Install ffmpeg for integration tests

for more information, see https://pre-commit.ci

.dockerignore

@@ -73,7 +73,7 @@ pip-log.txt
 pip-delete-this-directory.txt
 
 # Unit test / coverage reports
-!tests/artifacts
+!tests/data
 htmlcov/
 .tox/
 .nox/

.github/workflows/test-docker-build.yml

@@ -41,7 +41,7 @@ jobs:
 
       - name: Get changed files
         id: changed-files
-        uses: tj-actions/changed-files@3f54ebb830831fc121d3263c1857cfbdc310cdb9 #v42
+        uses: tj-actions/changed-files@v44
         with:
           files: docker/**
           json: "true"

.gitignore

@@ -26,7 +26,6 @@ outputs
 
 # VS Code
 .vscode
-.devcontainer
 
 # HPC
 nautilus/*.yaml
@@ -79,7 +78,7 @@ pip-log.txt
 pip-delete-this-directory.txt
 
 # Unit test / coverage reports
-!tests/artifacts
+!tests/data
 htmlcov/
 .tox/
 .nox/

.pre-commit-config.yaml

@@ -12,7 +12,7 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
-exclude: "tests/artifacts/.*\\.safetensors$"
+exclude: ^(tests/data)
 default_language_version:
     python: python3.10
 repos:
@@ -36,8 +36,8 @@ repos:
       - id: end-of-file-fixer
       - id: trailing-whitespace
 
-  - repo: https://github.com/adhtruong/mirrors-typos
-    rev: v1.31.1
+  - repo: https://github.com/crate-ci/typos
+    rev: v1.30.2
     hooks:
       - id: typos
         args: [--force-exclude]
@@ -46,9 +46,9 @@ repos:
     rev: v3.19.1
     hooks:
     -   id: pyupgrade
-        exclude: '^(.*_pb2_grpc\.py|.*_pb2\.py$)'
+
   - repo: https://github.com/astral-sh/ruff-pre-commit
-    rev: v0.11.5
+    rev: v0.9.10
     hooks:
       - id: ruff
         args: [--fix]
@@ -57,12 +57,12 @@ repos:
 
   ##### Security #####
   - repo: https://github.com/gitleaks/gitleaks
-    rev: v8.24.3
+    rev: v8.24.0
     hooks:
       - id: gitleaks
 
   - repo: https://github.com/woodruffw/zizmor-pre-commit
-    rev: v1.5.2
+    rev: v1.4.1
     hooks:
       - id: zizmor
 

CONTRIBUTING.md

@@ -291,7 +291,7 @@ sudo apt-get install git-lfs
 git lfs install
 ```
 
-Pull artifacts if they're not in [tests/artifacts](tests/artifacts)
+Pull artifacts if they're not in [tests/data](tests/data)
 ```bash
 git lfs pull
 ```

README.md

@@ -98,25 +98,14 @@ conda create -y -n lerobot python=3.10
 conda activate lerobot
 ```
 
-When using `miniconda`, install `ffmpeg` in your environment:
-```bash
-conda install ffmpeg -c conda-forge
-```
-
-> **NOTE:** This usually installs `ffmpeg 7.X` for your platform compiled with the `libsvtav1` encoder. If `libsvtav1` is not supported (check supported encoders with `ffmpeg -encoders`), you can:
->  - _[On any platform]_ Explicitly install `ffmpeg 7.X` using:
->  ```bash
->  conda install ffmpeg=7.1.1 -c conda-forge
->  ```
->  - _[On Linux only]_ Install [ffmpeg build dependencies](https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu#GettheDependencies) and [compile ffmpeg from source with libsvtav1](https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu#libsvtav1), and make sure you use the corresponding ffmpeg binary to your install with `which ffmpeg`.
-
 Install 🤗 LeRobot:
 ```bash
 pip install -e .
 ```
 
-> **NOTE:** If you encounter build errors, you may need to install additional dependencies (`cmake`, `build-essential`, and `ffmpeg libs`). On Linux, run:
-`sudo apt-get install cmake build-essential python3-dev pkg-config libavformat-dev libavcodec-dev libavdevice-dev libavutil-dev libswscale-dev libswresample-dev libavfilter-dev pkg-config`. For other systems, see: [Compiling PyAV](https://pyav.org/docs/develop/overview/installation.html#bring-your-own-ffmpeg)
+> **NOTE:** Depending on your platform, If you encounter any build errors during this step
+you may need to install `cmake` and `build-essential` for building some of our dependencies.
+On linux: `sudo apt-get install cmake build-essential`
 
 For simulations, 🤗 LeRobot comes with gymnasium environments that can be installed as extras:
 - [aloha](https://github.com/huggingface/gym-aloha)

benchmarks/video/README.md

@@ -51,7 +51,7 @@ For a comprehensive list and documentation of these parameters, see the ffmpeg d
 ### Decoding parameters
 **Decoder**
 We tested two video decoding backends from torchvision:
-- `pyav`
+- `pyav` (default)
 - `video_reader` (requires to build torchvision from source)
 
 **Requested timestamps**

benchmarks/video/capture_camera_feed.py

@@ -17,21 +17,12 @@
 
 import argparse
 import datetime as dt
-import os
-import time
 from pathlib import Path
 
 import cv2
-import rerun as rr
-
-# see https://rerun.io/docs/howto/visualization/limit-ram
-RERUN_MEMORY_LIMIT = os.getenv("LEROBOT_RERUN_MEMORY_LIMIT", "5%")
 
 
-def display_and_save_video_stream(output_dir: Path, fps: int, width: int, height: int, duration: int):
-    rr.init("lerobot_capture_camera_feed")
-    rr.spawn(memory_limit=RERUN_MEMORY_LIMIT)
-
+def display_and_save_video_stream(output_dir: Path, fps: int, width: int, height: int):
     now = dt.datetime.now()
     capture_dir = output_dir / f"{now:%Y-%m-%d}" / f"{now:%H-%M-%S}"
     if not capture_dir.exists():
@@ -48,21 +39,24 @@ def display_and_save_video_stream(output_dir: Path, fps: int, width: int, height
     cap.set(cv2.CAP_PROP_FRAME_HEIGHT, height)
 
     frame_index = 0
-    start_time = time.time()
-    while time.time() - start_time < duration:
+    while True:
         ret, frame = cap.read()
 
         if not ret:
             print("Error: Could not read frame.")
             break
-        rr.log("video/stream", rr.Image(frame.numpy()), static=True)
+
+        cv2.imshow("Video Stream", frame)
         cv2.imwrite(str(capture_dir / f"frame_{frame_index:06d}.png"), frame)
         frame_index += 1
 
-    # Release the capture
-    cap.release()
+        # Break the loop on 'q' key press
+        if cv2.waitKey(1) & 0xFF == ord("q"):
+            break
 
-    # TODO(Steven): Add a graceful shutdown via a close() method for the Viewer context, though not currently supported in the Rerun API.
+    # Release the capture and destroy all windows
+    cap.release()
+    cv2.destroyAllWindows()
 
 
 if __name__ == "__main__":
@@ -92,11 +86,5 @@ if __name__ == "__main__":
         default=720,
         help="Height of the captured images.",
     )
-    parser.add_argument(
-        "--duration",
-        type=int,
-        default=20,
-        help="Duration in seconds for which the video stream should be captured.",
-    )
     args = parser.parse_args()
     display_and_save_video_stream(**vars(args))

benchmarks/video/run_video_benchmark.py

@@ -32,11 +32,7 @@ import numpy as np
 import pandas as pd
 import PIL
 import torch
-from skimage.metrics import (
-    mean_squared_error,
-    peak_signal_noise_ratio,
-    structural_similarity,
-)
+from skimage.metrics import mean_squared_error, peak_signal_noise_ratio, structural_similarity
 from tqdm import tqdm
 
 from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
@@ -98,11 +94,7 @@ def load_original_frames(imgs_dir: Path, timestamps: list[float], fps: int) -> t
 
 
 def save_decoded_frames(
-    imgs_dir: Path,
-    save_dir: Path,
-    frames: torch.Tensor,
-    timestamps: list[float],
-    fps: int,
+    imgs_dir: Path, save_dir: Path, frames: torch.Tensor, timestamps: list[float], fps: int
 ) -> None:
     if save_dir.exists() and len(list(save_dir.glob("frame_*.png"))) == len(timestamps):
         return
@@ -112,10 +104,7 @@ def save_decoded_frames(
         idx = int(ts * fps)
         frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
         PIL.Image.fromarray(frame_hwc).save(save_dir / f"frame_{idx:06d}_decoded.png")
-        shutil.copyfile(
-            imgs_dir / f"frame_{idx:06d}.png",
-            save_dir / f"frame_{idx:06d}_original.png",
-        )
+        shutil.copyfile(imgs_dir / f"frame_{idx:06d}.png", save_dir / f"frame_{idx:06d}_original.png")
 
 
 def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
@@ -131,11 +120,7 @@ def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
     imgs_dataset = hf_dataset.select_columns(img_keys[0])
 
     for i, item in enumerate(
-        tqdm(
-            imgs_dataset,
-            desc=f"saving {dataset.repo_id} first episode images",
-            leave=False,
-        )
+        tqdm(imgs_dataset, desc=f"saving {dataset.repo_id} first episode images", leave=False)
     ):
         img = item[img_keys[0]]
         img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
@@ -290,9 +275,7 @@ def benchmark_encoding_decoding(
     random.seed(seed)
     benchmark_table = []
     for timestamps_mode in tqdm(
-        decoding_cfg["timestamps_modes"],
-        desc="decodings (timestamps_modes)",
-        leave=False,
+        decoding_cfg["timestamps_modes"], desc="decodings (timestamps_modes)", leave=False
     ):
         for backend in tqdm(decoding_cfg["backends"], desc="decodings (backends)", leave=False):
             benchmark_row = benchmark_decoding(

docker/lerobot-gpu-dev/Dockerfile

@@ -14,7 +14,7 @@ RUN apt-get update && apt-get install -y --no-install-recommends \
     tcpdump sysstat screen tmux \
     libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
     speech-dispatcher portaudio19-dev libgeos-dev \
-    python${PYTHON_VERSION} python${PYTHON_VERSION}-venv python${PYTHON_VERSION}-dev \
+    python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
     && apt-get clean && rm -rf /var/lib/apt/lists/*
 
 # Install ffmpeg build dependencies. See:

examples/10_use_so100.md

@@ -57,17 +57,17 @@ conda activate lerobot
 git clone https://github.com/huggingface/lerobot.git ~/lerobot
 ```
 
-#### 5. Install ffmpeg in your environment:
-When using `miniconda`, install `ffmpeg` in your environment:
-```bash
-conda install ffmpeg -c conda-forge
-```
-
-#### 6. Install LeRobot with dependencies for the feetech motors:
+#### 5. Install LeRobot with dependencies for the feetech motors:
 ```bash
 cd ~/lerobot && pip install -e ".[feetech]"
 ```
 
+*EXTRA: For Linux only (not Mac)*: install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
 Great :hugs:! You are now done installing LeRobot and we can begin assembling the SO100 arms :robot:.
 Every time you now want to use LeRobot you can go to the `~/lerobot` folder where we installed LeRobot and run one of the commands.
 
@@ -497,9 +497,6 @@ python lerobot/scripts/control_robot.py \
 
 #### a. Teleop with displaying cameras
 Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
-
-> **NOTE:** To visualize the data, enable `--control.display_data=true`. This streams the data using `rerun`.
-
 ```bash
 python lerobot/scripts/control_robot.py \
   --robot.type=so100 \
@@ -586,13 +583,6 @@ Let's explain it:
 
 Training should take several hours. You will find checkpoints in `outputs/train/act_so100_test/checkpoints`.
 
-To resume training from a checkpoint, below is an example command to resume from `last` checkpoint of the `act_so100_test` policy:
-```bash
-python lerobot/scripts/train.py \
-  --config_path=outputs/train/act_so100_test/checkpoints/last/pretrained_model/train_config.json \
-  --resume=true
-```
-
 ## K. Evaluate your policy
 
 You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:

examples/11_use_lekiwi.md

@@ -67,13 +67,7 @@ conda activate lerobot
 git clone https://github.com/huggingface/lerobot.git ~/lerobot
 ```
 
-#### 5. Install ffmpeg in your environment:
-When using `miniconda`, install `ffmpeg` in your environment:
-```bash
-conda install ffmpeg -c conda-forge
-```
-
-#### 6. Install LeRobot with dependencies for the feetech motors:
+#### 5. Install LeRobot with dependencies for the feetech motors:
 ```bash
 cd ~/lerobot && pip install -e ".[feetech]"
 ```
@@ -114,17 +108,17 @@ conda activate lerobot
 git clone https://github.com/huggingface/lerobot.git ~/lerobot
 ```
 
-#### 5. Install ffmpeg in your environment:
-When using `miniconda`, install `ffmpeg` in your environment:
-```bash
-conda install ffmpeg -c conda-forge
-```
-
-#### 6. Install LeRobot with dependencies for the feetech motors:
+#### 5. Install LeRobot with dependencies for the feetech motors:
 ```bash
 cd ~/lerobot && pip install -e ".[feetech]"
 ```
 
+*EXTRA: For Linux only (not Mac)*: install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
 Great :hugs:! You are now done installing LeRobot and we can begin assembling the SO100 arms and Mobile base :robot:.
 Every time you now want to use LeRobot you can go to the `~/lerobot` folder where we installed LeRobot and run one of the commands.
 
@@ -405,10 +399,6 @@ python lerobot/scripts/control_robot.py \
 ```
 
 # F. Teleoperate
-
-> [!TIP]
-> If you're using a Mac, you might need to give Terminal permission to access your keyboard. Go to System Preferences > Security & Privacy > Input Monitoring and check the box for Terminal.
-
 To teleoperate SSH into your Raspberry Pi, and run `conda activate lerobot` and this script:
 ```bash
 python lerobot/scripts/control_robot.py \
@@ -424,8 +414,6 @@ python lerobot/scripts/control_robot.py \
   --control.fps=30
 ```
 
-> **NOTE:** To visualize the data, enable `--control.display_data=true`. This streams the data using `rerun`. For the `--control.type=remote_robot` you will also need to set `--control.viewer_ip` and `--control.viewer_port`
-
 You should see on your laptop something like this: ```[INFO] Connected to remote robot at tcp://172.17.133.91:5555 and video stream at tcp://172.17.133.91:5556.``` Now you can move the leader arm and use the keyboard (w,a,s,d) to drive forward, left, backwards, right. And use (z,x) to turn left or turn right. You can use (r,f) to increase and decrease the speed of the mobile robot. There are three speed modes, see the table below:
 | Speed Mode | Linear Speed (m/s) | Rotation Speed (deg/s) |
 | ---------- | ------------------ | ---------------------- |

examples/11_use_moss.md

@@ -31,17 +31,18 @@ conda create -y -n lerobot python=3.10 && conda activate lerobot
 git clone https://github.com/huggingface/lerobot.git ~/lerobot
 ```
 
-5. Install ffmpeg in your environment:
-When using `miniconda`, install `ffmpeg` in your environment:
-```bash
-conda install ffmpeg -c conda-forge
-```
-
-6. Install LeRobot with dependencies for the feetech motors:
+5. Install LeRobot with dependencies for the feetech motors:
 ```bash
 cd ~/lerobot && pip install -e ".[feetech]"
 ```
 
+For Linux only (not Mac), install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
+
 ## Configure the motors
 
 Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the use of our scripts below.
@@ -218,9 +219,6 @@ python lerobot/scripts/control_robot.py \
 
 **Teleop with displaying cameras**
 Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
-
-> **NOTE:** To visualize the data, enable `--control.display_data=true`. This streams the data using `rerun`.
-
 ```bash
 python lerobot/scripts/control_robot.py \
   --robot.type=moss \

examples/12_train_hilserl_classifier.md

@@ -1,94 +0,0 @@
-# Training a HIL-SERL Reward Classifier with LeRobot
-
-This tutorial provides step-by-step instructions for training a reward classifier using LeRobot.
-
----
-
-## Training Script Overview
-
-LeRobot includes a ready-to-use training script located at [`lerobot/scripts/train_hilserl_classifier.py`](../../lerobot/scripts/train_hilserl_classifier.py). Here's an outline of its workflow:
-
-1. **Configuration Loading**
-   The script uses Hydra to load a configuration file for subsequent steps. (Details on Hydra follow below.)
-
-2. **Dataset Initialization**
-   It loads a `LeRobotDataset` containing images and rewards. To optimize performance, a weighted random sampler is used to balance class sampling.
-
-3. **Classifier Initialization**
-   A lightweight classification head is built on top of a frozen, pretrained image encoder from HuggingFace. The classifier outputs either:
-   - A single probability (binary classification), or
-   - Logits (multi-class classification).
-
-4. **Training Loop Execution**
-   The script performs:
-   - Forward and backward passes,
-   - Optimization steps,
-   - Periodic logging, evaluation, and checkpoint saving.
-
----
-
-## Configuring with Hydra
-
-For detailed information about Hydra usage, refer to [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md). However, note that training the reward classifier differs slightly and requires a separate configuration file.
-
-### Config File Setup
-
-The default `default.yaml` cannot launch the reward classifier training directly. Instead, you need a configuration file like [`lerobot/configs/policy/hilserl_classifier.yaml`](../../lerobot/configs/policy/hilserl_classifier.yaml), with the following adjustment:
-
-Replace the `dataset_repo_id` field with the identifier for your dataset, which contains images and sparse rewards:
-
-```yaml
-# Example: lerobot/configs/policy/reward_classifier.yaml
-dataset_repo_id: "my_dataset_repo_id"
-## Typical logs and metrics
-```
-When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
-
-After that, you will see training log like this one:
-
-```
-[2024-11-29 18:26:36,999][root][INFO] -
-Epoch 5/5
-Training:  82%|██████████████████████████████████████████████████████████████████████████████▋                 | 91/111 [00:50<00:09,  2.04it/s, loss=0.2999, acc=69.99%]
-```
-
-or evaluation log like:
-
-```
-Validation: 100%|████████████████████████████████████████████████████████████████████████████████████████████████████████████████████████| 28/28 [00:20<00:00,  1.37it/s]
-```
-
-### Metrics Tracking with Weights & Biases (WandB)
-
-If `wandb.enable` is set to `true`, the training and evaluation logs will also be saved in WandB. This allows you to track key metrics in real-time, including:
-
-- **Training Metrics**:
-  - `train/accuracy`
-  - `train/loss`
-  - `train/dataloading_s`
-- **Evaluation Metrics**:
-  - `eval/accuracy`
-  - `eval/loss`
-  - `eval/eval_s`
-
-#### Additional Features
-
-You can also log sample predictions during evaluation. Each logged sample will include:
-
-- The **input image**.
-- The **predicted label**.
-- The **true label**.
-- The **classifier's "confidence" (logits/probability)**.
-
-These logs can be useful for diagnosing and debugging performance issues.
-
-
-#### Generate protobuf files
-
-```bash
-python -m grpc_tools.protoc \
-    -I lerobot/scripts/server \
-    --python_out=lerobot/scripts/server \
-    --grpc_python_out=lerobot/scripts/server \
-    lerobot/scripts/server/hilserl.proto
-```

examples/1_load_lerobot_dataset.py

@@ -32,10 +32,7 @@ import torch
 from huggingface_hub import HfApi
 
 import lerobot
-from lerobot.common.datasets.lerobot_dataset import (
-    LeRobotDataset,
-    LeRobotDatasetMetadata,
-)
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
 
 # We ported a number of existing datasets ourselves, use this to see the list:
 print("List of available datasets:")
@@ -122,7 +119,7 @@ print(dataset.features[camera_key]["shape"])
 delta_timestamps = {
     # loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
     camera_key: [-1, -0.5, -0.20, 0],
-    # loads 6 state vectors: 1.5 seconds before, 1 second before, ... 200 ms, 100 ms, and current frame
+    # loads 8 state vectors: 1.5 seconds before, 1 second before, ... 200 ms, 100 ms, and current frame
     "observation.state": [-1.5, -1, -0.5, -0.20, -0.10, 0],
     # loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
     "action": [t / dataset.fps for t in range(64)],
@@ -146,6 +143,6 @@ dataloader = torch.utils.data.DataLoader(
 
 for batch in dataloader:
     print(f"{batch[camera_key].shape=}")  # (32, 4, c, h, w)
-    print(f"{batch['observation.state'].shape=}")  # (32, 6, c)
+    print(f"{batch['observation.state'].shape=}")  # (32, 5, c)
     print(f"{batch['action'].shape=}")  # (32, 64, c)
     break

examples/2_evaluate_pretrained_policy.py

@@ -18,7 +18,7 @@ training outputs directory. In the latter case, you might want to run examples/3
 
 It requires the installation of the 'gym_pusht' simulation environment. Install it by running:
 ```bash
-pip install -e ".[pusht]"
+pip install -e ".[pusht]"`
 ```
 """
 

examples/3_train_policy.py

@@ -22,10 +22,7 @@ from pathlib import Path
 
 import torch
 
-from lerobot.common.datasets.lerobot_dataset import (
-    LeRobotDataset,
-    LeRobotDatasetMetadata,
-)
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
 from lerobot.common.datasets.utils import dataset_to_policy_features
 from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
 from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
@@ -80,24 +77,7 @@ def main():
         # Load the previous action (-0.1), the next action to be executed (0.0),
         # and 14 future actions with a 0.1 seconds spacing. All these actions will be
         # used to supervise the policy.
-        "action": [
-            -0.1,
-            0.0,
-            0.1,
-            0.2,
-            0.3,
-            0.4,
-            0.5,
-            0.6,
-            0.7,
-            0.8,
-            0.9,
-            1.0,
-            1.1,
-            1.2,
-            1.3,
-            1.4,
-        ],
+        "action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
     }
 
     # We can then instantiate the dataset with these delta_timestamps configuration.

examples/4_train_policy_with_script.md

@@ -4,7 +4,7 @@ This tutorial will explain the training script, how to use it, and particularly
 
 ## The training script
 
-LeRobot offers a training script at [`lerobot/scripts/train.py`](../lerobot/scripts/train.py). At a high level it does the following:
+LeRobot offers a training script at [`lerobot/scripts/train.py`](../../lerobot/scripts/train.py). At a high level it does the following:
 
 - Initialize/load a configuration for the following steps using.
 - Instantiates a dataset.
@@ -21,7 +21,7 @@ In the training script, the main function `train` expects a `TrainPipelineConfig
 def train(cfg: TrainPipelineConfig):
 ```
 
-You can inspect the `TrainPipelineConfig` defined in [`lerobot/configs/train.py`](../lerobot/configs/train.py) (which is heavily commented and meant to be a reference to understand any option)
+You can inspect the `TrainPipelineConfig` defined in [`lerobot/configs/train.py`](../../lerobot/configs/train.py) (which is heavily commented and meant to be a reference to understand any option)
 
 When running the script, inputs for the command line are parsed thanks to the `@parser.wrap()` decorator and an instance of this class is automatically generated. Under the hood, this is done with [Draccus](https://github.com/dlwh/draccus) which is a tool dedicated for this purpose. If you're familiar with Hydra, Draccus can similarly load configurations from config files (.json, .yaml) and also override their values through command line inputs. Unlike Hydra, these configurations are pre-defined in the code through dataclasses rather than being defined entirely in config files. This allows for more rigorous serialization/deserialization, typing, and to manipulate configuration as objects directly in the code and not as dictionaries or namespaces (which enables nice features in an IDE such as autocomplete, jump-to-def, etc.)
 
@@ -50,7 +50,7 @@ By default, every field takes its default value specified in the dataclass. If a
 
 ## Specifying values from the CLI
 
-Let's say that we want to train [Diffusion Policy](../lerobot/common/policies/diffusion) on the [pusht](https://huggingface.co/datasets/lerobot/pusht) dataset, using the [gym_pusht](https://github.com/huggingface/gym-pusht) environment for evaluation. The command to do so would look like this:
+Let's say that we want to train [Diffusion Policy](../../lerobot/common/policies/diffusion) on the [pusht](https://huggingface.co/datasets/lerobot/pusht) dataset, using the [gym_pusht](https://github.com/huggingface/gym-pusht) environment for evaluation. The command to do so would look like this:
 ```bash
 python lerobot/scripts/train.py \
     --dataset.repo_id=lerobot/pusht \
@@ -60,10 +60,10 @@ python lerobot/scripts/train.py \
 
 Let's break this down:
 - To specify the dataset, we just need to specify its `repo_id` on the hub which is the only required argument in the `DatasetConfig`. The rest of the fields have default values and in this case we are fine with those so we can just add the option `--dataset.repo_id=lerobot/pusht`.
-- To specify the policy, we can just select diffusion policy using `--policy` appended with `.type`. Here, `.type` is a special argument which allows us to select config classes inheriting from `draccus.ChoiceRegistry` and that have been decorated with the `register_subclass()` method. To have a better explanation of this feature, have a look at this [Draccus demo](https://github.com/dlwh/draccus?tab=readme-ov-file#more-flexible-configuration-with-choice-types). In our code, we use this mechanism mainly to select policies, environments, robots, and some other components like optimizers. The policies available to select are located in [lerobot/common/policies](../lerobot/common/policies)
-- Similarly, we select the environment with `--env.type=pusht`. The different environment configs are available in [`lerobot/common/envs/configs.py`](../lerobot/common/envs/configs.py)
+- To specify the policy, we can just select diffusion policy using `--policy` appended with `.type`. Here, `.type` is a special argument which allows us to select config classes inheriting from `draccus.ChoiceRegistry` and that have been decorated with the `register_subclass()` method. To have a better explanation of this feature, have a look at this [Draccus demo](https://github.com/dlwh/draccus?tab=readme-ov-file#more-flexible-configuration-with-choice-types). In our code, we use this mechanism mainly to select policies, environments, robots, and some other components like optimizers. The policies available to select are located in [lerobot/common/policies](../../lerobot/common/policies)
+- Similarly, we select the environment with `--env.type=pusht`. The different environment configs are available in [`lerobot/common/envs/configs.py`](../../lerobot/common/envs/configs.py)
 
-Let's see another example. Let's say you've been training [ACT](../lerobot/common/policies/act) on [lerobot/aloha_sim_insertion_human](https://huggingface.co/datasets/lerobot/aloha_sim_insertion_human) using the [gym-aloha](https://github.com/huggingface/gym-aloha) environment for evaluation with:
+Let's see another example. Let's say you've been training [ACT](../../lerobot/common/policies/act) on [lerobot/aloha_sim_insertion_human](https://huggingface.co/datasets/lerobot/aloha_sim_insertion_human) using the [gym-aloha](https://github.com/huggingface/gym-aloha) environment for evaluation with:
 ```bash
 python lerobot/scripts/train.py \
     --policy.type=act \
@@ -74,7 +74,7 @@ python lerobot/scripts/train.py \
 > Notice we added `--output_dir` to explicitly tell where to write outputs from this run (checkpoints, training state, configs etc.). This is not mandatory and if you don't specify it, a default directory will be created from the current date and time, env.type and policy.type. This will typically look like `outputs/train/2025-01-24/16-10-05_aloha_act`.
 
 We now want to train a different policy for aloha on another task. We'll change the dataset and use [lerobot/aloha_sim_transfer_cube_human](https://huggingface.co/datasets/lerobot/aloha_sim_transfer_cube_human) instead. Of course, we also need to change the task of the environment as well to match this other task.
-Looking at the [`AlohaEnv`](../lerobot/common/envs/configs.py) config, the task is `"AlohaInsertion-v0"` by default, which corresponds to the task we trained on in the command above. The [gym-aloha](https://github.com/huggingface/gym-aloha?tab=readme-ov-file#description) environment also has the `AlohaTransferCube-v0` task which corresponds to this other task we want to train on. Putting this together, we can train this new policy on this different task using:
+Looking at the [`AlohaEnv`](../../lerobot/common/envs/configs.py) config, the task is `"AlohaInsertion-v0"` by default, which corresponds to the task we trained on in the command above. The [gym-aloha](https://github.com/huggingface/gym-aloha?tab=readme-ov-file#description) environment also has the `AlohaTransferCube-v0` task which corresponds to this other task we want to train on. Putting this together, we can train this new policy on this different task using:
 ```bash
 python lerobot/scripts/train.py \
     --policy.type=act \

examples/7_get_started_with_real_robot.md

@@ -46,6 +46,13 @@ Using `uv`:
 uv sync --extra "dynamixel"
 ```
 
+/!\ For Linux only, ffmpeg and opencv requires conda install for now. Run this exact sequence of commands:
+```bash
+conda install -c conda-forge ffmpeg
+pip uninstall opencv-python
+conda install -c conda-forge "opencv>=4.10.0"
+```
+
 You are now ready to plug the 5V power supply to the motor bus of the leader arm (the smaller one) since all its motors only require 5V.
 
 Then plug the 12V power supply to the motor bus of the follower arm. It has two motors that need 12V, and the rest will be powered with 5V through the voltage convertor.
@@ -55,9 +62,6 @@ Finally, connect both arms to your computer via USB. Note that the USB doesn't p
 Now you are ready to configure your motors for the first time, as detailed in the sections below. In the upcoming sections, you'll learn about our classes and functions by running some python code in an interactive session, or by copy-pasting it in a python file.
 
 If you have already configured your motors the first time, you can streamline the process by directly running the teleoperate script (which is detailed further in the tutorial):
-
-> **NOTE:** To visualize the data, enable `--control.display_data=true`. This streams the data using `rerun`.
-
 ```bash
 python lerobot/scripts/control_robot.py \
   --robot.type=koch \
@@ -288,11 +292,6 @@ Steps:
    - Scan for devices. All 12 motors should appear.
    - Select the motors one by one and move the arm. Check that the graphical indicator near the top right shows the movement.
 
-** There is a common issue with the Dynamixel XL430-W250 motors where the motors become undiscoverable after upgrading their firmware from Mac and Windows Dynamixel Wizard2 applications.  When this occurs, it is required to do a firmware recovery (Select `DYNAMIXEL Firmware Recovery` and follow the prompts).   There are two known workarounds to conduct this firmware reset:
-  1) Install the Dynamixel Wizard on a linux machine and complete the firmware recovery
-  2) Use the Dynamixel U2D2 in order to perform the reset with Windows or Mac.  This U2D2 can be purchased [here](https://www.robotis.us/u2d2/).
-  For either solution, open DYNAMIXEL Wizard 2.0 and select the appropriate port. You will likely be unable to see the motor in the GUI at this time. Select `Firmware Recovery`, carefully choose the correct model, and wait for the process to complete. Finally, re-scan to confirm the firmware recovery was successful.
-
 **Read and Write with DynamixelMotorsBus**
 
 To get familiar with how `DynamixelMotorsBus` communicates with the motors, you can start by reading data from them. Copy past this code in the same interactive python session:
@@ -830,6 +829,16 @@ It contains:
 - `dtRphone:33.84 (29.5hz)` which is the delta time of capturing an image from the phone camera in the thread running asynchronously.
 
 Troubleshooting:
+- On Linux, if you encounter a hanging issue when using cameras, uninstall opencv and re-install it with conda:
+```bash
+pip uninstall opencv-python
+conda install -c conda-forge opencv=4.10.0
+```
+- On Linux, if you encounter any issue during video encoding with `ffmpeg: unknown encoder libsvtav1`, you can:
+  - install with conda-forge by running `conda install -c conda-forge ffmpeg` (it should be compiled with `libsvtav1`),
+  - or, install [Homebrew](https://brew.sh) and run `brew install ffmpeg` (it should be compiled with `libsvtav1`),
+  - or, install [ffmpeg build dependencies](https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu#GettheDependencies) and [compile ffmpeg from source with libsvtav1](https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu#libsvtav1),
+  - and, make sure you use the corresponding ffmpeg binary to your install with `which ffmpeg`.
 - On Linux, if the left and right arrow keys and escape key don't have any effect during data recording, make sure you've set the `$DISPLAY` environment variable. See [pynput limitations](https://pynput.readthedocs.io/en/latest/limitations.html#linux).
 
 At the end of data recording, your dataset will be uploaded on your Hugging Face page (e.g. https://huggingface.co/datasets/cadene/koch_test) that you can obtain by running:

examples/8_use_stretch.md

@@ -43,19 +43,21 @@ conda create -y -n lerobot python=3.10 && conda activate lerobot
 git clone https://github.com/huggingface/lerobot.git ~/lerobot
 ```
 
-6. When using `miniconda`, install `ffmpeg` in your environment:
-```bash
-conda install ffmpeg -c conda-forge
-```
-
-7. Install LeRobot with stretch dependencies:
+6. Install LeRobot with stretch dependencies:
 ```bash
 cd ~/lerobot && pip install -e ".[stretch]"
 ```
 
 > **Note:** If you get this message, you can ignore it: `ERROR: pip's dependency resolver does not currently take into account all the packages that are installed.`
 
-8. Run a [system check](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#system-check) to make sure your robot is ready:
+For Linux only (not Mac), install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
+
+7. Run a [system check](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#system-check) to make sure your robot is ready:
 ```bash
 stretch_system_check.py
 ```
@@ -102,8 +104,6 @@ This is equivalent to running `stretch_robot_home.py`
 Before trying teleoperation, you need activate the gamepad controller by pressing the middle button. For more info, see Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/hello_robot/#gamepad-teleoperation).
 
 Now try out teleoperation (see above documentation to learn about the gamepad controls):
-
-> **NOTE:** To visualize the data, enable `--control.display_data=true`. This streams the data using `rerun`.
 ```bash
 python lerobot/scripts/control_robot.py \
     --robot.type=stretch \

examples/9_use_aloha.md

@@ -30,16 +30,18 @@ conda create -y -n lerobot python=3.10 && conda activate lerobot
 git clone https://github.com/huggingface/lerobot.git ~/lerobot
 ```
 
-5. When using `miniconda`, install `ffmpeg` in your environment:
-```bash
-conda install ffmpeg -c conda-forge
-```
-
-6. Install LeRobot with dependencies for the Aloha motors (dynamixel) and cameras (intelrealsense):
+5. Install LeRobot with dependencies for the Aloha motors (dynamixel) and cameras (intelrealsense):
 ```bash
 cd ~/lerobot && pip install -e ".[dynamixel, intelrealsense]"
 ```
 
+For Linux only (not Mac), install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
+
 ## Teleoperate
 
 **/!\ FOR SAFETY, READ THIS /!\**
@@ -48,9 +50,6 @@ Teleoperation consists in manually operating the leader arms to move the followe
 2. Our code assumes that your robot has been assembled following Trossen Robotics instructions. This allows us to skip calibration, as we use the pre-defined calibration files in `.cache/calibration/aloha_default`. If you replace a motor, make sure you follow the exact instructions from Trossen Robotics.
 
 By running the following code, you can start your first **SAFE** teleoperation:
-
-> **NOTE:** To visualize the data, enable `--control.display_data=true`. This streams the data using `rerun`.
-
 ```bash
 python lerobot/scripts/control_robot.py \
   --robot.type=aloha \

examples/advanced/2_calculate_validation_loss.py

@@ -26,10 +26,7 @@ import math
 
 import torch
 
-from lerobot.common.datasets.lerobot_dataset import (
-    LeRobotDataset,
-    LeRobotDatasetMetadata,
-)
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
 from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
 
 
@@ -54,24 +51,7 @@ def main():
         # Load the previous action (-0.1), the next action to be executed (0.0),
         # and 14 future actions with a 0.1 seconds spacing. All these actions will be
         # used to calculate the loss.
-        "action": [
-            -0.1,
-            0.0,
-            0.1,
-            0.2,
-            0.3,
-            0.4,
-            0.5,
-            0.6,
-            0.7,
-            0.8,
-            0.9,
-            1.0,
-            1.1,
-            1.2,
-            1.3,
-            1.4,
-        ],
+        "action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
     }
 
     # Load the last 10% of episodes of the dataset as a validation set.

examples/port_datasets/pusht_zarr.py

@@ -0,0 +1,243 @@
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import shutil
+from pathlib import Path
+
+import numpy as np
+from huggingface_hub import HfApi
+
+from lerobot.common.constants import HF_LEROBOT_HOME
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION, LeRobotDataset
+from lerobot.common.datasets.push_dataset_to_hub._download_raw import download_raw
+
+PUSHT_TASK = "Push the T-shaped blue block onto the T-shaped green target surface."
+PUSHT_FEATURES = {
+    "observation.state": {
+        "dtype": "float32",
+        "shape": (2,),
+        "names": {
+            "axes": ["x", "y"],
+        },
+    },
+    "action": {
+        "dtype": "float32",
+        "shape": (2,),
+        "names": {
+            "axes": ["x", "y"],
+        },
+    },
+    "next.reward": {
+        "dtype": "float32",
+        "shape": (1,),
+        "names": None,
+    },
+    "next.success": {
+        "dtype": "bool",
+        "shape": (1,),
+        "names": None,
+    },
+    "observation.environment_state": {
+        "dtype": "float32",
+        "shape": (16,),
+        "names": [
+            "keypoints",
+        ],
+    },
+    "observation.image": {
+        "dtype": None,
+        "shape": (3, 96, 96),
+        "names": [
+            "channels",
+            "height",
+            "width",
+        ],
+    },
+}
+
+
+def build_features(mode: str) -> dict:
+    features = PUSHT_FEATURES
+    if mode == "keypoints":
+        features.pop("observation.image")
+    else:
+        features.pop("observation.environment_state")
+        features["observation.image"]["dtype"] = mode
+
+    return features
+
+
+def load_raw_dataset(zarr_path: Path):
+    try:
+        from lerobot.common.datasets.push_dataset_to_hub._diffusion_policy_replay_buffer import (
+            ReplayBuffer as DiffusionPolicyReplayBuffer,
+        )
+    except ModuleNotFoundError as e:
+        print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
+        raise e
+
+    zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
+    return zarr_data
+
+
+def calculate_coverage(zarr_data):
+    try:
+        import pymunk
+        from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
+    except ModuleNotFoundError as e:
+        print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
+        raise e
+
+    block_pos = zarr_data["state"][:, 2:4]
+    block_angle = zarr_data["state"][:, 4]
+
+    num_frames = len(block_pos)
+
+    coverage = np.zeros((num_frames,), dtype=np.float32)
+    # 8 keypoints with 2 coords each
+    keypoints = np.zeros((num_frames, 16), dtype=np.float32)
+
+    # Set x, y, theta (in radians)
+    goal_pos_angle = np.array([256, 256, np.pi / 4])
+    goal_body = PushTEnv.get_goal_pose_body(goal_pos_angle)
+
+    for i in range(num_frames):
+        space = pymunk.Space()
+        space.gravity = 0, 0
+        space.damping = 0
+
+        # Add walls.
+        walls = [
+            PushTEnv.add_segment(space, (5, 506), (5, 5), 2),
+            PushTEnv.add_segment(space, (5, 5), (506, 5), 2),
+            PushTEnv.add_segment(space, (506, 5), (506, 506), 2),
+            PushTEnv.add_segment(space, (5, 506), (506, 506), 2),
+        ]
+        space.add(*walls)
+
+        block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
+        goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
+        block_geom = pymunk_to_shapely(block_body, block_body.shapes)
+        intersection_area = goal_geom.intersection(block_geom).area
+        goal_area = goal_geom.area
+        coverage[i] = intersection_area / goal_area
+        keypoints[i] = PushTEnv.get_keypoints(block_shapes).flatten()
+
+    return coverage, keypoints
+
+
+def calculate_success(coverage: float, success_threshold: float):
+    return coverage > success_threshold
+
+
+def calculate_reward(coverage: float, success_threshold: float):
+    return np.clip(coverage / success_threshold, 0, 1)
+
+
+def main(raw_dir: Path, repo_id: str, mode: str = "video", push_to_hub: bool = True):
+    if mode not in ["video", "image", "keypoints"]:
+        raise ValueError(mode)
+
+    if (HF_LEROBOT_HOME / repo_id).exists():
+        shutil.rmtree(HF_LEROBOT_HOME / repo_id)
+
+    if not raw_dir.exists():
+        download_raw(raw_dir, repo_id="lerobot-raw/pusht_raw")
+
+    zarr_data = load_raw_dataset(zarr_path=raw_dir / "pusht_cchi_v7_replay.zarr")
+
+    env_state = zarr_data["state"][:]
+    agent_pos = env_state[:, :2]
+
+    action = zarr_data["action"][:]
+    image = zarr_data["img"]  # (b, h, w, c)
+
+    if image.dtype == np.float32 and image.max() == np.float32(255):
+        # HACK: images are loaded as float32 but they actually encode uint8 data
+        image = image.astype(np.uint8)
+
+    episode_data_index = {
+        "from": np.concatenate(([0], zarr_data.meta["episode_ends"][:-1])),
+        "to": zarr_data.meta["episode_ends"],
+    }
+
+    # Calculate success and reward based on the overlapping area
+    # of the T-object and the T-area.
+    coverage, keypoints = calculate_coverage(zarr_data)
+    success = calculate_success(coverage, success_threshold=0.95)
+    reward = calculate_reward(coverage, success_threshold=0.95)
+
+    features = build_features(mode)
+    dataset = LeRobotDataset.create(
+        repo_id=repo_id,
+        fps=10,
+        robot_type="2d pointer",
+        features=features,
+        image_writer_threads=4,
+    )
+    episodes = range(len(episode_data_index["from"]))
+    for ep_idx in episodes:
+        from_idx = episode_data_index["from"][ep_idx]
+        to_idx = episode_data_index["to"][ep_idx]
+        num_frames = to_idx - from_idx
+
+        for frame_idx in range(num_frames):
+            i = from_idx + frame_idx
+            idx = i + (frame_idx < num_frames - 1)
+            frame = {
+                "action": action[i],
+                # Shift reward and success by +1 until the last item of the episode
+                "next.reward": reward[idx : idx + 1],
+                "next.success": success[idx : idx + 1],
+                "task": PUSHT_TASK,
+            }
+
+            frame["observation.state"] = agent_pos[i]
+
+            if mode == "keypoints":
+                frame["observation.environment_state"] = keypoints[i]
+            else:
+                frame["observation.image"] = image[i]
+
+            dataset.add_frame(frame)
+
+        dataset.save_episode()
+
+    if push_to_hub:
+        dataset.push_to_hub()
+        hub_api = HfApi()
+        hub_api.create_tag(repo_id, tag=CODEBASE_VERSION, repo_type="dataset")
+
+
+if __name__ == "__main__":
+    # To try this script, modify the repo id with your own HuggingFace user (e.g cadene/pusht)
+    repo_id = "lerobot/pusht"
+
+    modes = ["video", "image", "keypoints"]
+    # Uncomment if you want to try with a specific mode
+    # modes = ["video"]
+    # modes = ["image"]
+    # modes = ["keypoints"]
+
+    raw_dir = Path("data/lerobot-raw/pusht_raw")
+    for mode in modes:
+        if mode in ["image", "keypoints"]:
+            repo_id += f"_{mode}"
+
+        # download and load raw dataset, create LeRobotDataset, populate it, push to hub
+        main(raw_dir, repo_id=repo_id, mode=mode)
+
+        # Uncomment if you want to load the local dataset and explore it
+        # dataset = LeRobotDataset(repo_id=repo_id)
+        # breakpoint()

lerobot/common/datasets/compute_stats.py

@@ -19,10 +19,7 @@ from lerobot.common.datasets.utils import load_image_as_numpy
 
 
 def estimate_num_samples(
-    dataset_len: int,
-    min_num_samples: int = 100,
-    max_num_samples: int = 10_000,
-    power: float = 0.75,
+    dataset_len: int, min_num_samples: int = 100, max_num_samples: int = 10_000, power: float = 0.75
 ) -> int:
     """Heuristic to estimate the number of samples based on dataset size.
     The power controls the sample growth relative to dataset size.
@@ -126,9 +123,7 @@ def _assert_type_and_shape(stats_list: list[dict[str, dict]]):
                     raise ValueError(f"Shape of '{k}' must be (3,1,1), but is {v.shape} instead.")
 
 
-def aggregate_feature_stats(
-    stats_ft_list: list[dict[str, dict]],
-) -> dict[str, dict[str, np.ndarray]]:
+def aggregate_feature_stats(stats_ft_list: list[dict[str, dict]]) -> dict[str, dict[str, np.ndarray]]:
     """Aggregates stats for a single feature."""
     means = np.stack([s["mean"] for s in stats_ft_list])
     variances = np.stack([s["std"] ** 2 for s in stats_ft_list])
@@ -157,9 +152,7 @@ def aggregate_feature_stats(
     }
 
 
-def aggregate_stats(
-    stats_list: list[dict[str, dict]],
-) -> dict[str, dict[str, np.ndarray]]:
+def aggregate_stats(stats_list: list[dict[str, dict]]) -> dict[str, dict[str, np.ndarray]]:
     """Aggregate stats from multiple compute_stats outputs into a single set of stats.
 
     The final stats will have the union of all data keys from each of the stats dicts.

lerobot/common/datasets/lerobot_dataset.py

@@ -69,7 +69,6 @@ from lerobot.common.datasets.video_utils import (
     VideoFrame,
     decode_video_frames,
     encode_video_frames,
-    get_safe_default_codec,
     get_video_info,
 )
 from lerobot.common.robot_devices.robots.utils import Robot
@@ -318,7 +317,7 @@ class LeRobotDatasetMetadata:
         obj.root.mkdir(parents=True, exist_ok=False)
 
         if robot is not None:
-            features = {**(features or {}), **get_features_from_robot(robot)}
+            features = get_features_from_robot(robot, use_videos)
             robot_type = robot.robot_type
             if not all(cam.fps == fps for cam in robot.cameras.values()):
                 logging.warning(
@@ -463,7 +462,7 @@ class LeRobotDataset(torch.utils.data.Dataset):
             download_videos (bool, optional): Flag to download the videos. Note that when set to True but the
                 video files are already present on local disk, they won't be downloaded again. Defaults to
                 True.
-            video_backend (str | None, optional): Video backend to use for decoding videos. Defaults to torchcodec when available int the platform; otherwise, defaults to 'pyav'.
+            video_backend (str | None, optional): Video backend to use for decoding videos. Defaults to torchcodec.
                 You can also use the 'pyav' decoder used by Torchvision, which used to be the default option, or 'video_reader' which is another decoder of Torchvision.
         """
         super().__init__()
@@ -474,7 +473,7 @@ class LeRobotDataset(torch.utils.data.Dataset):
         self.episodes = episodes
         self.tolerance_s = tolerance_s
         self.revision = revision if revision else CODEBASE_VERSION
-        self.video_backend = video_backend if video_backend else get_safe_default_codec()
+        self.video_backend = video_backend if video_backend else "torchcodec"
         self.delta_indices = None
 
         # Unused attributes
@@ -821,9 +820,7 @@ class LeRobotDataset(torch.utils.data.Dataset):
 
             if self.features[key]["dtype"] in ["image", "video"]:
                 img_path = self._get_image_file_path(
-                    episode_index=self.episode_buffer["episode_index"],
-                    image_key=key,
-                    frame_index=frame_index,
+                    episode_index=self.episode_buffer["episode_index"], image_key=key, frame_index=frame_index
                 )
                 if frame_index == 0:
                     img_path.parent.mkdir(parents=True, exist_ok=True)
@@ -869,10 +866,7 @@ class LeRobotDataset(torch.utils.data.Dataset):
         for key, ft in self.features.items():
             # index, episode_index, task_index are already processed above, and image and video
             # are processed separately by storing image path and frame info as meta data
-            if key in ["index", "episode_index", "task_index"] or ft["dtype"] in [
-                "image",
-                "video",
-            ]:
+            if key in ["index", "episode_index", "task_index"] or ft["dtype"] in ["image", "video"]:
                 continue
             episode_buffer[key] = np.stack(episode_buffer[key])
 
@@ -1033,7 +1027,7 @@ class LeRobotDataset(torch.utils.data.Dataset):
         obj.delta_timestamps = None
         obj.delta_indices = None
         obj.episode_data_index = None
-        obj.video_backend = video_backend if video_backend is not None else get_safe_default_codec()
+        obj.video_backend = video_backend if video_backend is not None else "torchcodec"
         return obj
 
 
@@ -1058,7 +1052,7 @@ class MultiLeRobotDataset(torch.utils.data.Dataset):
         super().__init__()
         self.repo_ids = repo_ids
         self.root = Path(root) if root else HF_LEROBOT_HOME
-        self.tolerances_s = tolerances_s if tolerances_s else dict.fromkeys(repo_ids, 0.0001)
+        self.tolerances_s = tolerances_s if tolerances_s else {repo_id: 1e-4 for repo_id in repo_ids}
         # Construct the underlying datasets passing everything but `transform` and `delta_timestamps` which
         # are handled by this class.
         self._datasets = [

lerobot/common/datasets/online_buffer.py

@@ -154,32 +154,14 @@ class OnlineBuffer(torch.utils.data.Dataset):
             OnlineBuffer.NEXT_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": ()},
             # Since the memmap is initialized with all-zeros, this keeps track of which indices are occupied
             # with real data rather than the dummy initialization.
-            OnlineBuffer.OCCUPANCY_MASK_KEY: {
-                "dtype": np.dtype("?"),
-                "shape": (buffer_capacity,),
-            },
-            OnlineBuffer.INDEX_KEY: {
-                "dtype": np.dtype("int64"),
-                "shape": (buffer_capacity,),
-            },
-            OnlineBuffer.FRAME_INDEX_KEY: {
-                "dtype": np.dtype("int64"),
-                "shape": (buffer_capacity,),
-            },
-            OnlineBuffer.EPISODE_INDEX_KEY: {
-                "dtype": np.dtype("int64"),
-                "shape": (buffer_capacity,),
-            },
-            OnlineBuffer.TIMESTAMP_KEY: {
-                "dtype": np.dtype("float64"),
-                "shape": (buffer_capacity,),
-            },
+            OnlineBuffer.OCCUPANCY_MASK_KEY: {"dtype": np.dtype("?"), "shape": (buffer_capacity,)},
+            OnlineBuffer.INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
+            OnlineBuffer.FRAME_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
+            OnlineBuffer.EPISODE_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
+            OnlineBuffer.TIMESTAMP_KEY: {"dtype": np.dtype("float64"), "shape": (buffer_capacity,)},
         }
         for k, v in data_spec.items():
-            complete_data_spec[k] = {
-                "dtype": v["dtype"],
-                "shape": (buffer_capacity, *v["shape"]),
-            }
+            complete_data_spec[k] = {"dtype": v["dtype"], "shape": (buffer_capacity, *v["shape"])}
         return complete_data_spec
 
     def add_data(self, data: dict[str, np.ndarray]):

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_cabinet.txt

@@ -0,0 +1,85 @@
+https://drive.google.com/file/d/1_SOJkgfP5yZyVjMhTt3nwhvyUjcnlI51/view?usp=drive_link
+https://drive.google.com/file/d/1rmgN8UUzph1qwJnzG1d-uOafodn-gLvb/view?usp=drive_link
+https://drive.google.com/file/d/1NYQ-XxsBVinB6dUoZmVWweT83367P3i2/view?usp=drive_link
+https://drive.google.com/file/d/1oAv_j74zxxCJieMG7r5Vl2BeHK1__3s3/view?usp=drive_link
+https://drive.google.com/file/d/1wFUJQROsrTJt64YRuIeExhFjr2wnK5uu/view?usp=drive_link
+https://drive.google.com/file/d/1KzL3Tt0Le7jVl58XVRUcmigmXjyiuhbK/view?usp=drive_link
+https://drive.google.com/file/d/1qy_YBladeHtianSSGtgAPSHtMin7msvf/view?usp=drive_link
+https://drive.google.com/file/d/1rA_F0V_qL_nyuC_0aBKCisF4-0TIkF2Y/view?usp=drive_link
+https://drive.google.com/file/d/1hw-8qMpz9VgSt62XoASqNRuPECpCwJQP/view?usp=drive_link
+https://drive.google.com/file/d/1BpHOl9rKMzdvNGka6js7C0s40hH6vnDA/view?usp=drive_link
+https://drive.google.com/file/d/1PazhkhiDnJ-OUMyDVDFxEZNKQQqHiNWS/view?usp=drive_link
+https://drive.google.com/file/d/1lZ665R6ATl57dypxH4dGJ2NSt6XYnbuz/view?usp=drive_link
+https://drive.google.com/file/d/1V9HzLaf-tlG15wUzT7KrTDCS_z1vi5NV/view?usp=drive_link
+https://drive.google.com/file/d/1aKauWiXoKqbNwn_2xs4MrmLlaNYlVNmO/view?usp=drive_link
+https://drive.google.com/file/d/1WVD5DFhriO1YmmOgiVHhacR6HWoTPxav/view?usp=drive_link
+https://drive.google.com/file/d/1_X43WgeBAsfkhH9EmpyPki8U9joMeAGC/view?usp=drive_link
+https://drive.google.com/file/d/1t8x0GqWoNKWtnBsB7_D40Z34nL9ak4kf/view?usp=drive_link
+https://drive.google.com/file/d/15V_f26WaKOXjKnq2T3HRWAmtQUi4lbu2/view?usp=drive_link
+https://drive.google.com/file/d/11VFIAsiSDsMOBANgrOcZBpKB9AFWnLy7/view?usp=drive_link
+https://drive.google.com/file/d/1M0NS7vVaxJv3FHnuRYtdwTFYF7We4LxP/view?usp=drive_link
+https://drive.google.com/file/d/1mR0OItTNqFnVLoczcyKYlm6drAy778lO/view?usp=drive_link
+https://drive.google.com/file/d/1NbVFWDQAh-z4JJ4D-Zw6Lps9kdvpqh2j/view?usp=drive_link
+https://drive.google.com/file/d/1JQoZGBzl4W3QG26-n39tefcGN0fDRMbB/view?usp=drive_link
+https://drive.google.com/file/d/1VBjHl-TvZpncopvasIP5G9gecbB2a5f6/view?usp=drive_link
+https://drive.google.com/file/d/1VzSf6zaB21nahm7MsPwroXbJ84NIwq0b/view?usp=drive_link
+https://drive.google.com/file/d/1OtNnfMEydNtZOcivs4k6E_uJSpf8PkGy/view?usp=drive_link
+https://drive.google.com/file/d/14nVvpvsrFr_03Pa_N7MKzwnRwibOUYM6/view?usp=drive_link
+https://drive.google.com/file/d/1M8li6duiO2r3lv_9HhF_XJn0oZUIEK5F/view?usp=drive_link
+https://drive.google.com/file/d/1Cpzea6fO14lxAaNfSBifqoa4ekhCiLD1/view?usp=drive_link
+https://drive.google.com/file/d/1mbxRTm5vlbsY9UJ0jfjM6j9D7kPJjBpG/view?usp=drive_link
+https://drive.google.com/file/d/1RXD1i6IfWsHRlCxVmG04h2h5Ycm_WwZN/view?usp=drive_link
+https://drive.google.com/file/d/1QFqFSwDGOk1BkgGmqgCcc2BRWnJ6R3MA/view?usp=drive_link
+https://drive.google.com/file/d/1bFqWR8DQM0ZUxxtS2bl-RANQvukeFLzp/view?usp=drive_link
+https://drive.google.com/file/d/1pR-rH3yNGoyPdD4hJ6-3lXQ-PstBx9du/view?usp=drive_link
+https://drive.google.com/file/d/107OAwLY-hva9HeQLIK7VCh-ytdDabVjr/view?usp=drive_link
+https://drive.google.com/file/d/1Tpl08QOaSZ37GTO4awFWSdD8wBR9xdlT/view?usp=drive_link
+https://drive.google.com/file/d/1MR164AOM-0S1T6RX8xKTV2IHyaCvpqAW/view?usp=drive_link
+https://drive.google.com/file/d/1_wknJfVnStIhJ82lU_QtcrwahsqYIsr8/view?usp=drive_link
+https://drive.google.com/file/d/1ZuEktWrbYkTx0l5pj3WiZ2CJrfbDOHNo/view?usp=drive_link
+https://drive.google.com/file/d/15G_10hkkkq6yxvyI5NGZirlF-RzduR2F/view?usp=drive_link
+https://drive.google.com/file/d/1DBKxg3ONqh7dhLuX6oh1Yyo2x383V1Hp/view?usp=drive_link
+https://drive.google.com/file/d/1B5iDBkTUr5vopDddV_fHud18SqAHhauS/view?usp=drive_link
+https://drive.google.com/file/d/1acwFV0eenRkki1QcjSKH5xqOtys-P3Pr/view?usp=drive_link
+https://drive.google.com/file/d/1S47BI83xyrh-FKXsvAQqer98Biu_p8XK/view?usp=drive_link
+https://drive.google.com/file/d/1JL6DmBZl3uyq9dyLfgSqtGF06e7E9JwM/view?usp=drive_link
+https://drive.google.com/file/d/16WvRS4Kjog8Pxgr0E3sGGnI01YwL9Uql/view?usp=drive_link
+https://drive.google.com/file/d/12ttGqL33IPWg0-s1SD44rr22M6LiSQBr/view?usp=drive_link
+https://drive.google.com/file/d/1OyZqqnldTU_DliRbr6x0C4a_iWPwIN7j/view?usp=drive_link
+https://drive.google.com/file/d/1oYk00IpLnR9fesLfD15Ebe7nVBffEbcS/view?usp=drive_link
+https://drive.google.com/file/d/1eyE2-MQduCEqCd-5_kl5zsoOEERAzpZD/view?usp=drive_link
+https://drive.google.com/file/d/1ir1Ya-vO0d97pfvbePlUeuKTTRc0qIMU/view?usp=drive_link
+https://drive.google.com/file/d/1hOi-JnqlMt47gVnLZHMTqeojyYVErohl/view?usp=drive_link
+https://drive.google.com/file/d/1NFFw5_PqigQ7xGqsL-MNq2B1r5yAscCf/view?usp=drive_link
+https://drive.google.com/file/d/1uftq1-Zlh8d2sNLWrlVcKYQUwZTD7o24/view?usp=drive_link
+https://drive.google.com/file/d/1-ax19dSLPacVgk000T-m3l4flPcg07pM/view?usp=drive_link
+https://drive.google.com/file/d/126y-lgn86-ZmCz8hooF1THKJGGObw3OB/view?usp=drive_link
+https://drive.google.com/file/d/1JiDniK0VmDIkk92AbBILb8J2Ba59PWML/view?usp=drive_link
+https://drive.google.com/file/d/1kr8nPIRljiU0R4J9SMgj80o1FPQxzu9z/view?usp=drive_link
+https://drive.google.com/file/d/1bbThWRij1pKBh_kFgV8FwK0sXtTHBoLX/view?usp=drive_link
+https://drive.google.com/file/d/1WenzDW6lxk1xkOFm-OiGFfc0ROskAuKU/view?usp=drive_link
+https://drive.google.com/file/d/1MiKRzuzUn1yN-k_6kPJJzIGy7dT-nnsD/view?usp=drive_link
+https://drive.google.com/file/d/17rRg2tcmB-gNhQ0KoZJQmNfyFeoij1jH/view?usp=drive_link
+https://drive.google.com/file/d/11mokBpvrY3ld6sY5WztREtJ1jgqfQV70/view?usp=drive_link
+https://drive.google.com/file/d/1Il_6IOx9NDp1bX_KHizJfBwzTufTmn86/view?usp=drive_link
+https://drive.google.com/file/d/1KswtJGsxJ7eeBDAmNA_aeLjOxcH6MIxa/view?usp=drive_link
+https://drive.google.com/file/d/1gzMhi5uWu4C3Y6WbQ3L-08V96GxTZrRR/view?usp=drive_link
+https://drive.google.com/file/d/1nRQFtaBxfUCYc2W90Qibh0kHCt6YQCfc/view?usp=drive_link
+https://drive.google.com/file/d/1vs-gyW-KheqHbUATwAhA2mmR9GOGw7f_/view?usp=drive_link
+https://drive.google.com/file/d/1MuxzGOA2fgLaHryq82KkQumtuRJGcUOC/view?usp=drive_link
+https://drive.google.com/file/d/1IIwxZnGlqrXLUXqG6yMO0r7uhCvhpk9e/view?usp=drive_link
+https://drive.google.com/file/d/1vE7XPyaFcXP4DtTY5Y9WKIt7zWgmX-Cr/view?usp=drive_link
+https://drive.google.com/file/d/1j-bIV09gr21RC3-x1N_pK4RPLV3fmWKz/view?usp=drive_link
+https://drive.google.com/file/d/1t3nW1rD3S-EL0Oymb5U7ZAj5UMkydkln/view?usp=drive_link
+https://drive.google.com/file/d/14hbfHCdMKtJZ41F9CQReMec2jeRFTOqR/view?usp=drive_link
+https://drive.google.com/file/d/1x-hUyOSne5BW0AzQ3W6_Pf4g5yXQWi9M/view?usp=drive_link
+https://drive.google.com/file/d/1sw9JqRg6E-3P84I3ZhzTrJMu0vuiaMmP/view?usp=drive_link
+https://drive.google.com/file/d/1LuqhQlL4MGZhB_6THmkovRxrlP26BbdC/view?usp=drive_link
+https://drive.google.com/file/d/15C5K6v_lkjnMSmUvVyqHQKwh2N166e7K/view?usp=drive_link
+https://drive.google.com/file/d/1ns_9eSsQeeoZ10nlbkLy8tu0GmJFSnkt/view?usp=drive_link
+https://drive.google.com/file/d/1NpzWJeK6CqjxzjIMYe6aYdX8xGsQwD4o/view?usp=drive_link
+https://drive.google.com/file/d/1NMLezwufKJ9_8xTc9KQThSzVVD71B9Ui/view?usp=drive_link
+https://drive.google.com/file/d/1aa71DCUqs6oXlIxX35jgsmsgm-NlDxPV/view?usp=drive_link
+https://drive.google.com/file/d/1UJzkIZzAL0j-D5YQBnoq7mHvttASy12O/view?usp=drive_link
+https://drive.google.com/file/d/1nPgx36HIJFb7oI94VbRzWjpPP2GANxzG/view?usp=drive_link
+https://drive.google.com/file/d/1NovAP-KVJjqcuvWy3d6G4ptGGAIDqcCx/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_chair.txt

@@ -0,0 +1,55 @@
+https://drive.google.com/file/d/11M3Ye0r5agMaaicPbVGD0q2Hb3rGklbb/view?usp=drive_link
+https://drive.google.com/file/d/1-tx7SvYYgSvXCvnf_EI2OVdwK-CkFY6S/view?usp=drive_link
+https://drive.google.com/file/d/1EWJunmOpMHaU1hE106wwpbkGYcjQXYAF/view?usp=drive_link
+https://drive.google.com/file/d/1IDn95Z7FSiCckrSENtGV4u3RyFHNQSDY/view?usp=drive_link
+https://drive.google.com/file/d/1CwzvWj1i7QOtqrZvsCZ6BdZaKNDfpN32/view?usp=drive_link
+https://drive.google.com/file/d/1HvAvlhm77nAD3Td24QPSeq8lw-Rl_aOh/view?usp=drive_link
+https://drive.google.com/file/d/1t-suKYOPhXH666RpAYNRp2QU_DOy3AeM/view?usp=drive_link
+https://drive.google.com/file/d/18xpKgWh7RWyjMN5PkLTOo-AxsAadAuRw/view?usp=drive_link
+https://drive.google.com/file/d/1oci5Eto-ztv-AQNz8EnwZveBIhxvk-xJ/view?usp=drive_link
+https://drive.google.com/file/d/1Y-t_4vxdE6NpHO0DLJR8f3mD0Q-Wj5-c/view?usp=drive_link
+https://drive.google.com/file/d/1lylRqbbbB8bgtpsBWMPACmHJreuKmllv/view?usp=drive_link
+https://drive.google.com/file/d/1yliSyMig_NXShWfQx6qyW7Ijf2Y5lFK6/view?usp=drive_link
+https://drive.google.com/file/d/1XXhwJsJbeb7KXAooGvJapnm9bjnGUmxS/view?usp=drive_link
+https://drive.google.com/file/d/1_xs1f3hW2JArKyvfF7UWubWjyROGTLs6/view?usp=drive_link
+https://drive.google.com/file/d/1WVEHpr6EqKCZbkHapQSTXJq4xE4SWFT-/view?usp=drive_link
+https://drive.google.com/file/d/1RqOHv9pEQGvW8NUA7ynffFmG999TL_Az/view?usp=drive_link
+https://drive.google.com/file/d/1cu5AgD2gh-uA3PFJmzxxzNaF3qOSlYY1/view?usp=drive_link
+https://drive.google.com/file/d/1SsrXqiPclNrnYToPZ9Uq-k3y0C4qdHT1/view?usp=drive_link
+https://drive.google.com/file/d/1-J7EXf0vjkLIfSqT8ICEsP6CTjzSLBop/view?usp=drive_link
+https://drive.google.com/file/d/11O7ewUmoZXfyyKjy_6B5RW4DpjICxqBT/view?usp=drive_link
+https://drive.google.com/file/d/1iic44kZoCsjNsfAz2cMstZ9-WQvAhblF/view?usp=drive_link
+https://drive.google.com/file/d/1yLV1lVX-2WnWQldGlnQZ0x7QBuDiVkL3/view?usp=drive_link
+https://drive.google.com/file/d/1Tybp9ru98TTbGn4eyROpUQwDFuALWXmk/view?usp=drive_link
+https://drive.google.com/file/d/13E9OTMiipVJByDs5-J19oWwAz7l94LTN/view?usp=drive_link
+https://drive.google.com/file/d/1EeTpJQdMSliw4JzSMtJ6CyTvVdexjM4M/view?usp=drive_link
+https://drive.google.com/file/d/1NHyNwoFqzeAu-1_PSpq5JfxaiD_xbpn9/view?usp=drive_link
+https://drive.google.com/file/d/1fJcS0phDp4xm_FyGaJ5wr9Pe4KqtHaxD/view?usp=drive_link
+https://drive.google.com/file/d/12AqrLUaewDPEcFRqPZeZFb_TQ0Lfi3At/view?usp=drive_link
+https://drive.google.com/file/d/1x_hd4Qsq1oJS-aj2t3qM7WbbV7KZj05b/view?usp=drive_link
+https://drive.google.com/file/d/14OUSUArmsB068hs6BuEIXQhI1Cyz8Sf0/view?usp=drive_link
+https://drive.google.com/file/d/16zlzh1T5zeUJQnFf382NXkFEKEnDub4O/view?usp=drive_link
+https://drive.google.com/file/d/1IbDltmN-NEFCNtr1TO4ILxEgQ94rtjWv/view?usp=drive_link
+https://drive.google.com/file/d/15gmlf8Gx9455pZ1AlqcCSwh3nDPxMzSr/view?usp=drive_link
+https://drive.google.com/file/d/1qHpRL1oZfIMo_vxnm8qfwQ-7l0BZIVva/view?usp=drive_link
+https://drive.google.com/file/d/1H1xskIgiFZivkYn23rMzH3xePGOh3VTC/view?usp=drive_link
+https://drive.google.com/file/d/1avls6Pv0kYiCMNVknbc1zQsgy64MUDMM/view?usp=drive_link
+https://drive.google.com/file/d/1MmWVgCj5khc8KMIifmt3EzF1o-CtPyyn/view?usp=drive_link
+https://drive.google.com/file/d/1U0kCc_xqW0WNppf4sbnK14euWKdPZtzB/view?usp=drive_link
+https://drive.google.com/file/d/16CaEyQscOuhLj23PEGDTL9DeyNkohkMn/view?usp=drive_link
+https://drive.google.com/file/d/1Iu8uM6UUJ0zW8tvN-9UiOe_4oSNzEutg/view?usp=drive_link
+https://drive.google.com/file/d/1UImqiBaIxCR-1DNJaZhHqeHhaySOtVIr/view?usp=drive_link
+https://drive.google.com/file/d/1VpU2V_leIoRIyv_lAvE7eLHBG8DxCTnp/view?usp=drive_link
+https://drive.google.com/file/d/1_Q8J27OT3Xby7QY6yHvIJauFRWEMxkRm/view?usp=drive_link
+https://drive.google.com/file/d/1bantmVo1L9Xz4tbiNw_a1UC2Z_HPO1wT/view?usp=drive_link
+https://drive.google.com/file/d/1IRIXMJMCBDkBjbaHvAlEiBogSvZ1jK_3/view?usp=drive_link
+https://drive.google.com/file/d/1mAHXKjiFbjwydypW2t5Lv8_H5x6nHegl/view?usp=drive_link
+https://drive.google.com/file/d/1SfyY796fLrBCMY39OcyuxZafqSCRZPZk/view?usp=drive_link
+https://drive.google.com/file/d/1X-44sZ8CcfzIskc0dvSx882o1yFhHaZB/view?usp=drive_link
+https://drive.google.com/file/d/1BOIWCCCk6DLD4Bmvc75ZbbLi9AQm-1ao/view?usp=drive_link
+https://drive.google.com/file/d/1RuyDtRE1kk76sw-wP8vx5SgLoPF3PA_H/view?usp=drive_link
+https://drive.google.com/file/d/1c4eoQiBbGuy3CTAQDUSkd84Ponh1roAQ/view?usp=drive_link
+https://drive.google.com/file/d/19PXB9z4Ljq6dsbf9TqcOrrP5SRbw2Tc_/view?usp=drive_link
+https://drive.google.com/file/d/1nn1VVZVoIXWdYDozR7XHXE4mPLQG80PQ/view?usp=drive_link
+https://drive.google.com/file/d/1MBdFGOKPV8GUhwoSsJ_Ky3qAMLM2Bv3K/view?usp=drive_link
+https://drive.google.com/file/d/1of3k_M-7Nh3I1TndcWedxK4ca9dn8Sc5/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_elevator.txt

@@ -0,0 +1,20 @@
+https://drive.google.com/file/d/12ctkOAdkCNGN1JLbZb5ww3XTBn2LFpGI/view?usp=drive_link
+https://drive.google.com/file/d/1G_Vd46_4fq6O64gHHjUbJX5Ld44ZZx0y/view?usp=drive_link
+https://drive.google.com/file/d/1uKgUy73B3xBogQAOUhfZjO0X5qZGsi2c/view?usp=drive_link
+https://drive.google.com/file/d/1fu9cIrfI-fE2LhdGUxbx7-8Ci_PF8Ypm/view?usp=drive_link
+https://drive.google.com/file/d/1Ygk9ZPJzx8xw2A9JF3NHbJ44TqnvSTQR/view?usp=drive_link
+https://drive.google.com/file/d/18m5xPuccNsEB20WPshm3zhxmXc6k63ED/view?usp=drive_link
+https://drive.google.com/file/d/1DiqqxC44rriviRQpqogcv0-EB-Y6nr9g/view?usp=drive_link
+https://drive.google.com/file/d/1qPdaoTVDizJXkfXLioWU7iJ8hqCXSyOQ/view?usp=drive_link
+https://drive.google.com/file/d/1Fj9kIA_mG7f67WFfACJEaZ7izcHG7vUm/view?usp=drive_link
+https://drive.google.com/file/d/1WpYehZnI2P7dUdJPfkE-ij1rqCnjZEbB/view?usp=drive_link
+https://drive.google.com/file/d/1_zwWkT4jPyzB38STWb6whlzsPzXmfA9r/view?usp=drive_link
+https://drive.google.com/file/d/1U6-J4I_fPlSFFGfhZPxS5_YzKXwXIZYp/view?usp=drive_link
+https://drive.google.com/file/d/1pRhxxcTfZp5tQo_EScvJUwfc3amiS6Vk/view?usp=drive_link
+https://drive.google.com/file/d/1lWLntqra83RlYU_gN7Vostnfydf6gutd/view?usp=drive_link
+https://drive.google.com/file/d/1vIBKo0x-NYEHV1FvRpco1lQMpRdAWAIL/view?usp=drive_link
+https://drive.google.com/file/d/1pdrLV3JTQou_XH0Aap61Ssf60iVKm1jJ/view?usp=drive_link
+https://drive.google.com/file/d/1QTsLoQ7SwmKdQHjBGVDaR2uTwfFwtrOf/view?usp=drive_link
+https://drive.google.com/file/d/1Gytai8M_12J36GY6L_TulEcOC-035jwS/view?usp=drive_link
+https://drive.google.com/file/d/14LJudNc629NT-i8xreXtzl27ce_DxOFJ/view?usp=drive_link
+https://drive.google.com/file/d/1sBvPCODbzxGAI0S3lgN5cSG9Go3lRi00/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_shrimp.txt

@@ -0,0 +1,18 @@
+https://drive.google.com/file/d/1MJn9GbC8p9lN4gC9KDMLEkTkP_gGpXj0/view?usp=drive_link
+https://drive.google.com/file/d/1-4LXgjl7ZCOgp-8GCJmFRD8OeqN5Jf7-/view?usp=drive_link
+https://drive.google.com/file/d/1Ho06Ce0SPbqU3juaMxNUwAt3zCRLGC8W/view?usp=drive_link
+https://drive.google.com/file/d/1ivHoj7_7olBSxH-Y8kqXEW7ttITK-45j/view?usp=drive_link
+https://drive.google.com/file/d/1qjY4hM_IvZ8cq2II_n9MeJbvyeuN4oBP/view?usp=drive_link
+https://drive.google.com/file/d/1rKVhO_f92-7sw13T8hTVrza3B9oAVgoy/view?usp=drive_link
+https://drive.google.com/file/d/1pcLPHO8fBkc1-CRa88tyQtEueE4xiXNi/view?usp=drive_link
+https://drive.google.com/file/d/1Vev_chCsIeEdvQ8poEYNsOJFGy_QU8kZ/view?usp=drive_link
+https://drive.google.com/file/d/1l5G4zpRkxSLCQjvGPYSN4zfCvVRQuzMz/view?usp=drive_link
+https://drive.google.com/file/d/14vgthE1eoakXkr2-DRw50E6lAqYOiUuE/view?usp=drive_link
+https://drive.google.com/file/d/17nPSmKKmgQ2B7zkzWrZYiLM3RBuFod82/view?usp=drive_link
+https://drive.google.com/file/d/1QcDsxplVvb_ID9BVrihl5FvlC-j7waXi/view?usp=drive_link
+https://drive.google.com/file/d/18pEejBpI-eEVaWAAjBCyC0vgbX3T1Esj/view?usp=drive_link
+https://drive.google.com/file/d/1H8eH6_IRODtEFT6WoM77ltR5OoOrqXmI/view?usp=drive_link
+https://drive.google.com/file/d/1IWlpFRZhoxyG4nS13CWK4leZVk5wbNx4/view?usp=drive_link
+https://drive.google.com/file/d/1PbZA8_OCGmMLxNP9xbkLRSChniL4uGxl/view?usp=drive_link
+https://drive.google.com/file/d/1p9XAdmG2f_WeflNO4DIJ_tr1rK6M9B4B/view?usp=drive_link
+https://drive.google.com/file/d/1nS59Et1cNAvKo3Y4SeSGRuZD5TvBbCF3/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_wash_pan.txt

@@ -0,0 +1 @@
+https://drive.google.com/drive/folders/1S8eFg98IaGAIKVZ8QFWG1bx4mHa-O204

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_wipe_wine.txt

@@ -0,0 +1,4 @@
+https://drive.google.com/drive/folders/1tC_g1AJ8lglBLY-fjsQrG6DMBa3Ucp-0
+https://drive.google.com/file/d/1fG_Yi2MJrFjiUVN3XoiWXLtTxHlwwaDv/view?usp=drive_link
+https://drive.google.com/file/d/1WX32VWfzzX3Blmd06DRxLwFbMJfVe7P4/view?usp=drive_link
+https://drive.google.com/file/d/18onsX3vXg3xkFwP5bVUCjdV4n9TRn0C9/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/sim_insertion_human.txt

@@ -0,0 +1,3 @@
+https://drive.google.com/drive/folders/1RgyD0JgTX30H4IM5XZn8I3zSV_mr8pyF
+https://drive.google.com/file/d/18Cudl6nikDtgRolea7je8iF_gGKzynOP/view?usp=drive_link
+https://drive.google.com/file/d/1C1kZYyROzs-PrLc0SkDgUgMi4-L3lauE/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/sim_insertion_scripted.txt

@@ -0,0 +1,3 @@
+https://drive.google.com/drive/folders/1TsojQQSXtHEoGnqgJ3gmpPQR2DPLtS2N
+https://drive.google.com/file/d/1wfMSZ24oOh5KR_0aaP3Cnu_c4ZCveduB/view?usp=drive_link
+https://drive.google.com/file/d/17EuCUWS6uCCr6yyNzpXdcdE-_TTNCKtf/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/sim_transfer_cube_human.txt

@@ -0,0 +1,3 @@
+https://drive.google.com/drive/folders/1sc-E4QYW7A0o23m1u2VWNGVq5smAsfCo
+https://drive.google.com/file/d/18smMymtr8tIxaNUQ61gW6dG50pt3MvGq/view?usp=drive_link
+https://drive.google.com/file/d/1Nk7l53d9sJoGDBKAOnNrExX5nLacATc6/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/sim_transfer_cube_scripted.txt

@@ -0,0 +1,3 @@
+https://drive.google.com/drive/folders/1aRyoOhQwxhyt1J8XgEig4s6kzaw__LXj
+https://drive.google.com/file/d/1pnGIOd-E4-rhz2P3VxpknMKRZCoKt6eI/view?usp=drive_link
+https://drive.google.com/file/d/1GKReZHrXU73NMiC5zKCq_UtqPVtYq8eo/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_battery.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/19qS_n7vKgDcPeTMnvDHQ5-n73xEbJz5D
+https://drive.google.com/file/d/1oC31By0A2bsBeHyUwBdQw1z4ng6yi9Za/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_candy.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1m5rQ6UVH8Q9RQp_6c0CxkQ88-L-ScO7q
+https://drive.google.com/file/d/1wHz2qcmwcVG0C0CZ9MjQDQcmj4OY9_a3/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_coffee.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1seQGay470nGQ-knBI5TjsTr8iL9Qws5q
+https://drive.google.com/file/d/1T89hSX5U99wLGvGTE7yUBaQPOpyj6Sai/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_coffee_new.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1t3eDc5Rg0DveyRe8oTm6Dia_FYU5mXyf
+https://drive.google.com/file/d/1TXFaduTakvS0ZWJqKCX-HIvYglum_5CY/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_cups_open.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1Z9X3DNzd6LS0FFjQemNUMoMA5yk5VQOh
+https://drive.google.com/file/d/1Wlyc0vTkjXuWB6zbaVOWhEfD7BmPgUV_/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_fork_pick_up.txt

@@ -0,0 +1,53 @@
+https://drive.google.com/drive/folders/1DYgB4ifX4uIid9m9jnC0Zdz8Nf7ZC0fc
+https://drive.google.com/file/d/1Eb-NRNk_FmVleCbU_Ng5Y4dfcjTKN7Rv/view?usp=drive_link
+https://drive.google.com/file/d/1dkhjEADakT-44l9jf-nK4x89kr4yG_qb/view?usp=drive_link
+https://drive.google.com/file/d/14hDhgcZkVqNExGb4tIXpSjMshhqZETch/view?usp=drive_link
+https://drive.google.com/file/d/1zVMEHpHbuNyP5A_lYU7RPSLB-4V0yfZw/view?usp=drive_link
+https://drive.google.com/file/d/1JtgDjBvy7FnRpFzrx_foC3quorYQFAR-/view?usp=drive_link
+https://drive.google.com/file/d/1EHdneB6F-PP0dQlX8qPaXbxmKoBy_YwO/view?usp=drive_link
+https://drive.google.com/file/d/17Z0jjVBy1OPKREPu77_n_rQzorDiapji/view?usp=drive_link
+https://drive.google.com/file/d/1F4i23qPJ_qTf5jWjfLo4ARGJChznYWt3/view?usp=drive_link
+https://drive.google.com/file/d/1kZtXWM3uS0-rLblydBfJ0mMcVnMMXw9w/view?usp=drive_link
+https://drive.google.com/file/d/1mNODox87xFfY5Z_o5mcLsr8SHb39jDik/view?usp=drive_link
+https://drive.google.com/file/d/1Ob44VdmEUA93FKDECiRb5Ogz2xQg5IWp/view?usp=drive_link
+https://drive.google.com/file/d/1fdQLdjj3Cwv33R1wZhfrLz9Del8mqgHb/view?usp=drive_link
+https://drive.google.com/file/d/1Yu3L3ft21zP__XL8pCfhb788ZleuW1n5/view?usp=drive_link
+https://drive.google.com/file/d/1ozBBWXVZ9hXDh9ooHUNroHdYm8UDqnhJ/view?usp=drive_link
+https://drive.google.com/file/d/1o0TGqvfWw_Lunxb5ubKDS21Lr_WC0h75/view?usp=drive_link
+https://drive.google.com/file/d/1jZnd5eP5L6BH5l98BPN6OnoQx3fu8e9n/view?usp=drive_link
+https://drive.google.com/file/d/1S5sYbz8wcLYp0V67v13i4PRcBxodn4Hg/view?usp=drive_link
+https://drive.google.com/file/d/1rFeg_x6ftJYwPtBv34D3h2L2cpDLeR4G/view?usp=drive_link
+https://drive.google.com/file/d/1GvS3lcm4o6nm_scUk0XxKeVFNmzjucDZ/view?usp=drive_link
+https://drive.google.com/file/d/1-9i0riphC7NhhDahcQfD1QoBXP5gF90A/view?usp=drive_link
+https://drive.google.com/file/d/15p_IqGsMbKuvzMS872THAZr-3SBtb1Fr/view?usp=drive_link
+https://drive.google.com/file/d/1ToyYcBfJL8gbQn0q_59zPLsFmm7dmMJo/view?usp=drive_link
+https://drive.google.com/file/d/1e_7PNH7CYafE4pAebP7ZdI7XFbmEcy_i/view?usp=drive_link
+https://drive.google.com/file/d/1JoabvGVsIQdug2xOhUIhetEIyDM91y_Y/view?usp=drive_link
+https://drive.google.com/file/d/1kOMw1y0lmnVaCjwZICfzCsx6e0Z8MNGR/view?usp=drive_link
+https://drive.google.com/file/d/16it_wd1JOevUQTK2_CvF_pBACTgpIPgM/view?usp=drive_link
+https://drive.google.com/file/d/1IRcCj9HnJSfbyMgr5XEERGlEnWeZQwOc/view?usp=drive_link
+https://drive.google.com/file/d/1Z2dIJfq_S3liGmPN9Rphvkmucnmw7tlb/view?usp=drive_link
+https://drive.google.com/file/d/1J3NoAjzndGx9yNyaBOJHdNny1epzUoBt/view?usp=drive_link
+https://drive.google.com/file/d/18nOvxV1k8FSmBrhT4TPo2sKKSZXougyx/view?usp=drive_link
+https://drive.google.com/file/d/1CT8FxclafFMjSd7gCWVw3VSeryeiF04i/view?usp=drive_link
+https://drive.google.com/file/d/16M9KVqQMFfSsXfypK0bocFft8Nz3j2Rt/view?usp=drive_link
+https://drive.google.com/file/d/18QPVkw6bj6HW8LTPrQLWrrUX4R6RcF42/view?usp=drive_link
+https://drive.google.com/file/d/1hQTVtA5hBTE_StXpJafTZJ3tgt2VQQ_t/view?usp=drive_link
+https://drive.google.com/file/d/1Dn-d5g69H6EgAWgsFdrcbJKtz7ySsCQ8/view?usp=drive_link
+https://drive.google.com/file/d/13hMr16483P7ALYv73yMRUN37fJdVQM62/view?usp=drive_link
+https://drive.google.com/file/d/1848yN3XMN5zJMEgApt6KzrWgfRPfimtv/view?usp=drive_link
+https://drive.google.com/file/d/1oAD9kSnS0fTgj-CjD4u9VdZ5X67IOIMa/view?usp=drive_link
+https://drive.google.com/file/d/1ilzIWLCCG5b_KgF5s0wdN2I5-lFNpwC1/view?usp=drive_link
+https://drive.google.com/file/d/1rjsT2YBjnidxod1s9s-myAYz8boHr-WB/view?usp=drive_link
+https://drive.google.com/file/d/18Gg48HTub15bd8qzbhiCUufbVy0fbN5G/view?usp=drive_link
+https://drive.google.com/file/d/1WsSnQSqmMTVSRwrhT1Y-v782My2zcjLm/view?usp=drive_link
+https://drive.google.com/file/d/1ea9ZCvoyc-xqiFXgeDcA_mOWsw7VUuoi/view?usp=drive_link
+https://drive.google.com/file/d/1wv1v3-XhPgbNzp62BXbJTDzMPu2tlDUc/view?usp=drive_link
+https://drive.google.com/file/d/18-ikzt8LoZ83Gi3goKCELs4U4z8hrRoF/view?usp=drive_link
+https://drive.google.com/file/d/16Bjhp7JNCXkGuLvyNcZowAx3W-Y-15DV/view?usp=drive_link
+https://drive.google.com/file/d/1Gc-KRI-xwcp1fMR55ugbrLg_5y3SPde-/view?usp=drive_link
+https://drive.google.com/file/d/1oP72Q386Z4Sy5MMm-t5yNogIe5Van_9k/view?usp=drive_link
+https://drive.google.com/file/d/112T90eDUDVH-SyOV7UnZl5bscAH2hcfq/view?usp=drive_link
+https://drive.google.com/file/d/1y-uKOesRRhjgDtFbG_j65f4SGg0v8XDg/view?usp=drive_link
+https://drive.google.com/file/d/1LOP05OagoI3km-ZKQBrS204A85UVk7Ok/view?usp=drive_link
+https://drive.google.com/file/d/1QkHQKgasVzWsmdPvkXgGhWyQ84d93_Az/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_pingpong_test.txt

@@ -0,0 +1 @@
+https://drive.google.com/drive/folders/1Ut2cv6o6Pkfgg46DgwVUM7Z5PkNG8eJ-

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_pro_pencil.txt

@@ -0,0 +1 @@
+https://drive.google.com/drive/folders/1FqxPV0PgvgIu8XFjtvZSPSExuNcxVVAY

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_screw_driver.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1SKtG0ct9q0nVdYssJNMWSOjikcXliT58
+https://drive.google.com/file/d/1nchD21O30B3i3LDoqramo1zgW5YvpJIN/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_tape.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1_4DHf2cma0xsChLQFghwigX6Ukti5-zQ
+https://drive.google.com/file/d/1_8vS4hDNDgUQY-SmekrNaa7dF67QJYU-/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_thread_velcro.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1_4DHf2cma0xsChLQFghwigX6Ukti5-zQ
+https://drive.google.com/file/d/1_8vS4hDNDgUQY-SmekrNaa7dF67QJYU-/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_towel.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1fAD7vkyTGTFB_nGXIKofCU1U05oE3MFv
+https://drive.google.com/file/d/1XzyQ2B6LLvcurIonOpEu4nij2qwNWshH/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_vinh_cup.txt

@@ -0,0 +1,53 @@
+https://drive.google.com/drive/folders/13EQsVsnxT86K20QAoyE_YpsFbQ7fZQdu
+https://drive.google.com/file/d/1-W_JHghZG65FNTVhw1SXhtQrazdLL3Ue/view?usp=drive_link
+https://drive.google.com/file/d/1VwRJgdWUo-2nQaNM7Bs77-fsm8iwUxEo/view?usp=drive_link
+https://drive.google.com/file/d/1wFzGRo5iYA13WLi6IV1ry64RyahQBFio/view?usp=drive_link
+https://drive.google.com/file/d/1IKtQzQ-n-UTv64hYpReu2R4cqUvmNQqD/view?usp=drive_link
+https://drive.google.com/file/d/1GicVci9OiuuZZH79i5Mg7AtWod94MzwT/view?usp=drive_link
+https://drive.google.com/file/d/1JVnIoR7EIQp70T4eAf9RX65JcTrzsjQc/view?usp=drive_link
+https://drive.google.com/file/d/1W2xr4h23ucjPrc-mBEeqnACsfaImpc0p/view?usp=drive_link
+https://drive.google.com/file/d/10xj_0V7A07o3uCa7v5omUrTC0YlPW8H3/view?usp=drive_link
+https://drive.google.com/file/d/1FOc3EMaCy8Mb0_a7PuXLAwKwvxkbKmwU/view?usp=drive_link
+https://drive.google.com/file/d/143PgDXBcf2GQ0Q07ZPMVMfBgZDd5sLJG/view?usp=drive_link
+https://drive.google.com/file/d/1pE5Tyj0LlGbGWvUzuhixp86Ibu55Ez3I/view?usp=drive_link
+https://drive.google.com/file/d/141668b1VzX80ncrVJPzhkoAeIFB4MEK9/view?usp=drive_link
+https://drive.google.com/file/d/1bw12lo37p1ZvRvErHsll7cEYi2OxscvZ/view?usp=drive_link
+https://drive.google.com/file/d/1zfnMFvbgBjl6SzYhksbaOzfbwLrCN6tb/view?usp=drive_link
+https://drive.google.com/file/d/1-GIszA6mUJMaNB-tdh9r9skc77SWA0VX/view?usp=drive_link
+https://drive.google.com/file/d/1fTB0zWFYU6zh4IIUFT2zX_OkwYqmElwY/view?usp=drive_link
+https://drive.google.com/file/d/1gPIPNKGmrO9c7gKF7SP0SuUYbIBBq8z1/view?usp=drive_link
+https://drive.google.com/file/d/12JeJ-dQd5lYyn6PlDOGdE-ChVeiZ-Uv0/view?usp=drive_link
+https://drive.google.com/file/d/100_20cgCqerU6qoh3TfTbwLy9mlDAFEG/view?usp=drive_link
+https://drive.google.com/file/d/111oAGJ76ku_pYgbBoIdZAC1_XEQcPI__/view?usp=drive_link
+https://drive.google.com/file/d/1UhC8L-354ZQ2gblPFGI35EMsVwfpuKa0/view?usp=drive_link
+https://drive.google.com/file/d/1sIXQSgUR_xdrNtGrL6QGBnkLMKErsIp1/view?usp=drive_link
+https://drive.google.com/file/d/16Ax77bDSIXnsn4GFL8XYKKT1P6bPpfMd/view?usp=drive_link
+https://drive.google.com/file/d/1pgRVYwwVIsWq_qsWqZpe1UBzZfF5Fa9D/view?usp=drive_link
+https://drive.google.com/file/d/1jtimaZkWsY1P5gC2bbS64H_WCUU7HXN2/view?usp=drive_link
+https://drive.google.com/file/d/1N6Bh02P-RiTEgtx1YH1Db_X3TGpP-X_r/view?usp=drive_link
+https://drive.google.com/file/d/14Fy8EwJ8d9Vh97Yt1VOvUChSCrfIjBij/view?usp=drive_link
+https://drive.google.com/file/d/1IRuv42dvIMPuKhcMZmuXaBjJ-lPFOmQd/view?usp=drive_link
+https://drive.google.com/file/d/16XWzNY2D8ucVVn5geBgsVdhm3ppO4que/view?usp=drive_link
+https://drive.google.com/file/d/1xsVOoQgthK_L_SDrmq_JvQgUpAvPEAY8/view?usp=drive_link
+https://drive.google.com/file/d/1bZbw66DyEMvnJnzkdUUNbKjvNKg8KFYM/view?usp=drive_link
+https://drive.google.com/file/d/1CyTVkdrNGGpouCXr4CfhKbMzE6Ah3oo3/view?usp=drive_link
+https://drive.google.com/file/d/1hDRyeM-XEDpHXpptbT8LvNnlQUR3PWOh/view?usp=drive_link
+https://drive.google.com/file/d/1XhHWxbra8Iy5irQZ83IvxwaJqHq9x4s1/view?usp=drive_link
+https://drive.google.com/file/d/1haZcn6aM1o4JlmP9tJj3x2enrxiPaDSD/view?usp=drive_link
+https://drive.google.com/file/d/1ypDyuUTbljaBZ34f-t7lj3O_0bRmyX2n/view?usp=drive_link
+https://drive.google.com/file/d/1ILEEZo_tA9_ChIAprr2mPaNVKZi5vXsO/view?usp=drive_link
+https://drive.google.com/file/d/1U7nVYFaGE8vVTfLCW33D74xOjDcqfgyJ/view?usp=drive_link
+https://drive.google.com/file/d/1rZ93_rmCov5SMDxPkfM3qthcRELZrQX6/view?usp=drive_link
+https://drive.google.com/file/d/1mYO1b_csddtyE3qT6cwLiw-m2w2_1Lxh/view?usp=drive_link
+https://drive.google.com/file/d/1xz7Q5x2jikY8wJQjMRQpRws6AnfWlHm5/view?usp=drive_link
+https://drive.google.com/file/d/1OO8GaO-0FrSZRd1kxMYwBmubyiLOWnbl/view?usp=drive_link
+https://drive.google.com/file/d/1EXn4NVDmf-4_HCy34mYwT-vwK2CFI9ev/view?usp=drive_link
+https://drive.google.com/file/d/10hH70XhXRL9C5SnAG4toHtfHqfJUJo4H/view?usp=drive_link
+https://drive.google.com/file/d/18tiBcxea0guUai4lwsXQvt0q2LZ8ZnnJ/view?usp=drive_link
+https://drive.google.com/file/d/1Q8R8qv37vk5PQ5kQ2ibx6BFLOySD0VpX/view?usp=drive_link
+https://drive.google.com/file/d/17aNriHzjhdibCyuUjQoMFZqjybJZtggG/view?usp=drive_link
+https://drive.google.com/file/d/1LVjEYHSdeKm6CotU1QguIeNEPaIaFl_1/view?usp=drive_link
+https://drive.google.com/file/d/1ufAhE_EkgJ85slg2EW8aW_grOzE_Lmxd/view?usp=drive_link
+https://drive.google.com/file/d/1wtzLtXrkw9eXRGESTPIOlpl1tInu-b2m/view?usp=drive_link
+https://drive.google.com/file/d/1Mk5qvVtD_QHwGOUApRq76TUw2T5THu6f/view?usp=drive_link
+https://drive.google.com/file/d/1y1WQ3hboWVJ68KEYQQ3OhreGuaUpSgwc/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_vinh_cup_left.txt

@@ -0,0 +1,52 @@
+https://drive.google.com/drive/folders/1dxWh6YFZUDt6qXIoxgD9bla3CiFjZ11C
+https://drive.google.com/file/d/1hNBJN00SCAlOl0ZEgm7RRGbAGDjyBs0p/view?usp=drive_link
+https://drive.google.com/file/d/17He0CVwXGeoMmXg4SHKo-osNn7YPKVL7/view?usp=drive_link
+https://drive.google.com/file/d/1laNKUVID1x2CV6a2O2WQjwFewKu4lidL/view?usp=drive_link
+https://drive.google.com/file/d/1pNf36xbZJGRArYLmNAvRj5y6CoqdC6kB/view?usp=drive_link
+https://drive.google.com/file/d/1_4E1-y3JXk5I0ebycLYM70YDPK9g52gZ/view?usp=drive_link
+https://drive.google.com/file/d/1PHfzhGPdbolKyOpS3FnR2w7Q8zUlJXSk/view?usp=drive_link
+https://drive.google.com/file/d/17ls2PPN-Pi3tEuK059cwV2_iDT8aGhOO/view?usp=drive_link
+https://drive.google.com/file/d/1LWsg6PmCT00Kv_N_slrmcwKmQPGoBT3k/view?usp=drive_link
+https://drive.google.com/file/d/12LckrchoHTUVH7rxi8J7zD9dA19GXvoW/view?usp=drive_link
+https://drive.google.com/file/d/1VqrJKjAIkj5gtFXL69grdSeu9CyaqnSw/view?usp=drive_link
+https://drive.google.com/file/d/1g5rQYDBZvW-kUtYPeyF3qmd53v6k7kXu/view?usp=drive_link
+https://drive.google.com/file/d/10kUgaSJ0TS7teaG83G3Rf_DG4XGrBt6A/view?usp=drive_link
+https://drive.google.com/file/d/1je9XmneZQZvTma5adMJICUPDovW3ppei/view?usp=drive_link
+https://drive.google.com/file/d/1v28r6bedwZGbUPVVTVImXhK-42XdtGfj/view?usp=drive_link
+https://drive.google.com/file/d/1-TEEx9sGVvzMMaNXYfQMtY2JJ6cvl0dT/view?usp=drive_link
+https://drive.google.com/file/d/1YdBKdJFP9rJWBUX7qrOYL_gfUA8o6J9M/view?usp=drive_link
+https://drive.google.com/file/d/1X9vffwQHNUSKLXr2RlYNtbWDIFCIDfdF/view?usp=drive_link
+https://drive.google.com/file/d/11hqesqa5kvEe5FABUnZRcvmOhR373cYM/view?usp=drive_link
+https://drive.google.com/file/d/1ltTTECjEcbQPgS3UPRgMzaE2x9n6H7dC/view?usp=drive_link
+https://drive.google.com/file/d/1Zxqfa29JdwT-bfMpivi6IG2vz34d21dD/view?usp=drive_link
+https://drive.google.com/file/d/11LQlVxS5hz494dYUJ_PNRPx2NHIJbQns/view?usp=drive_link
+https://drive.google.com/file/d/1i1JhNtnZpO_E8rAv8gxBP3ZTZRvcvsZi/view?usp=drive_link
+https://drive.google.com/file/d/11jOXAr2EULUO4Qkm748634lg4UUFho5U/view?usp=drive_link
+https://drive.google.com/file/d/1rj67wur8DdB_Pipwx24bY43xu4X1eQ5e/view?usp=drive_link
+https://drive.google.com/file/d/15ZTm6lO6f_JQy_4SNfrOu3iPYn1Ro8mh/view?usp=drive_link
+https://drive.google.com/file/d/1q4gBtqWPJtCwXEvknGgN0WHGp7Vfn1b9/view?usp=drive_link
+https://drive.google.com/file/d/1t17keyre47AYqm8GgXiQ7EcvcUkeSiDQ/view?usp=drive_link
+https://drive.google.com/file/d/1OYUPGxtZgOF86Ng_BEOTXm_XOYpuQPsO/view?usp=drive_link
+https://drive.google.com/file/d/1cBjbGHi3dwWHtx6r9EQJi0JT_CE3LuHt/view?usp=drive_link
+https://drive.google.com/file/d/14qaMyF0mcbCB-fCYKNyo5_2NahSC6D5u/view?usp=drive_link
+https://drive.google.com/file/d/12FgX86eA7Y5co9ULBVK80XMsiKQSs-Ri/view?usp=drive_link
+https://drive.google.com/file/d/1yvoHWidf-jdBVw6qCCXOFfkVwKj_2hPk/view?usp=drive_link
+https://drive.google.com/file/d/1a2SugsSDlC8UtUrFzp-_KAwyZckQOvdQ/view?usp=drive_link
+https://drive.google.com/file/d/1l8pILBFSAosypWJMza2K09Vm7rug9axm/view?usp=drive_link
+https://drive.google.com/file/d/1hfPQ8dBCk97PnOhq6_MIISm3IEzcOxJG/view?usp=drive_link
+https://drive.google.com/file/d/1PPAUwlJCFKpms8cqF_k1v2_fCgDBOc3S/view?usp=drive_link
+https://drive.google.com/file/d/1lVKQZeqFfK3amEmLuFhYLUFQ2eyE8rOW/view?usp=drive_link
+https://drive.google.com/file/d/1K9iPMLfDowcIFoyzpvgn88dQ6x6kVwNG/view?usp=drive_link
+https://drive.google.com/file/d/1PNvMqG9tL7QxeLaYBGHiWYR6SYb5iIct/view?usp=drive_link
+https://drive.google.com/file/d/1xkRtzbvIkUsylx9hrFLGQsJn0h1EYu-5/view?usp=drive_link
+https://drive.google.com/file/d/1nxMRrJlSayjDIfr5CmHO1NzAw3COhsLi/view?usp=drive_link
+https://drive.google.com/file/d/1Qs3WEyMGrmagiHIkkFEueWNnJhkUeR1s/view?usp=drive_link
+https://drive.google.com/file/d/1D-G2_Q0SS3M8zyJbg_XzkF2ANPw1HTuX/view?usp=drive_link
+https://drive.google.com/file/d/1mdmJsDGO-YtJAOF_yPKl6lq4PJOIbQhT/view?usp=drive_link
+https://drive.google.com/file/d/11m9bwfop_sPmnQr_8amB6EEsrbAeG_z5/view?usp=drive_link
+https://drive.google.com/file/d/19tyYt5FMn5kru0g9o2nMJhKPnsDqkIZv/view?usp=drive_link
+https://drive.google.com/file/d/1XvTpUdsVTZ-vydvdYYmynbma--HfUGSl/view?usp=drive_link
+https://drive.google.com/file/d/1MO3hFu68J6NohTzr9aB_fY02VA6QSOqj/view?usp=drive_link
+https://drive.google.com/file/d/1Lh-UjwAk__04YOTWINF_QGVU8SjetVaY/view?usp=drive_link
+https://drive.google.com/file/d/1jkSOUwZV5GJ7rZlVeErjcu0DBQs8Np0d/view?usp=drive_link
+https://drive.google.com/file/d/1VIN1eLI-93WrVQwCjsv6XQr353DqqBYA/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_ziploc_slide.txt

@@ -0,0 +1,8 @@
+https://drive.google.com/drive/folders/1EgKar7rWBmTIRmeJYZciSwjZx3uP2mHO
+https://drive.google.com/file/d/12eYWQO15atK2hBjXhynPJd9MKAj_42pz/view?usp=drive_link
+https://drive.google.com/file/d/1Ul4oEeICJDjgfYTl4H1uaisTzVYIM6wd/view?usp=drive_link
+https://drive.google.com/file/d/1WSF-OG8lKSe2wVYCv5D1aJNipxpgddk-/view?usp=drive_link
+https://drive.google.com/file/d/1_ppD5j5sFh26aWW0JmhLzJMeNB-lCArk/view?usp=drive_link
+https://drive.google.com/file/d/1WUp846dgWXYhu4oJfhHxiU6YL_7N6s4W/view?usp=drive_link
+https://drive.google.com/file/d/1HRZNAIoAQw_uYiPwnBvtBioQoqiqoXdA/view?usp=drive_link
+https://drive.google.com/file/d/1hedGq-QDMnIn8GlXXBC3GiEJ_Y-LTxyt/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_diffusion_policy_replay_buffer.py

@@ -0,0 +1,634 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Helper code for loading PushT dataset from Diffusion Policy (https://diffusion-policy.cs.columbia.edu/)
+
+Copied from the original Diffusion Policy repository and used in our `download_and_upload_dataset.py` script.
+"""
+
+from __future__ import annotations
+
+import math
+import numbers
+import os
+from functools import cached_property
+
+import numcodecs
+import numpy as np
+import zarr
+
+
+def check_chunks_compatible(chunks: tuple, shape: tuple):
+    assert len(shape) == len(chunks)
+    for c in chunks:
+        assert isinstance(c, numbers.Integral)
+        assert c > 0
+
+
+def rechunk_recompress_array(group, name, chunks=None, chunk_length=None, compressor=None, tmp_key="_temp"):
+    old_arr = group[name]
+    if chunks is None:
+        chunks = (chunk_length,) + old_arr.chunks[1:] if chunk_length is not None else old_arr.chunks
+    check_chunks_compatible(chunks, old_arr.shape)
+
+    if compressor is None:
+        compressor = old_arr.compressor
+
+    if (chunks == old_arr.chunks) and (compressor == old_arr.compressor):
+        # no change
+        return old_arr
+
+    # rechunk recompress
+    group.move(name, tmp_key)
+    old_arr = group[tmp_key]
+    n_copied, n_skipped, n_bytes_copied = zarr.copy(
+        source=old_arr,
+        dest=group,
+        name=name,
+        chunks=chunks,
+        compressor=compressor,
+    )
+    del group[tmp_key]
+    arr = group[name]
+    return arr
+
+
+def get_optimal_chunks(shape, dtype, target_chunk_bytes=2e6, max_chunk_length=None):
+    """
+    Common shapes
+    T,D
+    T,N,D
+    T,H,W,C
+    T,N,H,W,C
+    """
+    itemsize = np.dtype(dtype).itemsize
+    # reversed
+    rshape = list(shape[::-1])
+    if max_chunk_length is not None:
+        rshape[-1] = int(max_chunk_length)
+    split_idx = len(shape) - 1
+    for i in range(len(shape) - 1):
+        this_chunk_bytes = itemsize * np.prod(rshape[:i])
+        next_chunk_bytes = itemsize * np.prod(rshape[: i + 1])
+        if this_chunk_bytes <= target_chunk_bytes and next_chunk_bytes > target_chunk_bytes:
+            split_idx = i
+
+    rchunks = rshape[:split_idx]
+    item_chunk_bytes = itemsize * np.prod(rshape[:split_idx])
+    this_max_chunk_length = rshape[split_idx]
+    next_chunk_length = min(this_max_chunk_length, math.ceil(target_chunk_bytes / item_chunk_bytes))
+    rchunks.append(next_chunk_length)
+    len_diff = len(shape) - len(rchunks)
+    rchunks.extend([1] * len_diff)
+    chunks = tuple(rchunks[::-1])
+    # print(np.prod(chunks) * itemsize / target_chunk_bytes)
+    return chunks
+
+
+class ReplayBuffer:
+    """
+    Zarr-based temporal datastructure.
+    Assumes first dimension to be time. Only chunk in time dimension.
+    """
+
+    def __init__(self, root: zarr.Group | dict[str, dict]):
+        """
+        Dummy constructor. Use copy_from* and create_from* class methods instead.
+        """
+        assert "data" in root
+        assert "meta" in root
+        assert "episode_ends" in root["meta"]
+        for value in root["data"].values():
+            assert value.shape[0] == root["meta"]["episode_ends"][-1]
+        self.root = root
+
+    # ============= create constructors ===============
+    @classmethod
+    def create_empty_zarr(cls, storage=None, root=None):
+        if root is None:
+            if storage is None:
+                storage = zarr.MemoryStore()
+            root = zarr.group(store=storage)
+        root.require_group("data", overwrite=False)
+        meta = root.require_group("meta", overwrite=False)
+        if "episode_ends" not in meta:
+            meta.zeros("episode_ends", shape=(0,), dtype=np.int64, compressor=None, overwrite=False)
+        return cls(root=root)
+
+    @classmethod
+    def create_empty_numpy(cls):
+        root = {"data": {}, "meta": {"episode_ends": np.zeros((0,), dtype=np.int64)}}
+        return cls(root=root)
+
+    @classmethod
+    def create_from_group(cls, group, **kwargs):
+        if "data" not in group:
+            # create from stratch
+            buffer = cls.create_empty_zarr(root=group, **kwargs)
+        else:
+            # already exist
+            buffer = cls(root=group, **kwargs)
+        return buffer
+
+    @classmethod
+    def create_from_path(cls, zarr_path, mode="r", **kwargs):
+        """
+        Open a on-disk zarr directly (for dataset larger than memory).
+        Slower.
+        """
+        group = zarr.open(os.path.expanduser(zarr_path), mode)
+        return cls.create_from_group(group, **kwargs)
+
+    # ============= copy constructors ===============
+    @classmethod
+    def copy_from_store(
+        cls,
+        src_store,
+        store=None,
+        keys=None,
+        chunks: dict[str, tuple] | None = None,
+        compressors: dict | str | numcodecs.abc.Codec | None = None,
+        if_exists="replace",
+        **kwargs,
+    ):
+        """
+        Load to memory.
+        """
+        src_root = zarr.group(src_store)
+        if chunks is None:
+            chunks = {}
+        if compressors is None:
+            compressors = {}
+        root = None
+        if store is None:
+            # numpy backend
+            meta = {}
+            for key, value in src_root["meta"].items():
+                if len(value.shape) == 0:
+                    meta[key] = np.array(value)
+                else:
+                    meta[key] = value[:]
+
+            if keys is None:
+                keys = src_root["data"].keys()
+            data = {}
+            for key in keys:
+                arr = src_root["data"][key]
+                data[key] = arr[:]
+
+            root = {"meta": meta, "data": data}
+        else:
+            root = zarr.group(store=store)
+            # copy without recompression
+            n_copied, n_skipped, n_bytes_copied = zarr.copy_store(
+                source=src_store, dest=store, source_path="/meta", dest_path="/meta", if_exists=if_exists
+            )
+            data_group = root.create_group("data", overwrite=True)
+            if keys is None:
+                keys = src_root["data"].keys()
+            for key in keys:
+                value = src_root["data"][key]
+                cks = cls._resolve_array_chunks(chunks=chunks, key=key, array=value)
+                cpr = cls._resolve_array_compressor(compressors=compressors, key=key, array=value)
+                if cks == value.chunks and cpr == value.compressor:
+                    # copy without recompression
+                    this_path = "/data/" + key
+                    n_copied, n_skipped, n_bytes_copied = zarr.copy_store(
+                        source=src_store,
+                        dest=store,
+                        source_path=this_path,
+                        dest_path=this_path,
+                        if_exists=if_exists,
+                    )
+                else:
+                    # copy with recompression
+                    n_copied, n_skipped, n_bytes_copied = zarr.copy(
+                        source=value,
+                        dest=data_group,
+                        name=key,
+                        chunks=cks,
+                        compressor=cpr,
+                        if_exists=if_exists,
+                    )
+        buffer = cls(root=root)
+        return buffer
+
+    @classmethod
+    def copy_from_path(
+        cls,
+        zarr_path,
+        backend=None,
+        store=None,
+        keys=None,
+        chunks: dict[str, tuple] | None = None,
+        compressors: dict | str | numcodecs.abc.Codec | None = None,
+        if_exists="replace",
+        **kwargs,
+    ):
+        """
+        Copy a on-disk zarr to in-memory compressed.
+        Recommended
+        """
+        if chunks is None:
+            chunks = {}
+        if compressors is None:
+            compressors = {}
+        if backend == "numpy":
+            print("backend argument is deprecated!")
+            store = None
+        group = zarr.open(os.path.expanduser(zarr_path), "r")
+        return cls.copy_from_store(
+            src_store=group.store,
+            store=store,
+            keys=keys,
+            chunks=chunks,
+            compressors=compressors,
+            if_exists=if_exists,
+            **kwargs,
+        )
+
+    # ============= save methods ===============
+    def save_to_store(
+        self,
+        store,
+        chunks: dict[str, tuple] | None = None,
+        compressors: str | numcodecs.abc.Codec | dict | None = None,
+        if_exists="replace",
+        **kwargs,
+    ):
+        root = zarr.group(store)
+        if chunks is None:
+            chunks = {}
+        if compressors is None:
+            compressors = {}
+        if self.backend == "zarr":
+            # recompression free copy
+            n_copied, n_skipped, n_bytes_copied = zarr.copy_store(
+                source=self.root.store,
+                dest=store,
+                source_path="/meta",
+                dest_path="/meta",
+                if_exists=if_exists,
+            )
+        else:
+            meta_group = root.create_group("meta", overwrite=True)
+            # save meta, no chunking
+            for key, value in self.root["meta"].items():
+                _ = meta_group.array(name=key, data=value, shape=value.shape, chunks=value.shape)
+
+        # save data, chunk
+        data_group = root.create_group("data", overwrite=True)
+        for key, value in self.root["data"].items():
+            cks = self._resolve_array_chunks(chunks=chunks, key=key, array=value)
+            cpr = self._resolve_array_compressor(compressors=compressors, key=key, array=value)
+            if isinstance(value, zarr.Array):
+                if cks == value.chunks and cpr == value.compressor:
+                    # copy without recompression
+                    this_path = "/data/" + key
+                    n_copied, n_skipped, n_bytes_copied = zarr.copy_store(
+                        source=self.root.store,
+                        dest=store,
+                        source_path=this_path,
+                        dest_path=this_path,
+                        if_exists=if_exists,
+                    )
+                else:
+                    # copy with recompression
+                    n_copied, n_skipped, n_bytes_copied = zarr.copy(
+                        source=value,
+                        dest=data_group,
+                        name=key,
+                        chunks=cks,
+                        compressor=cpr,
+                        if_exists=if_exists,
+                    )
+            else:
+                # numpy
+                _ = data_group.array(name=key, data=value, chunks=cks, compressor=cpr)
+        return store
+
+    def save_to_path(
+        self,
+        zarr_path,
+        chunks: dict[str, tuple] | None = None,
+        compressors: str | numcodecs.abc.Codec | dict | None = None,
+        if_exists="replace",
+        **kwargs,
+    ):
+        if chunks is None:
+            chunks = {}
+        if compressors is None:
+            compressors = {}
+        store = zarr.DirectoryStore(os.path.expanduser(zarr_path))
+        return self.save_to_store(
+            store, chunks=chunks, compressors=compressors, if_exists=if_exists, **kwargs
+        )
+
+    @staticmethod
+    def resolve_compressor(compressor="default"):
+        if compressor == "default":
+            compressor = numcodecs.Blosc(cname="lz4", clevel=5, shuffle=numcodecs.Blosc.NOSHUFFLE)
+        elif compressor == "disk":
+            compressor = numcodecs.Blosc("zstd", clevel=5, shuffle=numcodecs.Blosc.BITSHUFFLE)
+        return compressor
+
+    @classmethod
+    def _resolve_array_compressor(cls, compressors: dict | str | numcodecs.abc.Codec, key, array):
+        # allows compressor to be explicitly set to None
+        cpr = "nil"
+        if isinstance(compressors, dict):
+            if key in compressors:
+                cpr = cls.resolve_compressor(compressors[key])
+            elif isinstance(array, zarr.Array):
+                cpr = array.compressor
+        else:
+            cpr = cls.resolve_compressor(compressors)
+        # backup default
+        if cpr == "nil":
+            cpr = cls.resolve_compressor("default")
+        return cpr
+
+    @classmethod
+    def _resolve_array_chunks(cls, chunks: dict | tuple, key, array):
+        cks = None
+        if isinstance(chunks, dict):
+            if key in chunks:
+                cks = chunks[key]
+            elif isinstance(array, zarr.Array):
+                cks = array.chunks
+        elif isinstance(chunks, tuple):
+            cks = chunks
+        else:
+            raise TypeError(f"Unsupported chunks type {type(chunks)}")
+        # backup default
+        if cks is None:
+            cks = get_optimal_chunks(shape=array.shape, dtype=array.dtype)
+        # check
+        check_chunks_compatible(chunks=cks, shape=array.shape)
+        return cks
+
+    # ============= properties =================
+    @cached_property
+    def data(self):
+        return self.root["data"]
+
+    @cached_property
+    def meta(self):
+        return self.root["meta"]
+
+    def update_meta(self, data):
+        # sanitize data
+        np_data = {}
+        for key, value in data.items():
+            if isinstance(value, np.ndarray):
+                np_data[key] = value
+            else:
+                arr = np.array(value)
+                if arr.dtype == object:
+                    raise TypeError(f"Invalid value type {type(value)}")
+                np_data[key] = arr
+
+        meta_group = self.meta
+        if self.backend == "zarr":
+            for key, value in np_data.items():
+                _ = meta_group.array(
+                    name=key, data=value, shape=value.shape, chunks=value.shape, overwrite=True
+                )
+        else:
+            meta_group.update(np_data)
+
+        return meta_group
+
+    @property
+    def episode_ends(self):
+        return self.meta["episode_ends"]
+
+    def get_episode_idxs(self):
+        import numba
+
+        numba.jit(nopython=True)
+
+        def _get_episode_idxs(episode_ends):
+            result = np.zeros((episode_ends[-1],), dtype=np.int64)
+            for i in range(len(episode_ends)):
+                start = 0
+                if i > 0:
+                    start = episode_ends[i - 1]
+                end = episode_ends[i]
+                for idx in range(start, end):
+                    result[idx] = i
+            return result
+
+        return _get_episode_idxs(self.episode_ends)
+
+    @property
+    def backend(self):
+        backend = "numpy"
+        if isinstance(self.root, zarr.Group):
+            backend = "zarr"
+        return backend
+
+    # =========== dict-like API ==============
+    def __repr__(self) -> str:
+        if self.backend == "zarr":
+            return str(self.root.tree())
+        else:
+            return super().__repr__()
+
+    def keys(self):
+        return self.data.keys()
+
+    def values(self):
+        return self.data.values()
+
+    def items(self):
+        return self.data.items()
+
+    def __getitem__(self, key):
+        return self.data[key]
+
+    def __contains__(self, key):
+        return key in self.data
+
+    # =========== our API ==============
+    @property
+    def n_steps(self):
+        if len(self.episode_ends) == 0:
+            return 0
+        return self.episode_ends[-1]
+
+    @property
+    def n_episodes(self):
+        return len(self.episode_ends)
+
+    @property
+    def chunk_size(self):
+        if self.backend == "zarr":
+            return next(iter(self.data.arrays()))[-1].chunks[0]
+        return None
+
+    @property
+    def episode_lengths(self):
+        ends = self.episode_ends[:]
+        ends = np.insert(ends, 0, 0)
+        lengths = np.diff(ends)
+        return lengths
+
+    def add_episode(
+        self,
+        data: dict[str, np.ndarray],
+        chunks: dict[str, tuple] | None = None,
+        compressors: str | numcodecs.abc.Codec | dict | None = None,
+    ):
+        if chunks is None:
+            chunks = {}
+        if compressors is None:
+            compressors = {}
+        assert len(data) > 0
+        is_zarr = self.backend == "zarr"
+
+        curr_len = self.n_steps
+        episode_length = None
+        for value in data.values():
+            assert len(value.shape) >= 1
+            if episode_length is None:
+                episode_length = len(value)
+            else:
+                assert episode_length == len(value)
+        new_len = curr_len + episode_length
+
+        for key, value in data.items():
+            new_shape = (new_len,) + value.shape[1:]
+            # create array
+            if key not in self.data:
+                if is_zarr:
+                    cks = self._resolve_array_chunks(chunks=chunks, key=key, array=value)
+                    cpr = self._resolve_array_compressor(compressors=compressors, key=key, array=value)
+                    arr = self.data.zeros(
+                        name=key, shape=new_shape, chunks=cks, dtype=value.dtype, compressor=cpr
+                    )
+                else:
+                    # copy data to prevent modify
+                    arr = np.zeros(shape=new_shape, dtype=value.dtype)
+                    self.data[key] = arr
+            else:
+                arr = self.data[key]
+                assert value.shape[1:] == arr.shape[1:]
+                # same method for both zarr and numpy
+                if is_zarr:
+                    arr.resize(new_shape)
+                else:
+                    arr.resize(new_shape, refcheck=False)
+            # copy data
+            arr[-value.shape[0] :] = value
+
+        # append to episode ends
+        episode_ends = self.episode_ends
+        if is_zarr:
+            episode_ends.resize(episode_ends.shape[0] + 1)
+        else:
+            episode_ends.resize(episode_ends.shape[0] + 1, refcheck=False)
+        episode_ends[-1] = new_len
+
+        # rechunk
+        if is_zarr and episode_ends.chunks[0] < episode_ends.shape[0]:
+            rechunk_recompress_array(self.meta, "episode_ends", chunk_length=int(episode_ends.shape[0] * 1.5))
+
+    def drop_episode(self):
+        is_zarr = self.backend == "zarr"
+        episode_ends = self.episode_ends[:].copy()
+        assert len(episode_ends) > 0
+        start_idx = 0
+        if len(episode_ends) > 1:
+            start_idx = episode_ends[-2]
+        for value in self.data.values():
+            new_shape = (start_idx,) + value.shape[1:]
+            if is_zarr:
+                value.resize(new_shape)
+            else:
+                value.resize(new_shape, refcheck=False)
+        if is_zarr:
+            self.episode_ends.resize(len(episode_ends) - 1)
+        else:
+            self.episode_ends.resize(len(episode_ends) - 1, refcheck=False)
+
+    def pop_episode(self):
+        assert self.n_episodes > 0
+        episode = self.get_episode(self.n_episodes - 1, copy=True)
+        self.drop_episode()
+        return episode
+
+    def extend(self, data):
+        self.add_episode(data)
+
+    def get_episode(self, idx, copy=False):
+        idx = list(range(len(self.episode_ends)))[idx]
+        start_idx = 0
+        if idx > 0:
+            start_idx = self.episode_ends[idx - 1]
+        end_idx = self.episode_ends[idx]
+        result = self.get_steps_slice(start_idx, end_idx, copy=copy)
+        return result
+
+    def get_episode_slice(self, idx):
+        start_idx = 0
+        if idx > 0:
+            start_idx = self.episode_ends[idx - 1]
+        end_idx = self.episode_ends[idx]
+        return slice(start_idx, end_idx)
+
+    def get_steps_slice(self, start, stop, step=None, copy=False):
+        _slice = slice(start, stop, step)
+
+        result = {}
+        for key, value in self.data.items():
+            x = value[_slice]
+            if copy and isinstance(value, np.ndarray):
+                x = x.copy()
+            result[key] = x
+        return result
+
+    # =========== chunking =============
+    def get_chunks(self) -> dict:
+        assert self.backend == "zarr"
+        chunks = {}
+        for key, value in self.data.items():
+            chunks[key] = value.chunks
+        return chunks
+
+    def set_chunks(self, chunks: dict):
+        assert self.backend == "zarr"
+        for key, value in chunks.items():
+            if key in self.data:
+                arr = self.data[key]
+                if value != arr.chunks:
+                    check_chunks_compatible(chunks=value, shape=arr.shape)
+                    rechunk_recompress_array(self.data, key, chunks=value)
+
+    def get_compressors(self) -> dict:
+        assert self.backend == "zarr"
+        compressors = {}
+        for key, value in self.data.items():
+            compressors[key] = value.compressor
+        return compressors
+
+    def set_compressors(self, compressors: dict):
+        assert self.backend == "zarr"
+        for key, value in compressors.items():
+            if key in self.data:
+                arr = self.data[key]
+                compressor = self.resolve_compressor(value)
+                if compressor != arr.compressor:
+                    rechunk_recompress_array(self.data, key, compressor=compressor)

lerobot/common/datasets/push_dataset_to_hub/_download_raw.py

@@ -0,0 +1,202 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+This file contains download scripts for raw datasets.
+
+Example of usage:
+```
+python lerobot/common/datasets/push_dataset_to_hub/_download_raw.py \
+--raw-dir data/lerobot-raw/pusht_raw \
+--repo-id lerobot-raw/pusht_raw
+```
+"""
+
+import argparse
+import logging
+import warnings
+from pathlib import Path
+
+from huggingface_hub import snapshot_download
+
+from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
+
+# {raw_repo_id: raw_format}
+AVAILABLE_RAW_REPO_IDS = {
+    "lerobot-raw/aloha_mobile_cabinet_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_chair_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_elevator_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_shrimp_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_wash_pan_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_wipe_wine_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_sim_insertion_human_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_sim_insertion_scripted_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_sim_transfer_cube_human_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_sim_transfer_cube_scripted_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_battery_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_candy_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_coffee_new_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_coffee_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_cups_open_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_fork_pick_up_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_pingpong_test_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_pro_pencil_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_screw_driver_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_tape_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_thread_velcro_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_towel_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
+    "lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
+    "lerobot-raw/pusht_raw": "pusht_zarr",
+    "lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
+    "lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
+    "lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
+    "lerobot-raw/unitreeh1_warehouse_raw": "aloha_hdf5",
+    "lerobot-raw/xarm_lift_medium_raw": "xarm_pkl",
+    "lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
+    "lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
+    "lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
+    "lerobot-raw/fractal20220817_data_raw": "openx_rlds.fractal20220817_data",
+    "lerobot-raw/kuka_raw": "openx_rlds.kuka",
+    "lerobot-raw/bridge_openx_raw": "openx_rlds.bridge_openx",
+    "lerobot-raw/taco_play_raw": "openx_rlds.taco_play",
+    "lerobot-raw/jaco_play_raw": "openx_rlds.jaco_play",
+    "lerobot-raw/berkeley_cable_routing_raw": "openx_rlds.berkeley_cable_routing",
+    "lerobot-raw/roboturk_raw": "openx_rlds.roboturk",
+    "lerobot-raw/nyu_door_opening_surprising_effectiveness_raw": "openx_rlds.nyu_door_opening_surprising_effectiveness",
+    "lerobot-raw/viola_raw": "openx_rlds.viola",
+    "lerobot-raw/berkeley_autolab_ur5_raw": "openx_rlds.berkeley_autolab_ur5",
+    "lerobot-raw/toto_raw": "openx_rlds.toto",
+    "lerobot-raw/language_table_raw": "openx_rlds.language_table",
+    "lerobot-raw/columbia_cairlab_pusht_real_raw": "openx_rlds.columbia_cairlab_pusht_real",
+    "lerobot-raw/stanford_kuka_multimodal_dataset_raw": "openx_rlds.stanford_kuka_multimodal_dataset",
+    "lerobot-raw/nyu_rot_dataset_raw": "openx_rlds.nyu_rot_dataset",
+    "lerobot-raw/io_ai_tech_raw": "openx_rlds.io_ai_tech",
+    "lerobot-raw/stanford_hydra_dataset_raw": "openx_rlds.stanford_hydra_dataset",
+    "lerobot-raw/austin_buds_dataset_raw": "openx_rlds.austin_buds_dataset",
+    "lerobot-raw/nyu_franka_play_dataset_raw": "openx_rlds.nyu_franka_play_dataset",
+    "lerobot-raw/maniskill_dataset_raw": "openx_rlds.maniskill_dataset",
+    "lerobot-raw/furniture_bench_dataset_raw": "openx_rlds.furniture_bench_dataset",
+    "lerobot-raw/cmu_franka_exploration_dataset_raw": "openx_rlds.cmu_franka_exploration_dataset",
+    "lerobot-raw/ucsd_kitchen_dataset_raw": "openx_rlds.ucsd_kitchen_dataset",
+    "lerobot-raw/ucsd_pick_and_place_dataset_raw": "openx_rlds.ucsd_pick_and_place_dataset",
+    "lerobot-raw/spoc_raw": "openx_rlds.spoc",
+    "lerobot-raw/austin_sailor_dataset_raw": "openx_rlds.austin_sailor_dataset",
+    "lerobot-raw/austin_sirius_dataset_raw": "openx_rlds.austin_sirius_dataset",
+    "lerobot-raw/bc_z_raw": "openx_rlds.bc_z",
+    "lerobot-raw/utokyo_pr2_opening_fridge_raw": "openx_rlds.utokyo_pr2_opening_fridge",
+    "lerobot-raw/utokyo_pr2_tabletop_manipulation_raw": "openx_rlds.utokyo_pr2_tabletop_manipulation",
+    "lerobot-raw/utokyo_xarm_pick_and_place_raw": "openx_rlds.utokyo_xarm_pick_and_place",
+    "lerobot-raw/utokyo_xarm_bimanual_raw": "openx_rlds.utokyo_xarm_bimanual",
+    "lerobot-raw/utokyo_saytap_raw": "openx_rlds.utokyo_saytap",
+    "lerobot-raw/robo_net_raw": "openx_rlds.robo_net",
+    "lerobot-raw/robo_set_raw": "openx_rlds.robo_set",
+    "lerobot-raw/berkeley_mvp_raw": "openx_rlds.berkeley_mvp",
+    "lerobot-raw/berkeley_rpt_raw": "openx_rlds.berkeley_rpt",
+    "lerobot-raw/kaist_nonprehensile_raw": "openx_rlds.kaist_nonprehensile",
+    "lerobot-raw/stanford_mask_vit_raw": "openx_rlds.stanford_mask_vit",
+    "lerobot-raw/tokyo_u_lsmo_raw": "openx_rlds.tokyo_u_lsmo",
+    "lerobot-raw/dlr_sara_pour_raw": "openx_rlds.dlr_sara_pour",
+    "lerobot-raw/dlr_sara_grid_clamp_raw": "openx_rlds.dlr_sara_grid_clamp",
+    "lerobot-raw/dlr_edan_shared_control_raw": "openx_rlds.dlr_edan_shared_control",
+    "lerobot-raw/asu_table_top_raw": "openx_rlds.asu_table_top",
+    "lerobot-raw/stanford_robocook_raw": "openx_rlds.stanford_robocook",
+    "lerobot-raw/imperialcollege_sawyer_wrist_cam_raw": "openx_rlds.imperialcollege_sawyer_wrist_cam",
+    "lerobot-raw/iamlab_cmu_pickup_insert_raw": "openx_rlds.iamlab_cmu_pickup_insert",
+    "lerobot-raw/uiuc_d3field_raw": "openx_rlds.uiuc_d3field",
+    "lerobot-raw/utaustin_mutex_raw": "openx_rlds.utaustin_mutex",
+    "lerobot-raw/berkeley_fanuc_manipulation_raw": "openx_rlds.berkeley_fanuc_manipulation",
+    "lerobot-raw/cmu_playing_with_food_raw": "openx_rlds.cmu_playing_with_food",
+    "lerobot-raw/cmu_play_fusion_raw": "openx_rlds.cmu_play_fusion",
+    "lerobot-raw/cmu_stretch_raw": "openx_rlds.cmu_stretch",
+    "lerobot-raw/berkeley_gnm_recon_raw": "openx_rlds.berkeley_gnm_recon",
+    "lerobot-raw/berkeley_gnm_cory_hall_raw": "openx_rlds.berkeley_gnm_cory_hall",
+    "lerobot-raw/berkeley_gnm_sac_son_raw": "openx_rlds.berkeley_gnm_sac_son",
+    "lerobot-raw/droid_raw": "openx_rlds.droid",
+    "lerobot-raw/droid_100_raw": "openx_rlds.droid100",
+    "lerobot-raw/fmb_raw": "openx_rlds.fmb",
+    "lerobot-raw/dobbe_raw": "openx_rlds.dobbe",
+    "lerobot-raw/usc_cloth_sim_raw": "openx_rlds.usc_cloth_sim",
+    "lerobot-raw/plex_robosuite_raw": "openx_rlds.plex_robosuite",
+    "lerobot-raw/conq_hose_manipulation_raw": "openx_rlds.conq_hose_manipulation",
+    "lerobot-raw/vima_raw": "openx_rlds.vima",
+    "lerobot-raw/robot_vqa_raw": "openx_rlds.robot_vqa",
+    "lerobot-raw/mimic_play_raw": "openx_rlds.mimic_play",
+    "lerobot-raw/tidybot_raw": "openx_rlds.tidybot",
+    "lerobot-raw/eth_agent_affordances_raw": "openx_rlds.eth_agent_affordances",
+}
+
+
+def download_raw(raw_dir: Path, repo_id: str):
+    check_repo_id(repo_id)
+    user_id, dataset_id = repo_id.split("/")
+
+    if not dataset_id.endswith("_raw"):
+        warnings.warn(
+            f"""`dataset_id` ({dataset_id}) doesn't end with '_raw' (e.g. 'lerobot/pusht_raw'). Following this
+             naming convention by renaming your repository is advised, but not mandatory.""",
+            stacklevel=1,
+        )
+
+    # Send warning if raw_dir isn't well formatted
+    if raw_dir.parts[-2] != user_id or raw_dir.parts[-1] != dataset_id:
+        warnings.warn(
+            f"""`raw_dir` ({raw_dir}) doesn't contain a community or user id `/` the name of the dataset that
+             match the `repo_id` (e.g. 'data/lerobot/pusht_raw'). Following this naming convention is advised,
+             but not mandatory.""",
+            stacklevel=1,
+        )
+    raw_dir.mkdir(parents=True, exist_ok=True)
+
+    logging.info(f"Start downloading from huggingface.co/{user_id} for {dataset_id}")
+    snapshot_download(repo_id, repo_type="dataset", local_dir=raw_dir)
+    logging.info(f"Finish downloading from huggingface.co/{user_id} for {dataset_id}")
+
+
+def download_all_raw_datasets(data_dir: Path | None = None):
+    if data_dir is None:
+        data_dir = Path("data")
+    for repo_id in AVAILABLE_RAW_REPO_IDS:
+        raw_dir = data_dir / repo_id
+        download_raw(raw_dir, repo_id)
+
+
+def main():
+    parser = argparse.ArgumentParser(
+        description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
+            non exhaustive list of available repositories to use in `--repo-id`: {list(AVAILABLE_RAW_REPO_IDS.keys())}""",
+    )
+
+    parser.add_argument(
+        "--raw-dir",
+        type=Path,
+        required=True,
+        help="Directory containing input raw datasets (e.g. `data/aloha_mobile_chair_raw` or `data/pusht_raw).",
+    )
+    parser.add_argument(
+        "--repo-id",
+        type=str,
+        required=True,
+        help="""Repositery identifier on Hugging Face: a community or a user name `/` the name of
+        the dataset (e.g. `lerobot/pusht_raw`, `cadene/aloha_sim_insertion_human_raw`).""",
+    )
+    args = parser.parse_args()
+    download_raw(**vars(args))
+
+
+if __name__ == "__main__":
+    main()

lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py

@@ -0,0 +1,184 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Use this script to batch encode lerobot dataset from their raw format to LeRobotDataset and push their updated
+version to the hub. Under the hood, this script reuses 'push_dataset_to_hub.py'. It assumes that you already
+downloaded raw datasets, which you can do with the related '_download_raw.py' script.
+
+For instance, for codebase_version = 'v1.6', the following command was run, assuming raw datasets from
+lerobot-raw were downloaded in 'raw/datasets/directory':
+```bash
+python lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py \
+  --raw-dir raw/datasets/directory \
+  --raw-repo-ids lerobot-raw \
+  --local-dir push/datasets/directory \
+  --tests-data-dir tests/data \
+  --push-repo lerobot \
+  --vcodec libsvtav1 \
+  --pix-fmt yuv420p \
+  --g 2 \
+  --crf 30
+```
+"""
+
+import argparse
+from pathlib import Path
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub._download_raw import AVAILABLE_RAW_REPO_IDS
+from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
+from lerobot.scripts.push_dataset_to_hub import push_dataset_to_hub
+
+
+def get_push_repo_id_from_raw(raw_repo_id: str, push_repo: str) -> str:
+    dataset_id_raw = raw_repo_id.split("/")[1]
+    dataset_id = dataset_id_raw.removesuffix("_raw")
+    return f"{push_repo}/{dataset_id}"
+
+
+def encode_datasets(
+    raw_dir: Path,
+    raw_repo_ids: list[str],
+    push_repo: str,
+    vcodec: str,
+    pix_fmt: str,
+    g: int,
+    crf: int,
+    local_dir: Path | None = None,
+    tests_data_dir: Path | None = None,
+    raw_format: str | None = None,
+    dry_run: bool = False,
+) -> None:
+    if len(raw_repo_ids) == 1 and raw_repo_ids[0].lower() == "lerobot-raw":
+        raw_repo_ids_format = AVAILABLE_RAW_REPO_IDS
+    else:
+        if raw_format is None:
+            raise ValueError(raw_format)
+        raw_repo_ids_format = {id_: raw_format for id_ in raw_repo_ids}
+
+    for raw_repo_id, repo_raw_format in raw_repo_ids_format.items():
+        check_repo_id(raw_repo_id)
+        dataset_repo_id_push = get_push_repo_id_from_raw(raw_repo_id, push_repo)
+        dataset_raw_dir = raw_dir / raw_repo_id
+        dataset_dir = local_dir / dataset_repo_id_push if local_dir is not None else None
+        encoding = {
+            "vcodec": vcodec,
+            "pix_fmt": pix_fmt,
+            "g": g,
+            "crf": crf,
+        }
+
+        if not (dataset_raw_dir).is_dir():
+            raise NotADirectoryError(dataset_raw_dir)
+
+        if not dry_run:
+            push_dataset_to_hub(
+                dataset_raw_dir,
+                raw_format=repo_raw_format,
+                repo_id=dataset_repo_id_push,
+                local_dir=dataset_dir,
+                resume=True,
+                encoding=encoding,
+                tests_data_dir=tests_data_dir,
+            )
+        else:
+            print(
+                f"DRY RUN: {dataset_raw_dir}  -->  {dataset_dir}  -->  {dataset_repo_id_push}@{CODEBASE_VERSION}"
+            )
+
+
+def main():
+    parser = argparse.ArgumentParser()
+    parser.add_argument(
+        "--raw-dir",
+        type=Path,
+        default=Path("data"),
+        help="Directory where raw datasets are located.",
+    )
+    parser.add_argument(
+        "--raw-repo-ids",
+        type=str,
+        nargs="*",
+        default=["lerobot-raw"],
+        help="""Raw dataset repo ids. if 'lerobot-raw', the keys from `AVAILABLE_RAW_REPO_IDS` will be
+            used and raw datasets will be fetched from the 'lerobot-raw/' repo and pushed with their
+            associated format. It is assumed that each dataset is located at `raw_dir / raw_repo_id` """,
+    )
+    parser.add_argument(
+        "--raw-format",
+        type=str,
+        default=None,
+        help="""Raw format to use for the raw repo-ids. Must be specified if --raw-repo-ids is not
+            'lerobot-raw'""",
+    )
+    parser.add_argument(
+        "--local-dir",
+        type=Path,
+        default=None,
+        help="""When provided, writes the dataset converted to LeRobotDataset format in this directory
+        (e.g. `data/lerobot/aloha_mobile_chair`).""",
+    )
+    parser.add_argument(
+        "--push-repo",
+        type=str,
+        default="lerobot",
+        help="Repo to upload datasets to",
+    )
+    parser.add_argument(
+        "--vcodec",
+        type=str,
+        default="libsvtav1",
+        help="Codec to use for encoding videos",
+    )
+    parser.add_argument(
+        "--pix-fmt",
+        type=str,
+        default="yuv420p",
+        help="Pixel formats (chroma subsampling) to be used for encoding",
+    )
+    parser.add_argument(
+        "--g",
+        type=int,
+        default=2,
+        help="Group of pictures sizes to be used for encoding.",
+    )
+    parser.add_argument(
+        "--crf",
+        type=int,
+        default=30,
+        help="Constant rate factors to be used for encoding.",
+    )
+    parser.add_argument(
+        "--tests-data-dir",
+        type=Path,
+        default=None,
+        help=(
+            "When provided, save tests artifacts into the given directory "
+            "(e.g. `--tests-data-dir tests/data` will save to tests/data/{--repo-id})."
+        ),
+    )
+    parser.add_argument(
+        "--dry-run",
+        type=int,
+        default=0,
+        help="If not set to 0, this script won't download or upload anything.",
+    )
+    args = parser.parse_args()
+    encode_datasets(**vars(args))
+
+
+if __name__ == "__main__":
+    main()

lerobot/common/datasets/push_dataset_to_hub/_umi_imagecodecs_numcodecs.py

@@ -0,0 +1,326 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+# imagecodecs/numcodecs.py
+
+# Copyright (c) 2021-2022, Christoph Gohlke
+# All rights reserved.
+#
+# Redistribution and use in source and binary forms, with or without
+# modification, are permitted provided that the following conditions are met:
+#
+# 1. Redistributions of source code must retain the above copyright notice,
+#    this list of conditions and the following disclaimer.
+#
+# 2. Redistributions in binary form must reproduce the above copyright notice,
+#    this list of conditions and the following disclaimer in the documentation
+#    and/or other materials provided with the distribution.
+#
+# 3. Neither the name of the copyright holder nor the names of its
+#    contributors may be used to endorse or promote products derived from
+#    this software without specific prior written permission.
+#
+# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+# ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE
+# LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+# CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+# SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
+# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+# ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+# POSSIBILITY OF SUCH DAMAGE.
+
+# Copied from: https://github.com/real-stanford/universal_manipulation_interface/blob/298776ce251f33b6b3185a98d6e7d1f9ad49168b/diffusion_policy/codecs/imagecodecs_numcodecs.py#L1
+"""Additional numcodecs implemented using imagecodecs."""
+
+__version__ = "2022.9.26"
+
+__all__ = ("register_codecs",)
+
+import imagecodecs
+import numpy
+from numcodecs.abc import Codec
+from numcodecs.registry import get_codec, register_codec
+
+# TODO (azouitine): Remove useless codecs
+
+
+def protective_squeeze(x: numpy.ndarray):
+    """
+    Squeeze dim only if it's not the last dim.
+    Image dim expected to be *, H, W, C
+    """
+    img_shape = x.shape[-3:]
+    if len(x.shape) > 3:
+        n_imgs = numpy.prod(x.shape[:-3])
+        if n_imgs > 1:
+            img_shape = (-1,) + img_shape
+    return x.reshape(img_shape)
+
+
+def get_default_image_compressor(**kwargs):
+    if imagecodecs.JPEGXL:
+        # has JPEGXL
+        this_kwargs = {
+            "effort": 3,
+            "distance": 0.3,
+            # bug in libjxl, invalid codestream for non-lossless
+            # when decoding speed > 1
+            "decodingspeed": 1,
+        }
+        this_kwargs.update(kwargs)
+        return JpegXl(**this_kwargs)
+    else:
+        this_kwargs = {"level": 50}
+        this_kwargs.update(kwargs)
+        return Jpeg2k(**this_kwargs)
+
+
+class Jpeg2k(Codec):
+    """JPEG 2000 codec for numcodecs."""
+
+    codec_id = "imagecodecs_jpeg2k"
+
+    def __init__(
+        self,
+        level=None,
+        codecformat=None,
+        colorspace=None,
+        tile=None,
+        reversible=None,
+        bitspersample=None,
+        resolutions=None,
+        numthreads=None,
+        verbose=0,
+    ):
+        self.level = level
+        self.codecformat = codecformat
+        self.colorspace = colorspace
+        self.tile = None if tile is None else tuple(tile)
+        self.reversible = reversible
+        self.bitspersample = bitspersample
+        self.resolutions = resolutions
+        self.numthreads = numthreads
+        self.verbose = verbose
+
+    def encode(self, buf):
+        buf = protective_squeeze(numpy.asarray(buf))
+        return imagecodecs.jpeg2k_encode(
+            buf,
+            level=self.level,
+            codecformat=self.codecformat,
+            colorspace=self.colorspace,
+            tile=self.tile,
+            reversible=self.reversible,
+            bitspersample=self.bitspersample,
+            resolutions=self.resolutions,
+            numthreads=self.numthreads,
+            verbose=self.verbose,
+        )
+
+    def decode(self, buf, out=None):
+        return imagecodecs.jpeg2k_decode(buf, verbose=self.verbose, numthreads=self.numthreads, out=out)
+
+
+class JpegXl(Codec):
+    """JPEG XL codec for numcodecs."""
+
+    codec_id = "imagecodecs_jpegxl"
+
+    def __init__(
+        self,
+        # encode
+        level=None,
+        effort=None,
+        distance=None,
+        lossless=None,
+        decodingspeed=None,
+        photometric=None,
+        planar=None,
+        usecontainer=None,
+        # decode
+        index=None,
+        keeporientation=None,
+        # both
+        numthreads=None,
+    ):
+        """
+        Return JPEG XL image from numpy array.
+        Float must be in nominal range 0..1.
+
+        Currently L, LA, RGB, RGBA images are supported in contig mode.
+        Extra channels are only supported for grayscale images in planar mode.
+
+        Parameters
+        ----------
+        level : Default to None, i.e. not overwriting lossess and decodingspeed options.
+            When < 0: Use lossless compression
+            When in [0,1,2,3,4]: Sets the decoding speed tier for the provided options.
+                Minimum is 0 (slowest to decode, best quality/density), and maximum
+                is 4 (fastest to decode, at the cost of some quality/density).
+        effort : Default to 3.
+            Sets encoder effort/speed level without affecting decoding speed.
+            Valid values are, from faster to slower speed: 1:lightning 2:thunder
+                3:falcon 4:cheetah 5:hare 6:wombat 7:squirrel 8:kitten 9:tortoise.
+            Speed: lightning, thunder, falcon, cheetah, hare, wombat, squirrel, kitten, tortoise
+            control the encoder effort in ascending order.
+            This also affects memory usage: using lower effort will typically reduce memory
+            consumption during encoding.
+            lightning and thunder are fast modes useful for lossless mode (modular).
+            falcon disables all of the following tools.
+            cheetah enables coefficient reordering, context clustering, and heuristics for selecting DCT sizes and quantization steps.
+            hare enables Gaborish filtering, chroma from luma, and an initial estimate of quantization steps.
+            wombat enables error diffusion quantization and full DCT size selection heuristics.
+            squirrel (default) enables dots, patches, and spline detection, and full context clustering.
+            kitten optimizes the adaptive quantization for a psychovisual metric.
+            tortoise enables a more thorough adaptive quantization search.
+        distance : Default to 1.0
+            Sets the distance level for lossy compression: target max butteraugli distance,
+            lower = higher quality. Range: 0 .. 15. 0.0 = mathematically lossless
+            (however, use JxlEncoderSetFrameLossless instead to use true lossless,
+            as setting distance to 0 alone is not the only requirement).
+            1.0 = visually lossless. Recommended range: 0.5 .. 3.0.
+        lossess : Default to False.
+            Use lossess encoding.
+        decodingspeed : Default to 0.
+            Duplicate to level. [0,4]
+        photometric : Return JxlColorSpace value.
+            Default logic is quite complicated but works most of the time.
+            Accepted value:
+                int: [-1,3]
+                str: ['RGB',
+                    'WHITEISZERO', 'MINISWHITE',
+                    'BLACKISZERO', 'MINISBLACK', 'GRAY',
+                    'XYB', 'KNOWN']
+        planar : Enable multi-channel mode.
+            Default to false.
+        usecontainer :
+            Forces the encoder to use the box-based container format (BMFF)
+            even when not necessary.
+            When using JxlEncoderUseBoxes, JxlEncoderStoreJPEGMetadata or
+            JxlEncoderSetCodestreamLevel with level 10, the encoder will
+            automatically also use the container format, it is not necessary
+            to use JxlEncoderUseContainer for those use cases.
+            By default this setting is disabled.
+        index : Selectively decode frames for animation.
+            Default to 0, decode all frames.
+            When set to > 0, decode that frame index only.
+        keeporientation :
+            Enables or disables preserving of as-in-bitstream pixeldata orientation.
+            Some images are encoded with an Orientation tag indicating that the
+            decoder must perform a rotation and/or mirroring to the encoded image data.
+
+            If skip_reorientation is JXL_FALSE (the default): the decoder will apply
+            the transformation from the orientation setting, hence rendering the image
+            according to its specified intent. When producing a JxlBasicInfo, the decoder
+            will always set the orientation field to JXL_ORIENT_IDENTITY (matching the
+            returned pixel data) and also align xsize and ysize so that they correspond
+            to the width and the height of the returned pixel data.
+
+            If skip_reorientation is JXL_TRUE: the decoder will skip applying the
+            transformation from the orientation setting, returning the image in
+            the as-in-bitstream pixeldata orientation. This may be faster to decode
+            since the decoder doesnt have to apply the transformation, but can
+            cause wrong display of the image if the orientation tag is not correctly
+            taken into account by the user.
+
+            By default, this option is disabled, and the returned pixel data is
+            re-oriented according to the images Orientation setting.
+        threads : Default to 1.
+            If <= 0, use all cores.
+            If > 32, clipped to 32.
+        """
+
+        self.level = level
+        self.effort = effort
+        self.distance = distance
+        self.lossless = bool(lossless)
+        self.decodingspeed = decodingspeed
+        self.photometric = photometric
+        self.planar = planar
+        self.usecontainer = usecontainer
+        self.index = index
+        self.keeporientation = keeporientation
+        self.numthreads = numthreads
+
+    def encode(self, buf):
+        # TODO: only squeeze all but last dim
+        buf = protective_squeeze(numpy.asarray(buf))
+        return imagecodecs.jpegxl_encode(
+            buf,
+            level=self.level,
+            effort=self.effort,
+            distance=self.distance,
+            lossless=self.lossless,
+            decodingspeed=self.decodingspeed,
+            photometric=self.photometric,
+            planar=self.planar,
+            usecontainer=self.usecontainer,
+            numthreads=self.numthreads,
+        )
+
+    def decode(self, buf, out=None):
+        return imagecodecs.jpegxl_decode(
+            buf,
+            index=self.index,
+            keeporientation=self.keeporientation,
+            numthreads=self.numthreads,
+            out=out,
+        )
+
+
+def _flat(out):
+    """Return numpy array as contiguous view of bytes if possible."""
+    if out is None:
+        return None
+    view = memoryview(out)
+    if view.readonly or not view.contiguous:
+        return None
+    return view.cast("B")
+
+
+def register_codecs(codecs=None, force=False, verbose=True):
+    """Register codecs in this module with numcodecs."""
+    for name, cls in globals().items():
+        if not hasattr(cls, "codec_id") or name == "Codec":
+            continue
+        if codecs is not None and cls.codec_id not in codecs:
+            continue
+        try:
+            try:  # noqa: SIM105
+                get_codec({"id": cls.codec_id})
+            except TypeError:
+                # registered, but failed
+                pass
+        except ValueError:
+            # not registered yet
+            pass
+        else:
+            if not force:
+                if verbose:
+                    log_warning(f"numcodec {cls.codec_id!r} already registered")
+                continue
+            if verbose:
+                log_warning(f"replacing registered numcodec {cls.codec_id!r}")
+        register_codec(cls)
+
+
+def log_warning(msg, *args, **kwargs):
+    """Log message with level WARNING."""
+    import logging
+
+    logging.getLogger(__name__).warning(msg, *args, **kwargs)

lerobot/common/datasets/push_dataset_to_hub/aloha_hdf5_format.py

@@ -0,0 +1,233 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Contains utilities to process raw data format of HDF5 files like in: https://github.com/tonyzhaozh/act
+"""
+
+import gc
+import shutil
+from pathlib import Path
+
+import h5py
+import numpy as np
+import torch
+import tqdm
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    calculate_episode_data_index,
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+
+def get_cameras(hdf5_data):
+    # ignore depth channel, not currently handled
+    # TODO(rcadene): add depth
+    rgb_cameras = [key for key in hdf5_data["/observations/images"].keys() if "depth" not in key]  # noqa: SIM118
+    return rgb_cameras
+
+
+def check_format(raw_dir) -> bool:
+    # only frames from simulation are uncompressed
+    compressed_images = "sim" not in raw_dir.name
+
+    hdf5_paths = list(raw_dir.glob("episode_*.hdf5"))
+    assert len(hdf5_paths) != 0
+    for hdf5_path in hdf5_paths:
+        with h5py.File(hdf5_path, "r") as data:
+            assert "/action" in data
+            assert "/observations/qpos" in data
+
+            assert data["/action"].ndim == 2
+            assert data["/observations/qpos"].ndim == 2
+
+            num_frames = data["/action"].shape[0]
+            assert num_frames == data["/observations/qpos"].shape[0]
+
+            for camera in get_cameras(data):
+                assert num_frames == data[f"/observations/images/{camera}"].shape[0]
+
+                if compressed_images:
+                    assert data[f"/observations/images/{camera}"].ndim == 2
+                else:
+                    assert data[f"/observations/images/{camera}"].ndim == 4
+                    b, h, w, c = data[f"/observations/images/{camera}"].shape
+                    assert c < h and c < w, f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # only frames from simulation are uncompressed
+    compressed_images = "sim" not in raw_dir.name
+
+    hdf5_files = sorted(raw_dir.glob("episode_*.hdf5"))
+    num_episodes = len(hdf5_files)
+
+    ep_dicts = []
+    ep_ids = episodes if episodes else range(num_episodes)
+    for ep_idx in tqdm.tqdm(ep_ids):
+        ep_path = hdf5_files[ep_idx]
+        with h5py.File(ep_path, "r") as ep:
+            num_frames = ep["/action"].shape[0]
+
+            # last step of demonstration is considered done
+            done = torch.zeros(num_frames, dtype=torch.bool)
+            done[-1] = True
+
+            state = torch.from_numpy(ep["/observations/qpos"][:])
+            action = torch.from_numpy(ep["/action"][:])
+            if "/observations/qvel" in ep:
+                velocity = torch.from_numpy(ep["/observations/qvel"][:])
+            if "/observations/effort" in ep:
+                effort = torch.from_numpy(ep["/observations/effort"][:])
+
+            ep_dict = {}
+
+            for camera in get_cameras(ep):
+                img_key = f"observation.images.{camera}"
+
+                if compressed_images:
+                    import cv2
+
+                    # load one compressed image after the other in RAM and uncompress
+                    imgs_array = []
+                    for data in ep[f"/observations/images/{camera}"]:
+                        imgs_array.append(cv2.imdecode(data, 1))
+                    imgs_array = np.array(imgs_array)
+
+                else:
+                    # load all images in RAM
+                    imgs_array = ep[f"/observations/images/{camera}"][:]
+
+                if video:
+                    # save png images in temporary directory
+                    tmp_imgs_dir = videos_dir / "tmp_images"
+                    save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                    # encode images to a mp4 video
+                    fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                    video_path = videos_dir / fname
+                    encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                    # clean temporary images directory
+                    shutil.rmtree(tmp_imgs_dir)
+
+                    # store the reference to the video frame
+                    ep_dict[img_key] = [
+                        {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                    ]
+                else:
+                    ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+            ep_dict["observation.state"] = state
+            if "/observations/velocity" in ep:
+                ep_dict["observation.velocity"] = velocity
+            if "/observations/effort" in ep:
+                ep_dict["observation.effort"] = effort
+            ep_dict["action"] = action
+            ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
+            ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+            ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+            ep_dict["next.done"] = done
+            # TODO(rcadene): add reward and success by computing them in sim
+
+            assert isinstance(ep_idx, int)
+            ep_dicts.append(ep_dict)
+
+        gc.collect()
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+
+    keys = [key for key in data_dict if "observation.images." in key]
+    for key in keys:
+        if video:
+            features[key] = VideoFrame()
+        else:
+            features[key] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    if "observation.velocity" in data_dict:
+        features["observation.velocity"] = Sequence(
+            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    if "observation.effort" in data_dict:
+        features["observation.effort"] = Sequence(
+            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 50
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/cam_png_format.py

@@ -0,0 +1,107 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Contains utilities to process raw data format of png images files recorded with capture_camera_feed.py
+"""
+
+from pathlib import Path
+
+import torch
+from datasets import Dataset, Features, Image, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    calculate_episode_data_index,
+    concatenate_episodes,
+)
+from lerobot.common.datasets.utils import hf_transform_to_torch
+from lerobot.common.datasets.video_utils import VideoFrame
+
+
+def check_format(raw_dir: Path) -> bool:
+    image_paths = list(raw_dir.glob("frame_*.png"))
+    if len(image_paths) == 0:
+        raise ValueError
+
+
+def load_from_raw(raw_dir: Path, fps: int, episodes: list[int] | None = None):
+    if episodes is not None:
+        # TODO(aliberts): add support for multi-episodes.
+        raise NotImplementedError()
+
+    ep_dict = {}
+    ep_idx = 0
+
+    image_paths = sorted(raw_dir.glob("frame_*.png"))
+    num_frames = len(image_paths)
+
+    ep_dict["observation.image"] = [PILImage.open(x) for x in image_paths]
+    ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
+    ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+    ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+
+    ep_dicts = [ep_dict]
+    data_dict = concatenate_episodes(ep_dicts)
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+    if video:
+        features["observation.image"] = VideoFrame()
+    else:
+        features["observation.image"] = Image()
+
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    if video or episodes or encoding is not None:
+        # TODO(aliberts): support this
+        raise NotImplementedError
+
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 30
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/dora_parquet_format.py

@@ -0,0 +1,233 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Contains utilities to process raw data format from dora-record
+"""
+
+import re
+import warnings
+from pathlib import Path
+
+import pandas as pd
+import torch
+from datasets import Dataset, Features, Image, Sequence, Value
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import calculate_episode_data_index
+from lerobot.common.datasets.utils import (
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame
+
+
+def check_format(raw_dir) -> bool:
+    assert raw_dir.exists()
+
+    leader_file = list(raw_dir.glob("*.parquet"))
+    if len(leader_file) == 0:
+        raise ValueError(f"Missing parquet files in '{raw_dir}'")
+    return True
+
+
+def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episodes: list[int] | None = None):
+    # Load data stream that will be used as reference for the timestamps synchronization
+    reference_files = list(raw_dir.glob("observation.images.cam_*.parquet"))
+    if len(reference_files) == 0:
+        raise ValueError(f"Missing reference files for camera, starting with  in '{raw_dir}'")
+    # select first camera in alphanumeric order
+    reference_key = sorted(reference_files)[0].stem
+    reference_df = pd.read_parquet(raw_dir / f"{reference_key}.parquet")
+    reference_df = reference_df[["timestamp_utc", reference_key]]
+
+    # Merge all data stream using nearest backward strategy
+    df = reference_df
+    for path in raw_dir.glob("*.parquet"):
+        key = path.stem  # action or observation.state or ...
+        if key == reference_key:
+            continue
+        if "failed_episode_index" in key:
+            # TODO(rcadene): add support for removing episodes that are tagged as "failed"
+            continue
+        modality_df = pd.read_parquet(path)
+        modality_df = modality_df[["timestamp_utc", key]]
+        df = pd.merge_asof(
+            df,
+            modality_df,
+            on="timestamp_utc",
+            # "nearest" is the best option over "backward", since the latter can desynchronizes camera timestamps by
+            # matching timestamps that are too far apart, in order to fit the backward constraints. It's not the case for "nearest".
+            # However, note that "nearest" might synchronize the reference camera with other cameras on slightly future timestamps.
+            # are too far apart.
+            direction="nearest",
+            tolerance=pd.Timedelta(f"{1 / fps} seconds"),
+        )
+    # Remove rows with episode_index -1 which indicates data that correspond to in-between episodes
+    df = df[df["episode_index"] != -1]
+
+    image_keys = [key for key in df if "observation.images." in key]
+
+    def get_episode_index(row):
+        episode_index_per_cam = {}
+        for key in image_keys:
+            path = row[key][0]["path"]
+            match = re.search(r"_(\d{6}).mp4", path)
+            if not match:
+                raise ValueError(path)
+            episode_index = int(match.group(1))
+            episode_index_per_cam[key] = episode_index
+        if len(set(episode_index_per_cam.values())) != 1:
+            raise ValueError(
+                f"All cameras are expected to belong to the same episode, but getting {episode_index_per_cam}"
+            )
+        return episode_index
+
+    df["episode_index"] = df.apply(get_episode_index, axis=1)
+
+    # dora only use arrays, so single values are encapsulated into a list
+    df["frame_index"] = df.groupby("episode_index").cumcount()
+    df = df.reset_index()
+    df["index"] = df.index
+
+    # set 'next.done' to True for the last frame of each episode
+    df["next.done"] = False
+    df.loc[df.groupby("episode_index").tail(1).index, "next.done"] = True
+
+    df["timestamp"] = df["timestamp_utc"].map(lambda x: x.timestamp())
+    # each episode starts with timestamp 0 to match the ones from the video
+    df["timestamp"] = df.groupby("episode_index")["timestamp"].transform(lambda x: x - x.iloc[0])
+
+    del df["timestamp_utc"]
+
+    # sanity check
+    has_nan = df.isna().any().any()
+    if has_nan:
+        raise ValueError("Dataset contains Nan values.")
+
+    # sanity check episode indices go from 0 to n-1
+    ep_ids = [ep_idx for ep_idx, _ in df.groupby("episode_index")]
+    expected_ep_ids = list(range(df["episode_index"].max() + 1))
+    if ep_ids != expected_ep_ids:
+        raise ValueError(f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}")
+
+    # Create symlink to raw videos directory (that needs to be absolute not relative)
+    videos_dir.parent.mkdir(parents=True, exist_ok=True)
+    videos_dir.symlink_to((raw_dir / "videos").absolute())
+
+    # sanity check the video paths are well formatted
+    for key in df:
+        if "observation.images." not in key:
+            continue
+        for ep_idx in ep_ids:
+            video_path = videos_dir / f"{key}_episode_{ep_idx:06d}.mp4"
+            if not video_path.exists():
+                raise ValueError(f"Video file not found in {video_path}")
+
+    data_dict = {}
+    for key in df:
+        # is video frame
+        if "observation.images." in key:
+            # we need `[0] because dora only use arrays, so single values are encapsulated into a list.
+            # it is the case for video_frame dictionary = [{"path": ..., "timestamp": ...}]
+            data_dict[key] = [video_frame[0] for video_frame in df[key].values]
+
+            # sanity check the video path is well formatted
+            video_path = videos_dir.parent / data_dict[key][0]["path"]
+            if not video_path.exists():
+                raise ValueError(f"Video file not found in {video_path}")
+        # is number
+        elif df[key].iloc[0].ndim == 0 or df[key].iloc[0].shape[0] == 1:
+            data_dict[key] = torch.from_numpy(df[key].values)
+        # is vector
+        elif df[key].iloc[0].shape[0] > 1:
+            data_dict[key] = torch.stack([torch.from_numpy(x.copy()) for x in df[key].values])
+        else:
+            raise ValueError(key)
+
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+
+    keys = [key for key in data_dict if "observation.images." in key]
+    for key in keys:
+        if video:
+            features[key] = VideoFrame()
+        else:
+            features[key] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    if "observation.velocity" in data_dict:
+        features["observation.velocity"] = Sequence(
+            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    if "observation.effort" in data_dict:
+        features["observation.effort"] = Sequence(
+            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 30
+    else:
+        raise NotImplementedError()
+
+    if not video:
+        raise NotImplementedError()
+
+    if encoding is not None:
+        warnings.warn(
+            "Video encoding is currently done outside of LeRobot for the dora_parquet format.",
+            stacklevel=1,
+        )
+
+    data_df = load_from_raw(raw_dir, videos_dir, fps, episodes)
+    hf_dataset = to_hf_dataset(data_df, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = "unknown"
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py

@@ -0,0 +1,312 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+For all datasets in the RLDS format.
+For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets.
+
+NOTE: You need to install tensorflow and tensorflow_datasets before running this script.
+
+Example:
+    python lerobot/scripts/push_dataset_to_hub.py \
+        --raw-dir /path/to/data/bridge_dataset/1.0.0/ \
+        --repo-id your_hub/sampled_bridge_data_v2 \
+        --raw-format rlds \
+        --episodes 3 4 5 8 9
+
+Exact dataset fps defined in openx/config.py, obtained from:
+    https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R
+"""
+
+import shutil
+from pathlib import Path
+
+import numpy as np
+import tensorflow as tf
+import tensorflow_datasets as tfds
+import torch
+import tqdm
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    calculate_episode_data_index,
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+np.set_printoptions(precision=2)
+
+
+def tf_to_torch(data):
+    return torch.from_numpy(data.numpy())
+
+
+def tf_img_convert(img):
+    if img.dtype == tf.string:
+        img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8)
+    elif img.dtype != tf.uint8:
+        raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}")
+    return img.numpy()
+
+
+def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict:
+    """
+    In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps"
+    entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the
+    trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`.
+
+    NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/
+    """
+    steps = traj.pop("steps")
+
+    traj_len = tf.shape(tf.nest.flatten(steps)[0])[0]
+
+    # broadcast metadata to the length of the trajectory
+    metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj)
+
+    # put steps back in
+    assert "traj_metadata" not in steps
+    traj = {**steps, "traj_metadata": metadata}
+
+    assert "_len" not in traj
+    assert "_traj_index" not in traj
+    assert "_frame_index" not in traj
+    traj["_len"] = tf.repeat(traj_len, traj_len)
+    traj["_traj_index"] = tf.repeat(i, traj_len)
+    traj["_frame_index"] = tf.range(traj_len)
+
+    return traj
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    """
+    Args:
+        raw_dir (Path): _description_
+        videos_dir (Path): _description_
+        fps (int): _description_
+        video (bool): _description_
+        episodes (list[int] | None, optional): _description_. Defaults to None.
+    """
+    ds_builder = tfds.builder_from_directory(str(raw_dir))
+    dataset = ds_builder.as_dataset(
+        split="all",
+        decoders={"steps": tfds.decode.SkipDecoding()},
+    )
+
+    dataset_info = ds_builder.info
+    print("dataset_info: ", dataset_info)
+
+    ds_length = len(dataset)
+    dataset = dataset.take(ds_length)
+    # "flatten" the dataset as such we can apply trajectory level map() easily
+    # each [obs][key] has a shape of (frame_size, ...)
+    dataset = dataset.enumerate().map(_broadcast_metadata_rlds)
+
+    # we will apply the standardization transform if the dataset_name is provided
+    # if the dataset name is not provided and the goal is to convert any rlds formatted dataset
+    # search for 'image' keys in the observations
+    image_keys = []
+    state_keys = []
+    observation_info = dataset_info.features["steps"]["observation"]
+    for key in observation_info:
+        # check whether the key is for an image or a vector observation
+        if len(observation_info[key].shape) == 3:
+            # only adding uint8 images discards depth images
+            if observation_info[key].dtype == tf.uint8:
+                image_keys.append(key)
+        else:
+            state_keys.append(key)
+
+    lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None
+
+    print(" - image_keys: ", image_keys)
+    print(" - lang_key: ", lang_key)
+
+    it = iter(dataset)
+
+    ep_dicts = []
+    # Init temp path to save ep_dicts in case of crash
+    tmp_ep_dicts_dir = videos_dir.parent.joinpath("ep_dicts")
+    tmp_ep_dicts_dir.mkdir(parents=True, exist_ok=True)
+
+    # check if ep_dicts have already been saved in /tmp
+    starting_ep_idx = 0
+    saved_ep_dicts = [ep.__str__() for ep in tmp_ep_dicts_dir.iterdir()]
+    if len(saved_ep_dicts) > 0:
+        saved_ep_dicts.sort()
+        # get last ep_idx number
+        starting_ep_idx = int(saved_ep_dicts[-1][-13:-3]) + 1
+        for i in range(starting_ep_idx):
+            episode = next(it)
+            ep_dicts.append(torch.load(saved_ep_dicts[i]))
+
+    # if we user specified episodes, skip the ones not in the list
+    if episodes is not None:
+        if ds_length == 0:
+            raise ValueError("No episodes found.")
+        # convert episodes index to sorted list
+        episodes = sorted(episodes)
+
+    for ep_idx in tqdm.tqdm(range(starting_ep_idx, ds_length)):
+        episode = next(it)
+
+        # if user specified episodes, skip the ones not in the list
+        if episodes is not None:
+            if len(episodes) == 0:
+                break
+            if ep_idx == episodes[0]:
+                # process this episode
+                print(" selecting episode idx: ", ep_idx)
+                episodes.pop(0)
+            else:
+                continue  # skip
+
+        num_frames = episode["action"].shape[0]
+
+        ep_dict = {}
+        for key in state_keys:
+            ep_dict[f"observation.{key}"] = tf_to_torch(episode["observation"][key])
+
+        ep_dict["action"] = tf_to_torch(episode["action"])
+        ep_dict["next.reward"] = tf_to_torch(episode["reward"]).float()
+        ep_dict["next.done"] = tf_to_torch(episode["is_last"])
+        ep_dict["is_terminal"] = tf_to_torch(episode["is_terminal"])
+        ep_dict["is_first"] = tf_to_torch(episode["is_first"])
+        ep_dict["discount"] = tf_to_torch(episode["discount"])
+
+        # If lang_key is present, convert the entire tensor at once
+        if lang_key is not None:
+            ep_dict["language_instruction"] = [x.numpy().decode("utf-8") for x in episode[lang_key]]
+
+        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
+        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+
+        image_array_dict = {key: [] for key in image_keys}
+
+        for im_key in image_keys:
+            imgs = episode["observation"][im_key]
+            image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
+
+        # loop through all cameras
+        for im_key in image_keys:
+            img_key = f"observation.images.{im_key}"
+            imgs_array = image_array_dict[im_key]
+            imgs_array = np.array(imgs_array)
+            if video:
+                # save png images in temporary directory
+                tmp_imgs_dir = videos_dir / "tmp_images"
+                save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                # encode images to a mp4 video
+                fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                video_path = videos_dir / fname
+                encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                # clean temporary images directory
+                shutil.rmtree(tmp_imgs_dir)
+
+                # store the reference to the video frame
+                ep_dict[img_key] = [
+                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                ]
+            else:
+                ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+        path_ep_dict = tmp_ep_dicts_dir.joinpath(
+            "ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt"
+        )
+        torch.save(ep_dict, path_ep_dict)
+
+        ep_dicts.append(ep_dict)
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+
+    for key in data_dict:
+        # check if vector state obs
+        if key.startswith("observation.") and "observation.images." not in key:
+            features[key] = Sequence(length=data_dict[key].shape[1], feature=Value(dtype="float32", id=None))
+        # check if image obs
+        elif "observation.images." in key:
+            if video:
+                features[key] = VideoFrame()
+            else:
+                features[key] = Image()
+
+    if "language_instruction" in data_dict:
+        features["language_instruction"] = Value(dtype="string", id=None)
+
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+
+    features["is_terminal"] = Value(dtype="bool", id=None)
+    features["is_first"] = Value(dtype="bool", id=None)
+    features["discount"] = Value(dtype="float32", id=None)
+
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.reward"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/pusht_zarr_format.py

@@ -0,0 +1,275 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Process zarr files formatted like in: https://github.com/real-stanford/diffusion_policy"""
+
+import shutil
+from pathlib import Path
+
+import numpy as np
+import torch
+import tqdm
+import zarr
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    calculate_episode_data_index,
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+
+def check_format(raw_dir):
+    zarr_path = raw_dir / "pusht_cchi_v7_replay.zarr"
+    zarr_data = zarr.open(zarr_path, mode="r")
+
+    required_datasets = {
+        "data/action",
+        "data/img",
+        "data/keypoint",
+        "data/n_contacts",
+        "data/state",
+        "meta/episode_ends",
+    }
+    for dataset in required_datasets:
+        assert dataset in zarr_data
+    nb_frames = zarr_data["data/img"].shape[0]
+
+    required_datasets.remove("meta/episode_ends")
+
+    assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    keypoints_instead_of_image: bool = False,
+    encoding: dict | None = None,
+):
+    try:
+        import pymunk
+        from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
+
+        from lerobot.common.datasets.push_dataset_to_hub._diffusion_policy_replay_buffer import (
+            ReplayBuffer as DiffusionPolicyReplayBuffer,
+        )
+    except ModuleNotFoundError as e:
+        print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
+        raise e
+    # as define in gmy-pusht env: https://github.com/huggingface/gym-pusht/blob/e0684ff988d223808c0a9dcfaba9dc4991791370/gym_pusht/envs/pusht.py#L174
+    success_threshold = 0.95  # 95% coverage,
+
+    zarr_path = raw_dir / "pusht_cchi_v7_replay.zarr"
+    zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
+
+    episode_ids = torch.from_numpy(zarr_data.get_episode_idxs())
+    assert len(
+        {zarr_data[key].shape[0] for key in zarr_data.keys()}  # noqa: SIM118
+    ), "Some data type dont have the same number of total frames."
+
+    # TODO(rcadene): verify that goal pose is expected to be fixed
+    goal_pos_angle = np.array([256, 256, np.pi / 4])  # x, y, theta (in radians)
+    goal_body = PushTEnv.get_goal_pose_body(goal_pos_angle)
+
+    imgs = torch.from_numpy(zarr_data["img"])  # b h w c
+    states = torch.from_numpy(zarr_data["state"])
+    actions = torch.from_numpy(zarr_data["action"])
+
+    # load data indices from which each episode starts and ends
+    from_ids, to_ids = [], []
+    from_idx = 0
+    for to_idx in zarr_data.meta["episode_ends"]:
+        from_ids.append(from_idx)
+        to_ids.append(to_idx)
+        from_idx = to_idx
+
+    num_episodes = len(from_ids)
+
+    ep_dicts = []
+    ep_ids = episodes if episodes else range(num_episodes)
+    for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
+        from_idx = from_ids[selected_ep_idx]
+        to_idx = to_ids[selected_ep_idx]
+        num_frames = to_idx - from_idx
+
+        # sanity check
+        assert (episode_ids[from_idx:to_idx] == ep_idx).all()
+
+        # get image
+        if not keypoints_instead_of_image:
+            image = imgs[from_idx:to_idx]
+            assert image.min() >= 0.0
+            assert image.max() <= 255.0
+            image = image.type(torch.uint8)
+
+        # get state
+        state = states[from_idx:to_idx]
+        agent_pos = state[:, :2]
+        block_pos = state[:, 2:4]
+        block_angle = state[:, 4]
+
+        # get reward, success, done, and (maybe) keypoints
+        reward = torch.zeros(num_frames)
+        success = torch.zeros(num_frames, dtype=torch.bool)
+        if keypoints_instead_of_image:
+            keypoints = torch.zeros(num_frames, 16)  # 8 keypoints each with 2 coords
+        done = torch.zeros(num_frames, dtype=torch.bool)
+        for i in range(num_frames):
+            space = pymunk.Space()
+            space.gravity = 0, 0
+            space.damping = 0
+
+            # Add walls.
+            walls = [
+                PushTEnv.add_segment(space, (5, 506), (5, 5), 2),
+                PushTEnv.add_segment(space, (5, 5), (506, 5), 2),
+                PushTEnv.add_segment(space, (506, 5), (506, 506), 2),
+                PushTEnv.add_segment(space, (5, 506), (506, 506), 2),
+            ]
+            space.add(*walls)
+
+            block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
+            goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
+            block_geom = pymunk_to_shapely(block_body, block_body.shapes)
+            intersection_area = goal_geom.intersection(block_geom).area
+            goal_area = goal_geom.area
+            coverage = intersection_area / goal_area
+            reward[i] = np.clip(coverage / success_threshold, 0, 1)
+            success[i] = coverage > success_threshold
+            if keypoints_instead_of_image:
+                keypoints[i] = torch.from_numpy(PushTEnv.get_keypoints(block_shapes).flatten())
+
+        # last step of demonstration is considered done
+        done[-1] = True
+
+        ep_dict = {}
+
+        if not keypoints_instead_of_image:
+            imgs_array = [x.numpy() for x in image]
+            img_key = "observation.image"
+            if video:
+                # save png images in temporary directory
+                tmp_imgs_dir = videos_dir / "tmp_images"
+                save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                # encode images to a mp4 video
+                fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                video_path = videos_dir / fname
+                encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                # clean temporary images directory
+                shutil.rmtree(tmp_imgs_dir)
+
+                # store the reference to the video frame
+                ep_dict[img_key] = [
+                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                ]
+            else:
+                ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+        ep_dict["observation.state"] = agent_pos
+        if keypoints_instead_of_image:
+            ep_dict["observation.environment_state"] = keypoints
+        ep_dict["action"] = actions[from_idx:to_idx]
+        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+        # ep_dict["next.observation.image"] = image[1:],
+        # ep_dict["next.observation.state"] = agent_pos[1:],
+        # TODO(rcadene)] = verify that reward and done are aligned with image and agent_pos
+        ep_dict["next.reward"] = torch.cat([reward[1:], reward[[-1]]])
+        ep_dict["next.done"] = torch.cat([done[1:], done[[-1]]])
+        ep_dict["next.success"] = torch.cat([success[1:], success[[-1]]])
+        ep_dicts.append(ep_dict)
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video, keypoints_instead_of_image: bool = False):
+    features = {}
+
+    if not keypoints_instead_of_image:
+        if video:
+            features["observation.image"] = VideoFrame()
+        else:
+            features["observation.image"] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    if keypoints_instead_of_image:
+        features["observation.environment_state"] = Sequence(
+            length=data_dict["observation.environment_state"].shape[1],
+            feature=Value(dtype="float32", id=None),
+        )
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.reward"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["next.success"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # Manually change this to True to use keypoints of the T instead of an image observation (but don't merge
+    # with True). Also make sure to use video = 0 in the `push_dataset_to_hub.py` script.
+    keypoints_instead_of_image = False
+
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 10
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, keypoints_instead_of_image, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video, keypoints_instead_of_image)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video if not keypoints_instead_of_image else 0,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/umi_zarr_format.py

@@ -0,0 +1,234 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Process UMI (Universal Manipulation Interface) data stored in Zarr format like in: https://github.com/real-stanford/universal_manipulation_interface"""
+
+import logging
+import shutil
+from pathlib import Path
+
+import torch
+import tqdm
+import zarr
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    calculate_episode_data_index,
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+
+def check_format(raw_dir) -> bool:
+    zarr_path = raw_dir / "cup_in_the_wild.zarr"
+    zarr_data = zarr.open(zarr_path, mode="r")
+
+    required_datasets = {
+        "data/robot0_demo_end_pose",
+        "data/robot0_demo_start_pose",
+        "data/robot0_eef_pos",
+        "data/robot0_eef_rot_axis_angle",
+        "data/robot0_gripper_width",
+        "meta/episode_ends",
+        "data/camera0_rgb",
+    }
+    for dataset in required_datasets:
+        if dataset not in zarr_data:
+            return False
+
+    # mandatory to access zarr_data
+    register_codecs()
+    nb_frames = zarr_data["data/camera0_rgb"].shape[0]
+
+    required_datasets.remove("meta/episode_ends")
+    assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    zarr_path = raw_dir / "cup_in_the_wild.zarr"
+    zarr_data = zarr.open(zarr_path, mode="r")
+
+    # We process the image data separately because it is too large to fit in memory
+    end_pose = torch.from_numpy(zarr_data["data/robot0_demo_end_pose"][:])
+    start_pos = torch.from_numpy(zarr_data["data/robot0_demo_start_pose"][:])
+    eff_pos = torch.from_numpy(zarr_data["data/robot0_eef_pos"][:])
+    eff_rot_axis_angle = torch.from_numpy(zarr_data["data/robot0_eef_rot_axis_angle"][:])
+    gripper_width = torch.from_numpy(zarr_data["data/robot0_gripper_width"][:])
+
+    states_pos = torch.cat([eff_pos, eff_rot_axis_angle], dim=1)
+    states = torch.cat([states_pos, gripper_width], dim=1)
+
+    episode_ends = zarr_data["meta/episode_ends"][:]
+    num_episodes = episode_ends.shape[0]
+
+    # We convert it in torch tensor later because the jit function does not support torch tensors
+    episode_ends = torch.from_numpy(episode_ends)
+
+    # load data indices from which each episode starts and ends
+    from_ids, to_ids = [], []
+    from_idx = 0
+    for to_idx in episode_ends:
+        from_ids.append(from_idx)
+        to_ids.append(to_idx)
+        from_idx = to_idx
+
+    ep_dicts_dir = videos_dir / "ep_dicts"
+    ep_dicts_dir.mkdir(exist_ok=True, parents=True)
+    ep_dicts = []
+
+    ep_ids = episodes if episodes else range(num_episodes)
+    for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
+        ep_dict_path = ep_dicts_dir / f"{ep_idx}"
+        if not ep_dict_path.is_file():
+            from_idx = from_ids[selected_ep_idx]
+            to_idx = to_ids[selected_ep_idx]
+            num_frames = to_idx - from_idx
+
+            # TODO(rcadene): save temporary images of the episode?
+
+            state = states[from_idx:to_idx]
+
+            ep_dict = {}
+
+            # load 57MB of images in RAM (400x224x224x3 uint8)
+            imgs_array = zarr_data["data/camera0_rgb"][from_idx:to_idx]
+            img_key = "observation.image"
+            if video:
+                fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                video_path = videos_dir / fname
+                if not video_path.is_file():
+                    # save png images in temporary directory
+                    tmp_imgs_dir = videos_dir / "tmp_images"
+                    save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                    # encode images to a mp4 video
+                    encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                    # clean temporary images directory
+                    shutil.rmtree(tmp_imgs_dir)
+
+                # store the reference to the video frame
+                ep_dict[img_key] = [
+                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                ]
+            else:
+                ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+            ep_dict["observation.state"] = state
+            ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+            ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+            ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+            ep_dict["episode_data_index_from"] = torch.tensor([from_idx] * num_frames)
+            ep_dict["episode_data_index_to"] = torch.tensor([from_idx + num_frames] * num_frames)
+            ep_dict["end_pose"] = end_pose[from_idx:to_idx]
+            ep_dict["start_pos"] = start_pos[from_idx:to_idx]
+            ep_dict["gripper_width"] = gripper_width[from_idx:to_idx]
+            torch.save(ep_dict, ep_dict_path)
+        else:
+            ep_dict = torch.load(ep_dict_path)
+
+        ep_dicts.append(ep_dict)
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video):
+    features = {}
+
+    if video:
+        features["observation.image"] = VideoFrame()
+    else:
+        features["observation.image"] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+    features["episode_data_index_from"] = Value(dtype="int64", id=None)
+    features["episode_data_index_to"] = Value(dtype="int64", id=None)
+    # `start_pos` and `end_pos` respectively represent the positions of the end-effector
+    # at the beginning and the end of the episode.
+    # `gripper_width` indicates the distance between the grippers, and this value is included
+    # in the state vector, which comprises the concatenation of the end-effector position
+    # and gripper width.
+    features["end_pose"] = Sequence(
+        length=data_dict["end_pose"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["start_pos"] = Sequence(
+        length=data_dict["start_pos"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["gripper_width"] = Sequence(
+        length=data_dict["gripper_width"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        # For umi cup in the wild: https://arxiv.org/pdf/2402.10329#table.caption.16
+        fps = 10
+
+    if not video:
+        logging.warning(
+            "Generating UMI dataset without `video=True` creates ~150GB on disk and requires ~80GB in RAM."
+        )
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/utils.py

@@ -77,9 +77,7 @@ def check_repo_id(repo_id: str) -> None:
 
 
 # TODO(aliberts): remove
-def calculate_episode_data_index(
-    hf_dataset: datasets.Dataset,
-) -> Dict[str, torch.Tensor]:
+def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torch.Tensor]:
     """
     Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
 

lerobot/common/datasets/push_dataset_to_hub/xarm_pkl_format.py

@@ -0,0 +1,200 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Process pickle files formatted like in: https://github.com/fyhMer/fowm"""
+
+import pickle
+import shutil
+from pathlib import Path
+
+import einops
+import torch
+import tqdm
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    calculate_episode_data_index,
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+
+def check_format(raw_dir):
+    keys = {"actions", "rewards", "dones"}
+    nested_keys = {"observations": {"rgb", "state"}, "next_observations": {"rgb", "state"}}
+
+    xarm_files = list(raw_dir.glob("*.pkl"))
+    assert len(xarm_files) > 0
+
+    with open(xarm_files[0], "rb") as f:
+        dataset_dict = pickle.load(f)
+
+    assert isinstance(dataset_dict, dict)
+    assert all(k in dataset_dict for k in keys)
+
+    # Check for consistent lengths in nested keys
+    expected_len = len(dataset_dict["actions"])
+    assert all(len(dataset_dict[key]) == expected_len for key in keys if key in dataset_dict)
+
+    for key, subkeys in nested_keys.items():
+        nested_dict = dataset_dict.get(key, {})
+        assert all(len(nested_dict[subkey]) == expected_len for subkey in subkeys if subkey in nested_dict)
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    pkl_path = raw_dir / "buffer.pkl"
+
+    with open(pkl_path, "rb") as f:
+        pkl_data = pickle.load(f)
+
+    # load data indices from which each episode starts and ends
+    from_ids, to_ids = [], []
+    from_idx, to_idx = 0, 0
+    for done in pkl_data["dones"]:
+        to_idx += 1
+        if not done:
+            continue
+        from_ids.append(from_idx)
+        to_ids.append(to_idx)
+        from_idx = to_idx
+
+    num_episodes = len(from_ids)
+
+    ep_dicts = []
+    ep_ids = episodes if episodes else range(num_episodes)
+    for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
+        from_idx = from_ids[selected_ep_idx]
+        to_idx = to_ids[selected_ep_idx]
+        num_frames = to_idx - from_idx
+
+        image = torch.tensor(pkl_data["observations"]["rgb"][from_idx:to_idx])
+        image = einops.rearrange(image, "b c h w -> b h w c")
+        state = torch.tensor(pkl_data["observations"]["state"][from_idx:to_idx])
+        action = torch.tensor(pkl_data["actions"][from_idx:to_idx])
+        # TODO(rcadene): we have a missing last frame which is the observation when the env is done
+        # it is critical to have this frame for tdmpc to predict a "done observation/state"
+        # next_image = torch.tensor(pkl_data["next_observations"]["rgb"][from_idx:to_idx])
+        # next_state = torch.tensor(pkl_data["next_observations"]["state"][from_idx:to_idx])
+        next_reward = torch.tensor(pkl_data["rewards"][from_idx:to_idx])
+        next_done = torch.tensor(pkl_data["dones"][from_idx:to_idx])
+
+        ep_dict = {}
+
+        imgs_array = [x.numpy() for x in image]
+        img_key = "observation.image"
+        if video:
+            # save png images in temporary directory
+            tmp_imgs_dir = videos_dir / "tmp_images"
+            save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+            # encode images to a mp4 video
+            fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+            video_path = videos_dir / fname
+            encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+            # clean temporary images directory
+            shutil.rmtree(tmp_imgs_dir)
+
+            # store the reference to the video frame
+            ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
+        else:
+            ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+        ep_dict["observation.state"] = state
+        ep_dict["action"] = action
+        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+        # ep_dict["next.observation.image"] = next_image
+        # ep_dict["next.observation.state"] = next_state
+        ep_dict["next.reward"] = next_reward
+        ep_dict["next.done"] = next_done
+        ep_dicts.append(ep_dict)
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video):
+    features = {}
+
+    if video:
+        features["observation.image"] = VideoFrame()
+    else:
+        features["observation.image"] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.reward"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+    # TODO(rcadene): add success
+    # features["next.success"] = Value(dtype='bool', id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 15
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/sampler.py

@@ -43,10 +43,7 @@ class EpisodeAwareSampler:
         ):
             if episode_indices_to_use is None or episode_idx in episode_indices_to_use:
                 indices.extend(
-                    range(
-                        start_index.item() + drop_n_first_frames,
-                        end_index.item() - drop_n_last_frames,
-                    )
+                    range(start_index.item() + drop_n_first_frames, end_index.item() - drop_n_last_frames)
                 )
 
         self.indices = indices

lerobot/common/datasets/utils.py

@@ -225,10 +225,7 @@ def load_episodes(local_dir: Path) -> dict:
 def write_episode_stats(episode_index: int, episode_stats: dict, local_dir: Path):
     # We wrap episode_stats in a dictionary since `episode_stats["episode_index"]`
     # is a dictionary of stats and not an integer.
-    episode_stats = {
-        "episode_index": episode_index,
-        "stats": serialize_dict(episode_stats),
-    }
+    episode_stats = {"episode_index": episode_index, "stats": serialize_dict(episode_stats)}
     append_jsonlines(episode_stats, local_dir / EPISODES_STATS_PATH)
 
 
@@ -243,7 +240,7 @@ def load_episodes_stats(local_dir: Path) -> dict:
 def backward_compatible_episodes_stats(
     stats: dict[str, dict[str, np.ndarray]], episodes: list[int]
 ) -> dict[str, dict[str, np.ndarray]]:
-    return dict.fromkeys(episodes, stats)
+    return {ep_idx: stats for ep_idx in episodes}
 
 
 def load_image_as_numpy(
@@ -412,7 +409,7 @@ def dataset_to_policy_features(features: dict[str, dict]) -> dict[str, PolicyFea
 
             names = ft["names"]
             # Backward compatibility for "channel" which is an error introduced in LeRobotDataset v2.0 for ported datasets.
-            if names is not None and names[2] in ["channel", "channels"]:  # (h, w, c) -> (c, h, w)
+            if names[2] in ["channel", "channels"]:  # (h, w, c) -> (c, h, w)
                 shape = (shape[2], shape[0], shape[1])
         elif key == "observation.environment_state":
             type = FeatureType.ENV
@@ -543,10 +540,7 @@ def check_timestamps_sync(
 
 
 def check_delta_timestamps(
-    delta_timestamps: dict[str, list[float]],
-    fps: int,
-    tolerance_s: float,
-    raise_value_error: bool = True,
+    delta_timestamps: dict[str, list[float]], fps: int, tolerance_s: float, raise_value_error: bool = True
 ) -> bool:
     """This will check if all the values in delta_timestamps are multiples of 1/fps +/- tolerance.
     This is to ensure that these delta_timestamps added to any timestamp from a dataset will themselves be

lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py

@@ -118,10 +118,7 @@ DATASETS = {
         "single_task": "Place the battery into the slot of the remote controller.",
         **ALOHA_STATIC_INFO,
     },
-    "aloha_static_candy": {
-        "single_task": "Pick up the candy and unwrap it.",
-        **ALOHA_STATIC_INFO,
-    },
+    "aloha_static_candy": {"single_task": "Pick up the candy and unwrap it.", **ALOHA_STATIC_INFO},
     "aloha_static_coffee": {
         "single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray, then push the 'Hot Water' and 'Travel Mug' buttons.",
         **ALOHA_STATIC_INFO,
@@ -170,22 +167,13 @@ DATASETS = {
         "single_task": "Pick up the plastic cup with the left arm, then pop its lid open with the right arm.",
         **ALOHA_STATIC_INFO,
     },
-    "aloha_static_ziploc_slide": {
-        "single_task": "Slide open the ziploc bag.",
-        **ALOHA_STATIC_INFO,
-    },
-    "aloha_sim_insertion_scripted": {
-        "single_task": "Insert the peg into the socket.",
-        **ALOHA_STATIC_INFO,
-    },
+    "aloha_static_ziploc_slide": {"single_task": "Slide open the ziploc bag.", **ALOHA_STATIC_INFO},
+    "aloha_sim_insertion_scripted": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
     "aloha_sim_insertion_scripted_image": {
         "single_task": "Insert the peg into the socket.",
         **ALOHA_STATIC_INFO,
     },
-    "aloha_sim_insertion_human": {
-        "single_task": "Insert the peg into the socket.",
-        **ALOHA_STATIC_INFO,
-    },
+    "aloha_sim_insertion_human": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
     "aloha_sim_insertion_human_image": {
         "single_task": "Insert the peg into the socket.",
         **ALOHA_STATIC_INFO,
@@ -206,19 +194,10 @@ DATASETS = {
         "single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
         **ALOHA_STATIC_INFO,
     },
-    "pusht": {
-        "single_task": "Push the T-shaped block onto the T-shaped target.",
-        **PUSHT_INFO,
-    },
-    "pusht_image": {
-        "single_task": "Push the T-shaped block onto the T-shaped target.",
-        **PUSHT_INFO,
-    },
+    "pusht": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
+    "pusht_image": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
     "unitreeh1_fold_clothes": {"single_task": "Fold the sweatshirt.", **UNITREEH_INFO},
-    "unitreeh1_rearrange_objects": {
-        "single_task": "Put the object into the bin.",
-        **UNITREEH_INFO,
-    },
+    "unitreeh1_rearrange_objects": {"single_task": "Put the object into the bin.", **UNITREEH_INFO},
     "unitreeh1_two_robot_greeting": {
         "single_task": "Greet the other robot with a high five.",
         **UNITREEH_INFO,
@@ -228,31 +207,13 @@ DATASETS = {
         **UNITREEH_INFO,
     },
     "xarm_lift_medium": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
-    "xarm_lift_medium_image": {
-        "single_task": "Pick up the cube and lift it.",
-        **XARM_INFO,
-    },
-    "xarm_lift_medium_replay": {
-        "single_task": "Pick up the cube and lift it.",
-        **XARM_INFO,
-    },
-    "xarm_lift_medium_replay_image": {
-        "single_task": "Pick up the cube and lift it.",
-        **XARM_INFO,
-    },
+    "xarm_lift_medium_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
+    "xarm_lift_medium_replay": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
+    "xarm_lift_medium_replay_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
     "xarm_push_medium": {"single_task": "Push the cube onto the target.", **XARM_INFO},
-    "xarm_push_medium_image": {
-        "single_task": "Push the cube onto the target.",
-        **XARM_INFO,
-    },
-    "xarm_push_medium_replay": {
-        "single_task": "Push the cube onto the target.",
-        **XARM_INFO,
-    },
-    "xarm_push_medium_replay_image": {
-        "single_task": "Push the cube onto the target.",
-        **XARM_INFO,
-    },
+    "xarm_push_medium_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
+    "xarm_push_medium_replay": {"single_task": "Push the cube onto the target.", **XARM_INFO},
+    "xarm_push_medium_replay_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
     "umi_cup_in_the_wild": {
         "single_task": "Put the cup on the plate.",
         "license": "apache-2.0",

lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py

@@ -379,12 +379,7 @@ def fix_lfs_video_files_tracking(work_dir: Path, lfs_untracked_videos: list[str]
     for i in range(0, len(lfs_untracked_videos), 100):
         files = lfs_untracked_videos[i : i + 100]
         try:
-            subprocess.run(
-                ["git", "rm", "--cached", *files],
-                cwd=work_dir,
-                capture_output=True,
-                check=True,
-            )
+            subprocess.run(["git", "rm", "--cached", *files], cwd=work_dir, capture_output=True, check=True)
         except subprocess.CalledProcessError as e:
             print("git rm --cached ERROR:")
             print(e.stderr)
@@ -407,17 +402,7 @@ def _lfs_clone(repo_id: str, work_dir: Path, branch: str) -> None:
     repo_url = f"https://huggingface.co/datasets/{repo_id}"
     env = {"GIT_LFS_SKIP_SMUDGE": "1"}  # Prevent downloading LFS files
     subprocess.run(
-        [
-            "git",
-            "clone",
-            "--branch",
-            branch,
-            "--single-branch",
-            "--depth",
-            "1",
-            repo_url,
-            str(work_dir),
-        ],
+        ["git", "clone", "--branch", branch, "--single-branch", "--depth", "1", repo_url, str(work_dir)],
         check=True,
         env=env,
     )
@@ -425,11 +410,7 @@ def _lfs_clone(repo_id: str, work_dir: Path, branch: str) -> None:
 
 def _get_lfs_untracked_videos(work_dir: Path, video_files: list[str]) -> list[str]:
     lfs_tracked_files = subprocess.run(
-        ["git", "lfs", "ls-files", "-n"],
-        cwd=work_dir,
-        capture_output=True,
-        text=True,
-        check=True,
+        ["git", "lfs", "ls-files", "-n"], cwd=work_dir, capture_output=True, text=True, check=True
     )
     lfs_tracked_files = set(lfs_tracked_files.stdout.splitlines())
     return [f for f in video_files if f not in lfs_tracked_files]
@@ -443,11 +424,7 @@ def get_videos_info(repo_id: str, local_dir: Path, video_keys: list[str], branch
     ]
     hub_api = HfApi()
     hub_api.snapshot_download(
-        repo_id=repo_id,
-        repo_type="dataset",
-        local_dir=local_dir,
-        revision=branch,
-        allow_patterns=video_files,
+        repo_id=repo_id, repo_type="dataset", local_dir=local_dir, revision=branch, allow_patterns=video_files
     )
     videos_info_dict = {}
     for vid_key, vid_path in zip(video_keys, video_files, strict=True):
@@ -474,11 +451,7 @@ def convert_dataset(
 
     hub_api = HfApi()
     hub_api.snapshot_download(
-        repo_id=repo_id,
-        repo_type="dataset",
-        revision=v1,
-        local_dir=v1x_dir,
-        ignore_patterns="videos*/",
+        repo_id=repo_id, repo_type="dataset", revision=v1, local_dir=v1x_dir, ignore_patterns="videos*/"
     )
     branch = "main"
     if test_branch:
@@ -508,7 +481,7 @@ def convert_dataset(
 
     # Tasks
     if single_task:
-        tasks_by_episodes = dict.fromkeys(episode_indices, single_task)
+        tasks_by_episodes = {ep_idx: single_task for ep_idx in episode_indices}
         dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
         tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
     elif tasks_path:
@@ -536,21 +509,12 @@ def convert_dataset(
         dataset = dataset.remove_columns(video_keys)
         clean_gitattr = Path(
             hub_api.hf_hub_download(
-                repo_id=GITATTRIBUTES_REF,
-                repo_type="dataset",
-                local_dir=local_dir,
-                filename=".gitattributes",
+                repo_id=GITATTRIBUTES_REF, repo_type="dataset", local_dir=local_dir, filename=".gitattributes"
             )
         ).absolute()
         with tempfile.TemporaryDirectory() as tmp_video_dir:
             move_videos(
-                repo_id,
-                video_keys,
-                total_episodes,
-                total_chunks,
-                Path(tmp_video_dir),
-                clean_gitattr,
-                branch,
+                repo_id, video_keys, total_episodes, total_chunks, Path(tmp_video_dir), clean_gitattr, branch
             )
         videos_info = get_videos_info(repo_id, v1x_dir, video_keys=video_keys, branch=branch)
         for key in video_keys:
@@ -579,11 +543,7 @@ def convert_dataset(
 
     # Episodes
     episodes = [
-        {
-            "episode_index": ep_idx,
-            "tasks": tasks_by_episodes[ep_idx],
-            "length": episode_lengths[ep_idx],
-        }
+        {"episode_index": ep_idx, "tasks": tasks_by_episodes[ep_idx], "length": episode_lengths[ep_idx]}
         for ep_idx in episode_indices
     ]
     write_jsonlines(episodes, v20_dir / EPISODES_PATH)
@@ -612,12 +572,7 @@ def convert_dataset(
         hub_api.delete_folder(repo_id=repo_id, path_in_repo="data", repo_type="dataset", revision=branch)
 
     with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
-        hub_api.delete_folder(
-            repo_id=repo_id,
-            path_in_repo="meta_data",
-            repo_type="dataset",
-            revision=branch,
-        )
+        hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta_data", repo_type="dataset", revision=branch)
 
     with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
         hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta", repo_type="dataset", revision=branch)

lerobot/common/datasets/v21/convert_dataset_v20_to_v21.py

@@ -37,16 +37,8 @@ import logging
 from huggingface_hub import HfApi
 
 from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION, LeRobotDataset
-from lerobot.common.datasets.utils import (
-    EPISODES_STATS_PATH,
-    STATS_PATH,
-    load_stats,
-    write_info,
-)
-from lerobot.common.datasets.v21.convert_stats import (
-    check_aggregate_stats,
-    convert_stats,
-)
+from lerobot.common.datasets.utils import EPISODES_STATS_PATH, STATS_PATH, load_stats, write_info
+from lerobot.common.datasets.v21.convert_stats import check_aggregate_stats, convert_stats
 
 V20 = "v2.0"
 V21 = "v2.1"
@@ -87,16 +79,10 @@ def convert_dataset(
 
     hub_api = HfApi()
     if hub_api.file_exists(
-        repo_id=dataset.repo_id,
-        filename=STATS_PATH,
-        revision=branch,
-        repo_type="dataset",
+        repo_id=dataset.repo_id, filename=STATS_PATH, revision=branch, repo_type="dataset"
     ):
         hub_api.delete_file(
-            path_in_repo=STATS_PATH,
-            repo_id=dataset.repo_id,
-            revision=branch,
-            repo_type="dataset",
+            path_in_repo=STATS_PATH, repo_id=dataset.repo_id, revision=branch, repo_type="dataset"
         )
 
     hub_api.create_tag(repo_id, tag=CODEBASE_VERSION, revision=branch, repo_type="dataset")

lerobot/common/datasets/v21/convert_stats.py

@@ -17,11 +17,7 @@ from concurrent.futures import ThreadPoolExecutor, as_completed
 import numpy as np
 from tqdm import tqdm
 
-from lerobot.common.datasets.compute_stats import (
-    aggregate_stats,
-    get_feature_stats,
-    sample_indices,
-)
+from lerobot.common.datasets.compute_stats import aggregate_stats, get_feature_stats, sample_indices
 from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
 from lerobot.common.datasets.utils import write_episode_stats
 
@@ -99,9 +95,5 @@ def check_aggregate_stats(
             if key in reference_stats and stat in reference_stats[key]:
                 err_msg = f"feature='{key}' stats='{stat}'"
                 np.testing.assert_allclose(
-                    val,
-                    reference_stats[key][stat],
-                    rtol=rtol,
-                    atol=atol,
-                    err_msg=err_msg,
+                    val, reference_stats[key][stat], rtol=rtol, atol=atol, err_msg=err_msg
                 )

lerobot/common/datasets/video_utils.py

@@ -13,7 +13,6 @@
 # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
 # See the License for the specific language governing permissions and
 # limitations under the License.
-import importlib
 import json
 import logging
 import subprocess
@@ -28,23 +27,14 @@ import torch
 import torchvision
 from datasets.features.features import register_feature
 from PIL import Image
-
-
-def get_safe_default_codec():
-    if importlib.util.find_spec("torchcodec"):
-        return "torchcodec"
-    else:
-        logging.warning(
-            "'torchcodec' is not available in your platform, falling back to 'pyav' as a default decoder"
-        )
-        return "pyav"
+from torchcodec.decoders import VideoDecoder
 
 
 def decode_video_frames(
     video_path: Path | str,
     timestamps: list[float],
     tolerance_s: float,
-    backend: str | None = None,
+    backend: str = "torchcodec",
 ) -> torch.Tensor:
     """
     Decodes video frames using the specified backend.
@@ -53,15 +43,13 @@ def decode_video_frames(
         video_path (Path): Path to the video file.
         timestamps (list[float]): List of timestamps to extract frames.
         tolerance_s (float): Allowed deviation in seconds for frame retrieval.
-        backend (str, optional): Backend to use for decoding. Defaults to "torchcodec" when available in the platform; otherwise, defaults to "pyav"..
+        backend (str, optional): Backend to use for decoding. Defaults to "torchcodec".
 
     Returns:
         torch.Tensor: Decoded frames.
 
     Currently supports torchcodec on cpu and pyav.
     """
-    if backend is None:
-        backend = get_safe_default_codec()
     if backend == "torchcodec":
         return decode_video_frames_torchcodec(video_path, timestamps, tolerance_s)
     elif backend in ["pyav", "video_reader"]:
@@ -185,14 +173,9 @@ def decode_video_frames_torchcodec(
     and all subsequent frames until reaching the requested frame. The number of key frames in a video
     can be adjusted during encoding to take into account decoding time and video size in bytes.
     """
-
-    if importlib.util.find_spec("torchcodec"):
-        from torchcodec.decoders import VideoDecoder
-    else:
-        raise ImportError("torchcodec is required but not available.")
-
+    video_path = str(video_path)
     # initialize video decoder
-    decoder = VideoDecoder(video_path, device=device, seek_mode="approximate")
+    decoder = VideoDecoder(video_path, device=device)
     loaded_frames = []
     loaded_ts = []
     # get metadata for frame information
@@ -257,7 +240,6 @@ def encode_video_frames(
 ) -> None:
     """More info on ffmpeg arguments tuning on `benchmark/video/README.md`"""
     video_path = Path(video_path)
-    imgs_dir = Path(imgs_dir)
     video_path.parent.mkdir(parents=True, exist_ok=True)
 
     ffmpeg_args = OrderedDict(

lerobot/common/envs/configs.py

@@ -14,12 +14,10 @@
 
 import abc
 from dataclasses import dataclass, field
-from typing import Any, Dict, Optional, Tuple
 
 import draccus
 
 from lerobot.common.constants import ACTION, OBS_ENV, OBS_IMAGE, OBS_IMAGES, OBS_ROBOT
-from lerobot.common.robot_devices.robots.configs import RobotConfig
 from lerobot.configs.types import FeatureType, PolicyFeature
 
 
@@ -156,135 +154,3 @@ class XarmEnv(EnvConfig):
             "visualization_height": self.visualization_height,
             "max_episode_steps": self.episode_length,
         }
-
-
-@dataclass
-class VideoRecordConfig:
-    """Configuration for video recording in ManiSkill environments."""
-
-    enabled: bool = False
-    record_dir: str = "videos"
-    trajectory_name: str = "trajectory"
-
-
-@dataclass
-class WrapperConfig:
-    """Configuration for environment wrappers."""
-
-    joint_masking_action_space: list[bool] | None = None
-
-
-@dataclass
-class EEActionSpaceConfig:
-    """Configuration parameters for end-effector action space."""
-
-    x_step_size: float
-    y_step_size: float
-    z_step_size: float
-    bounds: Dict[str, Any]  # Contains 'min' and 'max' keys with position bounds
-    use_gamepad: bool = False
-
-
-@dataclass
-class EnvWrapperConfig:
-    """Configuration for environment wrappers."""
-
-    display_cameras: bool = False
-    use_relative_joint_positions: bool = True
-    add_joint_velocity_to_observation: bool = False
-    add_ee_pose_to_observation: bool = False
-    crop_params_dict: Optional[Dict[str, Tuple[int, int, int, int]]] = None
-    resize_size: Optional[Tuple[int, int]] = None
-    control_time_s: float = 20.0
-    fixed_reset_joint_positions: Optional[Any] = None
-    reset_time_s: float = 5.0
-    joint_masking_action_space: Optional[Any] = None
-    ee_action_space_params: Optional[EEActionSpaceConfig] = None
-    use_gripper: bool = False
-    gripper_quantization_threshold: float | None = 0.8
-    gripper_penalty: float = 0.0
-    gripper_penalty_in_reward: bool = False
-    open_gripper_on_reset: bool = False
-
-
-@EnvConfig.register_subclass(name="gym_manipulator")
-@dataclass
-class HILSerlRobotEnvConfig(EnvConfig):
-    """Configuration for the HILSerlRobotEnv environment."""
-
-    robot: Optional[RobotConfig] = None
-    wrapper: Optional[EnvWrapperConfig] = None
-    fps: int = 10
-    name: str = "real_robot"
-    mode: str = None  # Either "record", "replay", None
-    repo_id: Optional[str] = None
-    dataset_root: Optional[str] = None
-    task: str = ""
-    num_episodes: int = 10  # only for record mode
-    episode: int = 0
-    device: str = "cuda"
-    push_to_hub: bool = True
-    pretrained_policy_name_or_path: Optional[str] = None
-    reward_classifier: dict[str, str | None] = field(
-        default_factory=lambda: {
-            "pretrained_path": None,
-            "config_path": None,
-        }
-    )
-
-    def gym_kwargs(self) -> dict:
-        return {}
-
-
-@EnvConfig.register_subclass("maniskill_push")
-@dataclass
-class ManiskillEnvConfig(EnvConfig):
-    """Configuration for the ManiSkill environment."""
-
-    name: str = "maniskill/pushcube"
-    task: str = "PushCube-v1"
-    image_size: int = 64
-    control_mode: str = "pd_ee_delta_pose"
-    state_dim: int = 25
-    action_dim: int = 7
-    fps: int = 200
-    episode_length: int = 50
-    obs_type: str = "rgb"
-    render_mode: str = "rgb_array"
-    render_size: int = 64
-    device: str = "cuda"
-    robot: str = "so100"  # This is a hack to make the robot config work
-    video_record: VideoRecordConfig = field(default_factory=VideoRecordConfig)
-    wrapper: WrapperConfig = field(default_factory=WrapperConfig)
-    mock_gripper: bool = False
-    features: dict[str, PolicyFeature] = field(
-        default_factory=lambda: {
-            "action": PolicyFeature(type=FeatureType.ACTION, shape=(7,)),
-            "observation.image": PolicyFeature(type=FeatureType.VISUAL, shape=(3, 64, 64)),
-            "observation.state": PolicyFeature(type=FeatureType.STATE, shape=(25,)),
-        }
-    )
-    features_map: dict[str, str] = field(
-        default_factory=lambda: {
-            "action": ACTION,
-            "observation.image": OBS_IMAGE,
-            "observation.state": OBS_ROBOT,
-        }
-    )
-    reward_classifier: dict[str, str | None] = field(
-        default_factory=lambda: {
-            "pretrained_path": None,
-            "config_path": None,
-        }
-    )
-
-    @property
-    def gym_kwargs(self) -> dict:
-        return {
-            "obs_type": self.obs_type,
-            "render_mode": self.render_mode,
-            "max_episode_steps": self.episode_length,
-            "control_mode": self.control_mode,
-            "sensor_configs": {"width": self.image_size, "height": self.image_size},
-            "num_envs": 1,
-        }

lerobot/common/envs/utils.py

@@ -13,11 +13,7 @@
 # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
 # See the License for the specific language governing permissions and
 # limitations under the License.
-import warnings
-from typing import Any
-
 import einops
-import gymnasium as gym
 import numpy as np
 import torch
 from torch import Tensor
@@ -37,35 +33,29 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
     """
     # map to expected inputs for the policy
     return_observations = {}
-    # TODO: You have to merge all tensors from agent key and extra key
-    # You don't keep sensor param key in the observation
-    # And you keep sensor data rgb
-    for key, img in observations.items():
-        if "images" not in key:
-            continue
+    if "pixels" in observations:
+        if isinstance(observations["pixels"], dict):
+            imgs = {f"observation.images.{key}": img for key, img in observations["pixels"].items()}
+        else:
+            imgs = {"observation.image": observations["pixels"]}
 
-        # TODO(aliberts, rcadene): use transforms.ToTensor()?
-        if not torch.is_tensor(img):
+        for imgkey, img in imgs.items():
+            # TODO(aliberts, rcadene): use transforms.ToTensor()?
             img = torch.from_numpy(img)
 
-        if img.ndim == 3:
-            img = img.unsqueeze(0)
+            # sanity check that images are channel last
+            _, h, w, c = img.shape
+            assert c < h and c < w, f"expect channel last images, but instead got {img.shape=}"
 
-        # sanity check that images are channel last
-        _, h, w, c = img.shape
-        assert c < h and c < w, f"expect channel last images, but instead got {img.shape=}"
+            # sanity check that images are uint8
+            assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
 
-        # sanity check that images are uint8
-        assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
+            # convert to channel first of type float32 in range [0,1]
+            img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
+            img = img.type(torch.float32)
+            img /= 255
 
-        # convert to channel first of type float32 in range [0,1]
-        img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
-        img = img.type(torch.float32)
-        img /= 255
-
-        return_observations[key] = img
-        # obs state agent qpos and qvel
-        # image
+            return_observations[imgkey] = img
 
     if "environment_state" in observations:
         return_observations["observation.environment_state"] = torch.from_numpy(
@@ -74,8 +64,7 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
 
     # TODO(rcadene): enable pixels only baseline with `obs_type="pixels"` in environment by removing
     # requirement for "agent_pos"
-    # return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
-    return_observations["observation.state"] = observations["observation.state"].float()
+    return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
     return return_observations
 
 
@@ -93,46 +82,7 @@ def env_to_policy_features(env_cfg: EnvConfig) -> dict[str, PolicyFeature]:
         else:
             feature = ft
 
-        policy_key = env_cfg.features_map.get(key, key)
+        policy_key = env_cfg.features_map[key]
         policy_features[policy_key] = feature
 
     return policy_features
-
-
-def are_all_envs_same_type(env: gym.vector.VectorEnv) -> bool:
-    first_type = type(env.envs[0])  # Get type of first env
-    return all(type(e) is first_type for e in env.envs)  # Fast type check
-
-
-def check_env_attributes_and_types(env: gym.vector.VectorEnv) -> None:
-    with warnings.catch_warnings():
-        warnings.simplefilter("once", UserWarning)  # Apply filter only in this function
-
-        if not (
-            hasattr(env.envs[0], "task_description") and hasattr(env.envs[0], "task")
-        ):
-            warnings.warn(
-                "The environment does not have 'task_description' and 'task'. Some policies require these features.",
-                UserWarning,
-                stacklevel=2,
-            )
-        if not are_all_envs_same_type(env):
-            warnings.warn(
-                "The environments have different types. Make sure you infer the right task from each environment. Empty task will be passed instead.",
-                UserWarning,
-                stacklevel=2,
-            )
-
-
-def add_envs_task(
-    env: gym.vector.VectorEnv, observation: dict[str, Any]
-) -> dict[str, Any]:
-    """Adds task feature to the observation dict with respect to the first environment attribute."""
-    if hasattr(env.envs[0], "task_description"):
-        observation["task"] = env.call("task_description")
-    elif hasattr(env.envs[0], "task"):
-        observation["task"] = env.call("task")
-    else:  #  For envs without language instructions, e.g. aloha transfer cube and etc.
-        num_envs = observation[list(observation.keys())[0]].shape[0]
-        observation["task"] = ["" for _ in range(num_envs)]
-    return observation

lerobot/common/optim/optimizers.py

@@ -14,9 +14,8 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 import abc
-from dataclasses import asdict, dataclass, field
+from dataclasses import asdict, dataclass
 from pathlib import Path
-from typing import Any
 
 import draccus
 import torch
@@ -45,7 +44,7 @@ class OptimizerConfig(draccus.ChoiceRegistry, abc.ABC):
         return "adam"
 
     @abc.abstractmethod
-    def build(self) -> torch.optim.Optimizer | dict[str, torch.optim.Optimizer]:
+    def build(self) -> torch.optim.Optimizer:
         raise NotImplementedError
 
 
@@ -95,76 +94,7 @@ class SGDConfig(OptimizerConfig):
         return torch.optim.SGD(params, **kwargs)
 
 
-@OptimizerConfig.register_subclass("multi_adam")
-@dataclass
-class MultiAdamConfig(OptimizerConfig):
-    """Configuration for multiple Adam optimizers with different parameter groups.
-
-    This creates a dictionary of Adam optimizers, each with its own hyperparameters.
-
-    Args:
-        lr: Default learning rate (used if not specified for a group)
-        weight_decay: Default weight decay (used if not specified for a group)
-        optimizer_groups: Dictionary mapping parameter group names to their hyperparameters
-        grad_clip_norm: Gradient clipping norm
-    """
-
-    lr: float = 1e-3
-    weight_decay: float = 0.0
-    grad_clip_norm: float = 10.0
-    optimizer_groups: dict[str, dict[str, Any]] = field(default_factory=dict)
-
-    def build(self, params_dict: dict[str, list]) -> dict[str, torch.optim.Optimizer]:
-        """Build multiple Adam optimizers.
-
-        Args:
-            params_dict: Dictionary mapping parameter group names to lists of parameters
-                         The keys should match the keys in optimizer_groups
-
-        Returns:
-            Dictionary mapping parameter group names to their optimizers
-        """
-        optimizers = {}
-
-        for name, params in params_dict.items():
-            # Get group-specific hyperparameters or use defaults
-            group_config = self.optimizer_groups.get(name, {})
-
-            # Create optimizer with merged parameters (defaults + group-specific)
-            optimizer_kwargs = {
-                "lr": group_config.get("lr", self.lr),
-                "betas": group_config.get("betas", (0.9, 0.999)),
-                "eps": group_config.get("eps", 1e-5),
-                "weight_decay": group_config.get("weight_decay", self.weight_decay),
-            }
-
-            optimizers[name] = torch.optim.Adam(params, **optimizer_kwargs)
-
-        return optimizers
-
-
-def save_optimizer_state(
-    optimizer: torch.optim.Optimizer | dict[str, torch.optim.Optimizer], save_dir: Path
-) -> None:
-    """Save optimizer state to disk.
-
-    Args:
-        optimizer: Either a single optimizer or a dictionary of optimizers.
-        save_dir: Directory to save the optimizer state.
-    """
-    if isinstance(optimizer, dict):
-        # Handle dictionary of optimizers
-        for name, opt in optimizer.items():
-            optimizer_dir = save_dir / name
-            optimizer_dir.mkdir(exist_ok=True, parents=True)
-            _save_single_optimizer_state(opt, optimizer_dir)
-    else:
-        # Handle single optimizer
-        _save_single_optimizer_state(optimizer, save_dir)
-
-
-def _save_single_optimizer_state(optimizer: torch.optim.Optimizer, save_dir: Path) -> None:
-    """Save a single optimizer's state to disk."""
+def save_optimizer_state(optimizer: torch.optim.Optimizer, save_dir: Path) -> None:
     state = optimizer.state_dict()
     param_groups = state.pop("param_groups")
     flat_state = flatten_dict(state)
@@ -172,44 +102,11 @@ def _save_single_optimizer_state(optimizer: torch.optim.Optimizer, save_dir: Pat
     write_json(param_groups, save_dir / OPTIMIZER_PARAM_GROUPS)
 
 
-def load_optimizer_state(
-    optimizer: torch.optim.Optimizer | dict[str, torch.optim.Optimizer], save_dir: Path
-) -> torch.optim.Optimizer | dict[str, torch.optim.Optimizer]:
-    """Load optimizer state from disk.
-
-    Args:
-        optimizer: Either a single optimizer or a dictionary of optimizers.
-        save_dir: Directory to load the optimizer state from.
-
-    Returns:
-        The updated optimizer(s) with loaded state.
-    """
-    if isinstance(optimizer, dict):
-        # Handle dictionary of optimizers
-        loaded_optimizers = {}
-        for name, opt in optimizer.items():
-            optimizer_dir = save_dir / name
-            if optimizer_dir.exists():
-                loaded_optimizers[name] = _load_single_optimizer_state(opt, optimizer_dir)
-            else:
-                loaded_optimizers[name] = opt
-        return loaded_optimizers
-    else:
-        # Handle single optimizer
-        return _load_single_optimizer_state(optimizer, save_dir)
-
-
-def _load_single_optimizer_state(optimizer: torch.optim.Optimizer, save_dir: Path) -> torch.optim.Optimizer:
-    """Load a single optimizer's state from disk."""
+def load_optimizer_state(optimizer: torch.optim.Optimizer, save_dir: Path) -> torch.optim.Optimizer:
     current_state_dict = optimizer.state_dict()
     flat_state = load_file(save_dir / OPTIMIZER_STATE)
     state = unflatten_dict(flat_state)
-
-    # Handle case where 'state' key might not exist (for newly created optimizers)
-    if "state" in state:
-        loaded_state_dict = {"state": {int(k): v for k, v in state["state"].items()}}
-    else:
-        loaded_state_dict = {"state": {}}
+    loaded_state_dict = {"state": {int(k): v for k, v in state["state"].items()}}
 
     if "param_groups" in current_state_dict:
         param_groups = deserialize_json_into_object(

lerobot/common/optim/schedulers.py

@@ -49,11 +49,7 @@ class DiffuserSchedulerConfig(LRSchedulerConfig):
     def build(self, optimizer: Optimizer, num_training_steps: int) -> LambdaLR:
         from diffusers.optimization import get_scheduler
 
-        kwargs = {
-            **asdict(self),
-            "num_training_steps": num_training_steps,
-            "optimizer": optimizer,
-        }
+        kwargs = {**asdict(self), "num_training_steps": num_training_steps, "optimizer": optimizer}
         return get_scheduler(**kwargs)
 
 
@@ -75,10 +71,7 @@ class VQBeTSchedulerConfig(LRSchedulerConfig):
                 progress = float(adjusted_step - self.num_warmup_steps) / float(
                     max(1, num_training_steps - self.num_warmup_steps)
                 )
-                return max(
-                    0.0,
-                    0.5 * (1.0 + math.cos(math.pi * float(self.num_cycles) * 2.0 * progress)),
-                )
+                return max(0.0, 0.5 * (1.0 + math.cos(math.pi * float(self.num_cycles) * 2.0 * progress)))
 
         return LambdaLR(optimizer, lr_lambda, -1)
 

lerobot/common/policies/act/modeling_act.py

@@ -119,7 +119,9 @@ class ACTPolicy(PreTrainedPolicy):
         batch = self.normalize_inputs(batch)
         if self.config.image_features:
             batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
-            batch["observation.images"] = [batch[key] for key in self.config.image_features]
+            batch["observation.images"] = torch.stack(
+                [batch[key] for key in self.config.image_features], dim=-4
+            )
 
         # If we are doing temporal ensembling, do online updates where we keep track of the number of actions
         # we are ensembling over.
@@ -147,8 +149,9 @@ class ACTPolicy(PreTrainedPolicy):
         batch = self.normalize_inputs(batch)
         if self.config.image_features:
             batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
-            batch["observation.images"] = [batch[key] for key in self.config.image_features]
-
+            batch["observation.images"] = torch.stack(
+                [batch[key] for key in self.config.image_features], dim=-4
+            )
         batch = self.normalize_targets(batch)
         actions_hat, (mu_hat, log_sigma_x2_hat) = self.model(batch)
 
@@ -241,9 +244,7 @@ class ACTTemporalEnsembler:
             # Note: The last dimension is unsqueeze to make sure we can broadcast properly for tensor
             # operations later.
             self.ensembled_actions_count = torch.ones(
-                (self.chunk_size, 1),
-                dtype=torch.long,
-                device=self.ensembled_actions.device,
+                (self.chunk_size, 1), dtype=torch.long, device=self.ensembled_actions.device
             )
         else:
             # self.ensembled_actions will have shape (batch_size, chunk_size - 1, action_dim). Compute
@@ -255,10 +256,7 @@ class ACTTemporalEnsembler:
             # The last action, which has no prior online average, needs to get concatenated onto the end.
             self.ensembled_actions = torch.cat([self.ensembled_actions, actions[:, -1:]], dim=1)
             self.ensembled_actions_count = torch.cat(
-                [
-                    self.ensembled_actions_count,
-                    torch.ones_like(self.ensembled_actions_count[-1:]),
-                ]
+                [self.ensembled_actions_count, torch.ones_like(self.ensembled_actions_count[-1:])]
             )
         # "Consume" the first action.
         action, self.ensembled_actions, self.ensembled_actions_count = (
@@ -338,11 +336,7 @@ class ACT(nn.Module):
         # Backbone for image feature extraction.
         if self.config.image_features:
             backbone_model = getattr(torchvision.models, config.vision_backbone)(
-                replace_stride_with_dilation=[
-                    False,
-                    False,
-                    config.replace_final_stride_with_dilation,
-                ],
+                replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
                 weights=config.pretrained_backbone_weights,
                 norm_layer=FrozenBatchNorm2d,
             )
@@ -419,10 +413,11 @@ class ACT(nn.Module):
                 "actions must be provided when using the variational objective in training mode."
             )
 
-        if "observation.images" in batch:
-            batch_size = batch["observation.images"][0].shape[0]
-        else:
-            batch_size = batch["observation.environment_state"].shape[0]
+        batch_size = (
+            batch["observation.images"]
+            if "observation.images" in batch
+            else batch["observation.environment_state"]
+        ).shape[0]
 
         # Prepare the latent for input to the transformer encoder.
         if self.config.use_vae and "action" in batch:
@@ -436,11 +431,7 @@ class ACT(nn.Module):
             action_embed = self.vae_encoder_action_input_proj(batch["action"])  # (B, S, D)
 
             if self.config.robot_state_feature:
-                vae_encoder_input = [
-                    cls_embed,
-                    robot_state_embed,
-                    action_embed,
-                ]  # (B, S+2, D)
+                vae_encoder_input = [cls_embed, robot_state_embed, action_embed]  # (B, S+2, D)
             else:
                 vae_encoder_input = [cls_embed, action_embed]
             vae_encoder_input = torch.cat(vae_encoder_input, axis=1)
@@ -499,21 +490,20 @@ class ACT(nn.Module):
             all_cam_features = []
             all_cam_pos_embeds = []
 
-            # For a list of images, the H and W may vary but H*W is constant.
-            for img in batch["observation.images"]:
-                cam_features = self.backbone(img)["feature_map"]
+            for cam_index in range(batch["observation.images"].shape[-4]):
+                cam_features = self.backbone(batch["observation.images"][:, cam_index])["feature_map"]
+                # TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use
+                # buffer
                 cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(dtype=cam_features.dtype)
-                cam_features = self.encoder_img_feat_input_proj(cam_features)
-
-                # Rearrange features to (sequence, batch, dim).
-                cam_features = einops.rearrange(cam_features, "b c h w -> (h w) b c")
-                cam_pos_embed = einops.rearrange(cam_pos_embed, "b c h w -> (h w) b c")
-
+                cam_features = self.encoder_img_feat_input_proj(cam_features)  # (B, C, h, w)
                 all_cam_features.append(cam_features)
                 all_cam_pos_embeds.append(cam_pos_embed)
-
-            encoder_in_tokens.extend(torch.cat(all_cam_features, axis=0))
-            encoder_in_pos_embed.extend(torch.cat(all_cam_pos_embeds, axis=0))
+            # Concatenate camera observation feature maps and positional embeddings along the width dimension,
+            # and move to (sequence, batch, dim).
+            all_cam_features = torch.cat(all_cam_features, axis=-1)
+            encoder_in_tokens.extend(einops.rearrange(all_cam_features, "b c h w -> (h w) b c"))
+            all_cam_pos_embeds = torch.cat(all_cam_pos_embeds, axis=-1)
+            encoder_in_pos_embed.extend(einops.rearrange(all_cam_pos_embeds, "b c h w -> (h w) b c"))
 
         # Stack all tokens along the sequence dimension.
         encoder_in_tokens = torch.stack(encoder_in_tokens, axis=0)
@@ -553,10 +543,7 @@ class ACTEncoder(nn.Module):
         self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
 
     def forward(
-        self,
-        x: Tensor,
-        pos_embed: Tensor | None = None,
-        key_padding_mask: Tensor | None = None,
+        self, x: Tensor, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None
     ) -> Tensor:
         for layer in self.layers:
             x = layer(x, pos_embed=pos_embed, key_padding_mask=key_padding_mask)
@@ -619,10 +606,7 @@ class ACTDecoder(nn.Module):
     ) -> Tensor:
         for layer in self.layers:
             x = layer(
-                x,
-                encoder_out,
-                decoder_pos_embed=decoder_pos_embed,
-                encoder_pos_embed=encoder_pos_embed,
+                x, encoder_out, decoder_pos_embed=decoder_pos_embed, encoder_pos_embed=encoder_pos_embed
             )
         if self.norm is not None:
             x = self.norm(x)

lerobot/common/policies/diffusion/modeling_diffusion.py

@@ -209,10 +209,7 @@ class DiffusionModel(nn.Module):
 
     # ========= inference  ============
     def conditional_sample(
-        self,
-        batch_size: int,
-        global_cond: Tensor | None = None,
-        generator: torch.Generator | None = None,
+        self, batch_size: int, global_cond: Tensor | None = None, generator: torch.Generator | None = None
     ) -> Tensor:
         device = get_device_from_parameters(self)
         dtype = get_dtype_from_parameters(self)
@@ -257,10 +254,7 @@ class DiffusionModel(nn.Module):
                 # Separate batch and sequence dims back out. The camera index dim gets absorbed into the
                 # feature dim (effectively concatenating the camera features).
                 img_features = einops.rearrange(
-                    img_features_list,
-                    "(n b s) ... -> b s (n ...)",
-                    b=batch_size,
-                    s=n_obs_steps,
+                    img_features_list, "(n b s) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
                 )
             else:
                 # Combine batch, sequence, and "which camera" dims before passing to shared encoder.
@@ -270,10 +264,7 @@ class DiffusionModel(nn.Module):
                 # Separate batch dim and sequence dim back out. The camera index dim gets absorbed into the
                 # feature dim (effectively concatenating the camera features).
                 img_features = einops.rearrange(
-                    img_features,
-                    "(b s n) ... -> b s (n ...)",
-                    b=batch_size,
-                    s=n_obs_steps,
+                    img_features, "(b s n) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
                 )
             global_cond_feats.append(img_features)
 
@@ -524,9 +515,7 @@ class DiffusionRgbEncoder(nn.Module):
 
 
 def _replace_submodules(
-    root_module: nn.Module,
-    predicate: Callable[[nn.Module], bool],
-    func: Callable[[nn.Module], nn.Module],
+    root_module: nn.Module, predicate: Callable[[nn.Module], bool], func: Callable[[nn.Module], nn.Module]
 ) -> nn.Module:
     """
     Args:
@@ -644,14 +633,10 @@ class DiffusionConditionalUnet1d(nn.Module):
         self.mid_modules = nn.ModuleList(
             [
                 DiffusionConditionalResidualBlock1d(
-                    config.down_dims[-1],
-                    config.down_dims[-1],
-                    **common_res_block_kwargs,
+                    config.down_dims[-1], config.down_dims[-1], **common_res_block_kwargs
                 ),
                 DiffusionConditionalResidualBlock1d(
-                    config.down_dims[-1],
-                    config.down_dims[-1],
-                    **common_res_block_kwargs,
+                    config.down_dims[-1], config.down_dims[-1], **common_res_block_kwargs
                 ),
             ]
         )

lerobot/common/policies/factory.py

@@ -24,9 +24,7 @@ from lerobot.common.envs.configs import EnvConfig
 from lerobot.common.envs.utils import env_to_policy_features
 from lerobot.common.policies.act.configuration_act import ACTConfig
 from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
-from lerobot.common.policies.hilserl.classifier.configuration_classifier import ClassifierConfig
 from lerobot.common.policies.pi0.configuration_pi0 import PI0Config
-from lerobot.common.policies.pi0fast.configuration_pi0fast import PI0FASTConfig
 from lerobot.common.policies.pretrained import PreTrainedPolicy
 from lerobot.common.policies.tdmpc.configuration_tdmpc import TDMPCConfig
 from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
@@ -56,18 +54,6 @@ def get_policy_class(name: str) -> PreTrainedPolicy:
         from lerobot.common.policies.pi0.modeling_pi0 import PI0Policy
 
         return PI0Policy
-    elif name == "pi0fast":
-        from lerobot.common.policies.pi0fast.modeling_pi0fast import PI0FASTPolicy
-
-        return PI0FASTPolicy
-    elif name == "sac":
-        from lerobot.common.policies.sac.modeling_sac import SACPolicy
-
-        return SACPolicy
-    elif name == "hilserl_classifier":
-        from lerobot.common.policies.hilserl.classifier.modeling_classifier import Classifier
-
-        return Classifier
     else:
         raise NotImplementedError(f"Policy with name {name} is not implemented.")
 
@@ -83,10 +69,6 @@ def make_policy_config(policy_type: str, **kwargs) -> PreTrainedConfig:
         return VQBeTConfig(**kwargs)
     elif policy_type == "pi0":
         return PI0Config(**kwargs)
-    elif policy_type == "pi0fast":
-        return PI0FASTConfig(**kwargs)
-    elif policy_type == "hilserl_classifier":
-        return ClassifierConfig(**kwargs)
     else:
         raise ValueError(f"Policy type '{policy_type}' is not available.")
 

lerobot/common/policies/hilserl/classifier/configuration_classifier.py

@@ -1,53 +0,0 @@
-from dataclasses import dataclass
-from typing import List
-
-from lerobot.common.optim.optimizers import AdamWConfig, OptimizerConfig
-from lerobot.common.optim.schedulers import LRSchedulerConfig
-from lerobot.configs.policies import PreTrainedConfig
-
-
-@PreTrainedConfig.register_subclass(name="hilserl_classifier")
-@dataclass
-class ClassifierConfig(PreTrainedConfig):
-    """Configuration for the Classifier model."""
-
-    name: str = "hilserl_classifier"
-    num_classes: int = 2
-    hidden_dim: int = 256
-    dropout_rate: float = 0.1
-    model_name: str = "helper2424/resnet10"
-    device: str = "cpu"
-    model_type: str = "cnn"  # "transformer" or "cnn"
-    num_cameras: int = 2
-    learning_rate: float = 1e-4
-    normalization_mode = None
-    # output_features: Dict[str, PolicyFeature] = field(
-    #     default_factory=lambda: {"next.reward": PolicyFeature(type=FeatureType.REWARD, shape=(1,))}
-    # )
-
-    @property
-    def observation_delta_indices(self) -> List | None:
-        return None
-
-    @property
-    def action_delta_indices(self) -> List | None:
-        return None
-
-    @property
-    def reward_delta_indices(self) -> List | None:
-        return None
-
-    def get_optimizer_preset(self) -> OptimizerConfig:
-        return AdamWConfig(
-            lr=self.learning_rate,
-            weight_decay=0.01,
-            grad_clip_norm=1.0,
-        )
-
-    def get_scheduler_preset(self) -> LRSchedulerConfig | None:
-        return None
-
-    def validate_features(self) -> None:
-        """Validate feature configurations."""
-        # Classifier doesn't need specific feature validation
-        pass

lerobot/common/policies/hilserl/classifier/modeling_classifier.py

@@ -1,237 +0,0 @@
-import logging
-from typing import Dict, Optional, Tuple
-
-import torch
-from torch import Tensor, nn
-
-from lerobot.common.constants import OBS_IMAGE
-from lerobot.common.policies.hilserl.classifier.configuration_classifier import (
-    ClassifierConfig,
-)
-from lerobot.common.policies.normalize import Normalize, Unnormalize
-from lerobot.common.policies.pretrained import PreTrainedPolicy
-
-logging.basicConfig(level=logging.INFO, format="%(asctime)s - %(name)s - %(levelname)s - %(message)s")
-logger = logging.getLogger(__name__)
-
-
-class ClassifierOutput:
-    """Wrapper for classifier outputs with additional metadata."""
-
-    def __init__(
-        self,
-        logits: Tensor,
-        probabilities: Optional[Tensor] = None,
-        hidden_states: Optional[Tensor] = None,
-    ):
-        self.logits = logits
-        self.probabilities = probabilities
-        self.hidden_states = hidden_states
-
-    def __repr__(self):
-        return (
-            f"ClassifierOutput(logits={self.logits}, "
-            f"probabilities={self.probabilities}, "
-            f"hidden_states={self.hidden_states})"
-        )
-
-
-class Classifier(PreTrainedPolicy):
-    """Image classifier built on top of a pre-trained encoder."""
-
-    name = "hilserl_classifier"
-    config_class = ClassifierConfig
-
-    def __init__(
-        self,
-        config: ClassifierConfig,
-        dataset_stats: Dict[str, Dict[str, Tensor]] | None = None,
-    ):
-        from transformers import AutoModel
-
-        super().__init__(config)
-        self.config = config
-
-        # Initialize normalization (standardized with the policy framework)
-        self.normalize_inputs = Normalize(config.input_features, config.normalization_mapping, dataset_stats)
-        self.normalize_targets = Normalize(
-            config.output_features, config.normalization_mapping, dataset_stats
-        )
-        self.unnormalize_outputs = Unnormalize(
-            config.output_features, config.normalization_mapping, dataset_stats
-        )
-
-        # Set up encoder
-        encoder = AutoModel.from_pretrained(self.config.model_name, trust_remote_code=True)
-        # Extract vision model if we're given a multimodal model
-        if hasattr(encoder, "vision_model"):
-            logging.info("Multimodal model detected - using vision encoder only")
-            self.encoder = encoder.vision_model
-            self.vision_config = encoder.config.vision_config
-        else:
-            self.encoder = encoder
-            self.vision_config = getattr(encoder, "config", None)
-
-        # Model type from config
-        self.is_cnn = self.config.model_type == "cnn"
-
-        # For CNNs, initialize backbone
-        if self.is_cnn:
-            self._setup_cnn_backbone()
-
-        self._freeze_encoder()
-        self._build_classifier_head()
-
-    def _setup_cnn_backbone(self):
-        """Set up CNN encoder"""
-        if hasattr(self.encoder, "fc"):
-            self.feature_dim = self.encoder.fc.in_features
-            self.encoder = nn.Sequential(*list(self.encoder.children())[:-1])
-        elif hasattr(self.encoder.config, "hidden_sizes"):
-            self.feature_dim = self.encoder.config.hidden_sizes[-1]  # Last channel dimension
-        else:
-            raise ValueError("Unsupported CNN architecture")
-
-    def _freeze_encoder(self) -> None:
-        """Freeze the encoder parameters."""
-        for param in self.encoder.parameters():
-            param.requires_grad = False
-
-    def _build_classifier_head(self) -> None:
-        """Initialize the classifier head architecture."""
-        # Get input dimension based on model type
-        if self.is_cnn:
-            input_dim = self.feature_dim
-        else:  # Transformer models
-            if hasattr(self.encoder.config, "hidden_size"):
-                input_dim = self.encoder.config.hidden_size
-            else:
-                raise ValueError("Unsupported transformer architecture since hidden_size is not found")
-
-        self.classifier_head = nn.Sequential(
-            nn.Linear(input_dim * self.config.num_cameras, self.config.hidden_dim),
-            nn.Dropout(self.config.dropout_rate),
-            nn.LayerNorm(self.config.hidden_dim),
-            nn.ReLU(),
-            nn.Linear(
-                self.config.hidden_dim,
-                1 if self.config.num_classes == 2 else self.config.num_classes,
-            ),
-        )
-
-    def _get_encoder_output(self, x: torch.Tensor) -> torch.Tensor:
-        """Extract the appropriate output from the encoder."""
-        with torch.no_grad():
-            if self.is_cnn:
-                # The HF ResNet applies pooling internally
-                outputs = self.encoder(x)
-                # Get pooled output directly
-                features = outputs.pooler_output
-
-                if features.dim() > 2:
-                    features = features.squeeze(-1).squeeze(-1)
-                return features
-            else:  # Transformer models
-                outputs = self.encoder(x)
-                if hasattr(outputs, "pooler_output") and outputs.pooler_output is not None:
-                    return outputs.pooler_output
-                return outputs.last_hidden_state[:, 0, :]
-
-    def extract_images_and_labels(self, batch: Dict[str, Tensor]) -> Tuple[list, Tensor]:
-        """Extract image tensors and label tensors from batch."""
-        # Find image keys in input features
-        image_keys = [key for key in self.config.input_features if key.startswith(OBS_IMAGE)]
-
-        # Extract the images and labels
-        images = [batch[key] for key in image_keys]
-        labels = batch["next.reward"]
-
-        return images, labels
-
-    def predict(self, xs: list) -> ClassifierOutput:
-        """Forward pass of the classifier for inference."""
-        encoder_outputs = torch.hstack([self._get_encoder_output(x) for x in xs])
-        logits = self.classifier_head(encoder_outputs)
-
-        if self.config.num_classes == 2:
-            logits = logits.squeeze(-1)
-            probabilities = torch.sigmoid(logits)
-        else:
-            probabilities = torch.softmax(logits, dim=-1)
-
-        return ClassifierOutput(logits=logits, probabilities=probabilities, hidden_states=encoder_outputs)
-
-    def forward(self, batch: Dict[str, Tensor]) -> Tuple[Tensor, Dict[str, Tensor]]:
-        """Standard forward pass for training compatible with train.py."""
-        # Normalize inputs if needed
-        batch = self.normalize_inputs(batch)
-        batch = self.normalize_targets(batch)
-
-        # Extract images and labels
-        images, labels = self.extract_images_and_labels(batch)
-
-        # Get predictions
-        outputs = self.predict(images)
-
-        # Calculate loss
-        if self.config.num_classes == 2:
-            # Binary classification
-            loss = nn.functional.binary_cross_entropy_with_logits(outputs.logits, labels)
-            predictions = (torch.sigmoid(outputs.logits) > 0.5).float()
-        else:
-            # Multi-class classification
-            loss = nn.functional.cross_entropy(outputs.logits, labels.long())
-            predictions = torch.argmax(outputs.logits, dim=1)
-
-        # Calculate accuracy for logging
-        correct = (predictions == labels).sum().item()
-        total = labels.size(0)
-        accuracy = 100 * correct / total
-
-        # Return loss and metrics for logging
-        output_dict = {
-            "accuracy": accuracy,
-            "correct": correct,
-            "total": total,
-        }
-
-        return loss, output_dict
-
-    def predict_reward(self, batch, threshold=0.6):
-        """Legacy method for compatibility."""
-        images, _ = self.extract_images_and_labels(batch)
-        if self.config.num_classes == 2:
-            probs = self.predict(images).probabilities
-            logging.debug(f"Predicted reward images: {probs}")
-            return (probs > threshold).float()
-        else:
-            return torch.argmax(self.predict(images).probabilities, dim=1)
-
-    # Methods required by PreTrainedPolicy abstract class
-
-    def get_optim_params(self) -> dict:
-        """Return optimizer parameters for the policy."""
-        return {
-            "params": self.parameters(),
-            "lr": getattr(self.config, "learning_rate", 1e-4),
-            "weight_decay": getattr(self.config, "weight_decay", 0.01),
-        }
-
-    def reset(self):
-        """Reset any stateful components (required by PreTrainedPolicy)."""
-        # Classifier doesn't have stateful components that need resetting
-        pass
-
-    def select_action(self, batch: Dict[str, Tensor]) -> Tensor:
-        """Return action (class prediction) based on input observation."""
-        images, _ = self.extract_images_and_labels(batch)
-
-        with torch.no_grad():
-            outputs = self.predict(images)
-
-            if self.config.num_classes == 2:
-                # For binary classification return 0 or 1
-                return (outputs.probabilities > 0.5).float()
-            else:
-                # For multi-class return the predicted class
-                return torch.argmax(outputs.probabilities, dim=1)

lerobot/common/policies/hilserl/configuration_hilserl.py

@@ -1,23 +0,0 @@
-#!/usr/bin/env python
-
-# Copyright 2024 The HuggingFace Inc. team.
-# All rights reserved.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-from dataclasses import dataclass
-
-
-@dataclass
-class HILSerlConfig:
-    pass

lerobot/common/policies/hilserl/modeling_hilserl.py

@@ -1,29 +0,0 @@
-#!/usr/bin/env python
-
-# Copyright 2024 The HuggingFace Inc. team.
-# All rights reserved.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-import torch.nn as nn
-from huggingface_hub import PyTorchModelHubMixin
-
-
-class HILSerlPolicy(
-    nn.Module,
-    PyTorchModelHubMixin,
-    library_name="lerobot",
-    repo_url="https://github.com/huggingface/lerobot",
-    tags=["robotics", "hilserl"],
-):
-    pass

lerobot/common/policies/normalize.py

@@ -79,46 +79,28 @@ def create_stats_buffers(
             )
 
         # TODO(aliberts, rcadene): harmonize this to only use one framework (np or torch)
-        if stats and key in stats:
-            if norm_mode is NormalizationMode.MEAN_STD:
-                if "mean" not in stats[key] or "std" not in stats[key]:
-                    raise ValueError(
-                        f"Missing 'mean' or 'std' in stats for key {key} with MEAN_STD normalization"
-                    )
-
-                if isinstance(stats[key]["mean"], np.ndarray):
+        if stats:
+            if isinstance(stats[key]["mean"], np.ndarray):
+                if norm_mode is NormalizationMode.MEAN_STD:
                     buffer["mean"].data = torch.from_numpy(stats[key]["mean"]).to(dtype=torch.float32)
                     buffer["std"].data = torch.from_numpy(stats[key]["std"]).to(dtype=torch.float32)
-                elif isinstance(stats[key]["mean"], torch.Tensor):
-                    # Note: The clone is needed to make sure that the logic in save_pretrained doesn't see duplicated
-                    # tensors anywhere (for example, when we use the same stats for normalization and
-                    # unnormalization). See the logic here
-                    # https://github.com/huggingface/safetensors/blob/079781fd0dc455ba0fe851e2b4507c33d0c0d407/bindings/python/py_src/safetensors/torch.py#L97.
-                    buffer["mean"].data = stats[key]["mean"].clone().to(dtype=torch.float32)
-                    buffer["std"].data = stats[key]["std"].clone().to(dtype=torch.float32)
-                else:
-                    type_ = type(stats[key]["mean"])
-                    raise ValueError(
-                        f"np.ndarray or torch.Tensor expected for 'mean', but type is '{type_}' instead."
-                    )
-
-            elif norm_mode is NormalizationMode.MIN_MAX:
-                if "min" not in stats[key] or "max" not in stats[key]:
-                    raise ValueError(
-                        f"Missing 'min' or 'max' in stats for key {key} with MIN_MAX normalization"
-                    )
-
-                if isinstance(stats[key]["min"], np.ndarray):
+                elif norm_mode is NormalizationMode.MIN_MAX:
                     buffer["min"].data = torch.from_numpy(stats[key]["min"]).to(dtype=torch.float32)
                     buffer["max"].data = torch.from_numpy(stats[key]["max"]).to(dtype=torch.float32)
-                elif isinstance(stats[key]["min"], torch.Tensor):
+            elif isinstance(stats[key]["mean"], torch.Tensor):
+                # Note: The clone is needed to make sure that the logic in save_pretrained doesn't see duplicated
+                # tensors anywhere (for example, when we use the same stats for normalization and
+                # unnormalization). See the logic here
+                # https://github.com/huggingface/safetensors/blob/079781fd0dc455ba0fe851e2b4507c33d0c0d407/bindings/python/py_src/safetensors/torch.py#L97.
+                if norm_mode is NormalizationMode.MEAN_STD:
+                    buffer["mean"].data = stats[key]["mean"].clone().to(dtype=torch.float32)
+                    buffer["std"].data = stats[key]["std"].clone().to(dtype=torch.float32)
+                elif norm_mode is NormalizationMode.MIN_MAX:
                     buffer["min"].data = stats[key]["min"].clone().to(dtype=torch.float32)
                     buffer["max"].data = stats[key]["max"].clone().to(dtype=torch.float32)
-                else:
-                    type_ = type(stats[key]["min"])
-                    raise ValueError(
-                        f"np.ndarray or torch.Tensor expected for 'min', but type is '{type_}' instead."
-                    )
+            else:
+                type_ = type(stats[key]["mean"])
+                raise ValueError(f"np.ndarray or torch.Tensor expected, but type is '{type_}' instead.")
 
         stats_buffers[key] = buffer
     return stats_buffers
@@ -167,13 +149,12 @@ class Normalize(nn.Module):
             setattr(self, "buffer_" + key.replace(".", "_"), buffer)
 
     # TODO(rcadene): should we remove torch.no_grad?
-    # @torch.no_grad
+    @torch.no_grad
     def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
         batch = dict(batch)  # shallow copy avoids mutating the input batch
         for key, ft in self.features.items():
             if key not in batch:
                 # FIXME(aliberts, rcadene): This might lead to silent fail!
-                # NOTE: (azouitine) This continues help us for instantiation SACPolicy
                 continue
 
             norm_mode = self.norm_map.get(ft.type, NormalizationMode.IDENTITY)
@@ -242,7 +223,7 @@ class Unnormalize(nn.Module):
             setattr(self, "buffer_" + key.replace(".", "_"), buffer)
 
     # TODO(rcadene): should we remove torch.no_grad?
-    # @torch.no_grad
+    @torch.no_grad
     def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
         batch = dict(batch)  # shallow copy avoids mutating the input batch
         for key, ft in self.features.items():

lerobot/common/policies/pi0/conversion_scripts/convert_pi0_to_hf_lerobot.py

@@ -61,11 +61,7 @@ from lerobot.common.policies.pi0.conversion_scripts.conversion_utils import (
 )
 from lerobot.common.policies.pi0.modeling_pi0 import PI0Policy
 
-PRECISIONS = {
-    "bfloat16": torch.bfloat16,
-    "float32": torch.float32,
-    "float16": torch.float16,
-}
+PRECISIONS = {"bfloat16": torch.bfloat16, "float32": torch.float32, "float16": torch.float16}
 
 
 def slice_paligemma_state_dict(state_dict, config):

lerobot/common/policies/pi0/flex_attention.py

@@ -48,32 +48,18 @@ def flex_attention_forward(
 
     key_states = key_states[:, :, :, None, :]
     key_states = key_states.expand(
-        batch_size,
-        key_states.shape[1],
-        num_key_value_heads,
-        num_key_value_groups,
-        head_dim,
+        batch_size, key_states.shape[1], num_key_value_heads, num_key_value_groups, head_dim
     )
     key_states = key_states.reshape(
-        batch_size,
-        key_states.shape[1],
-        num_key_value_heads * num_key_value_groups,
-        head_dim,
+        batch_size, key_states.shape[1], num_key_value_heads * num_key_value_groups, head_dim
     )
 
     value_states = value_states[:, :, :, None, :]
     value_states = value_states.expand(
-        batch_size,
-        value_states.shape[1],
-        num_key_value_heads,
-        num_key_value_groups,
-        head_dim,
+        batch_size, value_states.shape[1], num_key_value_heads, num_key_value_groups, head_dim
     )
     value_states = value_states.reshape(
-        batch_size,
-        value_states.shape[1],
-        num_key_value_heads * num_key_value_groups,
-        head_dim,
+        batch_size, value_states.shape[1], num_key_value_heads * num_key_value_groups, head_dim
     )
 
     query_states = query_states.transpose(1, 2)

lerobot/common/policies/pi0/modeling_pi0.py

@@ -69,11 +69,7 @@ from lerobot.common.utils.utils import get_safe_dtype
 
 
 def create_sinusoidal_pos_embedding(
-    time: torch.tensor,
-    dimension: int,
-    min_period: float,
-    max_period: float,
-    device="cpu",
+    time: torch.tensor, dimension: int, min_period: float, max_period: float, device="cpu"
 ) -> Tensor:
     """Computes sine-cosine positional embedding vectors for scalar positions."""
     if dimension % 2 != 0:
@@ -317,7 +313,7 @@ class PI0Policy(PreTrainedPolicy):
         state = self.prepare_state(batch)
         lang_tokens, lang_masks = self.prepare_language(batch)
         actions = self.prepare_action(batch)
-        actions_is_pad = batch.get("action_is_pad")
+        actions_is_pad = batch.get("actions_is_pad")
 
         loss_dict = {}
         losses = self.model.forward(images, img_masks, lang_tokens, lang_masks, state, actions, noise, time)
@@ -581,11 +577,7 @@ class PI0FlowMatching(nn.Module):
 
         # Embed timestep using sine-cosine positional encoding with sensitivity in the range [0, 1]
         time_emb = create_sinusoidal_pos_embedding(
-            timestep,
-            self.config.proj_width,
-            min_period=4e-3,
-            max_period=4.0,
-            device=device,
+            timestep, self.config.proj_width, min_period=4e-3, max_period=4.0, device=device
         )
         time_emb = time_emb.type(dtype=dtype)
 
@@ -617,15 +609,7 @@ class PI0FlowMatching(nn.Module):
         return embs, pad_masks, att_masks
 
     def forward(
-        self,
-        images,
-        img_masks,
-        lang_tokens,
-        lang_masks,
-        state,
-        actions,
-        noise=None,
-        time=None,
+        self, images, img_masks, lang_tokens, lang_masks, state, actions, noise=None, time=None
     ) -> Tensor:
         """Do a full training forward pass and compute the loss (batch_size x num_steps x num_motors)"""
         if noise is None:
@@ -671,11 +655,7 @@ class PI0FlowMatching(nn.Module):
         device = state.device
 
         if noise is None:
-            actions_shape = (
-                bsize,
-                self.config.n_action_steps,
-                self.config.max_action_dim,
-            )
+            actions_shape = (bsize, self.config.n_action_steps, self.config.max_action_dim)
             noise = self.sample_noise(actions_shape, device)
 
         prefix_embs, prefix_pad_masks, prefix_att_masks = self.embed_prefix(

lerobot/common/policies/pi0/paligemma_with_expert.py

@@ -293,18 +293,12 @@ class PaliGemmaWithExpertModel(PreTrainedModel):
                     # in `transformers`. (molbap)
                     key_states = torch.cat([past_key_values[layer_idx]["key_states"], key_states], dim=1)
                     value_states = torch.cat(
-                        [past_key_values[layer_idx]["value_states"], value_states],
-                        dim=1,
+                        [past_key_values[layer_idx]["value_states"], value_states], dim=1
                     )
 
             attention_interface = self.get_attention_interface()
             att_output = attention_interface(
-                attention_mask,
-                batch_size,
-                head_dim,
-                query_states,
-                key_states,
-                value_states,
+                attention_mask, batch_size, head_dim, query_states, key_states, value_states
             )
             att_output = att_output.to(dtype=torch.bfloat16)
 
@@ -364,24 +358,12 @@ class PaliGemmaWithExpertModel(PreTrainedModel):
         return attention_interface
 
     def flash_attention_forward(
-        self,
-        attention_mask,
-        batch_size,
-        head_dim,
-        query_states,
-        key_states,
-        value_states,
+        self, attention_mask, batch_size, head_dim, query_states, key_states, value_states
     ):
         raise NotImplementedError("FA2 is not implemented (yet)")
 
     def eager_attention_forward(
-        self,
-        attention_mask,
-        batch_size,
-        head_dim,
-        query_states,
-        key_states,
-        value_states,
+        self, attention_mask, batch_size, head_dim, query_states, key_states, value_states
     ):
         num_att_heads = self.config.paligemma_config.text_config.num_attention_heads
         num_key_value_heads = self.config.paligemma_config.text_config.num_key_value_heads
@@ -393,31 +375,17 @@ class PaliGemmaWithExpertModel(PreTrainedModel):
         sequence_length = key_states.shape[1]
 
         key_states = key_states[:, :, :, None, :].expand(
-            batch_size,
-            sequence_length,
-            num_key_value_heads,
-            num_key_value_groups,
-            head_dim,
+            batch_size, sequence_length, num_key_value_heads, num_key_value_groups, head_dim
         )
         key_states = key_states.reshape(
-            batch_size,
-            sequence_length,
-            num_key_value_heads * num_key_value_groups,
-            head_dim,
+            batch_size, sequence_length, num_key_value_heads * num_key_value_groups, head_dim
         )
 
         value_states = value_states[:, :, :, None, :].expand(
-            batch_size,
-            sequence_length,
-            num_key_value_heads,
-            num_key_value_groups,
-            head_dim,
+            batch_size, sequence_length, num_key_value_heads, num_key_value_groups, head_dim
         )
         value_states = value_states.reshape(
-            batch_size,
-            sequence_length,
-            num_key_value_heads * num_key_value_groups,
-            head_dim,
+            batch_size, sequence_length, num_key_value_heads * num_key_value_groups, head_dim
         )
 
         # Attention here is upcasted to float32 to match the original eager implementation.

lerobot/common/policies/pi0fast/configuration_pi0fast.py

@@ -1,136 +0,0 @@
-from dataclasses import dataclass, field
-
-from lerobot.common.optim.optimizers import AdamWConfig
-from lerobot.common.optim.schedulers import (
-    CosineDecayWithWarmupSchedulerConfig,
-)
-from lerobot.configs.policies import PreTrainedConfig
-from lerobot.configs.types import FeatureType, NormalizationMode, PolicyFeature
-
-
-@PreTrainedConfig.register_subclass("pi0fast")
-@dataclass
-class PI0FASTConfig(PreTrainedConfig):
-    # Input / output structure.
-    n_obs_steps: int = 1
-    chunk_size: int = 10
-    n_action_steps: int = 5
-
-    normalization_mapping: dict[str, NormalizationMode] = field(
-        default_factory=lambda: {
-            "VISUAL": NormalizationMode.IDENTITY,
-            "STATE": NormalizationMode.MEAN_STD,
-            "ACTION": NormalizationMode.MEAN_STD,
-        }
-    )
-
-    # Shorter state and action vectors will be padded
-    max_state_dim: int = 32  # 32
-    max_action_dim: int = 32  # 32
-
-    # Image preprocessing
-    resize_imgs_with_padding: tuple[int, int] = (224, 224)
-    interpolate_like_pi: bool = False
-
-    # Add empty images. Used by pi0_aloha_sim which adds the empty
-    # left and right wrist cameras in addition to the top camera.
-    empty_cameras: int = 0
-
-    # Converts the joint and gripper values from the standard Aloha space to
-    # the space used by the pi internal runtime which was used to train the base model.
-    adapt_to_pi_aloha: bool = False
-
-    # Converts joint dimensions to deltas with respect to the current state before passing to the model.
-    # Gripper dimensions will remain in absolute values.
-    use_delta_joint_actions_aloha: bool = False
-
-    # Tokenizer
-    tokenizer_max_length: int = 48
-
-    # Projector
-    proj_width: int = 1024
-
-    # Decoding
-    max_decoding_steps: int = 256
-    fast_skip_tokens: int = 128  # Skip last 128 tokens in PaliGemma vocab since they are special tokens
-    max_input_seq_len: int = 256  # 512
-
-    # Utils
-    use_cache: bool = True
-
-    # Frozen parameters
-    freeze_vision_encoder: bool = True
-    freeze_lm_head: bool = True
-
-    # Training presets
-    optimizer_lr: float = 1e-4
-    optimizer_betas: tuple[float, float] = (0.9, 0.95)
-    optimizer_eps: float = 1e-8
-    optimizer_weight_decay: float = 1e-5
-
-    scheduler_warmup_steps: int = 1_000
-    scheduler_decay_steps: int = 30_000
-    scheduler_decay_lr: float = 2.5e-6
-
-    checkpoint_path: str = None
-
-    padding_side: str = "right"
-
-    precision: str = "bfloat16"
-    grad_clip_norm: float = 1
-
-    # Allows padding/truncation of generated action tokens during detokenization to ensure decoding.
-    # In the original version, tensors of 0s were generated if shapes didn't match for stable decoding.
-    relaxed_action_decoding: bool = True
-
-    def __post_init__(self):
-        super().__post_init__()
-
-        """Input validation (not exhaustive)."""
-        if self.n_action_steps > self.chunk_size:
-            raise ValueError(
-                f"The chunk size is the upper bound for the number of action steps per model invocation. Got "
-                f"{self.n_action_steps} for `n_action_steps` and {self.chunk_size} for `chunk_size`."
-            )
-        if self.n_obs_steps != 1:
-            raise ValueError(
-                f"Multiple observation steps not handled yet. Got `nobs_steps={self.n_obs_steps}`"
-            )
-
-    def validate_features(self) -> None:
-        for i in range(self.empty_cameras):
-            key = f"observation.images.empty_camera_{i}"
-            empty_camera = PolicyFeature(
-                type=FeatureType.VISUAL,
-                shape=(3, 480, 640),
-            )
-            self.input_features[key] = empty_camera
-
-    def get_optimizer_preset(self) -> AdamWConfig:
-        return AdamWConfig(
-            lr=self.optimizer_lr,
-            betas=self.optimizer_betas,
-            eps=self.optimizer_eps,
-            weight_decay=self.optimizer_weight_decay,
-            grad_clip_norm=self.grad_clip_norm,
-        )
-
-    def get_scheduler_preset(self):
-        return CosineDecayWithWarmupSchedulerConfig(
-            peak_lr=self.optimizer_lr,
-            decay_lr=self.scheduler_decay_lr,
-            num_warmup_steps=self.scheduler_warmup_steps,
-            num_decay_steps=self.scheduler_decay_steps,
-        )
-
-    @property
-    def observation_delta_indices(self) -> None:
-        return None
-
-    @property
-    def action_delta_indices(self) -> list:
-        return list(range(self.chunk_size))
-
-    @property
-    def reward_delta_indices(self) -> None:
-        return None

lerobot/common/policies/pi0fast/modeling_pi0fast.py

@@ -1,973 +0,0 @@
-#!/usr/bin/env python
-
-# Copyright 2025 Physical Intelligence and The HuggingFace Inc. team. All rights reserved.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-"""
-π0+FAST: Efficient Action Tokenization for Vision-Language-Action Models
-
-[Paper](https://arxiv.org/abs/2501.09747)
-[Jax code](https://github.com/Physical-Intelligence/openpi)
-
-Designed by Physical Intelligence. Ported from Jax by Hugging Face.
-
-Example of finetuning the pi0+FAST pretrained model (`pi0_fast_base` in `openpi`):
-```bash
-python lerobot/scripts/train.py \
---policy.path=lerobot/pi0fast_base \
---dataset.repo_id=danaaubakirova/koch_test
-```
-
-Example of training the pi0+FAST neural network with from scratch:
-```bash
-python lerobot/scripts/train.py \
---policy.type=pi0fast \
---dataset.repo_id=danaaubakirova/koch_test
-```
-
-Example of using the pi0 pretrained model outside LeRobot training framework:
-```python
-policy = PI0FASTPolicy.from_pretrained("lerobot/pi0fast_base")
-```
-
-"""
-
-from collections import deque
-from functools import partial
-
-import numpy as np
-import torch
-import torch.nn.functional as F  # noqa: N812
-from PIL import Image
-from scipy.fft import idct
-from torch import Tensor, nn
-from transformers import AutoProcessor, AutoTokenizer, PaliGemmaForConditionalGeneration
-from transformers.cache_utils import HybridCache, StaticCache
-from transformers.models.auto import CONFIG_MAPPING
-
-from lerobot.common.constants import ACTION, OBS_ROBOT
-from lerobot.common.policies.normalize import Normalize, Unnormalize
-from lerobot.common.policies.pi0fast.configuration_pi0fast import PI0FASTConfig
-from lerobot.common.policies.pretrained import PreTrainedPolicy
-
-PRECISION = {
-    "float16": torch.float16,
-    "float32": torch.float32,
-    "bfloat16": torch.bfloat16,
-}
-
-
-def normalize(x, min_val, max_val):
-    return (x - min_val) / (max_val - min_val)
-
-
-def unnormalize(x, min_val, max_val):
-    return x * (max_val - min_val) + min_val
-
-
-def safe_arcsin(value):
-    # This ensures that the input stays within
-    # [−1,1] to avoid invalid values for arcsin
-    return torch.arcsin(torch.clamp(value, -1.0, 1.0))
-
-
-def aloha_gripper_to_angular(value):
-    # Aloha transforms the gripper positions into a linear space. The following code
-    # reverses this transformation to be consistent with pi0 which is pretrained in
-    # angular space.
-    #
-    # These values are coming from the Aloha code:
-    # PUPPET_GRIPPER_POSITION_OPEN, PUPPET_GRIPPER_POSITION_CLOSED
-    value = unnormalize(value, min_val=0.01844, max_val=0.05800)
-
-    # This is the inverse of the angular to linear transformation inside the Interbotix code.
-    def linear_to_radian(linear_position, arm_length, horn_radius):
-        value = (horn_radius**2 + linear_position**2 - arm_length**2) / (2 * horn_radius * linear_position)
-        return safe_arcsin(value)
-
-    # The constants are taken from the Interbotix code.
-    value = linear_to_radian(value, arm_length=0.036, horn_radius=0.022)
-
-    # Normalize to [0, 1].
-    # The values 0.4 and 1.5 were measured on an actual Trossen robot.
-    return normalize(value, min_val=0.4, max_val=1.5)
-
-
-def aloha_gripper_from_angular(value):
-    # Convert from the gripper position used by pi0 to the gripper position that is used by Aloha.
-    # Note that the units are still angular but the range is different.
-
-    # The values 0.4 and 1.5 were measured on an actual Trossen robot.
-    value = unnormalize(value, min_val=0.4, max_val=1.5)
-
-    # These values are coming from the Aloha code:
-    # PUPPET_GRIPPER_JOINT_OPEN, PUPPET_GRIPPER_JOINT_CLOSE
-    return normalize(value, min_val=-0.6213, max_val=1.4910)
-
-
-def aloha_gripper_from_angular_inv(value):
-    # Directly inverts the gripper_from_angular function.
-    value = unnormalize(value, min_val=-0.6213, max_val=1.4910)
-    return normalize(value, min_val=0.4, max_val=1.5)
-
-
-class PI0FASTPolicy(PreTrainedPolicy):
-    """Wrapper class around PI0FAST tokenizer and model to train and run inference within LeRobot."""
-
-    config_class = PI0FASTConfig
-    name = "pi0fast"
-
-    def __init__(
-        self,
-        config: PI0FASTConfig,
-        dataset_stats: dict[str, dict[str, Tensor]] | None = None,
-    ):
-        """
-        Args:
-            config: Policy configuration class instance or None, in which case the default instantiation of
-                    the configuration class is used.
-            dataset_stats: Dataset statistics to be used for normalization. If not passed here, it is expected
-                that they will be passed with a call to `load_state_dict` before the policy is used.
-        """
-
-        super().__init__(config)
-        config.validate_features()
-        self.config = config
-
-        self.normalize_inputs = Normalize(config.input_features, config.normalization_mapping, dataset_stats)
-        self.normalize_targets = Normalize(
-            config.output_features, config.normalization_mapping, dataset_stats
-        )
-        self.unnormalize_outputs = Unnormalize(
-            config.output_features, config.normalization_mapping, dataset_stats
-        )
-
-        self.language_tokenizer = AutoProcessor.from_pretrained("google/paligemma-3b-pt-224")
-        self.model = PI0FAST(config)
-
-        self.reset()
-
-    def reset(self):
-        """This should be called whenever the environment is reset."""
-        self._action_queue = deque([], maxlen=self.config.n_action_steps)
-
-    def get_optim_params(self) -> dict:
-        return self.parameters()
-
-    def _pi_aloha_decode_state(self, state):
-        # Flip the joints.
-        for motor_idx in [1, 2, 8, 9]:
-            state[:, motor_idx] *= -1
-        # Reverse the gripper transformation that is being applied by the Aloha runtime.
-        for motor_idx in [6, 13]:
-            state[:, motor_idx] = aloha_gripper_to_angular(state[:, motor_idx])
-        return state
-
-    def _pi_aloha_encode_actions(self, actions):
-        # Flip the joints.
-        for motor_idx in [1, 2, 8, 9]:
-            actions[:, :, motor_idx] *= -1
-        # Reverse the gripper transformation that is being applied by the Aloha runtime.
-        for motor_idx in [6, 13]:
-            actions[:, :, motor_idx] = aloha_gripper_from_angular(actions[:, :, motor_idx])
-        return actions
-
-    def _pi_aloha_encode_actions_inv(self, actions):
-        # Flip the joints again.
-        for motor_idx in [1, 2, 8, 9]:
-            actions[:, :, motor_idx] *= -1
-        # Reverse the gripper transformation that is being applied by the Aloha runtime.
-        for motor_idx in [6, 13]:
-            actions[:, :, motor_idx] = aloha_gripper_from_angular_inv(actions[:, :, motor_idx])
-        return actions
-
-    @torch.no_grad
-    def select_action(self, batch: dict[str, Tensor]) -> Tensor:
-        """Select a single action given environment observations.
-
-        This method wraps `select_actions` in order to return one action at a time for execution in the
-        environment. It works by managing the actions in a queue and only calling `select_actions` when the
-        queue is empty.
-        """
-        self.eval()
-
-        if self.config.adapt_to_pi_aloha:
-            batch[OBS_ROBOT] = self._pi_aloha_decode_state(batch[OBS_ROBOT])
-
-        batch = self.normalize_inputs(batch)
-
-        # Action queue logic for n_action_steps > 1. When the action_queue is depleted, populate it by
-        # querying the policy.
-        if len(self._action_queue) == 0:
-            actions = self.model.generate_actions(batch)
-
-            actions = actions[:, : self.config.n_action_steps]
-
-            original_action_dim = self.config.action_feature.shape[
-                0
-            ]  # self.config.max_action_dim  # self.config.action_feature.shape[0]
-            actions = actions[:, :, :original_action_dim]
-
-            actions = self.unnormalize_outputs({"action": actions})["action"]
-
-            if self.config.adapt_to_pi_aloha:
-                actions = self._pi_aloha_encode_actions(actions)
-
-            # `self.model.forward` returns a (batch_size, n_action_steps, action_dim) tensor, but the queue
-            # effectively has shape (n_action_steps, batch_size, *), hence the transpose.
-            self._action_queue.extend(actions.transpose(0, 1))
-        return self._action_queue.popleft()
-
-    def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
-        if self.config.adapt_to_pi_aloha:
-            batch[OBS_ROBOT] = self._pi_aloha_decode_state(batch[OBS_ROBOT])
-            batch[ACTION] = self._pi_aloha_encode_actions_inv(batch[ACTION])
-        batch = self.normalize_inputs(batch)
-        batch = self.normalize_targets(batch)
-        loss_dict = self.model.forward(batch)
-        return loss_dict["loss"], loss_dict
-
-
-def block_causal_update_causal_mask(
-    attention_mask,
-    token_type_ids=None,
-    past_key_values=None,
-    cache_position=None,
-    input_tensor=None,
-    attn_implementation: str = "eager",
-    dtype: torch.dtype = "float32",
-):
-    """
-    Update the causal mask during training and generation. It can be customized to different attention masks.
-    """
-    if attn_implementation == "flash_attention_2":
-        if attention_mask is not None and 0.0 in attention_mask:
-            return attention_mask
-        return None
-    using_static_cache = isinstance(past_key_values, StaticCache)
-    min_dtype = torch.finfo(dtype).min
-
-    if input_tensor is None:
-        input_tensor = attention_mask
-
-    inputs_lead_dim, sequence_length = input_tensor.shape[:2]
-
-    if using_static_cache or isinstance(past_key_values, HybridCache):
-        target_length = past_key_values.get_max_cache_shape()
-    else:
-        target_length = (
-            attention_mask.shape[-1]
-            if isinstance(attention_mask, torch.Tensor)
-            else cache_position[0] + sequence_length + 1
-        )
-
-    # Handle precomputed attention masks
-    if attention_mask is not None and attention_mask.dim() == 4:
-        return attention_mask
-
-    # Causal mask initialization
-    causal_mask = torch.full(
-        (sequence_length, target_length), fill_value=min_dtype, dtype=dtype, device=cache_position.device
-    )
-
-    # Standard causal masking (triu ensures tokens can only attend to past)
-    if sequence_length != 1:
-        causal_mask = torch.triu(causal_mask, diagonal=1)
-
-        # Apply block causal mask
-        if token_type_ids is not None:
-            token_type_ids = token_type_ids.to(causal_mask.device).bool()
-            cumsum = torch.cumsum(token_type_ids, dim=1)
-            block_causal_mask = cumsum[:, None, :] <= cumsum[:, :, None]
-
-            # Combine causal_mask with block-wise attention mask
-            causal_mask = torch.where(block_causal_mask, 0.0, causal_mask)
-            causal_mask = causal_mask[:, None, :, :]
-        else:
-            # Apply past cache position constraint
-            causal_mask *= torch.arange(target_length, device=cache_position.device) > cache_position.reshape(
-                -1, 1
-            )
-            causal_mask = causal_mask[None, None, :, :].expand(inputs_lead_dim, 1, -1, -1)
-    else:
-        # Apply past cache position constraint
-        causal_mask *= torch.arange(target_length, device=cache_position.device) > cache_position.reshape(
-            -1, 1
-        )
-        causal_mask = causal_mask[None, None, :, :].expand(inputs_lead_dim, 1, -1, -1)
-
-    if attention_mask is not None:
-        causal_mask = causal_mask.clone()  # Copy to contiguous memory for in-place edits
-        mask_length = attention_mask.shape[-1]
-
-        # Apply padding mask
-        padding_mask = causal_mask[:, :, :, :mask_length] + attention_mask[:, None, None, :].to(
-            causal_mask.device
-        )
-        padding_mask = padding_mask == 0
-        causal_mask[:, :, :, :mask_length] = causal_mask[:, :, :, :mask_length].masked_fill(
-            padding_mask, min_dtype
-        )
-
-    return causal_mask
-
-
-def prepare_inputs_for_generation(
-    # self,
-    input_ids,
-    past_key_values=None,
-    inputs_embeds=None,
-    cache_position=None,
-    position_ids=None,
-    pixel_values=None,
-    attention_mask=None,
-    token_type_ids=None,
-    use_cache=True,
-    num_logits_to_keep=None,
-    labels=None,
-    self=None,
-    **kwargs,
-):
-    # create block causal attention
-    if cache_position[0] > 0 and input_ids.shape[1] > 0:
-        input_tensor = input_ids[:, -1:]
-        new_positions = (
-            torch.ones(
-                (position_ids.shape[0], input_ids.shape[1]),
-                dtype=position_ids.dtype,
-                device=position_ids.device,
-            ).cumsum(-1)
-            + position_ids[:, -1:]
-        )
-        position_ids = torch.cat([position_ids, new_positions], dim=-1)
-    else:
-        input_tensor = inputs_embeds
-    attention_mask = block_causal_update_causal_mask(
-        attention_mask=attention_mask,
-        past_key_values=past_key_values,
-        cache_position=cache_position,
-        input_tensor=input_tensor,
-        token_type_ids=token_type_ids,
-        dtype=self.dtype,
-        attn_implementation=self.config.text_config._attn_implementation,
-    )
-    # Overwritten -- custom `position_ids` and `pixel_values` handling
-    model_inputs = self.language_model.prepare_inputs_for_generation(
-        input_ids,
-        past_key_values=past_key_values,
-        inputs_embeds=inputs_embeds,
-        attention_mask=attention_mask,
-        position_ids=position_ids,
-        cache_position=cache_position,
-        use_cache=use_cache,
-        num_logits_to_keep=num_logits_to_keep,
-        token_type_ids=token_type_ids,
-        **kwargs,
-    )
-
-    # Position_ids in Paligemma are 1-indexed
-    if model_inputs.get("position_ids") is not None:
-        model_inputs["position_ids"] += 1
-    # If we're in cached decoding stage, pixel values should be None because input ids do not contain special image token anymore
-    # Otherwise we need pixel values to be passed to model. NOTE: use_cache=False needs pixel_values always
-    if cache_position[0] == 0:
-        model_inputs["pixel_values"] = pixel_values
-    is_training = token_type_ids is not None and labels is not None
-    if cache_position[0] == 0 and isinstance(past_key_values, HybridCache):
-        input_tensor = inputs_embeds if inputs_embeds is not None else input_ids
-        causal_mask = self._update_causal_mask(
-            attention_mask, token_type_ids, past_key_values, cache_position, input_tensor, is_training
-        )
-        model_inputs["attention_mask"] = causal_mask
-
-    return model_inputs
-
-
-class PI0FAST(nn.Module):
-    def __init__(self, config: PI0FASTConfig):
-        super().__init__()
-        self.config = config
-
-        # TODO: move tokenizers in Policy
-        fast_tokenizer_path = "physical-intelligence/fast"
-        pi0_paligemma_path = "google/paligemma-3b-pt-224"
-        self.paligemma_tokenizer = AutoTokenizer.from_pretrained(pi0_paligemma_path)
-        self.processor = AutoProcessor.from_pretrained(pi0_paligemma_path)
-        self.fast_tokenizer = AutoProcessor.from_pretrained(fast_tokenizer_path, trust_remote_code=True)
-        self.fast_skip_tokens = self.config.fast_skip_tokens
-        self.max_input_seq_len = self.config.max_input_seq_len
-        self.action_horizon = self.config.chunk_size
-        self.action_dim = self.config.action_feature.shape[
-            0
-        ]  # self.config.max_action_dim  # self.config.action_feature.shape[0]
-        precision = config.precision
-        torch_precision = PRECISION.get(precision, torch.float32)
-        self.pad_token_id = (
-            self.paligemma_tokenizer.pad_token_id
-            if hasattr(self.paligemma_tokenizer, "pad_token_id")
-            else self.paligemma_tokenizer.eos_token_id
-        )
-
-        paligemma_config = CONFIG_MAPPING["paligemma"](
-            transformers_version="4.48.1",
-            _vocab_size=257152,
-            bos_token_id=2,
-            eos_token_id=1,
-            hidden_size=2048,
-            image_token_index=257152,
-            model_type="paligemma",
-            pad_token_id=0,
-            projection_dim=2048,
-            text_config={
-                "hidden_activation": "gelu_pytorch_tanh",
-                "hidden_size": 2048,
-                "intermediate_size": 16384,
-                "model_type": "gemma",
-                "num_attention_heads": 8,
-                "num_hidden_layers": 18,
-                "num_image_tokens": 256,
-                "num_key_value_heads": 1,
-                "torch_dtype": precision,
-                "vocab_size": 257152,
-                "_attn_implementation": "eager",
-            },
-            vision_config={
-                "hidden_size": 1152,
-                "intermediate_size": 4304,
-                "model_type": "siglip_vision_model",
-                "num_attention_heads": 16,
-                "num_hidden_layers": 27,
-                "num_image_tokens": 256,
-                "patch_size": 14,
-                "projection_dim": 2048,
-                "projector_hidden_act": "gelu_pytorch_tanh",
-                "torch_dtype": precision,
-                "vision_use_head": False,
-            },
-        )
-        self.pi0_paligemma = PaliGemmaForConditionalGeneration(config=paligemma_config)
-
-        self.pi0_paligemma.prepare_inputs_for_generation = partial(
-            prepare_inputs_for_generation, self=self.pi0_paligemma
-        )
-        # change important stuff in bf16
-        params_to_change_dtype = [
-            "language_model",
-            "vision_tower",
-            "multi_modal",
-        ]
-        for name, param in self.pi0_paligemma.named_parameters():
-            if any(selector in name for selector in params_to_change_dtype):
-                param.data = param.data.to(dtype=torch_precision)
-        self.set_requires_grad()
-        self.image_keys = self.config.image_features.keys()
-        self.ignore_index = self.pi0_paligemma.config.ignore_index
-        self.padding_side = self.config.padding_side
-
-    def set_requires_grad(self):
-        if self.config.freeze_vision_encoder:
-            self.pi0_paligemma.vision_tower.eval()
-            for params in self.pi0_paligemma.vision_tower.parameters():
-                params.requires_grad = False
-        # To avoid unused params issue with distributed training
-        if self.config.freeze_lm_head:
-            for name, params in self.pi0_paligemma.named_parameters():
-                if "embed_tokens" in name:  # lm heads and embedding layer are tied
-                    params.requires_grad = False
-
-    def embed_tokens(self, tokens: torch.Tensor):
-        return self.pi0_paligemma.language_model.model.embed_tokens(tokens)
-
-    def prepare_inputs_for_generation(self, *args, **kwargs):
-        return self.pi0_paligemma.prepare_inputs_for_generation(*args, **kwargs)
-
-    def prepare_images(self, batch):
-        """Preprocess LeRobot batch into Pi0 inputs"""
-        images = []
-        img_masks = []
-        present_img_keys = [key for key in self.image_keys if key in batch]
-        if len(present_img_keys) == 0:
-            raise ValueError(
-                f"All image features are missing from the batch. At least one expected. (batch: {batch.keys()}) (image_features:{self.config.image_features})"
-            )
-
-        # Preprocess image features present in the batch
-        num_empty_cameras = 0
-        for key in self.image_keys:
-            if key in present_img_keys:
-                img = batch[key]
-
-                if self.config.resize_imgs_with_padding is not None:
-                    img = resize_with_pad(
-                        img,
-                        *self.config.resize_imgs_with_padding,
-                        pad_value=0,
-                        interpolate_like_pi=self.config.interpolate_like_pi,
-                    )
-
-                # Normalize from range [0,1] to [-1,1] as expacted by siglip
-                img = img * 2.0 - 1.0
-
-                bsize = img.shape[0]
-                device = img.device
-                mask = torch.ones(bsize, dtype=torch.bool, device=device)
-            else:
-                if num_empty_cameras >= self.config.empty_cameras:
-                    continue
-                img = torch.ones_like(img) * -1
-                bsize = img.shape[0]
-                device = img.device
-                mask = torch.ones(bsize, dtype=torch.bool, device=device)
-                num_empty_cameras += 1
-
-            images.append(img)
-            img_masks.append(mask)
-        return images, img_masks
-
-    def normalize_actions(self, actions: torch.Tensor) -> torch.Tensor:
-        mins = actions.amin(dim=(1, 2), keepdim=True)  # [0]
-        maxs = actions.amax(dim=(1, 2), keepdim=True)  # [0]
-        return 2 * (actions - mins) / (maxs - mins + 1e-8) - 1
-
-    def _act_tokens_to_paligemma_tokens(self, tokens: torch.Tensor) -> torch.Tensor:
-        out = self.paligemma_tokenizer.vocab_size - 1 - self.fast_skip_tokens - tokens
-        return out
-
-    def fast_tokenizer_wrapper(self, actions_norm):
-        """
-        A wrapper for self.fast_tokenizer that ensures batch processing,
-        conversion to PyTorch tensors, and returns a dictionary without padding.
-        """
-        batch_tokens = self.fast_tokenizer(actions_norm)
-        fast_out = self.processor.tokenizer.pad({"input_ids": batch_tokens}, return_tensors="pt")
-
-        return fast_out
-
-    def create_token_type_ids(self, padded_mask: torch.Tensor, prefix_len: int) -> torch.Tensor:
-        token_type_ids = torch.zeros_like(padded_mask, dtype=torch.bool)
-        # Compute cumulative sum mask
-        cumsum_mask = (padded_mask != 0).cumsum(dim=1)
-        # Suffix block (everything after prefix_len)
-        suffix_mask = cumsum_mask > prefix_len
-        token_type_ids = suffix_mask
-        return token_type_ids
-
-    def create_input_tokens(self, state, lang_text, actions=None):
-        bsize = state.shape[0]
-        device = state.device
-        bins = torch.linspace(-1, 1, 256 + 1, device=device)[:-1]
-        discretized = torch.bucketize(state, bins) - 1
-        discretized = discretized[:, :32]
-
-        prefix_texts = []
-        state_text = []
-        for txt, disc in zip(lang_text, discretized, strict=False):
-            cleaned = txt.lower().strip().replace("_", " ")
-            state_str = " ".join(str(val.item()) for val in disc)
-            prefix_texts.append(f"Task: {cleaned}, State: {state_str};\n")
-            state_text.append(f"State: {state_str};\n")
-
-        prefix_out = self.paligemma_tokenizer(
-            prefix_texts, add_special_tokens=True, return_tensors="pt", padding="longest", truncation=False
-        )
-        prefix_ids = prefix_out["input_ids"].to(device)
-        prefix_mask = prefix_out["attention_mask"].to(device)
-        prefix_lens = prefix_mask.sum(dim=1)[:, None].cpu()
-
-        if actions is not None:
-            actions_norm = self.normalize_actions(actions)
-            actions_pad = F.pad(
-                actions_norm, (0, max(0, self.config.max_action_dim - actions_norm.shape[2])), value=0
-            )[:, :, : self.config.max_action_dim]
-            fast_out = self.fast_tokenizer_wrapper(
-                actions_pad.cpu(),
-            )
-            act_ids = fast_out["input_ids"]
-            act_mask = fast_out["attention_mask"].to(device)
-
-            act_ids = self._act_tokens_to_paligemma_tokens(act_ids).to(device)
-            # Replace action with 0 to pad tokens
-            act_ids = torch.where(
-                act_ids == self.paligemma_tokenizer.vocab_size - 1 - self.fast_skip_tokens,
-                self.pad_token_id,
-                act_ids,
-            )
-
-            eos_token = torch.tensor(
-                [self.paligemma_tokenizer.eos_token_id], dtype=torch.long, device=device
-            ).expand(bsize, -1)
-            eos_mask = torch.tensor([1], dtype=torch.long, device=device).expand(bsize, -1)
-            bos = self.paligemma_tokenizer("Action: ", add_special_tokens=False, return_tensors="pt")
-            bos_token = bos["input_ids"].expand(act_ids.shape[0], -1).to(device)
-            bos_mask = bos["attention_mask"].expand(act_ids.shape[0], -1).to(device)
-            act_ids = torch.cat([bos_token, act_ids, eos_token], dim=1)
-            act_mask = torch.cat([bos_mask, act_mask, eos_mask], dim=1)
-            act_mask = act_mask.to(device)
-        else:
-            act_ids = torch.empty(bsize, self.pad_token_id, dtype=torch.long, device=device)
-            act_mask = torch.empty(bsize, 0, dtype=torch.long, device=device)
-        final_ids = torch.cat([prefix_ids, act_ids], dim=1)
-
-        final_mask = torch.cat([prefix_mask, act_mask], dim=1)
-        batch_inputs = {"input_ids": final_ids.tolist(), "attention_mask": final_mask.tolist()}
-
-        # Use tokenizer pad function
-        padded_output = self.paligemma_tokenizer.pad(
-            batch_inputs, padding="longest", max_length=180, return_tensors="pt"
-        )
-        padded_mask = padded_output["attention_mask"]
-
-        # define tensor of padding lengths
-        att_mask = (padded_mask != 0).cumsum(dim=1) > prefix_lens
-
-        token_type_ids = self.create_token_type_ids(padded_mask=padded_mask, prefix_len=prefix_lens)
-
-        padded_output["padded_mask"] = padded_output.pop("attention_mask")
-        padded_output["attention_mask"] = att_mask
-        # loss is computed not on prefix, and not on padding
-        padded_output["loss_mask"] = att_mask & padded_output["padded_mask"]
-        padded_output["token_type_ids"] = token_type_ids
-        return padded_output
-
-    def shift_padding_side(
-        self,
-        tokens: torch.Tensor,
-        ar_mask: torch.Tensor,
-        padding_mask: torch.Tensor,
-        loss_mask: torch.Tensor,
-        targets: torch.Tensor,
-        token_type_ids: torch.Tensor,
-        padding_side: str = "right",
-    ) -> tuple[torch.Tensor]:
-        if padding_side not in ["right", "left"]:
-            return tokens, ar_mask, padding_mask, loss_mask, targets, token_type_ids
-
-        new_tokens = torch.empty_like(tokens)
-        new_ar_masks = torch.empty_like(ar_mask)
-        new_padding_mask = torch.empty_like(padding_mask)
-        new_loss_mask = torch.empty_like(loss_mask)
-        new_targets = torch.empty_like(targets)
-        new_token_type_ids = torch.empty_like(token_type_ids)
-        batch_size = tokens.shape[0]
-        for i in range(batch_size):
-            padding_indices = torch.where(padding_mask[i] == 0)[0]
-            non_padding_indices = torch.where(padding_mask[i] == 1)[0]
-            if padding_side == "left":
-                new_indices = torch.cat((padding_indices, non_padding_indices), dim=0)
-            else:
-                new_indices = torch.cat((non_padding_indices, padding_indices), dim=0)
-            new_tokens[i] = tokens[i].index_select(0, new_indices)
-            new_ar_masks[i] = ar_mask[i].index_select(0, new_indices)
-            new_padding_mask[i] = padding_mask[i].index_select(0, new_indices)
-            new_loss_mask[i] = loss_mask[i].index_select(0, new_indices)
-            new_targets[i] = targets[i].index_select(0, new_indices)
-            new_token_type_ids[i] = token_type_ids[i].index_select(0, new_indices)
-
-        return new_tokens, new_ar_masks, new_padding_mask, new_loss_mask, new_targets, new_token_type_ids
-
-    def forward(self, batch: dict[str, Tensor]):
-        device = batch[OBS_ROBOT].device
-        # TODO: keep like this or move to the policy .forward
-        images, img_masks = self.prepare_images(batch)
-
-        padded_outs = self.create_input_tokens(
-            state=batch[OBS_ROBOT],
-            lang_text=batch["task"],
-            actions=batch[ACTION],
-        )
-
-        embs, pad_masks, _, targets, loss_mask, token_type_ids = self.embed_inputs(
-            images,
-            img_masks,
-            padded_outs["input_ids"],
-            padded_outs["padded_mask"],
-            padded_outs["attention_mask"],
-            padded_outs["loss_mask"],
-            padded_outs["token_type_ids"],
-            padding_side=self.padding_side,
-        )
-        position_ids = torch.cumsum(pad_masks, dim=1) - 1
-        token_type_ids = token_type_ids.to(dtype=torch.int64)
-        past_seen_tokens = 0
-        cache_position = torch.arange(past_seen_tokens, past_seen_tokens + embs.shape[1], device=embs.device)
-        pad_masks = block_causal_update_causal_mask(
-            attention_mask=pad_masks,
-            past_key_values=None,
-            cache_position=cache_position,
-            input_tensor=embs,
-            token_type_ids=token_type_ids,
-            dtype=self.pi0_paligemma.dtype,
-            attn_implementation=self.pi0_paligemma.config.text_config._attn_implementation,
-        )
-        outputs = self.pi0_paligemma.forward(
-            input_ids=None,
-            token_type_ids=None,
-            attention_mask=pad_masks,
-            position_ids=position_ids,
-            past_key_values=None,
-            inputs_embeds=embs,
-            use_cache=False,
-            labels=None,
-        )
-
-        logits = outputs.logits
-
-        loss_fct = nn.CrossEntropyLoss(reduction="none")
-
-        # Shift left for next-step prediction
-        logits = logits[:, :-1, :]
-        targets = targets[:, 1:].to(device)  # Shift targets
-        loss_mask = loss_mask[:, 1:].to(device)  # Ensure correct shape
-
-        # Compute per-token loss
-        token_loss = loss_fct(logits.reshape(-1, logits.shape[-1]), targets.reshape(-1))
-
-        # Apply loss mask
-        token_loss = token_loss * loss_mask.reshape(-1)
-
-        # Compute final loss
-        loss = token_loss.sum() / torch.clamp(loss_mask.sum(), min=1)
-
-        # Return loss dictionary
-        loss_dict = {"ce_loss": loss.item(), "loss": loss}
-        return loss_dict
-
-    def decode_actions_with_fast(
-        self,
-        tokens: list[list[int]],
-        *,
-        time_horizon: int | None = None,
-        action_dim: int | None = None,
-        relaxed_decoding: bool = True,
-    ) -> np.array:
-        """
-        Adapt original decoding in FAST to always return actions instead of zeros.
-        """
-        self.time_horizon = (
-            time_horizon or self.fast_tokenizer.time_horizon or self.fast_tokenizer.called_time_horizon
-        )
-        self.action_dim = (
-            action_dim or self.fast_tokenizer.action_dim or self.fast_tokenizer.called_action_dim
-        )
-
-        # Cache the time horizon and action dimension for the next call
-        self.called_time_horizon = self.time_horizon
-        self.called_action_dim = self.action_dim
-
-        assert self.time_horizon is not None and self.action_dim is not None, (
-            "Tokenizer not initialized, call encode() once or pass in time_horizon and action_dim."
-        )
-
-        decoded_actions = []
-        for token in tokens:
-            try:
-                decoded_tokens = self.fast_tokenizer.bpe_tokenizer.decode(token)
-                decoded_dct_coeff = np.array(list(map(ord, decoded_tokens))) + self.fast_tokenizer.min_token
-                if relaxed_decoding:
-                    # Expected sequence length
-                    expected_seq_len = self.time_horizon * self.action_dim
-                    diff = expected_seq_len - decoded_dct_coeff.shape[0]
-                    # Apply truncation if too long
-                    if diff < 0:
-                        decoded_dct_coeff = decoded_dct_coeff[:expected_seq_len]  # Truncate on the right
-                    # Apply padding if too short
-                    elif diff > 0:
-                        decoded_dct_coeff = np.pad(
-                            decoded_dct_coeff, (0, diff), mode="constant", constant_values=0
-                        )
-
-                decoded_dct_coeff = decoded_dct_coeff.reshape(-1, self.action_dim)
-                assert decoded_dct_coeff.shape == (
-                    self.time_horizon,
-                    self.action_dim,
-                ), (
-                    f"Decoded DCT coefficients have shape {decoded_dct_coeff.shape}, expected ({self.time_horizon}, {self.action_dim})"
-                )
-            except Exception as e:
-                print(f"Error decoding tokens: {e}")
-                print(f"Tokens: {token}")
-                decoded_dct_coeff = np.zeros((self.time_horizon, self.action_dim))
-            decoded_actions.append(idct(decoded_dct_coeff / self.fast_tokenizer.scale, axis=0, norm="ortho"))
-        return np.stack(decoded_actions)
-
-    def extract_actions(self, tokens: torch.Tensor, action_horizon: int, action_dim: int) -> torch.Tensor:
-        """
-        Extracts actions from predicted output tokens using the FAST model.
-
-        Args:
-            tokens (torch.Tensor): The input tensor of tokenized outputs.
-            action_horizon (int): The number of timesteps for actions.
-            action_dim (int): The dimensionality of each action.
-
-        Returns:
-            torch.Tensor: The extracted actions as a tensor of shape (action_horizon, action_dim).
-        """
-        # Decode predicted output tokens
-        decoded_tokens = self.paligemma_tokenizer.batch_decode(tokens, skip_special_tokens=True)
-        cleaned_tokens = [
-            tokens_sequence.replace("Action:", "").replace(":", "").strip().split("|")[0].strip()
-            for tokens_sequence in decoded_tokens
-        ]
-        raw_action_tokens = [
-            self.processor.tokenizer.encode(sample_tokens, return_tensors="pt", padding=False)
-            for sample_tokens in cleaned_tokens
-        ]  # something like this should be robust #looks good
-        action_tokens = [
-            self._act_tokens_to_paligemma_tokens(raw_action_token) for raw_action_token in raw_action_tokens
-        ]
-        # returns the tensor of decoded actions per sample in a list
-        decoded_actions = [
-            torch.tensor(
-                self.decode_actions_with_fast(
-                    tok.tolist(),
-                    time_horizon=action_horizon,
-                    action_dim=action_dim,
-                    relaxed_decoding=self.config.relaxed_action_decoding,
-                ),
-                device=tokens.device,
-            ).squeeze(0)
-            for tok in action_tokens
-        ]
-
-        return torch.stack(
-            decoded_actions,
-            dim=0,
-        )
-
-    def generate_actions(self, batch: dict[str, Tensor]):
-        # TODO: keep like this or move to the policy .forward
-        images, img_masks = self.prepare_images(batch)
-
-        padded_outs = self.create_input_tokens(state=batch[OBS_ROBOT], lang_text=batch["task"], actions=None)
-        embs, pad_masks, att_masks2, targets, loss_mask, token_type_ids = self.embed_inputs(
-            images,
-            img_masks,
-            padded_outs["input_ids"],
-            padded_outs["padded_mask"],
-            padded_outs["attention_mask"],
-            padded_outs["loss_mask"],
-            padded_outs["token_type_ids"],
-            padding_side="left",
-        )
-        token_type_ids = token_type_ids.to(dtype=torch.int64)
-        prefix_position_ids = torch.cumsum(pad_masks, dim=1) - 1
-        output_tokens = self.pi0_paligemma.generate(
-            input_ids=None,
-            attention_mask=pad_masks,
-            position_ids=prefix_position_ids,
-            past_key_values=None,
-            inputs_embeds=embs,
-            use_cache=self.config.use_cache,
-            max_new_tokens=self.config.max_decoding_steps,
-            do_sample=False,
-            num_beams=1,
-            token_type_ids=token_type_ids,
-        )
-        actions = self.extract_actions(output_tokens, self.action_horizon, self.action_dim)
-        return actions
-
-    def embed_image(self, image: torch.Tensor):
-        return self.pi0_paligemma.get_image_features(image)
-
-    def embed_inputs(
-        self,
-        images,
-        img_masks,
-        tokens,
-        pad_mask,
-        ar_mask,
-        loss_mask,
-        token_type_ids,
-        padding_side: str = "right",
-    ):
-        # TODO: avoid list in python and torch.cat ; prefer pre-allocation with torch.empty
-        # images are a list of same size
-        # vectorizing everything!
-        device = images[0].device
-        image_embedding_dim = images[0].shape[-1]  # TODO should be from self.config
-        all_images = torch.stack(images, dim=1).to(device)
-        b, n, c, h, w = all_images.shape
-        all_images = all_images.view(b * n, c, h, w)
-        embedded = self.embed_image(all_images).to(device)
-        b_n, p, image_embedding_dim = embedded.shape  # Extract current dimensions
-        m = b_n // b  # Compute the number of images per sample dynamically
-
-        # Reshape dynamically
-        embedded = embedded.view(b, m, p, image_embedding_dim)
-        tokens_embs = self.embed_tokens(tokens.to(device))
-
-        img_masks = torch.stack(img_masks, dim=1).unsqueeze(-1).to(device)
-        num_img_emb = embedded.shape[2]
-        img_pad_masks = img_masks.repeat(1, 1, num_img_emb).view(b, -1)
-        img_att_masks = torch.zeros((b, n, num_img_emb), dtype=torch.long, device=device).reshape(b, -1)
-
-        image_target_tokens = (
-            torch.ones((b, n, num_img_emb), dtype=torch.long, device=device) * self.pad_token_id
-        ).reshape(b, -1)
-        image_loss_mask = torch.zeros((b, n, num_img_emb), dtype=torch.long, device=device).reshape(b, -1)
-
-        embedded = embedded.reshape(b, n * num_img_emb, image_embedding_dim)  # Shape: (B, N*P, D)
-
-        embs = torch.cat([embedded, tokens_embs], dim=1).to(device)
-        pad_masks = torch.cat([img_pad_masks, pad_mask.to(device)], dim=1)
-        att_masks = torch.cat([img_att_masks, ar_mask.to(device)], dim=1)
-        loss_masks = torch.cat([image_loss_mask, loss_mask.to(device)], dim=1)
-        targets = torch.cat([image_target_tokens, tokens.to(device)], dim=1)
-        token_type_ids = torch.cat([img_att_masks, token_type_ids.to(device)], dim=1)
-
-        # Shift pad tokens to the left (.generate()) or right (.train())
-        embs, att_masks, pad_masks, loss_masks, targets, token_type_ids = self.shift_padding_side(
-            embs, att_masks, pad_masks, loss_masks, targets, token_type_ids, padding_side=padding_side
-        )
-
-        targets = torch.where(targets == self.pad_token_id, self.ignore_index, targets)
-        return embs, pad_masks, att_masks, targets, loss_masks, token_type_ids
-
-
-def resize_with_pad(img, width, height, pad_value=0, interpolate_like_pi=True):
-    # assume no-op when width height fits already
-    if img.ndim != 4:
-        raise ValueError(f"(b,c,h,w) expected, but {img.shape}")
-
-    cur_height, cur_width = img.shape[2:]
-
-    ratio = max(cur_width / width, cur_height / height)
-    resized_height = int(cur_height / ratio)
-    resized_width = int(cur_width / ratio)
-
-    if interpolate_like_pi:
-        img = (img * 255.0).to(dtype=torch.uint8)
-        img = img.permute(0, 2, 3, 1)
-        original_device = img.device
-        img = img.to(device="cpu").numpy()
-        imgs = []
-        for sub_img in img:
-            sub_img = Image.fromarray(sub_img)
-            resized_img = sub_img.resize((resized_width, resized_height), resample=2)
-            resized_img = torch.from_numpy(np.array(resized_img))
-            imgs.append(resized_img)
-        img = torch.stack(imgs, dim=0)
-        img = img.permute(0, 3, 1, 2)
-        resized_img = img.to(device=original_device, dtype=torch.float32) / 255.0
-    else:
-        resized_img = F.interpolate(
-            img, size=(resized_height, resized_width), mode="bilinear", align_corners=False
-        )
-
-    pad_height = max(0, int(height - resized_height))
-    pad_width = max(0, int(width - resized_width))
-
-    # pad on left and top of image
-    padded_img = F.pad(resized_img, (pad_width, 0, pad_height, 0), value=pad_value)
-    return padded_img

lerobot/common/policies/sac/configuration_sac.py

@@ -1,229 +0,0 @@
-#!/usr/bin/env python
-
-# Copyright 2024 The HuggingFace Inc. team.
-# All rights reserved.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-from dataclasses import dataclass, field
-
-from lerobot.common.optim.optimizers import MultiAdamConfig
-from lerobot.configs.policies import PreTrainedConfig
-from lerobot.configs.types import NormalizationMode
-
-
-@dataclass
-class ConcurrencyConfig:
-    actor: str = "threads"
-    learner: str = "threads"
-
-
-@dataclass
-class ActorLearnerConfig:
-    learner_host: str = "127.0.0.1"
-    learner_port: int = 50051
-    policy_parameters_push_frequency: int = 4
-
-
-@dataclass
-class CriticNetworkConfig:
-    hidden_dims: list[int] = field(default_factory=lambda: [256, 256])
-    activate_final: bool = True
-    final_activation: str | None = None
-
-
-@dataclass
-class ActorNetworkConfig:
-    hidden_dims: list[int] = field(default_factory=lambda: [256, 256])
-    activate_final: bool = True
-
-
-@dataclass
-class PolicyConfig:
-    use_tanh_squash: bool = True
-    log_std_min: float = 1e-5
-    log_std_max: float = 10.0
-    init_final: float = 0.05
-
-
-@PreTrainedConfig.register_subclass("sac")
-@dataclass
-class SACConfig(PreTrainedConfig):
-    """Soft Actor-Critic (SAC) configuration.
-
-    SAC is an off-policy actor-critic deep RL algorithm based on the maximum entropy
-    reinforcement learning framework. It learns a policy and a Q-function simultaneously
-    using experience collected from the environment.
-
-    This configuration class contains all the parameters needed to define a SAC agent,
-    including network architectures, optimization settings, and algorithm-specific
-    hyperparameters.
-
-    Args:
-        actor_network: Configuration for the actor network architecture.
-        critic_network: Configuration for the critic network architecture.
-        policy: Configuration for the policy parameters.
-        n_obs_steps: Number of observation steps to consider.
-        normalization_mapping: Mapping of feature types to normalization modes.
-        dataset_stats: Statistics for normalizing different types of inputs.
-        input_features: Dictionary of input features with their types and shapes.
-        output_features: Dictionary of output features with their types and shapes.
-        camera_number: Number of cameras used for visual observations.
-        device: Device to run the model on (e.g., "cuda", "cpu").
-        storage_device: Device to store the model on.
-        vision_encoder_name: Name of the vision encoder model.
-        freeze_vision_encoder: Whether to freeze the vision encoder during training.
-        image_encoder_hidden_dim: Hidden dimension size for the image encoder.
-        shared_encoder: Whether to use a shared encoder for actor and critic.
-        num_discrete_actions: Number of discrete actions, eg for gripper actions.
-        image_embedding_pooling_dim: Dimension of the image embedding pooling.
-        concurrency: Configuration for concurrency settings.
-        actor_learner: Configuration for actor-learner architecture.
-        online_steps: Number of steps for online training.
-        online_env_seed: Seed for the online environment.
-        online_buffer_capacity: Capacity of the online replay buffer.
-        offline_buffer_capacity: Capacity of the offline replay buffer.
-        async_prefetch: Whether to use asynchronous prefetching for the buffers.
-        online_step_before_learning: Number of steps before learning starts.
-        policy_update_freq: Frequency of policy updates.
-        discount: Discount factor for the SAC algorithm.
-        temperature_init: Initial temperature value.
-        num_critics: Number of critics in the ensemble.
-        num_subsample_critics: Number of subsampled critics for training.
-        critic_lr: Learning rate for the critic network.
-        actor_lr: Learning rate for the actor network.
-        temperature_lr: Learning rate for the temperature parameter.
-        critic_target_update_weight: Weight for the critic target update.
-        utd_ratio: Update-to-data ratio for the UTD algorithm.
-        state_encoder_hidden_dim: Hidden dimension size for the state encoder.
-        latent_dim: Dimension of the latent space.
-        target_entropy: Target entropy for the SAC algorithm.
-        use_backup_entropy: Whether to use backup entropy for the SAC algorithm.
-        grad_clip_norm: Gradient clipping norm for the SAC algorithm.
-    """
-
-    normalization_mapping: dict[str, NormalizationMode] = field(
-        default_factory=lambda: {
-            "VISUAL": NormalizationMode.MEAN_STD,
-            "STATE": NormalizationMode.MIN_MAX,
-            "ENV": NormalizationMode.MIN_MAX,
-            "ACTION": NormalizationMode.MIN_MAX,
-        }
-    )
-
-    dataset_stats: dict[str, dict[str, list[float]]] | None = field(
-        default_factory=lambda: {
-            "observation.image": {
-                "mean": [0.485, 0.456, 0.406],
-                "std": [0.229, 0.224, 0.225],
-            },
-            "observation.state": {
-                "min": [0.0, 0.0],
-                "max": [1.0, 1.0],
-            },
-            "action": {
-                "min": [0.0, 0.0, 0.0],
-                "max": [1.0, 1.0, 1.0],
-            },
-        }
-    )
-
-    # Architecture specifics
-    camera_number: int = 1
-    device: str = "cuda"
-    storage_device: str = "cpu"
-    # Set to "helper2424/resnet10" for hil serl
-    vision_encoder_name: str | None = None
-    freeze_vision_encoder: bool = True
-    image_encoder_hidden_dim: int = 32
-    shared_encoder: bool = True
-    num_discrete_actions: int | None = None
-    image_embedding_pooling_dim: int = 8
-
-    # Training parameter
-    online_steps: int = 1000000
-    online_env_seed: int = 10000
-    online_buffer_capacity: int = 100000
-    offline_buffer_capacity: int = 100000
-    async_prefetch: bool = False
-    online_step_before_learning: int = 100
-    policy_update_freq: int = 1
-
-    # SAC algorithm parameters
-    discount: float = 0.99
-    temperature_init: float = 1.0
-    num_critics: int = 2
-    num_subsample_critics: int | None = None
-    critic_lr: float = 3e-4
-    actor_lr: float = 3e-4
-    temperature_lr: float = 3e-4
-    critic_target_update_weight: float = 0.005
-    utd_ratio: int = 1  # If you want enable utd_ratio, you need to set it to >1
-    state_encoder_hidden_dim: int = 256
-    latent_dim: int = 256
-    target_entropy: float | None = None
-    use_backup_entropy: bool = True
-    grad_clip_norm: float = 40.0
-
-    # Network configuration
-    critic_network_kwargs: CriticNetworkConfig = field(default_factory=CriticNetworkConfig)
-    actor_network_kwargs: ActorNetworkConfig = field(default_factory=ActorNetworkConfig)
-    policy_kwargs: PolicyConfig = field(default_factory=PolicyConfig)
-    grasp_critic_network_kwargs: CriticNetworkConfig = field(default_factory=CriticNetworkConfig)
-    actor_learner_config: ActorLearnerConfig = field(default_factory=ActorLearnerConfig)
-    concurrency: ConcurrencyConfig = field(default_factory=ConcurrencyConfig)
-
-    def __post_init__(self):
-        super().__post_init__()
-        # Any validation specific to SAC configuration
-
-    def get_optimizer_preset(self) -> MultiAdamConfig:
-        return MultiAdamConfig(
-            weight_decay=0.0,
-            optimizer_groups={
-                "actor": {"lr": self.actor_lr},
-                "critic": {"lr": self.critic_lr},
-                "temperature": {"lr": self.temperature_lr},
-            },
-        )
-
-    def get_scheduler_preset(self) -> None:
-        return None
-
-    def validate_features(self) -> None:
-        has_image = any(key.startswith("observation.image") for key in self.input_features)
-        has_state = "observation.state" in self.input_features
-
-        if not (has_state or has_image):
-            raise ValueError(
-                "You must provide either 'observation.state' or an image observation (key starting with 'observation.image') in the input features"
-            )
-
-        if "action" not in self.output_features:
-            raise ValueError("You must provide 'action' in the output features")
-
-    @property
-    def image_features(self) -> list[str]:
-        return [key for key in self.input_features if "image" in key]
-
-    @property
-    def observation_delta_indices(self) -> list:
-        return None
-
-    @property
-    def action_delta_indices(self) -> list:
-        return None  # SAC typically predicts one action at a time
-
-    @property
-    def reward_delta_indices(self) -> None:
-        return None

lerobot/common/policies/tdmpc/modeling_tdmpc.py

@@ -39,11 +39,7 @@ from lerobot.common.constants import OBS_ENV, OBS_ROBOT
 from lerobot.common.policies.normalize import Normalize, Unnormalize
 from lerobot.common.policies.pretrained import PreTrainedPolicy
 from lerobot.common.policies.tdmpc.configuration_tdmpc import TDMPCConfig
-from lerobot.common.policies.utils import (
-    get_device_from_parameters,
-    get_output_shape,
-    populate_queues,
-)
+from lerobot.common.policies.utils import get_device_from_parameters, get_output_shape, populate_queues
 
 
 class TDMPCPolicy(PreTrainedPolicy):
@@ -67,11 +63,7 @@ class TDMPCPolicy(PreTrainedPolicy):
     config_class = TDMPCConfig
     name = "tdmpc"
 
-    def __init__(
-        self,
-        config: TDMPCConfig,
-        dataset_stats: dict[str, dict[str, Tensor]] | None = None,
-    ):
+    def __init__(self, config: TDMPCConfig, dataset_stats: dict[str, dict[str, Tensor]] | None = None):
         """
         Args:
             config: Policy configuration class instance or None, in which case the default instantiation of
@@ -130,7 +122,7 @@ class TDMPCPolicy(PreTrainedPolicy):
 
         # When the action queue is depleted, populate it again by querying the policy.
         if len(self._queues["action"]) == 0:
-            batch = {key: torch.stack(list(self._queues[key]), dim=1) for key in batch if key in self._queues}
+            batch = {key: torch.stack(list(self._queues[key]), dim=1) for key in batch}
 
             # Remove the time dimensions as it is not handled yet.
             for key in batch:
@@ -197,20 +189,13 @@ class TDMPCPolicy(PreTrainedPolicy):
 
         # In the CEM loop we will need this for a call to estimate_value with the gaussian sampled
         # trajectories.
-        z = einops.repeat(
-            z,
-            "b d -> n b d",
-            n=self.config.n_gaussian_samples + self.config.n_pi_samples,
-        )
+        z = einops.repeat(z, "b d -> n b d", n=self.config.n_gaussian_samples + self.config.n_pi_samples)
 
         # Model Predictive Path Integral (MPPI) with the cross-entropy method (CEM) as the optimization
         # algorithm.
         # The initial mean and standard deviation for the cross-entropy method (CEM).
         mean = torch.zeros(
-            self.config.horizon,
-            batch_size,
-            self.config.action_feature.shape[0],
-            device=device,
+            self.config.horizon, batch_size, self.config.action_feature.shape[0], device=device
         )
         # Maybe warm start CEM with the mean from the previous step.
         if self._prev_mean is not None:
@@ -306,10 +291,9 @@ class TDMPCPolicy(PreTrainedPolicy):
         if self.config.q_ensemble_size > 2:
             G += (
                 running_discount
-                * torch.min(
-                    terminal_values[torch.randint(0, self.config.q_ensemble_size, size=(2,))],
-                    dim=0,
-                )[0]
+                * torch.min(terminal_values[torch.randint(0, self.config.q_ensemble_size, size=(2,))], dim=0)[
+                    0
+                ]
             )
         else:
             G += running_discount * torch.min(terminal_values, dim=0)[0]
@@ -345,10 +329,7 @@ class TDMPCPolicy(PreTrainedPolicy):
         # Apply random image augmentations.
         if self.config.image_features and self.config.max_random_shift_ratio > 0:
             observations["observation.image"] = flatten_forward_unflatten(
-                partial(
-                    random_shifts_aug,
-                    max_random_shift_ratio=self.config.max_random_shift_ratio,
-                ),
+                partial(random_shifts_aug, max_random_shift_ratio=self.config.max_random_shift_ratio),
                 observations["observation.image"],
             )
 
@@ -572,10 +553,7 @@ class TDMPCTOLD(nn.Module):
         self._Qs = nn.ModuleList(
             [
                 nn.Sequential(
-                    nn.Linear(
-                        config.latent_dim + config.action_feature.shape[0],
-                        config.mlp_dim,
-                    ),
+                    nn.Linear(config.latent_dim + config.action_feature.shape[0], config.mlp_dim),
                     nn.LayerNorm(config.mlp_dim),
                     nn.Tanh(),
                     nn.Linear(config.mlp_dim, config.mlp_dim),
@@ -724,26 +702,11 @@ class TDMPCObservationEncoder(nn.Module):
                     stride=2,
                 ),
                 nn.ReLU(),
-                nn.Conv2d(
-                    config.image_encoder_hidden_dim,
-                    config.image_encoder_hidden_dim,
-                    5,
-                    stride=2,
-                ),
+                nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 5, stride=2),
                 nn.ReLU(),
-                nn.Conv2d(
-                    config.image_encoder_hidden_dim,
-                    config.image_encoder_hidden_dim,
-                    3,
-                    stride=2,
-                ),
+                nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
                 nn.ReLU(),
-                nn.Conv2d(
-                    config.image_encoder_hidden_dim,
-                    config.image_encoder_hidden_dim,
-                    3,
-                    stride=2,
-                ),
+                nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
                 nn.ReLU(),
             )
             dummy_shape = (1, *next(iter(config.image_features.values())).shape)
@@ -786,8 +749,7 @@ class TDMPCObservationEncoder(nn.Module):
         if self.config.image_features:
             feat.append(
                 flatten_forward_unflatten(
-                    self.image_enc_layers,
-                    obs_dict[next(iter(self.config.image_features))],
+                    self.image_enc_layers, obs_dict[next(iter(self.config.image_features))]
                 )
             )
         if self.config.env_state_feature:
@@ -834,9 +796,7 @@ def update_ema_parameters(ema_net: nn.Module, net: nn.Module, alpha: float):
     """Update EMA parameters in place with ema_param <- alpha * ema_param + (1 - alpha) * param."""
     for ema_module, module in zip(ema_net.modules(), net.modules(), strict=True):
         for (n_p_ema, p_ema), (n_p, p) in zip(
-            ema_module.named_parameters(recurse=False),
-            module.named_parameters(recurse=False),
-            strict=True,
+            ema_module.named_parameters(recurse=False), module.named_parameters(recurse=False), strict=True
         ):
             assert n_p_ema == n_p, "Parameter names don't match for EMA model update"
             if isinstance(p, dict):

lerobot/common/policies/vqbet/configuration_vqbet.py

@@ -193,12 +193,7 @@ class VQBeTConfig(PreTrainedConfig):
 
     @property
     def action_delta_indices(self) -> list:
-        return list(
-            range(
-                1 - self.n_obs_steps,
-                self.n_action_pred_token + self.action_chunk_size - 1,
-            )
-        )
+        return list(range(1 - self.n_obs_steps, self.n_action_pred_token + self.action_chunk_size - 1))
 
     @property
     def reward_delta_indices(self) -> None:

lerobot/common/policies/vqbet/modeling_vqbet.py

@@ -29,11 +29,7 @@ from torch import Tensor, nn
 
 from lerobot.common.policies.normalize import Normalize, Unnormalize
 from lerobot.common.policies.pretrained import PreTrainedPolicy
-from lerobot.common.policies.utils import (
-    get_device_from_parameters,
-    get_output_shape,
-    populate_queues,
-)
+from lerobot.common.policies.utils import get_device_from_parameters, get_output_shape, populate_queues
 from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
 from lerobot.common.policies.vqbet.vqbet_utils import GPT, ResidualVQ
 
@@ -328,8 +324,7 @@ class VQBeTModel(nn.Module):
 
         # To input state and observation features into GPT layers, we first project the features to fit the shape of input size of GPT.
         self.state_projector = MLP(
-            config.robot_state_feature.shape[0],
-            hidden_channels=[self.config.gpt_input_dim],
+            config.robot_state_feature.shape[0], hidden_channels=[self.config.gpt_input_dim]
         )
         self.rgb_feature_projector = MLP(
             self.rgb_encoder.feature_dim, hidden_channels=[self.config.gpt_input_dim]
@@ -359,11 +354,7 @@ class VQBeTModel(nn.Module):
         )
         # Separate batch and sequence dims.
         img_features = einops.rearrange(
-            img_features,
-            "(b s n) ... -> b s n ...",
-            b=batch_size,
-            s=n_obs_steps,
-            n=self.num_images,
+            img_features, "(b s n) ... -> b s n ...", b=batch_size, s=n_obs_steps, n=self.num_images
         )
 
         # Arrange prior and current observation step tokens as shown in the class docstring.
@@ -400,11 +391,7 @@ class VQBeTModel(nn.Module):
         # Thus, it predicts a historical action sequence, in addition to current and future actions (predicting future actions : optional).
         if len_additional_action_token > 0:
             features = torch.cat(
-                [
-                    features[:, historical_act_pred_index],
-                    features[:, -len_additional_action_token:],
-                ],
-                dim=1,
+                [features[:, historical_act_pred_index], features[:, -len_additional_action_token:]], dim=1
             )
         else:
             features = features[:, historical_act_pred_index]
@@ -527,13 +514,7 @@ class VQBeTHead(nn.Module):
 
             cbet_secondary_logits = self.map_to_cbet_preds_secondary_bin(
                 torch.cat(
-                    (
-                        x,
-                        F.one_hot(
-                            sampled_primary_centers,
-                            num_classes=self.config.vqvae_n_embed,
-                        ),
-                    ),
+                    (x, F.one_hot(sampled_primary_centers, num_classes=self.config.vqvae_n_embed)),
                     axis=1,
                 )
             )
@@ -551,9 +532,7 @@ class VQBeTHead(nn.Module):
         else:
             cbet_logits = self.map_to_cbet_preds_bin(x)
             cbet_logits = einops.rearrange(
-                cbet_logits,
-                "(NT) (G C) -> (NT) G C",
-                G=self.vqvae_model.vqvae_num_layers,
+                cbet_logits, "(NT) (G C) -> (NT) G C", G=self.vqvae_model.vqvae_num_layers
             )
             cbet_probs = torch.softmax(cbet_logits / self.config.bet_softmax_temperature, dim=-1)
             NT, G, choices = cbet_probs.shape
@@ -751,9 +730,7 @@ class VQBeTRgbEncoder(nn.Module):
 
 
 def _replace_submodules(
-    root_module: nn.Module,
-    predicate: Callable[[nn.Module], bool],
-    func: Callable[[nn.Module], nn.Module],
+    root_module: nn.Module, predicate: Callable[[nn.Module], bool], func: Callable[[nn.Module], nn.Module]
 ) -> nn.Module:
     """
     Args:

lerobot/common/policies/vqbet/vqbet_utils.py

@@ -377,10 +377,7 @@ class ResidualVQ(nn.Module):
         self.layers = nn.ModuleList(
             [
                 VectorQuantize(
-                    dim=codebook_dim,
-                    codebook_dim=codebook_dim,
-                    accept_image_fmap=accept_image_fmap,
-                    **kwargs,
+                    dim=codebook_dim, codebook_dim=codebook_dim, accept_image_fmap=accept_image_fmap, **kwargs
                 )
                 for _ in range(num_quantizers)
             ]

lerobot/common/robot_devices/cameras/intelrealsense.py

@@ -48,7 +48,7 @@ def find_cameras(raise_when_empty=True, mock=False) -> list[dict]:
     connected to the computer.
     """
     if mock:
-        import tests.cameras.mock_pyrealsense2 as rs
+        import tests.mock_pyrealsense2 as rs
     else:
         import pyrealsense2 as rs
 
@@ -100,7 +100,7 @@ def save_images_from_cameras(
         serial_numbers = [cam["serial_number"] for cam in camera_infos]
 
     if mock:
-        import tests.cameras.mock_cv2 as cv2
+        import tests.mock_cv2 as cv2
     else:
         import cv2
 
@@ -253,7 +253,7 @@ class IntelRealSenseCamera:
         self.logs = {}
 
         if self.mock:
-            import tests.cameras.mock_cv2 as cv2
+            import tests.mock_cv2 as cv2
         else:
             import cv2
 
@@ -287,7 +287,7 @@ class IntelRealSenseCamera:
             )
 
         if self.mock:
-            import tests.cameras.mock_pyrealsense2 as rs
+            import tests.mock_pyrealsense2 as rs
         else:
             import pyrealsense2 as rs
 
@@ -297,11 +297,7 @@ class IntelRealSenseCamera:
         if self.fps and self.capture_width and self.capture_height:
             # TODO(rcadene): can we set rgb8 directly?
             config.enable_stream(
-                rs.stream.color,
-                self.capture_width,
-                self.capture_height,
-                rs.format.rgb8,
-                self.fps,
+                rs.stream.color, self.capture_width, self.capture_height, rs.format.rgb8, self.fps
             )
         else:
             config.enable_stream(rs.stream.color)
@@ -309,11 +305,7 @@ class IntelRealSenseCamera:
         if self.use_depth:
             if self.fps and self.capture_width and self.capture_height:
                 config.enable_stream(
-                    rs.stream.depth,
-                    self.capture_width,
-                    self.capture_height,
-                    rs.format.z16,
-                    self.fps,
+                    rs.stream.depth, self.capture_width, self.capture_height, rs.format.z16, self.fps
                 )
             else:
                 config.enable_stream(rs.stream.depth)
@@ -383,7 +375,7 @@ class IntelRealSenseCamera:
             )
 
         if self.mock:
-            import tests.cameras.mock_cv2 as cv2
+            import tests.mock_cv2 as cv2
         else:
             import cv2
 
@@ -520,13 +512,13 @@ if __name__ == "__main__":
     )
     parser.add_argument(
         "--width",
-        type=int,
+        type=str,
         default=640,
         help="Set the width for all cameras. If not provided, use the default width of each camera.",
     )
     parser.add_argument(
         "--height",
-        type=int,
+        type=str,
         default=480,
         help="Set the height for all cameras. If not provided, use the default height of each camera.",
     )

lerobot/common/robot_devices/cameras/opencv.py

@@ -80,7 +80,7 @@ def _find_cameras(
     possible_camera_ids: list[int | str], raise_when_empty=False, mock=False
 ) -> list[int | str]:
     if mock:
-        import tests.cameras.mock_cv2 as cv2
+        import tests.mock_cv2 as cv2
     else:
         import cv2
 
@@ -269,7 +269,7 @@ class OpenCVCamera:
         self.logs = {}
 
         if self.mock:
-            import tests.cameras.mock_cv2 as cv2
+            import tests.mock_cv2 as cv2
         else:
             import cv2
 
@@ -286,7 +286,7 @@ class OpenCVCamera:
             raise RobotDeviceAlreadyConnectedError(f"OpenCVCamera({self.camera_index}) is already connected.")
 
         if self.mock:
-            import tests.cameras.mock_cv2 as cv2
+            import tests.mock_cv2 as cv2
         else:
             import cv2
 
@@ -398,7 +398,7 @@ class OpenCVCamera:
         # so we convert the image color from BGR to RGB.
         if requested_color_mode == "rgb":
             if self.mock:
-                import tests.cameras.mock_cv2 as cv2
+                import tests.mock_cv2 as cv2
             else:
                 import cv2
 
@@ -492,13 +492,13 @@ if __name__ == "__main__":
     )
     parser.add_argument(
         "--width",
-        type=int,
+        type=str,
         default=None,
         help="Set the width for all cameras. If not provided, use the default width of each camera.",
     )
     parser.add_argument(
         "--height",
-        type=int,
+        type=str,
         default=None,
         help="Set the height for all cameras. If not provided, use the default height of each camera.",
     )

lerobot/common/robot_devices/cameras/utils.py

@@ -41,9 +41,7 @@ def make_cameras_from_configs(camera_configs: dict[str, CameraConfig]) -> list[C
             cameras[key] = OpenCVCamera(cfg)
 
         elif cfg.type == "intelrealsense":
-            from lerobot.common.robot_devices.cameras.intelrealsense import (
-                IntelRealSenseCamera,
-            )
+            from lerobot.common.robot_devices.cameras.intelrealsense import IntelRealSenseCamera
 
             cameras[key] = IntelRealSenseCamera(cfg)
         else:
@@ -60,9 +58,7 @@ def make_camera(camera_type, **kwargs) -> Camera:
         return OpenCVCamera(config)
 
     elif camera_type == "intelrealsense":
-        from lerobot.common.robot_devices.cameras.intelrealsense import (
-            IntelRealSenseCamera,
-        )
+        from lerobot.common.robot_devices.cameras.intelrealsense import IntelRealSenseCamera
 
         config = IntelRealSenseCameraConfig(**kwargs)
         return IntelRealSenseCamera(config)

lerobot/common/robot_devices/control_configs.py

@@ -41,7 +41,7 @@ class TeleoperateControlConfig(ControlConfig):
     fps: int | None = None
     teleop_time_s: float | None = None
     # Display all cameras on screen
-    display_data: bool = False
+    display_cameras: bool = True
 
 
 @ControlConfig.register_subclass("record")
@@ -82,13 +82,11 @@ class RecordControlConfig(ControlConfig):
     # Not enough threads might cause low camera fps.
     num_image_writer_threads_per_camera: int = 4
     # Display all cameras on screen
-    display_data: bool = False
+    display_cameras: bool = True
     # Use vocal synthesis to read events.
     play_sounds: bool = True
     # Resume recording on an existing dataset.
     resume: bool = False
-    # Reset follower arms to an initial configuration.
-    reset_follower_arms: bool = True
 
     def __post_init__(self):
         # HACK: We parse again the cli args here to get the pretrained path if there was one.
@@ -118,11 +116,6 @@ class ReplayControlConfig(ControlConfig):
 @dataclass
 class RemoteRobotConfig(ControlConfig):
     log_interval: int = 100
-    # Display all cameras on screen
-    display_data: bool = False
-    # Rerun configuration for remote robot (https://ref.rerun.io/docs/python/0.22.1/common/initialization_functions/#rerun.connect_tcp)
-    viewer_ip: str | None = None
-    viewer_port: str | None = None
 
 
 @dataclass

lerobot/common/robot_devices/control_utils.py

@@ -24,8 +24,7 @@ from contextlib import nullcontext
 from copy import copy
 from functools import cache
 
-import rerun as rr
-import numpy as np
+import cv2
 import torch
 from deepdiff import DeepDiff
 from termcolor import colored
@@ -129,22 +128,14 @@ def predict_action(observation, policy, device, use_amp):
     return action
 
 
-def init_keyboard_listener(assign_rewards=False):
-    """
-    Initializes a keyboard listener to enable early termination of an episode
-    or environment reset by pressing the right arrow key ('->'). This may require
-    sudo permissions to allow the terminal to monitor keyboard events.
-
-    Args:
-        assign_rewards (bool): If True, allows annotating the collected trajectory
-        with a binary reward at the end of the episode to indicate success.
-    """
+def init_keyboard_listener():
+    # Allow to exit early while recording an episode or resetting the environment,
+    # by tapping the right arrow key '->'. This might require a sudo permission
+    # to allow your terminal to monitor keyboard events.
     events = {}
     events["exit_early"] = False
     events["rerecord_episode"] = False
     events["stop_recording"] = False
-    if assign_rewards:
-        events["next.reward"] = 0
 
     if is_headless():
         logging.warning(
@@ -169,13 +160,6 @@ def init_keyboard_listener(assign_rewards=False):
                 print("Escape key pressed. Stopping data recording...")
                 events["stop_recording"] = True
                 events["exit_early"] = True
-            elif assign_rewards and key == keyboard.Key.space:
-                events["next.reward"] = 1 if events["next.reward"] == 0 else 0
-                print(
-                    "Space key pressed. Assigning new reward to the subsequent frames. New reward:",
-                    events["next.reward"],
-                )
-
         except Exception as e:
             print(f"Error handling key press: {e}")
 
@@ -190,13 +174,13 @@ def warmup_record(
     events,
     enable_teleoperation,
     warmup_time_s,
-    display_data,
+    display_cameras,
     fps,
 ):
     control_loop(
         robot=robot,
         control_time_s=warmup_time_s,
-        display_data=display_data,
+        display_cameras=display_cameras,
         events=events,
         fps=fps,
         teleoperate=enable_teleoperation,
@@ -208,7 +192,7 @@ def record_episode(
     dataset,
     events,
     episode_time_s,
-    display_data,
+    display_cameras,
     policy,
     fps,
     single_task,
@@ -216,7 +200,7 @@ def record_episode(
     control_loop(
         robot=robot,
         control_time_s=episode_time_s,
-        display_data=display_data,
+        display_cameras=display_cameras,
         dataset=dataset,
         events=events,
         policy=policy,
@@ -231,7 +215,7 @@ def control_loop(
     robot,
     control_time_s=None,
     teleoperate=False,
-    display_data=False,
+    display_cameras=False,
     dataset: LeRobotDataset | None = None,
     events=None,
     policy: PreTrainedPolicy = None,
@@ -262,8 +246,6 @@ def control_loop(
     while timestamp < control_time_s:
         start_loop_t = time.perf_counter()
 
-        current_joint_positions = robot.follower_arms["main"].read("Present_Position")
-
         if teleoperate:
             observation, action = robot.teleop_step(record_data=True)
         else:
@@ -271,10 +253,7 @@ def control_loop(
 
             if policy is not None:
                 pred_action = predict_action(
-                    observation,
-                    policy,
-                    get_safe_torch_device(policy.config.device),
-                    policy.config.use_amp,
+                    observation, policy, get_safe_torch_device(policy.config.device), policy.config.use_amp
                 )
                 # Action can eventually be clipped using `max_relative_target`,
                 # so action actually sent is saved in the dataset.
@@ -285,15 +264,11 @@ def control_loop(
             frame = {**observation, **action, "task": single_task}
             dataset.add_frame(frame)
 
-        # TODO(Steven): This should be more general (for RemoteRobot instead of checking the name, but anyways it will change soon)
-        if (display_data and not is_headless()) or (display_data and robot.robot_type.startswith("lekiwi")):
-            for k, v in action.items():
-                for i, vv in enumerate(v):
-                    rr.log(f"sent_{k}_{i}", rr.Scalar(vv.numpy()))
-
+        if display_cameras and not is_headless():
             image_keys = [key for key in observation if "image" in key]
             for key in image_keys:
-                rr.log(key, rr.Image(observation[key].numpy()), static=True)
+                cv2.imshow(key, cv2.cvtColor(observation[key].numpy(), cv2.COLOR_RGB2BGR))
+            cv2.waitKey(1)
 
         if fps is not None:
             dt_s = time.perf_counter() - start_loop_t
@@ -322,21 +297,15 @@ def reset_environment(robot, events, reset_time_s, fps):
     )
 
 
-def reset_follower_position(robot: Robot, target_position):
-    current_position = robot.follower_arms["main"].read("Present_Position")
-    trajectory = torch.from_numpy(
-        np.linspace(current_position, target_position, 50)
-    )  # NOTE: 30 is just an aribtrary number
-    for pose in trajectory:
-        robot.send_action(pose)
-        busy_wait(0.015)
-
-
 def stop_recording(robot, listener, display_cameras):
     robot.disconnect()
 
-    if not is_headless() and listener is not None:
-        listener.stop()
+    if not is_headless():
+        if listener is not None:
+            listener.stop()
+
+        if display_cameras:
+            cv2.destroyAllWindows()
 
 
 def sanity_check_dataset_name(repo_id, policy_cfg):
@@ -358,20 +327,12 @@ def sanity_check_dataset_name(repo_id, policy_cfg):
 
 
 def sanity_check_dataset_robot_compatibility(
-    dataset: LeRobotDataset,
-    robot: Robot,
-    fps: int,
-    use_videos: bool,
-    extra_features: dict = None,
+    dataset: LeRobotDataset, robot: Robot, fps: int, use_videos: bool
 ) -> None:
-    features_from_robot = get_features_from_robot(robot, use_videos)
-    if extra_features is not None:
-        features_from_robot.update(extra_features)
-
     fields = [
         ("robot_type", dataset.meta.robot_type, robot.robot_type),
         ("fps", dataset.fps, fps),
-        ("features", dataset.features, features_from_robot),
+        ("features", dataset.features, get_features_from_robot(robot, use_videos)),
     ]
 
     mismatches = []

lerobot/common/robot_devices/motors/dynamixel.py

@@ -23,10 +23,7 @@ import numpy as np
 import tqdm
 
 from lerobot.common.robot_devices.motors.configs import DynamixelMotorsBusConfig
-from lerobot.common.robot_devices.utils import (
-    RobotDeviceAlreadyConnectedError,
-    RobotDeviceNotConnectedError,
-)
+from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
 from lerobot.common.utils.utils import capture_timestamp_utc
 
 PROTOCOL_VERSION = 2.0
@@ -335,7 +332,7 @@ class DynamixelMotorsBus:
             )
 
         if self.mock:
-            import tests.motors.mock_dynamixel_sdk as dxl
+            import tests.mock_dynamixel_sdk as dxl
         else:
             import dynamixel_sdk as dxl
 
@@ -359,7 +356,7 @@ class DynamixelMotorsBus:
 
     def reconnect(self):
         if self.mock:
-            import tests.motors.mock_dynamixel_sdk as dxl
+            import tests.mock_dynamixel_sdk as dxl
         else:
             import dynamixel_sdk as dxl
 
@@ -649,7 +646,7 @@ class DynamixelMotorsBus:
 
     def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
         if self.mock:
-            import tests.motors.mock_dynamixel_sdk as dxl
+            import tests.mock_dynamixel_sdk as dxl
         else:
             import dynamixel_sdk as dxl
 
@@ -694,7 +691,7 @@ class DynamixelMotorsBus:
         start_time = time.perf_counter()
 
         if self.mock:
-            import tests.motors.mock_dynamixel_sdk as dxl
+            import tests.mock_dynamixel_sdk as dxl
         else:
             import dynamixel_sdk as dxl
 
@@ -760,7 +757,7 @@ class DynamixelMotorsBus:
 
     def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
         if self.mock:
-            import tests.motors.mock_dynamixel_sdk as dxl
+            import tests.mock_dynamixel_sdk as dxl
         else:
             import dynamixel_sdk as dxl
 
@@ -787,12 +784,7 @@ class DynamixelMotorsBus:
                 f"{self.packet_handler.getTxRxResult(comm)}"
             )
 
-    def write(
-        self,
-        data_name,
-        values: int | float | np.ndarray,
-        motor_names: str | list[str] | None = None,
-    ):
+    def write(self, data_name, values: int | float | np.ndarray, motor_names: str | list[str] | None = None):
         if not self.is_connected:
             raise RobotDeviceNotConnectedError(
                 f"DynamixelMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
@@ -801,7 +793,7 @@ class DynamixelMotorsBus:
         start_time = time.perf_counter()
 
         if self.mock:
-            import tests.motors.mock_dynamixel_sdk as dxl
+            import tests.mock_dynamixel_sdk as dxl
         else:
             import dynamixel_sdk as dxl