=5, shuffle=numcodecs.Blosc.NOSHUFFLE
|
||||
)
|
||||
elif compressor == "disk":
|
||||
compressor = numcodecs.Blosc("zstd", clevel=5, shuffle=numcodecs.Blosc.BITSHUFFLE)
|
||||
compressor = numcodecs.Blosc(
|
||||
"zstd", clevel=5, shuffle=numcodecs.Blosc.BITSHUFFLE
|
||||
)
|
||||
return compressor
|
||||
|
||||
@classmethod
|
||||
def _resolve_array_compressor(cls, compressors: dict | str | numcodecs.abc.Codec, key, array):
|
||||
def _resolve_array_compressor(
|
||||
cls, compressors: dict | str | numcodecs.abc.Codec, key, array
|
||||
):
|
||||
# allows compressor to be explicitly set to None
|
||||
cpr = "nil"
|
||||
if isinstance(compressors, dict):
|
||||
@@ -404,7 +437,11 @@ class ReplayBuffer:
|
||||
if self.backend == "zarr":
|
||||
for key, value in np_data.items():
|
||||
_ = meta_group.array(
|
||||
name=key, data=value, shape=value.shape, chunks=value.shape, overwrite=True
|
||||
name=key,
|
||||
data=value,
|
||||
shape=value.shape,
|
||||
chunks=value.shape,
|
||||
overwrite=True,
|
||||
)
|
||||
else:
|
||||
meta_group.update(np_data)
|
||||
@@ -514,10 +551,18 @@ class ReplayBuffer:
|
||||
# create array
|
||||
if key not in self.data:
|
||||
if is_zarr:
|
||||
cks = self._resolve_array_chunks(chunks=chunks, key=key, array=value)
|
||||
cpr = self._resolve_array_compressor(compressors=compressors, key=key, array=value)
|
||||
cks = self._resolve_array_chunks(
|
||||
chunks=chunks, key=key, array=value
|
||||
)
|
||||
cpr = self._resolve_array_compressor(
|
||||
compressors=compressors, key=key, array=value
|
||||
)
|
||||
arr = self.data.zeros(
|
||||
name=key, shape=new_shape, chunks=cks, dtype=value.dtype, compressor=cpr
|
||||
name=key,
|
||||
shape=new_shape,
|
||||
chunks=cks,
|
||||
dtype=value.dtype,
|
||||
compressor=cpr,
|
||||
)
|
||||
else:
|
||||
# copy data to prevent modify
|
||||
@@ -544,7 +589,9 @@ class ReplayBuffer:
|
||||
|
||||
# rechunk
|
||||
if is_zarr and episode_ends.chunks[0] < episode_ends.shape[0]:
|
||||
rechunk_recompress_array(self.meta, "episode_ends", chunk_length=int(episode_ends.shape[0] * 1.5))
|
||||
rechunk_recompress_array(
|
||||
self.meta, "episode_ends", chunk_length=int(episode_ends.shape[0] * 1.5)
|
||||
)
|
||||
|
||||
def drop_episode(self):
|
||||
is_zarr = self.backend == "zarr"
|
||||
|
||||
@@ -14,156 +14,189 @@
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""
|
||||
This file contains all obsolete download scripts. They are centralized here to not have to load
|
||||
useless dependencies when using datasets.
|
||||
This file contains download scripts for raw datasets.
|
||||
|
||||
Example of usage:
|
||||
```
|
||||
python lerobot/common/datasets/push_dataset_to_hub/_download_raw.py \
|
||||
--raw-dir data/lerobot-raw/pusht_raw \
|
||||
--repo-id lerobot-raw/pusht_raw
|
||||
```
|
||||
"""
|
||||
|
||||
import io
|
||||
import argparse
|
||||
import logging
|
||||
import shutil
|
||||
import warnings
|
||||
from pathlib import Path
|
||||
|
||||
import tqdm
|
||||
from huggingface_hub import snapshot_download
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
|
||||
|
||||
def download_raw(raw_dir, dataset_id):
|
||||
if "aloha" in dataset_id or "image" in dataset_id:
|
||||
download_hub(raw_dir, dataset_id)
|
||||
elif "pusht" in dataset_id:
|
||||
download_pusht(raw_dir)
|
||||
elif "xarm" in dataset_id:
|
||||
download_xarm(raw_dir)
|
||||
elif "umi" in dataset_id:
|
||||
download_umi(raw_dir)
|
||||
else:
|
||||
raise ValueError(dataset_id)
|
||||
# {raw_repo_id: raw_format}
|
||||
AVAILABLE_RAW_REPO_IDS = {
|
||||
"lerobot-raw/aloha_mobile_cabinet_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_mobile_chair_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_mobile_elevator_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_mobile_shrimp_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_mobile_wash_pan_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_mobile_wipe_wine_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_sim_insertion_human_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_sim_insertion_scripted_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_sim_transfer_cube_human_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_sim_transfer_cube_scripted_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_battery_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_candy_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_coffee_new_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_coffee_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_cups_open_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_fork_pick_up_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_pingpong_test_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_pro_pencil_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_screw_driver_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_tape_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_thread_velcro_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_towel_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
|
||||
"lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
|
||||
"lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
|
||||
"lerobot-raw/pusht_raw": "pusht_zarr",
|
||||
"lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
|
||||
"lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
|
||||
"lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
|
||||
"lerobot-raw/unitreeh1_warehouse_raw": "aloha_hdf5",
|
||||
"lerobot-raw/xarm_lift_medium_raw": "xarm_pkl",
|
||||
"lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
|
||||
"lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
|
||||
"lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
|
||||
"lerobot-raw/fractal20220817_data_raw": "openx_rlds.fractal20220817_data",
|
||||
"lerobot-raw/kuka_raw": "openx_rlds.kuka",
|
||||
"lerobot-raw/bridge_openx_raw": "openx_rlds.bridge_openx",
|
||||
"lerobot-raw/taco_play_raw": "openx_rlds.taco_play",
|
||||
"lerobot-raw/jaco_play_raw": "openx_rlds.jaco_play",
|
||||
"lerobot-raw/berkeley_cable_routing_raw": "openx_rlds.berkeley_cable_routing",
|
||||
"lerobot-raw/roboturk_raw": "openx_rlds.roboturk",
|
||||
"lerobot-raw/nyu_door_opening_surprising_effectiveness_raw": "openx_rlds.nyu_door_opening_surprising_effectiveness",
|
||||
"lerobot-raw/viola_raw": "openx_rlds.viola",
|
||||
"lerobot-raw/berkeley_autolab_ur5_raw": "openx_rlds.berkeley_autolab_ur5",
|
||||
"lerobot-raw/toto_raw": "openx_rlds.toto",
|
||||
"lerobot-raw/language_table_raw": "openx_rlds.language_table",
|
||||
"lerobot-raw/columbia_cairlab_pusht_real_raw": "openx_rlds.columbia_cairlab_pusht_real",
|
||||
"lerobot-raw/stanford_kuka_multimodal_dataset_raw": "openx_rlds.stanford_kuka_multimodal_dataset",
|
||||
"lerobot-raw/nyu_rot_dataset_raw": "openx_rlds.nyu_rot_dataset",
|
||||
"lerobot-raw/io_ai_tech_raw": "openx_rlds.io_ai_tech",
|
||||
"lerobot-raw/stanford_hydra_dataset_raw": "openx_rlds.stanford_hydra_dataset",
|
||||
"lerobot-raw/austin_buds_dataset_raw": "openx_rlds.austin_buds_dataset",
|
||||
"lerobot-raw/nyu_franka_play_dataset_raw": "openx_rlds.nyu_franka_play_dataset",
|
||||
"lerobot-raw/maniskill_dataset_raw": "openx_rlds.maniskill_dataset",
|
||||
"lerobot-raw/furniture_bench_dataset_raw": "openx_rlds.furniture_bench_dataset",
|
||||
"lerobot-raw/cmu_franka_exploration_dataset_raw": "openx_rlds.cmu_franka_exploration_dataset",
|
||||
"lerobot-raw/ucsd_kitchen_dataset_raw": "openx_rlds.ucsd_kitchen_dataset",
|
||||
"lerobot-raw/ucsd_pick_and_place_dataset_raw": "openx_rlds.ucsd_pick_and_place_dataset",
|
||||
"lerobot-raw/spoc_raw": "openx_rlds.spoc",
|
||||
"lerobot-raw/austin_sailor_dataset_raw": "openx_rlds.austin_sailor_dataset",
|
||||
"lerobot-raw/austin_sirius_dataset_raw": "openx_rlds.austin_sirius_dataset",
|
||||
"lerobot-raw/bc_z_raw": "openx_rlds.bc_z",
|
||||
"lerobot-raw/utokyo_pr2_opening_fridge_raw": "openx_rlds.utokyo_pr2_opening_fridge",
|
||||
"lerobot-raw/utokyo_pr2_tabletop_manipulation_raw": "openx_rlds.utokyo_pr2_tabletop_manipulation",
|
||||
"lerobot-raw/utokyo_xarm_pick_and_place_raw": "openx_rlds.utokyo_xarm_pick_and_place",
|
||||
"lerobot-raw/utokyo_xarm_bimanual_raw": "openx_rlds.utokyo_xarm_bimanual",
|
||||
"lerobot-raw/utokyo_saytap_raw": "openx_rlds.utokyo_saytap",
|
||||
"lerobot-raw/robo_net_raw": "openx_rlds.robo_net",
|
||||
"lerobot-raw/robo_set_raw": "openx_rlds.robo_set",
|
||||
"lerobot-raw/berkeley_mvp_raw": "openx_rlds.berkeley_mvp",
|
||||
"lerobot-raw/berkeley_rpt_raw": "openx_rlds.berkeley_rpt",
|
||||
"lerobot-raw/kaist_nonprehensile_raw": "openx_rlds.kaist_nonprehensile",
|
||||
"lerobot-raw/stanford_mask_vit_raw": "openx_rlds.stanford_mask_vit",
|
||||
"lerobot-raw/tokyo_u_lsmo_raw": "openx_rlds.tokyo_u_lsmo",
|
||||
"lerobot-raw/dlr_sara_pour_raw": "openx_rlds.dlr_sara_pour",
|
||||
"lerobot-raw/dlr_sara_grid_clamp_raw": "openx_rlds.dlr_sara_grid_clamp",
|
||||
"lerobot-raw/dlr_edan_shared_control_raw": "openx_rlds.dlr_edan_shared_control",
|
||||
"lerobot-raw/asu_table_top_raw": "openx_rlds.asu_table_top",
|
||||
"lerobot-raw/stanford_robocook_raw": "openx_rlds.stanford_robocook",
|
||||
"lerobot-raw/imperialcollege_sawyer_wrist_cam_raw": "openx_rlds.imperialcollege_sawyer_wrist_cam",
|
||||
"lerobot-raw/iamlab_cmu_pickup_insert_raw": "openx_rlds.iamlab_cmu_pickup_insert",
|
||||
"lerobot-raw/uiuc_d3field_raw": "openx_rlds.uiuc_d3field",
|
||||
"lerobot-raw/utaustin_mutex_raw": "openx_rlds.utaustin_mutex",
|
||||
"lerobot-raw/berkeley_fanuc_manipulation_raw": "openx_rlds.berkeley_fanuc_manipulation",
|
||||
"lerobot-raw/cmu_playing_with_food_raw": "openx_rlds.cmu_playing_with_food",
|
||||
"lerobot-raw/cmu_play_fusion_raw": "openx_rlds.cmu_play_fusion",
|
||||
"lerobot-raw/cmu_stretch_raw": "openx_rlds.cmu_stretch",
|
||||
"lerobot-raw/berkeley_gnm_recon_raw": "openx_rlds.berkeley_gnm_recon",
|
||||
"lerobot-raw/berkeley_gnm_cory_hall_raw": "openx_rlds.berkeley_gnm_cory_hall",
|
||||
"lerobot-raw/berkeley_gnm_sac_son_raw": "openx_rlds.berkeley_gnm_sac_son",
|
||||
"lerobot-raw/droid_raw": "openx_rlds.droid",
|
||||
"lerobot-raw/droid_100_raw": "openx_rlds.droid100",
|
||||
"lerobot-raw/fmb_raw": "openx_rlds.fmb",
|
||||
"lerobot-raw/dobbe_raw": "openx_rlds.dobbe",
|
||||
"lerobot-raw/usc_cloth_sim_raw": "openx_rlds.usc_cloth_sim",
|
||||
"lerobot-raw/plex_robosuite_raw": "openx_rlds.plex_robosuite",
|
||||
"lerobot-raw/conq_hose_manipulation_raw": "openx_rlds.conq_hose_manipulation",
|
||||
"lerobot-raw/vima_raw": "openx_rlds.vima",
|
||||
"lerobot-raw/robot_vqa_raw": "openx_rlds.robot_vqa",
|
||||
"lerobot-raw/mimic_play_raw": "openx_rlds.mimic_play",
|
||||
"lerobot-raw/tidybot_raw": "openx_rlds.tidybot",
|
||||
"lerobot-raw/eth_agent_affordances_raw": "openx_rlds.eth_agent_affordances",
|
||||
}
|
||||
|
||||
|
||||
def download_and_extract_zip(url: str, destination_folder: Path) -> bool:
|
||||
import zipfile
|
||||
def download_raw(raw_dir: Path, repo_id: str):
|
||||
check_repo_id(repo_id)
|
||||
user_id, dataset_id = repo_id.split("/")
|
||||
|
||||
import requests
|
||||
if not dataset_id.endswith("_raw"):
|
||||
warnings.warn(
|
||||
f"""`dataset_id` ({dataset_id}) doesn't end with '_raw' (e.g. 'lerobot/pusht_raw'). Following this
|
||||
naming convention by renaming your repository is advised, but not mandatory.""",
|
||||
stacklevel=1,
|
||||
)
|
||||
|
||||
print(f"downloading from {url}")
|
||||
response = requests.get(url, stream=True)
|
||||
if response.status_code == 200:
|
||||
total_size = int(response.headers.get("content-length", 0))
|
||||
progress_bar = tqdm.tqdm(total=total_size, unit="B", unit_scale=True)
|
||||
|
||||
zip_file = io.BytesIO()
|
||||
for chunk in response.iter_content(chunk_size=1024):
|
||||
if chunk:
|
||||
zip_file.write(chunk)
|
||||
progress_bar.update(len(chunk))
|
||||
|
||||
progress_bar.close()
|
||||
|
||||
zip_file.seek(0)
|
||||
|
||||
with zipfile.ZipFile(zip_file, "r") as zip_ref:
|
||||
zip_ref.extractall(destination_folder)
|
||||
|
||||
|
||||
def download_pusht(raw_dir: str):
|
||||
pusht_url = "https://diffusion-policy.cs.columbia.edu/data/training/pusht.zip"
|
||||
|
||||
raw_dir = Path(raw_dir)
|
||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||
download_and_extract_zip(pusht_url, raw_dir)
|
||||
# file is created inside a useful "pusht" directory, so we move it out and delete the dir
|
||||
zarr_path = raw_dir / "pusht_cchi_v7_replay.zarr"
|
||||
shutil.move(raw_dir / "pusht" / "pusht_cchi_v7_replay.zarr", zarr_path)
|
||||
shutil.rmtree(raw_dir / "pusht")
|
||||
|
||||
|
||||
def download_xarm(raw_dir: Path):
|
||||
"""Download all xarm datasets at once"""
|
||||
import zipfile
|
||||
|
||||
import gdown
|
||||
|
||||
raw_dir = Path(raw_dir)
|
||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||
# from https://github.com/fyhMer/fowm/blob/main/scripts/download_datasets.py
|
||||
url = "https://drive.google.com/uc?id=1nhxpykGtPDhmQKm-_B8zBSywVRdgeVya"
|
||||
zip_path = raw_dir / "data.zip"
|
||||
gdown.download(url, str(zip_path), quiet=False)
|
||||
print("Extracting...")
|
||||
with zipfile.ZipFile(str(zip_path), "r") as zip_f:
|
||||
for pkl_path in zip_f.namelist():
|
||||
if pkl_path.startswith("data/xarm") and pkl_path.endswith(".pkl"):
|
||||
zip_f.extract(member=pkl_path)
|
||||
# move to corresponding raw directory
|
||||
extract_dir = pkl_path.replace("/buffer.pkl", "")
|
||||
raw_pkl_path = raw_dir / "buffer.pkl"
|
||||
shutil.move(pkl_path, raw_pkl_path)
|
||||
shutil.rmtree(extract_dir)
|
||||
zip_path.unlink()
|
||||
|
||||
|
||||
def download_hub(raw_dir: Path, dataset_id: str):
|
||||
raw_dir = Path(raw_dir)
|
||||
# Send warning if raw_dir isn't well formated
|
||||
if raw_dir.parts[-2] != user_id or raw_dir.parts[-1] != dataset_id:
|
||||
warnings.warn(
|
||||
f"""`raw_dir` ({raw_dir}) doesn't contain a community or user id `/` the name of the dataset that
|
||||
match the `repo_id` (e.g. 'data/lerobot/pusht_raw'). Following this naming convention is advised,
|
||||
but not mandatory.""",
|
||||
stacklevel=1,
|
||||
)
|
||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
logging.info(f"Start downloading from huggingface.co/cadene for {dataset_id}")
|
||||
snapshot_download(f"cadene/{dataset_id}_raw", repo_type="dataset", local_dir=raw_dir)
|
||||
logging.info(f"Finish downloading from huggingface.co/cadene for {dataset_id}")
|
||||
logging.info(f"Start downloading from huggingface.co/{user_id} for {dataset_id}")
|
||||
snapshot_download(repo_id, repo_type="dataset", local_dir=raw_dir)
|
||||
logging.info(f"Finish downloading from huggingface.co/{user_id} for {dataset_id}")
|
||||
|
||||
|
||||
def download_umi(raw_dir: Path):
|
||||
url_cup_in_the_wild = "https://real.stanford.edu/umi/data/zarr_datasets/cup_in_the_wild.zarr.zip"
|
||||
zarr_path = raw_dir / "cup_in_the_wild.zarr"
|
||||
def download_all_raw_datasets(data_dir: Path | None = None):
|
||||
if data_dir is None:
|
||||
data_dir = Path("data")
|
||||
for repo_id in AVAILABLE_RAW_REPO_IDS:
|
||||
raw_dir = data_dir / repo_id
|
||||
download_raw(raw_dir, repo_id)
|
||||
|
||||
raw_dir = Path(raw_dir)
|
||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||
download_and_extract_zip(url_cup_in_the_wild, zarr_path)
|
||||
|
||||
def main():
|
||||
parser = argparse.ArgumentParser(
|
||||
description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
|
||||
non exhaustive list of available repositories to use in `--repo-id`: {list(AVAILABLE_RAW_REPO_IDS.keys())}""",
|
||||
)
|
||||
|
||||
parser.add_argument(
|
||||
"--raw-dir",
|
||||
type=Path,
|
||||
required=True,
|
||||
help="Directory containing input raw datasets (e.g. `data/aloha_mobile_chair_raw` or `data/pusht_raw).",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--repo-id",
|
||||
type=str,
|
||||
required=True,
|
||||
help="""Repositery identifier on Hugging Face: a community or a user name `/` the name of
|
||||
the dataset (e.g. `lerobot/pusht_raw`, `cadene/aloha_sim_insertion_human_raw`).""",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
download_raw(**vars(args))
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
data_dir = Path("data")
|
||||
dataset_ids = [
|
||||
"pusht_image",
|
||||
"xarm_lift_medium_image",
|
||||
"xarm_lift_medium_replay_image",
|
||||
"xarm_push_medium_image",
|
||||
"xarm_push_medium_replay_image",
|
||||
"aloha_sim_insertion_human_image",
|
||||
"aloha_sim_insertion_scripted_image",
|
||||
"aloha_sim_transfer_cube_human_image",
|
||||
"aloha_sim_transfer_cube_scripted_image",
|
||||
"pusht",
|
||||
"xarm_lift_medium",
|
||||
"xarm_lift_medium_replay",
|
||||
"xarm_push_medium",
|
||||
"xarm_push_medium_replay",
|
||||
"aloha_sim_insertion_human",
|
||||
"aloha_sim_insertion_scripted",
|
||||
"aloha_sim_transfer_cube_human",
|
||||
"aloha_sim_transfer_cube_scripted",
|
||||
"aloha_mobile_cabinet",
|
||||
"aloha_mobile_chair",
|
||||
"aloha_mobile_elevator",
|
||||
"aloha_mobile_shrimp",
|
||||
"aloha_mobile_wash_pan",
|
||||
"aloha_mobile_wipe_wine",
|
||||
"aloha_static_battery",
|
||||
"aloha_static_candy",
|
||||
"aloha_static_coffee",
|
||||
"aloha_static_coffee_new",
|
||||
"aloha_static_cups_open",
|
||||
"aloha_static_fork_pick_up",
|
||||
"aloha_static_pingpong_test",
|
||||
"aloha_static_pro_pencil",
|
||||
"aloha_static_screw_driver",
|
||||
"aloha_static_tape",
|
||||
"aloha_static_thread_velcro",
|
||||
"aloha_static_towel",
|
||||
"aloha_static_vinh_cup",
|
||||
"aloha_static_vinh_cup_left",
|
||||
"aloha_static_ziploc_slide",
|
||||
"umi_cup_in_the_wild",
|
||||
]
|
||||
for dataset_id in dataset_ids:
|
||||
raw_dir = data_dir / f"{dataset_id}_raw"
|
||||
download_raw(raw_dir, dataset_id)
|
||||
main()
|
||||
|
||||
188
lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py
Normal file
188
lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py
Normal file
@@ -0,0 +1,188 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""
|
||||
Use this script to batch encode lerobot dataset from their raw format to LeRobotDataset and push their updated
|
||||
version to the hub. Under the hood, this script reuses 'push_dataset_to_hub.py'. It assumes that you already
|
||||
downloaded raw datasets, which you can do with the related '_download_raw.py' script.
|
||||
|
||||
For instance, for codebase_version = 'v1.6', the following command was run, assuming raw datasets from
|
||||
lerobot-raw were downloaded in 'raw/datasets/directory':
|
||||
```bash
|
||||
python lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py \
|
||||
--raw-dir raw/datasets/directory \
|
||||
--raw-repo-ids lerobot-raw \
|
||||
--local-dir push/datasets/directory \
|
||||
--tests-data-dir tests/data \
|
||||
--push-repo lerobot \
|
||||
--vcodec libsvtav1 \
|
||||
--pix-fmt yuv420p \
|
||||
--g 2 \
|
||||
--crf 30
|
||||
```
|
||||
"""
|
||||
|
||||
import argparse
|
||||
from pathlib import Path
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
from lerobot.common.datasets.push_dataset_to_hub._download_raw import (
|
||||
AVAILABLE_RAW_REPO_IDS,
|
||||
)
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
|
||||
from lerobot.scripts.push_dataset_to_hub import push_dataset_to_hub
|
||||
|
||||
|
||||
def get_push_repo_id_from_raw(raw_repo_id: str, push_repo: str) -> str:
|
||||
dataset_id_raw = raw_repo_id.split("/")[1]
|
||||
dataset_id = dataset_id_raw.removesuffix("_raw")
|
||||
return f"{push_repo}/{dataset_id}"
|
||||
|
||||
|
||||
def encode_datasets(
|
||||
raw_dir: Path,
|
||||
raw_repo_ids: list[str],
|
||||
push_repo: str,
|
||||
vcodec: str,
|
||||
pix_fmt: str,
|
||||
g: int,
|
||||
crf: int,
|
||||
local_dir: Path | None = None,
|
||||
tests_data_dir: Path | None = None,
|
||||
raw_format: str | None = None,
|
||||
dry_run: bool = False,
|
||||
) -> None:
|
||||
if len(raw_repo_ids) == 1 and raw_repo_ids[0].lower() == "lerobot-raw":
|
||||
raw_repo_ids_format = AVAILABLE_RAW_REPO_IDS
|
||||
else:
|
||||
if raw_format is None:
|
||||
raise ValueError(raw_format)
|
||||
raw_repo_ids_format = {id_: raw_format for id_ in raw_repo_ids}
|
||||
|
||||
for raw_repo_id, repo_raw_format in raw_repo_ids_format.items():
|
||||
check_repo_id(raw_repo_id)
|
||||
dataset_repo_id_push = get_push_repo_id_from_raw(raw_repo_id, push_repo)
|
||||
dataset_raw_dir = raw_dir / raw_repo_id
|
||||
dataset_dir = (
|
||||
local_dir / dataset_repo_id_push if local_dir is not None else None
|
||||
)
|
||||
encoding = {
|
||||
"vcodec": vcodec,
|
||||
"pix_fmt": pix_fmt,
|
||||
"g": g,
|
||||
"crf": crf,
|
||||
}
|
||||
|
||||
if not (dataset_raw_dir).is_dir():
|
||||
raise NotADirectoryError(dataset_raw_dir)
|
||||
|
||||
if not dry_run:
|
||||
push_dataset_to_hub(
|
||||
dataset_raw_dir,
|
||||
raw_format=repo_raw_format,
|
||||
repo_id=dataset_repo_id_push,
|
||||
local_dir=dataset_dir,
|
||||
resume=True,
|
||||
encoding=encoding,
|
||||
tests_data_dir=tests_data_dir,
|
||||
)
|
||||
else:
|
||||
print(
|
||||
f"DRY RUN: {dataset_raw_dir} --> {dataset_dir} --> {dataset_repo_id_push}@{CODEBASE_VERSION}"
|
||||
)
|
||||
|
||||
|
||||
def main():
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument(
|
||||
"--raw-dir",
|
||||
type=Path,
|
||||
default=Path("data"),
|
||||
help="Directory where raw datasets are located.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--raw-repo-ids",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=["lerobot-raw"],
|
||||
help="""Raw dataset repo ids. if 'lerobot-raw', the keys from `AVAILABLE_RAW_REPO_IDS` will be
|
||||
used and raw datasets will be fetched from the 'lerobot-raw/' repo and pushed with their
|
||||
associated format. It is assumed that each dataset is located at `raw_dir / raw_repo_id` """,
|
||||
)
|
||||
parser.add_argument(
|
||||
"--raw-format",
|
||||
type=str,
|
||||
default=None,
|
||||
help="""Raw format to use for the raw repo-ids. Must be specified if --raw-repo-ids is not
|
||||
'lerobot-raw'""",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--local-dir",
|
||||
type=Path,
|
||||
default=None,
|
||||
help="""When provided, writes the dataset converted to LeRobotDataset format in this directory
|
||||
(e.g. `data/lerobot/aloha_mobile_chair`).""",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--push-repo",
|
||||
type=str,
|
||||
default="lerobot",
|
||||
help="Repo to upload datasets to",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--vcodec",
|
||||
type=str,
|
||||
default="libsvtav1",
|
||||
help="Codec to use for encoding videos",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--pix-fmt",
|
||||
type=str,
|
||||
default="yuv420p",
|
||||
help="Pixel formats (chroma subsampling) to be used for encoding",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--g",
|
||||
type=int,
|
||||
default=2,
|
||||
help="Group of pictures sizes to be used for encoding.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--crf",
|
||||
type=int,
|
||||
default=30,
|
||||
help="Constant rate factors to be used for encoding.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--tests-data-dir",
|
||||
type=Path,
|
||||
default=None,
|
||||
help=(
|
||||
"When provided, save tests artifacts into the given directory "
|
||||
"(e.g. `--tests-data-dir tests/data` will save to tests/data/{--repo-id})."
|
||||
),
|
||||
)
|
||||
parser.add_argument(
|
||||
"--dry-run",
|
||||
type=int,
|
||||
default=0,
|
||||
help="If not set to 0, this script won't download or upload anything.",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
encode_datasets(**vars(args))
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
main()
|
||||
@@ -133,7 +133,9 @@ class Jpeg2k(Codec):
|
||||
)
|
||||
|
||||
def decode(self, buf, out=None):
|
||||
return imagecodecs.jpeg2k_decode(buf, verbose=self.verbose, numthreads=self.numthreads, out=out)
|
||||
return imagecodecs.jpeg2k_decode(
|
||||
buf, verbose=self.verbose, numthreads=self.numthreads, out=out
|
||||
)
|
||||
|
||||
|
||||
class JpegXl(Codec):
|
||||
|
||||
@@ -28,7 +28,13 @@ import tqdm
|
||||
from datasets import Dataset, Features, Image, Sequence, Value
|
||||
from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||
calculate_episode_data_index,
|
||||
concatenate_episodes,
|
||||
get_default_encoding,
|
||||
save_images_concurrently,
|
||||
)
|
||||
from lerobot.common.datasets.utils import (
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
@@ -38,11 +44,16 @@ from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
def get_cameras(hdf5_data):
|
||||
# ignore depth channel, not currently handled
|
||||
# TODO(rcadene): add depth
|
||||
rgb_cameras = [key for key in hdf5_data["/observations/images"].keys() if "depth" not in key] # noqa: SIM118
|
||||
rgb_cameras = [
|
||||
key for key in hdf5_data["/observations/images"].keys() if "depth" not in key
|
||||
] # noqa: SIM118
|
||||
return rgb_cameras
|
||||
|
||||
|
||||
def check_format(raw_dir) -> bool:
|
||||
# only frames from simulation are uncompressed
|
||||
compressed_images = "sim" not in raw_dir.name
|
||||
|
||||
hdf5_paths = list(raw_dir.glob("episode_*.hdf5"))
|
||||
assert len(hdf5_paths) != 0
|
||||
for hdf5_path in hdf5_paths:
|
||||
@@ -59,22 +70,34 @@ def check_format(raw_dir) -> bool:
|
||||
for camera in get_cameras(data):
|
||||
assert num_frames == data[f"/observations/images/{camera}"].shape[0]
|
||||
|
||||
# ndim 2 when image are compressed and 4 when uncompressed
|
||||
assert data[f"/observations/images/{camera}"].ndim in [2, 4]
|
||||
if data[f"/observations/images/{camera}"].ndim == 4:
|
||||
if compressed_images:
|
||||
assert data[f"/observations/images/{camera}"].ndim == 2
|
||||
else:
|
||||
assert data[f"/observations/images/{camera}"].ndim == 4
|
||||
b, h, w, c = data[f"/observations/images/{camera}"].shape
|
||||
assert c < h and c < w, f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
|
||||
assert (
|
||||
c < h and c < w
|
||||
), f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
|
||||
|
||||
|
||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
def load_from_raw(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int,
|
||||
video: bool,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
# only frames from simulation are uncompressed
|
||||
compressed_images = "sim" not in raw_dir.name
|
||||
|
||||
hdf5_files = sorted(raw_dir.glob("episode_*.hdf5"))
|
||||
num_episodes = len(hdf5_files)
|
||||
|
||||
hdf5_files = list(raw_dir.glob("*.hdf5"))
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
|
||||
id_from = 0
|
||||
for ep_idx, ep_path in tqdm.tqdm(enumerate(hdf5_files), total=len(hdf5_files)):
|
||||
ep_ids = episodes if episodes else range(num_episodes)
|
||||
for ep_idx in tqdm.tqdm(ep_ids):
|
||||
ep_path = hdf5_files[ep_idx]
|
||||
with h5py.File(ep_path, "r") as ep:
|
||||
num_frames = ep["/action"].shape[0]
|
||||
|
||||
@@ -94,7 +117,7 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
for camera in get_cameras(ep):
|
||||
img_key = f"observation.images.{camera}"
|
||||
|
||||
if ep[f"/observations/images/{camera}"].ndim == 2:
|
||||
if compressed_images:
|
||||
import cv2
|
||||
|
||||
# load one compressed image after the other in RAM and uncompress
|
||||
@@ -109,20 +132,23 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = out_dir / "tmp_images"
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = out_dir / "videos" / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(
|
||||
tmp_imgs_dir, video_path, fps, **(encoding or {})
|
||||
)
|
||||
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [
|
||||
{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
|
||||
{"path": f"videos/{fname}", "timestamp": i / fps}
|
||||
for i in range(num_frames)
|
||||
]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
@@ -142,19 +168,13 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
assert isinstance(ep_idx, int)
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(id_from + num_frames)
|
||||
|
||||
id_from += num_frames
|
||||
|
||||
gc.collect()
|
||||
|
||||
# process first episode only
|
||||
if debug:
|
||||
break
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
return data_dict, episode_data_index
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
@@ -168,15 +188,18 @@ def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
features[key] = Image()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.state"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
if "observation.velocity" in data_dict:
|
||||
features["observation.velocity"] = Sequence(
|
||||
length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.velocity"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
if "observation.effort" in data_dict:
|
||||
features["observation.effort"] = Sequence(
|
||||
length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.effort"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
@@ -192,18 +215,29 @@ def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 50
|
||||
|
||||
data_dir, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
||||
hf_dataset = to_hf_dataset(data_dir, video)
|
||||
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"codebase_version": CODEBASE_VERSION,
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
if video:
|
||||
info["encoding"] = get_default_encoding()
|
||||
|
||||
return hf_dataset, episode_data_index, info
|
||||
|
||||
107
lerobot/common/datasets/push_dataset_to_hub/cam_png_format.py
Normal file
107
lerobot/common/datasets/push_dataset_to_hub/cam_png_format.py
Normal file
@@ -0,0 +1,107 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""
|
||||
Contains utilities to process raw data format of png images files recorded with capture_camera_feed.py
|
||||
"""
|
||||
|
||||
from pathlib import Path
|
||||
|
||||
import torch
|
||||
from datasets import Dataset, Features, Image, Value
|
||||
from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||
calculate_episode_data_index,
|
||||
concatenate_episodes,
|
||||
)
|
||||
from lerobot.common.datasets.utils import hf_transform_to_torch
|
||||
from lerobot.common.datasets.video_utils import VideoFrame
|
||||
|
||||
|
||||
def check_format(raw_dir: Path) -> bool:
|
||||
image_paths = list(raw_dir.glob("frame_*.png"))
|
||||
if len(image_paths) == 0:
|
||||
raise ValueError
|
||||
|
||||
|
||||
def load_from_raw(raw_dir: Path, fps: int, episodes: list[int] | None = None):
|
||||
if episodes is not None:
|
||||
# TODO(aliberts): add support for multi-episodes.
|
||||
raise NotImplementedError()
|
||||
|
||||
ep_dict = {}
|
||||
ep_idx = 0
|
||||
|
||||
image_paths = sorted(raw_dir.glob("frame_*.png"))
|
||||
num_frames = len(image_paths)
|
||||
|
||||
ep_dict["observation.image"] = [PILImage.open(x) for x in image_paths]
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
|
||||
ep_dicts = [ep_dict]
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
features = {}
|
||||
if video:
|
||||
features["observation.image"] = VideoFrame()
|
||||
else:
|
||||
features["observation.image"] = Image()
|
||||
|
||||
features["episode_index"] = Value(dtype="int64", id=None)
|
||||
features["frame_index"] = Value(dtype="int64", id=None)
|
||||
features["timestamp"] = Value(dtype="float32", id=None)
|
||||
features["index"] = Value(dtype="int64", id=None)
|
||||
|
||||
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||
hf_dataset.set_transform(hf_transform_to_torch)
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
if video or episodes or encoding is not None:
|
||||
# TODO(aliberts): support this
|
||||
raise NotImplementedError
|
||||
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 30
|
||||
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"codebase_version": CODEBASE_VERSION,
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
return hf_dataset, episode_data_index, info
|
||||
@@ -17,19 +17,22 @@
|
||||
Contains utilities to process raw data format from dora-record
|
||||
"""
|
||||
|
||||
import logging
|
||||
import re
|
||||
import warnings
|
||||
from pathlib import Path
|
||||
|
||||
import pandas as pd
|
||||
import torch
|
||||
from datasets import Dataset, Features, Image, Sequence, Value
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||
calculate_episode_data_index,
|
||||
)
|
||||
from lerobot.common.datasets.utils import (
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame
|
||||
from lerobot.common.utils.utils import init_logging
|
||||
|
||||
|
||||
def check_format(raw_dir) -> bool:
|
||||
@@ -41,11 +44,19 @@ def check_format(raw_dir) -> bool:
|
||||
return True
|
||||
|
||||
|
||||
def load_from_raw(raw_dir: Path, out_dir: Path, fps: int):
|
||||
def load_from_raw(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int,
|
||||
video: bool,
|
||||
episodes: list[int] | None = None,
|
||||
):
|
||||
# Load data stream that will be used as reference for the timestamps synchronization
|
||||
reference_files = list(raw_dir.glob("observation.images.cam_*.parquet"))
|
||||
if len(reference_files) == 0:
|
||||
raise ValueError(f"Missing reference files for camera, starting with in '{raw_dir}'")
|
||||
raise ValueError(
|
||||
f"Missing reference files for camera, starting with in '{raw_dir}'"
|
||||
)
|
||||
# select first camera in alphanumeric order
|
||||
reference_key = sorted(reference_files)[0].stem
|
||||
reference_df = pd.read_parquet(raw_dir / f"{reference_key}.parquet")
|
||||
@@ -106,7 +117,9 @@ def load_from_raw(raw_dir: Path, out_dir: Path, fps: int):
|
||||
|
||||
df["timestamp"] = df["timestamp_utc"].map(lambda x: x.timestamp())
|
||||
# each episode starts with timestamp 0 to match the ones from the video
|
||||
df["timestamp"] = df.groupby("episode_index")["timestamp"].transform(lambda x: x - x.iloc[0])
|
||||
df["timestamp"] = df.groupby("episode_index")["timestamp"].transform(
|
||||
lambda x: x - x.iloc[0]
|
||||
)
|
||||
|
||||
del df["timestamp_utc"]
|
||||
|
||||
@@ -119,11 +132,12 @@ def load_from_raw(raw_dir: Path, out_dir: Path, fps: int):
|
||||
ep_ids = [ep_idx for ep_idx, _ in df.groupby("episode_index")]
|
||||
expected_ep_ids = list(range(df["episode_index"].max() + 1))
|
||||
if ep_ids != expected_ep_ids:
|
||||
raise ValueError(f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}")
|
||||
raise ValueError(
|
||||
f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}"
|
||||
)
|
||||
|
||||
# Create symlink to raw videos directory (that needs to be absolute not relative)
|
||||
out_dir.mkdir(parents=True, exist_ok=True)
|
||||
videos_dir = out_dir / "videos"
|
||||
videos_dir.parent.mkdir(parents=True, exist_ok=True)
|
||||
videos_dir.symlink_to((raw_dir / "videos").absolute())
|
||||
|
||||
# sanity check the video paths are well formated
|
||||
@@ -152,20 +166,13 @@ def load_from_raw(raw_dir: Path, out_dir: Path, fps: int):
|
||||
data_dict[key] = torch.from_numpy(df[key].values)
|
||||
# is vector
|
||||
elif df[key].iloc[0].shape[0] > 1:
|
||||
data_dict[key] = torch.stack([torch.from_numpy(x.copy()) for x in df[key].values])
|
||||
data_dict[key] = torch.stack(
|
||||
[torch.from_numpy(x.copy()) for x in df[key].values]
|
||||
)
|
||||
else:
|
||||
raise ValueError(key)
|
||||
|
||||
# Get the episode index containing for each unique episode index
|
||||
first_ep_index_df = df.groupby("episode_index").agg(start_index=("index", "first")).reset_index()
|
||||
from_ = first_ep_index_df["start_index"].tolist()
|
||||
to_ = from_[1:] + [len(df)]
|
||||
episode_data_index = {
|
||||
"from": from_,
|
||||
"to": to_,
|
||||
}
|
||||
|
||||
return data_dict, episode_data_index
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
@@ -179,15 +186,18 @@ def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
features[key] = Image()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.state"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
if "observation.velocity" in data_dict:
|
||||
features["observation.velocity"] = Sequence(
|
||||
length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.velocity"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
if "observation.effort" in data_dict:
|
||||
features["observation.effort"] = Sequence(
|
||||
length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.effort"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
@@ -203,12 +213,14 @@ def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
init_logging()
|
||||
|
||||
if debug:
|
||||
logging.warning("debug=True not implemented. Falling back to debug=False.")
|
||||
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
@@ -220,11 +232,21 @@ def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=Tru
|
||||
if not video:
|
||||
raise NotImplementedError()
|
||||
|
||||
data_df, episode_data_index = load_from_raw(raw_dir, out_dir, fps)
|
||||
hf_dataset = to_hf_dataset(data_df, video)
|
||||
if encoding is not None:
|
||||
warnings.warn(
|
||||
"Video encoding is currently done outside of LeRobot for the dora_parquet format.",
|
||||
stacklevel=1,
|
||||
)
|
||||
|
||||
data_df = load_from_raw(raw_dir, videos_dir, fps, episodes)
|
||||
hf_dataset = to_hf_dataset(data_df, video)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"codebase_version": CODEBASE_VERSION,
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
if video:
|
||||
info["encoding"] = "unknown"
|
||||
|
||||
return hf_dataset, episode_data_index, info
|
||||
321
lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py
Normal file
321
lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py
Normal file
@@ -0,0 +1,321 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""
|
||||
For all datasets in the RLDS format.
|
||||
For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets.
|
||||
|
||||
NOTE: You need to install tensorflow and tensorflow_datsets before running this script.
|
||||
|
||||
Example:
|
||||
python lerobot/scripts/push_dataset_to_hub.py \
|
||||
--raw-dir /path/to/data/bridge_dataset/1.0.0/ \
|
||||
--repo-id your_hub/sampled_bridge_data_v2 \
|
||||
--raw-format rlds \
|
||||
--episodes 3 4 5 8 9
|
||||
|
||||
Exact dataset fps defined in openx/config.py, obtained from:
|
||||
https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R
|
||||
"""
|
||||
|
||||
import shutil
|
||||
from pathlib import Path
|
||||
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
import tensorflow_datasets as tfds
|
||||
import torch
|
||||
import tqdm
|
||||
from datasets import Dataset, Features, Image, Sequence, Value
|
||||
from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||
calculate_episode_data_index,
|
||||
concatenate_episodes,
|
||||
get_default_encoding,
|
||||
save_images_concurrently,
|
||||
)
|
||||
from lerobot.common.datasets.utils import (
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
|
||||
np.set_printoptions(precision=2)
|
||||
|
||||
|
||||
def tf_to_torch(data):
|
||||
return torch.from_numpy(data.numpy())
|
||||
|
||||
|
||||
def tf_img_convert(img):
|
||||
if img.dtype == tf.string:
|
||||
img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8)
|
||||
elif img.dtype != tf.uint8:
|
||||
raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}")
|
||||
return img.numpy()
|
||||
|
||||
|
||||
def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict:
|
||||
"""
|
||||
In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps"
|
||||
entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the
|
||||
trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`.
|
||||
|
||||
NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/
|
||||
"""
|
||||
steps = traj.pop("steps")
|
||||
|
||||
traj_len = tf.shape(tf.nest.flatten(steps)[0])[0]
|
||||
|
||||
# broadcast metadata to the length of the trajectory
|
||||
metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj)
|
||||
|
||||
# put steps back in
|
||||
assert "traj_metadata" not in steps
|
||||
traj = {**steps, "traj_metadata": metadata}
|
||||
|
||||
assert "_len" not in traj
|
||||
assert "_traj_index" not in traj
|
||||
assert "_frame_index" not in traj
|
||||
traj["_len"] = tf.repeat(traj_len, traj_len)
|
||||
traj["_traj_index"] = tf.repeat(i, traj_len)
|
||||
traj["_frame_index"] = tf.range(traj_len)
|
||||
|
||||
return traj
|
||||
|
||||
|
||||
def load_from_raw(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int,
|
||||
video: bool,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
"""
|
||||
Args:
|
||||
raw_dir (Path): _description_
|
||||
videos_dir (Path): _description_
|
||||
fps (int): _description_
|
||||
video (bool): _description_
|
||||
episodes (list[int] | None, optional): _description_. Defaults to None.
|
||||
"""
|
||||
ds_builder = tfds.builder_from_directory(str(raw_dir))
|
||||
dataset = ds_builder.as_dataset(
|
||||
split="all",
|
||||
decoders={"steps": tfds.decode.SkipDecoding()},
|
||||
)
|
||||
|
||||
dataset_info = ds_builder.info
|
||||
print("dataset_info: ", dataset_info)
|
||||
|
||||
ds_length = len(dataset)
|
||||
dataset = dataset.take(ds_length)
|
||||
# "flatten" the dataset as such we can apply trajectory level map() easily
|
||||
# each [obs][key] has a shape of (frame_size, ...)
|
||||
dataset = dataset.enumerate().map(_broadcast_metadata_rlds)
|
||||
|
||||
# we will apply the standardization transform if the dataset_name is provided
|
||||
# if the dataset name is not provided and the goal is to convert any rlds formatted dataset
|
||||
# search for 'image' keys in the observations
|
||||
image_keys = []
|
||||
state_keys = []
|
||||
observation_info = dataset_info.features["steps"]["observation"]
|
||||
for key in observation_info:
|
||||
# check whether the key is for an image or a vector observation
|
||||
if len(observation_info[key].shape) == 3:
|
||||
# only adding uint8 images discards depth images
|
||||
if observation_info[key].dtype == tf.uint8:
|
||||
image_keys.append(key)
|
||||
else:
|
||||
state_keys.append(key)
|
||||
|
||||
lang_key = (
|
||||
"language_instruction"
|
||||
if "language_instruction" in dataset.element_spec
|
||||
else None
|
||||
)
|
||||
|
||||
print(" - image_keys: ", image_keys)
|
||||
print(" - lang_key: ", lang_key)
|
||||
|
||||
it = iter(dataset)
|
||||
|
||||
ep_dicts = []
|
||||
# Init temp path to save ep_dicts in case of crash
|
||||
tmp_ep_dicts_dir = videos_dir.parent.joinpath("ep_dicts")
|
||||
tmp_ep_dicts_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
# check if ep_dicts have already been saved in /tmp
|
||||
starting_ep_idx = 0
|
||||
saved_ep_dicts = [ep.__str__() for ep in tmp_ep_dicts_dir.iterdir()]
|
||||
if len(saved_ep_dicts) > 0:
|
||||
saved_ep_dicts.sort()
|
||||
# get last ep_idx number
|
||||
starting_ep_idx = int(saved_ep_dicts[-1][-13:-3]) + 1
|
||||
for i in range(starting_ep_idx):
|
||||
episode = next(it)
|
||||
ep_dicts.append(torch.load(saved_ep_dicts[i]))
|
||||
|
||||
# if we user specified episodes, skip the ones not in the list
|
||||
if episodes is not None:
|
||||
if ds_length == 0:
|
||||
raise ValueError("No episodes found.")
|
||||
# convert episodes index to sorted list
|
||||
episodes = sorted(episodes)
|
||||
|
||||
for ep_idx in tqdm.tqdm(range(starting_ep_idx, ds_length)):
|
||||
episode = next(it)
|
||||
|
||||
# if user specified episodes, skip the ones not in the list
|
||||
if episodes is not None:
|
||||
if len(episodes) == 0:
|
||||
break
|
||||
if ep_idx == episodes[0]:
|
||||
# process this episode
|
||||
print(" selecting episode idx: ", ep_idx)
|
||||
episodes.pop(0)
|
||||
else:
|
||||
continue # skip
|
||||
|
||||
num_frames = episode["action"].shape[0]
|
||||
|
||||
ep_dict = {}
|
||||
for key in state_keys:
|
||||
ep_dict[f"observation.{key}"] = tf_to_torch(episode["observation"][key])
|
||||
|
||||
ep_dict["action"] = tf_to_torch(episode["action"])
|
||||
ep_dict["next.reward"] = tf_to_torch(episode["reward"]).float()
|
||||
ep_dict["next.done"] = tf_to_torch(episode["is_last"])
|
||||
ep_dict["is_terminal"] = tf_to_torch(episode["is_terminal"])
|
||||
ep_dict["is_first"] = tf_to_torch(episode["is_first"])
|
||||
ep_dict["discount"] = tf_to_torch(episode["discount"])
|
||||
|
||||
# If lang_key is present, convert the entire tensor at once
|
||||
if lang_key is not None:
|
||||
ep_dict["language_instruction"] = [
|
||||
x.numpy().decode("utf-8") for x in episode[lang_key]
|
||||
]
|
||||
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
|
||||
image_array_dict = {key: [] for key in image_keys}
|
||||
|
||||
for im_key in image_keys:
|
||||
imgs = episode["observation"][im_key]
|
||||
image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
|
||||
|
||||
# loop through all cameras
|
||||
for im_key in image_keys:
|
||||
img_key = f"observation.images.{im_key}"
|
||||
imgs_array = image_array_dict[im_key]
|
||||
imgs_array = np.array(imgs_array)
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [
|
||||
{"path": f"videos/{fname}", "timestamp": i / fps}
|
||||
for i in range(num_frames)
|
||||
]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
|
||||
path_ep_dict = tmp_ep_dicts_dir.joinpath(
|
||||
"ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt"
|
||||
)
|
||||
torch.save(ep_dict, path_ep_dict)
|
||||
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
features = {}
|
||||
|
||||
for key in data_dict:
|
||||
# check if vector state obs
|
||||
if key.startswith("observation.") and "observation.images." not in key:
|
||||
features[key] = Sequence(
|
||||
length=data_dict[key].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
# check if image obs
|
||||
elif "observation.images." in key:
|
||||
if video:
|
||||
features[key] = VideoFrame()
|
||||
else:
|
||||
features[key] = Image()
|
||||
|
||||
if "language_instruction" in data_dict:
|
||||
features["language_instruction"] = Value(dtype="string", id=None)
|
||||
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
|
||||
features["is_terminal"] = Value(dtype="bool", id=None)
|
||||
features["is_first"] = Value(dtype="bool", id=None)
|
||||
features["discount"] = Value(dtype="float32", id=None)
|
||||
|
||||
features["episode_index"] = Value(dtype="int64", id=None)
|
||||
features["frame_index"] = Value(dtype="int64", id=None)
|
||||
features["timestamp"] = Value(dtype="float32", id=None)
|
||||
features["next.reward"] = Value(dtype="float32", id=None)
|
||||
features["next.done"] = Value(dtype="bool", id=None)
|
||||
features["index"] = Value(dtype="int64", id=None)
|
||||
|
||||
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||
hf_dataset.set_transform(hf_transform_to_torch)
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"codebase_version": CODEBASE_VERSION,
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
if video:
|
||||
info["encoding"] = get_default_encoding()
|
||||
|
||||
return hf_dataset, episode_data_index, info
|
||||
@@ -25,7 +25,13 @@ import zarr
|
||||
from datasets import Dataset, Features, Image, Sequence, Value
|
||||
from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||
calculate_episode_data_index,
|
||||
concatenate_episodes,
|
||||
get_default_encoding,
|
||||
save_images_concurrently,
|
||||
)
|
||||
from lerobot.common.datasets.utils import (
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
@@ -50,10 +56,20 @@ def check_format(raw_dir):
|
||||
|
||||
required_datasets.remove("meta/episode_ends")
|
||||
|
||||
assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
|
||||
assert all(
|
||||
nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets
|
||||
)
|
||||
|
||||
|
||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
def load_from_raw(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int,
|
||||
video: bool,
|
||||
episodes: list[int] | None = None,
|
||||
keypoints_instead_of_image: bool = False,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
try:
|
||||
import pymunk
|
||||
from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
|
||||
@@ -62,7 +78,9 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
ReplayBuffer as DiffusionPolicyReplayBuffer,
|
||||
)
|
||||
except ModuleNotFoundError as e:
|
||||
print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
|
||||
print(
|
||||
"`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`"
|
||||
)
|
||||
raise e
|
||||
# as define in gmy-pusht env: https://github.com/huggingface/gym-pusht/blob/e0684ff988d223808c0a9dcfaba9dc4991791370/gym_pusht/envs/pusht.py#L174
|
||||
success_threshold = 0.95 # 95% coverage,
|
||||
@@ -71,7 +89,6 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
|
||||
|
||||
episode_ids = torch.from_numpy(zarr_data.get_episode_idxs())
|
||||
num_episodes = zarr_data.meta["episode_ends"].shape[0]
|
||||
assert len(
|
||||
{zarr_data[key].shape[0] for key in zarr_data.keys()} # noqa: SIM118
|
||||
), "Some data type dont have the same number of total frames."
|
||||
@@ -84,32 +101,44 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
states = torch.from_numpy(zarr_data["state"])
|
||||
actions = torch.from_numpy(zarr_data["action"])
|
||||
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
# load data indices from which each episode starts and ends
|
||||
from_ids, to_ids = [], []
|
||||
from_idx = 0
|
||||
for to_idx in zarr_data.meta["episode_ends"]:
|
||||
from_ids.append(from_idx)
|
||||
to_ids.append(to_idx)
|
||||
from_idx = to_idx
|
||||
|
||||
id_from = 0
|
||||
for ep_idx in tqdm.tqdm(range(num_episodes)):
|
||||
id_to = zarr_data.meta["episode_ends"][ep_idx]
|
||||
num_frames = id_to - id_from
|
||||
num_episodes = len(from_ids)
|
||||
|
||||
ep_dicts = []
|
||||
ep_ids = episodes if episodes else range(num_episodes)
|
||||
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||
from_idx = from_ids[selected_ep_idx]
|
||||
to_idx = to_ids[selected_ep_idx]
|
||||
num_frames = to_idx - from_idx
|
||||
|
||||
# sanity check
|
||||
assert (episode_ids[id_from:id_to] == ep_idx).all()
|
||||
assert (episode_ids[from_idx:to_idx] == ep_idx).all()
|
||||
|
||||
# get image
|
||||
image = imgs[id_from:id_to]
|
||||
assert image.min() >= 0.0
|
||||
assert image.max() <= 255.0
|
||||
image = image.type(torch.uint8)
|
||||
if not keypoints_instead_of_image:
|
||||
image = imgs[from_idx:to_idx]
|
||||
assert image.min() >= 0.0
|
||||
assert image.max() <= 255.0
|
||||
image = image.type(torch.uint8)
|
||||
|
||||
# get state
|
||||
state = states[id_from:id_to]
|
||||
state = states[from_idx:to_idx]
|
||||
agent_pos = state[:, :2]
|
||||
block_pos = state[:, 2:4]
|
||||
block_angle = state[:, 4]
|
||||
|
||||
# get reward, success, done
|
||||
# get reward, success, done, and (maybe) keypoints
|
||||
reward = torch.zeros(num_frames)
|
||||
success = torch.zeros(num_frames, dtype=torch.bool)
|
||||
if keypoints_instead_of_image:
|
||||
keypoints = torch.zeros(num_frames, 16) # 8 keypoints each with 2 coords
|
||||
done = torch.zeros(num_frames, dtype=torch.bool)
|
||||
for i in range(num_frames):
|
||||
space = pymunk.Space()
|
||||
@@ -125,7 +154,9 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
]
|
||||
space.add(*walls)
|
||||
|
||||
block_body = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
|
||||
block_body, block_shapes = PushTEnv.add_tee(
|
||||
space, block_pos[i].tolist(), block_angle[i].item()
|
||||
)
|
||||
goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
|
||||
block_geom = pymunk_to_shapely(block_body, block_body.shapes)
|
||||
intersection_area = goal_geom.intersection(block_geom).area
|
||||
@@ -133,35 +164,47 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
coverage = intersection_area / goal_area
|
||||
reward[i] = np.clip(coverage / success_threshold, 0, 1)
|
||||
success[i] = coverage > success_threshold
|
||||
if keypoints_instead_of_image:
|
||||
keypoints[i] = torch.from_numpy(
|
||||
PushTEnv.get_keypoints(block_shapes).flatten()
|
||||
)
|
||||
|
||||
# last step of demonstration is considered done
|
||||
done[-1] = True
|
||||
|
||||
ep_dict = {}
|
||||
|
||||
imgs_array = [x.numpy() for x in image]
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = out_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
if not keypoints_instead_of_image:
|
||||
imgs_array = [x.numpy() for x in image]
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = out_dir / "videos" / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [
|
||||
{"path": f"videos/{fname}", "timestamp": i / fps}
|
||||
for i in range(num_frames)
|
||||
]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
|
||||
ep_dict["observation.state"] = agent_pos
|
||||
ep_dict["action"] = actions[id_from:id_to]
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
||||
if keypoints_instead_of_image:
|
||||
ep_dict["observation.environment_state"] = keypoints
|
||||
ep_dict["action"] = actions[from_idx:to_idx]
|
||||
ep_dict["episode_index"] = torch.tensor(
|
||||
[ep_idx] * num_frames, dtype=torch.int64
|
||||
)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
# ep_dict["next.observation.image"] = image[1:],
|
||||
@@ -171,31 +214,31 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
ep_dict["next.done"] = torch.cat([done[1:], done[[-1]]])
|
||||
ep_dict["next.success"] = torch.cat([success[1:], success[[-1]]])
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(id_from + num_frames)
|
||||
|
||||
id_from += num_frames
|
||||
|
||||
# process first episode only
|
||||
if debug:
|
||||
break
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
return data_dict, episode_data_index
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video):
|
||||
def to_hf_dataset(data_dict, video, keypoints_instead_of_image: bool = False):
|
||||
features = {}
|
||||
|
||||
if video:
|
||||
features["observation.image"] = VideoFrame()
|
||||
else:
|
||||
features["observation.image"] = Image()
|
||||
if not keypoints_instead_of_image:
|
||||
if video:
|
||||
features["observation.image"] = VideoFrame()
|
||||
else:
|
||||
features["observation.image"] = Image()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.state"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
if keypoints_instead_of_image:
|
||||
features["observation.environment_state"] = Sequence(
|
||||
length=data_dict["observation.environment_state"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
@@ -212,18 +255,35 @@ def to_hf_dataset(data_dict, video):
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
# Manually change this to True to use keypoints of the T instead of an image observation (but don't merge
|
||||
# with True). Also make sure to use video = 0 in the `push_dataset_to_hub.py` script.
|
||||
keypoints_instead_of_image = False
|
||||
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 10
|
||||
|
||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
|
||||
data_dict = load_from_raw(
|
||||
raw_dir, videos_dir, fps, video, episodes, keypoints_instead_of_image, encoding
|
||||
)
|
||||
hf_dataset = to_hf_dataset(data_dict, video, keypoints_instead_of_image)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"codebase_version": CODEBASE_VERSION,
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
"video": video if not keypoints_instead_of_image else 0,
|
||||
}
|
||||
if video:
|
||||
info["encoding"] = get_default_encoding()
|
||||
|
||||
return hf_dataset, episode_data_index, info
|
||||
|
||||
@@ -19,15 +19,22 @@ import logging
|
||||
import shutil
|
||||
from pathlib import Path
|
||||
|
||||
import numpy as np
|
||||
import torch
|
||||
import tqdm
|
||||
import zarr
|
||||
from datasets import Dataset, Features, Image, Sequence, Value
|
||||
from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import (
|
||||
register_codecs,
|
||||
)
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||
calculate_episode_data_index,
|
||||
concatenate_episodes,
|
||||
get_default_encoding,
|
||||
save_images_concurrently,
|
||||
)
|
||||
from lerobot.common.datasets.utils import (
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
@@ -56,26 +63,19 @@ def check_format(raw_dir) -> bool:
|
||||
nb_frames = zarr_data["data/camera0_rgb"].shape[0]
|
||||
|
||||
required_datasets.remove("meta/episode_ends")
|
||||
assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
|
||||
assert all(
|
||||
nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets
|
||||
)
|
||||
|
||||
|
||||
def get_episode_idxs(episode_ends: np.ndarray) -> np.ndarray:
|
||||
# Optimized and simplified version of this function: https://github.com/real-stanford/universal_manipulation_interface/blob/298776ce251f33b6b3185a98d6e7d1f9ad49168b/diffusion_policy/common/replay_buffer.py#L374
|
||||
from numba import jit
|
||||
|
||||
@jit(nopython=True)
|
||||
def _get_episode_idxs(episode_ends):
|
||||
result = np.zeros((episode_ends[-1],), dtype=np.int64)
|
||||
start_idx = 0
|
||||
for episode_number, end_idx in enumerate(episode_ends):
|
||||
result[start_idx:end_idx] = episode_number
|
||||
start_idx = end_idx
|
||||
return result
|
||||
|
||||
return _get_episode_idxs(episode_ends)
|
||||
|
||||
|
||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
def load_from_raw(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int,
|
||||
video: bool,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
zarr_path = raw_dir / "cup_in_the_wild.zarr"
|
||||
zarr_data = zarr.open(zarr_path, mode="r")
|
||||
|
||||
@@ -83,7 +83,9 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
end_pose = torch.from_numpy(zarr_data["data/robot0_demo_end_pose"][:])
|
||||
start_pos = torch.from_numpy(zarr_data["data/robot0_demo_start_pose"][:])
|
||||
eff_pos = torch.from_numpy(zarr_data["data/robot0_eef_pos"][:])
|
||||
eff_rot_axis_angle = torch.from_numpy(zarr_data["data/robot0_eef_rot_axis_angle"][:])
|
||||
eff_rot_axis_angle = torch.from_numpy(
|
||||
zarr_data["data/robot0_eef_rot_axis_angle"][:]
|
||||
)
|
||||
gripper_width = torch.from_numpy(zarr_data["data/robot0_gripper_width"][:])
|
||||
|
||||
states_pos = torch.cat([eff_pos, eff_rot_axis_angle], dim=1)
|
||||
@@ -92,74 +94,86 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
episode_ends = zarr_data["meta/episode_ends"][:]
|
||||
num_episodes = episode_ends.shape[0]
|
||||
|
||||
episode_ids = torch.from_numpy(get_episode_idxs(episode_ends))
|
||||
|
||||
# We convert it in torch tensor later because the jit function does not support torch tensors
|
||||
episode_ends = torch.from_numpy(episode_ends)
|
||||
|
||||
# load data indices from which each episode starts and ends
|
||||
from_ids, to_ids = [], []
|
||||
from_idx = 0
|
||||
for to_idx in episode_ends:
|
||||
from_ids.append(from_idx)
|
||||
to_ids.append(to_idx)
|
||||
from_idx = to_idx
|
||||
|
||||
ep_dicts_dir = videos_dir / "ep_dicts"
|
||||
ep_dicts_dir.mkdir(exist_ok=True, parents=True)
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
|
||||
id_from = 0
|
||||
for ep_idx in tqdm.tqdm(range(num_episodes)):
|
||||
id_to = episode_ends[ep_idx]
|
||||
num_frames = id_to - id_from
|
||||
ep_ids = episodes if episodes else range(num_episodes)
|
||||
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||
ep_dict_path = ep_dicts_dir / f"{ep_idx}"
|
||||
if not ep_dict_path.is_file():
|
||||
from_idx = from_ids[selected_ep_idx]
|
||||
to_idx = to_ids[selected_ep_idx]
|
||||
num_frames = to_idx - from_idx
|
||||
|
||||
# sanity heck
|
||||
assert (episode_ids[id_from:id_to] == ep_idx).all()
|
||||
# TODO(rcadene): save temporary images of the episode?
|
||||
|
||||
# TODO(rcadene): save temporary images of the episode?
|
||||
state = states[from_idx:to_idx]
|
||||
|
||||
state = states[id_from:id_to]
|
||||
ep_dict = {}
|
||||
|
||||
ep_dict = {}
|
||||
# load 57MB of images in RAM (400x224x224x3 uint8)
|
||||
imgs_array = zarr_data["data/camera0_rgb"][from_idx:to_idx]
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = videos_dir / fname
|
||||
if not video_path.is_file():
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# load 57MB of images in RAM (400x224x224x3 uint8)
|
||||
imgs_array = zarr_data["data/camera0_rgb"][id_from:id_to]
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = out_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
# encode images to a mp4 video
|
||||
encode_video_frames(
|
||||
tmp_imgs_dir, video_path, fps, **(encoding or {})
|
||||
)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = out_dir / "videos" / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [
|
||||
{"path": f"videos/{fname}", "timestamp": i / fps}
|
||||
for i in range(num_frames)
|
||||
]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
|
||||
ep_dict["observation.state"] = state
|
||||
ep_dict["episode_index"] = torch.tensor(
|
||||
[ep_idx] * num_frames, dtype=torch.int64
|
||||
)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
ep_dict["episode_data_index_from"] = torch.tensor([from_idx] * num_frames)
|
||||
ep_dict["episode_data_index_to"] = torch.tensor(
|
||||
[from_idx + num_frames] * num_frames
|
||||
)
|
||||
ep_dict["end_pose"] = end_pose[from_idx:to_idx]
|
||||
ep_dict["start_pos"] = start_pos[from_idx:to_idx]
|
||||
ep_dict["gripper_width"] = gripper_width[from_idx:to_idx]
|
||||
torch.save(ep_dict, ep_dict_path)
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
ep_dict = torch.load(ep_dict_path)
|
||||
|
||||
ep_dict["observation.state"] = state
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
ep_dict["episode_data_index_from"] = torch.tensor([id_from] * num_frames)
|
||||
ep_dict["episode_data_index_to"] = torch.tensor([id_from + num_frames] * num_frames)
|
||||
ep_dict["end_pose"] = end_pose[id_from:id_to]
|
||||
ep_dict["start_pos"] = start_pos[id_from:id_to]
|
||||
ep_dict["gripper_width"] = gripper_width[id_from:id_to]
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(id_from + num_frames)
|
||||
id_from += num_frames
|
||||
|
||||
# process first episode only
|
||||
if debug:
|
||||
break
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
|
||||
total_frames = id_from
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
|
||||
return data_dict, episode_data_index
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video):
|
||||
@@ -171,7 +185,8 @@ def to_hf_dataset(data_dict, video):
|
||||
features["observation.image"] = Image()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.state"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
features["episode_index"] = Value(dtype="int64", id=None)
|
||||
features["frame_index"] = Value(dtype="int64", id=None)
|
||||
@@ -191,7 +206,8 @@ def to_hf_dataset(data_dict, video):
|
||||
length=data_dict["start_pos"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
features["gripper_width"] = Sequence(
|
||||
length=data_dict["gripper_width"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["gripper_width"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
|
||||
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||
@@ -199,7 +215,14 @@ def to_hf_dataset(data_dict, video):
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
@@ -212,11 +235,15 @@ def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=Tru
|
||||
"Generating UMI dataset without `video=True` creates ~150GB on disk and requires ~80GB in RAM."
|
||||
)
|
||||
|
||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"codebase_version": CODEBASE_VERSION,
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
if video:
|
||||
info["encoding"] = get_default_encoding()
|
||||
|
||||
return hf_dataset, episode_data_index, info
|
||||
|
||||
@@ -13,39 +13,41 @@
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import inspect
|
||||
from concurrent.futures import ThreadPoolExecutor
|
||||
from pathlib import Path
|
||||
from typing import Dict
|
||||
|
||||
import datasets
|
||||
import numpy
|
||||
import PIL
|
||||
import torch
|
||||
|
||||
from lerobot.common.datasets.video_utils import encode_video_frames
|
||||
|
||||
def concatenate_episodes(ep_dicts, drop_episodes_last_frame=False):
|
||||
|
||||
def concatenate_episodes(ep_dicts):
|
||||
data_dict = {}
|
||||
|
||||
keys = ep_dicts[0].keys()
|
||||
for key in keys:
|
||||
if torch.is_tensor(ep_dicts[0][key][0]):
|
||||
if drop_episodes_last_frame:
|
||||
data_dict[key] = torch.cat([ep_dict[key][:-1] for ep_dict in ep_dicts])
|
||||
else:
|
||||
data_dict[key] = torch.cat([ep_dict[key] for ep_dict in ep_dicts])
|
||||
data_dict[key] = torch.cat([ep_dict[key] for ep_dict in ep_dicts])
|
||||
else:
|
||||
if key not in data_dict:
|
||||
data_dict[key] = []
|
||||
for ep_dict in ep_dicts:
|
||||
for x in ep_dict[key]:
|
||||
data_dict[key].append(x)
|
||||
if drop_episodes_last_frame:
|
||||
data_dict[key].pop()
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def save_images_concurrently(imgs_array: numpy.array, out_dir: Path, max_workers: int = 4):
|
||||
def save_images_concurrently(
|
||||
imgs_array: numpy.array, out_dir: Path, max_workers: int = 4
|
||||
):
|
||||
out_dir = Path(out_dir)
|
||||
out_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
@@ -55,4 +57,83 @@ def save_images_concurrently(imgs_array: numpy.array, out_dir: Path, max_workers
|
||||
|
||||
num_images = len(imgs_array)
|
||||
with ThreadPoolExecutor(max_workers=max_workers) as executor:
|
||||
[executor.submit(save_image, imgs_array[i], i, out_dir) for i in range(num_images)]
|
||||
[
|
||||
executor.submit(save_image, imgs_array[i], i, out_dir)
|
||||
for i in range(num_images)
|
||||
]
|
||||
|
||||
|
||||
def get_default_encoding() -> dict:
|
||||
"""Returns the default ffmpeg encoding parameters used by `encode_video_frames`."""
|
||||
signature = inspect.signature(encode_video_frames)
|
||||
return {
|
||||
k: v.default
|
||||
for k, v in signature.parameters.items()
|
||||
if v.default is not inspect.Parameter.empty
|
||||
and k in ["vcodec", "pix_fmt", "g", "crf"]
|
||||
}
|
||||
|
||||
|
||||
def check_repo_id(repo_id: str) -> None:
|
||||
if len(repo_id.split("/")) != 2:
|
||||
raise ValueError(
|
||||
f"""`repo_id` is expected to contain a community or user id `/` the name of the dataset
|
||||
(e.g. 'lerobot/pusht'), but contains '{repo_id}'."""
|
||||
)
|
||||
|
||||
|
||||
# TODO(aliberts): remove
|
||||
def calculate_episode_data_index(
|
||||
hf_dataset: datasets.Dataset,
|
||||
) -> Dict[str, torch.Tensor]:
|
||||
"""
|
||||
Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
|
||||
|
||||
Parameters:
|
||||
- hf_dataset (datasets.Dataset): A HuggingFace dataset containing the episode index.
|
||||
|
||||
Returns:
|
||||
- episode_data_index: A dictionary containing the data index for each episode. The dictionary has two keys:
|
||||
- "from": A tensor containing the starting index of each episode.
|
||||
- "to": A tensor containing the ending index of each episode.
|
||||
"""
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
|
||||
current_episode = None
|
||||
"""
|
||||
The episode_index is a list of integers, each representing the episode index of the corresponding example.
|
||||
For instance, the following is a valid episode_index:
|
||||
[0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 2]
|
||||
|
||||
Below, we iterate through the episode_index and populate the episode_data_index dictionary with the starting and
|
||||
ending index of each episode. For the episode_index above, the episode_data_index dictionary will look like this:
|
||||
{
|
||||
"from": [0, 3, 7],
|
||||
"to": [3, 7, 12]
|
||||
}
|
||||
"""
|
||||
if len(hf_dataset) == 0:
|
||||
episode_data_index = {
|
||||
"from": torch.tensor([]),
|
||||
"to": torch.tensor([]),
|
||||
}
|
||||
return episode_data_index
|
||||
for idx, episode_idx in enumerate(hf_dataset["episode_index"]):
|
||||
if episode_idx != current_episode:
|
||||
# We encountered a new episode, so we append its starting location to the "from" list
|
||||
episode_data_index["from"].append(idx)
|
||||
# If this is not the first episode, we append the ending location of the previous episode to the "to" list
|
||||
if current_episode is not None:
|
||||
episode_data_index["to"].append(idx)
|
||||
# Let's keep track of the current episode index
|
||||
current_episode = episode_idx
|
||||
else:
|
||||
# We are still in the same episode, so there is nothing for us to do here
|
||||
pass
|
||||
# We have reached the end of the dataset, so we append the ending location of the last episode to the "to" list
|
||||
episode_data_index["to"].append(idx + 1)
|
||||
|
||||
for k in ["from", "to"]:
|
||||
episode_data_index[k] = torch.tensor(episode_data_index[k])
|
||||
|
||||
return episode_data_index
|
||||
|
||||
@@ -25,7 +25,13 @@ import tqdm
|
||||
from datasets import Dataset, Features, Image, Sequence, Value
|
||||
from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||
calculate_episode_data_index,
|
||||
concatenate_episodes,
|
||||
get_default_encoding,
|
||||
save_images_concurrently,
|
||||
)
|
||||
from lerobot.common.datasets.utils import (
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
@@ -34,7 +40,10 @@ from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
|
||||
def check_format(raw_dir):
|
||||
keys = {"actions", "rewards", "dones"}
|
||||
nested_keys = {"observations": {"rgb", "state"}, "next_observations": {"rgb", "state"}}
|
||||
nested_keys = {
|
||||
"observations": {"rgb", "state"},
|
||||
"next_observations": {"rgb", "state"},
|
||||
}
|
||||
|
||||
xarm_files = list(raw_dir.glob("*.pkl"))
|
||||
assert len(xarm_files) > 0
|
||||
@@ -47,44 +56,62 @@ def check_format(raw_dir):
|
||||
|
||||
# Check for consistent lengths in nested keys
|
||||
expected_len = len(dataset_dict["actions"])
|
||||
assert all(len(dataset_dict[key]) == expected_len for key in keys if key in dataset_dict)
|
||||
assert all(
|
||||
len(dataset_dict[key]) == expected_len for key in keys if key in dataset_dict
|
||||
)
|
||||
|
||||
for key, subkeys in nested_keys.items():
|
||||
nested_dict = dataset_dict.get(key, {})
|
||||
assert all(len(nested_dict[subkey]) == expected_len for subkey in subkeys if subkey in nested_dict)
|
||||
assert all(
|
||||
len(nested_dict[subkey]) == expected_len
|
||||
for subkey in subkeys
|
||||
if subkey in nested_dict
|
||||
)
|
||||
|
||||
|
||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
def load_from_raw(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int,
|
||||
video: bool,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
pkl_path = raw_dir / "buffer.pkl"
|
||||
|
||||
with open(pkl_path, "rb") as f:
|
||||
pkl_data = pickle.load(f)
|
||||
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
|
||||
id_from = 0
|
||||
id_to = 0
|
||||
ep_idx = 0
|
||||
total_frames = pkl_data["actions"].shape[0]
|
||||
for i in tqdm.tqdm(range(total_frames)):
|
||||
id_to += 1
|
||||
|
||||
if not pkl_data["dones"][i]:
|
||||
# load data indices from which each episode starts and ends
|
||||
from_ids, to_ids = [], []
|
||||
from_idx, to_idx = 0, 0
|
||||
for done in pkl_data["dones"]:
|
||||
to_idx += 1
|
||||
if not done:
|
||||
continue
|
||||
from_ids.append(from_idx)
|
||||
to_ids.append(to_idx)
|
||||
from_idx = to_idx
|
||||
|
||||
num_frames = id_to - id_from
|
||||
num_episodes = len(from_ids)
|
||||
|
||||
image = torch.tensor(pkl_data["observations"]["rgb"][id_from:id_to])
|
||||
ep_dicts = []
|
||||
ep_ids = episodes if episodes else range(num_episodes)
|
||||
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||
from_idx = from_ids[selected_ep_idx]
|
||||
to_idx = to_ids[selected_ep_idx]
|
||||
num_frames = to_idx - from_idx
|
||||
|
||||
image = torch.tensor(pkl_data["observations"]["rgb"][from_idx:to_idx])
|
||||
image = einops.rearrange(image, "b c h w -> b h w c")
|
||||
state = torch.tensor(pkl_data["observations"]["state"][id_from:id_to])
|
||||
action = torch.tensor(pkl_data["actions"][id_from:id_to])
|
||||
state = torch.tensor(pkl_data["observations"]["state"][from_idx:to_idx])
|
||||
action = torch.tensor(pkl_data["actions"][from_idx:to_idx])
|
||||
# TODO(rcadene): we have a missing last frame which is the observation when the env is done
|
||||
# it is critical to have this frame for tdmpc to predict a "done observation/state"
|
||||
# next_image = torch.tensor(pkl_data["next_observations"]["rgb"][id_from:id_to])
|
||||
# next_state = torch.tensor(pkl_data["next_observations"]["state"][id_from:id_to])
|
||||
next_reward = torch.tensor(pkl_data["rewards"][id_from:id_to])
|
||||
next_done = torch.tensor(pkl_data["dones"][id_from:id_to])
|
||||
# next_image = torch.tensor(pkl_data["next_observations"]["rgb"][from_idx:to_idx])
|
||||
# next_state = torch.tensor(pkl_data["next_observations"]["state"][from_idx:to_idx])
|
||||
next_reward = torch.tensor(pkl_data["rewards"][from_idx:to_idx])
|
||||
next_done = torch.tensor(pkl_data["dones"][from_idx:to_idx])
|
||||
|
||||
ep_dict = {}
|
||||
|
||||
@@ -92,25 +119,30 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = out_dir / "tmp_images"
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = out_dir / "videos" / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
|
||||
ep_dict[img_key] = [
|
||||
{"path": f"videos/{fname}", "timestamp": i / fps}
|
||||
for i in range(num_frames)
|
||||
]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
|
||||
ep_dict["observation.state"] = state
|
||||
ep_dict["action"] = action
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
||||
ep_dict["episode_index"] = torch.tensor(
|
||||
[ep_idx] * num_frames, dtype=torch.int64
|
||||
)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
# ep_dict["next.observation.image"] = next_image
|
||||
@@ -119,18 +151,11 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
ep_dict["next.done"] = next_done
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(id_from + num_frames)
|
||||
|
||||
id_from = id_to
|
||||
ep_idx += 1
|
||||
|
||||
# process first episode only
|
||||
if debug:
|
||||
break
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
return data_dict, episode_data_index
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video):
|
||||
@@ -142,7 +167,8 @@ def to_hf_dataset(data_dict, video):
|
||||
features["observation.image"] = Image()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
length=data_dict["observation.state"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
@@ -161,18 +187,29 @@ def to_hf_dataset(data_dict, video):
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
encoding: dict | None = None,
|
||||
):
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 15
|
||||
|
||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"codebase_version": CODEBASE_VERSION,
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
if video:
|
||||
info["encoding"] = get_default_encoding()
|
||||
|
||||
return hf_dataset, episode_data_index, info
|
||||
|
||||
@@ -43,7 +43,10 @@ class EpisodeAwareSampler:
|
||||
):
|
||||
if episode_indices_to_use is None or episode_idx in episode_indices_to_use:
|
||||
indices.extend(
|
||||
range(start_index.item() + drop_n_first_frames, end_index.item() - drop_n_last_frames)
|
||||
range(
|
||||
start_index.item() + drop_n_first_frames,
|
||||
end_index.item() - drop_n_last_frames,
|
||||
)
|
||||
)
|
||||
|
||||
self.indices = indices
|
||||
|
||||
238
lerobot/common/datasets/transforms.py
Normal file
238
lerobot/common/datasets/transforms.py
Normal file
@@ -0,0 +1,238 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import collections
|
||||
from typing import Any, Callable, Dict, Sequence
|
||||
|
||||
import torch
|
||||
from torchvision.transforms import v2
|
||||
from torchvision.transforms.v2 import Transform
|
||||
from torchvision.transforms.v2 import functional as F # noqa: N812
|
||||
|
||||
|
||||
class RandomSubsetApply(Transform):
|
||||
"""Apply a random subset of N transformations from a list of transformations.
|
||||
|
||||
Args:
|
||||
transforms: list of transformations.
|
||||
p: represents the multinomial probabilities (with no replacement) used for sampling the transform.
|
||||
If the sum of the weights is not 1, they will be normalized. If ``None`` (default), all transforms
|
||||
have the same probability.
|
||||
n_subset: number of transformations to apply. If ``None``, all transforms are applied.
|
||||
Must be in [1, len(transforms)].
|
||||
random_order: apply transformations in a random order.
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
transforms: Sequence[Callable],
|
||||
p: list[float] | None = None,
|
||||
n_subset: int | None = None,
|
||||
random_order: bool = False,
|
||||
) -> None:
|
||||
super().__init__()
|
||||
if not isinstance(transforms, Sequence):
|
||||
raise TypeError("Argument transforms should be a sequence of callables")
|
||||
if p is None:
|
||||
p = [1] * len(transforms)
|
||||
elif len(p) != len(transforms):
|
||||
raise ValueError(
|
||||
f"Length of p doesn't match the number of transforms: {len(p)} != {len(transforms)}"
|
||||
)
|
||||
|
||||
if n_subset is None:
|
||||
n_subset = len(transforms)
|
||||
elif not isinstance(n_subset, int):
|
||||
raise TypeError("n_subset should be an int or None")
|
||||
elif not (1 <= n_subset <= len(transforms)):
|
||||
raise ValueError(
|
||||
f"n_subset should be in the interval [1, {len(transforms)}]"
|
||||
)
|
||||
|
||||
self.transforms = transforms
|
||||
total = sum(p)
|
||||
self.p = [prob / total for prob in p]
|
||||
self.n_subset = n_subset
|
||||
self.random_order = random_order
|
||||
|
||||
def forward(self, *inputs: Any) -> Any:
|
||||
needs_unpacking = len(inputs) > 1
|
||||
|
||||
selected_indices = torch.multinomial(torch.tensor(self.p), self.n_subset)
|
||||
if not self.random_order:
|
||||
selected_indices = selected_indices.sort().values
|
||||
|
||||
selected_transforms = [self.transforms[i] for i in selected_indices]
|
||||
|
||||
for transform in selected_transforms:
|
||||
outputs = transform(*inputs)
|
||||
inputs = outputs if needs_unpacking else (outputs,)
|
||||
|
||||
return outputs
|
||||
|
||||
def extra_repr(self) -> str:
|
||||
return (
|
||||
f"transforms={self.transforms}, "
|
||||
f"p={self.p}, "
|
||||
f"n_subset={self.n_subset}, "
|
||||
f"random_order={self.random_order}"
|
||||
)
|
||||
|
||||
|
||||
class SharpnessJitter(Transform):
|
||||
"""Randomly change the sharpness of an image or video.
|
||||
|
||||
Similar to a v2.RandomAdjustSharpness with p=1 and a sharpness_factor sampled randomly.
|
||||
While v2.RandomAdjustSharpness applies — with a given probability — a fixed sharpness_factor to an image,
|
||||
SharpnessJitter applies a random sharpness_factor each time. This is to have a more diverse set of
|
||||
augmentations as a result.
|
||||
|
||||
A sharpness_factor of 0 gives a blurred image, 1 gives the original image while 2 increases the sharpness
|
||||
by a factor of 2.
|
||||
|
||||
If the input is a :class:`torch.Tensor`,
|
||||
it is expected to have [..., 1 or 3, H, W] shape, where ... means an arbitrary number of leading dimensions.
|
||||
|
||||
Args:
|
||||
sharpness: How much to jitter sharpness. sharpness_factor is chosen uniformly from
|
||||
[max(0, 1 - sharpness), 1 + sharpness] or the given
|
||||
[min, max]. Should be non negative numbers.
|
||||
"""
|
||||
|
||||
def __init__(self, sharpness: float | Sequence[float]) -> None:
|
||||
super().__init__()
|
||||
self.sharpness = self._check_input(sharpness)
|
||||
|
||||
def _check_input(self, sharpness):
|
||||
if isinstance(sharpness, (int, float)):
|
||||
if sharpness < 0:
|
||||
raise ValueError(
|
||||
"If sharpness is a single number, it must be non negative."
|
||||
)
|
||||
sharpness = [1.0 - sharpness, 1.0 + sharpness]
|
||||
sharpness[0] = max(sharpness[0], 0.0)
|
||||
elif isinstance(sharpness, collections.abc.Sequence) and len(sharpness) == 2:
|
||||
sharpness = [float(v) for v in sharpness]
|
||||
else:
|
||||
raise TypeError(
|
||||
f"{sharpness=} should be a single number or a sequence with length 2."
|
||||
)
|
||||
|
||||
if not 0.0 <= sharpness[0] <= sharpness[1]:
|
||||
raise ValueError(
|
||||
f"sharpnesss values should be between (0., inf), but got {sharpness}."
|
||||
)
|
||||
|
||||
return float(sharpness[0]), float(sharpness[1])
|
||||
|
||||
def _generate_value(self, left: float, right: float) -> float:
|
||||
return torch.empty(1).uniform_(left, right).item()
|
||||
|
||||
def _transform(self, inpt: Any, params: Dict[str, Any]) -> Any:
|
||||
sharpness_factor = self._generate_value(self.sharpness[0], self.sharpness[1])
|
||||
return self._call_kernel(
|
||||
F.adjust_sharpness, inpt, sharpness_factor=sharpness_factor
|
||||
)
|
||||
|
||||
|
||||
def get_image_transforms(
|
||||
brightness_weight: float = 1.0,
|
||||
brightness_min_max: tuple[float, float] | None = None,
|
||||
contrast_weight: float = 1.0,
|
||||
contrast_min_max: tuple[float, float] | None = None,
|
||||
saturation_weight: float = 1.0,
|
||||
saturation_min_max: tuple[float, float] | None = None,
|
||||
hue_weight: float = 1.0,
|
||||
hue_min_max: tuple[float, float] | None = None,
|
||||
sharpness_weight: float = 1.0,
|
||||
sharpness_min_max: tuple[float, float] | None = None,
|
||||
max_num_transforms: int | None = None,
|
||||
random_order: bool = False,
|
||||
interpolation: str | None = None,
|
||||
image_size: tuple[int, int] | None = None,
|
||||
image_mean: list[float] | None = None,
|
||||
image_std: list[float] | None = None,
|
||||
):
|
||||
def check_value(name, weight, min_max):
|
||||
if min_max is not None:
|
||||
if len(min_max) != 2:
|
||||
raise ValueError(
|
||||
f"`{name}_min_max` is expected to be a tuple of 2 dimensions, but {min_max} provided."
|
||||
)
|
||||
if weight < 0.0:
|
||||
raise ValueError(
|
||||
f"`{name}_weight` is expected to be 0 or positive, but is negative ({weight})."
|
||||
)
|
||||
|
||||
check_value("brightness", brightness_weight, brightness_min_max)
|
||||
check_value("contrast", contrast_weight, contrast_min_max)
|
||||
check_value("saturation", saturation_weight, saturation_min_max)
|
||||
check_value("hue", hue_weight, hue_min_max)
|
||||
check_value("sharpness", sharpness_weight, sharpness_min_max)
|
||||
|
||||
weights = []
|
||||
transforms = []
|
||||
if image_size is not None:
|
||||
interpolations = [interpolation.value for interpolation in v2.InterpolationMode]
|
||||
if interpolation is None:
|
||||
# Use BICUBIC as default interpolation
|
||||
interpolation_mode = v2.InterpolationMode.BICUBIC
|
||||
elif interpolation in interpolations:
|
||||
interpolation_mode = v2.InterpolationMode(interpolation)
|
||||
else:
|
||||
raise ValueError("The interpolation passed is not supported")
|
||||
# Weight for resizing is always 1
|
||||
weights.append(1.0)
|
||||
transforms.append(
|
||||
v2.Resize(
|
||||
size=(image_size[0], image_size[1]), interpolation=interpolation_mode
|
||||
)
|
||||
)
|
||||
if brightness_min_max is not None and brightness_weight > 0.0:
|
||||
weights.append(brightness_weight)
|
||||
transforms.append(v2.ColorJitter(brightness=brightness_min_max))
|
||||
if contrast_min_max is not None and contrast_weight > 0.0:
|
||||
weights.append(contrast_weight)
|
||||
transforms.append(v2.ColorJitter(contrast=contrast_min_max))
|
||||
if saturation_min_max is not None and saturation_weight > 0.0:
|
||||
weights.append(saturation_weight)
|
||||
transforms.append(v2.ColorJitter(saturation=saturation_min_max))
|
||||
if hue_min_max is not None and hue_weight > 0.0:
|
||||
weights.append(hue_weight)
|
||||
transforms.append(v2.ColorJitter(hue=hue_min_max))
|
||||
if sharpness_min_max is not None and sharpness_weight > 0.0:
|
||||
weights.append(sharpness_weight)
|
||||
transforms.append(SharpnessJitter(sharpness=sharpness_min_max))
|
||||
if image_mean is not None and image_std is not None:
|
||||
# Weight for normalization is always 1
|
||||
weights.append(1.0)
|
||||
transforms.append(
|
||||
v2.Normalize(
|
||||
mean=image_mean,
|
||||
std=image_std,
|
||||
)
|
||||
)
|
||||
|
||||
n_subset = len(transforms)
|
||||
if max_num_transforms is not None:
|
||||
n_subset = min(n_subset, max_num_transforms)
|
||||
|
||||
if n_subset == 0:
|
||||
return v2.Identity()
|
||||
else:
|
||||
# TODO(rcadene, aliberts): add v2.ToDtype float16?
|
||||
return RandomSubsetApply(
|
||||
transforms, p=weights, n_subset=n_subset, random_order=random_order
|
||||
)
|
||||
@@ -13,21 +13,66 @@
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import importlib.resources
|
||||
import json
|
||||
import re
|
||||
import logging
|
||||
import textwrap
|
||||
from collections.abc import Iterator
|
||||
from itertools import accumulate
|
||||
from pathlib import Path
|
||||
from typing import Dict
|
||||
from pprint import pformat
|
||||
from types import SimpleNamespace
|
||||
from typing import Any
|
||||
|
||||
import datasets
|
||||
import jsonlines
|
||||
import numpy as np
|
||||
import pyarrow.compute as pc
|
||||
import torch
|
||||
from datasets import load_dataset, load_from_disk
|
||||
from huggingface_hub import hf_hub_download, snapshot_download
|
||||
from datasets.table import embed_table_storage
|
||||
from huggingface_hub import DatasetCard, DatasetCardData, HfApi
|
||||
from PIL import Image as PILImage
|
||||
from safetensors.torch import load_file
|
||||
from torchvision import transforms
|
||||
|
||||
from lerobot.common.robot_devices.robots.utils import Robot
|
||||
|
||||
def flatten_dict(d, parent_key="", sep="/"):
|
||||
DEFAULT_CHUNK_SIZE = 1000 # Max number of episodes per chunk
|
||||
|
||||
INFO_PATH = "meta/info.json"
|
||||
EPISODES_PATH = "meta/episodes.jsonl"
|
||||
STATS_PATH = "meta/stats.json"
|
||||
TASKS_PATH = "meta/tasks.jsonl"
|
||||
|
||||
DEFAULT_VIDEO_PATH = (
|
||||
"videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4"
|
||||
)
|
||||
DEFAULT_PARQUET_PATH = (
|
||||
"data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet"
|
||||
)
|
||||
DEFAULT_IMAGE_PATH = (
|
||||
"images/{image_key}/episode_{episode_index:06d}/frame_{frame_index:06d}.png"
|
||||
)
|
||||
|
||||
DATASET_CARD_TEMPLATE = """
|
||||
---
|
||||
# Metadata will go there
|
||||
---
|
||||
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
|
||||
|
||||
## {}
|
||||
|
||||
"""
|
||||
|
||||
DEFAULT_FEATURES = {
|
||||
"timestamp": {"dtype": "float32", "shape": (1,), "names": None},
|
||||
"frame_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||
"episode_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||
"index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||
"task_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||
}
|
||||
|
||||
|
||||
def flatten_dict(d: dict, parent_key: str = "", sep: str = "/") -> dict:
|
||||
"""Flatten a nested dictionary structure by collapsing nested keys into one key with a separator.
|
||||
|
||||
For example:
|
||||
@@ -46,7 +91,7 @@ def flatten_dict(d, parent_key="", sep="/"):
|
||||
return dict(items)
|
||||
|
||||
|
||||
def unflatten_dict(d, sep="/"):
|
||||
def unflatten_dict(d: dict, sep: str = "/") -> dict:
|
||||
outdict = {}
|
||||
for key, value in d.items():
|
||||
parts = key.split(sep)
|
||||
@@ -59,6 +104,89 @@ def unflatten_dict(d, sep="/"):
|
||||
return outdict
|
||||
|
||||
|
||||
def serialize_dict(stats: dict[str, torch.Tensor | np.ndarray | dict]) -> dict:
|
||||
serialized_dict = {
|
||||
key: value.tolist() for key, value in flatten_dict(stats).items()
|
||||
}
|
||||
return unflatten_dict(serialized_dict)
|
||||
|
||||
|
||||
def write_parquet(dataset: datasets.Dataset, fpath: Path) -> None:
|
||||
# Embed image bytes into the table before saving to parquet
|
||||
format = dataset.format
|
||||
dataset = dataset.with_format("arrow")
|
||||
dataset = dataset.map(embed_table_storage, batched=False)
|
||||
dataset = dataset.with_format(**format)
|
||||
dataset.to_parquet(fpath)
|
||||
|
||||
|
||||
def load_json(fpath: Path) -> Any:
|
||||
with open(fpath) as f:
|
||||
return json.load(f)
|
||||
|
||||
|
||||
def write_json(data: dict, fpath: Path) -> None:
|
||||
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||
with open(fpath, "w") as f:
|
||||
json.dump(data, f, indent=4, ensure_ascii=False)
|
||||
|
||||
|
||||
def load_jsonlines(fpath: Path) -> list[Any]:
|
||||
with jsonlines.open(fpath, "r") as reader:
|
||||
return list(reader)
|
||||
|
||||
|
||||
def write_jsonlines(data: dict, fpath: Path) -> None:
|
||||
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||
with jsonlines.open(fpath, "w") as writer:
|
||||
writer.write_all(data)
|
||||
|
||||
|
||||
def append_jsonlines(data: dict, fpath: Path) -> None:
|
||||
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||
with jsonlines.open(fpath, "a") as writer:
|
||||
writer.write(data)
|
||||
|
||||
|
||||
def load_info(local_dir: Path) -> dict:
|
||||
info = load_json(local_dir / INFO_PATH)
|
||||
for ft in info["features"].values():
|
||||
ft["shape"] = tuple(ft["shape"])
|
||||
return info
|
||||
|
||||
|
||||
def load_stats(local_dir: Path) -> dict:
|
||||
if not (local_dir / STATS_PATH).exists():
|
||||
return None
|
||||
stats = load_json(local_dir / STATS_PATH)
|
||||
stats = {key: torch.tensor(value) for key, value in flatten_dict(stats).items()}
|
||||
return unflatten_dict(stats)
|
||||
|
||||
|
||||
def load_tasks(local_dir: Path) -> dict:
|
||||
tasks = load_jsonlines(local_dir / TASKS_PATH)
|
||||
return {
|
||||
item["task_index"]: item["task"]
|
||||
for item in sorted(tasks, key=lambda x: x["task_index"])
|
||||
}
|
||||
|
||||
|
||||
def load_episodes(local_dir: Path) -> dict:
|
||||
return load_jsonlines(local_dir / EPISODES_PATH)
|
||||
|
||||
|
||||
def load_image_as_numpy(
|
||||
fpath: str | Path, dtype="float32", channel_first: bool = True
|
||||
) -> np.ndarray:
|
||||
img = PILImage.open(fpath).convert("RGB")
|
||||
img_array = np.array(img, dtype=dtype)
|
||||
if channel_first: # (H, W, C) -> (C, H, W)
|
||||
img_array = np.transpose(img_array, (2, 0, 1))
|
||||
if "float" in dtype:
|
||||
img_array /= 255.0
|
||||
return img_array
|
||||
|
||||
|
||||
def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
|
||||
"""Get a transform function that convert items from Hugging Face dataset (pyarrow)
|
||||
to torch tensors. Importantly, images are converted from PIL, which corresponds to
|
||||
@@ -70,9 +198,6 @@ def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
|
||||
if isinstance(first_item, PILImage.Image):
|
||||
to_tensor = transforms.ToTensor()
|
||||
items_dict[key] = [to_tensor(img) for img in items_dict[key]]
|
||||
elif isinstance(first_item, dict) and "path" in first_item and "timestamp" in first_item:
|
||||
# video frame will be processed downstream
|
||||
pass
|
||||
elif first_item is None:
|
||||
pass
|
||||
else:
|
||||
@@ -80,267 +205,272 @@ def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
|
||||
return items_dict
|
||||
|
||||
|
||||
def load_hf_dataset(repo_id, version, root, split) -> datasets.Dataset:
|
||||
"""hf_dataset contains all the observations, states, actions, rewards, etc."""
|
||||
if root is not None:
|
||||
hf_dataset = load_from_disk(str(Path(root) / repo_id / "train"))
|
||||
# TODO(rcadene): clean this which enables getting a subset of dataset
|
||||
if split != "train":
|
||||
if "%" in split:
|
||||
raise NotImplementedError(f"We dont support splitting based on percentage for now ({split}).")
|
||||
match_from = re.search(r"train\[(\d+):\]", split)
|
||||
match_to = re.search(r"train\[:(\d+)\]", split)
|
||||
if match_from:
|
||||
from_frame_index = int(match_from.group(1))
|
||||
hf_dataset = hf_dataset.select(range(from_frame_index, len(hf_dataset)))
|
||||
elif match_to:
|
||||
to_frame_index = int(match_to.group(1))
|
||||
hf_dataset = hf_dataset.select(range(to_frame_index))
|
||||
else:
|
||||
raise ValueError(
|
||||
f'`split` ({split}) should either be "train", "train[INT:]", or "train[:INT]"'
|
||||
)
|
||||
else:
|
||||
hf_dataset = load_dataset(repo_id, revision=version, split=split)
|
||||
hf_dataset.set_transform(hf_transform_to_torch)
|
||||
return hf_dataset
|
||||
def _get_major_minor(version: str) -> tuple[int]:
|
||||
split = version.strip("v").split(".")
|
||||
return int(split[0]), int(split[1])
|
||||
|
||||
|
||||
def load_episode_data_index(repo_id, version, root) -> dict[str, torch.Tensor]:
|
||||
"""episode_data_index contains the range of indices for each episode
|
||||
class BackwardCompatibilityError(Exception):
|
||||
def __init__(self, repo_id, version):
|
||||
message = textwrap.dedent(f"""
|
||||
BackwardCompatibilityError: The dataset you requested ({repo_id}) is in {version} format.
|
||||
|
||||
Example:
|
||||
```python
|
||||
from_id = episode_data_index["from"][episode_id].item()
|
||||
to_id = episode_data_index["to"][episode_id].item()
|
||||
episode_frames = [dataset[i] for i in range(from_id, to_id)]
|
||||
```
|
||||
"""
|
||||
if root is not None:
|
||||
path = Path(root) / repo_id / "meta_data" / "episode_data_index.safetensors"
|
||||
else:
|
||||
path = hf_hub_download(
|
||||
repo_id, "meta_data/episode_data_index.safetensors", repo_type="dataset", revision=version
|
||||
We introduced a new format since v2.0 which is not backward compatible with v1.x.
|
||||
Please, use our conversion script. Modify the following command with your own task description:
|
||||
```
|
||||
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \\
|
||||
--repo-id {repo_id} \\
|
||||
--single-task "TASK DESCRIPTION." # <---- /!\\ Replace TASK DESCRIPTION /!\\
|
||||
```
|
||||
|
||||
A few examples to replace TASK DESCRIPTION: "Pick up the blue cube and place it into the bin.",
|
||||
"Insert the peg into the socket.", "Slide open the ziploc bag.", "Take the elevator to the 1st floor.",
|
||||
"Open the top cabinet, store the pot inside it then close the cabinet.", "Push the T-shaped block onto the T-shaped target.",
|
||||
"Grab the spray paint on the shelf and place it in the bin on top of the robot dog.", "Fold the sweatshirt.", ...
|
||||
|
||||
If you encounter a problem, contact LeRobot maintainers on [Discord](https://discord.com/invite/s3KuuzsPFb)
|
||||
or open an [issue on GitHub](https://github.com/huggingface/lerobot/issues/new/choose).
|
||||
""")
|
||||
super().__init__(message)
|
||||
|
||||
|
||||
def check_version_compatibility(
|
||||
repo_id: str,
|
||||
version_to_check: str,
|
||||
current_version: str,
|
||||
enforce_breaking_major: bool = True,
|
||||
) -> None:
|
||||
current_major, _ = _get_major_minor(current_version)
|
||||
major_to_check, _ = _get_major_minor(version_to_check)
|
||||
if major_to_check < current_major and enforce_breaking_major:
|
||||
raise BackwardCompatibilityError(repo_id, version_to_check)
|
||||
elif float(version_to_check.strip("v")) < float(current_version.strip("v")):
|
||||
logging.warning(
|
||||
f"""The dataset you requested ({repo_id}) was created with a previous version ({version_to_check}) of the
|
||||
codebase. The current codebase version is {current_version}. You should be fine since
|
||||
backward compatibility is maintained. If you encounter a problem, contact LeRobot maintainers on
|
||||
Discord ('https://discord.com/invite/s3KuuzsPFb') or open an issue on github.""",
|
||||
)
|
||||
|
||||
return load_file(path)
|
||||
|
||||
def get_hub_safe_version(repo_id: str, version: str) -> str:
|
||||
api = HfApi()
|
||||
dataset_info = api.list_repo_refs(repo_id, repo_type="dataset")
|
||||
branches = [b.name for b in dataset_info.branches]
|
||||
if version not in branches:
|
||||
num_version = float(version.strip("v"))
|
||||
hub_num_versions = [float(v.strip("v")) for v in branches if v.startswith("v")]
|
||||
if num_version >= 2.0 and all(v < 2.0 for v in hub_num_versions):
|
||||
raise BackwardCompatibilityError(repo_id, version)
|
||||
|
||||
def load_stats(repo_id, version, root) -> dict[str, dict[str, torch.Tensor]]:
|
||||
"""stats contains the statistics per modality computed over the full dataset, such as max, min, mean, std
|
||||
|
||||
Example:
|
||||
```python
|
||||
normalized_action = (action - stats["action"]["mean"]) / stats["action"]["std"]
|
||||
```
|
||||
"""
|
||||
if root is not None:
|
||||
path = Path(root) / repo_id / "meta_data" / "stats.safetensors"
|
||||
else:
|
||||
path = hf_hub_download(repo_id, "meta_data/stats.safetensors", repo_type="dataset", revision=version)
|
||||
|
||||
stats = load_file(path)
|
||||
return unflatten_dict(stats)
|
||||
|
||||
|
||||
def load_info(repo_id, version, root) -> dict:
|
||||
"""info contains useful information regarding the dataset that are not stored elsewhere
|
||||
|
||||
Example:
|
||||
```python
|
||||
print("frame per second used to collect the video", info["fps"])
|
||||
```
|
||||
"""
|
||||
if root is not None:
|
||||
path = Path(root) / repo_id / "meta_data" / "info.json"
|
||||
else:
|
||||
path = hf_hub_download(repo_id, "meta_data/info.json", repo_type="dataset", revision=version)
|
||||
|
||||
with open(path) as f:
|
||||
info = json.load(f)
|
||||
return info
|
||||
|
||||
|
||||
def load_videos(repo_id, version, root) -> Path:
|
||||
if root is not None:
|
||||
path = Path(root) / repo_id / "videos"
|
||||
else:
|
||||
# TODO(rcadene): we download the whole repo here. see if we can avoid this
|
||||
repo_dir = snapshot_download(repo_id, repo_type="dataset", revision=version)
|
||||
path = Path(repo_dir) / "videos"
|
||||
|
||||
return path
|
||||
|
||||
|
||||
def load_previous_and_future_frames(
|
||||
item: dict[str, torch.Tensor],
|
||||
hf_dataset: datasets.Dataset,
|
||||
episode_data_index: dict[str, torch.Tensor],
|
||||
delta_timestamps: dict[str, list[float]],
|
||||
tolerance_s: float,
|
||||
) -> dict[torch.Tensor]:
|
||||
"""
|
||||
Given a current item in the dataset containing a timestamp (e.g. 0.6 seconds), and a list of time differences of
|
||||
some modalities (e.g. delta_timestamps={"observation.image": [-0.8, -0.2, 0, 0.2]}), this function computes for each
|
||||
given modality (e.g. "observation.image") a list of query timestamps (e.g. [-0.2, 0.4, 0.6, 0.8]) and loads the closest
|
||||
frames in the dataset.
|
||||
|
||||
Importantly, when no frame can be found around a query timestamp within a specified tolerance window, this function
|
||||
raises an AssertionError. When a timestamp is queried before the first available timestamp of the episode or after
|
||||
the last available timestamp, the violation of the tolerance doesnt raise an AssertionError, and the function
|
||||
populates a boolean array indicating which frames are outside of the episode range. For instance, this boolean array
|
||||
is useful during batched training to not supervise actions associated to timestamps coming after the end of the
|
||||
episode, or to pad the observations in a specific way. Note that by default the observation frames before the start
|
||||
of the episode are the same as the first frame of the episode.
|
||||
|
||||
Parameters:
|
||||
- item (dict): A dictionary containing all the data related to a frame. It is the result of `dataset[idx]`. Each key
|
||||
corresponds to a different modality (e.g., "timestamp", "observation.image", "action").
|
||||
- hf_dataset (datasets.Dataset): A dictionary containing the full dataset. Each key corresponds to a different
|
||||
modality (e.g., "timestamp", "observation.image", "action").
|
||||
- episode_data_index (dict): A dictionary containing two keys ("from" and "to") associated to dataset indices.
|
||||
They indicate the start index and end index of each episode in the dataset.
|
||||
- delta_timestamps (dict): A dictionary containing lists of delta timestamps for each possible modality to be
|
||||
retrieved. These deltas are added to the item timestamp to form the query timestamps.
|
||||
- tolerance_s (float, optional): The tolerance level (in seconds) used to determine if a data point is close enough to the query
|
||||
timestamp by asserting `tol > difference`. It is suggested to set `tol` to a smaller value than the
|
||||
smallest expected inter-frame period, but large enough to account for jitter.
|
||||
|
||||
Returns:
|
||||
- The same item with the queried frames for each modality specified in delta_timestamps, with an additional key for
|
||||
each modality (e.g. "observation.image_is_pad").
|
||||
|
||||
Raises:
|
||||
- AssertionError: If any of the frames unexpectedly violate the tolerance level. This could indicate synchronization
|
||||
issues with timestamps during data collection.
|
||||
"""
|
||||
# get indices of the frames associated to the episode, and their timestamps
|
||||
ep_id = item["episode_index"].item()
|
||||
ep_data_id_from = episode_data_index["from"][ep_id].item()
|
||||
ep_data_id_to = episode_data_index["to"][ep_id].item()
|
||||
ep_data_ids = torch.arange(ep_data_id_from, ep_data_id_to, 1)
|
||||
|
||||
# load timestamps
|
||||
ep_timestamps = hf_dataset.select_columns("timestamp")[ep_data_id_from:ep_data_id_to]["timestamp"]
|
||||
ep_timestamps = torch.stack(ep_timestamps)
|
||||
|
||||
# we make the assumption that the timestamps are sorted
|
||||
ep_first_ts = ep_timestamps[0]
|
||||
ep_last_ts = ep_timestamps[-1]
|
||||
current_ts = item["timestamp"].item()
|
||||
|
||||
for key in delta_timestamps:
|
||||
# get timestamps used as query to retrieve data of previous/future frames
|
||||
delta_ts = delta_timestamps[key]
|
||||
query_ts = current_ts + torch.tensor(delta_ts)
|
||||
|
||||
# compute distances between each query timestamp and all timestamps of all the frames belonging to the episode
|
||||
dist = torch.cdist(query_ts[:, None], ep_timestamps[:, None], p=1)
|
||||
min_, argmin_ = dist.min(1)
|
||||
|
||||
# TODO(rcadene): synchronize timestamps + interpolation if needed
|
||||
|
||||
is_pad = min_ > tolerance_s
|
||||
|
||||
# check violated query timestamps are all outside the episode range
|
||||
assert ((query_ts[is_pad] < ep_first_ts) | (ep_last_ts < query_ts[is_pad])).all(), (
|
||||
f"One or several timestamps unexpectedly violate the tolerance ({min_} > {tolerance_s=}) inside episode range."
|
||||
"This might be due to synchronization issues with timestamps during data collection."
|
||||
logging.warning(
|
||||
f"""You are trying to load a dataset from {repo_id} created with a previous version of the
|
||||
codebase. The following versions are available: {branches}.
|
||||
The requested version ('{version}') is not found. You should be fine since
|
||||
backward compatibility is maintained. If you encounter a problem, contact LeRobot maintainers on
|
||||
Discord ('https://discord.com/invite/s3KuuzsPFb') or open an issue on github.""",
|
||||
)
|
||||
if "main" not in branches:
|
||||
raise ValueError(f"Version 'main' not found on {repo_id}")
|
||||
return "main"
|
||||
else:
|
||||
return version
|
||||
|
||||
# get dataset indices corresponding to frames to be loaded
|
||||
data_ids = ep_data_ids[argmin_]
|
||||
|
||||
# load frames modality
|
||||
item[key] = hf_dataset.select_columns(key)[data_ids][key]
|
||||
|
||||
if isinstance(item[key][0], dict) and "path" in item[key][0]:
|
||||
# video mode where frame are expressed as dict of path and timestamp
|
||||
item[key] = item[key]
|
||||
def get_hf_features_from_features(features: dict) -> datasets.Features:
|
||||
hf_features = {}
|
||||
for key, ft in features.items():
|
||||
if ft["dtype"] == "video":
|
||||
continue
|
||||
elif ft["dtype"] == "image":
|
||||
hf_features[key] = datasets.Image()
|
||||
elif ft["shape"] == (1,):
|
||||
hf_features[key] = datasets.Value(dtype=ft["dtype"])
|
||||
else:
|
||||
item[key] = torch.stack(item[key])
|
||||
assert len(ft["shape"]) == 1
|
||||
hf_features[key] = datasets.Sequence(
|
||||
length=ft["shape"][0], feature=datasets.Value(dtype=ft["dtype"])
|
||||
)
|
||||
# TODO: (alibers, azouitine) Add support for ft["shap"] == 0 as Value
|
||||
|
||||
item[f"{key}_is_pad"] = is_pad
|
||||
|
||||
return item
|
||||
return datasets.Features(hf_features)
|
||||
|
||||
|
||||
def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torch.Tensor]:
|
||||
"""
|
||||
Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
|
||||
|
||||
Parameters:
|
||||
- hf_dataset (datasets.Dataset): A HuggingFace dataset containing the episode index.
|
||||
|
||||
Returns:
|
||||
- episode_data_index: A dictionary containing the data index for each episode. The dictionary has two keys:
|
||||
- "from": A tensor containing the starting index of each episode.
|
||||
- "to": A tensor containing the ending index of each episode.
|
||||
"""
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
|
||||
current_episode = None
|
||||
"""
|
||||
The episode_index is a list of integers, each representing the episode index of the corresponding example.
|
||||
For instance, the following is a valid episode_index:
|
||||
[0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 2]
|
||||
|
||||
Below, we iterate through the episode_index and populate the episode_data_index dictionary with the starting and
|
||||
ending index of each episode. For the episode_index above, the episode_data_index dictionary will look like this:
|
||||
{
|
||||
"from": [0, 3, 7],
|
||||
"to": [3, 7, 12]
|
||||
def get_features_from_robot(robot: Robot, use_videos: bool = True) -> dict:
|
||||
camera_ft = {}
|
||||
if robot.cameras:
|
||||
camera_ft = {
|
||||
key: {"dtype": "video" if use_videos else "image", **ft}
|
||||
for key, ft in robot.camera_features.items()
|
||||
}
|
||||
"""
|
||||
if len(hf_dataset) == 0:
|
||||
episode_data_index = {
|
||||
"from": torch.tensor([]),
|
||||
"to": torch.tensor([]),
|
||||
}
|
||||
return episode_data_index
|
||||
for idx, episode_idx in enumerate(hf_dataset["episode_index"]):
|
||||
if episode_idx != current_episode:
|
||||
# We encountered a new episode, so we append its starting location to the "from" list
|
||||
episode_data_index["from"].append(idx)
|
||||
# If this is not the first episode, we append the ending location of the previous episode to the "to" list
|
||||
if current_episode is not None:
|
||||
episode_data_index["to"].append(idx)
|
||||
# Let's keep track of the current episode index
|
||||
current_episode = episode_idx
|
||||
else:
|
||||
# We are still in the same episode, so there is nothing for us to do here
|
||||
pass
|
||||
# We have reached the end of the dataset, so we append the ending location of the last episode to the "to" list
|
||||
episode_data_index["to"].append(idx + 1)
|
||||
|
||||
for k in ["from", "to"]:
|
||||
episode_data_index[k] = torch.tensor(episode_data_index[k])
|
||||
|
||||
return episode_data_index
|
||||
return {**robot.motor_features, **camera_ft, **DEFAULT_FEATURES}
|
||||
|
||||
|
||||
def reset_episode_index(hf_dataset: datasets.Dataset) -> datasets.Dataset:
|
||||
"""Reset the `episode_index` of the provided HuggingFace Dataset.
|
||||
|
||||
`episode_data_index` (and related functionality such as `load_previous_and_future_frames`) requires the
|
||||
`episode_index` to be sorted, continuous (1,1,1 and not 1,2,1) and start at 0.
|
||||
|
||||
This brings the `episode_index` to the required format.
|
||||
"""
|
||||
if len(hf_dataset) == 0:
|
||||
return hf_dataset
|
||||
unique_episode_idxs = torch.stack(hf_dataset["episode_index"]).unique().tolist()
|
||||
episode_idx_to_reset_idx_mapping = {
|
||||
ep_id: reset_ep_id for reset_ep_id, ep_id in enumerate(unique_episode_idxs)
|
||||
def create_empty_dataset_info(
|
||||
codebase_version: str,
|
||||
fps: int,
|
||||
robot_type: str,
|
||||
features: dict,
|
||||
use_videos: bool,
|
||||
) -> dict:
|
||||
return {
|
||||
"codebase_version": codebase_version,
|
||||
"robot_type": robot_type,
|
||||
"total_episodes": 0,
|
||||
"total_frames": 0,
|
||||
"total_tasks": 0,
|
||||
"total_videos": 0,
|
||||
"total_chunks": 0,
|
||||
"chunks_size": DEFAULT_CHUNK_SIZE,
|
||||
"fps": fps,
|
||||
"splits": {},
|
||||
"data_path": DEFAULT_PARQUET_PATH,
|
||||
"video_path": DEFAULT_VIDEO_PATH if use_videos else None,
|
||||
"features": features,
|
||||
}
|
||||
|
||||
def modify_ep_idx_func(example):
|
||||
example["episode_index"] = episode_idx_to_reset_idx_mapping[example["episode_index"].item()]
|
||||
return example
|
||||
|
||||
hf_dataset = hf_dataset.map(modify_ep_idx_func)
|
||||
def get_episode_data_index(
|
||||
episode_dicts: list[dict], episodes: list[int] | None = None
|
||||
) -> dict[str, torch.Tensor]:
|
||||
episode_lengths = {
|
||||
ep_idx: ep_dict["length"] for ep_idx, ep_dict in enumerate(episode_dicts)
|
||||
}
|
||||
if episodes is not None:
|
||||
episode_lengths = {ep_idx: episode_lengths[ep_idx] for ep_idx in episodes}
|
||||
|
||||
return hf_dataset
|
||||
cumulative_lenghts = list(accumulate(episode_lengths.values()))
|
||||
return {
|
||||
"from": torch.LongTensor([0] + cumulative_lenghts[:-1]),
|
||||
"to": torch.LongTensor(cumulative_lenghts),
|
||||
}
|
||||
|
||||
|
||||
def calculate_total_episode(
|
||||
hf_dataset: datasets.Dataset, raise_if_not_contiguous: bool = True
|
||||
) -> dict[str, torch.Tensor]:
|
||||
episode_indices = sorted(hf_dataset.unique("episode_index"))
|
||||
total_episodes = len(episode_indices)
|
||||
if raise_if_not_contiguous and episode_indices != list(range(total_episodes)):
|
||||
raise ValueError("episode_index values are not sorted and contiguous.")
|
||||
return total_episodes
|
||||
|
||||
|
||||
def calculate_episode_data_index(
|
||||
hf_dataset: datasets.Dataset,
|
||||
) -> dict[str, torch.Tensor]:
|
||||
episode_lengths = []
|
||||
table = hf_dataset.data.table
|
||||
total_episodes = calculate_total_episode(hf_dataset)
|
||||
for ep_idx in range(total_episodes):
|
||||
ep_table = table.filter(pc.equal(table["episode_index"], ep_idx))
|
||||
episode_lengths.insert(ep_idx, len(ep_table))
|
||||
|
||||
cumulative_lenghts = list(accumulate(episode_lengths))
|
||||
return {
|
||||
"from": torch.LongTensor([0] + cumulative_lenghts[:-1]),
|
||||
"to": torch.LongTensor(cumulative_lenghts),
|
||||
}
|
||||
|
||||
|
||||
def check_timestamps_sync(
|
||||
hf_dataset: datasets.Dataset,
|
||||
episode_data_index: dict[str, torch.Tensor],
|
||||
fps: int,
|
||||
tolerance_s: float,
|
||||
raise_value_error: bool = True,
|
||||
) -> bool:
|
||||
"""
|
||||
This check is to make sure that each timestamps is separated to the next by 1/fps +/- tolerance to
|
||||
account for possible numerical error.
|
||||
"""
|
||||
timestamps = torch.stack(hf_dataset["timestamp"])
|
||||
diffs = torch.diff(timestamps)
|
||||
within_tolerance = torch.abs(diffs - 1 / fps) <= tolerance_s
|
||||
|
||||
# We mask differences between the timestamp at the end of an episode
|
||||
# and the one at the start of the next episode since these are expected
|
||||
# to be outside tolerance.
|
||||
mask = torch.ones(len(diffs), dtype=torch.bool)
|
||||
ignored_diffs = episode_data_index["to"][:-1] - 1
|
||||
mask[ignored_diffs] = False
|
||||
filtered_within_tolerance = within_tolerance[mask]
|
||||
|
||||
if not torch.all(filtered_within_tolerance):
|
||||
# Track original indices before masking
|
||||
original_indices = torch.arange(len(diffs))
|
||||
filtered_indices = original_indices[mask]
|
||||
outside_tolerance_filtered_indices = torch.nonzero(
|
||||
~filtered_within_tolerance
|
||||
) # .squeeze()
|
||||
outside_tolerance_indices = filtered_indices[outside_tolerance_filtered_indices]
|
||||
episode_indices = torch.stack(hf_dataset["episode_index"])
|
||||
|
||||
outside_tolerances = []
|
||||
for idx in outside_tolerance_indices:
|
||||
entry = {
|
||||
"timestamps": [timestamps[idx], timestamps[idx + 1]],
|
||||
"diff": diffs[idx],
|
||||
"episode_index": episode_indices[idx].item(),
|
||||
}
|
||||
outside_tolerances.append(entry)
|
||||
|
||||
if raise_value_error:
|
||||
raise ValueError(
|
||||
f"""One or several timestamps unexpectedly violate the tolerance inside episode range.
|
||||
This might be due to synchronization issues with timestamps during data collection.
|
||||
\n{pformat(outside_tolerances)}"""
|
||||
)
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
|
||||
def check_delta_timestamps(
|
||||
delta_timestamps: dict[str, list[float]],
|
||||
fps: int,
|
||||
tolerance_s: float,
|
||||
raise_value_error: bool = True,
|
||||
) -> bool:
|
||||
"""This will check if all the values in delta_timestamps are multiples of 1/fps +/- tolerance.
|
||||
This is to ensure that these delta_timestamps added to any timestamp from a dataset will themselves be
|
||||
actual timestamps from the dataset.
|
||||
"""
|
||||
outside_tolerance = {}
|
||||
for key, delta_ts in delta_timestamps.items():
|
||||
within_tolerance = [
|
||||
abs(ts * fps - round(ts * fps)) / fps <= tolerance_s for ts in delta_ts
|
||||
]
|
||||
if not all(within_tolerance):
|
||||
outside_tolerance[key] = [
|
||||
ts
|
||||
for ts, is_within in zip(delta_ts, within_tolerance, strict=True)
|
||||
if not is_within
|
||||
]
|
||||
|
||||
if len(outside_tolerance) > 0:
|
||||
if raise_value_error:
|
||||
raise ValueError(
|
||||
f"""
|
||||
The following delta_timestamps are found outside of tolerance range.
|
||||
Please make sure they are multiples of 1/{fps} +/- tolerance and adjust
|
||||
their values accordingly.
|
||||
\n{pformat(outside_tolerance)}
|
||||
"""
|
||||
)
|
||||
return False
|
||||
|
||||
return True
|
||||
|
||||
|
||||
def get_delta_indices(
|
||||
delta_timestamps: dict[str, list[float]], fps: int
|
||||
) -> dict[str, list[int]]:
|
||||
delta_indices = {}
|
||||
for key, delta_ts in delta_timestamps.items():
|
||||
delta_indices[key] = (torch.tensor(delta_ts) * fps).long().tolist()
|
||||
|
||||
return delta_indices
|
||||
|
||||
|
||||
def cycle(iterable):
|
||||
@@ -354,3 +484,113 @@ def cycle(iterable):
|
||||
yield next(iterator)
|
||||
except StopIteration:
|
||||
iterator = iter(iterable)
|
||||
|
||||
|
||||
def create_branch(repo_id, *, branch: str, repo_type: str | None = None) -> None:
|
||||
"""Create a branch on a existing Hugging Face repo. Delete the branch if it already
|
||||
exists before creating it.
|
||||
"""
|
||||
api = HfApi()
|
||||
|
||||
branches = api.list_repo_refs(repo_id, repo_type=repo_type).branches
|
||||
refs = [branch.ref for branch in branches]
|
||||
ref = f"refs/heads/{branch}"
|
||||
if ref in refs:
|
||||
api.delete_branch(repo_id, repo_type=repo_type, branch=branch)
|
||||
|
||||
api.create_branch(repo_id, repo_type=repo_type, branch=branch)
|
||||
|
||||
|
||||
def create_lerobot_dataset_card(
|
||||
tags: list | None = None,
|
||||
dataset_info: dict | None = None,
|
||||
**kwargs,
|
||||
) -> DatasetCard:
|
||||
"""
|
||||
Keyword arguments will be used to replace values in ./lerobot/common/datasets/card_template.md.
|
||||
Note: If specified, license must be one of https://huggingface.co/docs/hub/repositories-licenses.
|
||||
"""
|
||||
card_tags = ["LeRobot"]
|
||||
|
||||
if tags:
|
||||
card_tags += tags
|
||||
if dataset_info:
|
||||
dataset_structure = "[meta/info.json](meta/info.json):\n"
|
||||
dataset_structure += f"```json\n{json.dumps(dataset_info, indent=4)}\n```\n"
|
||||
kwargs = {**kwargs, "dataset_structure": dataset_structure}
|
||||
card_data = DatasetCardData(
|
||||
license=kwargs.get("license"),
|
||||
tags=card_tags,
|
||||
task_categories=["robotics"],
|
||||
configs=[
|
||||
{
|
||||
"config_name": "default",
|
||||
"data_files": "data/*/*.parquet",
|
||||
}
|
||||
],
|
||||
)
|
||||
|
||||
card_template = (
|
||||
importlib.resources.files("lerobot.common.datasets") / "card_template.md"
|
||||
).read_text()
|
||||
|
||||
return DatasetCard.from_template(
|
||||
card_data=card_data,
|
||||
template_str=card_template,
|
||||
**kwargs,
|
||||
)
|
||||
|
||||
|
||||
class IterableNamespace(SimpleNamespace):
|
||||
"""
|
||||
A namespace object that supports both dictionary-like iteration and dot notation access.
|
||||
Automatically converts nested dictionaries into IterableNamespaces.
|
||||
|
||||
This class extends SimpleNamespace to provide:
|
||||
- Dictionary-style iteration over keys
|
||||
- Access to items via both dot notation (obj.key) and brackets (obj["key"])
|
||||
- Dictionary-like methods: items(), keys(), values()
|
||||
- Recursive conversion of nested dictionaries
|
||||
|
||||
Args:
|
||||
dictionary: Optional dictionary to initialize the namespace
|
||||
**kwargs: Additional keyword arguments passed to SimpleNamespace
|
||||
|
||||
Examples:
|
||||
>>> data = {"name": "Alice", "details": {"age": 25}}
|
||||
>>> ns = IterableNamespace(data)
|
||||
>>> ns.name
|
||||
'Alice'
|
||||
>>> ns.details.age
|
||||
25
|
||||
>>> list(ns.keys())
|
||||
['name', 'details']
|
||||
>>> for key, value in ns.items():
|
||||
... print(f"{key}: {value}")
|
||||
name: Alice
|
||||
details: IterableNamespace(age=25)
|
||||
"""
|
||||
|
||||
def __init__(self, dictionary: dict[str, Any] = None, **kwargs):
|
||||
super().__init__(**kwargs)
|
||||
if dictionary is not None:
|
||||
for key, value in dictionary.items():
|
||||
if isinstance(value, dict):
|
||||
setattr(self, key, IterableNamespace(value))
|
||||
else:
|
||||
setattr(self, key, value)
|
||||
|
||||
def __iter__(self) -> Iterator[str]:
|
||||
return iter(vars(self))
|
||||
|
||||
def __getitem__(self, key: str) -> Any:
|
||||
return vars(self)[key]
|
||||
|
||||
def items(self):
|
||||
return vars(self).items()
|
||||
|
||||
def values(self):
|
||||
return vars(self).values()
|
||||
|
||||
def keys(self):
|
||||
return vars(self).keys()
|
||||
|
||||
924
lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py
Normal file
924
lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py
Normal file
@@ -0,0 +1,924 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
"""
|
||||
This script is for internal use to convert all datasets under the 'lerobot' hub user account to v2.
|
||||
|
||||
Note: Since the original Aloha datasets don't use shadow motors, you need to comment those out in
|
||||
lerobot/configs/robot/aloha.yaml before running this script.
|
||||
"""
|
||||
|
||||
import traceback
|
||||
from pathlib import Path
|
||||
from textwrap import dedent
|
||||
|
||||
from lerobot import available_datasets
|
||||
from lerobot.common.datasets.v2.convert_dataset_v1_to_v2 import (
|
||||
convert_dataset,
|
||||
parse_robot_config,
|
||||
)
|
||||
|
||||
LOCAL_DIR = Path("data/")
|
||||
|
||||
ALOHA_CONFIG = Path("lerobot/configs/robot/aloha.yaml")
|
||||
ALOHA_MOBILE_INFO = {
|
||||
"robot_config": parse_robot_config(ALOHA_CONFIG),
|
||||
"license": "mit",
|
||||
"url": "https://mobile-aloha.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2401.02117",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{fu2024mobile,
|
||||
author = {Fu, Zipeng and Zhao, Tony Z. and Finn, Chelsea},
|
||||
title = {Mobile ALOHA: Learning Bimanual Mobile Manipulation with Low-Cost Whole-Body Teleoperation},
|
||||
booktitle = {arXiv},
|
||||
year = {2024},
|
||||
}""").lstrip(),
|
||||
}
|
||||
ALOHA_STATIC_INFO = {
|
||||
"robot_config": parse_robot_config(ALOHA_CONFIG),
|
||||
"license": "mit",
|
||||
"url": "https://tonyzhaozh.github.io/aloha/",
|
||||
"paper": "https://arxiv.org/abs/2304.13705",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{Zhao2023LearningFB,
|
||||
title={Learning Fine-Grained Bimanual Manipulation with Low-Cost Hardware},
|
||||
author={Tony Zhao and Vikash Kumar and Sergey Levine and Chelsea Finn},
|
||||
journal={RSS},
|
||||
year={2023},
|
||||
volume={abs/2304.13705},
|
||||
url={https://arxiv.org/abs/2304.13705}
|
||||
}""").lstrip(),
|
||||
}
|
||||
PUSHT_INFO = {
|
||||
"license": "mit",
|
||||
"url": "https://diffusion-policy.cs.columbia.edu/",
|
||||
"paper": "https://arxiv.org/abs/2303.04137v5",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{chi2024diffusionpolicy,
|
||||
author = {Cheng Chi and Zhenjia Xu and Siyuan Feng and Eric Cousineau and Yilun Du and Benjamin Burchfiel and Russ Tedrake and Shuran Song},
|
||||
title ={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||
journal = {The International Journal of Robotics Research},
|
||||
year = {2024},
|
||||
}""").lstrip(),
|
||||
}
|
||||
XARM_INFO = {
|
||||
"license": "mit",
|
||||
"url": "https://www.nicklashansen.com/td-mpc/",
|
||||
"paper": "https://arxiv.org/abs/2203.04955",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{Hansen2022tdmpc,
|
||||
title={Temporal Difference Learning for Model Predictive Control},
|
||||
author={Nicklas Hansen and Xiaolong Wang and Hao Su},
|
||||
booktitle={ICML},
|
||||
year={2022}
|
||||
}
|
||||
"""),
|
||||
}
|
||||
UNITREEH_INFO = {
|
||||
"license": "apache-2.0",
|
||||
}
|
||||
|
||||
DATASETS = {
|
||||
"aloha_mobile_cabinet": {
|
||||
"single_task": "Open the top cabinet, store the pot inside it then close the cabinet.",
|
||||
**ALOHA_MOBILE_INFO,
|
||||
},
|
||||
"aloha_mobile_chair": {
|
||||
"single_task": "Push the chairs in front of the desk to place them against it.",
|
||||
**ALOHA_MOBILE_INFO,
|
||||
},
|
||||
"aloha_mobile_elevator": {
|
||||
"single_task": "Take the elevator to the 1st floor.",
|
||||
**ALOHA_MOBILE_INFO,
|
||||
},
|
||||
"aloha_mobile_shrimp": {
|
||||
"single_task": "Sauté the raw shrimp on both sides, then serve it in the bowl.",
|
||||
**ALOHA_MOBILE_INFO,
|
||||
},
|
||||
"aloha_mobile_wash_pan": {
|
||||
"single_task": "Pick up the pan, rinse it in the sink and then place it in the drying rack.",
|
||||
**ALOHA_MOBILE_INFO,
|
||||
},
|
||||
"aloha_mobile_wipe_wine": {
|
||||
"single_task": "Pick up the wet cloth on the faucet and use it to clean the spilled wine on the table and underneath the glass.",
|
||||
**ALOHA_MOBILE_INFO,
|
||||
},
|
||||
"aloha_static_battery": {
|
||||
"single_task": "Place the battery into the slot of the remote controller.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_candy": {
|
||||
"single_task": "Pick up the candy and unwrap it.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_coffee": {
|
||||
"single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray, then push the 'Hot Water' and 'Travel Mug' buttons.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_coffee_new": {
|
||||
"single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_cups_open": {
|
||||
"single_task": "Pick up the plastic cup and open its lid.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_fork_pick_up": {
|
||||
"single_task": "Pick up the fork and place it on the plate.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_pingpong_test": {
|
||||
"single_task": "Transfer one of the two balls in the right glass into the left glass, then transfer it back to the right glass.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_pro_pencil": {
|
||||
"single_task": "Pick up the pencil with the right arm, hand it over to the left arm then place it back onto the table.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_screw_driver": {
|
||||
"single_task": "Pick up the screwdriver with the right arm, hand it over to the left arm then place it into the cup.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_tape": {
|
||||
"single_task": "Cut a small piece of tape from the tape dispenser then place it on the cardboard box's edge.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_thread_velcro": {
|
||||
"single_task": "Pick up the velcro cable tie with the left arm, then insert the end of the velcro tie into the other end's loop with the right arm.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_towel": {
|
||||
"single_task": "Pick up a piece of paper towel and place it on the spilled liquid.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_vinh_cup": {
|
||||
"single_task": "Pick up the plastic cup with the right arm, then pop its lid open with the left arm.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_vinh_cup_left": {
|
||||
"single_task": "Pick up the plastic cup with the left arm, then pop its lid open with the right arm.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_static_ziploc_slide": {
|
||||
"single_task": "Slide open the ziploc bag.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_sim_insertion_scripted": {
|
||||
"single_task": "Insert the peg into the socket.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_sim_insertion_scripted_image": {
|
||||
"single_task": "Insert the peg into the socket.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_sim_insertion_human": {
|
||||
"single_task": "Insert the peg into the socket.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_sim_insertion_human_image": {
|
||||
"single_task": "Insert the peg into the socket.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_sim_transfer_cube_scripted": {
|
||||
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_sim_transfer_cube_scripted_image": {
|
||||
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_sim_transfer_cube_human": {
|
||||
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"aloha_sim_transfer_cube_human_image": {
|
||||
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||
**ALOHA_STATIC_INFO,
|
||||
},
|
||||
"pusht": {
|
||||
"single_task": "Push the T-shaped block onto the T-shaped target.",
|
||||
**PUSHT_INFO,
|
||||
},
|
||||
"pusht_image": {
|
||||
"single_task": "Push the T-shaped block onto the T-shaped target.",
|
||||
**PUSHT_INFO,
|
||||
},
|
||||
"unitreeh1_fold_clothes": {"single_task": "Fold the sweatshirt.", **UNITREEH_INFO},
|
||||
"unitreeh1_rearrange_objects": {
|
||||
"single_task": "Put the object into the bin.",
|
||||
**UNITREEH_INFO,
|
||||
},
|
||||
"unitreeh1_two_robot_greeting": {
|
||||
"single_task": "Greet the other robot with a high five.",
|
||||
**UNITREEH_INFO,
|
||||
},
|
||||
"unitreeh1_warehouse": {
|
||||
"single_task": "Grab the spray paint on the shelf and place it in the bin on top of the robot dog.",
|
||||
**UNITREEH_INFO,
|
||||
},
|
||||
"xarm_lift_medium": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||
"xarm_lift_medium_image": {
|
||||
"single_task": "Pick up the cube and lift it.",
|
||||
**XARM_INFO,
|
||||
},
|
||||
"xarm_lift_medium_replay": {
|
||||
"single_task": "Pick up the cube and lift it.",
|
||||
**XARM_INFO,
|
||||
},
|
||||
"xarm_lift_medium_replay_image": {
|
||||
"single_task": "Pick up the cube and lift it.",
|
||||
**XARM_INFO,
|
||||
},
|
||||
"xarm_push_medium": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||
"xarm_push_medium_image": {
|
||||
"single_task": "Push the cube onto the target.",
|
||||
**XARM_INFO,
|
||||
},
|
||||
"xarm_push_medium_replay": {
|
||||
"single_task": "Push the cube onto the target.",
|
||||
**XARM_INFO,
|
||||
},
|
||||
"xarm_push_medium_replay_image": {
|
||||
"single_task": "Push the cube onto the target.",
|
||||
**XARM_INFO,
|
||||
},
|
||||
"umi_cup_in_the_wild": {
|
||||
"single_task": "Put the cup on the plate.",
|
||||
"license": "apache-2.0",
|
||||
},
|
||||
"asu_table_top": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"paper": "https://link.springer.com/article/10.1007/s10514-023-10129-1",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{zhou2023modularity,
|
||||
title={Modularity through Attention: Efficient Training and Transfer of Language-Conditioned Policies for Robot Manipulation},
|
||||
author={Zhou, Yifan and Sonawani, Shubham and Phielipp, Mariano and Stepputtis, Simon and Amor, Heni},
|
||||
booktitle={Conference on Robot Learning},
|
||||
pages={1684--1695},
|
||||
year={2023},
|
||||
organization={PMLR}
|
||||
}
|
||||
@article{zhou2023learning,
|
||||
title={Learning modular language-conditioned robot policies through attention},
|
||||
author={Zhou, Yifan and Sonawani, Shubham and Phielipp, Mariano and Ben Amor, Heni and Stepputtis, Simon},
|
||||
journal={Autonomous Robots},
|
||||
pages={1--21},
|
||||
year={2023},
|
||||
publisher={Springer}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"austin_buds_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://ut-austin-rpl.github.io/BUDS-website/",
|
||||
"paper": "https://arxiv.org/abs/2109.13841",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{zhu2022bottom,
|
||||
title={Bottom-Up Skill Discovery From Unsegmented Demonstrations for Long-Horizon Robot Manipulation},
|
||||
author={Zhu, Yifeng and Stone, Peter and Zhu, Yuke},
|
||||
journal={IEEE Robotics and Automation Letters},
|
||||
volume={7},
|
||||
number={2},
|
||||
pages={4126--4133},
|
||||
year={2022},
|
||||
publisher={IEEE}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"austin_sailor_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://ut-austin-rpl.github.io/sailor/",
|
||||
"paper": "https://arxiv.org/abs/2210.11435",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{nasiriany2022sailor,
|
||||
title={Learning and Retrieval from Prior Data for Skill-based Imitation Learning},
|
||||
author={Soroush Nasiriany and Tian Gao and Ajay Mandlekar and Yuke Zhu},
|
||||
booktitle={Conference on Robot Learning (CoRL)},
|
||||
year={2022}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"austin_sirius_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://ut-austin-rpl.github.io/sirius/",
|
||||
"paper": "https://arxiv.org/abs/2211.08416",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{liu2022robot,
|
||||
title = {Robot Learning on the Job: Human-in-the-Loop Autonomy and Learning During Deployment},
|
||||
author = {Huihan Liu and Soroush Nasiriany and Lance Zhang and Zhiyao Bao and Yuke Zhu},
|
||||
booktitle = {Robotics: Science and Systems (RSS)},
|
||||
year = {2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"berkeley_autolab_ur5": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "cc-by-4.0",
|
||||
"url": "https://sites.google.com/view/berkeley-ur5/home",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@misc{BerkeleyUR5Website,
|
||||
title = {Berkeley {UR5} Demonstration Dataset},
|
||||
author = {Lawrence Yunliang Chen and Simeon Adebola and Ken Goldberg},
|
||||
howpublished = {https://sites.google.com/view/berkeley-ur5/home},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"berkeley_cable_routing": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "cc-by-4.0",
|
||||
"url": "https://sites.google.com/view/cablerouting/home",
|
||||
"paper": "https://arxiv.org/abs/2307.08927",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{luo2023multistage,
|
||||
author = {Jianlan Luo and Charles Xu and Xinyang Geng and Gilbert Feng and Kuan Fang and Liam Tan and Stefan Schaal and Sergey Levine},
|
||||
title = {Multi-Stage Cable Routing through Hierarchical Imitation Learning},
|
||||
journal = {arXiv pre-print},
|
||||
year = {2023},
|
||||
url = {https://arxiv.org/abs/2307.08927},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"berkeley_fanuc_manipulation": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://sites.google.com/berkeley.edu/fanuc-manipulation",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{fanuc_manipulation2023,
|
||||
title={Fanuc Manipulation: A Dataset for Learning-based Manipulation with FANUC Mate 200iD Robot},
|
||||
author={Zhu, Xinghao and Tian, Ran and Xu, Chenfeng and Ding, Mingyu and Zhan, Wei and Tomizuka, Masayoshi},
|
||||
year={2023},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"berkeley_gnm_cory_hall": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"paper": "https://arxiv.org/abs/1709.10489",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{kahn2018self,
|
||||
title={Self-supervised deep reinforcement learning with generalized computation graphs for robot navigation},
|
||||
author={Kahn, Gregory and Villaflor, Adam and Ding, Bosen and Abbeel, Pieter and Levine, Sergey},
|
||||
booktitle={2018 IEEE international conference on robotics and automation (ICRA)},
|
||||
pages={5129--5136},
|
||||
year={2018},
|
||||
organization={IEEE}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"berkeley_gnm_recon": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://sites.google.com/view/recon-robot",
|
||||
"paper": "https://arxiv.org/abs/2104.05859",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{shah2021rapid,
|
||||
title={Rapid Exploration for Open-World Navigation with Latent Goal Models},
|
||||
author={Dhruv Shah and Benjamin Eysenbach and Nicholas Rhinehart and Sergey Levine},
|
||||
booktitle={5th Annual Conference on Robot Learning },
|
||||
year={2021},
|
||||
url={https://openreview.net/forum?id=d_SWJhyKfVw}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"berkeley_gnm_sac_son": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://sites.google.com/view/SACSoN-review",
|
||||
"paper": "https://arxiv.org/abs/2306.01874",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{hirose2023sacson,
|
||||
title={SACSoN: Scalable Autonomous Data Collection for Social Navigation},
|
||||
author={Hirose, Noriaki and Shah, Dhruv and Sridhar, Ajay and Levine, Sergey},
|
||||
journal={arXiv preprint arXiv:2306.01874},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"berkeley_mvp": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"paper": "https://arxiv.org/abs/2203.06173",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@InProceedings{Radosavovic2022,
|
||||
title = {Real-World Robot Learning with Masked Visual Pre-training},
|
||||
author = {Ilija Radosavovic and Tete Xiao and Stephen James and Pieter Abbeel and Jitendra Malik and Trevor Darrell},
|
||||
booktitle = {CoRL},
|
||||
year = {2022}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"berkeley_rpt": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"paper": "https://arxiv.org/abs/2306.10007",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{Radosavovic2023,
|
||||
title={Robot Learning with Sensorimotor Pre-training},
|
||||
author={Ilija Radosavovic and Baifeng Shi and Letian Fu and Ken Goldberg and Trevor Darrell and Jitendra Malik},
|
||||
year={2023},
|
||||
journal={arXiv:2306.10007}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"cmu_franka_exploration_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://human-world-model.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2308.10901",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{mendonca2023structured,
|
||||
title={Structured World Models from Human Videos},
|
||||
author={Mendonca, Russell and Bahl, Shikhar and Pathak, Deepak},
|
||||
journal={RSS},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"cmu_play_fusion": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://play-fusion.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2312.04549",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{chen2023playfusion,
|
||||
title={PlayFusion: Skill Acquisition via Diffusion from Language-Annotated Play},
|
||||
author={Chen, Lili and Bahl, Shikhar and Pathak, Deepak},
|
||||
booktitle={CoRL},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"cmu_stretch": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://robo-affordances.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2304.08488",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{bahl2023affordances,
|
||||
title={Affordances from Human Videos as a Versatile Representation for Robotics},
|
||||
author={Bahl, Shikhar and Mendonca, Russell and Chen, Lili and Jain, Unnat and Pathak, Deepak},
|
||||
booktitle={CVPR},
|
||||
year={2023}
|
||||
}
|
||||
@article{mendonca2023structured,
|
||||
title={Structured World Models from Human Videos},
|
||||
author={Mendonca, Russell and Bahl, Shikhar and Pathak, Deepak},
|
||||
journal={CoRL},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"columbia_cairlab_pusht_real": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://diffusion-policy.cs.columbia.edu/",
|
||||
"paper": "https://arxiv.org/abs/2303.04137v5",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{chi2023diffusionpolicy,
|
||||
title={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||
author={Chi, Cheng and Feng, Siyuan and Du, Yilun and Xu, Zhenjia and Cousineau, Eric and Burchfiel, Benjamin and Song, Shuran},
|
||||
booktitle={Proceedings of Robotics: Science and Systems (RSS)},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"conq_hose_manipulation": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://sites.google.com/view/conq-hose-manipulation-dataset/home",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@misc{ConqHoseManipData,
|
||||
author={Peter Mitrano and Dmitry Berenson},
|
||||
title={Conq Hose Manipulation Dataset, v1.15.0},
|
||||
year={2024},
|
||||
howpublished={https://sites.google.com/view/conq-hose-manipulation-dataset}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"dlr_edan_shared_control": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"paper": "https://ieeexplore.ieee.org/document/9341156",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{vogel_edan_2020,
|
||||
title = {EDAN - an EMG-Controlled Daily Assistant to Help People with Physical Disabilities},
|
||||
language = {en},
|
||||
booktitle = {2020 {IEEE}/{RSJ} {International} {Conference} on {Intelligent} {Robots} and {Systems} ({IROS})},
|
||||
author = {Vogel, Jörn and Hagengruber, Annette and Iskandar, Maged and Quere, Gabriel and Leipscher, Ulrike and Bustamante, Samuel and Dietrich, Alexander and Hoeppner, Hannes and Leidner, Daniel and Albu-Schäffer, Alin},
|
||||
year = {2020}
|
||||
}
|
||||
@inproceedings{quere_shared_2020,
|
||||
address = {Paris, France},
|
||||
title = {Shared {Control} {Templates} for {Assistive} {Robotics}},
|
||||
language = {en},
|
||||
booktitle = {2020 {IEEE} {International} {Conference} on {Robotics} and {Automation} ({ICRA})},
|
||||
author = {Quere, Gabriel and Hagengruber, Annette and Iskandar, Maged and Bustamante, Samuel and Leidner, Daniel and Stulp, Freek and Vogel, Joern},
|
||||
year = {2020},
|
||||
pages = {7},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"dlr_sara_grid_clamp": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"paper": "https://www.researchsquare.com/article/rs-3289569/v1",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{padalkar2023guided,
|
||||
title={A guided reinforcement learning approach using shared control templates for learning manipulation skills in the real world},
|
||||
author={Padalkar, Abhishek and Quere, Gabriel and Raffin, Antonin and Silv{\'e}rio, Jo{\~a}o and Stulp, Freek},
|
||||
journal={Research square preprint rs-3289569/v1},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"dlr_sara_pour": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"paper": "https://elib.dlr.de/193739/1/padalkar2023rlsct.pdf",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{padalkar2023guiding,
|
||||
title={Guiding Reinforcement Learning with Shared Control Templates},
|
||||
author={Padalkar, Abhishek and Quere, Gabriel and Steinmetz, Franz and Raffin, Antonin and Nieuwenhuisen, Matthias and Silv{\'e}rio, Jo{\~a}o and Stulp, Freek},
|
||||
booktitle={40th IEEE International Conference on Robotics and Automation, ICRA 2023},
|
||||
year={2023},
|
||||
organization={IEEE}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"droid_100": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://droid-dataset.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2403.12945",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{khazatsky2024droid,
|
||||
title = {DROID: A Large-Scale In-The-Wild Robot Manipulation Dataset},
|
||||
author = {Alexander Khazatsky and Karl Pertsch and Suraj Nair and Ashwin Balakrishna and Sudeep Dasari and Siddharth Karamcheti and Soroush Nasiriany and Mohan Kumar Srirama and Lawrence Yunliang Chen and Kirsty Ellis and Peter David Fagan and Joey Hejna and Masha Itkina and Marion Lepert and Yecheng Jason Ma and Patrick Tree Miller and Jimmy Wu and Suneel Belkhale and Shivin Dass and Huy Ha and Arhan Jain and Abraham Lee and Youngwoon Lee and Marius Memmel and Sungjae Park and Ilija Radosavovic and Kaiyuan Wang and Albert Zhan and Kevin Black and Cheng Chi and Kyle Beltran Hatch and Shan Lin and Jingpei Lu and Jean Mercat and Abdul Rehman and Pannag R Sanketi and Archit Sharma and Cody Simpson and Quan Vuong and Homer Rich Walke and Blake Wulfe and Ted Xiao and Jonathan Heewon Yang and Arefeh Yavary and Tony Z. Zhao and Christopher Agia and Rohan Baijal and Mateo Guaman Castro and Daphne Chen and Qiuyu Chen and Trinity Chung and Jaimyn Drake and Ethan Paul Foster and Jensen Gao and David Antonio Herrera and Minho Heo and Kyle Hsu and Jiaheng Hu and Donovon Jackson and Charlotte Le and Yunshuang Li and Kevin Lin and Roy Lin and Zehan Ma and Abhiram Maddukuri and Suvir Mirchandani and Daniel Morton and Tony Nguyen and Abigail O'Neill and Rosario Scalise and Derick Seale and Victor Son and Stephen Tian and Emi Tran and Andrew E. Wang and Yilin Wu and Annie Xie and Jingyun Yang and Patrick Yin and Yunchu Zhang and Osbert Bastani and Glen Berseth and Jeannette Bohg and Ken Goldberg and Abhinav Gupta and Abhishek Gupta and Dinesh Jayaraman and Joseph J Lim and Jitendra Malik and Roberto Martín-Martín and Subramanian Ramamoorthy and Dorsa Sadigh and Shuran Song and Jiajun Wu and Michael C. Yip and Yuke Zhu and Thomas Kollar and Sergey Levine and Chelsea Finn},
|
||||
year = {2024},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"fmb": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "cc-by-4.0",
|
||||
"url": "https://functional-manipulation-benchmark.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2401.08553",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{luo2024fmb,
|
||||
title={FMB: a Functional Manipulation Benchmark for Generalizable Robotic Learning},
|
||||
author={Luo, Jianlan and Xu, Charles and Liu, Fangchen and Tan, Liam and Lin, Zipeng and Wu, Jeffrey and Abbeel, Pieter and Levine, Sergey},
|
||||
journal={arXiv preprint arXiv:2401.08553},
|
||||
year={2024}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"iamlab_cmu_pickup_insert": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://openreview.net/forum?id=WuBv9-IGDUA",
|
||||
"paper": "https://arxiv.org/abs/2401.14502",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{saxena2023multiresolution,
|
||||
title={Multi-Resolution Sensing for Real-Time Control with Vision-Language Models},
|
||||
author={Saumya Saxena and Mohit Sharma and Oliver Kroemer},
|
||||
booktitle={7th Annual Conference on Robot Learning},
|
||||
year={2023},
|
||||
url={https://openreview.net/forum?id=WuBv9-IGDUA}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"imperialcollege_sawyer_wrist_cam": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
},
|
||||
"jaco_play": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "cc-by-4.0",
|
||||
"url": "https://github.com/clvrai/clvr_jaco_play_dataset",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@software{dass2023jacoplay,
|
||||
author = {Dass, Shivin and Yapeter, Jullian and Zhang, Jesse and Zhang, Jiahui
|
||||
and Pertsch, Karl and Nikolaidis, Stefanos and Lim, Joseph J.},
|
||||
title = {CLVR Jaco Play Dataset},
|
||||
url = {https://github.com/clvrai/clvr_jaco_play_dataset},
|
||||
version = {1.0.0},
|
||||
year = {2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"kaist_nonprehensile": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "cc-by-4.0",
|
||||
"url": "https://github.com/JaeHyung-Kim/rlds_dataset_builder",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{kimpre,
|
||||
title={Pre-and post-contact policy decomposition for non-prehensile manipulation with zero-shot sim-to-real transfer},
|
||||
author={Kim, Minchan and Han, Junhyek and Kim, Jaehyung and Kim, Beomjoon},
|
||||
booktitle={2023 IEEE/RSJ International Conference on Intelligent Robots and Systems (IROS)},
|
||||
year={2023},
|
||||
organization={IEEE}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"nyu_door_opening_surprising_effectiveness": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://jyopari.github.io/VINN/",
|
||||
"paper": "https://arxiv.org/abs/2112.01511",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@misc{pari2021surprising,
|
||||
title={The Surprising Effectiveness of Representation Learning for Visual Imitation},
|
||||
author={Jyothish Pari and Nur Muhammad Shafiullah and Sridhar Pandian Arunachalam and Lerrel Pinto},
|
||||
year={2021},
|
||||
eprint={2112.01511},
|
||||
archivePrefix={arXiv},
|
||||
primaryClass={cs.RO}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"nyu_franka_play_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://play-to-policy.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2210.10047",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{cui2022play,
|
||||
title = {From Play to Policy: Conditional Behavior Generation from Uncurated Robot Data},
|
||||
author = {Cui, Zichen Jeff and Wang, Yibin and Shafiullah, Nur Muhammad Mahi and Pinto, Lerrel},
|
||||
journal = {arXiv preprint arXiv:2210.10047},
|
||||
year = {2022}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"nyu_rot_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://rot-robot.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2206.15469",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{haldar2023watch,
|
||||
title={Watch and match: Supercharging imitation with regularized optimal transport},
|
||||
author={Haldar, Siddhant and Mathur, Vaibhav and Yarats, Denis and Pinto, Lerrel},
|
||||
booktitle={Conference on Robot Learning},
|
||||
pages={32--43},
|
||||
year={2023},
|
||||
organization={PMLR}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"roboturk": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://roboturk.stanford.edu/dataset_real.html",
|
||||
"paper": "PAPER",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{mandlekar2019scaling,
|
||||
title={Scaling robot supervision to hundreds of hours with roboturk: Robotic manipulation dataset through human reasoning and dexterity},
|
||||
author={Mandlekar, Ajay and Booher, Jonathan and Spero, Max and Tung, Albert and Gupta, Anchit and Zhu, Yuke and Garg, Animesh and Savarese, Silvio and Fei-Fei, Li},
|
||||
booktitle={2019 IEEE/RSJ International Conference on Intelligent Robots and Systems (IROS)},
|
||||
pages={1048--1055},
|
||||
year={2019},
|
||||
organization={IEEE}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"stanford_hydra_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://sites.google.com/view/hydra-il-2023",
|
||||
"paper": "https://arxiv.org/abs/2306.17237",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{belkhale2023hydra,
|
||||
title={HYDRA: Hybrid Robot Actions for Imitation Learning},
|
||||
author={Belkhale, Suneel and Cui, Yuchen and Sadigh, Dorsa},
|
||||
journal={arxiv},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"stanford_kuka_multimodal_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://sites.google.com/view/visionandtouch",
|
||||
"paper": "https://arxiv.org/abs/1810.10191",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{lee2019icra,
|
||||
title={Making sense of vision and touch: Self-supervised learning of multimodal representations for contact-rich tasks},
|
||||
author={Lee, Michelle A and Zhu, Yuke and Srinivasan, Krishnan and Shah, Parth and Savarese, Silvio and Fei-Fei, Li and Garg, Animesh and Bohg, Jeannette},
|
||||
booktitle={2019 IEEE International Conference on Robotics and Automation (ICRA)},
|
||||
year={2019},
|
||||
url={https://arxiv.org/abs/1810.10191}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"stanford_robocook": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://hshi74.github.io/robocook/",
|
||||
"paper": "https://arxiv.org/abs/2306.14447",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{shi2023robocook,
|
||||
title={RoboCook: Long-Horizon Elasto-Plastic Object Manipulation with Diverse Tools},
|
||||
author={Shi, Haochen and Xu, Huazhe and Clarke, Samuel and Li, Yunzhu and Wu, Jiajun},
|
||||
journal={arXiv preprint arXiv:2306.14447},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"taco_play": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "cc-by-4.0",
|
||||
"url": "https://www.kaggle.com/datasets/oiermees/taco-robot",
|
||||
"paper": "https://arxiv.org/abs/2209.08959, https://arxiv.org/abs/2210.01911",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{rosete2022tacorl,
|
||||
author = {Erick Rosete-Beas and Oier Mees and Gabriel Kalweit and Joschka Boedecker and Wolfram Burgard},
|
||||
title = {Latent Plans for Task Agnostic Offline Reinforcement Learning},
|
||||
journal = {Proceedings of the 6th Conference on Robot Learning (CoRL)},
|
||||
year = {2022}
|
||||
}
|
||||
@inproceedings{mees23hulc2,
|
||||
title={Grounding Language with Visual Affordances over Unstructured Data},
|
||||
author={Oier Mees and Jessica Borja-Diaz and Wolfram Burgard},
|
||||
booktitle = {Proceedings of the IEEE International Conference on Robotics and Automation (ICRA)},
|
||||
year={2023},
|
||||
address = {London, UK}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"tokyo_u_lsmo": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "URL",
|
||||
"paper": "https://arxiv.org/abs/2107.05842",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@Article{Osa22,
|
||||
author = {Takayuki Osa},
|
||||
journal = {The International Journal of Robotics Research},
|
||||
title = {Motion Planning by Learning the Solution Manifold in Trajectory Optimization},
|
||||
year = {2022},
|
||||
number = {3},
|
||||
pages = {291--311},
|
||||
volume = {41},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"toto": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://toto-benchmark.org/",
|
||||
"paper": "https://arxiv.org/abs/2306.00942",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{zhou2023train,
|
||||
author={Zhou, Gaoyue and Dean, Victoria and Srirama, Mohan Kumar and Rajeswaran, Aravind and Pari, Jyothish and Hatch, Kyle and Jain, Aryan and Yu, Tianhe and Abbeel, Pieter and Pinto, Lerrel and Finn, Chelsea and Gupta, Abhinav},
|
||||
booktitle={2023 IEEE International Conference on Robotics and Automation (ICRA)},
|
||||
title={Train Offline, Test Online: A Real Robot Learning Benchmark},
|
||||
year={2023},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"ucsd_kitchen_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@ARTICLE{ucsd_kitchens,
|
||||
author = {Ge Yan, Kris Wu, and Xiaolong Wang},
|
||||
title = {{ucsd kitchens Dataset}},
|
||||
year = {2023},
|
||||
month = {August}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"ucsd_pick_and_place_dataset": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://owmcorl.github.io/#",
|
||||
"paper": "https://arxiv.org/abs/2310.16029",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@preprint{Feng2023Finetuning,
|
||||
title={Finetuning Offline World Models in the Real World},
|
||||
author={Yunhai Feng, Nicklas Hansen, Ziyan Xiong, Chandramouli Rajagopalan, Xiaolong Wang},
|
||||
year={2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"uiuc_d3field": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://robopil.github.io/d3fields/",
|
||||
"paper": "https://arxiv.org/abs/2309.16118",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{wang2023d3field,
|
||||
title={D^3Field: Dynamic 3D Descriptor Fields for Generalizable Robotic Manipulation},
|
||||
author={Wang, Yixuan and Li, Zhuoran and Zhang, Mingtong and Driggs-Campbell, Katherine and Wu, Jiajun and Fei-Fei, Li and Li, Yunzhu},
|
||||
journal={arXiv preprint arXiv:},
|
||||
year={2023},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"usc_cloth_sim": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://uscresl.github.io/dmfd/",
|
||||
"paper": "https://arxiv.org/abs/2207.10148",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{salhotra2022dmfd,
|
||||
author={Salhotra, Gautam and Liu, I-Chun Arthur and Dominguez-Kuhne, Marcus and Sukhatme, Gaurav S.},
|
||||
journal={IEEE Robotics and Automation Letters},
|
||||
title={Learning Deformable Object Manipulation From Expert Demonstrations},
|
||||
year={2022},
|
||||
volume={7},
|
||||
number={4},
|
||||
pages={8775-8782},
|
||||
doi={10.1109/LRA.2022.3187843}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"utaustin_mutex": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://ut-austin-rpl.github.io/MUTEX/",
|
||||
"paper": "https://arxiv.org/abs/2309.14320",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@inproceedings{shah2023mutex,
|
||||
title={{MUTEX}: Learning Unified Policies from Multimodal Task Specifications},
|
||||
author={Rutav Shah and Roberto Mart{\'\i}n-Mart{\'\i}n and Yuke Zhu},
|
||||
booktitle={7th Annual Conference on Robot Learning},
|
||||
year={2023},
|
||||
url={https://openreview.net/forum?id=PwqiqaaEzJ}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"utokyo_pr2_opening_fridge": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@misc{oh2023pr2utokyodatasets,
|
||||
author={Jihoon Oh and Naoaki Kanazawa and Kento Kawaharazuka},
|
||||
title={X-Embodiment U-Tokyo PR2 Datasets},
|
||||
year={2023},
|
||||
url={https://github.com/ojh6404/rlds_dataset_builder},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"utokyo_pr2_tabletop_manipulation": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@misc{oh2023pr2utokyodatasets,
|
||||
author={Jihoon Oh and Naoaki Kanazawa and Kento Kawaharazuka},
|
||||
title={X-Embodiment U-Tokyo PR2 Datasets},
|
||||
year={2023},
|
||||
url={https://github.com/ojh6404/rlds_dataset_builder},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"utokyo_saytap": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://saytap.github.io/",
|
||||
"paper": "https://arxiv.org/abs/2306.07580",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{saytap2023,
|
||||
author = {Yujin Tang and Wenhao Yu and Jie Tan and Heiga Zen and Aleksandra Faust and
|
||||
Tatsuya Harada},
|
||||
title = {SayTap: Language to Quadrupedal Locomotion},
|
||||
eprint = {arXiv:2306.07580},
|
||||
url = {https://saytap.github.io},
|
||||
note = {https://saytap.github.io},
|
||||
year = {2023}
|
||||
}""").lstrip(),
|
||||
},
|
||||
"utokyo_xarm_bimanual": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "cc-by-4.0",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@misc{matsushima2023weblab,
|
||||
title={Weblab xArm Dataset},
|
||||
author={Tatsuya Matsushima and Hiroki Furuta and Yusuke Iwasawa and Yutaka Matsuo},
|
||||
year={2023},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"utokyo_xarm_pick_and_place": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "cc-by-4.0",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@misc{matsushima2023weblab,
|
||||
title={Weblab xArm Dataset},
|
||||
author={Tatsuya Matsushima and Hiroki Furuta and Yusuke Iwasawa and Yutaka Matsuo},
|
||||
year={2023},
|
||||
}""").lstrip(),
|
||||
},
|
||||
"viola": {
|
||||
"tasks_col": "language_instruction",
|
||||
"license": "mit",
|
||||
"url": "https://ut-austin-rpl.github.io/VIOLA/",
|
||||
"paper": "https://arxiv.org/abs/2210.11339",
|
||||
"citation_bibtex": dedent(r"""
|
||||
@article{zhu2022viola,
|
||||
title={VIOLA: Imitation Learning for Vision-Based Manipulation with Object Proposal Priors},
|
||||
author={Zhu, Yifeng and Joshi, Abhishek and Stone, Peter and Zhu, Yuke},
|
||||
journal={6th Annual Conference on Robot Learning (CoRL)},
|
||||
year={2022}
|
||||
}""").lstrip(),
|
||||
},
|
||||
}
|
||||
|
||||
|
||||
def batch_convert():
|
||||
status = {}
|
||||
logfile = LOCAL_DIR / "conversion_log.txt"
|
||||
assert set(DATASETS) == {id_.split("/")[1] for id_ in available_datasets}
|
||||
for num, (name, kwargs) in enumerate(DATASETS.items()):
|
||||
repo_id = f"lerobot/{name}"
|
||||
print(f"\nConverting {repo_id} ({num}/{len(DATASETS)})")
|
||||
print("---------------------------------------------------------")
|
||||
try:
|
||||
convert_dataset(repo_id, LOCAL_DIR, **kwargs)
|
||||
status = f"{repo_id}: success."
|
||||
with open(logfile, "a") as file:
|
||||
file.write(status + "\n")
|
||||
except Exception:
|
||||
status = f"{repo_id}: failed\n {traceback.format_exc()}"
|
||||
with open(logfile, "a") as file:
|
||||
file.write(status + "\n")
|
||||
continue
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
batch_convert()
|
||||
774
lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py
Normal file
774
lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py
Normal file
@@ -0,0 +1,774 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
"""
|
||||
This script will help you convert any LeRobot dataset already pushed to the hub from codebase version 1.6 to
|
||||
2.0. You will be required to provide the 'tasks', which is a short but accurate description in plain English
|
||||
for each of the task performed in the dataset. This will allow to easily train models with task-conditionning.
|
||||
|
||||
We support 3 different scenarios for these tasks (see instructions below):
|
||||
1. Single task dataset: all episodes of your dataset have the same single task.
|
||||
2. Single task episodes: the episodes of your dataset each contain a single task but they can differ from
|
||||
one episode to the next.
|
||||
3. Multi task episodes: episodes of your dataset may each contain several different tasks.
|
||||
|
||||
|
||||
Can you can also provide a robot config .yaml file (not mandatory) to this script via the option
|
||||
'--robot-config' so that it writes information about the robot (robot type, motors names) this dataset was
|
||||
recorded with. For now, only Aloha/Koch type robots are supported with this option.
|
||||
|
||||
|
||||
# 1. Single task dataset
|
||||
If your dataset contains a single task, you can simply provide it directly via the CLI with the
|
||||
'--single-task' option.
|
||||
|
||||
Examples:
|
||||
|
||||
```bash
|
||||
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||
--repo-id lerobot/aloha_sim_insertion_human_image \
|
||||
--single-task "Insert the peg into the socket." \
|
||||
--robot-config lerobot/configs/robot/aloha.yaml \
|
||||
--local-dir data
|
||||
```
|
||||
|
||||
```bash
|
||||
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||
--repo-id aliberts/koch_tutorial \
|
||||
--single-task "Pick the Lego block and drop it in the box on the right." \
|
||||
--robot-config lerobot/configs/robot/koch.yaml \
|
||||
--local-dir data
|
||||
```
|
||||
|
||||
|
||||
# 2. Single task episodes
|
||||
If your dataset is a multi-task dataset, you have two options to provide the tasks to this script:
|
||||
|
||||
- If your dataset already contains a language instruction column in its parquet file, you can simply provide
|
||||
this column's name with the '--tasks-col' arg.
|
||||
|
||||
Example:
|
||||
|
||||
```bash
|
||||
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||
--repo-id lerobot/stanford_kuka_multimodal_dataset \
|
||||
--tasks-col "language_instruction" \
|
||||
--local-dir data
|
||||
```
|
||||
|
||||
- If your dataset doesn't contain a language instruction, you should provide the path to a .json file with the
|
||||
'--tasks-path' arg. This file should have the following structure where keys correspond to each
|
||||
episode_index in the dataset, and values are the language instruction for that episode.
|
||||
|
||||
Example:
|
||||
|
||||
```json
|
||||
{
|
||||
"0": "Do something",
|
||||
"1": "Do something else",
|
||||
"2": "Do something",
|
||||
"3": "Go there",
|
||||
...
|
||||
}
|
||||
```
|
||||
|
||||
# 3. Multi task episodes
|
||||
If you have multiple tasks per episodes, your dataset should contain a language instruction column in its
|
||||
parquet file, and you must provide this column's name with the '--tasks-col' arg.
|
||||
|
||||
Example:
|
||||
|
||||
```bash
|
||||
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||
--repo-id lerobot/stanford_kuka_multimodal_dataset \
|
||||
--tasks-col "language_instruction" \
|
||||
--local-dir data
|
||||
```
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import contextlib
|
||||
import filecmp
|
||||
import json
|
||||
import logging
|
||||
import math
|
||||
import shutil
|
||||
import subprocess
|
||||
import tempfile
|
||||
from pathlib import Path
|
||||
|
||||
import datasets
|
||||
import pyarrow.compute as pc
|
||||
import pyarrow.parquet as pq
|
||||
import torch
|
||||
from datasets import Dataset
|
||||
from huggingface_hub import HfApi
|
||||
from huggingface_hub.errors import EntryNotFoundError, HfHubHTTPError
|
||||
from safetensors.torch import load_file
|
||||
|
||||
from lerobot.common.datasets.utils import (
|
||||
DEFAULT_CHUNK_SIZE,
|
||||
DEFAULT_PARQUET_PATH,
|
||||
DEFAULT_VIDEO_PATH,
|
||||
EPISODES_PATH,
|
||||
INFO_PATH,
|
||||
STATS_PATH,
|
||||
TASKS_PATH,
|
||||
create_branch,
|
||||
create_lerobot_dataset_card,
|
||||
flatten_dict,
|
||||
get_hub_safe_version,
|
||||
load_json,
|
||||
unflatten_dict,
|
||||
write_json,
|
||||
write_jsonlines,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import (
|
||||
VideoFrame, # noqa: F401
|
||||
get_image_pixel_channels,
|
||||
get_video_info,
|
||||
)
|
||||
from lerobot.common.utils.utils import init_hydra_config
|
||||
|
||||
V16 = "v1.6"
|
||||
V20 = "v2.0"
|
||||
|
||||
GITATTRIBUTES_REF = "aliberts/gitattributes_reference"
|
||||
V1_VIDEO_FILE = "{video_key}_episode_{episode_index:06d}.mp4"
|
||||
V1_INFO_PATH = "meta_data/info.json"
|
||||
V1_STATS_PATH = "meta_data/stats.safetensors"
|
||||
|
||||
|
||||
def parse_robot_config(
|
||||
config_path: Path, config_overrides: list[str] | None = None
|
||||
) -> tuple[str, dict]:
|
||||
robot_cfg = init_hydra_config(config_path, config_overrides)
|
||||
if robot_cfg["robot_type"] in ["aloha", "koch"]:
|
||||
state_names = [
|
||||
f"{arm}_{motor}" if len(robot_cfg["follower_arms"]) > 1 else motor
|
||||
for arm in robot_cfg["follower_arms"]
|
||||
for motor in robot_cfg["follower_arms"][arm]["motors"]
|
||||
]
|
||||
action_names = [
|
||||
# f"{arm}_{motor}" for arm in ["left", "right"] for motor in robot_cfg["leader_arms"][arm]["motors"]
|
||||
f"{arm}_{motor}" if len(robot_cfg["leader_arms"]) > 1 else motor
|
||||
for arm in robot_cfg["leader_arms"]
|
||||
for motor in robot_cfg["leader_arms"][arm]["motors"]
|
||||
]
|
||||
# elif robot_cfg["robot_type"] == "stretch3": TODO
|
||||
else:
|
||||
raise NotImplementedError(
|
||||
"Please provide robot_config={'robot_type': ..., 'names': ...} directly to convert_dataset()."
|
||||
)
|
||||
|
||||
return {
|
||||
"robot_type": robot_cfg["robot_type"],
|
||||
"names": {
|
||||
"observation.state": state_names,
|
||||
"observation.effort": state_names,
|
||||
"action": action_names,
|
||||
},
|
||||
}
|
||||
|
||||
|
||||
def convert_stats_to_json(v1_dir: Path, v2_dir: Path) -> None:
|
||||
safetensor_path = v1_dir / V1_STATS_PATH
|
||||
stats = load_file(safetensor_path)
|
||||
serialized_stats = {key: value.tolist() for key, value in stats.items()}
|
||||
serialized_stats = unflatten_dict(serialized_stats)
|
||||
|
||||
json_path = v2_dir / STATS_PATH
|
||||
json_path.parent.mkdir(exist_ok=True, parents=True)
|
||||
with open(json_path, "w") as f:
|
||||
json.dump(serialized_stats, f, indent=4)
|
||||
|
||||
# Sanity check
|
||||
with open(json_path) as f:
|
||||
stats_json = json.load(f)
|
||||
|
||||
stats_json = flatten_dict(stats_json)
|
||||
stats_json = {key: torch.tensor(value) for key, value in stats_json.items()}
|
||||
for key in stats:
|
||||
torch.testing.assert_close(stats_json[key], stats[key])
|
||||
|
||||
|
||||
def get_features_from_hf_dataset(
|
||||
dataset: Dataset, robot_config: dict | None = None
|
||||
) -> dict[str, list]:
|
||||
features = {}
|
||||
for key, ft in dataset.features.items():
|
||||
if isinstance(ft, datasets.Value):
|
||||
dtype = ft.dtype
|
||||
shape = (1,)
|
||||
names = None
|
||||
if isinstance(ft, datasets.Sequence):
|
||||
assert isinstance(ft.feature, datasets.Value)
|
||||
dtype = ft.feature.dtype
|
||||
shape = (ft.length,)
|
||||
motor_names = (
|
||||
robot_config["names"][key]
|
||||
if robot_config
|
||||
else [f"motor_{i}" for i in range(ft.length)]
|
||||
)
|
||||
assert len(motor_names) == shape[0]
|
||||
names = {"motors": motor_names}
|
||||
elif isinstance(ft, datasets.Image):
|
||||
dtype = "image"
|
||||
image = dataset[0][key] # Assuming first row
|
||||
channels = get_image_pixel_channels(image)
|
||||
shape = (image.height, image.width, channels)
|
||||
names = ["height", "width", "channel"]
|
||||
elif ft._type == "VideoFrame":
|
||||
dtype = "video"
|
||||
shape = None # Add shape later
|
||||
names = ["height", "width", "channel"]
|
||||
|
||||
features[key] = {
|
||||
"dtype": dtype,
|
||||
"shape": shape,
|
||||
"names": names,
|
||||
}
|
||||
|
||||
return features
|
||||
|
||||
|
||||
def add_task_index_by_episodes(
|
||||
dataset: Dataset, tasks_by_episodes: dict
|
||||
) -> tuple[Dataset, list[str]]:
|
||||
df = dataset.to_pandas()
|
||||
tasks = list(set(tasks_by_episodes.values()))
|
||||
tasks_to_task_index = {task: task_idx for task_idx, task in enumerate(tasks)}
|
||||
episodes_to_task_index = {
|
||||
ep_idx: tasks_to_task_index[task] for ep_idx, task in tasks_by_episodes.items()
|
||||
}
|
||||
df["task_index"] = df["episode_index"].map(episodes_to_task_index).astype(int)
|
||||
|
||||
features = dataset.features
|
||||
features["task_index"] = datasets.Value(dtype="int64")
|
||||
dataset = Dataset.from_pandas(df, features=features, split="train")
|
||||
return dataset, tasks
|
||||
|
||||
|
||||
def add_task_index_from_tasks_col(
|
||||
dataset: Dataset, tasks_col: str
|
||||
) -> tuple[Dataset, dict[str, list[str]], list[str]]:
|
||||
df = dataset.to_pandas()
|
||||
|
||||
# HACK: This is to clean some of the instructions in our version of Open X datasets
|
||||
prefix_to_clean = "tf.Tensor(b'"
|
||||
suffix_to_clean = "', shape=(), dtype=string)"
|
||||
df[tasks_col] = (
|
||||
df[tasks_col]
|
||||
.str.removeprefix(prefix_to_clean)
|
||||
.str.removesuffix(suffix_to_clean)
|
||||
)
|
||||
|
||||
# Create task_index col
|
||||
tasks_by_episode = (
|
||||
df.groupby("episode_index")[tasks_col]
|
||||
.unique()
|
||||
.apply(lambda x: x.tolist())
|
||||
.to_dict()
|
||||
)
|
||||
tasks = df[tasks_col].unique().tolist()
|
||||
tasks_to_task_index = {task: idx for idx, task in enumerate(tasks)}
|
||||
df["task_index"] = df[tasks_col].map(tasks_to_task_index).astype(int)
|
||||
|
||||
# Build the dataset back from df
|
||||
features = dataset.features
|
||||
features["task_index"] = datasets.Value(dtype="int64")
|
||||
dataset = Dataset.from_pandas(df, features=features, split="train")
|
||||
dataset = dataset.remove_columns(tasks_col)
|
||||
|
||||
return dataset, tasks, tasks_by_episode
|
||||
|
||||
|
||||
def split_parquet_by_episodes(
|
||||
dataset: Dataset,
|
||||
total_episodes: int,
|
||||
total_chunks: int,
|
||||
output_dir: Path,
|
||||
) -> list:
|
||||
table = dataset.data.table
|
||||
episode_lengths = []
|
||||
for ep_chunk in range(total_chunks):
|
||||
ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
|
||||
ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
|
||||
chunk_dir = "/".join(DEFAULT_PARQUET_PATH.split("/")[:-1]).format(
|
||||
episode_chunk=ep_chunk
|
||||
)
|
||||
(output_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
|
||||
for ep_idx in range(ep_chunk_start, ep_chunk_end):
|
||||
ep_table = table.filter(pc.equal(table["episode_index"], ep_idx))
|
||||
episode_lengths.insert(ep_idx, len(ep_table))
|
||||
output_file = output_dir / DEFAULT_PARQUET_PATH.format(
|
||||
episode_chunk=ep_chunk, episode_index=ep_idx
|
||||
)
|
||||
pq.write_table(ep_table, output_file)
|
||||
|
||||
return episode_lengths
|
||||
|
||||
|
||||
def move_videos(
|
||||
repo_id: str,
|
||||
video_keys: list[str],
|
||||
total_episodes: int,
|
||||
total_chunks: int,
|
||||
work_dir: Path,
|
||||
clean_gittatributes: Path,
|
||||
branch: str = "main",
|
||||
) -> None:
|
||||
"""
|
||||
HACK: Since HfApi() doesn't provide a way to move files directly in a repo, this function will run git
|
||||
commands to fetch git lfs video files references to move them into subdirectories without having to
|
||||
actually download them.
|
||||
"""
|
||||
_lfs_clone(repo_id, work_dir, branch)
|
||||
|
||||
videos_moved = False
|
||||
video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*.mp4")]
|
||||
if len(video_files) == 0:
|
||||
video_files = [
|
||||
str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*/*/*.mp4")
|
||||
]
|
||||
videos_moved = True # Videos have already been moved
|
||||
|
||||
assert len(video_files) == total_episodes * len(video_keys)
|
||||
|
||||
lfs_untracked_videos = _get_lfs_untracked_videos(work_dir, video_files)
|
||||
|
||||
current_gittatributes = work_dir / ".gitattributes"
|
||||
if not filecmp.cmp(current_gittatributes, clean_gittatributes, shallow=False):
|
||||
fix_gitattributes(work_dir, current_gittatributes, clean_gittatributes)
|
||||
|
||||
if lfs_untracked_videos:
|
||||
fix_lfs_video_files_tracking(work_dir, video_files)
|
||||
|
||||
if videos_moved:
|
||||
return
|
||||
|
||||
video_dirs = sorted(work_dir.glob("videos*/"))
|
||||
for ep_chunk in range(total_chunks):
|
||||
ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
|
||||
ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
|
||||
for vid_key in video_keys:
|
||||
chunk_dir = "/".join(DEFAULT_VIDEO_PATH.split("/")[:-1]).format(
|
||||
episode_chunk=ep_chunk, video_key=vid_key
|
||||
)
|
||||
(work_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
|
||||
|
||||
for ep_idx in range(ep_chunk_start, ep_chunk_end):
|
||||
target_path = DEFAULT_VIDEO_PATH.format(
|
||||
episode_chunk=ep_chunk, video_key=vid_key, episode_index=ep_idx
|
||||
)
|
||||
video_file = V1_VIDEO_FILE.format(
|
||||
video_key=vid_key, episode_index=ep_idx
|
||||
)
|
||||
if len(video_dirs) == 1:
|
||||
video_path = video_dirs[0] / video_file
|
||||
else:
|
||||
for dir in video_dirs:
|
||||
if (dir / video_file).is_file():
|
||||
video_path = dir / video_file
|
||||
break
|
||||
|
||||
video_path.rename(work_dir / target_path)
|
||||
|
||||
commit_message = "Move video files into chunk subdirectories"
|
||||
subprocess.run(["git", "add", "."], cwd=work_dir, check=True)
|
||||
subprocess.run(["git", "commit", "-m", commit_message], cwd=work_dir, check=True)
|
||||
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||
|
||||
|
||||
def fix_lfs_video_files_tracking(
|
||||
work_dir: Path, lfs_untracked_videos: list[str]
|
||||
) -> None:
|
||||
"""
|
||||
HACK: This function fixes the tracking by git lfs which was not properly set on some repos. In that case,
|
||||
there's no other option than to download the actual files and reupload them with lfs tracking.
|
||||
"""
|
||||
for i in range(0, len(lfs_untracked_videos), 100):
|
||||
files = lfs_untracked_videos[i : i + 100]
|
||||
try:
|
||||
subprocess.run(
|
||||
["git", "rm", "--cached", *files],
|
||||
cwd=work_dir,
|
||||
capture_output=True,
|
||||
check=True,
|
||||
)
|
||||
except subprocess.CalledProcessError as e:
|
||||
print("git rm --cached ERROR:")
|
||||
print(e.stderr)
|
||||
subprocess.run(["git", "add", *files], cwd=work_dir, check=True)
|
||||
|
||||
commit_message = "Track video files with git lfs"
|
||||
subprocess.run(["git", "commit", "-m", commit_message], cwd=work_dir, check=True)
|
||||
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||
|
||||
|
||||
def fix_gitattributes(
|
||||
work_dir: Path, current_gittatributes: Path, clean_gittatributes: Path
|
||||
) -> None:
|
||||
shutil.copyfile(clean_gittatributes, current_gittatributes)
|
||||
subprocess.run(["git", "add", ".gitattributes"], cwd=work_dir, check=True)
|
||||
subprocess.run(
|
||||
["git", "commit", "-m", "Fix .gitattributes"], cwd=work_dir, check=True
|
||||
)
|
||||
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||
|
||||
|
||||
def _lfs_clone(repo_id: str, work_dir: Path, branch: str) -> None:
|
||||
subprocess.run(["git", "lfs", "install"], cwd=work_dir, check=True)
|
||||
repo_url = f"https://huggingface.co/datasets/{repo_id}"
|
||||
env = {"GIT_LFS_SKIP_SMUDGE": "1"} # Prevent downloading LFS files
|
||||
subprocess.run(
|
||||
[
|
||||
"git",
|
||||
"clone",
|
||||
"--branch",
|
||||
branch,
|
||||
"--single-branch",
|
||||
"--depth",
|
||||
"1",
|
||||
repo_url,
|
||||
str(work_dir),
|
||||
],
|
||||
check=True,
|
||||
env=env,
|
||||
)
|
||||
|
||||
|
||||
def _get_lfs_untracked_videos(work_dir: Path, video_files: list[str]) -> list[str]:
|
||||
lfs_tracked_files = subprocess.run(
|
||||
["git", "lfs", "ls-files", "-n"],
|
||||
cwd=work_dir,
|
||||
capture_output=True,
|
||||
text=True,
|
||||
check=True,
|
||||
)
|
||||
lfs_tracked_files = set(lfs_tracked_files.stdout.splitlines())
|
||||
return [f for f in video_files if f not in lfs_tracked_files]
|
||||
|
||||
|
||||
def get_videos_info(
|
||||
repo_id: str, local_dir: Path, video_keys: list[str], branch: str
|
||||
) -> dict:
|
||||
# Assumes first episode
|
||||
video_files = [
|
||||
DEFAULT_VIDEO_PATH.format(episode_chunk=0, video_key=vid_key, episode_index=0)
|
||||
for vid_key in video_keys
|
||||
]
|
||||
hub_api = HfApi()
|
||||
hub_api.snapshot_download(
|
||||
repo_id=repo_id,
|
||||
repo_type="dataset",
|
||||
local_dir=local_dir,
|
||||
revision=branch,
|
||||
allow_patterns=video_files,
|
||||
)
|
||||
videos_info_dict = {}
|
||||
for vid_key, vid_path in zip(video_keys, video_files, strict=True):
|
||||
videos_info_dict[vid_key] = get_video_info(local_dir / vid_path)
|
||||
|
||||
return videos_info_dict
|
||||
|
||||
|
||||
def convert_dataset(
|
||||
repo_id: str,
|
||||
local_dir: Path,
|
||||
single_task: str | None = None,
|
||||
tasks_path: Path | None = None,
|
||||
tasks_col: Path | None = None,
|
||||
robot_config: dict | None = None,
|
||||
test_branch: str | None = None,
|
||||
**card_kwargs,
|
||||
):
|
||||
v1 = get_hub_safe_version(repo_id, V16)
|
||||
v1x_dir = local_dir / V16 / repo_id
|
||||
v20_dir = local_dir / V20 / repo_id
|
||||
v1x_dir.mkdir(parents=True, exist_ok=True)
|
||||
v20_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
hub_api = HfApi()
|
||||
hub_api.snapshot_download(
|
||||
repo_id=repo_id,
|
||||
repo_type="dataset",
|
||||
revision=v1,
|
||||
local_dir=v1x_dir,
|
||||
ignore_patterns="videos*/",
|
||||
)
|
||||
branch = "main"
|
||||
if test_branch:
|
||||
branch = test_branch
|
||||
create_branch(repo_id=repo_id, branch=test_branch, repo_type="dataset")
|
||||
|
||||
metadata_v1 = load_json(v1x_dir / V1_INFO_PATH)
|
||||
dataset = datasets.load_dataset("parquet", data_dir=v1x_dir / "data", split="train")
|
||||
features = get_features_from_hf_dataset(dataset, robot_config)
|
||||
video_keys = [key for key, ft in features.items() if ft["dtype"] == "video"]
|
||||
|
||||
if single_task and "language_instruction" in dataset.column_names:
|
||||
logging.warning(
|
||||
"'single_task' provided but 'language_instruction' tasks_col found. Using 'language_instruction'.",
|
||||
)
|
||||
single_task = None
|
||||
tasks_col = "language_instruction"
|
||||
|
||||
# Episodes & chunks
|
||||
episode_indices = sorted(dataset.unique("episode_index"))
|
||||
total_episodes = len(episode_indices)
|
||||
assert episode_indices == list(range(total_episodes))
|
||||
total_videos = total_episodes * len(video_keys)
|
||||
total_chunks = total_episodes // DEFAULT_CHUNK_SIZE
|
||||
if total_episodes % DEFAULT_CHUNK_SIZE != 0:
|
||||
total_chunks += 1
|
||||
|
||||
# Tasks
|
||||
if single_task:
|
||||
tasks_by_episodes = {ep_idx: single_task for ep_idx in episode_indices}
|
||||
dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
|
||||
tasks_by_episodes = {
|
||||
ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()
|
||||
}
|
||||
elif tasks_path:
|
||||
tasks_by_episodes = load_json(tasks_path)
|
||||
tasks_by_episodes = {
|
||||
int(ep_idx): task for ep_idx, task in tasks_by_episodes.items()
|
||||
}
|
||||
dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
|
||||
tasks_by_episodes = {
|
||||
ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()
|
||||
}
|
||||
elif tasks_col:
|
||||
dataset, tasks, tasks_by_episodes = add_task_index_from_tasks_col(
|
||||
dataset, tasks_col
|
||||
)
|
||||
else:
|
||||
raise ValueError
|
||||
|
||||
assert set(tasks) == {
|
||||
task for ep_tasks in tasks_by_episodes.values() for task in ep_tasks
|
||||
}
|
||||
tasks = [
|
||||
{"task_index": task_idx, "task": task} for task_idx, task in enumerate(tasks)
|
||||
]
|
||||
write_jsonlines(tasks, v20_dir / TASKS_PATH)
|
||||
features["task_index"] = {
|
||||
"dtype": "int64",
|
||||
"shape": (1,),
|
||||
"names": None,
|
||||
}
|
||||
|
||||
# Videos
|
||||
if video_keys:
|
||||
assert metadata_v1.get("video", False)
|
||||
dataset = dataset.remove_columns(video_keys)
|
||||
clean_gitattr = Path(
|
||||
hub_api.hf_hub_download(
|
||||
repo_id=GITATTRIBUTES_REF,
|
||||
repo_type="dataset",
|
||||
local_dir=local_dir,
|
||||
filename=".gitattributes",
|
||||
)
|
||||
).absolute()
|
||||
with tempfile.TemporaryDirectory() as tmp_video_dir:
|
||||
move_videos(
|
||||
repo_id,
|
||||
video_keys,
|
||||
total_episodes,
|
||||
total_chunks,
|
||||
Path(tmp_video_dir),
|
||||
clean_gitattr,
|
||||
branch,
|
||||
)
|
||||
videos_info = get_videos_info(
|
||||
repo_id, v1x_dir, video_keys=video_keys, branch=branch
|
||||
)
|
||||
for key in video_keys:
|
||||
features[key]["shape"] = (
|
||||
videos_info[key].pop("video.height"),
|
||||
videos_info[key].pop("video.width"),
|
||||
videos_info[key].pop("video.channels"),
|
||||
)
|
||||
features[key]["video_info"] = videos_info[key]
|
||||
assert math.isclose(
|
||||
videos_info[key]["video.fps"], metadata_v1["fps"], rel_tol=1e-3
|
||||
)
|
||||
if "encoding" in metadata_v1:
|
||||
assert (
|
||||
videos_info[key]["video.pix_fmt"]
|
||||
== metadata_v1["encoding"]["pix_fmt"]
|
||||
)
|
||||
else:
|
||||
assert metadata_v1.get("video", 0) == 0
|
||||
videos_info = None
|
||||
|
||||
# Split data into 1 parquet file by episode
|
||||
episode_lengths = split_parquet_by_episodes(
|
||||
dataset, total_episodes, total_chunks, v20_dir
|
||||
)
|
||||
|
||||
if robot_config is not None:
|
||||
robot_type = robot_config["robot_type"]
|
||||
repo_tags = [robot_type]
|
||||
else:
|
||||
robot_type = "unknown"
|
||||
repo_tags = None
|
||||
|
||||
# Episodes
|
||||
episodes = [
|
||||
{
|
||||
"episode_index": ep_idx,
|
||||
"tasks": tasks_by_episodes[ep_idx],
|
||||
"length": episode_lengths[ep_idx],
|
||||
}
|
||||
for ep_idx in episode_indices
|
||||
]
|
||||
write_jsonlines(episodes, v20_dir / EPISODES_PATH)
|
||||
|
||||
# Assemble metadata v2.0
|
||||
metadata_v2_0 = {
|
||||
"codebase_version": V20,
|
||||
"robot_type": robot_type,
|
||||
"total_episodes": total_episodes,
|
||||
"total_frames": len(dataset),
|
||||
"total_tasks": len(tasks),
|
||||
"total_videos": total_videos,
|
||||
"total_chunks": total_chunks,
|
||||
"chunks_size": DEFAULT_CHUNK_SIZE,
|
||||
"fps": metadata_v1["fps"],
|
||||
"splits": {"train": f"0:{total_episodes}"},
|
||||
"data_path": DEFAULT_PARQUET_PATH,
|
||||
"video_path": DEFAULT_VIDEO_PATH if video_keys else None,
|
||||
"features": features,
|
||||
}
|
||||
write_json(metadata_v2_0, v20_dir / INFO_PATH)
|
||||
convert_stats_to_json(v1x_dir, v20_dir)
|
||||
card = create_lerobot_dataset_card(
|
||||
tags=repo_tags, dataset_info=metadata_v2_0, **card_kwargs
|
||||
)
|
||||
|
||||
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||
hub_api.delete_folder(
|
||||
repo_id=repo_id, path_in_repo="data", repo_type="dataset", revision=branch
|
||||
)
|
||||
|
||||
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||
hub_api.delete_folder(
|
||||
repo_id=repo_id,
|
||||
path_in_repo="meta_data",
|
||||
repo_type="dataset",
|
||||
revision=branch,
|
||||
)
|
||||
|
||||
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||
hub_api.delete_folder(
|
||||
repo_id=repo_id, path_in_repo="meta", repo_type="dataset", revision=branch
|
||||
)
|
||||
|
||||
hub_api.upload_folder(
|
||||
repo_id=repo_id,
|
||||
path_in_repo="data",
|
||||
folder_path=v20_dir / "data",
|
||||
repo_type="dataset",
|
||||
revision=branch,
|
||||
)
|
||||
hub_api.upload_folder(
|
||||
repo_id=repo_id,
|
||||
path_in_repo="meta",
|
||||
folder_path=v20_dir / "meta",
|
||||
repo_type="dataset",
|
||||
revision=branch,
|
||||
)
|
||||
|
||||
card.push_to_hub(repo_id=repo_id, repo_type="dataset", revision=branch)
|
||||
|
||||
if not test_branch:
|
||||
create_branch(repo_id=repo_id, branch=V20, repo_type="dataset")
|
||||
|
||||
|
||||
def main():
|
||||
parser = argparse.ArgumentParser()
|
||||
task_args = parser.add_mutually_exclusive_group(required=True)
|
||||
|
||||
parser.add_argument(
|
||||
"--repo-id",
|
||||
type=str,
|
||||
required=True,
|
||||
help="Repository identifier on Hugging Face: a community or a user name `/` the name of the dataset (e.g. `lerobot/pusht`, `cadene/aloha_sim_insertion_human`).",
|
||||
)
|
||||
task_args.add_argument(
|
||||
"--single-task",
|
||||
type=str,
|
||||
help="A short but accurate description of the single task performed in the dataset.",
|
||||
)
|
||||
task_args.add_argument(
|
||||
"--tasks-col",
|
||||
type=str,
|
||||
help="The name of the column containing language instructions",
|
||||
)
|
||||
task_args.add_argument(
|
||||
"--tasks-path",
|
||||
type=Path,
|
||||
help="The path to a .json file containing one language instruction for each episode_index",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--robot-config",
|
||||
type=Path,
|
||||
default=None,
|
||||
help="Path to the robot's config yaml the dataset during conversion.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--robot-overrides",
|
||||
type=str,
|
||||
nargs="*",
|
||||
help="Any key=value arguments to override the robot config values (use dots for.nested=overrides)",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--local-dir",
|
||||
type=Path,
|
||||
default=None,
|
||||
help="Local directory to store the dataset during conversion. Defaults to /tmp/lerobot_dataset_v2",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--license",
|
||||
type=str,
|
||||
default="apache-2.0",
|
||||
help="Repo license. Must be one of https://huggingface.co/docs/hub/repositories-licenses. Defaults to mit.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--test-branch",
|
||||
type=str,
|
||||
default=None,
|
||||
help="Repo branch to test your conversion first (e.g. 'v2.0.test')",
|
||||
)
|
||||
|
||||
args = parser.parse_args()
|
||||
if not args.local_dir:
|
||||
args.local_dir = Path("/tmp/lerobot_dataset_v2")
|
||||
|
||||
robot_config = (
|
||||
parse_robot_config(args.robot_config, args.robot_overrides)
|
||||
if args.robot_config
|
||||
else None
|
||||
)
|
||||
del args.robot_config, args.robot_overrides
|
||||
|
||||
convert_dataset(**vars(args), robot_config=robot_config)
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
main()
|
||||
@@ -13,9 +13,11 @@
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import json
|
||||
import logging
|
||||
import subprocess
|
||||
import warnings
|
||||
from collections import OrderedDict
|
||||
from dataclasses import dataclass, field
|
||||
from pathlib import Path
|
||||
from typing import Any, ClassVar
|
||||
@@ -24,50 +26,29 @@ import pyarrow as pa
|
||||
import torch
|
||||
import torchvision
|
||||
from datasets.features.features import register_feature
|
||||
|
||||
|
||||
def load_from_videos(
|
||||
item: dict[str, torch.Tensor], video_frame_keys: list[str], videos_dir: Path, tolerance_s: float
|
||||
):
|
||||
"""Note: When using data workers (e.g. DataLoader with num_workers>0), do not call this function
|
||||
in the main process (e.g. by using a second Dataloader with num_workers=0). It will result in a Segmentation Fault.
|
||||
This probably happens because a memory reference to the video loader is created in the main process and a
|
||||
subprocess fails to access it.
|
||||
"""
|
||||
# since video path already contains "videos" (e.g. videos_dir="data/videos", path="videos/episode_0.mp4")
|
||||
data_dir = videos_dir.parent
|
||||
|
||||
for key in video_frame_keys:
|
||||
if isinstance(item[key], list):
|
||||
# load multiple frames at once (expected when delta_timestamps is not None)
|
||||
timestamps = [frame["timestamp"] for frame in item[key]]
|
||||
paths = [frame["path"] for frame in item[key]]
|
||||
if len(set(paths)) > 1:
|
||||
raise NotImplementedError("All video paths are expected to be the same for now.")
|
||||
video_path = data_dir / paths[0]
|
||||
|
||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s)
|
||||
item[key] = frames
|
||||
else:
|
||||
# load one frame
|
||||
timestamps = [item[key]["timestamp"]]
|
||||
video_path = data_dir / item[key]["path"]
|
||||
|
||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s)
|
||||
item[key] = frames[0]
|
||||
|
||||
return item
|
||||
from PIL import Image
|
||||
|
||||
|
||||
def decode_video_frames_torchvision(
|
||||
video_path: str,
|
||||
video_path: Path | str,
|
||||
timestamps: list[float],
|
||||
tolerance_s: float,
|
||||
device: str = "cpu",
|
||||
backend: str = "pyav",
|
||||
log_loaded_timestamps: bool = False,
|
||||
):
|
||||
) -> torch.Tensor:
|
||||
"""Loads frames associated to the requested timestamps of a video
|
||||
|
||||
The backend can be either "pyav" (default) or "video_reader".
|
||||
"video_reader" requires installing torchvision from source, see:
|
||||
https://github.com/pytorch/vision/blob/main/torchvision/csrc/io/decoder/gpu/README.rst
|
||||
(note that you need to compile against ffmpeg<4.3)
|
||||
|
||||
While both use cpu, "video_reader" is supposedly faster than "pyav" but requires additional setup.
|
||||
For more info on video decoding, see `benchmark/video/README.md`
|
||||
|
||||
See torchvision doc for more info on these two backends:
|
||||
https://pytorch.org/vision/0.18/index.html?highlight=backend#torchvision.set_video_backend
|
||||
|
||||
Note: Video benefits from inter-frame compression. Instead of storing every frame individually,
|
||||
the encoder stores a reference frame (or a key frame) and subsequent frames as differences relative to
|
||||
that key frame. As a consequence, to access a requested frame, we need to load the preceding key frame,
|
||||
@@ -78,21 +59,9 @@ def decode_video_frames_torchvision(
|
||||
|
||||
# set backend
|
||||
keyframes_only = False
|
||||
if device == "cpu":
|
||||
# explicitely use pyav
|
||||
torchvision.set_video_backend("pyav")
|
||||
torchvision.set_video_backend(backend)
|
||||
if backend == "pyav":
|
||||
keyframes_only = True # pyav doesnt support accuracte seek
|
||||
elif device == "cuda":
|
||||
# TODO(rcadene, aliberts): implement video decoding with GPU
|
||||
# torchvision.set_video_backend("cuda")
|
||||
# torchvision.set_video_backend("video_reader")
|
||||
# requires installing torchvision from source, see: https://github.com/pytorch/vision/blob/main/torchvision/csrc/io/decoder/gpu/README.rst
|
||||
# check possible bug: https://github.com/pytorch/vision/issues/7745
|
||||
raise NotImplementedError(
|
||||
"Video decoding on gpu with cuda is currently not supported. Use `device='cpu'`."
|
||||
)
|
||||
else:
|
||||
raise ValueError(device)
|
||||
|
||||
# set a video stream reader
|
||||
# TODO(rcadene): also load audio stream at the same time
|
||||
@@ -120,7 +89,9 @@ def decode_video_frames_torchvision(
|
||||
if current_ts >= last_ts:
|
||||
break
|
||||
|
||||
reader.container.close()
|
||||
if backend == "pyav":
|
||||
reader.container.close()
|
||||
|
||||
reader = None
|
||||
|
||||
query_ts = torch.tensor(timestamps)
|
||||
@@ -136,6 +107,10 @@ def decode_video_frames_torchvision(
|
||||
"It means that the closest frame that can be loaded from the video is too far away in time."
|
||||
"This might be due to synchronization issues with timestamps during data collection."
|
||||
"To be safe, we advise to ignore this item during training."
|
||||
f"\nqueried timestamps: {query_ts}"
|
||||
f"\nloaded timestamps: {loaded_ts}"
|
||||
f"\nvideo: {video_path}"
|
||||
f"\nbackend: {backend}"
|
||||
)
|
||||
|
||||
# get closest frames to the query timestamps
|
||||
@@ -152,22 +127,59 @@ def decode_video_frames_torchvision(
|
||||
return closest_frames
|
||||
|
||||
|
||||
def encode_video_frames(imgs_dir: Path, video_path: Path, fps: int):
|
||||
"""More info on ffmpeg arguments tuning on `lerobot/common/datasets/_video_benchmark/README.md`"""
|
||||
def encode_video_frames(
|
||||
imgs_dir: Path | str,
|
||||
video_path: Path | str,
|
||||
fps: int,
|
||||
vcodec: str = "libsvtav1",
|
||||
pix_fmt: str = "yuv420p",
|
||||
g: int | None = 2,
|
||||
crf: int | None = 30,
|
||||
fast_decode: int = 0,
|
||||
log_level: str | None = "error",
|
||||
overwrite: bool = False,
|
||||
) -> None:
|
||||
"""More info on ffmpeg arguments tuning on `benchmark/video/README.md`"""
|
||||
video_path = Path(video_path)
|
||||
video_path.parent.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
ffmpeg_cmd = (
|
||||
f"ffmpeg -r {fps} "
|
||||
"-f image2 "
|
||||
"-loglevel error "
|
||||
f"-i {str(imgs_dir / 'frame_%06d.png')} "
|
||||
"-vcodec libx264 "
|
||||
"-g 2 "
|
||||
"-pix_fmt yuv444p "
|
||||
f"{str(video_path)}"
|
||||
ffmpeg_args = OrderedDict(
|
||||
[
|
||||
("-f", "image2"),
|
||||
("-r", str(fps)),
|
||||
("-i", str(imgs_dir / "frame_%06d.png")),
|
||||
("-vcodec", vcodec),
|
||||
("-pix_fmt", pix_fmt),
|
||||
]
|
||||
)
|
||||
subprocess.run(ffmpeg_cmd.split(" "), check=True)
|
||||
|
||||
if g is not None:
|
||||
ffmpeg_args["-g"] = str(g)
|
||||
|
||||
if crf is not None:
|
||||
ffmpeg_args["-crf"] = str(crf)
|
||||
|
||||
if fast_decode:
|
||||
key = "-svtav1-params" if vcodec == "libsvtav1" else "-tune"
|
||||
value = f"fast-decode={fast_decode}" if vcodec == "libsvtav1" else "fastdecode"
|
||||
ffmpeg_args[key] = value
|
||||
|
||||
if log_level is not None:
|
||||
ffmpeg_args["-loglevel"] = str(log_level)
|
||||
|
||||
ffmpeg_args = [item for pair in ffmpeg_args.items() for item in pair]
|
||||
if overwrite:
|
||||
ffmpeg_args.append("-y")
|
||||
|
||||
ffmpeg_cmd = ["ffmpeg"] + ffmpeg_args + [str(video_path)]
|
||||
# redirect stdin to subprocess.DEVNULL to prevent reading random keyboard inputs from terminal
|
||||
subprocess.run(ffmpeg_cmd, check=True, stdin=subprocess.DEVNULL)
|
||||
|
||||
if not video_path.exists():
|
||||
raise OSError(
|
||||
f"Video encoding did not work. File not found: {video_path}. "
|
||||
f"Try running the command manually to debug: `{''.join(ffmpeg_cmd)}`"
|
||||
)
|
||||
|
||||
|
||||
@dataclass
|
||||
@@ -200,3 +212,110 @@ with warnings.catch_warnings():
|
||||
)
|
||||
# to make VideoFrame available in HuggingFace `datasets`
|
||||
register_feature(VideoFrame, "VideoFrame")
|
||||
|
||||
|
||||
def get_audio_info(video_path: Path | str) -> dict:
|
||||
ffprobe_audio_cmd = [
|
||||
"ffprobe",
|
||||
"-v",
|
||||
"error",
|
||||
"-select_streams",
|
||||
"a:0",
|
||||
"-show_entries",
|
||||
"stream=channels,codec_name,bit_rate,sample_rate,bit_depth,channel_layout,duration",
|
||||
"-of",
|
||||
"json",
|
||||
str(video_path),
|
||||
]
|
||||
result = subprocess.run(
|
||||
ffprobe_audio_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True
|
||||
)
|
||||
if result.returncode != 0:
|
||||
raise RuntimeError(f"Error running ffprobe: {result.stderr}")
|
||||
|
||||
info = json.loads(result.stdout)
|
||||
audio_stream_info = info["streams"][0] if info.get("streams") else None
|
||||
if audio_stream_info is None:
|
||||
return {"has_audio": False}
|
||||
|
||||
# Return the information, defaulting to None if no audio stream is present
|
||||
return {
|
||||
"has_audio": True,
|
||||
"audio.channels": audio_stream_info.get("channels", None),
|
||||
"audio.codec": audio_stream_info.get("codec_name", None),
|
||||
"audio.bit_rate": int(audio_stream_info["bit_rate"])
|
||||
if audio_stream_info.get("bit_rate")
|
||||
else None,
|
||||
"audio.sample_rate": int(audio_stream_info["sample_rate"])
|
||||
if audio_stream_info.get("sample_rate")
|
||||
else None,
|
||||
"audio.bit_depth": audio_stream_info.get("bit_depth", None),
|
||||
"audio.channel_layout": audio_stream_info.get("channel_layout", None),
|
||||
}
|
||||
|
||||
|
||||
def get_video_info(video_path: Path | str) -> dict:
|
||||
ffprobe_video_cmd = [
|
||||
"ffprobe",
|
||||
"-v",
|
||||
"error",
|
||||
"-select_streams",
|
||||
"v:0",
|
||||
"-show_entries",
|
||||
"stream=r_frame_rate,width,height,codec_name,nb_frames,duration,pix_fmt",
|
||||
"-of",
|
||||
"json",
|
||||
str(video_path),
|
||||
]
|
||||
result = subprocess.run(
|
||||
ffprobe_video_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True
|
||||
)
|
||||
if result.returncode != 0:
|
||||
raise RuntimeError(f"Error running ffprobe: {result.stderr}")
|
||||
|
||||
info = json.loads(result.stdout)
|
||||
video_stream_info = info["streams"][0]
|
||||
|
||||
# Calculate fps from r_frame_rate
|
||||
r_frame_rate = video_stream_info["r_frame_rate"]
|
||||
num, denom = map(int, r_frame_rate.split("/"))
|
||||
fps = num / denom
|
||||
|
||||
pixel_channels = get_video_pixel_channels(video_stream_info["pix_fmt"])
|
||||
|
||||
video_info = {
|
||||
"video.fps": fps,
|
||||
"video.height": video_stream_info["height"],
|
||||
"video.width": video_stream_info["width"],
|
||||
"video.channels": pixel_channels,
|
||||
"video.codec": video_stream_info["codec_name"],
|
||||
"video.pix_fmt": video_stream_info["pix_fmt"],
|
||||
"video.is_depth_map": False,
|
||||
**get_audio_info(video_path),
|
||||
}
|
||||
|
||||
return video_info
|
||||
|
||||
|
||||
def get_video_pixel_channels(pix_fmt: str) -> int:
|
||||
if "gray" in pix_fmt or "depth" in pix_fmt or "monochrome" in pix_fmt:
|
||||
return 1
|
||||
elif "rgba" in pix_fmt or "yuva" in pix_fmt:
|
||||
return 4
|
||||
elif "rgb" in pix_fmt or "yuv" in pix_fmt:
|
||||
return 3
|
||||
else:
|
||||
raise ValueError("Unknown format")
|
||||
|
||||
|
||||
def get_image_pixel_channels(image: Image):
|
||||
if image.mode == "L":
|
||||
return 1 # Grayscale
|
||||
elif image.mode == "LA":
|
||||
return 2 # Grayscale + Alpha
|
||||
elif image.mode == "RGB":
|
||||
return 3 # RGB
|
||||
elif image.mode == "RGBA":
|
||||
return 4 # RGBA
|
||||
else:
|
||||
raise ValueError("Unknown format")
|
||||
|
||||
@@ -14,12 +14,16 @@
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import importlib
|
||||
from collections import deque
|
||||
|
||||
import gymnasium as gym
|
||||
import numpy as np
|
||||
import torch
|
||||
from omegaconf import DictConfig
|
||||
# from mani_skill.utils import common
|
||||
|
||||
|
||||
def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv:
|
||||
def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv | None:
|
||||
"""Makes a gym vector environment according to the evaluation config.
|
||||
|
||||
n_envs can be used to override eval.batch_size in the configuration. Must be at least 1.
|
||||
@@ -27,6 +31,15 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
|
||||
if n_envs is not None and n_envs < 1:
|
||||
raise ValueError("`n_envs must be at least 1")
|
||||
|
||||
if cfg.env.name == "real_world":
|
||||
return
|
||||
|
||||
if "maniskill" in cfg.env.name:
|
||||
env = make_maniskill_env(
|
||||
cfg, n_envs if n_envs is not None else cfg.eval.batch_size
|
||||
)
|
||||
return env
|
||||
|
||||
package_name = f"gym_{cfg.env.name}"
|
||||
|
||||
try:
|
||||
@@ -44,7 +57,11 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
|
||||
gym_kwgs["max_episode_steps"] = cfg.env.episode_length
|
||||
|
||||
# batched version of the env that returns an observation of shape (b, c)
|
||||
env_cls = gym.vector.AsyncVectorEnv if cfg.eval.use_async_envs else gym.vector.SyncVectorEnv
|
||||
env_cls = (
|
||||
gym.vector.AsyncVectorEnv
|
||||
if cfg.eval.use_async_envs
|
||||
else gym.vector.SyncVectorEnv
|
||||
)
|
||||
env = env_cls(
|
||||
[
|
||||
lambda: gym.make(gym_handle, disable_env_checker=True, **gym_kwgs)
|
||||
@@ -53,3 +70,99 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
|
||||
)
|
||||
|
||||
return env
|
||||
|
||||
|
||||
def make_maniskill_env(
|
||||
cfg: DictConfig, n_envs: int | None = None
|
||||
) -> gym.vector.VectorEnv | None:
|
||||
"""Make ManiSkill3 gym environment"""
|
||||
from mani_skill.vector.wrappers.gymnasium import ManiSkillVectorEnv
|
||||
|
||||
env = gym.make(
|
||||
cfg.env.task,
|
||||
obs_mode=cfg.env.obs,
|
||||
control_mode=cfg.env.control_mode,
|
||||
render_mode=cfg.env.render_mode,
|
||||
sensor_configs=dict(width=cfg.env.image_size, height=cfg.env.image_size),
|
||||
num_envs=n_envs,
|
||||
)
|
||||
# cfg.env_cfg.control_mode = cfg.eval_env_cfg.control_mode = env.control_mode
|
||||
env = ManiSkillVectorEnv(env, ignore_terminations=True)
|
||||
# state should have the size of 25
|
||||
# env = ConvertToLeRobotEnv(env, n_envs)
|
||||
# env = PixelWrapper(cfg, env, n_envs)
|
||||
env._max_episode_steps = env.max_episode_steps = (
|
||||
50 # gym_utils.find_max_episode_steps_value(env)
|
||||
)
|
||||
env.unwrapped.metadata["render_fps"] = 20
|
||||
|
||||
return env
|
||||
|
||||
|
||||
class PixelWrapper(gym.Wrapper):
|
||||
"""
|
||||
Wrapper for pixel observations. Works with Maniskill vectorized environments
|
||||
"""
|
||||
|
||||
def __init__(self, cfg, env, num_envs, num_frames=3):
|
||||
super().__init__(env)
|
||||
self.cfg = cfg
|
||||
self.env = env
|
||||
self.observation_space = gym.spaces.Box(
|
||||
low=0,
|
||||
high=255,
|
||||
shape=(num_envs, num_frames * 3, cfg.env.render_size, cfg.env.render_size),
|
||||
dtype=np.uint8,
|
||||
)
|
||||
self._frames = deque([], maxlen=num_frames)
|
||||
self._render_size = cfg.env.render_size
|
||||
|
||||
def _get_obs(self, obs):
|
||||
frame = obs["sensor_data"]["base_camera"]["rgb"].cpu().permute(0, 3, 1, 2)
|
||||
self._frames.append(frame)
|
||||
return {
|
||||
"pixels": torch.from_numpy(np.concatenate(self._frames, axis=1)).to(
|
||||
self.env.device
|
||||
)
|
||||
}
|
||||
|
||||
def reset(self, seed):
|
||||
obs, info = self.env.reset() # (seed=seed)
|
||||
for _ in range(self._frames.maxlen):
|
||||
obs_frames = self._get_obs(obs)
|
||||
return obs_frames, info
|
||||
|
||||
def step(self, action):
|
||||
obs, reward, terminated, truncated, info = self.env.step(action)
|
||||
return self._get_obs(obs), reward, terminated, truncated, info
|
||||
|
||||
|
||||
# TODO: Remove this
|
||||
class ConvertToLeRobotEnv(gym.Wrapper):
|
||||
def __init__(self, env, num_envs):
|
||||
super().__init__(env)
|
||||
|
||||
def reset(self, seed=None, options=None):
|
||||
obs, info = self.env.reset(seed=seed, options={})
|
||||
return self._get_obs(obs), info
|
||||
|
||||
def step(self, action):
|
||||
obs, reward, terminated, truncated, info = self.env.step(action)
|
||||
return self._get_obs(obs), reward, terminated, truncated, info
|
||||
|
||||
def _get_obs(self, observation):
|
||||
sensor_data = observation.pop("sensor_data")
|
||||
del observation["sensor_param"]
|
||||
images = []
|
||||
for cam_data in sensor_data.values():
|
||||
images.append(cam_data["rgb"])
|
||||
|
||||
images = torch.concat(images, axis=-1)
|
||||
# flatten the rest of the data which should just be state data
|
||||
observation = common.flatten_state_dict(
|
||||
observation, use_torch=True, device=self.base_env.device
|
||||
)
|
||||
ret = dict()
|
||||
ret["state"] = observation
|
||||
ret["pixels"] = images
|
||||
return ret
|
||||
|
||||
@@ -28,20 +28,20 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
|
||||
"""
|
||||
# map to expected inputs for the policy
|
||||
return_observations = {}
|
||||
# TODO: You have to merge all tensors from agent key and extra key
|
||||
# You don't keep sensor param key in the observation
|
||||
# And you keep sensor data rgb
|
||||
for key, img in observations.items():
|
||||
if "images" not in key:
|
||||
continue
|
||||
|
||||
if "pixels" in observations and isinstance(observations["pixels"], dict):
|
||||
imgs = {f"observation.images.{key}": img for key, img in observations["pixels"].items()}
|
||||
elif "pixels" in observations and isinstance(observations["pixels"], np.ndarray):
|
||||
imgs = {"observation.image": observations["pixels"]}
|
||||
else:
|
||||
imgs = {f"observation.{key}": img for key, img in observations.items() if "images" in key}
|
||||
|
||||
for imgkey, img in imgs.items():
|
||||
img = torch.from_numpy(img)
|
||||
|
||||
if img.ndim == 3:
|
||||
img = img.unsqueeze(0)
|
||||
# sanity check that images are channel last
|
||||
_, h, w, c = img.shape
|
||||
assert c < h and c < w, f"expect channel first images, but instead {img.shape}"
|
||||
assert (
|
||||
c < h and c < w
|
||||
), f"expect channel last images, but instead got {img.shape=}"
|
||||
|
||||
# sanity check that images are uint8
|
||||
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
||||
@@ -51,10 +51,54 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
|
||||
img = img.type(torch.float32)
|
||||
img /= 255
|
||||
|
||||
return_observations[imgkey] = img
|
||||
return_observations[key] = img
|
||||
# obs state agent qpos and qvel
|
||||
# image
|
||||
|
||||
if "environment_state" in observations:
|
||||
return_observations["observation.environment_state"] = torch.from_numpy(
|
||||
observations["environment_state"]
|
||||
).float()
|
||||
|
||||
# TODO(rcadene): enable pixels only baseline with `obs_type="pixels"` in environment by removing
|
||||
# requirement for "agent_pos"
|
||||
return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
|
||||
|
||||
# return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
|
||||
return_observations["observation.state"] = observations["observation.state"].float()
|
||||
return return_observations
|
||||
|
||||
|
||||
def preprocess_maniskill_observation(
|
||||
observations: dict[str, np.ndarray],
|
||||
) -> dict[str, Tensor]:
|
||||
"""Convert environment observation to LeRobot format observation.
|
||||
Args:
|
||||
observation: Dictionary of observation batches from a Gym vector environment.
|
||||
Returns:
|
||||
Dictionary of observation batches with keys renamed to LeRobot format and values as tensors.
|
||||
"""
|
||||
# map to expected inputs for the policy
|
||||
return_observations = {}
|
||||
# TODO: You have to merge all tensors from agent key and extra key
|
||||
# You don't keep sensor param key in the observation
|
||||
# And you keep sensor data rgb
|
||||
q_pos = observations["agent"]["qpos"]
|
||||
q_vel = observations["agent"]["qvel"]
|
||||
tcp_pos = observations["extra"]["tcp_pose"]
|
||||
img = observations["sensor_data"]["base_camera"]["rgb"]
|
||||
|
||||
_, h, w, c = img.shape
|
||||
assert c < h and c < w, f"expect channel last images, but instead got {img.shape=}"
|
||||
|
||||
# sanity check that images are uint8
|
||||
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
||||
|
||||
# convert to channel first of type float32 in range [0,1]
|
||||
img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
|
||||
img = img.type(torch.float32)
|
||||
img /= 255
|
||||
|
||||
state = torch.cat([q_pos, q_vel, tcp_pos], dim=-1)
|
||||
|
||||
return_observations["observation.image"] = img
|
||||
return_observations["observation.state"] = state
|
||||
return return_observations
|
||||
|
||||
@@ -25,6 +25,7 @@ from glob import glob
|
||||
from pathlib import Path
|
||||
|
||||
import torch
|
||||
import wandb
|
||||
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE
|
||||
from omegaconf import DictConfig, OmegaConf
|
||||
from termcolor import colored
|
||||
@@ -83,7 +84,9 @@ class Logger:
|
||||
pretrained_model_dir_name = "pretrained_model"
|
||||
training_state_file_name = "training_state.pth"
|
||||
|
||||
def __init__(self, cfg: DictConfig, log_dir: str, wandb_job_name: str | None = None):
|
||||
def __init__(
|
||||
self, cfg: DictConfig, log_dir: str, wandb_job_name: str | None = None
|
||||
):
|
||||
"""
|
||||
Args:
|
||||
log_dir: The directory to save all logs and training outputs to.
|
||||
@@ -103,12 +106,12 @@ class Logger:
|
||||
enable_wandb = cfg.get("wandb", {}).get("enable", False)
|
||||
run_offline = not enable_wandb or not project
|
||||
if run_offline:
|
||||
logging.info(colored("Logs will be saved locally.", "yellow", attrs=["bold"]))
|
||||
logging.info(
|
||||
colored("Logs will be saved locally.", "yellow", attrs=["bold"])
|
||||
)
|
||||
self._wandb = None
|
||||
else:
|
||||
os.environ["WANDB_SILENT"] = "true"
|
||||
import wandb
|
||||
|
||||
wandb_run_id = None
|
||||
if cfg.resume:
|
||||
wandb_run_id = get_wandb_run_id_from_filesystem(self.checkpoints_dir)
|
||||
@@ -128,8 +131,12 @@ class Logger:
|
||||
job_type="train_eval",
|
||||
resume="must" if cfg.resume else None,
|
||||
)
|
||||
# Handle custom step key for rl asynchronous training.
|
||||
self._wandb_custom_step_key: set[str] | None = None
|
||||
print(colored("Logs will be synced with wandb.", "blue", attrs=["bold"]))
|
||||
logging.info(f"Track this run --> {colored(wandb.run.get_url(), 'yellow', attrs=['bold'])}")
|
||||
logging.info(
|
||||
f"Track this run --> {colored(wandb.run.get_url(), 'yellow', attrs=['bold'])}"
|
||||
)
|
||||
self._wandb = wandb
|
||||
|
||||
@classmethod
|
||||
@@ -150,7 +157,9 @@ class Logger:
|
||||
"""
|
||||
return cls.get_last_checkpoint_dir(log_dir) / cls.pretrained_model_dir_name
|
||||
|
||||
def save_model(self, save_dir: Path, policy: Policy, wandb_artifact_name: str | None = None):
|
||||
def save_model(
|
||||
self, save_dir: Path, policy: Policy, wandb_artifact_name: str | None = None
|
||||
):
|
||||
"""Save the weights of the Policy model using PyTorchModelHubMixin.
|
||||
|
||||
The weights are saved in a folder called "pretrained_model" under the checkpoint directory.
|
||||
@@ -173,29 +182,44 @@ class Logger:
|
||||
self,
|
||||
save_dir: Path,
|
||||
train_step: int,
|
||||
optimizer: Optimizer,
|
||||
optimizer: Optimizer | dict,
|
||||
scheduler: LRScheduler | None,
|
||||
interaction_step: int | None = None,
|
||||
):
|
||||
"""Checkpoint the global training_step, optimizer state, scheduler state, and random state.
|
||||
|
||||
All of these are saved as "training_state.pth" under the checkpoint directory.
|
||||
"""
|
||||
# In Sac, for example, we have a dictionary of torch.optim.Optimizer
|
||||
if type(optimizer) is dict:
|
||||
optimizer_state_dict = {}
|
||||
for k in optimizer:
|
||||
optimizer_state_dict[k] = optimizer[k].state_dict()
|
||||
else:
|
||||
optimizer_state_dict = optimizer.state_dict()
|
||||
|
||||
training_state = {
|
||||
"step": train_step,
|
||||
"optimizer": optimizer.state_dict(),
|
||||
"optimizer": optimizer_state_dict,
|
||||
**get_global_random_state(),
|
||||
}
|
||||
# Interaction step is related to the distributed training code
|
||||
# In that setup, we have two kinds of steps, the online step of the env and the optimization step
|
||||
# We need to save both in order to resume the optimization properly and not break the logs dependant on the interaction step
|
||||
if interaction_step is not None:
|
||||
training_state["interaction_step"] = interaction_step
|
||||
if scheduler is not None:
|
||||
training_state["scheduler"] = scheduler.state_dict()
|
||||
torch.save(training_state, save_dir / self.training_state_file_name)
|
||||
|
||||
def save_checkpont(
|
||||
def save_checkpoint(
|
||||
self,
|
||||
train_step: int,
|
||||
policy: Policy,
|
||||
optimizer: Optimizer,
|
||||
scheduler: LRScheduler | None,
|
||||
identifier: str,
|
||||
interaction_step: int | None = None,
|
||||
):
|
||||
"""Checkpoint the model weights and the training state."""
|
||||
checkpoint_dir = self.checkpoints_dir / str(identifier)
|
||||
@@ -205,18 +229,34 @@ class Logger:
|
||||
else f"{self._group.replace(':', '_').replace('/', '_')}-{self._cfg.seed}-{identifier}"
|
||||
)
|
||||
self.save_model(
|
||||
checkpoint_dir / self.pretrained_model_dir_name, policy, wandb_artifact_name=wandb_artifact_name
|
||||
checkpoint_dir / self.pretrained_model_dir_name,
|
||||
policy,
|
||||
wandb_artifact_name=wandb_artifact_name,
|
||||
)
|
||||
self.save_training_state(
|
||||
checkpoint_dir, train_step, optimizer, scheduler, interaction_step
|
||||
)
|
||||
self.save_training_state(checkpoint_dir, train_step, optimizer, scheduler)
|
||||
os.symlink(checkpoint_dir.absolute(), self.last_checkpoint_dir)
|
||||
|
||||
def load_last_training_state(self, optimizer: Optimizer, scheduler: LRScheduler | None) -> int:
|
||||
def load_last_training_state(
|
||||
self, optimizer: Optimizer | dict, scheduler: LRScheduler | None
|
||||
) -> int:
|
||||
"""
|
||||
Given the last checkpoint in the logging directory, load the optimizer state, scheduler state, and
|
||||
random state, and return the global training step.
|
||||
"""
|
||||
training_state = torch.load(self.last_checkpoint_dir / self.training_state_file_name)
|
||||
optimizer.load_state_dict(training_state["optimizer"])
|
||||
training_state = torch.load(
|
||||
self.last_checkpoint_dir / self.training_state_file_name
|
||||
)
|
||||
# For the case where the optimizer is a dictionary of optimizers (e.g., sac)
|
||||
if type(training_state["optimizer"]) is dict:
|
||||
assert set(training_state["optimizer"].keys()) == set(
|
||||
optimizer.keys()
|
||||
), "Optimizer dictionaries do not have the same keys during resume!"
|
||||
for k, v in training_state["optimizer"].items():
|
||||
optimizer[k].load_state_dict(v)
|
||||
else:
|
||||
optimizer.load_state_dict(training_state["optimizer"])
|
||||
if scheduler is not None:
|
||||
scheduler.load_state_dict(training_state["scheduler"])
|
||||
elif "scheduler" in training_state:
|
||||
@@ -224,22 +264,66 @@ class Logger:
|
||||
"The checkpoint contains a scheduler state_dict, but no LRScheduler was provided."
|
||||
)
|
||||
# Small hack to get the expected keys: use `get_global_random_state`.
|
||||
set_global_random_state({k: training_state[k] for k in get_global_random_state()})
|
||||
set_global_random_state(
|
||||
{k: training_state[k] for k in get_global_random_state()}
|
||||
)
|
||||
return training_state["step"]
|
||||
|
||||
def log_dict(self, d, step, mode="train"):
|
||||
def log_dict(
|
||||
self,
|
||||
d,
|
||||
step: int | None = None,
|
||||
mode="train",
|
||||
custom_step_key: str | None = None,
|
||||
):
|
||||
"""Log a dictionary of metrics to WandB."""
|
||||
assert mode in {"train", "eval"}
|
||||
# TODO(alexander-soare): Add local text log.
|
||||
if step is None and custom_step_key is None:
|
||||
raise ValueError("Either step or custom_step_key must be provided.")
|
||||
|
||||
if self._wandb is not None:
|
||||
# NOTE: This is not simple. Wandb step is it must always monotonically increase and it
|
||||
# increases with each wandb.log call, but in the case of asynchronous RL for example,
|
||||
# multiple time steps is possible for example, the interaction step with the environment,
|
||||
# the training step, the evaluation step, etc. So we need to define a custom step key
|
||||
# to log the correct step for each metric.
|
||||
if custom_step_key is not None:
|
||||
if self._wandb_custom_step_key is None:
|
||||
self._wandb_custom_step_key = set()
|
||||
new_custom_key = f"{mode}/{custom_step_key}"
|
||||
if new_custom_key not in self._wandb_custom_step_key:
|
||||
self._wandb_custom_step_key.add(new_custom_key)
|
||||
self._wandb.define_metric(new_custom_key, hidden=True)
|
||||
|
||||
for k, v in d.items():
|
||||
if not isinstance(v, (int, float, str)):
|
||||
if not isinstance(v, (int, float, str, wandb.Table)):
|
||||
logging.warning(
|
||||
f'WandB logging of key "{k}" was ignored as its type is not handled by this wrapper.'
|
||||
)
|
||||
continue
|
||||
self._wandb.log({f"{mode}/{k}": v}, step=step)
|
||||
|
||||
# Do not log the custom step key itself.
|
||||
if (
|
||||
self._wandb_custom_step_key is not None
|
||||
and k in self._wandb_custom_step_key
|
||||
):
|
||||
continue
|
||||
|
||||
if custom_step_key is not None:
|
||||
value_custom_step = d[custom_step_key]
|
||||
self._wandb.log(
|
||||
{
|
||||
f"{mode}/{k}": v,
|
||||
f"{mode}/{custom_step_key}": value_custom_step,
|
||||
}
|
||||
)
|
||||
continue
|
||||
|
||||
self._wandb.log(data={f"{mode}/{k}": v}, step=step)
|
||||
|
||||
def log_video(self, video_path: str, step: int, mode: str = "train"):
|
||||
assert mode in {"train", "eval"}
|
||||
assert self._wandb is not None
|
||||
wandb_video = self._wandb.Video(video_path, fps=self._cfg.fps, format="mp4")
|
||||
self._wandb.log({f"{mode}/video": wandb_video}, step=step)
|
||||
|
||||
@@ -26,7 +26,10 @@ class ACTConfig:
|
||||
Those are: `input_shapes` and 'output_shapes`.
|
||||
|
||||
Notes on the inputs and outputs:
|
||||
- At least one key starting with "observation.image is required as an input.
|
||||
- Either:
|
||||
- At least one key starting with "observation.image is required as an input.
|
||||
AND/OR
|
||||
- The key "observation.environment_state" is required as input.
|
||||
- If there are multiple keys beginning with "observation.images." they are treated as multiple camera
|
||||
views. Right now we only support all images having the same shape.
|
||||
- May optionally work without an "observation.state" key for the proprioceptive robot state.
|
||||
@@ -73,12 +76,10 @@ class ACTConfig:
|
||||
documentation in the policy class).
|
||||
latent_dim: The VAE's latent dimension.
|
||||
n_vae_encoder_layers: The number of transformer layers to use for the VAE's encoder.
|
||||
temporal_ensemble_momentum: Exponential moving average (EMA) momentum parameter (α) for ensembling
|
||||
actions for a given time step over multiple policy invocations. Updates are calculated as:
|
||||
x⁻ₙ = αx⁻ₙ₋₁ + (1-α)xₙ. Note that the ACT paper and original ACT code describes a different
|
||||
parameter here: they refer to a weighting scheme wᵢ = exp(-m⋅i) and set m = 0.01. With our
|
||||
formulation, this is equivalent to α = exp(-0.01) ≈ 0.99. When this parameter is provided, we
|
||||
require `n_action_steps == 1` (since we need to query the policy every step anyway).
|
||||
temporal_ensemble_coeff: Coefficient for the exponential weighting scheme to apply for temporal
|
||||
ensembling. Defaults to None which means temporal ensembling is not used. `n_action_steps` must be
|
||||
1 when using this feature, as inference needs to happen at every step to form an ensemble. For
|
||||
more information on how ensembling works, please see `ACTTemporalEnsembler`.
|
||||
dropout: Dropout to use in the transformer layers (see code for details).
|
||||
kl_weight: The weight to use for the KL-divergence component of the loss if the variational objective
|
||||
is enabled. Loss is then calculated as: `reconstruction_loss + kl_weight * kld_loss`.
|
||||
@@ -129,16 +130,15 @@ class ACTConfig:
|
||||
# Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
|
||||
# that means only the first layer is used. Here we match the original implementation by setting this to 1.
|
||||
# See this issue https://github.com/tonyzhaozh/act/issues/25#issue-2258740521.
|
||||
# As a consequence we also remove the final, unused layer normalization, by default
|
||||
n_decoder_layers: int = 1
|
||||
decoder_norm: bool = False
|
||||
# VAE.
|
||||
use_vae: bool = True
|
||||
latent_dim: int = 32
|
||||
n_vae_encoder_layers: int = 4
|
||||
|
||||
# Inference.
|
||||
temporal_ensemble_momentum: float | None = None
|
||||
# Note: the value used in ACT when temporal ensembling is enabled is 0.01.
|
||||
temporal_ensemble_coeff: float | None = None
|
||||
|
||||
# Training and loss computation.
|
||||
dropout: float = 0.1
|
||||
@@ -150,7 +150,7 @@ class ACTConfig:
|
||||
raise ValueError(
|
||||
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||
)
|
||||
if self.temporal_ensemble_momentum is not None and self.n_action_steps > 1:
|
||||
if self.temporal_ensemble_coeff is not None and self.n_action_steps > 1:
|
||||
raise NotImplementedError(
|
||||
"`n_action_steps` must be 1 when using temporal ensembling. This is "
|
||||
"because the policy needs to be queried every step to compute the ensembled action."
|
||||
@@ -164,3 +164,10 @@ class ACTConfig:
|
||||
raise ValueError(
|
||||
f"Multiple observation steps not handled yet. Got `nobs_steps={self.n_obs_steps}`"
|
||||
)
|
||||
if (
|
||||
not any(k.startswith("observation.image") for k in self.input_shapes)
|
||||
and "observation.environment_state" not in self.input_shapes
|
||||
):
|
||||
raise ValueError(
|
||||
"You must provide at least one image or the environment state among the inputs."
|
||||
)
|
||||
|
||||
@@ -38,7 +38,13 @@ from lerobot.common.policies.act.configuration_act import ACTConfig
|
||||
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||
|
||||
|
||||
class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
class ACTPolicy(
|
||||
nn.Module,
|
||||
PyTorchModelHubMixin,
|
||||
library_name="lerobot",
|
||||
repo_url="https://github.com/huggingface/lerobot",
|
||||
tags=["robotics", "act"],
|
||||
):
|
||||
"""
|
||||
Action Chunking Transformer Policy as per Learning Fine-Grained Bimanual Manipulation with Low-Cost
|
||||
Hardware (paper: https://arxiv.org/abs/2304.13705, code: https://github.com/tonyzhaozh/act)
|
||||
@@ -75,14 +81,21 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
|
||||
self.model = ACT(config)
|
||||
|
||||
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
self.expected_image_keys = [
|
||||
k for k in config.input_shapes if k.startswith("observation.image")
|
||||
]
|
||||
|
||||
if config.temporal_ensemble_coeff is not None:
|
||||
self.temporal_ensembler = ACTTemporalEnsembler(
|
||||
config.temporal_ensemble_coeff, config.chunk_size
|
||||
)
|
||||
|
||||
self.reset()
|
||||
|
||||
def reset(self):
|
||||
"""This should be called whenever the environment is reset."""
|
||||
if self.config.temporal_ensemble_momentum is not None:
|
||||
self._ensembled_actions = None
|
||||
if self.config.temporal_ensemble_coeff is not None:
|
||||
self.temporal_ensembler.reset()
|
||||
else:
|
||||
self._action_queue = deque([], maxlen=self.config.n_action_steps)
|
||||
|
||||
@@ -97,26 +110,20 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
self.eval()
|
||||
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
if len(self.expected_image_keys) > 0:
|
||||
batch = dict(
|
||||
batch
|
||||
) # shallow copy so that adding a key doesn't modify the original
|
||||
batch["observation.images"] = torch.stack(
|
||||
[batch[k] for k in self.expected_image_keys], dim=-4
|
||||
)
|
||||
|
||||
# If we are doing temporal ensembling, keep track of the exponential moving average (EMA), and return
|
||||
# the first action.
|
||||
if self.config.temporal_ensemble_momentum is not None:
|
||||
# If we are doing temporal ensembling, do online updates where we keep track of the number of actions
|
||||
# we are ensembling over.
|
||||
if self.config.temporal_ensemble_coeff is not None:
|
||||
actions = self.model(batch)[0] # (batch_size, chunk_size, action_dim)
|
||||
actions = self.unnormalize_outputs({"action": actions})["action"]
|
||||
if self._ensembled_actions is None:
|
||||
# Initializes `self._ensembled_action` to the sequence of actions predicted during the first
|
||||
# time step of the episode.
|
||||
self._ensembled_actions = actions.clone()
|
||||
else:
|
||||
# self._ensembled_actions will have shape (batch_size, chunk_size - 1, action_dim). Compute
|
||||
# the EMA update for those entries.
|
||||
alpha = self.config.temporal_ensemble_momentum
|
||||
self._ensembled_actions = alpha * self._ensembled_actions + (1 - alpha) * actions[:, :-1]
|
||||
# The last action, which has no prior moving average, needs to get concatenated onto the end.
|
||||
self._ensembled_actions = torch.cat([self._ensembled_actions, actions[:, -1:]], dim=1)
|
||||
# "Consume" the first action.
|
||||
action, self._ensembled_actions = self._ensembled_actions[:, 0], self._ensembled_actions[:, 1:]
|
||||
action = self.temporal_ensembler.update(actions)
|
||||
return action
|
||||
|
||||
# Action queue logic for n_action_steps > 1. When the action_queue is depleted, populate it by
|
||||
@@ -135,12 +142,19 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||
"""Run the batch through the model and compute the loss for training or validation."""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
if len(self.expected_image_keys) > 0:
|
||||
batch = dict(
|
||||
batch
|
||||
) # shallow copy so that adding a key doesn't modify the original
|
||||
batch["observation.images"] = torch.stack(
|
||||
[batch[k] for k in self.expected_image_keys], dim=-4
|
||||
)
|
||||
batch = self.normalize_targets(batch)
|
||||
actions_hat, (mu_hat, log_sigma_x2_hat) = self.model(batch)
|
||||
|
||||
l1_loss = (
|
||||
F.l1_loss(batch["action"], actions_hat, reduction="none") * ~batch["action_is_pad"].unsqueeze(-1)
|
||||
F.l1_loss(batch["action"], actions_hat, reduction="none")
|
||||
* ~batch["action_is_pad"].unsqueeze(-1)
|
||||
).mean()
|
||||
|
||||
loss_dict = {"l1_loss": l1_loss.item()}
|
||||
@@ -150,7 +164,12 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
# KL-divergence per batch element, then take the mean over the batch.
|
||||
# (See App. B of https://arxiv.org/abs/1312.6114 for more details).
|
||||
mean_kld = (
|
||||
(-0.5 * (1 + log_sigma_x2_hat - mu_hat.pow(2) - (log_sigma_x2_hat).exp())).sum(-1).mean()
|
||||
(
|
||||
-0.5
|
||||
* (1 + log_sigma_x2_hat - mu_hat.pow(2) - (log_sigma_x2_hat).exp())
|
||||
)
|
||||
.sum(-1)
|
||||
.mean()
|
||||
)
|
||||
loss_dict["kld_loss"] = mean_kld.item()
|
||||
loss_dict["loss"] = l1_loss + mean_kld * self.config.kl_weight
|
||||
@@ -160,6 +179,116 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
return loss_dict
|
||||
|
||||
|
||||
class ACTTemporalEnsembler:
|
||||
def __init__(self, temporal_ensemble_coeff: float, chunk_size: int) -> None:
|
||||
"""Temporal ensembling as described in Algorithm 2 of https://arxiv.org/abs/2304.13705.
|
||||
|
||||
The weights are calculated as wᵢ = exp(-temporal_ensemble_coeff * i) where w₀ is the oldest action.
|
||||
They are then normalized to sum to 1 by dividing by Σwᵢ. Here's some intuition around how the
|
||||
coefficient works:
|
||||
- Setting it to 0 uniformly weighs all actions.
|
||||
- Setting it positive gives more weight to older actions.
|
||||
- Setting it negative gives more weight to newer actions.
|
||||
NOTE: The default value for `temporal_ensemble_coeff` used by the original ACT work is 0.01. This
|
||||
results in older actions being weighed more highly than newer actions (the experiments documented in
|
||||
https://github.com/huggingface/lerobot/pull/319 hint at why highly weighing new actions might be
|
||||
detrimental: doing so aggressively may diminish the benefits of action chunking).
|
||||
|
||||
Here we use an online method for computing the average rather than caching a history of actions in
|
||||
order to compute the average offline. For a simple 1D sequence it looks something like:
|
||||
|
||||
```
|
||||
import torch
|
||||
|
||||
seq = torch.linspace(8, 8.5, 100)
|
||||
print(seq)
|
||||
|
||||
m = 0.01
|
||||
exp_weights = torch.exp(-m * torch.arange(len(seq)))
|
||||
print(exp_weights)
|
||||
|
||||
# Calculate offline
|
||||
avg = (exp_weights * seq).sum() / exp_weights.sum()
|
||||
print("offline", avg)
|
||||
|
||||
# Calculate online
|
||||
for i, item in enumerate(seq):
|
||||
if i == 0:
|
||||
avg = item
|
||||
continue
|
||||
avg *= exp_weights[:i].sum()
|
||||
avg += item * exp_weights[i]
|
||||
avg /= exp_weights[:i+1].sum()
|
||||
print("online", avg)
|
||||
```
|
||||
"""
|
||||
self.chunk_size = chunk_size
|
||||
self.ensemble_weights = torch.exp(
|
||||
-temporal_ensemble_coeff * torch.arange(chunk_size)
|
||||
)
|
||||
self.ensemble_weights_cumsum = torch.cumsum(self.ensemble_weights, dim=0)
|
||||
self.reset()
|
||||
|
||||
def reset(self):
|
||||
"""Resets the online computation variables."""
|
||||
self.ensembled_actions = None
|
||||
# (chunk_size,) count of how many actions are in the ensemble for each time step in the sequence.
|
||||
self.ensembled_actions_count = None
|
||||
|
||||
def update(self, actions: Tensor) -> Tensor:
|
||||
"""
|
||||
Takes a (batch, chunk_size, action_dim) sequence of actions, update the temporal ensemble for all
|
||||
time steps, and pop/return the next batch of actions in the sequence.
|
||||
"""
|
||||
self.ensemble_weights = self.ensemble_weights.to(device=actions.device)
|
||||
self.ensemble_weights_cumsum = self.ensemble_weights_cumsum.to(
|
||||
device=actions.device
|
||||
)
|
||||
if self.ensembled_actions is None:
|
||||
# Initializes `self._ensembled_action` to the sequence of actions predicted during the first
|
||||
# time step of the episode.
|
||||
self.ensembled_actions = actions.clone()
|
||||
# Note: The last dimension is unsqueeze to make sure we can broadcast properly for tensor
|
||||
# operations later.
|
||||
self.ensembled_actions_count = torch.ones(
|
||||
(self.chunk_size, 1),
|
||||
dtype=torch.long,
|
||||
device=self.ensembled_actions.device,
|
||||
)
|
||||
else:
|
||||
# self.ensembled_actions will have shape (batch_size, chunk_size - 1, action_dim). Compute
|
||||
# the online update for those entries.
|
||||
self.ensembled_actions *= self.ensemble_weights_cumsum[
|
||||
self.ensembled_actions_count - 1
|
||||
]
|
||||
self.ensembled_actions += (
|
||||
actions[:, :-1] * self.ensemble_weights[self.ensembled_actions_count]
|
||||
)
|
||||
self.ensembled_actions /= self.ensemble_weights_cumsum[
|
||||
self.ensembled_actions_count
|
||||
]
|
||||
self.ensembled_actions_count = torch.clamp(
|
||||
self.ensembled_actions_count + 1, max=self.chunk_size
|
||||
)
|
||||
# The last action, which has no prior online average, needs to get concatenated onto the end.
|
||||
self.ensembled_actions = torch.cat(
|
||||
[self.ensembled_actions, actions[:, -1:]], dim=1
|
||||
)
|
||||
self.ensembled_actions_count = torch.cat(
|
||||
[
|
||||
self.ensembled_actions_count,
|
||||
torch.ones_like(self.ensembled_actions_count[-1:]),
|
||||
]
|
||||
)
|
||||
# "Consume" the first action.
|
||||
action, self.ensembled_actions, self.ensembled_actions_count = (
|
||||
self.ensembled_actions[:, 0],
|
||||
self.ensembled_actions[:, 1:],
|
||||
self.ensembled_actions_count[1:],
|
||||
)
|
||||
return action
|
||||
|
||||
|
||||
class ACT(nn.Module):
|
||||
"""Action Chunking Transformer: The underlying neural network for ACTPolicy.
|
||||
|
||||
@@ -200,12 +329,16 @@ class ACT(nn.Module):
|
||||
self.config = config
|
||||
# BERT style VAE encoder with input tokens [cls, robot_state, *action_sequence].
|
||||
# The cls token forms parameters of the latent's distribution (like this [*means, *log_variances]).
|
||||
self.use_input_state = "observation.state" in config.input_shapes
|
||||
self.use_robot_state = "observation.state" in config.input_shapes
|
||||
self.use_images = any(
|
||||
k.startswith("observation.image") for k in config.input_shapes
|
||||
)
|
||||
self.use_env_state = "observation.environment_state" in config.input_shapes
|
||||
if self.config.use_vae:
|
||||
self.vae_encoder = ACTEncoder(config)
|
||||
self.vae_encoder = ACTEncoder(config, is_vae_encoder=True)
|
||||
self.vae_encoder_cls_embed = nn.Embedding(1, config.dim_model)
|
||||
# Projection layer for joint-space configuration to hidden dimension.
|
||||
if self.use_input_state:
|
||||
if self.use_robot_state:
|
||||
self.vae_encoder_robot_state_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.state"][0], config.dim_model
|
||||
)
|
||||
@@ -214,53 +347,79 @@ class ACT(nn.Module):
|
||||
config.output_shapes["action"][0], config.dim_model
|
||||
)
|
||||
# Projection layer from the VAE encoder's output to the latent distribution's parameter space.
|
||||
self.vae_encoder_latent_output_proj = nn.Linear(config.dim_model, config.latent_dim * 2)
|
||||
self.vae_encoder_latent_output_proj = nn.Linear(
|
||||
config.dim_model, config.latent_dim * 2
|
||||
)
|
||||
# Fixed sinusoidal positional embedding for the input to the VAE encoder. Unsqueeze for batch
|
||||
# dimension.
|
||||
num_input_token_encoder = 1 + config.chunk_size
|
||||
if self.use_input_state:
|
||||
if self.use_robot_state:
|
||||
num_input_token_encoder += 1
|
||||
self.register_buffer(
|
||||
"vae_encoder_pos_enc",
|
||||
create_sinusoidal_pos_embedding(num_input_token_encoder, config.dim_model).unsqueeze(0),
|
||||
create_sinusoidal_pos_embedding(
|
||||
num_input_token_encoder, config.dim_model
|
||||
).unsqueeze(0),
|
||||
)
|
||||
|
||||
# Backbone for image feature extraction.
|
||||
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
||||
replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
|
||||
weights=config.pretrained_backbone_weights,
|
||||
norm_layer=FrozenBatchNorm2d,
|
||||
)
|
||||
# Note: The assumption here is that we are using a ResNet model (and hence layer4 is the final feature
|
||||
# map).
|
||||
# Note: The forward method of this returns a dict: {"feature_map": output}.
|
||||
self.backbone = IntermediateLayerGetter(backbone_model, return_layers={"layer4": "feature_map"})
|
||||
if self.use_images:
|
||||
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
||||
replace_stride_with_dilation=[
|
||||
False,
|
||||
False,
|
||||
config.replace_final_stride_with_dilation,
|
||||
],
|
||||
weights=config.pretrained_backbone_weights,
|
||||
norm_layer=FrozenBatchNorm2d,
|
||||
)
|
||||
# Note: The assumption here is that we are using a ResNet model (and hence layer4 is the final
|
||||
# feature map).
|
||||
# Note: The forward method of this returns a dict: {"feature_map": output}.
|
||||
self.backbone = IntermediateLayerGetter(
|
||||
backbone_model, return_layers={"layer4": "feature_map"}
|
||||
)
|
||||
|
||||
# Transformer (acts as VAE decoder when training with the variational objective).
|
||||
self.encoder = ACTEncoder(config)
|
||||
self.decoder = ACTDecoder(config)
|
||||
|
||||
# Transformer encoder input projections. The tokens will be structured like
|
||||
# [latent, robot_state, image_feature_map_pixels].
|
||||
if self.use_input_state:
|
||||
# [latent, (robot_state), (env_state), (image_feature_map_pixels)].
|
||||
if self.use_robot_state:
|
||||
self.encoder_robot_state_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.state"][0], config.dim_model
|
||||
)
|
||||
if self.use_env_state:
|
||||
self.encoder_env_state_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.environment_state"][0],
|
||||
config.dim_model,
|
||||
)
|
||||
self.encoder_latent_input_proj = nn.Linear(config.latent_dim, config.dim_model)
|
||||
self.encoder_img_feat_input_proj = nn.Conv2d(
|
||||
backbone_model.fc.in_features, config.dim_model, kernel_size=1
|
||||
)
|
||||
if self.use_images:
|
||||
self.encoder_img_feat_input_proj = nn.Conv2d(
|
||||
backbone_model.fc.in_features, config.dim_model, kernel_size=1
|
||||
)
|
||||
# Transformer encoder positional embeddings.
|
||||
num_input_token_decoder = 2 if self.use_input_state else 1
|
||||
self.encoder_robot_and_latent_pos_embed = nn.Embedding(num_input_token_decoder, config.dim_model)
|
||||
self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(config.dim_model // 2)
|
||||
n_1d_tokens = 1 # for the latent
|
||||
if self.use_robot_state:
|
||||
n_1d_tokens += 1
|
||||
if self.use_env_state:
|
||||
n_1d_tokens += 1
|
||||
self.encoder_1d_feature_pos_embed = nn.Embedding(n_1d_tokens, config.dim_model)
|
||||
if self.use_images:
|
||||
self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(
|
||||
config.dim_model // 2
|
||||
)
|
||||
|
||||
# Transformer decoder.
|
||||
# Learnable positional embedding for the transformer's decoder (in the style of DETR object queries).
|
||||
self.decoder_pos_embed = nn.Embedding(config.chunk_size, config.dim_model)
|
||||
|
||||
# Final action regression head on the output of the transformer's decoder.
|
||||
self.action_head = nn.Linear(config.dim_model, config.output_shapes["action"][0])
|
||||
self.action_head = nn.Linear(
|
||||
config.dim_model, config.output_shapes["action"][0]
|
||||
)
|
||||
|
||||
self._reset_parameters()
|
||||
|
||||
@@ -270,14 +429,19 @@ class ACT(nn.Module):
|
||||
if p.dim() > 1:
|
||||
nn.init.xavier_uniform_(p)
|
||||
|
||||
def forward(self, batch: dict[str, Tensor]) -> tuple[Tensor, tuple[Tensor, Tensor] | tuple[None, None]]:
|
||||
def forward(
|
||||
self, batch: dict[str, Tensor]
|
||||
) -> tuple[Tensor, tuple[Tensor, Tensor] | tuple[None, None]]:
|
||||
"""A forward pass through the Action Chunking Transformer (with optional VAE encoder).
|
||||
|
||||
`batch` should have the following structure:
|
||||
|
||||
{
|
||||
"observation.state": (B, state_dim) batch of robot states.
|
||||
"observation.state" (optional): (B, state_dim) batch of robot states.
|
||||
|
||||
"observation.images": (B, n_cameras, C, H, W) batch of images.
|
||||
AND/OR
|
||||
"observation.environment_state": (B, env_dim) batch of environment states.
|
||||
|
||||
"action" (optional, only if training with VAE): (B, chunk_size, action dim) batch of actions.
|
||||
}
|
||||
|
||||
@@ -291,7 +455,11 @@ class ACT(nn.Module):
|
||||
"action" in batch
|
||||
), "actions must be provided when using the variational objective in training mode."
|
||||
|
||||
batch_size = batch["observation.images"].shape[0]
|
||||
batch_size = (
|
||||
batch["observation.images"]
|
||||
if "observation.images" in batch
|
||||
else batch["observation.environment_state"]
|
||||
).shape[0]
|
||||
|
||||
# Prepare the latent for input to the transformer encoder.
|
||||
if self.config.use_vae and "action" in batch:
|
||||
@@ -299,13 +467,21 @@ class ACT(nn.Module):
|
||||
cls_embed = einops.repeat(
|
||||
self.vae_encoder_cls_embed.weight, "1 d -> b 1 d", b=batch_size
|
||||
) # (B, 1, D)
|
||||
if self.use_input_state:
|
||||
robot_state_embed = self.vae_encoder_robot_state_input_proj(batch["observation.state"])
|
||||
if self.use_robot_state:
|
||||
robot_state_embed = self.vae_encoder_robot_state_input_proj(
|
||||
batch["observation.state"]
|
||||
)
|
||||
robot_state_embed = robot_state_embed.unsqueeze(1) # (B, 1, D)
|
||||
action_embed = self.vae_encoder_action_input_proj(batch["action"]) # (B, S, D)
|
||||
action_embed = self.vae_encoder_action_input_proj(
|
||||
batch["action"]
|
||||
) # (B, S, D)
|
||||
|
||||
if self.use_input_state:
|
||||
vae_encoder_input = [cls_embed, robot_state_embed, action_embed] # (B, S+2, D)
|
||||
if self.use_robot_state:
|
||||
vae_encoder_input = [
|
||||
cls_embed,
|
||||
robot_state_embed,
|
||||
action_embed,
|
||||
] # (B, S+2, D)
|
||||
else:
|
||||
vae_encoder_input = [cls_embed, action_embed]
|
||||
vae_encoder_input = torch.cat(vae_encoder_input, axis=1)
|
||||
@@ -314,11 +490,19 @@ class ACT(nn.Module):
|
||||
# Note: detach() shouldn't be necessary but leaving it the same as the original code just in case.
|
||||
pos_embed = self.vae_encoder_pos_enc.clone().detach() # (1, S+2, D)
|
||||
|
||||
# Prepare key padding mask for the transformer encoder. We have 1 or 2 extra tokens at the start of the
|
||||
# sequence depending whether we use the input states or not (cls and robot state)
|
||||
# False means not a padding token.
|
||||
cls_joint_is_pad = torch.full(
|
||||
(batch_size, 2 if self.use_robot_state else 1),
|
||||
False,
|
||||
device=batch["observation.state"].device,
|
||||
)
|
||||
key_padding_mask = torch.cat(
|
||||
[cls_joint_is_pad, batch["action_is_pad"]], axis=1
|
||||
) # (bs, seq+1 or 2)
|
||||
|
||||
# Forward pass through VAE encoder to get the latent PDF parameters.
|
||||
cls_joint_is_pad = torch.full((batch_size, 2), False).to(
|
||||
batch["observation.state"].device
|
||||
) # False: not a padding
|
||||
key_padding_mask = torch.cat([cls_joint_is_pad, batch["action_is_pad"]], axis=1) # (bs, seq+1)
|
||||
cls_token_out = self.vae_encoder(
|
||||
vae_encoder_input.permute(1, 0, 2),
|
||||
pos_embed=pos_embed.permute(1, 0, 2),
|
||||
@@ -335,60 +519,74 @@ class ACT(nn.Module):
|
||||
# When not using the VAE encoder, we set the latent to be all zeros.
|
||||
mu = log_sigma_x2 = None
|
||||
# TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use buffer
|
||||
latent_sample = torch.zeros([batch_size, self.config.latent_dim], dtype=torch.float32).to(
|
||||
batch["observation.state"].device
|
||||
latent_sample = torch.zeros(
|
||||
[batch_size, self.config.latent_dim], dtype=torch.float32
|
||||
).to(batch["observation.state"].device)
|
||||
|
||||
# Prepare transformer encoder inputs.
|
||||
encoder_in_tokens = [self.encoder_latent_input_proj(latent_sample)]
|
||||
encoder_in_pos_embed = list(
|
||||
self.encoder_1d_feature_pos_embed.weight.unsqueeze(1)
|
||||
)
|
||||
# Robot state token.
|
||||
if self.use_robot_state:
|
||||
encoder_in_tokens.append(
|
||||
self.encoder_robot_state_input_proj(batch["observation.state"])
|
||||
)
|
||||
# Environment state token.
|
||||
if self.use_env_state:
|
||||
encoder_in_tokens.append(
|
||||
self.encoder_env_state_input_proj(
|
||||
batch["observation.environment_state"]
|
||||
)
|
||||
)
|
||||
|
||||
# Prepare all other transformer encoder inputs.
|
||||
# Camera observation features and positional embeddings.
|
||||
all_cam_features = []
|
||||
all_cam_pos_embeds = []
|
||||
images = batch["observation.images"]
|
||||
if self.use_images:
|
||||
all_cam_features = []
|
||||
all_cam_pos_embeds = []
|
||||
|
||||
for cam_index in range(images.shape[-4]):
|
||||
cam_features = self.backbone(images[:, cam_index])["feature_map"]
|
||||
# TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use buffer
|
||||
cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(dtype=cam_features.dtype)
|
||||
cam_features = self.encoder_img_feat_input_proj(cam_features) # (B, C, h, w)
|
||||
all_cam_features.append(cam_features)
|
||||
all_cam_pos_embeds.append(cam_pos_embed)
|
||||
# Concatenate camera observation feature maps and positional embeddings along the width dimension.
|
||||
encoder_in = torch.cat(all_cam_features, axis=-1)
|
||||
cam_pos_embed = torch.cat(all_cam_pos_embeds, axis=-1)
|
||||
for cam_index in range(batch["observation.images"].shape[-4]):
|
||||
cam_features = self.backbone(batch["observation.images"][:, cam_index])[
|
||||
"feature_map"
|
||||
]
|
||||
# TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use
|
||||
# buffer
|
||||
cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(
|
||||
dtype=cam_features.dtype
|
||||
)
|
||||
cam_features = self.encoder_img_feat_input_proj(
|
||||
cam_features
|
||||
) # (B, C, h, w)
|
||||
all_cam_features.append(cam_features)
|
||||
all_cam_pos_embeds.append(cam_pos_embed)
|
||||
# Concatenate camera observation feature maps and positional embeddings along the width dimension,
|
||||
# and move to (sequence, batch, dim).
|
||||
all_cam_features = torch.cat(all_cam_features, axis=-1)
|
||||
encoder_in_tokens.extend(
|
||||
einops.rearrange(all_cam_features, "b c h w -> (h w) b c")
|
||||
)
|
||||
all_cam_pos_embeds = torch.cat(all_cam_pos_embeds, axis=-1)
|
||||
encoder_in_pos_embed.extend(
|
||||
einops.rearrange(all_cam_pos_embeds, "b c h w -> (h w) b c")
|
||||
)
|
||||
|
||||
# Get positional embeddings for robot state and latent.
|
||||
if self.use_input_state:
|
||||
robot_state_embed = self.encoder_robot_state_input_proj(batch["observation.state"]) # (B, C)
|
||||
latent_embed = self.encoder_latent_input_proj(latent_sample) # (B, C)
|
||||
|
||||
# Stack encoder input and positional embeddings moving to (S, B, C).
|
||||
encoder_in_feats = [latent_embed, robot_state_embed] if self.use_input_state else [latent_embed]
|
||||
encoder_in = torch.cat(
|
||||
[
|
||||
torch.stack(encoder_in_feats, axis=0),
|
||||
einops.rearrange(encoder_in, "b c h w -> (h w) b c"),
|
||||
]
|
||||
)
|
||||
pos_embed = torch.cat(
|
||||
[
|
||||
self.encoder_robot_and_latent_pos_embed.weight.unsqueeze(1),
|
||||
cam_pos_embed.flatten(2).permute(2, 0, 1),
|
||||
],
|
||||
axis=0,
|
||||
)
|
||||
# Stack all tokens along the sequence dimension.
|
||||
encoder_in_tokens = torch.stack(encoder_in_tokens, axis=0)
|
||||
encoder_in_pos_embed = torch.stack(encoder_in_pos_embed, axis=0)
|
||||
|
||||
# Forward pass through the transformer modules.
|
||||
encoder_out = self.encoder(encoder_in, pos_embed=pos_embed)
|
||||
encoder_out = self.encoder(encoder_in_tokens, pos_embed=encoder_in_pos_embed)
|
||||
# TODO(rcadene, alexander-soare): remove call to `device` ; precompute and use buffer
|
||||
decoder_in = torch.zeros(
|
||||
(self.config.chunk_size, batch_size, self.config.dim_model),
|
||||
dtype=pos_embed.dtype,
|
||||
device=pos_embed.device,
|
||||
dtype=encoder_in_pos_embed.dtype,
|
||||
device=encoder_in_pos_embed.device,
|
||||
)
|
||||
decoder_out = self.decoder(
|
||||
decoder_in,
|
||||
encoder_out,
|
||||
encoder_pos_embed=pos_embed,
|
||||
encoder_pos_embed=encoder_in_pos_embed,
|
||||
decoder_pos_embed=self.decoder_pos_embed.weight.unsqueeze(1),
|
||||
)
|
||||
|
||||
@@ -403,13 +601,24 @@ class ACT(nn.Module):
|
||||
class ACTEncoder(nn.Module):
|
||||
"""Convenience module for running multiple encoder layers, maybe followed by normalization."""
|
||||
|
||||
def __init__(self, config: ACTConfig):
|
||||
def __init__(self, config: ACTConfig, is_vae_encoder: bool = False):
|
||||
super().__init__()
|
||||
self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(config.n_encoder_layers)])
|
||||
self.is_vae_encoder = is_vae_encoder
|
||||
num_layers = (
|
||||
config.n_vae_encoder_layers
|
||||
if self.is_vae_encoder
|
||||
else config.n_encoder_layers
|
||||
)
|
||||
self.layers = nn.ModuleList(
|
||||
[ACTEncoderLayer(config) for _ in range(num_layers)]
|
||||
)
|
||||
self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
|
||||
|
||||
def forward(
|
||||
self, x: Tensor, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None
|
||||
self,
|
||||
x: Tensor,
|
||||
pos_embed: Tensor | None = None,
|
||||
key_padding_mask: Tensor | None = None,
|
||||
) -> Tensor:
|
||||
for layer in self.layers:
|
||||
x = layer(x, pos_embed=pos_embed, key_padding_mask=key_padding_mask)
|
||||
@@ -420,7 +629,9 @@ class ACTEncoder(nn.Module):
|
||||
class ACTEncoderLayer(nn.Module):
|
||||
def __init__(self, config: ACTConfig):
|
||||
super().__init__()
|
||||
self.self_attn = nn.MultiheadAttention(config.dim_model, config.n_heads, dropout=config.dropout)
|
||||
self.self_attn = nn.MultiheadAttention(
|
||||
config.dim_model, config.n_heads, dropout=config.dropout
|
||||
)
|
||||
|
||||
# Feed forward layers.
|
||||
self.linear1 = nn.Linear(config.dim_model, config.dim_feedforward)
|
||||
@@ -435,14 +646,15 @@ class ACTEncoderLayer(nn.Module):
|
||||
self.activation = get_activation_fn(config.feedforward_activation)
|
||||
self.pre_norm = config.pre_norm
|
||||
|
||||
def forward(self, x, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None) -> Tensor:
|
||||
def forward(
|
||||
self, x, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None
|
||||
) -> Tensor:
|
||||
skip = x
|
||||
if self.pre_norm:
|
||||
x = self.norm1(x)
|
||||
q = k = x if pos_embed is None else x + pos_embed
|
||||
x = self.self_attn(q, k, value=x, key_padding_mask=key_padding_mask)[
|
||||
0
|
||||
] # select just the output, not the attention weights
|
||||
x = self.self_attn(q, k, value=x, key_padding_mask=key_padding_mask)
|
||||
x = x[0] # note: [0] to select just the output, not the attention weights
|
||||
x = skip + self.dropout1(x)
|
||||
if self.pre_norm:
|
||||
skip = x
|
||||
@@ -461,11 +673,10 @@ class ACTDecoder(nn.Module):
|
||||
def __init__(self, config: ACTConfig):
|
||||
"""Convenience module for running multiple decoder layers followed by normalization."""
|
||||
super().__init__()
|
||||
self.layers = nn.ModuleList([ACTDecoderLayer(config) for _ in range(config.n_decoder_layers)])
|
||||
if config.decoder_norm:
|
||||
self.norm = nn.LayerNorm(config.dim_model)
|
||||
else:
|
||||
self.norm = nn.Identity()
|
||||
self.layers = nn.ModuleList(
|
||||
[ACTDecoderLayer(config) for _ in range(config.n_decoder_layers)]
|
||||
)
|
||||
self.norm = nn.LayerNorm(config.dim_model)
|
||||
|
||||
def forward(
|
||||
self,
|
||||
@@ -476,17 +687,25 @@ class ACTDecoder(nn.Module):
|
||||
) -> Tensor:
|
||||
for layer in self.layers:
|
||||
x = layer(
|
||||
x, encoder_out, decoder_pos_embed=decoder_pos_embed, encoder_pos_embed=encoder_pos_embed
|
||||
x,
|
||||
encoder_out,
|
||||
decoder_pos_embed=decoder_pos_embed,
|
||||
encoder_pos_embed=encoder_pos_embed,
|
||||
)
|
||||
x = self.norm(x)
|
||||
if self.norm is not None:
|
||||
x = self.norm(x)
|
||||
return x
|
||||
|
||||
|
||||
class ACTDecoderLayer(nn.Module):
|
||||
def __init__(self, config: ACTConfig):
|
||||
super().__init__()
|
||||
self.self_attn = nn.MultiheadAttention(config.dim_model, config.n_heads, dropout=config.dropout)
|
||||
self.multihead_attn = nn.MultiheadAttention(config.dim_model, config.n_heads, dropout=config.dropout)
|
||||
self.self_attn = nn.MultiheadAttention(
|
||||
config.dim_model, config.n_heads, dropout=config.dropout
|
||||
)
|
||||
self.multihead_attn = nn.MultiheadAttention(
|
||||
config.dim_model, config.n_heads, dropout=config.dropout
|
||||
)
|
||||
|
||||
# Feed forward layers.
|
||||
self.linear1 = nn.Linear(config.dim_model, config.dim_feedforward)
|
||||
@@ -527,7 +746,9 @@ class ACTDecoderLayer(nn.Module):
|
||||
if self.pre_norm:
|
||||
x = self.norm1(x)
|
||||
q = k = self.maybe_add_pos_embed(x, decoder_pos_embed)
|
||||
x = self.self_attn(q, k, value=x)[0] # select just the output, not the attention weights
|
||||
x = self.self_attn(q, k, value=x)[
|
||||
0
|
||||
] # select just the output, not the attention weights
|
||||
x = skip + self.dropout1(x)
|
||||
if self.pre_norm:
|
||||
skip = x
|
||||
@@ -564,9 +785,14 @@ def create_sinusoidal_pos_embedding(num_positions: int, dimension: int) -> Tenso
|
||||
"""
|
||||
|
||||
def get_position_angle_vec(position):
|
||||
return [position / np.power(10000, 2 * (hid_j // 2) / dimension) for hid_j in range(dimension)]
|
||||
return [
|
||||
position / np.power(10000, 2 * (hid_j // 2) / dimension)
|
||||
for hid_j in range(dimension)
|
||||
]
|
||||
|
||||
sinusoid_table = np.array([get_position_angle_vec(pos_i) for pos_i in range(num_positions)])
|
||||
sinusoid_table = np.array(
|
||||
[get_position_angle_vec(pos_i) for pos_i in range(num_positions)]
|
||||
)
|
||||
sinusoid_table[:, 0::2] = np.sin(sinusoid_table[:, 0::2]) # dim 2i
|
||||
sinusoid_table[:, 1::2] = np.cos(sinusoid_table[:, 1::2]) # dim 2i+1
|
||||
return torch.from_numpy(sinusoid_table).float()
|
||||
@@ -611,7 +837,9 @@ class ACTSinusoidalPositionEmbedding2d(nn.Module):
|
||||
x_range = x_range / (x_range[:, :, -1:] + self._eps) * self._two_pi
|
||||
|
||||
inverse_frequency = self._temperature ** (
|
||||
2 * (torch.arange(self.dimension, dtype=torch.float32, device=x.device) // 2) / self.dimension
|
||||
2
|
||||
* (torch.arange(self.dimension, dtype=torch.float32, device=x.device) // 2)
|
||||
/ self.dimension
|
||||
)
|
||||
|
||||
x_range = x_range.unsqueeze(-1) / inverse_frequency # (1, H, W, 1)
|
||||
@@ -619,9 +847,15 @@ class ACTSinusoidalPositionEmbedding2d(nn.Module):
|
||||
|
||||
# Note: this stack then flatten operation results in interleaved sine and cosine terms.
|
||||
# pos_embed_x and pos_embed_y are (1, H, W, C // 2).
|
||||
pos_embed_x = torch.stack((x_range[..., 0::2].sin(), x_range[..., 1::2].cos()), dim=-1).flatten(3)
|
||||
pos_embed_y = torch.stack((y_range[..., 0::2].sin(), y_range[..., 1::2].cos()), dim=-1).flatten(3)
|
||||
pos_embed = torch.cat((pos_embed_y, pos_embed_x), dim=3).permute(0, 3, 1, 2) # (1, C, H, W)
|
||||
pos_embed_x = torch.stack(
|
||||
(x_range[..., 0::2].sin(), x_range[..., 1::2].cos()), dim=-1
|
||||
).flatten(3)
|
||||
pos_embed_y = torch.stack(
|
||||
(y_range[..., 0::2].sin(), y_range[..., 1::2].cos()), dim=-1
|
||||
).flatten(3)
|
||||
pos_embed = torch.cat((pos_embed_y, pos_embed_x), dim=3).permute(
|
||||
0, 3, 1, 2
|
||||
) # (1, C, H, W)
|
||||
|
||||
return pos_embed
|
||||
|
||||
|
||||
@@ -28,7 +28,12 @@ class DiffusionConfig:
|
||||
|
||||
Notes on the inputs and outputs:
|
||||
- "observation.state" is required as an input key.
|
||||
- A key starting with "observation.image is required as an input.
|
||||
- Either:
|
||||
- At least one key starting with "observation.image is required as an input.
|
||||
AND/OR
|
||||
- The key "observation.environment_state" is required as input.
|
||||
- If there are multiple keys beginning with "observation.image" they are treated as multiple camera
|
||||
views. Right now we only support all images having the same shape.
|
||||
- "action" is required as an output key.
|
||||
|
||||
Args:
|
||||
@@ -62,6 +67,7 @@ class DiffusionConfig:
|
||||
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
||||
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
||||
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
||||
use_separate_rgb_encoders_per_camera: Whether to use a separate RGB encoder for each camera view.
|
||||
down_dims: Feature dimension for each stage of temporal downsampling in the diffusion modeling Unet.
|
||||
You may provide a variable number of dimensions, therefore also controlling the degree of
|
||||
downsampling.
|
||||
@@ -115,7 +121,9 @@ class DiffusionConfig:
|
||||
"observation.state": "min_max",
|
||||
}
|
||||
)
|
||||
output_normalization_modes: dict[str, str] = field(default_factory=lambda: {"action": "min_max"})
|
||||
output_normalization_modes: dict[str, str] = field(
|
||||
default_factory=lambda: {"action": "min_max"}
|
||||
)
|
||||
|
||||
# Architecture / modeling.
|
||||
# Vision backbone.
|
||||
@@ -125,6 +133,7 @@ class DiffusionConfig:
|
||||
pretrained_backbone_weights: str | None = None
|
||||
use_group_norm: bool = True
|
||||
spatial_softmax_num_keypoints: int = 32
|
||||
use_separate_rgb_encoder_per_camera: bool = False
|
||||
# Unet.
|
||||
down_dims: tuple[int, ...] = (512, 1024, 2048)
|
||||
kernel_size: int = 5
|
||||
@@ -153,22 +162,38 @@ class DiffusionConfig:
|
||||
raise ValueError(
|
||||
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||
)
|
||||
# There should only be one image key.
|
||||
|
||||
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
||||
if len(image_keys) != 1:
|
||||
raise ValueError(
|
||||
f"{self.__class__.__name__} only handles one image for now. Got image keys {image_keys}."
|
||||
)
|
||||
image_key = next(iter(image_keys))
|
||||
if self.crop_shape is not None and (
|
||||
self.crop_shape[0] > self.input_shapes[image_key][1]
|
||||
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
||||
|
||||
if (
|
||||
len(image_keys) == 0
|
||||
and "observation.environment_state" not in self.input_shapes
|
||||
):
|
||||
raise ValueError(
|
||||
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
||||
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
||||
"`input_shapes[{image_key}]`."
|
||||
"You must provide at least one image or the environment state among the inputs."
|
||||
)
|
||||
|
||||
if len(image_keys) > 0:
|
||||
if self.crop_shape is not None:
|
||||
for image_key in image_keys:
|
||||
if (
|
||||
self.crop_shape[0] > self.input_shapes[image_key][1]
|
||||
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
||||
):
|
||||
raise ValueError(
|
||||
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
||||
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
||||
"`input_shapes[{image_key}]`."
|
||||
)
|
||||
# Check that all input images have the same shape.
|
||||
first_image_key = next(iter(image_keys))
|
||||
for image_key in image_keys:
|
||||
if self.input_shapes[image_key] != self.input_shapes[first_image_key]:
|
||||
raise ValueError(
|
||||
f"`input_shapes[{image_key}]` does not match `input_shapes[{first_image_key}]`, but we "
|
||||
"expect all image shapes to match."
|
||||
)
|
||||
|
||||
supported_prediction_types = ["epsilon", "sample"]
|
||||
if self.prediction_type not in supported_prediction_types:
|
||||
raise ValueError(
|
||||
@@ -180,3 +205,12 @@ class DiffusionConfig:
|
||||
f"`noise_scheduler_type` must be one of {supported_noise_schedulers}. "
|
||||
f"Got {self.noise_scheduler_type}."
|
||||
)
|
||||
|
||||
# Check that the horizon size and U-Net downsampling is compatible.
|
||||
# U-Net downsamples by 2 with each stage.
|
||||
downsampling_factor = 2 ** len(self.down_dims)
|
||||
if self.horizon % downsampling_factor != 0:
|
||||
raise ValueError(
|
||||
"The horizon should be an integer multiple of the downsampling factor (which is determined "
|
||||
f"by `len(down_dims)`). Got {self.horizon=} and {self.down_dims=}"
|
||||
)
|
||||
|
||||
@@ -18,7 +18,6 @@
|
||||
|
||||
TODO(alexander-soare):
|
||||
- Remove reliance on diffusers for DDPMScheduler and LR scheduler.
|
||||
- Make compatible with multiple image keys.
|
||||
"""
|
||||
|
||||
import math
|
||||
@@ -44,7 +43,13 @@ from lerobot.common.policies.utils import (
|
||||
)
|
||||
|
||||
|
||||
class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
class DiffusionPolicy(
|
||||
nn.Module,
|
||||
PyTorchModelHubMixin,
|
||||
library_name="lerobot",
|
||||
repo_url="https://github.com/huggingface/lerobot",
|
||||
tags=["robotics", "diffusion-policy"],
|
||||
):
|
||||
"""
|
||||
Diffusion Policy as per "Diffusion Policy: Visuomotor Policy Learning via Action Diffusion"
|
||||
(paper: https://arxiv.org/abs/2303.04137, code: https://github.com/real-stanford/diffusion_policy).
|
||||
@@ -83,23 +88,25 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
|
||||
self.diffusion = DiffusionModel(config)
|
||||
|
||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
# Note: This check is covered in the post-init of the config but have a sanity check just in case.
|
||||
if len(image_keys) != 1:
|
||||
raise NotImplementedError(
|
||||
f"{self.__class__.__name__} only handles one image for now. Got image keys {image_keys}."
|
||||
)
|
||||
self.input_image_key = image_keys[0]
|
||||
self.expected_image_keys = [
|
||||
k for k in config.input_shapes if k.startswith("observation.image")
|
||||
]
|
||||
self.use_env_state = "observation.environment_state" in config.input_shapes
|
||||
|
||||
self.reset()
|
||||
|
||||
def reset(self):
|
||||
"""Clear observation and action queues. Should be called on `env.reset()`"""
|
||||
self._queues = {
|
||||
"observation.image": deque(maxlen=self.config.n_obs_steps),
|
||||
"observation.state": deque(maxlen=self.config.n_obs_steps),
|
||||
"action": deque(maxlen=self.config.n_action_steps),
|
||||
}
|
||||
if len(self.expected_image_keys) > 0:
|
||||
self._queues["observation.images"] = deque(maxlen=self.config.n_obs_steps)
|
||||
if self.use_env_state:
|
||||
self._queues["observation.environment_state"] = deque(
|
||||
maxlen=self.config.n_obs_steps
|
||||
)
|
||||
|
||||
@torch.no_grad
|
||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
@@ -114,23 +121,33 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
Schematically this looks like:
|
||||
----------------------------------------------------------------------------------------------
|
||||
(legend: o = n_obs_steps, h = horizon, a = n_action_steps)
|
||||
|timestep | n-o+1 | n-o+2 | ..... | n | ..... | n+a-1 | n+a | ..... |n-o+1+h|
|
||||
|observation is used | YES | YES | YES | NO | NO | NO | NO | NO | NO |
|
||||
|timestep | n-o+1 | n-o+2 | ..... | n | ..... | n+a-1 | n+a | ..... | n-o+h |
|
||||
|observation is used | YES | YES | YES | YES | NO | NO | NO | NO | NO |
|
||||
|action is generated | YES | YES | YES | YES | YES | YES | YES | YES | YES |
|
||||
|action is used | NO | NO | NO | YES | YES | YES | NO | NO | NO |
|
||||
----------------------------------------------------------------------------------------------
|
||||
Note that this means we require: `n_action_steps < horizon - n_obs_steps + 1`. Also, note that
|
||||
Note that this means we require: `n_action_steps <= horizon - n_obs_steps + 1`. Also, note that
|
||||
"horizon" may not the best name to describe what the variable actually means, because this period is
|
||||
actually measured from the first observation which (if `n_obs_steps` > 1) happened in the past.
|
||||
"""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
|
||||
if len(self.expected_image_keys) > 0:
|
||||
batch = dict(
|
||||
batch
|
||||
) # shallow copy so that adding a key doesn't modify the original
|
||||
batch["observation.images"] = torch.stack(
|
||||
[batch[k] for k in self.expected_image_keys], dim=-4
|
||||
)
|
||||
# Note: It's important that this happens after stacking the images into a single key.
|
||||
self._queues = populate_queues(self._queues, batch)
|
||||
|
||||
if len(self._queues["action"]) == 0:
|
||||
# stack n latest observations from the queue
|
||||
batch = {k: torch.stack(list(self._queues[k]), dim=1) for k in batch if k in self._queues}
|
||||
batch = {
|
||||
k: torch.stack(list(self._queues[k]), dim=1)
|
||||
for k in batch
|
||||
if k in self._queues
|
||||
}
|
||||
actions = self.diffusion.generate_actions(batch)
|
||||
|
||||
# TODO(rcadene): make above methods return output dictionary?
|
||||
@@ -144,7 +161,13 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||
"""Run the batch through the model and compute the loss for training or validation."""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
if len(self.expected_image_keys) > 0:
|
||||
batch = dict(
|
||||
batch
|
||||
) # shallow copy so that adding a key doesn't modify the original
|
||||
batch["observation.images"] = torch.stack(
|
||||
[batch[k] for k in self.expected_image_keys], dim=-4
|
||||
)
|
||||
batch = self.normalize_targets(batch)
|
||||
loss = self.diffusion.compute_loss(batch)
|
||||
return {"loss": loss}
|
||||
@@ -168,11 +191,28 @@ class DiffusionModel(nn.Module):
|
||||
super().__init__()
|
||||
self.config = config
|
||||
|
||||
self.rgb_encoder = DiffusionRgbEncoder(config)
|
||||
# Build observation encoders (depending on which observations are provided).
|
||||
global_cond_dim = config.input_shapes["observation.state"][0]
|
||||
num_images = len(
|
||||
[k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
)
|
||||
self._use_images = False
|
||||
self._use_env_state = False
|
||||
if num_images > 0:
|
||||
self._use_images = True
|
||||
if self.config.use_separate_rgb_encoder_per_camera:
|
||||
encoders = [DiffusionRgbEncoder(config) for _ in range(num_images)]
|
||||
self.rgb_encoder = nn.ModuleList(encoders)
|
||||
global_cond_dim += encoders[0].feature_dim * num_images
|
||||
else:
|
||||
self.rgb_encoder = DiffusionRgbEncoder(config)
|
||||
global_cond_dim += self.rgb_encoder.feature_dim * num_images
|
||||
if "observation.environment_state" in config.input_shapes:
|
||||
self._use_env_state = True
|
||||
global_cond_dim += config.input_shapes["observation.environment_state"][0]
|
||||
|
||||
self.unet = DiffusionConditionalUnet1d(
|
||||
config,
|
||||
global_cond_dim=(config.output_shapes["action"][0] + self.rgb_encoder.feature_dim)
|
||||
* config.n_obs_steps,
|
||||
config, global_cond_dim=global_cond_dim * config.n_obs_steps
|
||||
)
|
||||
|
||||
self.noise_scheduler = _make_noise_scheduler(
|
||||
@@ -193,14 +233,21 @@ class DiffusionModel(nn.Module):
|
||||
|
||||
# ========= inference ============
|
||||
def conditional_sample(
|
||||
self, batch_size: int, global_cond: Tensor | None = None, generator: torch.Generator | None = None
|
||||
self,
|
||||
batch_size: int,
|
||||
global_cond: Tensor | None = None,
|
||||
generator: torch.Generator | None = None,
|
||||
) -> Tensor:
|
||||
device = get_device_from_parameters(self)
|
||||
dtype = get_dtype_from_parameters(self)
|
||||
|
||||
# Sample prior.
|
||||
sample = torch.randn(
|
||||
size=(batch_size, self.config.horizon, self.config.output_shapes["action"][0]),
|
||||
size=(
|
||||
batch_size,
|
||||
self.config.horizon,
|
||||
self.config.output_shapes["action"][0],
|
||||
),
|
||||
dtype=dtype,
|
||||
device=device,
|
||||
generator=generator,
|
||||
@@ -216,27 +263,78 @@ class DiffusionModel(nn.Module):
|
||||
global_cond=global_cond,
|
||||
)
|
||||
# Compute previous image: x_t -> x_t-1
|
||||
sample = self.noise_scheduler.step(model_output, t, sample, generator=generator).prev_sample
|
||||
sample = self.noise_scheduler.step(
|
||||
model_output, t, sample, generator=generator
|
||||
).prev_sample
|
||||
|
||||
return sample
|
||||
|
||||
def _prepare_global_conditioning(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""Encode image features and concatenate them all together along with the state vector."""
|
||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||
global_cond_feats = [batch["observation.state"]]
|
||||
# Extract image features.
|
||||
if self._use_images:
|
||||
if self.config.use_separate_rgb_encoder_per_camera:
|
||||
# Combine batch and sequence dims while rearranging to make the camera index dimension first.
|
||||
images_per_camera = einops.rearrange(
|
||||
batch["observation.images"], "b s n ... -> n (b s) ..."
|
||||
)
|
||||
img_features_list = torch.cat(
|
||||
[
|
||||
encoder(images)
|
||||
for encoder, images in zip(
|
||||
self.rgb_encoder, images_per_camera, strict=True
|
||||
)
|
||||
]
|
||||
)
|
||||
# Separate batch and sequence dims back out. The camera index dim gets absorbed into the
|
||||
# feature dim (effectively concatenating the camera features).
|
||||
img_features = einops.rearrange(
|
||||
img_features_list,
|
||||
"(n b s) ... -> b s (n ...)",
|
||||
b=batch_size,
|
||||
s=n_obs_steps,
|
||||
)
|
||||
else:
|
||||
# Combine batch, sequence, and "which camera" dims before passing to shared encoder.
|
||||
img_features = self.rgb_encoder(
|
||||
einops.rearrange(
|
||||
batch["observation.images"], "b s n ... -> (b s n) ..."
|
||||
)
|
||||
)
|
||||
# Separate batch dim and sequence dim back out. The camera index dim gets absorbed into the
|
||||
# feature dim (effectively concatenating the camera features).
|
||||
img_features = einops.rearrange(
|
||||
img_features,
|
||||
"(b s n) ... -> b s (n ...)",
|
||||
b=batch_size,
|
||||
s=n_obs_steps,
|
||||
)
|
||||
global_cond_feats.append(img_features)
|
||||
|
||||
if self._use_env_state:
|
||||
global_cond_feats.append(batch["observation.environment_state"])
|
||||
|
||||
# Concatenate features then flatten to (B, global_cond_dim).
|
||||
return torch.cat(global_cond_feats, dim=-1).flatten(start_dim=1)
|
||||
|
||||
def generate_actions(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""
|
||||
This function expects `batch` to have:
|
||||
{
|
||||
"observation.state": (B, n_obs_steps, state_dim)
|
||||
"observation.image": (B, n_obs_steps, C, H, W)
|
||||
|
||||
"observation.images": (B, n_obs_steps, num_cameras, C, H, W)
|
||||
AND/OR
|
||||
"observation.environment_state": (B, environment_dim)
|
||||
}
|
||||
"""
|
||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||
assert n_obs_steps == self.config.n_obs_steps
|
||||
|
||||
# Extract image feature (first combine batch and sequence dims).
|
||||
img_features = self.rgb_encoder(einops.rearrange(batch["observation.image"], "b n ... -> (b n) ..."))
|
||||
# Separate batch and sequence dims.
|
||||
img_features = einops.rearrange(img_features, "(b n) ... -> b n ...", b=batch_size)
|
||||
# Concatenate state and image features then flatten to (B, global_cond_dim).
|
||||
global_cond = torch.cat([batch["observation.state"], img_features], dim=-1).flatten(start_dim=1)
|
||||
# Encode image features and concatenate them all together along with the state vector.
|
||||
global_cond = self._prepare_global_conditioning(batch) # (B, global_cond_dim)
|
||||
|
||||
# run sampling
|
||||
actions = self.conditional_sample(batch_size, global_cond=global_cond)
|
||||
@@ -253,28 +351,28 @@ class DiffusionModel(nn.Module):
|
||||
This function expects `batch` to have (at least):
|
||||
{
|
||||
"observation.state": (B, n_obs_steps, state_dim)
|
||||
"observation.image": (B, n_obs_steps, C, H, W)
|
||||
|
||||
"observation.images": (B, n_obs_steps, num_cameras, C, H, W)
|
||||
AND/OR
|
||||
"observation.environment_state": (B, environment_dim)
|
||||
|
||||
"action": (B, horizon, action_dim)
|
||||
"action_is_pad": (B, horizon)
|
||||
}
|
||||
"""
|
||||
# Input validation.
|
||||
assert set(batch).issuperset({"observation.state", "observation.image", "action", "action_is_pad"})
|
||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||
assert set(batch).issuperset({"observation.state", "action", "action_is_pad"})
|
||||
assert "observation.images" in batch or "observation.environment_state" in batch
|
||||
n_obs_steps = batch["observation.state"].shape[1]
|
||||
horizon = batch["action"].shape[1]
|
||||
assert horizon == self.config.horizon
|
||||
assert n_obs_steps == self.config.n_obs_steps
|
||||
|
||||
# Extract image feature (first combine batch and sequence dims).
|
||||
img_features = self.rgb_encoder(einops.rearrange(batch["observation.image"], "b n ... -> (b n) ..."))
|
||||
# Separate batch and sequence dims.
|
||||
img_features = einops.rearrange(img_features, "(b n) ... -> b n ...", b=batch_size)
|
||||
# Concatenate state and image features then flatten to (B, global_cond_dim).
|
||||
global_cond = torch.cat([batch["observation.state"], img_features], dim=-1).flatten(start_dim=1)
|
||||
|
||||
trajectory = batch["action"]
|
||||
# Encode image features and concatenate them all together along with the state vector.
|
||||
global_cond = self._prepare_global_conditioning(batch) # (B, global_cond_dim)
|
||||
|
||||
# Forward diffusion.
|
||||
trajectory = batch["action"]
|
||||
# Sample noise to add to the trajectory.
|
||||
eps = torch.randn(trajectory.shape, device=trajectory.device)
|
||||
# Sample a random noising timestep for each item in the batch.
|
||||
@@ -297,7 +395,9 @@ class DiffusionModel(nn.Module):
|
||||
elif self.config.prediction_type == "sample":
|
||||
target = batch["action"]
|
||||
else:
|
||||
raise ValueError(f"Unsupported prediction type {self.config.prediction_type}")
|
||||
raise ValueError(
|
||||
f"Unsupported prediction type {self.config.prediction_type}"
|
||||
)
|
||||
|
||||
loss = F.mse_loss(pred, target, reduction="none")
|
||||
|
||||
@@ -305,7 +405,8 @@ class DiffusionModel(nn.Module):
|
||||
if self.config.do_mask_loss_for_padding:
|
||||
if "action_is_pad" not in batch:
|
||||
raise ValueError(
|
||||
f"You need to provide 'action_is_pad' in the batch when {self.config.do_mask_loss_for_padding=}."
|
||||
"You need to provide 'action_is_pad' in the batch when "
|
||||
f"{self.config.do_mask_loss_for_padding=}."
|
||||
)
|
||||
in_episode_bound = ~batch["action_is_pad"]
|
||||
loss = loss * in_episode_bound.unsqueeze(-1)
|
||||
@@ -356,7 +457,9 @@ class SpatialSoftmax(nn.Module):
|
||||
|
||||
# we could use torch.linspace directly but that seems to behave slightly differently than numpy
|
||||
# and causes a small degradation in pc_success of pre-trained models.
|
||||
pos_x, pos_y = np.meshgrid(np.linspace(-1.0, 1.0, self._in_w), np.linspace(-1.0, 1.0, self._in_h))
|
||||
pos_x, pos_y = np.meshgrid(
|
||||
np.linspace(-1.0, 1.0, self._in_w), np.linspace(-1.0, 1.0, self._in_h)
|
||||
)
|
||||
pos_x = torch.from_numpy(pos_x.reshape(self._in_h * self._in_w, 1)).float()
|
||||
pos_y = torch.from_numpy(pos_y.reshape(self._in_h * self._in_w, 1)).float()
|
||||
# register as buffer so it's moved to the correct device.
|
||||
@@ -398,7 +501,9 @@ class DiffusionRgbEncoder(nn.Module):
|
||||
# Always use center crop for eval
|
||||
self.center_crop = torchvision.transforms.CenterCrop(config.crop_shape)
|
||||
if config.crop_is_random:
|
||||
self.maybe_random_crop = torchvision.transforms.RandomCrop(config.crop_shape)
|
||||
self.maybe_random_crop = torchvision.transforms.RandomCrop(
|
||||
config.crop_shape
|
||||
)
|
||||
else:
|
||||
self.maybe_random_crop = self.center_crop
|
||||
else:
|
||||
@@ -419,7 +524,9 @@ class DiffusionRgbEncoder(nn.Module):
|
||||
self.backbone = _replace_submodules(
|
||||
root_module=self.backbone,
|
||||
predicate=lambda x: isinstance(x, nn.BatchNorm2d),
|
||||
func=lambda x: nn.GroupNorm(num_groups=x.num_features // 16, num_channels=x.num_features),
|
||||
func=lambda x: nn.GroupNorm(
|
||||
num_groups=x.num_features // 16, num_channels=x.num_features
|
||||
),
|
||||
)
|
||||
|
||||
# Set up pooling and final layers.
|
||||
@@ -427,17 +534,25 @@ class DiffusionRgbEncoder(nn.Module):
|
||||
# The dummy input should take the number of image channels from `config.input_shapes` and it should
|
||||
# use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
|
||||
# height and width from `config.input_shapes`.
|
||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
assert len(image_keys) == 1
|
||||
image_keys = [
|
||||
k for k in config.input_shapes if k.startswith("observation.image")
|
||||
]
|
||||
# Note: we have a check in the config class to make sure all images have the same shape.
|
||||
image_key = image_keys[0]
|
||||
dummy_input_h_w = (
|
||||
config.crop_shape if config.crop_shape is not None else config.input_shapes[image_key][1:]
|
||||
config.crop_shape
|
||||
if config.crop_shape is not None
|
||||
else config.input_shapes[image_key][1:]
|
||||
)
|
||||
dummy_input = torch.zeros(
|
||||
size=(1, config.input_shapes[image_key][0], *dummy_input_h_w)
|
||||
)
|
||||
dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *dummy_input_h_w))
|
||||
with torch.inference_mode():
|
||||
dummy_feature_map = self.backbone(dummy_input)
|
||||
feature_map_shape = tuple(dummy_feature_map.shape[1:])
|
||||
self.pool = SpatialSoftmax(feature_map_shape, num_kp=config.spatial_softmax_num_keypoints)
|
||||
self.pool = SpatialSoftmax(
|
||||
feature_map_shape, num_kp=config.spatial_softmax_num_keypoints
|
||||
)
|
||||
self.feature_dim = config.spatial_softmax_num_keypoints * 2
|
||||
self.out = nn.Linear(config.spatial_softmax_num_keypoints * 2, self.feature_dim)
|
||||
self.relu = nn.ReLU()
|
||||
@@ -464,7 +579,9 @@ class DiffusionRgbEncoder(nn.Module):
|
||||
|
||||
|
||||
def _replace_submodules(
|
||||
root_module: nn.Module, predicate: Callable[[nn.Module], bool], func: Callable[[nn.Module], nn.Module]
|
||||
root_module: nn.Module,
|
||||
predicate: Callable[[nn.Module], bool],
|
||||
func: Callable[[nn.Module], nn.Module],
|
||||
) -> nn.Module:
|
||||
"""
|
||||
Args:
|
||||
@@ -477,7 +594,11 @@ def _replace_submodules(
|
||||
if predicate(root_module):
|
||||
return func(root_module)
|
||||
|
||||
replace_list = [k.split(".") for k, m in root_module.named_modules(remove_duplicate=True) if predicate(m)]
|
||||
replace_list = [
|
||||
k.split(".")
|
||||
for k, m in root_module.named_modules(remove_duplicate=True)
|
||||
if predicate(m)
|
||||
]
|
||||
for *parents, k in replace_list:
|
||||
parent_module = root_module
|
||||
if len(parents) > 0:
|
||||
@@ -492,7 +613,9 @@ def _replace_submodules(
|
||||
else:
|
||||
setattr(parent_module, k, tgt_module)
|
||||
# verify that all BN are replaced
|
||||
assert not any(predicate(m) for _, m in root_module.named_modules(remove_duplicate=True))
|
||||
assert not any(
|
||||
predicate(m) for _, m in root_module.named_modules(remove_duplicate=True)
|
||||
)
|
||||
return root_module
|
||||
|
||||
|
||||
@@ -520,7 +643,9 @@ class DiffusionConv1dBlock(nn.Module):
|
||||
super().__init__()
|
||||
|
||||
self.block = nn.Sequential(
|
||||
nn.Conv1d(inp_channels, out_channels, kernel_size, padding=kernel_size // 2),
|
||||
nn.Conv1d(
|
||||
inp_channels, out_channels, kernel_size, padding=kernel_size // 2
|
||||
),
|
||||
nn.GroupNorm(n_groups, out_channels),
|
||||
nn.Mish(),
|
||||
)
|
||||
@@ -543,9 +668,13 @@ class DiffusionConditionalUnet1d(nn.Module):
|
||||
# Encoder for the diffusion timestep.
|
||||
self.diffusion_step_encoder = nn.Sequential(
|
||||
DiffusionSinusoidalPosEmb(config.diffusion_step_embed_dim),
|
||||
nn.Linear(config.diffusion_step_embed_dim, config.diffusion_step_embed_dim * 4),
|
||||
nn.Linear(
|
||||
config.diffusion_step_embed_dim, config.diffusion_step_embed_dim * 4
|
||||
),
|
||||
nn.Mish(),
|
||||
nn.Linear(config.diffusion_step_embed_dim * 4, config.diffusion_step_embed_dim),
|
||||
nn.Linear(
|
||||
config.diffusion_step_embed_dim * 4, config.diffusion_step_embed_dim
|
||||
),
|
||||
)
|
||||
|
||||
# The FiLM conditioning dimension.
|
||||
@@ -570,10 +699,16 @@ class DiffusionConditionalUnet1d(nn.Module):
|
||||
self.down_modules.append(
|
||||
nn.ModuleList(
|
||||
[
|
||||
DiffusionConditionalResidualBlock1d(dim_in, dim_out, **common_res_block_kwargs),
|
||||
DiffusionConditionalResidualBlock1d(dim_out, dim_out, **common_res_block_kwargs),
|
||||
DiffusionConditionalResidualBlock1d(
|
||||
dim_in, dim_out, **common_res_block_kwargs
|
||||
),
|
||||
DiffusionConditionalResidualBlock1d(
|
||||
dim_out, dim_out, **common_res_block_kwargs
|
||||
),
|
||||
# Downsample as long as it is not the last block.
|
||||
nn.Conv1d(dim_out, dim_out, 3, 2, 1) if not is_last else nn.Identity(),
|
||||
nn.Conv1d(dim_out, dim_out, 3, 2, 1)
|
||||
if not is_last
|
||||
else nn.Identity(),
|
||||
]
|
||||
)
|
||||
)
|
||||
@@ -582,10 +717,14 @@ class DiffusionConditionalUnet1d(nn.Module):
|
||||
self.mid_modules = nn.ModuleList(
|
||||
[
|
||||
DiffusionConditionalResidualBlock1d(
|
||||
config.down_dims[-1], config.down_dims[-1], **common_res_block_kwargs
|
||||
config.down_dims[-1],
|
||||
config.down_dims[-1],
|
||||
**common_res_block_kwargs,
|
||||
),
|
||||
DiffusionConditionalResidualBlock1d(
|
||||
config.down_dims[-1], config.down_dims[-1], **common_res_block_kwargs
|
||||
config.down_dims[-1],
|
||||
config.down_dims[-1],
|
||||
**common_res_block_kwargs,
|
||||
),
|
||||
]
|
||||
)
|
||||
@@ -598,16 +737,24 @@ class DiffusionConditionalUnet1d(nn.Module):
|
||||
nn.ModuleList(
|
||||
[
|
||||
# dim_in * 2, because it takes the encoder's skip connection as well
|
||||
DiffusionConditionalResidualBlock1d(dim_in * 2, dim_out, **common_res_block_kwargs),
|
||||
DiffusionConditionalResidualBlock1d(dim_out, dim_out, **common_res_block_kwargs),
|
||||
DiffusionConditionalResidualBlock1d(
|
||||
dim_in * 2, dim_out, **common_res_block_kwargs
|
||||
),
|
||||
DiffusionConditionalResidualBlock1d(
|
||||
dim_out, dim_out, **common_res_block_kwargs
|
||||
),
|
||||
# Upsample as long as it is not the last block.
|
||||
nn.ConvTranspose1d(dim_out, dim_out, 4, 2, 1) if not is_last else nn.Identity(),
|
||||
nn.ConvTranspose1d(dim_out, dim_out, 4, 2, 1)
|
||||
if not is_last
|
||||
else nn.Identity(),
|
||||
]
|
||||
)
|
||||
)
|
||||
|
||||
self.final_conv = nn.Sequential(
|
||||
DiffusionConv1dBlock(config.down_dims[0], config.down_dims[0], kernel_size=config.kernel_size),
|
||||
DiffusionConv1dBlock(
|
||||
config.down_dims[0], config.down_dims[0], kernel_size=config.kernel_size
|
||||
),
|
||||
nn.Conv1d(config.down_dims[0], config.output_shapes["action"][0], 1),
|
||||
)
|
||||
|
||||
@@ -675,17 +822,23 @@ class DiffusionConditionalResidualBlock1d(nn.Module):
|
||||
self.use_film_scale_modulation = use_film_scale_modulation
|
||||
self.out_channels = out_channels
|
||||
|
||||
self.conv1 = DiffusionConv1dBlock(in_channels, out_channels, kernel_size, n_groups=n_groups)
|
||||
self.conv1 = DiffusionConv1dBlock(
|
||||
in_channels, out_channels, kernel_size, n_groups=n_groups
|
||||
)
|
||||
|
||||
# FiLM modulation (https://arxiv.org/abs/1709.07871) outputs per-channel bias and (maybe) scale.
|
||||
cond_channels = out_channels * 2 if use_film_scale_modulation else out_channels
|
||||
self.cond_encoder = nn.Sequential(nn.Mish(), nn.Linear(cond_dim, cond_channels))
|
||||
|
||||
self.conv2 = DiffusionConv1dBlock(out_channels, out_channels, kernel_size, n_groups=n_groups)
|
||||
self.conv2 = DiffusionConv1dBlock(
|
||||
out_channels, out_channels, kernel_size, n_groups=n_groups
|
||||
)
|
||||
|
||||
# A final convolution for dimension matching the residual (if needed).
|
||||
self.residual_conv = (
|
||||
nn.Conv1d(in_channels, out_channels, 1) if in_channels != out_channels else nn.Identity()
|
||||
nn.Conv1d(in_channels, out_channels, 1)
|
||||
if in_channels != out_channels
|
||||
else nn.Identity()
|
||||
)
|
||||
|
||||
def forward(self, x: Tensor, cond: Tensor) -> Tensor:
|
||||
|
||||
@@ -28,9 +28,15 @@ def _policy_cfg_from_hydra_cfg(policy_cfg_class, hydra_cfg):
|
||||
logging.warning(
|
||||
f"Hydra config is missing arguments: {set(expected_kwargs).difference(hydra_cfg.policy)}"
|
||||
)
|
||||
|
||||
# OmegaConf.to_container returns lists where sequences are found, but our dataclasses use tuples to avoid
|
||||
# issues with mutable defaults. This filter changes all lists to tuples.
|
||||
def list_to_tuple(item):
|
||||
return tuple(item) if isinstance(item, list) else item
|
||||
|
||||
policy_cfg = policy_cfg_class(
|
||||
**{
|
||||
k: v
|
||||
k: list_to_tuple(v)
|
||||
for k, v in OmegaConf.to_container(hydra_cfg.policy, resolve=True).items()
|
||||
if k in expected_kwargs
|
||||
}
|
||||
@@ -46,7 +52,9 @@ def get_policy_and_config_classes(name: str) -> tuple[Policy, object]:
|
||||
|
||||
return TDMPCPolicy, TDMPCConfig
|
||||
elif name == "diffusion":
|
||||
from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
|
||||
from lerobot.common.policies.diffusion.configuration_diffusion import (
|
||||
DiffusionConfig,
|
||||
)
|
||||
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||
|
||||
return DiffusionPolicy, DiffusionConfig
|
||||
@@ -55,12 +63,26 @@ def get_policy_and_config_classes(name: str) -> tuple[Policy, object]:
|
||||
from lerobot.common.policies.act.modeling_act import ACTPolicy
|
||||
|
||||
return ACTPolicy, ACTConfig
|
||||
elif name == "vqbet":
|
||||
from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
|
||||
from lerobot.common.policies.vqbet.modeling_vqbet import VQBeTPolicy
|
||||
|
||||
return VQBeTPolicy, VQBeTConfig
|
||||
elif name == "sac":
|
||||
from lerobot.common.policies.sac.configuration_sac import SACConfig
|
||||
from lerobot.common.policies.sac.modeling_sac import SACPolicy
|
||||
|
||||
return SACPolicy, SACConfig
|
||||
else:
|
||||
raise NotImplementedError(f"Policy with name {name} is not implemented.")
|
||||
|
||||
|
||||
def make_policy(
|
||||
hydra_cfg: DictConfig, pretrained_policy_name_or_path: str | None = None, dataset_stats=None
|
||||
hydra_cfg: DictConfig,
|
||||
pretrained_policy_name_or_path: str | None = None,
|
||||
dataset_stats=None,
|
||||
*args,
|
||||
**kwargs,
|
||||
) -> Policy:
|
||||
"""Make an instance of a policy class.
|
||||
|
||||
@@ -74,23 +96,30 @@ def make_policy(
|
||||
be provided when initializing a new policy, and must not be provided when loading a pretrained
|
||||
policy. Therefore, this argument is mutually exclusive with `pretrained_policy_name_or_path`.
|
||||
"""
|
||||
if not (pretrained_policy_name_or_path is None) ^ (dataset_stats is None):
|
||||
raise ValueError("Only one of `pretrained_policy_name_or_path` and `dataset_stats` may be provided.")
|
||||
# if not (pretrained_policy_name_or_path is None) ^ (dataset_stats is None):
|
||||
# raise ValueError(
|
||||
# "Exactly one of `pretrained_policy_name_or_path` and `dataset_stats` must be provided."
|
||||
# )
|
||||
|
||||
policy_cls, policy_cfg_class = get_policy_and_config_classes(hydra_cfg.policy.name)
|
||||
|
||||
policy_cfg = _policy_cfg_from_hydra_cfg(policy_cfg_class, hydra_cfg)
|
||||
if pretrained_policy_name_or_path is None:
|
||||
# Make a fresh policy.
|
||||
policy = policy_cls(policy_cfg, dataset_stats)
|
||||
# HACK: We pass *args and **kwargs to the policy constructor to allow for additional arguments
|
||||
# for example device for the sac policy.
|
||||
policy = policy_cls(config=policy_cfg, dataset_stats=dataset_stats)
|
||||
else:
|
||||
# Load a pretrained policy and override the config if needed (for example, if there are inference-time
|
||||
# hyperparameters that we want to vary).
|
||||
# TODO(alexander-soare): This hack makes use of huggingface_hub's tooling to load the policy with, pretrained
|
||||
# weights which are then loaded into a fresh policy with the desired config. This PR in huggingface_hub should
|
||||
# make it possible to avoid the hack: https://github.com/huggingface/huggingface_hub/pull/2274.
|
||||
# TODO(alexander-soare): This hack makes use of huggingface_hub's tooling to load the policy with,
|
||||
# pretrained weights which are then loaded into a fresh policy with the desired config. This PR in
|
||||
# huggingface_hub should make it possible to avoid the hack:
|
||||
# https://github.com/huggingface/huggingface_hub/pull/2274.
|
||||
policy = policy_cls(policy_cfg)
|
||||
policy.load_state_dict(policy_cls.from_pretrained(pretrained_policy_name_or_path).state_dict())
|
||||
policy.load_state_dict(
|
||||
policy_cls.from_pretrained(pretrained_policy_name_or_path).state_dict()
|
||||
)
|
||||
|
||||
policy.to(get_safe_torch_device(hydra_cfg.device))
|
||||
|
||||
|
||||
@@ -0,0 +1,35 @@
|
||||
import json
|
||||
import os
|
||||
from dataclasses import asdict, dataclass
|
||||
|
||||
|
||||
@dataclass
|
||||
class ClassifierConfig:
|
||||
"""Configuration for the Classifier model."""
|
||||
|
||||
num_classes: int = 2
|
||||
hidden_dim: int = 256
|
||||
dropout_rate: float = 0.1
|
||||
model_name: str = "helper2424/resnet10"
|
||||
device: str = "cpu"
|
||||
model_type: str = "cnn" # "transformer" or "cnn"
|
||||
num_cameras: int = 2
|
||||
|
||||
def save_pretrained(self, save_dir):
|
||||
"""Save config to json file."""
|
||||
os.makedirs(save_dir, exist_ok=True)
|
||||
|
||||
# Convert to dict and save as JSON
|
||||
config_dict = asdict(self)
|
||||
with open(os.path.join(save_dir, "config.json"), "w") as f:
|
||||
json.dump(config_dict, f, indent=2)
|
||||
|
||||
@classmethod
|
||||
def from_pretrained(cls, pretrained_model_name_or_path):
|
||||
"""Load config from json file."""
|
||||
config_file = os.path.join(pretrained_model_name_or_path, "config.json")
|
||||
|
||||
with open(config_file) as f:
|
||||
config_dict = json.load(f)
|
||||
|
||||
return cls(**config_dict)
|
||||
@@ -0,0 +1,173 @@
|
||||
import logging
|
||||
from typing import Optional
|
||||
|
||||
import torch
|
||||
from huggingface_hub import PyTorchModelHubMixin
|
||||
from torch import Tensor, nn
|
||||
|
||||
from .configuration_classifier import ClassifierConfig
|
||||
|
||||
logging.basicConfig(
|
||||
level=logging.INFO, format="%(asctime)s - %(name)s - %(levelname)s - %(message)s"
|
||||
)
|
||||
logger = logging.getLogger(__name__)
|
||||
|
||||
|
||||
class ClassifierOutput:
|
||||
"""Wrapper for classifier outputs with additional metadata."""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
logits: Tensor,
|
||||
probabilities: Optional[Tensor] = None,
|
||||
hidden_states: Optional[Tensor] = None,
|
||||
):
|
||||
self.logits = logits
|
||||
self.probabilities = probabilities
|
||||
self.hidden_states = hidden_states
|
||||
|
||||
def __repr__(self):
|
||||
return (
|
||||
f"ClassifierOutput(logits={self.logits}, "
|
||||
f"probabilities={self.probabilities}, "
|
||||
f"hidden_states={self.hidden_states})"
|
||||
)
|
||||
|
||||
|
||||
class Classifier(
|
||||
nn.Module,
|
||||
PyTorchModelHubMixin,
|
||||
# Add Hub metadata
|
||||
library_name="lerobot",
|
||||
repo_url="https://github.com/huggingface/lerobot",
|
||||
tags=["robotics", "vision-classifier"],
|
||||
):
|
||||
"""Image classifier built on top of a pre-trained encoder."""
|
||||
|
||||
# Add name attribute for factory
|
||||
name = "classifier"
|
||||
|
||||
def __init__(self, config: ClassifierConfig):
|
||||
from transformers import AutoModel
|
||||
|
||||
super().__init__()
|
||||
self.config = config
|
||||
# self.processor = AutoImageProcessor.from_pretrained(self.config.model_name, trust_remote_code=True)
|
||||
encoder = AutoModel.from_pretrained(
|
||||
self.config.model_name, trust_remote_code=True
|
||||
)
|
||||
# Extract vision model if we're given a multimodal model
|
||||
if hasattr(encoder, "vision_model"):
|
||||
logging.info("Multimodal model detected - using vision encoder only")
|
||||
self.encoder = encoder.vision_model
|
||||
self.vision_config = encoder.config.vision_config
|
||||
else:
|
||||
self.encoder = encoder
|
||||
self.vision_config = getattr(encoder, "config", None)
|
||||
|
||||
# Model type from config
|
||||
self.is_cnn = self.config.model_type == "cnn"
|
||||
|
||||
# For CNNs, initialize backbone
|
||||
if self.is_cnn:
|
||||
self._setup_cnn_backbone()
|
||||
|
||||
self._freeze_encoder()
|
||||
self._build_classifier_head()
|
||||
|
||||
def _setup_cnn_backbone(self):
|
||||
"""Set up CNN encoder"""
|
||||
if hasattr(self.encoder, "fc"):
|
||||
self.feature_dim = self.encoder.fc.in_features
|
||||
self.encoder = nn.Sequential(*list(self.encoder.children())[:-1])
|
||||
elif hasattr(self.encoder.config, "hidden_sizes"):
|
||||
self.feature_dim = self.encoder.config.hidden_sizes[
|
||||
-1
|
||||
] # Last channel dimension
|
||||
else:
|
||||
raise ValueError("Unsupported CNN architecture")
|
||||
|
||||
self.encoder = self.encoder.to(self.config.device)
|
||||
|
||||
def _freeze_encoder(self) -> None:
|
||||
"""Freeze the encoder parameters."""
|
||||
for param in self.encoder.parameters():
|
||||
param.requires_grad = False
|
||||
|
||||
def _build_classifier_head(self) -> None:
|
||||
"""Initialize the classifier head architecture."""
|
||||
# Get input dimension based on model type
|
||||
if self.is_cnn:
|
||||
input_dim = self.feature_dim
|
||||
else: # Transformer models
|
||||
if hasattr(self.encoder.config, "hidden_size"):
|
||||
input_dim = self.encoder.config.hidden_size
|
||||
else:
|
||||
raise ValueError(
|
||||
"Unsupported transformer architecture since hidden_size is not found"
|
||||
)
|
||||
|
||||
self.classifier_head = nn.Sequential(
|
||||
nn.Linear(input_dim * self.config.num_cameras, self.config.hidden_dim),
|
||||
nn.Dropout(self.config.dropout_rate),
|
||||
nn.LayerNorm(self.config.hidden_dim),
|
||||
nn.ReLU(),
|
||||
nn.Linear(
|
||||
self.config.hidden_dim,
|
||||
1 if self.config.num_classes == 2 else self.config.num_classes,
|
||||
),
|
||||
)
|
||||
self.classifier_head = self.classifier_head.to(self.config.device)
|
||||
|
||||
def _get_encoder_output(self, x: torch.Tensor) -> torch.Tensor:
|
||||
"""Extract the appropriate output from the encoder."""
|
||||
# Process images with the processor (handles resizing and normalization)
|
||||
# processed = self.processor(
|
||||
# images=x, # LeRobotDataset already provides proper tensor format
|
||||
# return_tensors="pt",
|
||||
# )
|
||||
# processed = processed["pixel_values"].to(x.device)
|
||||
processed = x
|
||||
|
||||
with torch.no_grad():
|
||||
if self.is_cnn:
|
||||
# The HF ResNet applies pooling internally
|
||||
outputs = self.encoder(processed)
|
||||
# Get pooled output directly
|
||||
features = outputs.pooler_output
|
||||
|
||||
if features.dim() > 2:
|
||||
features = features.squeeze(-1).squeeze(-1)
|
||||
return features
|
||||
else: # Transformer models
|
||||
outputs = self.encoder(processed)
|
||||
if (
|
||||
hasattr(outputs, "pooler_output")
|
||||
and outputs.pooler_output is not None
|
||||
):
|
||||
return outputs.pooler_output
|
||||
return outputs.last_hidden_state[:, 0, :]
|
||||
|
||||
def forward(self, xs: torch.Tensor) -> ClassifierOutput:
|
||||
"""Forward pass of the classifier."""
|
||||
# For training, we expect input to be a tensor directly from LeRobotDataset
|
||||
encoder_outputs = torch.hstack([self._get_encoder_output(x) for x in xs])
|
||||
logits = self.classifier_head(encoder_outputs)
|
||||
|
||||
if self.config.num_classes == 2:
|
||||
logits = logits.squeeze(-1)
|
||||
probabilities = torch.sigmoid(logits)
|
||||
else:
|
||||
probabilities = torch.softmax(logits, dim=-1)
|
||||
|
||||
return ClassifierOutput(
|
||||
logits=logits, probabilities=probabilities, hidden_states=encoder_outputs
|
||||
)
|
||||
|
||||
def predict_reward(self, x, threshold=0.6):
|
||||
if self.config.num_classes == 2:
|
||||
probs = self.forward(x).probabilities
|
||||
logging.debug(f"Predicted reward images: {probs}")
|
||||
return (probs > threshold).float()
|
||||
else:
|
||||
return torch.argmax(self.forward(x).probabilities, dim=1)
|
||||
23
lerobot/common/policies/hilserl/configuration_hilserl.py
Normal file
23
lerobot/common/policies/hilserl/configuration_hilserl.py
Normal file
@@ -0,0 +1,23 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team.
|
||||
# All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
from dataclasses import dataclass
|
||||
|
||||
|
||||
@dataclass
|
||||
class HILSerlConfig:
|
||||
pass
|
||||
29
lerobot/common/policies/hilserl/modeling_hilserl.py
Normal file
29
lerobot/common/policies/hilserl/modeling_hilserl.py
Normal file
@@ -0,0 +1,29 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team.
|
||||
# All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
import torch.nn as nn
|
||||
from huggingface_hub import PyTorchModelHubMixin
|
||||
|
||||
|
||||
class HILSerlPolicy(
|
||||
nn.Module,
|
||||
PyTorchModelHubMixin,
|
||||
library_name="lerobot",
|
||||
repo_url="https://github.com/huggingface/lerobot",
|
||||
tags=["robotics", "hilserl"],
|
||||
):
|
||||
pass
|
||||
@@ -130,8 +130,9 @@ class Normalize(nn.Module):
|
||||
setattr(self, "buffer_" + key.replace(".", "_"), buffer)
|
||||
|
||||
# TODO(rcadene): should we remove torch.no_grad?
|
||||
@torch.no_grad
|
||||
# @torch.no_grad
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||
batch = dict(batch) # shallow copy avoids mutating the input batch
|
||||
for key, mode in self.modes.items():
|
||||
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
||||
|
||||
@@ -195,8 +196,9 @@ class Unnormalize(nn.Module):
|
||||
setattr(self, "buffer_" + key.replace(".", "_"), buffer)
|
||||
|
||||
# TODO(rcadene): should we remove torch.no_grad?
|
||||
@torch.no_grad
|
||||
# @torch.no_grad
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||
batch = dict(batch) # shallow copy avoids mutating the input batch
|
||||
for key, mode in self.modes.items():
|
||||
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
||||
|
||||
|
||||
@@ -57,7 +57,7 @@ class Policy(Protocol):
|
||||
other items should be logging-friendly, native Python types.
|
||||
"""
|
||||
|
||||
def select_action(self, batch: dict[str, Tensor]):
|
||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""Return one action to run in the environment (potentially in batch mode).
|
||||
|
||||
When the model uses a history of observations, or outputs a sequence of actions, this method deals
|
||||
|
||||
108
lerobot/common/policies/sac/configuration_sac.py
Normal file
108
lerobot/common/policies/sac/configuration_sac.py
Normal file
@@ -0,0 +1,108 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team.
|
||||
# All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
from dataclasses import dataclass, field
|
||||
from typing import Any
|
||||
|
||||
|
||||
@dataclass
|
||||
class SACConfig:
|
||||
input_shapes: dict[str, list[int]] = field(
|
||||
default_factory=lambda: {
|
||||
"observation.image": [3, 84, 84],
|
||||
"observation.state": [4],
|
||||
}
|
||||
)
|
||||
output_shapes: dict[str, list[int]] = field(
|
||||
default_factory=lambda: {
|
||||
"action": [2],
|
||||
}
|
||||
)
|
||||
input_normalization_modes: dict[str, str] = field(
|
||||
default_factory=lambda: {
|
||||
"observation.image": "mean_std",
|
||||
"observation.state": "min_max",
|
||||
"observation.environment_state": "min_max",
|
||||
}
|
||||
)
|
||||
input_normalization_params: dict[str, dict[str, list[float]]] = field(
|
||||
default_factory=lambda: {
|
||||
"observation.image": {
|
||||
"mean": [[0.485, 0.456, 0.406]],
|
||||
"std": [[0.229, 0.224, 0.225]],
|
||||
},
|
||||
"observation.state": {"min": [-1, -1, -1, -1], "max": [1, 1, 1, 1]},
|
||||
}
|
||||
)
|
||||
output_normalization_modes: dict[str, str] = field(
|
||||
default_factory=lambda: {"action": "min_max"}
|
||||
)
|
||||
output_normalization_params: dict[str, dict[str, list[float]]] = field(
|
||||
default_factory=lambda: {
|
||||
"action": {"min": [-1, -1], "max": [1, 1]},
|
||||
}
|
||||
)
|
||||
# TODO: Move it outside of the config
|
||||
actor_learner_config: dict[str, str | int] = field(
|
||||
default_factory=lambda: {
|
||||
"learner_host": "127.0.0.1",
|
||||
"learner_port": 50051,
|
||||
}
|
||||
)
|
||||
camera_number: int = 1
|
||||
|
||||
storage_device: str = "cpu"
|
||||
# Add type annotations for these fields:
|
||||
vision_encoder_name: str | None = field(default="helper2424/resnet10")
|
||||
freeze_vision_encoder: bool = True
|
||||
image_encoder_hidden_dim: int = 32
|
||||
shared_encoder: bool = True
|
||||
discount: float = 0.99
|
||||
temperature_init: float = 1.0
|
||||
num_critics: int = 2
|
||||
num_subsample_critics: int | None = None
|
||||
critic_lr: float = 3e-4
|
||||
actor_lr: float = 3e-4
|
||||
temperature_lr: float = 3e-4
|
||||
critic_target_update_weight: float = 0.005
|
||||
utd_ratio: int = 1 # If you want enable utd_ratio, you need to set it to >1
|
||||
state_encoder_hidden_dim: int = 256
|
||||
latent_dim: int = 256
|
||||
target_entropy: float | None = None
|
||||
use_backup_entropy: bool = True
|
||||
grad_clip_norm: float = 40.0
|
||||
critic_network_kwargs: dict[str, Any] = field(
|
||||
default_factory=lambda: {
|
||||
"hidden_dims": [256, 256],
|
||||
"activate_final": True,
|
||||
"final_activation": None,
|
||||
}
|
||||
)
|
||||
actor_network_kwargs: dict[str, Any] = field(
|
||||
default_factory=lambda: {
|
||||
"hidden_dims": [256, 256],
|
||||
"activate_final": True,
|
||||
}
|
||||
)
|
||||
policy_kwargs: dict[str, Any] = field(
|
||||
default_factory=lambda: {
|
||||
"use_tanh_squash": True,
|
||||
"log_std_min": -5,
|
||||
"log_std_max": 2,
|
||||
"init_final": 0.05,
|
||||
}
|
||||
)
|
||||
981
lerobot/common/policies/sac/modeling_sac.py
Normal file
981
lerobot/common/policies/sac/modeling_sac.py
Normal file
@@ -0,0 +1,981 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team.
|
||||
# All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
# TODO: (1) better device management
|
||||
|
||||
import math
|
||||
from typing import Callable, Optional, Tuple, Union, Dict, List
|
||||
from pathlib import Path
|
||||
|
||||
import einops
|
||||
import numpy as np
|
||||
import torch
|
||||
import torch.nn as nn
|
||||
import torch.nn.functional as F # noqa: N812
|
||||
from huggingface_hub import PyTorchModelHubMixin
|
||||
from torch import Tensor
|
||||
|
||||
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||
from lerobot.common.policies.sac.configuration_sac import SACConfig
|
||||
from lerobot.common.policies.utils import get_device_from_parameters
|
||||
|
||||
|
||||
class SACPolicy(
|
||||
nn.Module,
|
||||
PyTorchModelHubMixin,
|
||||
library_name="lerobot",
|
||||
repo_url="https://github.com/huggingface/lerobot",
|
||||
tags=["robotics", "RL", "SAC"],
|
||||
):
|
||||
name = "sac"
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
config: SACConfig | None = None,
|
||||
dataset_stats: dict[str, dict[str, Tensor]] | None = None,
|
||||
):
|
||||
super().__init__()
|
||||
|
||||
if config is None:
|
||||
config = SACConfig()
|
||||
self.config = config
|
||||
|
||||
if config.input_normalization_modes is not None:
|
||||
input_normalization_params = _convert_normalization_params_to_tensor(
|
||||
config.input_normalization_params
|
||||
)
|
||||
self.normalize_inputs = Normalize(
|
||||
config.input_shapes,
|
||||
config.input_normalization_modes,
|
||||
input_normalization_params,
|
||||
)
|
||||
else:
|
||||
self.normalize_inputs = nn.Identity()
|
||||
|
||||
output_normalization_params = _convert_normalization_params_to_tensor(
|
||||
config.output_normalization_params
|
||||
)
|
||||
|
||||
# HACK: This is hacky and should be removed
|
||||
dataset_stats = dataset_stats or output_normalization_params
|
||||
self.normalize_targets = Normalize(
|
||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||
)
|
||||
self.unnormalize_outputs = Unnormalize(
|
||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||
)
|
||||
|
||||
# NOTE: For images the encoder should be shared between the actor and critic
|
||||
if config.shared_encoder:
|
||||
encoder_critic = SACObservationEncoder(config, self.normalize_inputs)
|
||||
encoder_actor: SACObservationEncoder = encoder_critic
|
||||
else:
|
||||
encoder_critic = SACObservationEncoder(config, self.normalize_inputs)
|
||||
encoder_actor = SACObservationEncoder(config, self.normalize_inputs)
|
||||
|
||||
# Create a list of critic heads
|
||||
critic_heads = [
|
||||
CriticHead(
|
||||
input_dim=encoder_critic.output_dim + config.output_shapes["action"][0],
|
||||
**config.critic_network_kwargs,
|
||||
)
|
||||
for _ in range(config.num_critics)
|
||||
]
|
||||
|
||||
self.critic_ensemble = CriticEnsemble(
|
||||
encoder=encoder_critic,
|
||||
ensemble=critic_heads,
|
||||
output_normalization=self.normalize_targets,
|
||||
)
|
||||
|
||||
# Create target critic heads as deepcopies of the original critic heads
|
||||
target_critic_heads = [
|
||||
CriticHead(
|
||||
input_dim=encoder_critic.output_dim + config.output_shapes["action"][0],
|
||||
**config.critic_network_kwargs,
|
||||
)
|
||||
for _ in range(config.num_critics)
|
||||
]
|
||||
|
||||
self.critic_target = CriticEnsemble(
|
||||
encoder=encoder_critic,
|
||||
ensemble=target_critic_heads,
|
||||
output_normalization=self.normalize_targets,
|
||||
)
|
||||
|
||||
self.critic_target.load_state_dict(self.critic_ensemble.state_dict())
|
||||
|
||||
self.critic_ensemble = torch.compile(self.critic_ensemble)
|
||||
self.critic_target = torch.compile(self.critic_target)
|
||||
|
||||
self.actor = Policy(
|
||||
encoder=encoder_actor,
|
||||
network=MLP(
|
||||
input_dim=encoder_actor.output_dim, **config.actor_network_kwargs
|
||||
),
|
||||
action_dim=config.output_shapes["action"][0],
|
||||
encoder_is_shared=config.shared_encoder,
|
||||
**config.policy_kwargs,
|
||||
)
|
||||
if config.target_entropy is None:
|
||||
config.target_entropy = (
|
||||
-np.prod(config.output_shapes["action"][0]) / 2
|
||||
) # (-dim(A)/2)
|
||||
|
||||
# TODO (azouitine): Handle the case where the temparameter is a fixed
|
||||
# TODO (michel-aractingi): Put the log_alpha in cuda by default because otherwise
|
||||
# it triggers "can't optimize a non-leaf Tensor"
|
||||
|
||||
temperature_init = config.temperature_init
|
||||
self.log_alpha = nn.Parameter(torch.tensor([math.log(temperature_init)]))
|
||||
self.temperature = self.log_alpha.exp().item()
|
||||
|
||||
def _save_pretrained(self, save_directory):
|
||||
"""Custom save method to handle TensorDict properly"""
|
||||
import os
|
||||
import json
|
||||
from dataclasses import asdict
|
||||
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE, CONFIG_NAME
|
||||
from safetensors.torch import save_model
|
||||
|
||||
save_model(self, os.path.join(save_directory, SAFETENSORS_SINGLE_FILE))
|
||||
|
||||
# Save config
|
||||
config_dict = asdict(self.config)
|
||||
with open(os.path.join(save_directory, CONFIG_NAME), "w") as f:
|
||||
json.dump(config_dict, f, indent=2)
|
||||
print(f"Saved config to {os.path.join(save_directory, CONFIG_NAME)}")
|
||||
|
||||
@classmethod
|
||||
def _from_pretrained(
|
||||
cls,
|
||||
*,
|
||||
model_id: str,
|
||||
revision: Optional[str],
|
||||
cache_dir: Optional[Union[str, Path]],
|
||||
force_download: bool,
|
||||
proxies: Optional[Dict],
|
||||
resume_download: Optional[bool],
|
||||
local_files_only: bool,
|
||||
token: Optional[Union[str, bool]],
|
||||
map_location: str = "cpu",
|
||||
strict: bool = False,
|
||||
**model_kwargs,
|
||||
) -> "SACPolicy":
|
||||
"""Custom load method to handle loading SAC policy from saved files"""
|
||||
import os
|
||||
import json
|
||||
from pathlib import Path
|
||||
from huggingface_hub import hf_hub_download
|
||||
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE, CONFIG_NAME
|
||||
from safetensors.torch import load_model
|
||||
from lerobot.common.policies.sac.configuration_sac import SACConfig
|
||||
|
||||
# Check if model_id is a local path or a hub model ID
|
||||
if os.path.isdir(model_id):
|
||||
model_path = Path(model_id)
|
||||
safetensors_file = os.path.join(model_path, SAFETENSORS_SINGLE_FILE)
|
||||
config_file = os.path.join(model_path, CONFIG_NAME)
|
||||
else:
|
||||
# Download the safetensors file from the hub
|
||||
safetensors_file = hf_hub_download(
|
||||
repo_id=model_id,
|
||||
filename=SAFETENSORS_SINGLE_FILE,
|
||||
revision=revision,
|
||||
cache_dir=cache_dir,
|
||||
force_download=force_download,
|
||||
proxies=proxies,
|
||||
resume_download=resume_download,
|
||||
token=token,
|
||||
local_files_only=local_files_only,
|
||||
)
|
||||
# Download the config file
|
||||
try:
|
||||
config_file = hf_hub_download(
|
||||
repo_id=model_id,
|
||||
filename=CONFIG_NAME,
|
||||
revision=revision,
|
||||
cache_dir=cache_dir,
|
||||
force_download=force_download,
|
||||
proxies=proxies,
|
||||
resume_download=resume_download,
|
||||
token=token,
|
||||
local_files_only=local_files_only,
|
||||
)
|
||||
except Exception:
|
||||
config_file = None
|
||||
|
||||
# Load or create config
|
||||
if config_file and os.path.exists(config_file):
|
||||
# Load config from file
|
||||
with open(config_file) as f:
|
||||
config_dict = json.load(f)
|
||||
config = SACConfig(**config_dict)
|
||||
else:
|
||||
# Use the provided config or create a default one
|
||||
config = model_kwargs.get("config", SACConfig())
|
||||
|
||||
# Create a new instance with the loaded config
|
||||
model = cls(config=config)
|
||||
|
||||
# Load state dict from safetensors file
|
||||
if os.path.exists(safetensors_file):
|
||||
load_model(model, filename=safetensors_file, device=map_location)
|
||||
|
||||
return model
|
||||
|
||||
def reset(self):
|
||||
"""Reset the policy"""
|
||||
pass
|
||||
|
||||
def to(self, *args, **kwargs):
|
||||
"""Override .to(device) method to involve moving the log_alpha fixed_std"""
|
||||
if self.actor.fixed_std is not None:
|
||||
self.actor.fixed_std = self.actor.fixed_std.to(*args, **kwargs)
|
||||
# self.log_alpha = self.log_alpha.to(*args, **kwargs)
|
||||
super().to(*args, **kwargs)
|
||||
|
||||
@torch.no_grad()
|
||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""Select action for inference/evaluation"""
|
||||
actions, _, _ = self.actor(batch)
|
||||
actions = self.unnormalize_outputs({"action": actions})["action"]
|
||||
return actions
|
||||
|
||||
def critic_forward(
|
||||
self,
|
||||
observations: dict[str, Tensor],
|
||||
actions: Tensor,
|
||||
use_target: bool = False,
|
||||
observation_features: Tensor | None = None,
|
||||
) -> Tensor:
|
||||
"""Forward pass through a critic network ensemble
|
||||
|
||||
Args:
|
||||
observations: Dictionary of observations
|
||||
actions: Action tensor
|
||||
use_target: If True, use target critics, otherwise use ensemble critics
|
||||
|
||||
Returns:
|
||||
Tensor of Q-values from all critics
|
||||
"""
|
||||
critics = self.critic_target if use_target else self.critic_ensemble
|
||||
q_values = critics(observations, actions, observation_features)
|
||||
return q_values
|
||||
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor | float]: ...
|
||||
def update_target_networks(self):
|
||||
"""Update target networks with exponential moving average"""
|
||||
for target_param, param in zip(
|
||||
self.critic_target.parameters(),
|
||||
self.critic_ensemble.parameters(),
|
||||
strict=False,
|
||||
):
|
||||
target_param.data.copy_(
|
||||
param.data * self.config.critic_target_update_weight
|
||||
+ target_param.data * (1.0 - self.config.critic_target_update_weight)
|
||||
)
|
||||
|
||||
def compute_loss_critic(
|
||||
self,
|
||||
observations,
|
||||
actions,
|
||||
rewards,
|
||||
next_observations,
|
||||
done,
|
||||
observation_features: Tensor | None = None,
|
||||
next_observation_features: Tensor | None = None,
|
||||
) -> Tensor:
|
||||
self.temperature = self.log_alpha.exp().item()
|
||||
with torch.no_grad():
|
||||
next_action_preds, next_log_probs, _ = self.actor(
|
||||
next_observations, next_observation_features
|
||||
)
|
||||
|
||||
# TODO: (maractingi, azouitine) This is to slow, we should find a way to do this in a more efficient way
|
||||
next_action_preds = self.unnormalize_outputs({"action": next_action_preds})[
|
||||
"action"
|
||||
]
|
||||
|
||||
# 2- compute q targets
|
||||
q_targets = self.critic_forward(
|
||||
observations=next_observations,
|
||||
actions=next_action_preds,
|
||||
use_target=True,
|
||||
observation_features=next_observation_features,
|
||||
)
|
||||
|
||||
# subsample critics to prevent overfitting if use high UTD (update to date)
|
||||
if self.config.num_subsample_critics is not None:
|
||||
indices = torch.randperm(self.config.num_critics)
|
||||
indices = indices[: self.config.num_subsample_critics]
|
||||
q_targets = q_targets[indices]
|
||||
|
||||
# critics subsample size
|
||||
min_q, _ = q_targets.min(dim=0) # Get values from min operation
|
||||
if self.config.use_backup_entropy:
|
||||
min_q = min_q - (self.temperature * next_log_probs)
|
||||
|
||||
td_target = rewards + (1 - done) * self.config.discount * min_q
|
||||
|
||||
# 3- compute predicted qs
|
||||
q_preds = self.critic_forward(
|
||||
observations,
|
||||
actions,
|
||||
use_target=False,
|
||||
observation_features=observation_features,
|
||||
)
|
||||
|
||||
# 4- Calculate loss
|
||||
# Compute state-action value loss (TD loss) for all of the Q functions in the ensemble.
|
||||
td_target_duplicate = einops.repeat(td_target, "b -> e b", e=q_preds.shape[0])
|
||||
# You compute the mean loss of the batch for each critic and then to compute the final loss you sum them up
|
||||
critics_loss = (
|
||||
F.mse_loss(
|
||||
input=q_preds,
|
||||
target=td_target_duplicate,
|
||||
reduction="none",
|
||||
).mean(1)
|
||||
).sum()
|
||||
return critics_loss
|
||||
|
||||
def compute_loss_temperature(
|
||||
self, observations, observation_features: Tensor | None = None
|
||||
) -> Tensor:
|
||||
"""Compute the temperature loss"""
|
||||
# calculate temperature loss
|
||||
with torch.no_grad():
|
||||
_, log_probs, _ = self.actor(observations, observation_features)
|
||||
temperature_loss = (
|
||||
-self.log_alpha.exp() * (log_probs + self.config.target_entropy)
|
||||
).mean()
|
||||
return temperature_loss
|
||||
|
||||
def compute_loss_actor(
|
||||
self, observations, observation_features: Tensor | None = None
|
||||
) -> Tensor:
|
||||
self.temperature = self.log_alpha.exp().item()
|
||||
|
||||
actions_pi, log_probs, _ = self.actor(observations, observation_features)
|
||||
|
||||
# TODO: (maractingi, azouitine) This is to slow, we should find a way to do this in a more efficient way
|
||||
actions_pi = self.unnormalize_outputs({"action": actions_pi})["action"]
|
||||
|
||||
q_preds = self.critic_forward(
|
||||
observations,
|
||||
actions_pi,
|
||||
use_target=False,
|
||||
observation_features=observation_features,
|
||||
)
|
||||
min_q_preds = q_preds.min(dim=0)[0]
|
||||
|
||||
actor_loss = ((self.temperature * log_probs) - min_q_preds).mean()
|
||||
return actor_loss
|
||||
|
||||
|
||||
class MLP(nn.Module):
|
||||
def __init__(
|
||||
self,
|
||||
input_dim: int,
|
||||
hidden_dims: list[int],
|
||||
activations: Callable[[torch.Tensor], torch.Tensor] | str = nn.SiLU(),
|
||||
activate_final: bool = False,
|
||||
dropout_rate: Optional[float] = None,
|
||||
final_activation: Callable[[torch.Tensor], torch.Tensor] | str | None = None,
|
||||
):
|
||||
super().__init__()
|
||||
self.activate_final = activate_final
|
||||
layers = []
|
||||
|
||||
# First layer uses input_dim
|
||||
layers.append(nn.Linear(input_dim, hidden_dims[0]))
|
||||
|
||||
# Add activation after first layer
|
||||
if dropout_rate is not None and dropout_rate > 0:
|
||||
layers.append(nn.Dropout(p=dropout_rate))
|
||||
layers.append(nn.LayerNorm(hidden_dims[0]))
|
||||
layers.append(
|
||||
activations
|
||||
if isinstance(activations, nn.Module)
|
||||
else getattr(nn, activations)()
|
||||
)
|
||||
|
||||
# Rest of the layers
|
||||
for i in range(1, len(hidden_dims)):
|
||||
layers.append(nn.Linear(hidden_dims[i - 1], hidden_dims[i]))
|
||||
|
||||
if i + 1 < len(hidden_dims) or activate_final:
|
||||
if dropout_rate is not None and dropout_rate > 0:
|
||||
layers.append(nn.Dropout(p=dropout_rate))
|
||||
layers.append(nn.LayerNorm(hidden_dims[i]))
|
||||
|
||||
# If we're at the final layer and a final activation is specified, use it
|
||||
if (
|
||||
i + 1 == len(hidden_dims)
|
||||
and activate_final
|
||||
and final_activation is not None
|
||||
):
|
||||
layers.append(
|
||||
final_activation
|
||||
if isinstance(final_activation, nn.Module)
|
||||
else getattr(nn, final_activation)()
|
||||
)
|
||||
else:
|
||||
layers.append(
|
||||
activations
|
||||
if isinstance(activations, nn.Module)
|
||||
else getattr(nn, activations)()
|
||||
)
|
||||
|
||||
self.net = nn.Sequential(*layers)
|
||||
|
||||
def forward(self, x: torch.Tensor) -> torch.Tensor:
|
||||
return self.net(x)
|
||||
|
||||
|
||||
class CriticHead(nn.Module):
|
||||
def __init__(
|
||||
self,
|
||||
input_dim: int,
|
||||
hidden_dims: list[int],
|
||||
activations: Callable[[torch.Tensor], torch.Tensor] | str = nn.SiLU(),
|
||||
activate_final: bool = False,
|
||||
dropout_rate: Optional[float] = None,
|
||||
init_final: Optional[float] = None,
|
||||
final_activation: Callable[[torch.Tensor], torch.Tensor] | str | None = None,
|
||||
):
|
||||
super().__init__()
|
||||
self.net = MLP(
|
||||
input_dim=input_dim,
|
||||
hidden_dims=hidden_dims,
|
||||
activations=activations,
|
||||
activate_final=activate_final,
|
||||
dropout_rate=dropout_rate,
|
||||
final_activation=final_activation,
|
||||
)
|
||||
self.output_layer = nn.Linear(in_features=hidden_dims[-1], out_features=1)
|
||||
if init_final is not None:
|
||||
nn.init.uniform_(self.output_layer.weight, -init_final, init_final)
|
||||
nn.init.uniform_(self.output_layer.bias, -init_final, init_final)
|
||||
else:
|
||||
orthogonal_init()(self.output_layer.weight)
|
||||
|
||||
def forward(self, x: torch.Tensor) -> torch.Tensor:
|
||||
return self.output_layer(self.net(x))
|
||||
|
||||
|
||||
class CriticEnsemble(nn.Module):
|
||||
"""
|
||||
┌──────────────────┬─────────────────────────────────────────────────────────┐
|
||||
│ Critic Ensemble │ │
|
||||
├──────────────────┘ │
|
||||
│ │
|
||||
│ ┌────┐ ┌────┐ ┌────┐ │
|
||||
│ │ Q1 │ │ Q2 │ │ Qn │ │
|
||||
│ └────┘ └────┘ └────┘ │
|
||||
│ ┌──────────────┐ ┌──────────────┐ ┌──────────────┐ │
|
||||
│ │ │ │ │ │ │ │
|
||||
│ │ MLP 1 │ │ MLP 2 │ │ MLP │ │
|
||||
│ │ │ │ │ ... │ num_critics │ │
|
||||
│ │ │ │ │ │ │ │
|
||||
│ └──────────────┘ └──────────────┘ └──────────────┘ │
|
||||
│ ▲ ▲ ▲ │
|
||||
│ └───────────────────┴───────┬────────────────────────────┘ │
|
||||
│ │ │
|
||||
│ │ │
|
||||
│ ┌───────────────────┐ │
|
||||
│ │ Embedding │ │
|
||||
│ │ │ │
|
||||
│ └───────────────────┘ │
|
||||
│ ▲ │
|
||||
│ │ │
|
||||
│ ┌─────────────┴────────────┐ │
|
||||
│ │ │ │
|
||||
│ │ SACObservationEncoder │ │
|
||||
│ │ │ │
|
||||
│ └──────────────────────────┘ │
|
||||
│ ▲ │
|
||||
│ │ │
|
||||
│ │ │
|
||||
│ │ │
|
||||
└───────────────────────────┬────────────────────┬───────────────────────────┘
|
||||
│ Observation │
|
||||
└────────────────────┘
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
encoder: Optional[nn.Module],
|
||||
ensemble: List[CriticHead],
|
||||
output_normalization: nn.Module,
|
||||
init_final: Optional[float] = None,
|
||||
):
|
||||
super().__init__()
|
||||
self.encoder = encoder
|
||||
self.init_final = init_final
|
||||
self.output_normalization = output_normalization
|
||||
self.critics = nn.ModuleList(ensemble)
|
||||
|
||||
self.parameters_to_optimize = []
|
||||
# Handle the case where a part of the encoder if frozen
|
||||
if self.encoder is not None:
|
||||
self.parameters_to_optimize += list(self.encoder.parameters_to_optimize)
|
||||
self.parameters_to_optimize += list(self.critics.parameters())
|
||||
|
||||
def forward(
|
||||
self,
|
||||
observations: dict[str, torch.Tensor],
|
||||
actions: torch.Tensor,
|
||||
observation_features: torch.Tensor | None = None,
|
||||
) -> torch.Tensor:
|
||||
device = get_device_from_parameters(self)
|
||||
# Move each tensor in observations to device
|
||||
observations = {k: v.to(device) for k, v in observations.items()}
|
||||
# NOTE: We normalize actions it helps for sample efficiency
|
||||
actions: dict[str, torch.tensor] = {"action": actions}
|
||||
# NOTE: Normalization layer took dict in input and outputs a dict that why
|
||||
actions = self.output_normalization(actions)["action"]
|
||||
actions = actions.to(device)
|
||||
|
||||
obs_enc = (
|
||||
observation_features
|
||||
if observation_features is not None
|
||||
else (observations if self.encoder is None else self.encoder(observations))
|
||||
)
|
||||
|
||||
inputs = torch.cat([obs_enc, actions], dim=-1)
|
||||
|
||||
# Loop through critics and collect outputs
|
||||
q_values = []
|
||||
for critic in self.critics:
|
||||
q_values.append(critic(inputs))
|
||||
|
||||
# Stack outputs to match expected shape [num_critics, batch_size]
|
||||
q_values = torch.stack([q.squeeze(-1) for q in q_values], dim=0)
|
||||
return q_values
|
||||
|
||||
|
||||
class Policy(nn.Module):
|
||||
def __init__(
|
||||
self,
|
||||
encoder: Optional[nn.Module],
|
||||
network: nn.Module,
|
||||
action_dim: int,
|
||||
log_std_min: float = -5,
|
||||
log_std_max: float = 2,
|
||||
fixed_std: Optional[torch.Tensor] = None,
|
||||
init_final: Optional[float] = None,
|
||||
use_tanh_squash: bool = False,
|
||||
encoder_is_shared: bool = False,
|
||||
):
|
||||
super().__init__()
|
||||
self.encoder = encoder
|
||||
self.network = network
|
||||
self.action_dim = action_dim
|
||||
self.log_std_min = log_std_min
|
||||
self.log_std_max = log_std_max
|
||||
self.fixed_std = fixed_std
|
||||
self.use_tanh_squash = use_tanh_squash
|
||||
self.parameters_to_optimize = []
|
||||
|
||||
self.parameters_to_optimize += list(self.network.parameters())
|
||||
|
||||
if self.encoder is not None and not encoder_is_shared:
|
||||
self.parameters_to_optimize += list(self.encoder.parameters())
|
||||
# Find the last Linear layer's output dimension
|
||||
for layer in reversed(network.net):
|
||||
if isinstance(layer, nn.Linear):
|
||||
out_features = layer.out_features
|
||||
break
|
||||
# Mean layer
|
||||
self.mean_layer = nn.Linear(out_features, action_dim)
|
||||
if init_final is not None:
|
||||
nn.init.uniform_(self.mean_layer.weight, -init_final, init_final)
|
||||
nn.init.uniform_(self.mean_layer.bias, -init_final, init_final)
|
||||
else:
|
||||
orthogonal_init()(self.mean_layer.weight)
|
||||
|
||||
self.parameters_to_optimize += list(self.mean_layer.parameters())
|
||||
# Standard deviation layer or parameter
|
||||
if fixed_std is None:
|
||||
self.std_layer = nn.Linear(out_features, action_dim)
|
||||
if init_final is not None:
|
||||
nn.init.uniform_(self.std_layer.weight, -init_final, init_final)
|
||||
nn.init.uniform_(self.std_layer.bias, -init_final, init_final)
|
||||
else:
|
||||
orthogonal_init()(self.std_layer.weight)
|
||||
self.parameters_to_optimize += list(self.std_layer.parameters())
|
||||
|
||||
def forward(
|
||||
self,
|
||||
observations: torch.Tensor,
|
||||
observation_features: torch.Tensor | None = None,
|
||||
) -> Tuple[torch.Tensor, torch.Tensor]:
|
||||
# Encode observations if encoder exists
|
||||
obs_enc = (
|
||||
observation_features
|
||||
if observation_features is not None
|
||||
else (observations if self.encoder is None else self.encoder(observations))
|
||||
)
|
||||
|
||||
# Get network outputs
|
||||
outputs = self.network(obs_enc)
|
||||
means = self.mean_layer(outputs)
|
||||
|
||||
# Compute standard deviations
|
||||
if self.fixed_std is None:
|
||||
log_std = self.std_layer(outputs)
|
||||
assert not torch.isnan(
|
||||
log_std
|
||||
).any(), "[ERROR] log_std became NaN after std_layer!"
|
||||
|
||||
if self.use_tanh_squash:
|
||||
log_std = torch.tanh(log_std)
|
||||
log_std = self.log_std_min + 0.5 * (
|
||||
self.log_std_max - self.log_std_min
|
||||
) * (log_std + 1.0)
|
||||
else:
|
||||
log_std = torch.clamp(log_std, self.log_std_min, self.log_std_max)
|
||||
else:
|
||||
log_std = self.fixed_std.expand_as(means)
|
||||
|
||||
# uses tanh activation function to squash the action to be in the range of [-1, 1]
|
||||
normal = torch.distributions.Normal(means, torch.exp(log_std))
|
||||
x_t = normal.rsample() # Reparameterization trick (mean + std * N(0,1))
|
||||
log_probs = normal.log_prob(x_t) # Base log probability before Tanh
|
||||
|
||||
if self.use_tanh_squash:
|
||||
actions = torch.tanh(x_t)
|
||||
log_probs -= torch.log(
|
||||
(1 - actions.pow(2)) + 1e-6
|
||||
) # Adjust log-probs for Tanh
|
||||
else:
|
||||
actions = x_t # No Tanh; raw Gaussian sample
|
||||
|
||||
log_probs = log_probs.sum(-1) # Sum over action dimensions
|
||||
means = torch.tanh(means) if self.use_tanh_squash else means
|
||||
return actions, log_probs, means
|
||||
|
||||
def get_features(self, observations: torch.Tensor) -> torch.Tensor:
|
||||
"""Get encoded features from observations"""
|
||||
device = get_device_from_parameters(self)
|
||||
observations = observations.to(device)
|
||||
if self.encoder is not None:
|
||||
with torch.inference_mode():
|
||||
return self.encoder(observations)
|
||||
return observations
|
||||
|
||||
|
||||
class SACObservationEncoder(nn.Module):
|
||||
"""Encode image and/or state vector observations."""
|
||||
|
||||
def __init__(self, config: SACConfig, input_normalizer: nn.Module):
|
||||
"""
|
||||
Creates encoders for pixel and/or state modalities.
|
||||
"""
|
||||
super().__init__()
|
||||
self.config = config
|
||||
self.input_normalization = input_normalizer
|
||||
self.has_pretrained_vision_encoder = False
|
||||
self.parameters_to_optimize = []
|
||||
|
||||
self.aggregation_size: int = 0
|
||||
if any("observation.image" in key for key in config.input_shapes):
|
||||
self.camera_number = config.camera_number
|
||||
|
||||
if self.config.vision_encoder_name is not None:
|
||||
self.image_enc_layers = PretrainedImageEncoder(config)
|
||||
self.has_pretrained_vision_encoder = True
|
||||
else:
|
||||
self.image_enc_layers = DefaultImageEncoder(config)
|
||||
|
||||
self.aggregation_size += config.latent_dim * self.camera_number
|
||||
|
||||
if config.freeze_vision_encoder:
|
||||
freeze_image_encoder(self.image_enc_layers)
|
||||
else:
|
||||
self.parameters_to_optimize += list(self.image_enc_layers.parameters())
|
||||
self.all_image_keys = [
|
||||
k for k in config.input_shapes if k.startswith("observation.image")
|
||||
]
|
||||
|
||||
if "observation.state" in config.input_shapes:
|
||||
self.state_enc_layers = nn.Sequential(
|
||||
nn.Linear(
|
||||
in_features=config.input_shapes["observation.state"][0],
|
||||
out_features=config.latent_dim,
|
||||
),
|
||||
nn.LayerNorm(normalized_shape=config.latent_dim),
|
||||
nn.Tanh(),
|
||||
)
|
||||
self.aggregation_size += config.latent_dim
|
||||
|
||||
self.parameters_to_optimize += list(self.state_enc_layers.parameters())
|
||||
|
||||
if "observation.environment_state" in config.input_shapes:
|
||||
self.env_state_enc_layers = nn.Sequential(
|
||||
nn.Linear(
|
||||
in_features=config.input_shapes["observation.environment_state"][0],
|
||||
out_features=config.latent_dim,
|
||||
),
|
||||
nn.LayerNorm(normalized_shape=config.latent_dim),
|
||||
nn.Tanh(),
|
||||
)
|
||||
self.aggregation_size += config.latent_dim
|
||||
self.parameters_to_optimize += list(self.env_state_enc_layers.parameters())
|
||||
|
||||
self.aggregation_layer = nn.Linear(
|
||||
in_features=self.aggregation_size, out_features=config.latent_dim
|
||||
)
|
||||
self.parameters_to_optimize += list(self.aggregation_layer.parameters())
|
||||
|
||||
def forward(self, obs_dict: dict[str, Tensor]) -> Tensor:
|
||||
"""Encode the image and/or state vector.
|
||||
|
||||
Each modality is encoded into a feature vector of size (latent_dim,) and then a uniform mean is taken
|
||||
over all features.
|
||||
"""
|
||||
feat = []
|
||||
obs_dict = self.input_normalization(obs_dict)
|
||||
# Batch all images along the batch dimension, then encode them.
|
||||
if len(self.all_image_keys) > 0:
|
||||
images_batched = torch.cat(
|
||||
[obs_dict[key] for key in self.all_image_keys], dim=0
|
||||
)
|
||||
images_batched = self.image_enc_layers(images_batched)
|
||||
embeddings_chunks = torch.chunk(
|
||||
images_batched, dim=0, chunks=len(self.all_image_keys)
|
||||
)
|
||||
feat.extend(embeddings_chunks)
|
||||
|
||||
if "observation.environment_state" in self.config.input_shapes:
|
||||
feat.append(
|
||||
self.env_state_enc_layers(obs_dict["observation.environment_state"])
|
||||
)
|
||||
if "observation.state" in self.config.input_shapes:
|
||||
feat.append(self.state_enc_layers(obs_dict["observation.state"]))
|
||||
|
||||
features = torch.cat(tensors=feat, dim=-1)
|
||||
features = self.aggregation_layer(features)
|
||||
|
||||
return features
|
||||
|
||||
@property
|
||||
def output_dim(self) -> int:
|
||||
"""Returns the dimension of the encoder output"""
|
||||
return self.config.latent_dim
|
||||
|
||||
|
||||
class DefaultImageEncoder(nn.Module):
|
||||
def __init__(self, config):
|
||||
super().__init__()
|
||||
self.image_enc_layers = nn.Sequential(
|
||||
nn.Conv2d(
|
||||
in_channels=config.input_shapes["observation.image"][0],
|
||||
out_channels=config.image_encoder_hidden_dim,
|
||||
kernel_size=7,
|
||||
stride=2,
|
||||
),
|
||||
nn.ReLU(),
|
||||
nn.Conv2d(
|
||||
in_channels=config.image_encoder_hidden_dim,
|
||||
out_channels=config.image_encoder_hidden_dim,
|
||||
kernel_size=5,
|
||||
stride=2,
|
||||
),
|
||||
nn.ReLU(),
|
||||
nn.Conv2d(
|
||||
in_channels=config.image_encoder_hidden_dim,
|
||||
out_channels=config.image_encoder_hidden_dim,
|
||||
kernel_size=3,
|
||||
stride=2,
|
||||
),
|
||||
nn.ReLU(),
|
||||
nn.Conv2d(
|
||||
in_channels=config.image_encoder_hidden_dim,
|
||||
out_channels=config.image_encoder_hidden_dim,
|
||||
kernel_size=3,
|
||||
stride=2,
|
||||
),
|
||||
nn.ReLU(),
|
||||
)
|
||||
dummy_batch = torch.zeros(1, *config.input_shapes["observation.image"])
|
||||
with torch.inference_mode():
|
||||
self.image_enc_out_shape = self.image_enc_layers(dummy_batch).shape[1:]
|
||||
self.image_enc_layers.extend(
|
||||
nn.Sequential(
|
||||
nn.Flatten(),
|
||||
nn.Linear(np.prod(self.image_enc_out_shape), config.latent_dim),
|
||||
nn.LayerNorm(config.latent_dim),
|
||||
nn.Tanh(),
|
||||
)
|
||||
)
|
||||
|
||||
def forward(self, x):
|
||||
return self.image_enc_layers(x)
|
||||
|
||||
|
||||
class PretrainedImageEncoder(nn.Module):
|
||||
def __init__(self, config):
|
||||
super().__init__()
|
||||
|
||||
self.image_enc_layers, self.image_enc_out_shape = (
|
||||
self._load_pretrained_vision_encoder(config)
|
||||
)
|
||||
self.image_enc_proj = nn.Sequential(
|
||||
nn.Linear(np.prod(self.image_enc_out_shape), config.latent_dim),
|
||||
nn.LayerNorm(config.latent_dim),
|
||||
nn.Tanh(),
|
||||
)
|
||||
|
||||
def _load_pretrained_vision_encoder(self, config):
|
||||
"""Set up CNN encoder"""
|
||||
from transformers import AutoModel
|
||||
|
||||
self.image_enc_layers = AutoModel.from_pretrained(
|
||||
config.vision_encoder_name, trust_remote_code=True
|
||||
)
|
||||
# self.image_enc_layers.pooler = Identity()
|
||||
|
||||
if hasattr(self.image_enc_layers.config, "hidden_sizes"):
|
||||
self.image_enc_out_shape = self.image_enc_layers.config.hidden_sizes[
|
||||
-1
|
||||
] # Last channel dimension
|
||||
elif hasattr(self.image_enc_layers, "fc"):
|
||||
self.image_enc_out_shape = self.image_enc_layers.fc.in_features
|
||||
else:
|
||||
raise ValueError(
|
||||
"Unsupported vision encoder architecture, make sure you are using a CNN"
|
||||
)
|
||||
return self.image_enc_layers, self.image_enc_out_shape
|
||||
|
||||
def forward(self, x):
|
||||
# TODO: (maractingi, azouitine) check the forward pass of the pretrained model
|
||||
# doesn't reach the classifier layer because we don't need it
|
||||
enc_feat = self.image_enc_layers(x).pooler_output
|
||||
enc_feat = self.image_enc_proj(enc_feat.view(enc_feat.shape[0], -1))
|
||||
return enc_feat
|
||||
|
||||
|
||||
def freeze_image_encoder(image_encoder: nn.Module):
|
||||
"""Freeze all parameters in the encoder"""
|
||||
for param in image_encoder.parameters():
|
||||
param.requires_grad = False
|
||||
|
||||
|
||||
def orthogonal_init():
|
||||
return lambda x: torch.nn.init.orthogonal_(x, gain=1.0)
|
||||
|
||||
|
||||
class Identity(nn.Module):
|
||||
def __init__(self):
|
||||
super().__init__()
|
||||
|
||||
def forward(self, x):
|
||||
return x
|
||||
|
||||
|
||||
def _convert_normalization_params_to_tensor(normalization_params: dict) -> dict:
|
||||
converted_params = {}
|
||||
for outer_key, inner_dict in normalization_params.items():
|
||||
converted_params[outer_key] = {}
|
||||
for key, value in inner_dict.items():
|
||||
converted_params[outer_key][key] = torch.tensor(value)
|
||||
if "image" in outer_key:
|
||||
converted_params[outer_key][key] = converted_params[outer_key][
|
||||
key
|
||||
].view(3, 1, 1)
|
||||
|
||||
return converted_params
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
# Benchmark the CriticEnsemble performance
|
||||
import time
|
||||
|
||||
# Configuration
|
||||
num_critics = 10
|
||||
batch_size = 32
|
||||
action_dim = 7
|
||||
obs_dim = 64
|
||||
hidden_dims = [256, 256]
|
||||
num_iterations = 100
|
||||
|
||||
print("Creating test environment...")
|
||||
|
||||
# Create a simple dummy encoder
|
||||
class DummyEncoder(nn.Module):
|
||||
def __init__(self):
|
||||
super().__init__()
|
||||
self.output_dim = obs_dim
|
||||
self.parameters_to_optimize = []
|
||||
|
||||
def forward(self, obs):
|
||||
# Just return a random tensor of the right shape
|
||||
# In practice, this would encode the observations
|
||||
return torch.randn(batch_size, obs_dim, device=device)
|
||||
|
||||
# Create critic heads
|
||||
print(f"Creating {num_critics} critic heads...")
|
||||
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
|
||||
critic_heads = [
|
||||
CriticHead(
|
||||
input_dim=obs_dim + action_dim,
|
||||
hidden_dims=hidden_dims,
|
||||
).to(device)
|
||||
for _ in range(num_critics)
|
||||
]
|
||||
|
||||
# Create the critic ensemble
|
||||
print("Creating CriticEnsemble...")
|
||||
critic_ensemble = CriticEnsemble(
|
||||
encoder=DummyEncoder().to(device),
|
||||
ensemble=critic_heads,
|
||||
output_normalization=nn.Identity(),
|
||||
).to(device)
|
||||
|
||||
# Create random input data
|
||||
print("Creating input data...")
|
||||
obs_dict = {
|
||||
"observation.state": torch.randn(batch_size, obs_dim, device=device),
|
||||
}
|
||||
actions = torch.randn(batch_size, action_dim, device=device)
|
||||
|
||||
# Warmup run
|
||||
print("Warming up...")
|
||||
_ = critic_ensemble(obs_dict, actions)
|
||||
|
||||
# Time the forward pass
|
||||
print(f"Running benchmark with {num_iterations} iterations...")
|
||||
start_time = time.perf_counter()
|
||||
for _ in range(num_iterations):
|
||||
q_values = critic_ensemble(obs_dict, actions)
|
||||
end_time = time.perf_counter()
|
||||
|
||||
# Print results
|
||||
elapsed_time = end_time - start_time
|
||||
print(f"Total time: {elapsed_time:.4f} seconds")
|
||||
print(f"Average time per iteration: {elapsed_time / num_iterations * 1000:.4f} ms")
|
||||
print(f"Output shape: {q_values.shape}") # Should be [num_critics, batch_size]
|
||||
|
||||
# Verify that all critic heads produce different outputs
|
||||
# This confirms each critic head is unique
|
||||
# print("\nVerifying critic outputs are different:")
|
||||
# for i in range(num_critics):
|
||||
# for j in range(i + 1, num_critics):
|
||||
# diff = torch.abs(q_values[i] - q_values[j]).mean().item()
|
||||
# print(f"Mean difference between critic {i} and {j}: {diff:.6f}")
|
||||
@@ -25,12 +25,16 @@ class TDMPCConfig:
|
||||
camera observations.
|
||||
|
||||
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||
Those are: `input_shapes`, `output_shapes`, and perhaps `max_random_shift`.
|
||||
Those are: `input_shapes`, `output_shapes`, and perhaps `max_random_shift_ratio`.
|
||||
|
||||
Args:
|
||||
n_action_repeats: The number of times to repeat the action returned by the planning. (hint: Google
|
||||
action repeats in Q-learning or ask your favorite chatbot)
|
||||
horizon: Horizon for model predictive control.
|
||||
n_action_steps: Number of action steps to take from the plan given by model predictive control. This
|
||||
is an alternative to using action repeats. If this is set to more than 1, then we require
|
||||
`n_action_repeats == 1`, `use_mpc == True` and `n_action_steps <= horizon`. Note that this
|
||||
approach of using multiple steps from the plan is not in the original implementation.
|
||||
input_shapes: A dictionary defining the shapes of the input data for the policy. The key represents
|
||||
the input data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||
For example, "observation.image" refers to an input from a camera with dimensions [3, 96, 96],
|
||||
@@ -100,6 +104,7 @@ class TDMPCConfig:
|
||||
# Input / output structure.
|
||||
n_action_repeats: int = 2
|
||||
horizon: int = 5
|
||||
n_action_steps: int = 1
|
||||
|
||||
input_shapes: dict[str, list[int]] = field(
|
||||
default_factory=lambda: {
|
||||
@@ -158,17 +163,18 @@ class TDMPCConfig:
|
||||
"""Input validation (not exhaustive)."""
|
||||
# There should only be one image key.
|
||||
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
||||
if len(image_keys) != 1:
|
||||
if len(image_keys) > 1:
|
||||
raise ValueError(
|
||||
f"{self.__class__.__name__} only handles one image for now. Got image keys {image_keys}."
|
||||
)
|
||||
image_key = next(iter(image_keys))
|
||||
if self.input_shapes[image_key][-2] != self.input_shapes[image_key][-1]:
|
||||
# TODO(alexander-soare): This limitation is solely because of code in the random shift
|
||||
# augmentation. It should be able to be removed.
|
||||
raise ValueError(
|
||||
f"Only square images are handled now. Got image shape {self.input_shapes[image_key]}."
|
||||
f"{self.__class__.__name__} handles at most one image for now. Got image keys {image_keys}."
|
||||
)
|
||||
if len(image_keys) > 0:
|
||||
image_key = next(iter(image_keys))
|
||||
if self.input_shapes[image_key][-2] != self.input_shapes[image_key][-1]:
|
||||
# TODO(alexander-soare): This limitation is solely because of code in the random shift
|
||||
# augmentation. It should be able to be removed.
|
||||
raise ValueError(
|
||||
f"Only square images are handled now. Got image shape {self.input_shapes[image_key]}."
|
||||
)
|
||||
if self.n_gaussian_samples <= 0:
|
||||
raise ValueError(
|
||||
f"The number of guassian samples for CEM should be non-zero. Got `{self.n_gaussian_samples=}`"
|
||||
@@ -179,3 +185,16 @@ class TDMPCConfig:
|
||||
f"advised that you stick with the default. See {self.__class__.__name__} docstring for more "
|
||||
"information."
|
||||
)
|
||||
if self.n_action_steps > 1:
|
||||
if self.n_action_repeats != 1:
|
||||
raise ValueError(
|
||||
"If `n_action_steps > 1`, `n_action_repeats` must be left to its default value of 1."
|
||||
)
|
||||
if not self.use_mpc:
|
||||
raise ValueError(
|
||||
"If `n_action_steps > 1`, `use_mpc` must be set to `True`."
|
||||
)
|
||||
if self.n_action_steps > self.horizon:
|
||||
raise ValueError(
|
||||
"`n_action_steps` must be less than or equal to `horizon`."
|
||||
)
|
||||
|
||||
@@ -19,14 +19,10 @@
|
||||
The comments in this code may sometimes refer to these references:
|
||||
TD-MPC paper: Temporal Difference Learning for Model Predictive Control (https://arxiv.org/abs/2203.04955)
|
||||
FOWM paper: Finetuning Offline World Models in the Real World (https://arxiv.org/abs/2310.16029)
|
||||
|
||||
TODO(alexander-soare): Make rollout work for batch sizes larger than 1.
|
||||
TODO(alexander-soare): Use batch-first throughout.
|
||||
"""
|
||||
|
||||
# ruff: noqa: N806
|
||||
|
||||
import logging
|
||||
from collections import deque
|
||||
from copy import deepcopy
|
||||
from functools import partial
|
||||
@@ -45,7 +41,13 @@ from lerobot.common.policies.tdmpc.configuration_tdmpc import TDMPCConfig
|
||||
from lerobot.common.policies.utils import get_device_from_parameters, populate_queues
|
||||
|
||||
|
||||
class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
class TDMPCPolicy(
|
||||
nn.Module,
|
||||
PyTorchModelHubMixin,
|
||||
library_name="lerobot",
|
||||
repo_url="https://github.com/huggingface/lerobot",
|
||||
tags=["robotics", "tdmpc"],
|
||||
):
|
||||
"""Implementation of TD-MPC learning + inference.
|
||||
|
||||
Please note several warnings for this policy.
|
||||
@@ -56,15 +58,19 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
process communication to use the xarm environment from FOWM. This is because our xarm
|
||||
environment uses newer dependencies and does not match the environment in FOWM. See
|
||||
https://github.com/huggingface/lerobot/pull/103 for implementation details.
|
||||
- We have NOT checked that training on LeRobot reproduces SOTA results. This is a TODO.
|
||||
- We have NOT checked that training on LeRobot reproduces the results from FOWM.
|
||||
- Nevertheless, we have verified that we can train TD-MPC for PushT. See
|
||||
`lerobot/configs/policy/tdmpc_pusht_keypoints.yaml`.
|
||||
- Our current xarm datasets were generated using the environment from FOWM. Therefore they do not
|
||||
match our xarm environment.
|
||||
match our xarm environment.
|
||||
"""
|
||||
|
||||
name = "tdmpc"
|
||||
|
||||
def __init__(
|
||||
self, config: TDMPCConfig | None = None, dataset_stats: dict[str, dict[str, Tensor]] | None = None
|
||||
self,
|
||||
config: TDMPCConfig | None = None,
|
||||
dataset_stats: dict[str, dict[str, Tensor]] | None = None,
|
||||
):
|
||||
"""
|
||||
Args:
|
||||
@@ -74,22 +80,6 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
that they will be passed with a call to `load_state_dict` before the policy is used.
|
||||
"""
|
||||
super().__init__()
|
||||
logging.warning(
|
||||
"""
|
||||
Please note several warnings for this policy.
|
||||
|
||||
- Evaluation of pretrained weights created with the original FOWM code
|
||||
(https://github.com/fyhMer/fowm) works as expected. To be precise: we trained and evaluated a
|
||||
model with the FOWM code for the xarm_lift_medium_replay dataset. We ported the weights across
|
||||
to LeRobot, and were able to evaluate with the same success metric. BUT, we had to use inter-
|
||||
process communication to use the xarm environment from FOWM. This is because our xarm
|
||||
environment uses newer dependencies and does not match the environment in FOWM. See
|
||||
https://github.com/huggingface/lerobot/pull/103 for implementation details.
|
||||
- We have NOT checked that training on LeRobot reproduces SOTA results. This is a TODO.
|
||||
- Our current xarm datasets were generated using the environment from FOWM. Therefore they do not
|
||||
match our xarm environment.
|
||||
"""
|
||||
)
|
||||
|
||||
if config is None:
|
||||
config = TDMPCConfig()
|
||||
@@ -112,10 +102,18 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||
)
|
||||
|
||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
image_keys = [
|
||||
k for k in config.input_shapes if k.startswith("observation.image")
|
||||
]
|
||||
# Note: This check is covered in the post-init of the config but have a sanity check just in case.
|
||||
assert len(image_keys) == 1
|
||||
self.input_image_key = image_keys[0]
|
||||
self._use_image = False
|
||||
self._use_env_state = False
|
||||
if len(image_keys) > 0:
|
||||
assert len(image_keys) == 1
|
||||
self._use_image = True
|
||||
self.input_image_key = image_keys[0]
|
||||
if "observation.environment_state" in config.input_shapes:
|
||||
self._use_env_state = True
|
||||
|
||||
self.reset()
|
||||
|
||||
@@ -125,19 +123,28 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
called on `env.reset()`
|
||||
"""
|
||||
self._queues = {
|
||||
"observation.image": deque(maxlen=1),
|
||||
"observation.state": deque(maxlen=1),
|
||||
"action": deque(maxlen=self.config.n_action_repeats),
|
||||
"action": deque(
|
||||
maxlen=max(self.config.n_action_steps, self.config.n_action_repeats)
|
||||
),
|
||||
}
|
||||
if self._use_image:
|
||||
self._queues["observation.image"] = deque(maxlen=1)
|
||||
if self._use_env_state:
|
||||
self._queues["observation.environment_state"] = deque(maxlen=1)
|
||||
# Previous mean obtained from the cross-entropy method (CEM) used during MPC. It is used to warm start
|
||||
# CEM for the next step.
|
||||
self._prev_mean: torch.Tensor | None = None
|
||||
|
||||
@torch.no_grad()
|
||||
def select_action(self, batch: dict[str, Tensor]):
|
||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""Select a single action given environment observations."""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
if self._use_image:
|
||||
batch = dict(
|
||||
batch
|
||||
) # shallow copy so that adding a key doesn't modify the original
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
|
||||
self._queues = populate_queues(self._queues, batch)
|
||||
|
||||
@@ -151,49 +158,57 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
batch[key] = batch[key][:, 0]
|
||||
|
||||
# NOTE: Order of observations matters here.
|
||||
z = self.model.encode({k: batch[k] for k in ["observation.image", "observation.state"]})
|
||||
if self.config.use_mpc:
|
||||
batch_size = batch["observation.image"].shape[0]
|
||||
# Batch processing is not handled in MPC mode, so process the batch in a loop.
|
||||
action = [] # will be a batch of actions for one step
|
||||
for i in range(batch_size):
|
||||
# Note: self.plan does not handle batches, hence the squeeze.
|
||||
action.append(self.plan(z[i]))
|
||||
action = torch.stack(action)
|
||||
encode_keys = []
|
||||
if self._use_image:
|
||||
encode_keys.append("observation.image")
|
||||
if self._use_env_state:
|
||||
encode_keys.append("observation.environment_state")
|
||||
encode_keys.append("observation.state")
|
||||
z = self.model.encode({k: batch[k] for k in encode_keys})
|
||||
if self.config.use_mpc: # noqa: SIM108
|
||||
actions = self.plan(z) # (horizon, batch, action_dim)
|
||||
else:
|
||||
# Plan with the policy (π) alone.
|
||||
action = self.model.pi(z)
|
||||
# Plan with the policy (π) alone. This always returns one action so unsqueeze to get a
|
||||
# sequence dimension like in the MPC branch.
|
||||
actions = self.model.pi(z).unsqueeze(0)
|
||||
|
||||
self.unnormalize_outputs({"action": action})["action"]
|
||||
actions = torch.clamp(actions, -1, +1)
|
||||
|
||||
for _ in range(self.config.n_action_repeats):
|
||||
self._queues["action"].append(action)
|
||||
actions = self.unnormalize_outputs({"action": actions})["action"]
|
||||
|
||||
if self.config.n_action_repeats > 1:
|
||||
for _ in range(self.config.n_action_repeats):
|
||||
self._queues["action"].append(actions[0])
|
||||
else:
|
||||
# Action queue is (n_action_steps, batch_size, action_dim), so we transpose the action.
|
||||
self._queues["action"].extend(actions[: self.config.n_action_steps])
|
||||
|
||||
action = self._queues["action"].popleft()
|
||||
return torch.clamp(action, -1, 1)
|
||||
return action
|
||||
|
||||
@torch.no_grad()
|
||||
def plan(self, z: Tensor) -> Tensor:
|
||||
"""Plan next action using TD-MPC inference.
|
||||
"""Plan sequence of actions using TD-MPC inference.
|
||||
|
||||
Args:
|
||||
z: (latent_dim,) tensor for the initial state.
|
||||
z: (batch, latent_dim,) tensor for the initial state.
|
||||
Returns:
|
||||
(action_dim,) tensor for the next action.
|
||||
|
||||
TODO(alexander-soare) Extend this to be able to work with batches.
|
||||
(horizon, batch, action_dim,) tensor for the planned trajectory of actions.
|
||||
"""
|
||||
device = get_device_from_parameters(self)
|
||||
|
||||
batch_size = z.shape[0]
|
||||
|
||||
# Sample Nπ trajectories from the policy.
|
||||
pi_actions = torch.empty(
|
||||
self.config.horizon,
|
||||
self.config.n_pi_samples,
|
||||
batch_size,
|
||||
self.config.output_shapes["action"][0],
|
||||
device=device,
|
||||
)
|
||||
if self.config.n_pi_samples > 0:
|
||||
_z = einops.repeat(z, "d -> n d", n=self.config.n_pi_samples)
|
||||
_z = einops.repeat(z, "b d -> n b d", n=self.config.n_pi_samples)
|
||||
for t in range(self.config.horizon):
|
||||
# Note: Adding a small amount of noise here doesn't hurt during inference and may even be
|
||||
# helpful for CEM.
|
||||
@@ -202,12 +217,21 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
|
||||
# In the CEM loop we will need this for a call to estimate_value with the gaussian sampled
|
||||
# trajectories.
|
||||
z = einops.repeat(z, "d -> n d", n=self.config.n_gaussian_samples + self.config.n_pi_samples)
|
||||
z = einops.repeat(
|
||||
z,
|
||||
"b d -> n b d",
|
||||
n=self.config.n_gaussian_samples + self.config.n_pi_samples,
|
||||
)
|
||||
|
||||
# Model Predictive Path Integral (MPPI) with the cross-entropy method (CEM) as the optimization
|
||||
# algorithm.
|
||||
# The initial mean and standard deviation for the cross-entropy method (CEM).
|
||||
mean = torch.zeros(self.config.horizon, self.config.output_shapes["action"][0], device=device)
|
||||
mean = torch.zeros(
|
||||
self.config.horizon,
|
||||
batch_size,
|
||||
self.config.output_shapes["action"][0],
|
||||
device=device,
|
||||
)
|
||||
# Maybe warm start CEM with the mean from the previous step.
|
||||
if self._prev_mean is not None:
|
||||
mean[:-1] = self._prev_mean[1:]
|
||||
@@ -218,35 +242,51 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
std_normal_noise = torch.randn(
|
||||
self.config.horizon,
|
||||
self.config.n_gaussian_samples,
|
||||
batch_size,
|
||||
self.config.output_shapes["action"][0],
|
||||
device=std.device,
|
||||
)
|
||||
gaussian_actions = torch.clamp(mean.unsqueeze(1) + std.unsqueeze(1) * std_normal_noise, -1, 1)
|
||||
gaussian_actions = torch.clamp(
|
||||
mean.unsqueeze(1) + std.unsqueeze(1) * std_normal_noise, -1, 1
|
||||
)
|
||||
|
||||
# Compute elite actions.
|
||||
actions = torch.cat([gaussian_actions, pi_actions], dim=1)
|
||||
value = self.estimate_value(z, actions).nan_to_num_(0)
|
||||
elite_idxs = torch.topk(value, self.config.n_elites, dim=0).indices
|
||||
elite_value, elite_actions = value[elite_idxs], actions[:, elite_idxs]
|
||||
elite_idxs = torch.topk(
|
||||
value, self.config.n_elites, dim=0
|
||||
).indices # (n_elites, batch)
|
||||
elite_value = value.take_along_dim(elite_idxs, dim=0) # (n_elites, batch)
|
||||
# (horizon, n_elites, batch, action_dim)
|
||||
elite_actions = actions.take_along_dim(
|
||||
einops.rearrange(elite_idxs, "n b -> 1 n b 1"), dim=1
|
||||
)
|
||||
|
||||
# Update guassian PDF parameters to be the (weighted) mean and standard deviation of the elites.
|
||||
max_value = elite_value.max(0)[0]
|
||||
# Update gaussian PDF parameters to be the (weighted) mean and standard deviation of the elites.
|
||||
max_value = elite_value.max(0, keepdim=True)[0] # (1, batch)
|
||||
# The weighting is a softmax over trajectory values. Note that this is not the same as the usage
|
||||
# of Ω in eqn 4 of the TD-MPC paper. Instead it is the normalized version of it: s = Ω/ΣΩ. This
|
||||
# makes the equations: μ = Σ(s⋅Γ), σ = Σ(s⋅(Γ-μ)²).
|
||||
score = torch.exp(self.config.elite_weighting_temperature * (elite_value - max_value))
|
||||
score /= score.sum()
|
||||
_mean = torch.sum(einops.rearrange(score, "n -> n 1") * elite_actions, dim=1)
|
||||
score = torch.exp(
|
||||
self.config.elite_weighting_temperature * (elite_value - max_value)
|
||||
)
|
||||
score /= score.sum(axis=0, keepdim=True)
|
||||
# (horizon, batch, action_dim)
|
||||
_mean = torch.sum(
|
||||
einops.rearrange(score, "n b -> n b 1") * elite_actions, dim=1
|
||||
)
|
||||
_std = torch.sqrt(
|
||||
torch.sum(
|
||||
einops.rearrange(score, "n -> n 1")
|
||||
* (elite_actions - einops.rearrange(_mean, "h d -> h 1 d")) ** 2,
|
||||
einops.rearrange(score, "n b -> n b 1")
|
||||
* (elite_actions - einops.rearrange(_mean, "h b d -> h 1 b d"))
|
||||
** 2,
|
||||
dim=1,
|
||||
)
|
||||
)
|
||||
# Update mean with an exponential moving average, and std with a direct replacement.
|
||||
mean = (
|
||||
self.config.gaussian_mean_momentum * mean + (1 - self.config.gaussian_mean_momentum) * _mean
|
||||
self.config.gaussian_mean_momentum * mean
|
||||
+ (1 - self.config.gaussian_mean_momentum) * _mean
|
||||
)
|
||||
std = _std.clamp_(self.config.min_std, self.config.max_std)
|
||||
|
||||
@@ -255,11 +295,11 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
|
||||
# Randomly select one of the elite actions from the last iteration of MPPI/CEM using the softmax
|
||||
# scores from the last iteration.
|
||||
actions = elite_actions[:, torch.multinomial(score, 1).item()]
|
||||
actions = elite_actions[
|
||||
:, torch.multinomial(score.T, 1).squeeze(), torch.arange(batch_size)
|
||||
]
|
||||
|
||||
# Select only the first action
|
||||
action = actions[0]
|
||||
return action
|
||||
return actions
|
||||
|
||||
@torch.no_grad()
|
||||
def estimate_value(self, z: Tensor, actions: Tensor):
|
||||
@@ -280,7 +320,8 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
# of the FOWM paper.
|
||||
if self.config.uncertainty_regularizer_coeff > 0:
|
||||
regularization = -(
|
||||
self.config.uncertainty_regularizer_coeff * self.model.Qs(z, actions[t]).std(0)
|
||||
self.config.uncertainty_regularizer_coeff
|
||||
* self.model.Qs(z, actions[t]).std(0)
|
||||
)
|
||||
else:
|
||||
regularization = 0
|
||||
@@ -300,23 +341,37 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
if self.config.q_ensemble_size > 2:
|
||||
G += (
|
||||
running_discount
|
||||
* torch.min(terminal_values[torch.randint(0, self.config.q_ensemble_size, size=(2,))], dim=0)[
|
||||
0
|
||||
]
|
||||
* torch.min(
|
||||
terminal_values[
|
||||
torch.randint(0, self.config.q_ensemble_size, size=(2,))
|
||||
],
|
||||
dim=0,
|
||||
)[0]
|
||||
)
|
||||
else:
|
||||
G += running_discount * torch.min(terminal_values, dim=0)[0]
|
||||
# Finally, also regularize the terminal value.
|
||||
if self.config.uncertainty_regularizer_coeff > 0:
|
||||
G -= running_discount * self.config.uncertainty_regularizer_coeff * terminal_values.std(0)
|
||||
G -= (
|
||||
running_discount
|
||||
* self.config.uncertainty_regularizer_coeff
|
||||
* terminal_values.std(0)
|
||||
)
|
||||
return G
|
||||
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||
"""Run the batch through the model and compute the loss."""
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor | float]:
|
||||
"""Run the batch through the model and compute the loss.
|
||||
|
||||
Returns a dictionary with loss as a tensor, and other information as native floats.
|
||||
"""
|
||||
device = get_device_from_parameters(self)
|
||||
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
if self._use_image:
|
||||
batch = dict(
|
||||
batch
|
||||
) # shallow copy so that adding a key doesn't modify the original
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
batch = self.normalize_targets(batch)
|
||||
|
||||
info = {}
|
||||
@@ -326,14 +381,17 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
if batch[key].ndim > 1:
|
||||
batch[key] = batch[key].transpose(1, 0)
|
||||
|
||||
action = batch["action"] # (t, b)
|
||||
reward = batch["next.reward"] # (t,)
|
||||
action = batch["action"] # (t, b, action_dim)
|
||||
reward = batch["next.reward"] # (t, b)
|
||||
observations = {k: v for k, v in batch.items() if k.startswith("observation.")}
|
||||
|
||||
# Apply random image augmentations.
|
||||
if self.config.max_random_shift_ratio > 0:
|
||||
if self._use_image and self.config.max_random_shift_ratio > 0:
|
||||
observations["observation.image"] = flatten_forward_unflatten(
|
||||
partial(random_shifts_aug, max_random_shift_ratio=self.config.max_random_shift_ratio),
|
||||
partial(
|
||||
random_shifts_aug,
|
||||
max_random_shift_ratio=self.config.max_random_shift_ratio,
|
||||
),
|
||||
observations["observation.image"],
|
||||
)
|
||||
|
||||
@@ -343,20 +401,28 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
for k in observations:
|
||||
current_observation[k] = observations[k][0]
|
||||
next_observations[k] = observations[k][1:]
|
||||
horizon = next_observations["observation.image"].shape[0]
|
||||
horizon, batch_size = next_observations[
|
||||
"observation.image" if self._use_image else "observation.environment_state"
|
||||
].shape[:2]
|
||||
|
||||
# Run latent rollout using the latent dynamics model and policy model.
|
||||
# Note this has shape `horizon+1` because there are `horizon` actions and a current `z`. Each action
|
||||
# gives us a next `z`.
|
||||
batch_size = batch["index"].shape[0]
|
||||
z_preds = torch.empty(horizon + 1, batch_size, self.config.latent_dim, device=device)
|
||||
z_preds = torch.empty(
|
||||
horizon + 1, batch_size, self.config.latent_dim, device=device
|
||||
)
|
||||
z_preds[0] = self.model.encode(current_observation)
|
||||
reward_preds = torch.empty_like(reward, device=device)
|
||||
for t in range(horizon):
|
||||
z_preds[t + 1], reward_preds[t] = self.model.latent_dynamics_and_reward(z_preds[t], action[t])
|
||||
z_preds[t + 1], reward_preds[t] = self.model.latent_dynamics_and_reward(
|
||||
z_preds[t], action[t]
|
||||
)
|
||||
|
||||
# Compute Q and V value predictions based on the latent rollout.
|
||||
q_preds_ensemble = self.model.Qs(z_preds[:-1], action) # (ensemble, horizon, batch)
|
||||
q_preds_ensemble = self.model.Qs(
|
||||
z_preds[:-1], action
|
||||
) # (ensemble, horizon, batch)
|
||||
v_preds = self.model.V(z_preds[:-1])
|
||||
info.update({"Q": q_preds_ensemble.mean().item(), "V": v_preds.mean().item()})
|
||||
|
||||
@@ -370,10 +436,14 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
# actions (not actions estimated by π).
|
||||
# Note: Here we do not use self.model_target, but self.model. This is to follow the original code
|
||||
# and the FOWM paper.
|
||||
q_targets = reward + self.config.discount * self.model.V(self.model.encode(next_observations))
|
||||
q_targets = reward + self.config.discount * self.model.V(
|
||||
self.model.encode(next_observations)
|
||||
)
|
||||
# From eqn 3 of FOWM. These appear as Q(z, a). Here we call them v_targets to emphasize that we
|
||||
# are using them to compute loss for V.
|
||||
v_targets = self.model_target.Qs(z_preds[:-1].detach(), action, return_min=True)
|
||||
v_targets = self.model_target.Qs(
|
||||
z_preds[:-1].detach(), action, return_min=True
|
||||
)
|
||||
|
||||
# Compute losses.
|
||||
# Exponentially decay the loss weight with respect to the timestep. Steps that are more distant in the
|
||||
@@ -413,9 +483,12 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
# Compute state-action value loss (TD loss) for all of the Q functions in the ensemble.
|
||||
q_value_loss = (
|
||||
(
|
||||
F.mse_loss(
|
||||
temporal_loss_coeffs
|
||||
* F.mse_loss(
|
||||
q_preds_ensemble,
|
||||
einops.repeat(q_targets, "t b -> e t b", e=q_preds_ensemble.shape[0]),
|
||||
einops.repeat(
|
||||
q_targets, "t b -> e t b", e=q_preds_ensemble.shape[0]
|
||||
),
|
||||
reduction="none",
|
||||
).sum(0) # sum over ensemble
|
||||
# `q_preds_ensemble` depends on the first observation and the actions.
|
||||
@@ -453,19 +526,22 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
z_preds = z_preds.detach()
|
||||
# Use stopgrad for the advantage calculation.
|
||||
with torch.no_grad():
|
||||
advantage = self.model_target.Qs(z_preds[:-1], action, return_min=True) - self.model.V(
|
||||
z_preds[:-1]
|
||||
)
|
||||
advantage = self.model_target.Qs(
|
||||
z_preds[:-1], action, return_min=True
|
||||
) - self.model.V(z_preds[:-1])
|
||||
info["advantage"] = advantage[0]
|
||||
# (t, b)
|
||||
exp_advantage = torch.clamp(torch.exp(advantage * self.config.advantage_scaling), max=100.0)
|
||||
exp_advantage = torch.clamp(
|
||||
torch.exp(advantage * self.config.advantage_scaling), max=100.0
|
||||
)
|
||||
action_preds = self.model.pi(z_preds[:-1]) # (t, b, a)
|
||||
# Calculate the MSE between the actions and the action predictions.
|
||||
# Note: FOWM's original code calculates the log probability (wrt to a unit standard deviation
|
||||
# gaussian) and sums over the action dimension. Computing the log probability amounts to multiplying
|
||||
# the MSE by 0.5 and adding a constant offset (the log(2*pi) term) . Here we drop the constant offset
|
||||
# as it doesn't change the optimization step, and we drop the 0.5 as we instead make a configuration
|
||||
# parameter for it (see below where we compute the total loss).
|
||||
# gaussian) and sums over the action dimension. Computing the (negative) log probability amounts to
|
||||
# multiplying the MSE by 0.5 and adding a constant offset (the log(2*pi)/2 term, times the action
|
||||
# dimension). Here we drop the constant offset as it doesn't change the optimization step, and we drop
|
||||
# the 0.5 as we instead make a configuration parameter for it (see below where we compute the total
|
||||
# loss).
|
||||
mse = F.mse_loss(action_preds, action, reduction="none").sum(-1) # (t, b)
|
||||
# NOTE: The original implementation does not take the sum over the temporal dimension like with the
|
||||
# other losses.
|
||||
@@ -512,7 +588,9 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
# Note a minor variation with respect to the original FOWM code. Here they do this based on an EMA
|
||||
# update frequency parameter which is set to 2 (every 2 steps an update is done). To simplify the code
|
||||
# we update every step and adjust the decay parameter `alpha` accordingly (0.99 -> 0.995)
|
||||
update_ema_parameters(self.model_target, self.model, self.config.target_model_momentum)
|
||||
update_ema_parameters(
|
||||
self.model_target, self.model, self.config.target_model_momentum
|
||||
)
|
||||
|
||||
|
||||
class TDMPCTOLD(nn.Module):
|
||||
@@ -523,7 +601,9 @@ class TDMPCTOLD(nn.Module):
|
||||
self.config = config
|
||||
self._encoder = TDMPCObservationEncoder(config)
|
||||
self._dynamics = nn.Sequential(
|
||||
nn.Linear(config.latent_dim + config.output_shapes["action"][0], config.mlp_dim),
|
||||
nn.Linear(
|
||||
config.latent_dim + config.output_shapes["action"][0], config.mlp_dim
|
||||
),
|
||||
nn.LayerNorm(config.mlp_dim),
|
||||
nn.Mish(),
|
||||
nn.Linear(config.mlp_dim, config.mlp_dim),
|
||||
@@ -534,7 +614,9 @@ class TDMPCTOLD(nn.Module):
|
||||
nn.Sigmoid(),
|
||||
)
|
||||
self._reward = nn.Sequential(
|
||||
nn.Linear(config.latent_dim + config.output_shapes["action"][0], config.mlp_dim),
|
||||
nn.Linear(
|
||||
config.latent_dim + config.output_shapes["action"][0], config.mlp_dim
|
||||
),
|
||||
nn.LayerNorm(config.mlp_dim),
|
||||
nn.Mish(),
|
||||
nn.Linear(config.mlp_dim, config.mlp_dim),
|
||||
@@ -554,7 +636,10 @@ class TDMPCTOLD(nn.Module):
|
||||
self._Qs = nn.ModuleList(
|
||||
[
|
||||
nn.Sequential(
|
||||
nn.Linear(config.latent_dim + config.output_shapes["action"][0], config.mlp_dim),
|
||||
nn.Linear(
|
||||
config.latent_dim + config.output_shapes["action"][0],
|
||||
config.mlp_dim,
|
||||
),
|
||||
nn.LayerNorm(config.mlp_dim),
|
||||
nn.Tanh(),
|
||||
nn.Linear(config.mlp_dim, config.mlp_dim),
|
||||
@@ -599,7 +684,9 @@ class TDMPCTOLD(nn.Module):
|
||||
m[-1], nn.Linear
|
||||
), "Sanity check. The last linear layer needs 0 initialization on weights."
|
||||
nn.init.zeros_(m[-1].weight)
|
||||
nn.init.zeros_(m[-1].bias) # this has already been done, but keep this line here for good measure
|
||||
nn.init.zeros_(
|
||||
m[-1].bias
|
||||
) # this has already been done, but keep this line here for good measure
|
||||
|
||||
def encode(self, obs: dict[str, Tensor]) -> Tensor:
|
||||
"""Encodes an observation into its latent representation."""
|
||||
@@ -697,14 +784,32 @@ class TDMPCObservationEncoder(nn.Module):
|
||||
if "observation.image" in config.input_shapes:
|
||||
self.image_enc_layers = nn.Sequential(
|
||||
nn.Conv2d(
|
||||
config.input_shapes["observation.image"][0], config.image_encoder_hidden_dim, 7, stride=2
|
||||
config.input_shapes["observation.image"][0],
|
||||
config.image_encoder_hidden_dim,
|
||||
7,
|
||||
stride=2,
|
||||
),
|
||||
nn.ReLU(),
|
||||
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 5, stride=2),
|
||||
nn.Conv2d(
|
||||
config.image_encoder_hidden_dim,
|
||||
config.image_encoder_hidden_dim,
|
||||
5,
|
||||
stride=2,
|
||||
),
|
||||
nn.ReLU(),
|
||||
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
|
||||
nn.Conv2d(
|
||||
config.image_encoder_hidden_dim,
|
||||
config.image_encoder_hidden_dim,
|
||||
3,
|
||||
stride=2,
|
||||
),
|
||||
nn.ReLU(),
|
||||
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
|
||||
nn.Conv2d(
|
||||
config.image_encoder_hidden_dim,
|
||||
config.image_encoder_hidden_dim,
|
||||
3,
|
||||
stride=2,
|
||||
),
|
||||
nn.ReLU(),
|
||||
)
|
||||
dummy_batch = torch.zeros(1, *config.input_shapes["observation.image"])
|
||||
@@ -720,7 +825,21 @@ class TDMPCObservationEncoder(nn.Module):
|
||||
)
|
||||
if "observation.state" in config.input_shapes:
|
||||
self.state_enc_layers = nn.Sequential(
|
||||
nn.Linear(config.input_shapes["observation.state"][0], config.state_encoder_hidden_dim),
|
||||
nn.Linear(
|
||||
config.input_shapes["observation.state"][0],
|
||||
config.state_encoder_hidden_dim,
|
||||
),
|
||||
nn.ELU(),
|
||||
nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
|
||||
nn.LayerNorm(config.latent_dim),
|
||||
nn.Sigmoid(),
|
||||
)
|
||||
if "observation.environment_state" in config.input_shapes:
|
||||
self.env_state_enc_layers = nn.Sequential(
|
||||
nn.Linear(
|
||||
config.input_shapes["observation.environment_state"][0],
|
||||
config.state_encoder_hidden_dim,
|
||||
),
|
||||
nn.ELU(),
|
||||
nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
|
||||
nn.LayerNorm(config.latent_dim),
|
||||
@@ -734,8 +853,17 @@ class TDMPCObservationEncoder(nn.Module):
|
||||
over all features.
|
||||
"""
|
||||
feat = []
|
||||
# NOTE: Order of observations matters here.
|
||||
if "observation.image" in self.config.input_shapes:
|
||||
feat.append(flatten_forward_unflatten(self.image_enc_layers, obs_dict["observation.image"]))
|
||||
feat.append(
|
||||
flatten_forward_unflatten(
|
||||
self.image_enc_layers, obs_dict["observation.image"]
|
||||
)
|
||||
)
|
||||
if "observation.environment_state" in self.config.input_shapes:
|
||||
feat.append(
|
||||
self.env_state_enc_layers(obs_dict["observation.environment_state"])
|
||||
)
|
||||
if "observation.state" in self.config.input_shapes:
|
||||
feat.append(self.state_enc_layers(obs_dict["observation.state"]))
|
||||
return torch.stack(feat, dim=0).mean(0)
|
||||
@@ -778,12 +906,17 @@ def update_ema_parameters(ema_net: nn.Module, net: nn.Module, alpha: float):
|
||||
"""Update EMA parameters in place with ema_param <- alpha * ema_param + (1 - alpha) * param."""
|
||||
for ema_module, module in zip(ema_net.modules(), net.modules(), strict=True):
|
||||
for (n_p_ema, p_ema), (n_p, p) in zip(
|
||||
ema_module.named_parameters(recurse=False), module.named_parameters(recurse=False), strict=True
|
||||
ema_module.named_parameters(recurse=False),
|
||||
module.named_parameters(recurse=False),
|
||||
strict=True,
|
||||
):
|
||||
assert n_p_ema == n_p, "Parameter names don't match for EMA model update"
|
||||
if isinstance(p, dict):
|
||||
raise RuntimeError("Dict parameter not supported")
|
||||
if isinstance(module, nn.modules.batchnorm._BatchNorm) or not p.requires_grad:
|
||||
if (
|
||||
isinstance(module, nn.modules.batchnorm._BatchNorm)
|
||||
or not p.requires_grad
|
||||
):
|
||||
# Copy BatchNorm parameters, and non-trainable parameters directly.
|
||||
p_ema.copy_(p.to(dtype=p_ema.dtype).data)
|
||||
with torch.no_grad():
|
||||
@@ -791,7 +924,9 @@ def update_ema_parameters(ema_net: nn.Module, net: nn.Module, alpha: float):
|
||||
p_ema.add_(p.to(dtype=p_ema.dtype).data, alpha=1 - alpha)
|
||||
|
||||
|
||||
def flatten_forward_unflatten(fn: Callable[[Tensor], Tensor], image_tensor: Tensor) -> Tensor:
|
||||
def flatten_forward_unflatten(
|
||||
fn: Callable[[Tensor], Tensor], image_tensor: Tensor
|
||||
) -> Tensor:
|
||||
"""Helper to temporarily flatten extra dims at the start of the image tensor.
|
||||
|
||||
Args:
|
||||
|
||||
169
lerobot/common/policies/vqbet/configuration_vqbet.py
Normal file
169
lerobot/common/policies/vqbet/configuration_vqbet.py
Normal file
@@ -0,0 +1,169 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 Seungjae Lee and Yibin Wang and Haritheja Etukuru
|
||||
# and H. Jin Kim and Nur Muhammad Mahi Shafiullah and Lerrel Pinto
|
||||
# and The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
from dataclasses import dataclass, field
|
||||
|
||||
|
||||
@dataclass
|
||||
class VQBeTConfig:
|
||||
"""Configuration class for VQ-BeT.
|
||||
|
||||
Defaults are configured for training with PushT providing proprioceptive and single camera observations.
|
||||
|
||||
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||
Those are: `input_shapes` and `output_shapes`.
|
||||
|
||||
Notes on the inputs and outputs:
|
||||
- "observation.state" is required as an input key.
|
||||
- At least one key starting with "observation.image is required as an input.
|
||||
- If there are multiple keys beginning with "observation.image" they are treated as multiple camera
|
||||
views. Right now we only support all images having the same shape.
|
||||
- "action" is required as an output key.
|
||||
|
||||
Args:
|
||||
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
||||
current step and additional steps going back).
|
||||
n_action_pred_token: Total number of current token and future tokens that VQ-BeT predicts.
|
||||
action_chunk_size: Action chunk size of each action prediction token.
|
||||
input_shapes: A dictionary defining the shapes of the input data for the policy.
|
||||
The key represents the input data name, and the value is a list indicating the dimensions
|
||||
of the corresponding data. For example, "observation.image" refers to an input from
|
||||
a camera with dimensions [3, 96, 96], indicating it has three color channels and 96x96 resolution.
|
||||
Importantly, shapes doesnt include batch dimension or temporal dimension.
|
||||
output_shapes: A dictionary defining the shapes of the output data for the policy.
|
||||
The key represents the output data name, and the value is a list indicating the dimensions
|
||||
of the corresponding data. For example, "action" refers to an output shape of [14], indicating
|
||||
14-dimensional actions. Importantly, shapes doesnt include batch dimension or temporal dimension.
|
||||
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||
[-1, 1] range.
|
||||
output_normalization_modes: Similar dictionary as `normalize_input_modes`, but to unnormalize to the
|
||||
original scale. Note that this is also used for normalizing the training targets.
|
||||
vision_backbone: Name of the torchvision resnet backbone to use for encoding images.
|
||||
crop_shape: (H, W) shape to crop images to as a preprocessing step for the vision backbone. Must fit
|
||||
within the image size. If None, no cropping is done.
|
||||
crop_is_random: Whether the crop should be random at training time (it's always a center crop in eval
|
||||
mode).
|
||||
pretrained_backbone_weights: Pretrained weights from torchvision to initalize the backbone.
|
||||
`None` means no pretrained weights.
|
||||
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
||||
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
||||
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
||||
n_vqvae_training_steps: Number of optimization steps for training Residual VQ.
|
||||
vqvae_n_embed: Number of embedding vectors in the RVQ dictionary (each layer).
|
||||
vqvae_embedding_dim: Dimension of each embedding vector in the RVQ dictionary.
|
||||
vqvae_enc_hidden_dim: Size of hidden dimensions of Encoder / Decoder part of Residaul VQ-VAE
|
||||
gpt_block_size: Max block size of minGPT (should be larger than the number of input tokens)
|
||||
gpt_input_dim: Size of output input of GPT. This is also used as the dimension of observation features.
|
||||
gpt_output_dim: Size of output dimension of GPT. This is also used as a input dimension of offset / bin prediction headers.
|
||||
gpt_n_layer: Number of layers of GPT
|
||||
gpt_n_head: Number of headers of GPT
|
||||
gpt_hidden_dim: Size of hidden dimensions of GPT
|
||||
dropout: Dropout rate for GPT
|
||||
mlp_hidden_dim: Size of hidden dimensions of offset header / bin prediction headers parts of VQ-BeT
|
||||
offset_loss_weight: A constant that is multiplied to the offset loss
|
||||
primary_code_loss_weight: A constant that is multiplied to the primary code prediction loss
|
||||
secondary_code_loss_weight: A constant that is multiplied to the secondary code prediction loss
|
||||
bet_softmax_temperature: Sampling temperature of code for rollout with VQ-BeT
|
||||
sequentially_select: Whether select code of primary / secondary as sequentially (pick primary code,
|
||||
and then select secodnary code), or at the same time.
|
||||
"""
|
||||
|
||||
# Inputs / output structure.
|
||||
n_obs_steps: int = 5
|
||||
n_action_pred_token: int = 3
|
||||
action_chunk_size: int = 5
|
||||
|
||||
input_shapes: dict[str, list[int]] = field(
|
||||
default_factory=lambda: {
|
||||
"observation.image": [3, 96, 96],
|
||||
"observation.state": [2],
|
||||
}
|
||||
)
|
||||
output_shapes: dict[str, list[int]] = field(
|
||||
default_factory=lambda: {
|
||||
"action": [2],
|
||||
}
|
||||
)
|
||||
|
||||
# Normalization / Unnormalization
|
||||
input_normalization_modes: dict[str, str] = field(
|
||||
default_factory=lambda: {
|
||||
"observation.image": "mean_std",
|
||||
"observation.state": "min_max",
|
||||
}
|
||||
)
|
||||
output_normalization_modes: dict[str, str] = field(
|
||||
default_factory=lambda: {"action": "min_max"}
|
||||
)
|
||||
|
||||
# Architecture / modeling.
|
||||
# Vision backbone.
|
||||
vision_backbone: str = "resnet18"
|
||||
crop_shape: tuple[int, int] | None = (84, 84)
|
||||
crop_is_random: bool = True
|
||||
pretrained_backbone_weights: str | None = None
|
||||
use_group_norm: bool = True
|
||||
spatial_softmax_num_keypoints: int = 32
|
||||
# VQ-VAE
|
||||
n_vqvae_training_steps: int = 20000
|
||||
vqvae_n_embed: int = 16
|
||||
vqvae_embedding_dim: int = 256
|
||||
vqvae_enc_hidden_dim: int = 128
|
||||
# VQ-BeT
|
||||
gpt_block_size: int = 500
|
||||
gpt_input_dim: int = 512
|
||||
gpt_output_dim: int = 512
|
||||
gpt_n_layer: int = 8
|
||||
gpt_n_head: int = 8
|
||||
gpt_hidden_dim: int = 512
|
||||
dropout: float = 0.1
|
||||
mlp_hidden_dim: int = 1024
|
||||
offset_loss_weight: float = 10000.0
|
||||
primary_code_loss_weight: float = 5.0
|
||||
secondary_code_loss_weight: float = 0.5
|
||||
bet_softmax_temperature: float = 0.1
|
||||
sequentially_select: bool = False
|
||||
|
||||
def __post_init__(self):
|
||||
"""Input validation (not exhaustive)."""
|
||||
if not self.vision_backbone.startswith("resnet"):
|
||||
raise ValueError(
|
||||
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||
)
|
||||
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
||||
if self.crop_shape is not None:
|
||||
for image_key in image_keys:
|
||||
if (
|
||||
self.crop_shape[0] > self.input_shapes[image_key][1]
|
||||
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
||||
):
|
||||
raise ValueError(
|
||||
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
||||
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
||||
"`input_shapes[{image_key}]`."
|
||||
)
|
||||
# Check that all input images have the same shape.
|
||||
first_image_key = next(iter(image_keys))
|
||||
for image_key in image_keys:
|
||||
if self.input_shapes[image_key] != self.input_shapes[first_image_key]:
|
||||
raise ValueError(
|
||||
f"`input_shapes[{image_key}]` does not match `input_shapes[{first_image_key}]`, but we "
|
||||
"expect all image shapes to match."
|
||||
)
|
||||
1080
lerobot/common/policies/vqbet/modeling_vqbet.py
Normal file
1080
lerobot/common/policies/vqbet/modeling_vqbet.py
Normal file
File diff suppressed because it is too large
Load Diff
1558
lerobot/common/policies/vqbet/vqbet_utils.py
Normal file
1558
lerobot/common/policies/vqbet/vqbet_utils.py
Normal file
File diff suppressed because it is too large
Load Diff
593
lerobot/common/robot_devices/cameras/intelrealsense.py
Normal file
593
lerobot/common/robot_devices/cameras/intelrealsense.py
Normal file
@@ -0,0 +1,593 @@
|
||||
"""
|
||||
This file contains utilities for recording frames from Intel Realsense cameras.
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import concurrent.futures
|
||||
import logging
|
||||
import math
|
||||
import shutil
|
||||
import threading
|
||||
import time
|
||||
import traceback
|
||||
from collections import Counter
|
||||
from dataclasses import dataclass, replace
|
||||
from pathlib import Path
|
||||
from threading import Thread
|
||||
|
||||
import numpy as np
|
||||
from PIL import Image
|
||||
|
||||
from lerobot.common.robot_devices.utils import (
|
||||
RobotDeviceAlreadyConnectedError,
|
||||
RobotDeviceNotConnectedError,
|
||||
busy_wait,
|
||||
)
|
||||
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||
|
||||
SERIAL_NUMBER_INDEX = 1
|
||||
|
||||
|
||||
def find_cameras(raise_when_empty=True, mock=False) -> list[dict]:
|
||||
"""
|
||||
Find the names and the serial numbers of the Intel RealSense cameras
|
||||
connected to the computer.
|
||||
"""
|
||||
if mock:
|
||||
import tests.mock_pyrealsense2 as rs
|
||||
else:
|
||||
import pyrealsense2 as rs
|
||||
|
||||
cameras = []
|
||||
for device in rs.context().query_devices():
|
||||
serial_number = int(device.get_info(rs.camera_info(SERIAL_NUMBER_INDEX)))
|
||||
name = device.get_info(rs.camera_info.name)
|
||||
cameras.append(
|
||||
{
|
||||
"serial_number": serial_number,
|
||||
"name": name,
|
||||
}
|
||||
)
|
||||
|
||||
if raise_when_empty and len(cameras) == 0:
|
||||
raise OSError(
|
||||
"Not a single camera was detected. Try re-plugging, or re-installing `librealsense` and its python wrapper `pyrealsense2`, or updating the firmware."
|
||||
)
|
||||
|
||||
return cameras
|
||||
|
||||
|
||||
def save_image(img_array, serial_number, frame_index, images_dir):
|
||||
try:
|
||||
img = Image.fromarray(img_array)
|
||||
path = images_dir / f"camera_{serial_number}_frame_{frame_index:06d}.png"
|
||||
path.parent.mkdir(parents=True, exist_ok=True)
|
||||
img.save(str(path), quality=100)
|
||||
logging.info(f"Saved image: {path}")
|
||||
except Exception as e:
|
||||
logging.error(
|
||||
f"Failed to save image for camera {serial_number} frame {frame_index}: {e}"
|
||||
)
|
||||
|
||||
|
||||
def save_images_from_cameras(
|
||||
images_dir: Path,
|
||||
serial_numbers: list[int] | None = None,
|
||||
fps=None,
|
||||
width=None,
|
||||
height=None,
|
||||
record_time_s=2,
|
||||
mock=False,
|
||||
):
|
||||
"""
|
||||
Initializes all the cameras and saves images to the directory. Useful to visually identify the camera
|
||||
associated to a given serial number.
|
||||
"""
|
||||
if serial_numbers is None or len(serial_numbers) == 0:
|
||||
camera_infos = find_cameras(mock=mock)
|
||||
serial_numbers = [cam["serial_number"] for cam in camera_infos]
|
||||
|
||||
if mock:
|
||||
import tests.mock_cv2 as cv2
|
||||
else:
|
||||
import cv2
|
||||
|
||||
print("Connecting cameras")
|
||||
cameras = []
|
||||
for cam_sn in serial_numbers:
|
||||
print(f"{cam_sn=}")
|
||||
camera = IntelRealSenseCamera(
|
||||
cam_sn, fps=fps, width=width, height=height, mock=mock
|
||||
)
|
||||
camera.connect()
|
||||
print(
|
||||
f"IntelRealSenseCamera({camera.serial_number}, fps={camera.fps}, width={camera.width}, height={camera.height}, color_mode={camera.color_mode})"
|
||||
)
|
||||
cameras.append(camera)
|
||||
|
||||
images_dir = Path(images_dir)
|
||||
if images_dir.exists():
|
||||
shutil.rmtree(
|
||||
images_dir,
|
||||
)
|
||||
images_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
print(f"Saving images to {images_dir}")
|
||||
frame_index = 0
|
||||
start_time = time.perf_counter()
|
||||
try:
|
||||
with concurrent.futures.ThreadPoolExecutor(max_workers=1) as executor:
|
||||
while True:
|
||||
now = time.perf_counter()
|
||||
|
||||
for camera in cameras:
|
||||
# If we use async_read when fps is None, the loop will go full speed, and we will end up
|
||||
# saving the same images from the cameras multiple times until the RAM/disk is full.
|
||||
image = camera.read() if fps is None else camera.async_read()
|
||||
if image is None:
|
||||
print("No Frame")
|
||||
|
||||
bgr_converted_image = cv2.cvtColor(image, cv2.COLOR_RGB2BGR)
|
||||
|
||||
executor.submit(
|
||||
save_image,
|
||||
bgr_converted_image,
|
||||
camera.serial_number,
|
||||
frame_index,
|
||||
images_dir,
|
||||
)
|
||||
|
||||
if fps is not None:
|
||||
dt_s = time.perf_counter() - now
|
||||
busy_wait(1 / fps - dt_s)
|
||||
|
||||
if time.perf_counter() - start_time > record_time_s:
|
||||
break
|
||||
|
||||
print(
|
||||
f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}"
|
||||
)
|
||||
|
||||
frame_index += 1
|
||||
finally:
|
||||
print(f"Images have been saved to {images_dir}")
|
||||
for camera in cameras:
|
||||
camera.disconnect()
|
||||
|
||||
|
||||
@dataclass
|
||||
class IntelRealSenseCameraConfig:
|
||||
"""
|
||||
Example of tested options for Intel Real Sense D405:
|
||||
|
||||
```python
|
||||
IntelRealSenseCameraConfig(30, 640, 480)
|
||||
IntelRealSenseCameraConfig(60, 640, 480)
|
||||
IntelRealSenseCameraConfig(90, 640, 480)
|
||||
IntelRealSenseCameraConfig(30, 1280, 720)
|
||||
IntelRealSenseCameraConfig(30, 640, 480, use_depth=True)
|
||||
IntelRealSenseCameraConfig(30, 640, 480, rotation=90)
|
||||
```
|
||||
"""
|
||||
|
||||
fps: int | None = None
|
||||
width: int | None = None
|
||||
height: int | None = None
|
||||
color_mode: str = "rgb"
|
||||
channels: int | None = None
|
||||
use_depth: bool = False
|
||||
force_hardware_reset: bool = True
|
||||
rotation: int | None = None
|
||||
mock: bool = False
|
||||
|
||||
def __post_init__(self):
|
||||
if self.color_mode not in ["rgb", "bgr"]:
|
||||
raise ValueError(
|
||||
f"`color_mode` is expected to be 'rgb' or 'bgr', but {self.color_mode} is provided."
|
||||
)
|
||||
|
||||
self.channels = 3
|
||||
|
||||
at_least_one_is_not_none = (
|
||||
self.fps is not None or self.width is not None or self.height is not None
|
||||
)
|
||||
at_least_one_is_none = (
|
||||
self.fps is None or self.width is None or self.height is None
|
||||
)
|
||||
if at_least_one_is_not_none and at_least_one_is_none:
|
||||
raise ValueError(
|
||||
"For `fps`, `width` and `height`, either all of them need to be set, or none of them, "
|
||||
f"but {self.fps=}, {self.width=}, {self.height=} were provided."
|
||||
)
|
||||
|
||||
if self.rotation not in [-90, None, 90, 180]:
|
||||
raise ValueError(
|
||||
f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})"
|
||||
)
|
||||
|
||||
|
||||
class IntelRealSenseCamera:
|
||||
"""
|
||||
The IntelRealSenseCamera class is similar to OpenCVCamera class but adds additional features for Intel Real Sense cameras:
|
||||
- is instantiated with the serial number of the camera - won't randomly change as it can be the case of OpenCVCamera for Linux,
|
||||
- can also be instantiated with the camera's name — if it's unique — using IntelRealSenseCamera.init_from_name(),
|
||||
- depth map can be returned.
|
||||
|
||||
To find the camera indices of your cameras, you can run our utility script that will save a few frames for each camera:
|
||||
```bash
|
||||
python lerobot/common/robot_devices/cameras/intelrealsense.py --images-dir outputs/images_from_intelrealsense_cameras
|
||||
```
|
||||
|
||||
When an IntelRealSenseCamera is instantiated, if no specific config is provided, the default fps, width, height and color_mode
|
||||
of the given camera will be used.
|
||||
|
||||
Example of usage:
|
||||
```python
|
||||
# Instantiate with its serial number
|
||||
camera = IntelRealSenseCamera(128422271347)
|
||||
# Or by its name if it's unique
|
||||
camera = IntelRealSenseCamera.init_from_name("Intel RealSense D405")
|
||||
camera.connect()
|
||||
color_image = camera.read()
|
||||
# when done using the camera, consider disconnecting
|
||||
camera.disconnect()
|
||||
```
|
||||
|
||||
Example of changing default fps, width, height and color_mode:
|
||||
```python
|
||||
camera = IntelRealSenseCamera(serial_number, fps=30, width=1280, height=720)
|
||||
camera = connect() # applies the settings, might error out if these settings are not compatible with the camera
|
||||
|
||||
camera = IntelRealSenseCamera(serial_number, fps=90, width=640, height=480)
|
||||
camera = connect()
|
||||
|
||||
camera = IntelRealSenseCamera(serial_number, fps=90, width=640, height=480, color_mode="bgr")
|
||||
camera = connect()
|
||||
```
|
||||
|
||||
Example of returning depth:
|
||||
```python
|
||||
camera = IntelRealSenseCamera(serial_number, use_depth=True)
|
||||
camera.connect()
|
||||
color_image, depth_map = camera.read()
|
||||
```
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
serial_number: int,
|
||||
config: IntelRealSenseCameraConfig | None = None,
|
||||
**kwargs,
|
||||
):
|
||||
if config is None:
|
||||
config = IntelRealSenseCameraConfig()
|
||||
|
||||
# Overwrite the config arguments using kwargs
|
||||
config = replace(config, **kwargs)
|
||||
|
||||
self.serial_number = serial_number
|
||||
self.fps = config.fps
|
||||
self.width = config.width
|
||||
self.height = config.height
|
||||
self.channels = config.channels
|
||||
self.color_mode = config.color_mode
|
||||
self.use_depth = config.use_depth
|
||||
self.force_hardware_reset = config.force_hardware_reset
|
||||
self.mock = config.mock
|
||||
|
||||
self.camera = None
|
||||
self.is_connected = False
|
||||
self.thread = None
|
||||
self.stop_event = None
|
||||
self.color_image = None
|
||||
self.depth_map = None
|
||||
self.logs = {}
|
||||
|
||||
if self.mock:
|
||||
import tests.mock_cv2 as cv2
|
||||
else:
|
||||
import cv2
|
||||
|
||||
# TODO(alibets): Do we keep original width/height or do we define them after rotation?
|
||||
self.rotation = None
|
||||
if config.rotation == -90:
|
||||
self.rotation = cv2.ROTATE_90_COUNTERCLOCKWISE
|
||||
elif config.rotation == 90:
|
||||
self.rotation = cv2.ROTATE_90_CLOCKWISE
|
||||
elif config.rotation == 180:
|
||||
self.rotation = cv2.ROTATE_180
|
||||
|
||||
@classmethod
|
||||
def init_from_name(
|
||||
cls, name: str, config: IntelRealSenseCameraConfig | None = None, **kwargs
|
||||
):
|
||||
camera_infos = find_cameras()
|
||||
camera_names = [cam["name"] for cam in camera_infos]
|
||||
this_name_count = Counter(camera_names)[name]
|
||||
if this_name_count > 1:
|
||||
# TODO(aliberts): Test this with multiple identical cameras (Aloha)
|
||||
raise ValueError(
|
||||
f"Multiple {name} cameras have been detected. Please use their serial number to instantiate them."
|
||||
)
|
||||
|
||||
name_to_serial_dict = {
|
||||
cam["name"]: cam["serial_number"] for cam in camera_infos
|
||||
}
|
||||
cam_sn = name_to_serial_dict[name]
|
||||
|
||||
if config is None:
|
||||
config = IntelRealSenseCameraConfig()
|
||||
|
||||
# Overwrite the config arguments using kwargs
|
||||
config = replace(config, **kwargs)
|
||||
|
||||
return cls(serial_number=cam_sn, config=config, **kwargs)
|
||||
|
||||
def connect(self):
|
||||
if self.is_connected:
|
||||
raise RobotDeviceAlreadyConnectedError(
|
||||
f"IntelRealSenseCamera({self.serial_number}) is already connected."
|
||||
)
|
||||
|
||||
if self.mock:
|
||||
import tests.mock_pyrealsense2 as rs
|
||||
else:
|
||||
import pyrealsense2 as rs
|
||||
|
||||
config = rs.config()
|
||||
config.enable_device(str(self.serial_number))
|
||||
|
||||
if self.fps and self.width and self.height:
|
||||
# TODO(rcadene): can we set rgb8 directly?
|
||||
config.enable_stream(
|
||||
rs.stream.color, self.width, self.height, rs.format.rgb8, self.fps
|
||||
)
|
||||
else:
|
||||
config.enable_stream(rs.stream.color)
|
||||
|
||||
if self.use_depth:
|
||||
if self.fps and self.width and self.height:
|
||||
config.enable_stream(
|
||||
rs.stream.depth, self.width, self.height, rs.format.z16, self.fps
|
||||
)
|
||||
else:
|
||||
config.enable_stream(rs.stream.depth)
|
||||
|
||||
self.camera = rs.pipeline()
|
||||
try:
|
||||
profile = self.camera.start(config)
|
||||
is_camera_open = True
|
||||
except RuntimeError:
|
||||
is_camera_open = False
|
||||
traceback.print_exc()
|
||||
|
||||
# If the camera doesn't work, display the camera indices corresponding to
|
||||
# valid cameras.
|
||||
if not is_camera_open:
|
||||
# Verify that the provided `serial_number` is valid before printing the traceback
|
||||
camera_infos = find_cameras()
|
||||
serial_numbers = [cam["serial_number"] for cam in camera_infos]
|
||||
if self.serial_number not in serial_numbers:
|
||||
raise ValueError(
|
||||
f"`serial_number` is expected to be one of these available cameras {serial_numbers}, but {self.serial_number} is provided instead. "
|
||||
"To find the serial number you should use, run `python lerobot/common/robot_devices/cameras/intelrealsense.py`."
|
||||
)
|
||||
|
||||
raise OSError(f"Can't access IntelRealSenseCamera({self.serial_number}).")
|
||||
|
||||
color_stream = profile.get_stream(rs.stream.color)
|
||||
color_profile = color_stream.as_video_stream_profile()
|
||||
actual_fps = color_profile.fps()
|
||||
actual_width = color_profile.width()
|
||||
actual_height = color_profile.height()
|
||||
|
||||
# Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
|
||||
if self.fps is not None and not math.isclose(
|
||||
self.fps, actual_fps, rel_tol=1e-3
|
||||
):
|
||||
# Using `OSError` since it's a broad that encompasses issues related to device communication
|
||||
raise OSError(
|
||||
f"Can't set {self.fps=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_fps}."
|
||||
)
|
||||
if self.width is not None and self.width != actual_width:
|
||||
raise OSError(
|
||||
f"Can't set {self.width=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_width}."
|
||||
)
|
||||
if self.height is not None and self.height != actual_height:
|
||||
raise OSError(
|
||||
f"Can't set {self.height=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_height}."
|
||||
)
|
||||
|
||||
self.fps = round(actual_fps)
|
||||
self.width = round(actual_width)
|
||||
self.height = round(actual_height)
|
||||
|
||||
self.is_connected = True
|
||||
|
||||
def read(
|
||||
self, temporary_color: str | None = None
|
||||
) -> np.ndarray | tuple[np.ndarray, np.ndarray]:
|
||||
"""Read a frame from the camera returned in the format height x width x channels (e.g. 480 x 640 x 3)
|
||||
of type `np.uint8`, contrarily to the pytorch format which is float channel first.
|
||||
|
||||
When `use_depth=True`, returns a tuple `(color_image, depth_map)` with a depth map in the format
|
||||
height x width (e.g. 480 x 640) of type np.uint16.
|
||||
|
||||
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
||||
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
||||
"""
|
||||
if not self.is_connected:
|
||||
raise RobotDeviceNotConnectedError(
|
||||
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||
)
|
||||
|
||||
if self.mock:
|
||||
import tests.mock_cv2 as cv2
|
||||
else:
|
||||
import cv2
|
||||
|
||||
start_time = time.perf_counter()
|
||||
|
||||
frame = self.camera.wait_for_frames(timeout_ms=5000)
|
||||
|
||||
color_frame = frame.get_color_frame()
|
||||
|
||||
if not color_frame:
|
||||
raise OSError(
|
||||
f"Can't capture color image from IntelRealSenseCamera({self.serial_number})."
|
||||
)
|
||||
|
||||
color_image = np.asanyarray(color_frame.get_data())
|
||||
|
||||
requested_color_mode = (
|
||||
self.color_mode if temporary_color is None else temporary_color
|
||||
)
|
||||
if requested_color_mode not in ["rgb", "bgr"]:
|
||||
raise ValueError(
|
||||
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
||||
)
|
||||
|
||||
# IntelRealSense uses RGB format as default (red, green, blue).
|
||||
if requested_color_mode == "bgr":
|
||||
color_image = cv2.cvtColor(color_image, cv2.COLOR_RGB2BGR)
|
||||
|
||||
h, w, _ = color_image.shape
|
||||
if h != self.height or w != self.width:
|
||||
raise OSError(
|
||||
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||
)
|
||||
|
||||
if self.rotation is not None:
|
||||
color_image = cv2.rotate(color_image, self.rotation)
|
||||
|
||||
# log the number of seconds it took to read the image
|
||||
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
||||
|
||||
# log the utc time at which the image was received
|
||||
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
||||
|
||||
if self.use_depth:
|
||||
depth_frame = frame.get_depth_frame()
|
||||
if not depth_frame:
|
||||
raise OSError(
|
||||
f"Can't capture depth image from IntelRealSenseCamera({self.serial_number})."
|
||||
)
|
||||
|
||||
depth_map = np.asanyarray(depth_frame.get_data())
|
||||
|
||||
h, w = depth_map.shape
|
||||
if h != self.height or w != self.width:
|
||||
raise OSError(
|
||||
f"Can't capture depth map with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||
)
|
||||
|
||||
if self.rotation is not None:
|
||||
depth_map = cv2.rotate(depth_map, self.rotation)
|
||||
|
||||
return color_image, depth_map
|
||||
else:
|
||||
return color_image
|
||||
|
||||
def read_loop(self):
|
||||
while not self.stop_event.is_set():
|
||||
if self.use_depth:
|
||||
self.color_image, self.depth_map = self.read()
|
||||
else:
|
||||
self.color_image = self.read()
|
||||
|
||||
def async_read(self):
|
||||
"""Access the latest color image"""
|
||||
if not self.is_connected:
|
||||
raise RobotDeviceNotConnectedError(
|
||||
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||
)
|
||||
|
||||
if self.thread is None:
|
||||
self.stop_event = threading.Event()
|
||||
self.thread = Thread(target=self.read_loop, args=())
|
||||
self.thread.daemon = True
|
||||
self.thread.start()
|
||||
|
||||
num_tries = 0
|
||||
while self.color_image is None:
|
||||
# TODO(rcadene, aliberts): intelrealsense has diverged compared to opencv over here
|
||||
num_tries += 1
|
||||
time.sleep(1 / self.fps)
|
||||
if num_tries > self.fps and (
|
||||
self.thread.ident is None or not self.thread.is_alive()
|
||||
):
|
||||
raise Exception(
|
||||
"The thread responsible for `self.async_read()` took too much time to start. There might be an issue. Verify that `self.thread.start()` has been called."
|
||||
)
|
||||
|
||||
if self.use_depth:
|
||||
return self.color_image, self.depth_map
|
||||
else:
|
||||
return self.color_image
|
||||
|
||||
def disconnect(self):
|
||||
if not self.is_connected:
|
||||
raise RobotDeviceNotConnectedError(
|
||||
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||
)
|
||||
|
||||
if self.thread is not None and self.thread.is_alive():
|
||||
# wait for the thread to finish
|
||||
self.stop_event.set()
|
||||
self.thread.join()
|
||||
self.thread = None
|
||||
self.stop_event = None
|
||||
|
||||
self.camera.stop()
|
||||
self.camera = None
|
||||
|
||||
self.is_connected = False
|
||||
|
||||
def __del__(self):
|
||||
if getattr(self, "is_connected", False):
|
||||
self.disconnect()
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
parser = argparse.ArgumentParser(
|
||||
description="Save a few frames using `IntelRealSenseCamera` for all cameras connected to the computer, or a selected subset."
|
||||
)
|
||||
parser.add_argument(
|
||||
"--serial-numbers",
|
||||
type=int,
|
||||
nargs="*",
|
||||
default=None,
|
||||
help="List of serial numbers used to instantiate the `IntelRealSenseCamera`. If not provided, find and use all available camera indices.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--fps",
|
||||
type=int,
|
||||
default=30,
|
||||
help="Set the number of frames recorded per seconds for all cameras. If not provided, use the default fps of each camera.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--width",
|
||||
type=str,
|
||||
default=640,
|
||||
help="Set the width for all cameras. If not provided, use the default width of each camera.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--height",
|
||||
type=str,
|
||||
default=480,
|
||||
help="Set the height for all cameras. If not provided, use the default height of each camera.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--images-dir",
|
||||
type=Path,
|
||||
default="outputs/images_from_intelrealsense_cameras",
|
||||
help="Set directory to save a few frames for each camera.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--record-time-s",
|
||||
type=float,
|
||||
default=2.0,
|
||||
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
save_images_from_cameras(**vars(args))
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user