forked from tangger/lerobot
Compare commits
155 Commits
thom_arm
...
temp_branc
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
def42ff487 | ||
|
|
c9af8e36a7 | ||
|
|
ed66c92383 | ||
|
|
668d493bf9 | ||
|
|
67f4d7ea7a | ||
|
|
4b0c88ff8e | ||
|
|
b19fef9d18 | ||
|
|
1612e00e63 | ||
|
|
c3bc136420 | ||
|
|
1020bc3108 | ||
|
|
7fcf638c0d | ||
|
|
e35546f58e | ||
|
|
1aa8d4ac91 | ||
|
|
66f8736598 | ||
|
|
4c41f6fcc6 | ||
|
|
44f9b21e74 | ||
|
|
03f49ceaf0 | ||
|
|
8e7d6970ea | ||
|
|
286bca37cc | ||
|
|
a2c181992a | ||
|
|
32eb0cec8f | ||
|
|
96c7052777 | ||
|
|
975c1c25c3 | ||
|
|
20f466768e | ||
|
|
8af693548e | ||
|
|
963738d983 | ||
|
|
e0df56de62 | ||
|
|
538455a965 | ||
|
|
172809a502 | ||
|
|
55e4ff6742 | ||
|
|
07e8716315 | ||
|
|
114870d703 | ||
|
|
2efee45ef1 | ||
|
|
c351e1fff9 | ||
|
|
cd0fc261c0 | ||
|
|
77478d50e5 | ||
|
|
97b1feb0b3 | ||
|
|
c29e70e5a1 | ||
|
|
d5b669634a | ||
|
|
1a343c3591 | ||
|
|
26f97cfd17 | ||
|
|
72f402d44b | ||
|
|
92573486a8 | ||
|
|
c712d68f6a | ||
|
|
f431a08efa | ||
|
|
beaa427504 | ||
|
|
a88dd602d9 | ||
|
|
6c0324f467 | ||
|
|
a60d27b132 | ||
|
|
9c463661c1 | ||
|
|
4255655618 | ||
|
|
f17d9a2ba1 | ||
|
|
9ff829a3a1 | ||
|
|
d6516f0e03 | ||
|
|
b0b8612eff | ||
|
|
1072a055db | ||
|
|
9c9f5cac90 | ||
|
|
9d0c6fe419 | ||
|
|
54ac25cfc9 | ||
|
|
150a292795 | ||
|
|
429a463aff | ||
|
|
27ba2951d1 | ||
|
|
b2896d38f5 | ||
|
|
c0da806232 | ||
|
|
114e09f570 | ||
|
|
04a995e7d1 | ||
|
|
4806336816 | ||
|
|
1ce418e4a1 | ||
|
|
eb4c505cff | ||
|
|
aad59e6b6b | ||
|
|
9ce98bb93c | ||
|
|
97086cdcdf | ||
|
|
9c7649f140 | ||
|
|
a2592a5563 | ||
|
|
b5ad79a7d3 | ||
|
|
996468bcce | ||
|
|
f98200297d | ||
|
|
86bbd16d43 | ||
|
|
0f6e0f6d74 | ||
|
|
fc3e545e03 | ||
|
|
b98ea415c1 | ||
|
|
bbe9057225 | ||
|
|
8c4643687c | ||
|
|
fab037f78d | ||
|
|
03d647269e | ||
|
|
2252b42337 | ||
|
|
bc6384bb80 | ||
|
|
8df7e63d61 | ||
|
|
7a3cb1ad34 | ||
|
|
f8a6574698 | ||
|
|
abbb1d2367 | ||
|
|
0b21210d72 | ||
|
|
461d5472d3 | ||
|
|
c75ea789a8 | ||
|
|
ee200e86cb | ||
|
|
8865e19c12 | ||
|
|
5f5efe7cb9 | ||
|
|
c0101f0948 | ||
|
|
5e54e39795 | ||
|
|
5ffcb48a9a | ||
|
|
471eab3d7e | ||
|
|
64425d5e00 | ||
|
|
e410e5d711 | ||
|
|
cc2f6e7404 | ||
|
|
a4d77b99f0 | ||
|
|
7bd5ab16d1 | ||
|
|
74362ac453 | ||
|
|
964f9e86d6 | ||
|
|
7a5fc76b9f | ||
|
|
342f429f1c | ||
|
|
7d1542cae1 | ||
|
|
9aa4cdb976 | ||
|
|
2abef3bef9 | ||
|
|
48951662f2 | ||
|
|
56199fb76f | ||
|
|
11f1cb5dc9 | ||
|
|
b72d574891 | ||
|
|
15dd682714 | ||
|
|
e28fa2344c | ||
|
|
a92d79fff2 | ||
|
|
125bd93e29 | ||
|
|
c38f535c9f | ||
|
|
ff8f6aa6cd | ||
|
|
1cf050d412 | ||
|
|
54c9776bde | ||
|
|
a06598678c | ||
|
|
055a6f60c6 | ||
|
|
e54d6ea1eb | ||
|
|
1eb4bfe2e4 | ||
|
|
21f222fa1d | ||
|
|
33362dbd17 | ||
|
|
b0d954c6e1 | ||
|
|
bd3111f28b | ||
|
|
cf15cba5fc | ||
|
|
042e193995 | ||
|
|
d585c73f9f | ||
|
|
504d2aaf48 | ||
|
|
83f4f7f7e8 | ||
|
|
633115d861 | ||
|
|
57fb5fe8a6 | ||
|
|
0b51a335bc | ||
|
|
111cd58f8a | ||
|
|
265b0ec44d | ||
|
|
2c2e4e14ed | ||
|
|
13310681b1 | ||
|
|
3d625ae6d3 | ||
|
|
e3b9f1c19b | ||
|
|
7ec76ee235 | ||
|
|
3b86050ab0 | ||
|
|
6d39b73399 | ||
|
|
aca424a481 | ||
|
|
35c1ce7a66 | ||
|
|
e67da1d7a6 | ||
|
|
b6c216b590 | ||
|
|
2b270d085b |
68
.cache/calibration/aloha_default/left_follower.json
Normal file
68
.cache/calibration/aloha_default/left_follower.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2015,
|
||||||
|
3058,
|
||||||
|
3061,
|
||||||
|
1071,
|
||||||
|
1071,
|
||||||
|
2035,
|
||||||
|
2152,
|
||||||
|
2029,
|
||||||
|
2499
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1008,
|
||||||
|
-1963,
|
||||||
|
-1966,
|
||||||
|
2141,
|
||||||
|
2143,
|
||||||
|
-971,
|
||||||
|
3043,
|
||||||
|
-1077,
|
||||||
|
3144
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/left_leader.json
Normal file
68
.cache/calibration/aloha_default/left_leader.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-1024
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2035,
|
||||||
|
3024,
|
||||||
|
3019,
|
||||||
|
979,
|
||||||
|
981,
|
||||||
|
1982,
|
||||||
|
2166,
|
||||||
|
2124,
|
||||||
|
1968
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-990,
|
||||||
|
-2017,
|
||||||
|
-2015,
|
||||||
|
2078,
|
||||||
|
2076,
|
||||||
|
-1030,
|
||||||
|
3117,
|
||||||
|
-1016,
|
||||||
|
2556
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/right_follower.json
Normal file
68
.cache/calibration/aloha_default/right_follower.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2056,
|
||||||
|
2895,
|
||||||
|
2896,
|
||||||
|
1191,
|
||||||
|
1190,
|
||||||
|
2018,
|
||||||
|
2051,
|
||||||
|
2056,
|
||||||
|
2509
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1040,
|
||||||
|
-2004,
|
||||||
|
-2006,
|
||||||
|
2126,
|
||||||
|
2127,
|
||||||
|
-1010,
|
||||||
|
3050,
|
||||||
|
-1117,
|
||||||
|
3143
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
68
.cache/calibration/aloha_default/right_leader.json
Normal file
68
.cache/calibration/aloha_default/right_leader.json
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
{
|
||||||
|
"homing_offset": [
|
||||||
|
2048,
|
||||||
|
3072,
|
||||||
|
3072,
|
||||||
|
-1024,
|
||||||
|
-1024,
|
||||||
|
2048,
|
||||||
|
-2048,
|
||||||
|
2048,
|
||||||
|
-2048
|
||||||
|
],
|
||||||
|
"drive_mode": [
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0,
|
||||||
|
1,
|
||||||
|
0
|
||||||
|
],
|
||||||
|
"start_pos": [
|
||||||
|
2068,
|
||||||
|
3034,
|
||||||
|
3030,
|
||||||
|
1038,
|
||||||
|
1041,
|
||||||
|
1991,
|
||||||
|
1948,
|
||||||
|
2090,
|
||||||
|
1985
|
||||||
|
],
|
||||||
|
"end_pos": [
|
||||||
|
-1025,
|
||||||
|
-2014,
|
||||||
|
-2015,
|
||||||
|
2058,
|
||||||
|
2060,
|
||||||
|
-955,
|
||||||
|
3091,
|
||||||
|
-940,
|
||||||
|
2576
|
||||||
|
],
|
||||||
|
"calib_mode": [
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"DEGREE",
|
||||||
|
"LINEAR"
|
||||||
|
],
|
||||||
|
"motor_names": [
|
||||||
|
"waist",
|
||||||
|
"shoulder",
|
||||||
|
"shoulder_shadow",
|
||||||
|
"elbow",
|
||||||
|
"elbow_shadow",
|
||||||
|
"forearm_roll",
|
||||||
|
"wrist_angle",
|
||||||
|
"wrist_rotate",
|
||||||
|
"gripper"
|
||||||
|
]
|
||||||
|
}
|
||||||
@@ -65,7 +65,6 @@ htmlcov/
|
|||||||
.nox/
|
.nox/
|
||||||
.coverage
|
.coverage
|
||||||
.coverage.*
|
.coverage.*
|
||||||
.cache
|
|
||||||
nosetests.xml
|
nosetests.xml
|
||||||
coverage.xml
|
coverage.xml
|
||||||
*.cover
|
*.cover
|
||||||
@@ -73,6 +72,11 @@ coverage.xml
|
|||||||
.hypothesis/
|
.hypothesis/
|
||||||
.pytest_cache/
|
.pytest_cache/
|
||||||
|
|
||||||
|
# Ignore .cache except calibration
|
||||||
|
.cache/*
|
||||||
|
!.cache/calibration/
|
||||||
|
!.cache/calibration/**
|
||||||
|
|
||||||
# Translations
|
# Translations
|
||||||
*.mo
|
*.mo
|
||||||
*.pot
|
*.pot
|
||||||
|
|||||||
2
.gitattributes
vendored
2
.gitattributes
vendored
@@ -3,4 +3,4 @@
|
|||||||
*.safetensors filter=lfs diff=lfs merge=lfs -text
|
*.safetensors filter=lfs diff=lfs merge=lfs -text
|
||||||
*.mp4 filter=lfs diff=lfs merge=lfs -text
|
*.mp4 filter=lfs diff=lfs merge=lfs -text
|
||||||
*.arrow filter=lfs diff=lfs merge=lfs -text
|
*.arrow filter=lfs diff=lfs merge=lfs -text
|
||||||
*.json filter=lfs diff=lfs merge=lfs -text
|
*.json !text !filter !merge !diff
|
||||||
|
|||||||
2
.github/PULL_REQUEST_TEMPLATE.md
vendored
2
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -21,7 +21,7 @@ Provide a simple way for the reviewer to try out your changes.
|
|||||||
|
|
||||||
Examples:
|
Examples:
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR=tests/data pytest -sx tests/test_stuff.py::test_something
|
pytest -sx tests/test_stuff.py::test_something
|
||||||
```
|
```
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py --some.option=true
|
python lerobot/scripts/train.py --some.option=true
|
||||||
|
|||||||
116
.github/workflows/build-docker-images.yml
vendored
116
.github/workflows/build-docker-images.yml
vendored
@@ -10,31 +10,26 @@ on:
|
|||||||
|
|
||||||
env:
|
env:
|
||||||
PYTHON_VERSION: "3.10"
|
PYTHON_VERSION: "3.10"
|
||||||
# CI_SLACK_CHANNEL: ${{ secrets.CI_DOCKER_CHANNEL }}
|
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
latest-cpu:
|
latest-cpu:
|
||||||
name: CPU
|
name: CPU
|
||||||
runs-on: ubuntu-latest
|
runs-on:
|
||||||
|
group: aws-general-8-plus
|
||||||
steps:
|
steps:
|
||||||
- name: Cleanup disk
|
- name: Install Git LFS
|
||||||
run: |
|
run: |
|
||||||
sudo df -h
|
sudo apt-get update
|
||||||
# sudo ls -l /usr/local/lib/
|
sudo apt-get install git-lfs
|
||||||
# sudo ls -l /usr/share/
|
git lfs install
|
||||||
sudo du -sh /usr/local/lib/
|
|
||||||
sudo du -sh /usr/share/
|
|
||||||
sudo rm -rf /usr/local/lib/android
|
|
||||||
sudo rm -rf /usr/share/dotnet
|
|
||||||
sudo du -sh /usr/local/lib/
|
|
||||||
sudo du -sh /usr/share/
|
|
||||||
sudo df -h
|
|
||||||
|
|
||||||
- name: Set up Docker Buildx
|
- name: Set up Docker Buildx
|
||||||
uses: docker/setup-buildx-action@v3
|
uses: docker/setup-buildx-action@v3
|
||||||
|
|
||||||
- name: Check out code
|
- name: Check out code
|
||||||
uses: actions/checkout@v4
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
lfs: true
|
||||||
|
|
||||||
- name: Login to DockerHub
|
- name: Login to DockerHub
|
||||||
uses: docker/login-action@v3
|
uses: docker/login-action@v3
|
||||||
@@ -51,52 +46,25 @@ jobs:
|
|||||||
tags: huggingface/lerobot-cpu
|
tags: huggingface/lerobot-cpu
|
||||||
build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
|
build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
|
||||||
|
|
||||||
# - name: Post to a Slack channel
|
|
||||||
# id: slack
|
|
||||||
# #uses: slackapi/slack-github-action@v1.25.0
|
|
||||||
# uses: slackapi/slack-github-action@6c661ce58804a1a20f6dc5fbee7f0381b469e001
|
|
||||||
# with:
|
|
||||||
# # Slack channel id, channel name, or user id to post message.
|
|
||||||
# # See also: https://api.slack.com/methods/chat.postMessage#channels
|
|
||||||
# channel-id: ${{ env.CI_SLACK_CHANNEL }}
|
|
||||||
# # For posting a rich message using Block Kit
|
|
||||||
# payload: |
|
|
||||||
# {
|
|
||||||
# "text": "lerobot-cpu Docker Image build result: ${{ job.status }}\n${{ github.event.pull_request.html_url || github.event.head_commit.url }}",
|
|
||||||
# "blocks": [
|
|
||||||
# {
|
|
||||||
# "type": "section",
|
|
||||||
# "text": {
|
|
||||||
# "type": "mrkdwn",
|
|
||||||
# "text": "lerobot-cpu Docker Image build result: ${{ job.status }}\n${{ github.event.pull_request.html_url || github.event.head_commit.url }}"
|
|
||||||
# }
|
|
||||||
# }
|
|
||||||
# ]
|
|
||||||
# }
|
|
||||||
# env:
|
|
||||||
# SLACK_BOT_TOKEN: ${{ secrets.SLACK_CIFEEDBACK_BOT_TOKEN }}
|
|
||||||
|
|
||||||
latest-cuda:
|
latest-cuda:
|
||||||
name: GPU
|
name: GPU
|
||||||
runs-on: ubuntu-latest
|
runs-on:
|
||||||
|
group: aws-general-8-plus
|
||||||
steps:
|
steps:
|
||||||
- name: Cleanup disk
|
- name: Install Git LFS
|
||||||
run: |
|
run: |
|
||||||
sudo df -h
|
sudo apt-get update
|
||||||
# sudo ls -l /usr/local/lib/
|
sudo apt-get install git-lfs
|
||||||
# sudo ls -l /usr/share/
|
git lfs install
|
||||||
sudo du -sh /usr/local/lib/
|
|
||||||
sudo du -sh /usr/share/
|
|
||||||
sudo rm -rf /usr/local/lib/android
|
|
||||||
sudo rm -rf /usr/share/dotnet
|
|
||||||
sudo du -sh /usr/local/lib/
|
|
||||||
sudo du -sh /usr/share/
|
|
||||||
sudo df -h
|
|
||||||
- name: Set up Docker Buildx
|
- name: Set up Docker Buildx
|
||||||
uses: docker/setup-buildx-action@v3
|
uses: docker/setup-buildx-action@v3
|
||||||
|
|
||||||
- name: Check out code
|
- name: Check out code
|
||||||
uses: actions/checkout@v4
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
lfs: true
|
||||||
|
|
||||||
- name: Login to DockerHub
|
- name: Login to DockerHub
|
||||||
uses: docker/login-action@v3
|
uses: docker/login-action@v3
|
||||||
@@ -113,27 +81,29 @@ jobs:
|
|||||||
tags: huggingface/lerobot-gpu
|
tags: huggingface/lerobot-gpu
|
||||||
build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
|
build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
|
||||||
|
|
||||||
# - name: Post to a Slack channel
|
|
||||||
# id: slack
|
latest-cuda-dev:
|
||||||
# #uses: slackapi/slack-github-action@v1.25.0
|
name: GPU Dev
|
||||||
# uses: slackapi/slack-github-action@6c661ce58804a1a20f6dc5fbee7f0381b469e001
|
runs-on:
|
||||||
# with:
|
group: aws-general-8-plus
|
||||||
# # Slack channel id, channel name, or user id to post message.
|
steps:
|
||||||
# # See also: https://api.slack.com/methods/chat.postMessage#channels
|
- name: Set up Docker Buildx
|
||||||
# channel-id: ${{ env.CI_SLACK_CHANNEL }}
|
uses: docker/setup-buildx-action@v3
|
||||||
# # For posting a rich message using Block Kit
|
|
||||||
# payload: |
|
- name: Check out code
|
||||||
# {
|
uses: actions/checkout@v4
|
||||||
# "text": "lerobot-gpu Docker Image build result: ${{ job.status }}\n${{ github.event.pull_request.html_url || github.event.head_commit.url }}",
|
|
||||||
# "blocks": [
|
- name: Login to DockerHub
|
||||||
# {
|
uses: docker/login-action@v3
|
||||||
# "type": "section",
|
with:
|
||||||
# "text": {
|
username: ${{ secrets.DOCKERHUB_USERNAME }}
|
||||||
# "type": "mrkdwn",
|
password: ${{ secrets.DOCKERHUB_PASSWORD }}
|
||||||
# "text": "lerobot-gpu Docker Image build result: ${{ job.status }}\n${{ github.event.pull_request.html_url || github.event.head_commit.url }}"
|
|
||||||
# }
|
- name: Build and Push GPU dev
|
||||||
# }
|
uses: docker/build-push-action@v5
|
||||||
# ]
|
with:
|
||||||
# }
|
context: .
|
||||||
# env:
|
file: ./docker/lerobot-gpu-dev/Dockerfile
|
||||||
# SLACK_BOT_TOKEN: ${{ secrets.SLACK_CIFEEDBACK_BOT_TOKEN }}
|
push: true
|
||||||
|
tags: huggingface/lerobot-gpu:dev
|
||||||
|
build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
|
||||||
|
|||||||
16
.github/workflows/nightly-tests.yml
vendored
16
.github/workflows/nightly-tests.yml
vendored
@@ -7,16 +7,15 @@ on:
|
|||||||
schedule:
|
schedule:
|
||||||
- cron: "0 2 * * *"
|
- cron: "0 2 * * *"
|
||||||
|
|
||||||
env:
|
# env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
# SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
|
# SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
run_all_tests_cpu:
|
run_all_tests_cpu:
|
||||||
name: CPU
|
name: CPU
|
||||||
strategy:
|
strategy:
|
||||||
fail-fast: false
|
fail-fast: false
|
||||||
runs-on: ubuntu-latest
|
runs-on:
|
||||||
|
group: aws-general-8-plus
|
||||||
container:
|
container:
|
||||||
image: huggingface/lerobot-cpu:latest
|
image: huggingface/lerobot-cpu:latest
|
||||||
options: --shm-size "16gb"
|
options: --shm-size "16gb"
|
||||||
@@ -29,13 +28,9 @@ jobs:
|
|||||||
working-directory: /lerobot
|
working-directory: /lerobot
|
||||||
steps:
|
steps:
|
||||||
- name: Tests
|
- name: Tests
|
||||||
env:
|
|
||||||
DATA_DIR: tests/data
|
|
||||||
run: pytest -v --cov=./lerobot --disable-warnings tests
|
run: pytest -v --cov=./lerobot --disable-warnings tests
|
||||||
|
|
||||||
- name: Tests end-to-end
|
- name: Tests end-to-end
|
||||||
env:
|
|
||||||
DATA_DIR: tests/data
|
|
||||||
run: make test-end-to-end
|
run: make test-end-to-end
|
||||||
|
|
||||||
|
|
||||||
@@ -43,7 +38,8 @@ jobs:
|
|||||||
name: GPU
|
name: GPU
|
||||||
strategy:
|
strategy:
|
||||||
fail-fast: false
|
fail-fast: false
|
||||||
runs-on: [single-gpu, nvidia-gpu, t4, ci]
|
runs-on:
|
||||||
|
group: aws-g6-4xlarge-plus
|
||||||
env:
|
env:
|
||||||
CUDA_VISIBLE_DEVICES: "0"
|
CUDA_VISIBLE_DEVICES: "0"
|
||||||
TEST_TYPE: "single_gpu"
|
TEST_TYPE: "single_gpu"
|
||||||
@@ -70,6 +66,8 @@ jobs:
|
|||||||
# files: ./coverage.xml
|
# files: ./coverage.xml
|
||||||
# verbose: true
|
# verbose: true
|
||||||
- name: Tests end-to-end
|
- name: Tests end-to-end
|
||||||
|
env:
|
||||||
|
DEVICE: cuda
|
||||||
run: make test-end-to-end
|
run: make test-end-to-end
|
||||||
|
|
||||||
# - name: Generate Report
|
# - name: Generate Report
|
||||||
|
|||||||
28
.github/workflows/quality.yml
vendored
28
.github/workflows/quality.yml
vendored
@@ -54,3 +54,31 @@ jobs:
|
|||||||
|
|
||||||
- name: Poetry check
|
- name: Poetry check
|
||||||
run: poetry check
|
run: poetry check
|
||||||
|
|
||||||
|
|
||||||
|
poetry_relax:
|
||||||
|
name: Poetry relax
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- name: Checkout Repository
|
||||||
|
uses: actions/checkout@v3
|
||||||
|
|
||||||
|
- name: Install poetry
|
||||||
|
run: pipx install poetry
|
||||||
|
|
||||||
|
- name: Install poetry-relax
|
||||||
|
run: poetry self add poetry-relax
|
||||||
|
|
||||||
|
- name: Poetry relax
|
||||||
|
id: poetry_relax
|
||||||
|
run: |
|
||||||
|
output=$(poetry relax --check 2>&1)
|
||||||
|
if echo "$output" | grep -q "Proposing updates"; then
|
||||||
|
echo "$output"
|
||||||
|
echo ""
|
||||||
|
echo "Some dependencies have caret '^' version requirement added by poetry by default."
|
||||||
|
echo "Please replace them with '>='. You can do this by hand or use poetry-relax to do this."
|
||||||
|
exit 1
|
||||||
|
else
|
||||||
|
echo "$output"
|
||||||
|
fi
|
||||||
|
|||||||
16
.github/workflows/test-docker-build.yml
vendored
16
.github/workflows/test-docker-build.yml
vendored
@@ -42,26 +42,14 @@ jobs:
|
|||||||
build_modified_dockerfiles:
|
build_modified_dockerfiles:
|
||||||
name: Build modified Docker images
|
name: Build modified Docker images
|
||||||
needs: get_changed_files
|
needs: get_changed_files
|
||||||
runs-on: ubuntu-latest
|
runs-on:
|
||||||
|
group: aws-general-8-plus
|
||||||
if: ${{ needs.get_changed_files.outputs.matrix }} != ''
|
if: ${{ needs.get_changed_files.outputs.matrix }} != ''
|
||||||
strategy:
|
strategy:
|
||||||
fail-fast: false
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
docker-file: ${{ fromJson(needs.get_changed_files.outputs.matrix) }}
|
docker-file: ${{ fromJson(needs.get_changed_files.outputs.matrix) }}
|
||||||
steps:
|
steps:
|
||||||
- name: Cleanup disk
|
|
||||||
run: |
|
|
||||||
sudo df -h
|
|
||||||
# sudo ls -l /usr/local/lib/
|
|
||||||
# sudo ls -l /usr/share/
|
|
||||||
sudo du -sh /usr/local/lib/
|
|
||||||
sudo du -sh /usr/share/
|
|
||||||
sudo rm -rf /usr/local/lib/android
|
|
||||||
sudo rm -rf /usr/share/dotnet
|
|
||||||
sudo du -sh /usr/local/lib/
|
|
||||||
sudo du -sh /usr/share/
|
|
||||||
sudo df -h
|
|
||||||
|
|
||||||
- name: Set up Docker Buildx
|
- name: Set up Docker Buildx
|
||||||
uses: docker/setup-buildx-action@v3
|
uses: docker/setup-buildx-action@v3
|
||||||
|
|
||||||
|
|||||||
79
.github/workflows/test.yml
vendored
79
.github/workflows/test.yml
vendored
@@ -10,6 +10,8 @@ on:
|
|||||||
- "examples/**"
|
- "examples/**"
|
||||||
- ".github/**"
|
- ".github/**"
|
||||||
- "poetry.lock"
|
- "poetry.lock"
|
||||||
|
- "Makefile"
|
||||||
|
- ".cache/**"
|
||||||
push:
|
push:
|
||||||
branches:
|
branches:
|
||||||
- main
|
- main
|
||||||
@@ -19,27 +21,32 @@ on:
|
|||||||
- "examples/**"
|
- "examples/**"
|
||||||
- ".github/**"
|
- ".github/**"
|
||||||
- "poetry.lock"
|
- "poetry.lock"
|
||||||
|
- "Makefile"
|
||||||
|
- ".cache/**"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
pytest:
|
pytest:
|
||||||
name: Pytest
|
name: Pytest
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
env:
|
env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
MUJOCO_GL: egl
|
MUJOCO_GL: egl
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v4
|
- uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
lfs: true # Ensure LFS files are pulled
|
lfs: true # Ensure LFS files are pulled
|
||||||
|
|
||||||
- name: Install EGL
|
- name: Install apt dependencies
|
||||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
|
# portaudio19-dev is needed to install pyaudio
|
||||||
|
run: |
|
||||||
|
sudo apt-get update && \
|
||||||
|
sudo apt-get install -y libegl1-mesa-dev ffmpeg portaudio19-dev
|
||||||
|
|
||||||
- name: Install poetry
|
- name: Install poetry
|
||||||
run: |
|
run: |
|
||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
pipx install poetry && poetry config virtualenvs.in-project true
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||||
|
|
||||||
|
# TODO(rcadene, aliberts): python 3.12 seems to be used in the tests, not python 3.10
|
||||||
- name: Set up Python 3.10
|
- name: Set up Python 3.10
|
||||||
uses: actions/setup-python@v5
|
uses: actions/setup-python@v5
|
||||||
with:
|
with:
|
||||||
@@ -58,23 +65,25 @@ jobs:
|
|||||||
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
||||||
&& rm -rf tests/outputs outputs
|
&& rm -rf tests/outputs outputs
|
||||||
|
|
||||||
|
|
||||||
pytest-minimal:
|
pytest-minimal:
|
||||||
name: Pytest (minimal install)
|
name: Pytest (minimal install)
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
env:
|
env:
|
||||||
DATA_DIR: tests/data
|
|
||||||
MUJOCO_GL: egl
|
MUJOCO_GL: egl
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v4
|
- uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
lfs: true # Ensure LFS files are pulled
|
lfs: true # Ensure LFS files are pulled
|
||||||
|
|
||||||
|
- name: Install apt dependencies
|
||||||
|
run: sudo apt-get update && sudo apt-get install -y ffmpeg
|
||||||
|
|
||||||
- name: Install poetry
|
- name: Install poetry
|
||||||
run: |
|
run: |
|
||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
pipx install poetry && poetry config virtualenvs.in-project true
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||||
|
|
||||||
|
# TODO(rcadene, aliberts): python 3.12 seems to be used in the tests, not python 3.10
|
||||||
- name: Set up Python 3.10
|
- name: Set up Python 3.10
|
||||||
uses: actions/setup-python@v5
|
uses: actions/setup-python@v5
|
||||||
with:
|
with:
|
||||||
@@ -92,37 +101,39 @@ jobs:
|
|||||||
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
-W ignore::UserWarning:gymnasium.utils.env_checker:247 \
|
||||||
&& rm -rf tests/outputs outputs
|
&& rm -rf tests/outputs outputs
|
||||||
|
|
||||||
|
# TODO(aliberts, rcadene): redesign after v2 migration / removing hydra
|
||||||
|
# end-to-end:
|
||||||
|
# name: End-to-end
|
||||||
|
# runs-on: ubuntu-latest
|
||||||
|
# env:
|
||||||
|
# MUJOCO_GL: egl
|
||||||
|
# steps:
|
||||||
|
# - uses: actions/checkout@v4
|
||||||
|
# with:
|
||||||
|
# lfs: true # Ensure LFS files are pulled
|
||||||
|
|
||||||
end-to-end:
|
# - name: Install apt dependencies
|
||||||
name: End-to-end
|
# # portaudio19-dev is needed to install pyaudio
|
||||||
runs-on: ubuntu-latest
|
# run: |
|
||||||
env:
|
# sudo apt-get update && \
|
||||||
DATA_DIR: tests/data
|
# sudo apt-get install -y libegl1-mesa-dev portaudio19-dev
|
||||||
MUJOCO_GL: egl
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@v4
|
|
||||||
with:
|
|
||||||
lfs: true # Ensure LFS files are pulled
|
|
||||||
|
|
||||||
- name: Install EGL
|
# - name: Install poetry
|
||||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
|
# run: |
|
||||||
|
# pipx install poetry && poetry config virtualenvs.in-project true
|
||||||
|
# echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
||||||
|
|
||||||
- name: Install poetry
|
# - name: Set up Python 3.10
|
||||||
run: |
|
# uses: actions/setup-python@v5
|
||||||
pipx install poetry && poetry config virtualenvs.in-project true
|
# with:
|
||||||
echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
|
# python-version: "3.10"
|
||||||
|
# cache: "poetry"
|
||||||
|
|
||||||
- name: Set up Python 3.10
|
# - name: Install poetry dependencies
|
||||||
uses: actions/setup-python@v5
|
# run: |
|
||||||
with:
|
# poetry install --all-extras
|
||||||
python-version: "3.10"
|
|
||||||
cache: "poetry"
|
|
||||||
|
|
||||||
- name: Install poetry dependencies
|
# - name: Test end-to-end
|
||||||
run: |
|
# run: |
|
||||||
poetry install --all-extras
|
# make test-end-to-end \
|
||||||
|
# && rm -rf outputs
|
||||||
- name: Test end-to-end
|
|
||||||
run: |
|
|
||||||
make test-end-to-end \
|
|
||||||
&& rm -rf outputs
|
|
||||||
|
|||||||
20
.github/workflows/trufflehog.yml
vendored
Normal file
20
.github/workflows/trufflehog.yml
vendored
Normal file
@@ -0,0 +1,20 @@
|
|||||||
|
on:
|
||||||
|
push:
|
||||||
|
|
||||||
|
name: Secret Leaks
|
||||||
|
|
||||||
|
permissions:
|
||||||
|
contents: read
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
trufflehog:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- name: Checkout code
|
||||||
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
fetch-depth: 0
|
||||||
|
- name: Secret Scanning
|
||||||
|
uses: trufflesecurity/trufflehog@main
|
||||||
|
with:
|
||||||
|
extra_args: --only-verified
|
||||||
37
.gitignore
vendored
37
.gitignore
vendored
@@ -2,12 +2,17 @@
|
|||||||
logs
|
logs
|
||||||
tmp
|
tmp
|
||||||
wandb
|
wandb
|
||||||
|
|
||||||
|
# Data
|
||||||
data
|
data
|
||||||
outputs
|
outputs
|
||||||
.vscode
|
|
||||||
rl
|
# Apple
|
||||||
.DS_Store
|
.DS_Store
|
||||||
|
|
||||||
|
# VS Code
|
||||||
|
.vscode
|
||||||
|
|
||||||
# HPC
|
# HPC
|
||||||
nautilus/*.yaml
|
nautilus/*.yaml
|
||||||
*.key
|
*.key
|
||||||
@@ -61,7 +66,6 @@ htmlcov/
|
|||||||
.nox/
|
.nox/
|
||||||
.coverage
|
.coverage
|
||||||
.coverage.*
|
.coverage.*
|
||||||
.cache
|
|
||||||
nosetests.xml
|
nosetests.xml
|
||||||
coverage.xml
|
coverage.xml
|
||||||
*.cover
|
*.cover
|
||||||
@@ -69,6 +73,11 @@ coverage.xml
|
|||||||
.hypothesis/
|
.hypothesis/
|
||||||
.pytest_cache/
|
.pytest_cache/
|
||||||
|
|
||||||
|
# Ignore .cache except calibration
|
||||||
|
.cache/*
|
||||||
|
!.cache/calibration/
|
||||||
|
!.cache/calibration/**
|
||||||
|
|
||||||
# Translations
|
# Translations
|
||||||
*.mo
|
*.mo
|
||||||
*.pot
|
*.pot
|
||||||
@@ -90,6 +99,7 @@ instance/
|
|||||||
docs/_build/
|
docs/_build/
|
||||||
|
|
||||||
# PyBuilder
|
# PyBuilder
|
||||||
|
.pybuilder/
|
||||||
target/
|
target/
|
||||||
|
|
||||||
# Jupyter Notebook
|
# Jupyter Notebook
|
||||||
@@ -102,13 +112,6 @@ ipython_config.py
|
|||||||
# pyenv
|
# pyenv
|
||||||
.python-version
|
.python-version
|
||||||
|
|
||||||
# pipenv
|
|
||||||
# According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control.
|
|
||||||
# However, in case of collaboration, if having platform-specific dependencies or dependencies
|
|
||||||
# having no cross-platform support, pipenv may install dependencies that don't work, or not
|
|
||||||
# install all needed dependencies.
|
|
||||||
#Pipfile.lock
|
|
||||||
|
|
||||||
# PEP 582; used by e.g. github.com/David-OConnor/pyflow
|
# PEP 582; used by e.g. github.com/David-OConnor/pyflow
|
||||||
__pypackages__/
|
__pypackages__/
|
||||||
|
|
||||||
@@ -119,6 +122,14 @@ celerybeat.pid
|
|||||||
# SageMath parsed files
|
# SageMath parsed files
|
||||||
*.sage.py
|
*.sage.py
|
||||||
|
|
||||||
|
# Environments
|
||||||
|
.env
|
||||||
|
.venv
|
||||||
|
env/
|
||||||
|
venv/
|
||||||
|
env.bak/
|
||||||
|
venv.bak/
|
||||||
|
|
||||||
# Spyder project settings
|
# Spyder project settings
|
||||||
.spyderproject
|
.spyderproject
|
||||||
.spyproject
|
.spyproject
|
||||||
@@ -136,3 +147,9 @@ dmypy.json
|
|||||||
|
|
||||||
# Pyre type checker
|
# Pyre type checker
|
||||||
.pyre/
|
.pyre/
|
||||||
|
|
||||||
|
# pytype static type analyzer
|
||||||
|
.pytype/
|
||||||
|
|
||||||
|
# Cython debug symbols
|
||||||
|
cython_debug/
|
||||||
|
|||||||
@@ -3,7 +3,7 @@ default_language_version:
|
|||||||
python: python3.10
|
python: python3.10
|
||||||
repos:
|
repos:
|
||||||
- repo: https://github.com/pre-commit/pre-commit-hooks
|
- repo: https://github.com/pre-commit/pre-commit-hooks
|
||||||
rev: v4.6.0
|
rev: v5.0.0
|
||||||
hooks:
|
hooks:
|
||||||
- id: check-added-large-files
|
- id: check-added-large-files
|
||||||
- id: debug-statements
|
- id: debug-statements
|
||||||
@@ -14,11 +14,11 @@ repos:
|
|||||||
- id: end-of-file-fixer
|
- id: end-of-file-fixer
|
||||||
- id: trailing-whitespace
|
- id: trailing-whitespace
|
||||||
- repo: https://github.com/asottile/pyupgrade
|
- repo: https://github.com/asottile/pyupgrade
|
||||||
rev: v3.15.2
|
rev: v3.19.0
|
||||||
hooks:
|
hooks:
|
||||||
- id: pyupgrade
|
- id: pyupgrade
|
||||||
- repo: https://github.com/astral-sh/ruff-pre-commit
|
- repo: https://github.com/astral-sh/ruff-pre-commit
|
||||||
rev: v0.4.3
|
rev: v0.8.2
|
||||||
hooks:
|
hooks:
|
||||||
- id: ruff
|
- id: ruff
|
||||||
args: [--fix]
|
args: [--fix]
|
||||||
@@ -31,3 +31,7 @@ repos:
|
|||||||
args:
|
args:
|
||||||
- "--check"
|
- "--check"
|
||||||
- "--no-update"
|
- "--no-update"
|
||||||
|
- repo: https://github.com/gitleaks/gitleaks
|
||||||
|
rev: v8.21.2
|
||||||
|
hooks:
|
||||||
|
- id: gitleaks
|
||||||
|
|||||||
@@ -20,7 +20,7 @@ Some of the ways you can contribute to 🤗 LeRobot:
|
|||||||
* Contributing to the examples or to the documentation.
|
* Contributing to the examples or to the documentation.
|
||||||
* Submitting issues related to bugs or desired new features.
|
* Submitting issues related to bugs or desired new features.
|
||||||
|
|
||||||
Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](remi.cadene@huggingface.co).
|
Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](mailto:remi.cadene@huggingface.co).
|
||||||
|
|
||||||
If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/orgs/huggingface/projects/46)
|
If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/orgs/huggingface/projects/46)
|
||||||
|
|
||||||
@@ -267,7 +267,7 @@ We use `pytest` in order to run the tests. From the root of the
|
|||||||
repository, here's how to run tests with `pytest` for the library:
|
repository, here's how to run tests with `pytest` for the library:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
DATA_DIR="tests/data" python -m pytest -sv ./tests
|
python -m pytest -sv ./tests
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
126
Makefile
126
Makefile
@@ -5,11 +5,12 @@ PYTHON_PATH := $(shell which python)
|
|||||||
# If Poetry is installed, redefine PYTHON_PATH to use the Poetry-managed Python
|
# If Poetry is installed, redefine PYTHON_PATH to use the Poetry-managed Python
|
||||||
POETRY_CHECK := $(shell command -v poetry)
|
POETRY_CHECK := $(shell command -v poetry)
|
||||||
ifneq ($(POETRY_CHECK),)
|
ifneq ($(POETRY_CHECK),)
|
||||||
PYTHON_PATH := $(shell poetry run which python)
|
PYTHON_PATH := $(shell poetry run which python)
|
||||||
endif
|
endif
|
||||||
|
|
||||||
export PATH := $(dir $(PYTHON_PATH)):$(PATH)
|
export PATH := $(dir $(PYTHON_PATH)):$(PATH)
|
||||||
|
|
||||||
|
DEVICE ?= cpu
|
||||||
|
|
||||||
build-cpu:
|
build-cpu:
|
||||||
docker build -t lerobot:latest -f docker/lerobot-cpu/Dockerfile .
|
docker build -t lerobot:latest -f docker/lerobot-cpu/Dockerfile .
|
||||||
@@ -18,61 +19,100 @@ build-gpu:
|
|||||||
docker build -t lerobot:latest -f docker/lerobot-gpu/Dockerfile .
|
docker build -t lerobot:latest -f docker/lerobot-gpu/Dockerfile .
|
||||||
|
|
||||||
test-end-to-end:
|
test-end-to-end:
|
||||||
${MAKE} test-act-ete-train
|
${MAKE} DEVICE=$(DEVICE) test-act-ete-train
|
||||||
${MAKE} test-act-ete-eval
|
${MAKE} DEVICE=$(DEVICE) test-act-ete-eval
|
||||||
${MAKE} test-diffusion-ete-train
|
${MAKE} DEVICE=$(DEVICE) test-act-ete-train-amp
|
||||||
${MAKE} test-diffusion-ete-eval
|
${MAKE} DEVICE=$(DEVICE) test-act-ete-eval-amp
|
||||||
${MAKE} test-tdmpc-ete-train
|
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-train
|
||||||
${MAKE} test-tdmpc-ete-eval
|
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-eval
|
||||||
${MAKE} test-default-ete-eval
|
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train
|
||||||
|
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train-with-online
|
||||||
|
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-eval
|
||||||
|
${MAKE} DEVICE=$(DEVICE) test-default-ete-eval
|
||||||
|
${MAKE} DEVICE=$(DEVICE) test-act-pusht-tutorial
|
||||||
|
|
||||||
test-act-ete-train:
|
test-act-ete-train:
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
policy=act \
|
policy=act \
|
||||||
|
policy.dim_model=64 \
|
||||||
env=aloha \
|
env=aloha \
|
||||||
wandb.enable=False \
|
wandb.enable=False \
|
||||||
training.offline_steps=2 \
|
training.offline_steps=2 \
|
||||||
training.online_steps=0 \
|
training.online_steps=0 \
|
||||||
eval.n_episodes=1 \
|
eval.n_episodes=1 \
|
||||||
eval.batch_size=1 \
|
eval.batch_size=1 \
|
||||||
device=cpu \
|
device=$(DEVICE) \
|
||||||
training.save_model=true \
|
training.save_checkpoint=true \
|
||||||
training.save_freq=2 \
|
training.save_freq=2 \
|
||||||
policy.n_action_steps=20 \
|
policy.n_action_steps=20 \
|
||||||
policy.chunk_size=20 \
|
policy.chunk_size=20 \
|
||||||
training.batch_size=2 \
|
training.batch_size=2 \
|
||||||
|
training.image_transforms.enable=true \
|
||||||
hydra.run.dir=tests/outputs/act/
|
hydra.run.dir=tests/outputs/act/
|
||||||
|
|
||||||
test-act-ete-eval:
|
test-act-ete-eval:
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py \
|
||||||
-p tests/outputs/act/checkpoints/000002 \
|
-p tests/outputs/act/checkpoints/000002/pretrained_model \
|
||||||
eval.n_episodes=1 \
|
eval.n_episodes=1 \
|
||||||
eval.batch_size=1 \
|
eval.batch_size=1 \
|
||||||
env.episode_length=8 \
|
env.episode_length=8 \
|
||||||
device=cpu \
|
device=$(DEVICE) \
|
||||||
|
|
||||||
|
test-act-ete-train-amp:
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
policy=act \
|
||||||
|
policy.dim_model=64 \
|
||||||
|
env=aloha \
|
||||||
|
wandb.enable=False \
|
||||||
|
training.offline_steps=2 \
|
||||||
|
training.online_steps=0 \
|
||||||
|
eval.n_episodes=1 \
|
||||||
|
eval.batch_size=1 \
|
||||||
|
device=$(DEVICE) \
|
||||||
|
training.save_checkpoint=true \
|
||||||
|
training.save_freq=2 \
|
||||||
|
policy.n_action_steps=20 \
|
||||||
|
policy.chunk_size=20 \
|
||||||
|
training.batch_size=2 \
|
||||||
|
hydra.run.dir=tests/outputs/act_amp/ \
|
||||||
|
training.image_transforms.enable=true \
|
||||||
|
use_amp=true
|
||||||
|
|
||||||
|
test-act-ete-eval-amp:
|
||||||
|
python lerobot/scripts/eval.py \
|
||||||
|
-p tests/outputs/act_amp/checkpoints/000002/pretrained_model \
|
||||||
|
eval.n_episodes=1 \
|
||||||
|
eval.batch_size=1 \
|
||||||
|
env.episode_length=8 \
|
||||||
|
device=$(DEVICE) \
|
||||||
|
use_amp=true
|
||||||
|
|
||||||
test-diffusion-ete-train:
|
test-diffusion-ete-train:
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
policy=diffusion \
|
policy=diffusion \
|
||||||
|
policy.down_dims=\[64,128,256\] \
|
||||||
|
policy.diffusion_step_embed_dim=32 \
|
||||||
|
policy.num_inference_steps=10 \
|
||||||
env=pusht \
|
env=pusht \
|
||||||
wandb.enable=False \
|
wandb.enable=False \
|
||||||
training.offline_steps=2 \
|
training.offline_steps=2 \
|
||||||
training.online_steps=0 \
|
training.online_steps=0 \
|
||||||
eval.n_episodes=1 \
|
eval.n_episodes=1 \
|
||||||
eval.batch_size=1 \
|
eval.batch_size=1 \
|
||||||
device=cpu \
|
device=$(DEVICE) \
|
||||||
training.save_model=true \
|
training.save_checkpoint=true \
|
||||||
training.save_freq=2 \
|
training.save_freq=2 \
|
||||||
training.batch_size=2 \
|
training.batch_size=2 \
|
||||||
|
training.image_transforms.enable=true \
|
||||||
hydra.run.dir=tests/outputs/diffusion/
|
hydra.run.dir=tests/outputs/diffusion/
|
||||||
|
|
||||||
test-diffusion-ete-eval:
|
test-diffusion-ete-eval:
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py \
|
||||||
-p tests/outputs/diffusion/checkpoints/000002 \
|
-p tests/outputs/diffusion/checkpoints/000002/pretrained_model \
|
||||||
eval.n_episodes=1 \
|
eval.n_episodes=1 \
|
||||||
eval.batch_size=1 \
|
eval.batch_size=1 \
|
||||||
env.episode_length=8 \
|
env.episode_length=8 \
|
||||||
device=cpu \
|
device=$(DEVICE) \
|
||||||
|
|
||||||
test-tdmpc-ete-train:
|
test-tdmpc-ete-train:
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
@@ -82,24 +122,46 @@ test-tdmpc-ete-train:
|
|||||||
dataset_repo_id=lerobot/xarm_lift_medium \
|
dataset_repo_id=lerobot/xarm_lift_medium \
|
||||||
wandb.enable=False \
|
wandb.enable=False \
|
||||||
training.offline_steps=2 \
|
training.offline_steps=2 \
|
||||||
training.online_steps=2 \
|
training.online_steps=0 \
|
||||||
eval.n_episodes=1 \
|
eval.n_episodes=1 \
|
||||||
eval.batch_size=1 \
|
eval.batch_size=1 \
|
||||||
env.episode_length=2 \
|
env.episode_length=2 \
|
||||||
device=cpu \
|
device=$(DEVICE) \
|
||||||
training.save_model=true \
|
training.save_checkpoint=true \
|
||||||
training.save_freq=2 \
|
training.save_freq=2 \
|
||||||
training.batch_size=2 \
|
training.batch_size=2 \
|
||||||
|
training.image_transforms.enable=true \
|
||||||
hydra.run.dir=tests/outputs/tdmpc/
|
hydra.run.dir=tests/outputs/tdmpc/
|
||||||
|
|
||||||
|
test-tdmpc-ete-train-with-online:
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
env=pusht \
|
||||||
|
env.gym.obs_type=environment_state_agent_pos \
|
||||||
|
policy=tdmpc_pusht_keypoints \
|
||||||
|
eval.n_episodes=1 \
|
||||||
|
eval.batch_size=1 \
|
||||||
|
env.episode_length=10 \
|
||||||
|
device=$(DEVICE) \
|
||||||
|
training.offline_steps=2 \
|
||||||
|
training.online_steps=20 \
|
||||||
|
training.save_checkpoint=false \
|
||||||
|
training.save_freq=10 \
|
||||||
|
training.batch_size=2 \
|
||||||
|
training.online_rollout_n_episodes=2 \
|
||||||
|
training.online_rollout_batch_size=2 \
|
||||||
|
training.online_steps_between_rollouts=10 \
|
||||||
|
training.online_buffer_capacity=15 \
|
||||||
|
eval.use_async_envs=true \
|
||||||
|
hydra.run.dir=tests/outputs/tdmpc_online/
|
||||||
|
|
||||||
|
|
||||||
test-tdmpc-ete-eval:
|
test-tdmpc-ete-eval:
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py \
|
||||||
-p tests/outputs/tdmpc/checkpoints/000002 \
|
-p tests/outputs/tdmpc/checkpoints/000002/pretrained_model \
|
||||||
eval.n_episodes=1 \
|
eval.n_episodes=1 \
|
||||||
eval.batch_size=1 \
|
eval.batch_size=1 \
|
||||||
env.episode_length=8 \
|
env.episode_length=8 \
|
||||||
device=cpu \
|
device=$(DEVICE) \
|
||||||
|
|
||||||
|
|
||||||
test-default-ete-eval:
|
test-default-ete-eval:
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py \
|
||||||
@@ -107,4 +169,22 @@ test-default-ete-eval:
|
|||||||
eval.n_episodes=1 \
|
eval.n_episodes=1 \
|
||||||
eval.batch_size=1 \
|
eval.batch_size=1 \
|
||||||
env.episode_length=8 \
|
env.episode_length=8 \
|
||||||
device=cpu \
|
device=$(DEVICE) \
|
||||||
|
|
||||||
|
test-act-pusht-tutorial:
|
||||||
|
cp examples/advanced/1_train_act_pusht/act_pusht.yaml lerobot/configs/policy/created_by_Makefile.yaml
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
policy=created_by_Makefile.yaml \
|
||||||
|
env=pusht \
|
||||||
|
wandb.enable=False \
|
||||||
|
training.offline_steps=2 \
|
||||||
|
eval.n_episodes=1 \
|
||||||
|
eval.batch_size=1 \
|
||||||
|
env.episode_length=2 \
|
||||||
|
device=$(DEVICE) \
|
||||||
|
training.save_model=true \
|
||||||
|
training.save_freq=2 \
|
||||||
|
training.batch_size=2 \
|
||||||
|
training.image_transforms.enable=true \
|
||||||
|
hydra.run.dir=tests/outputs/act_pusht/
|
||||||
|
rm lerobot/configs/policy/created_by_Makefile.yaml
|
||||||
|
|||||||
200
README.md
200
README.md
@@ -22,8 +22,22 @@
|
|||||||
|
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<h2 align="center">
|
||||||
|
<p><a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">New robot in town: SO-100</a></p>
|
||||||
|
</h2>
|
||||||
|
|
||||||
|
<div align="center">
|
||||||
|
<img src="media/so100/leader_follower.webp?raw=true" alt="SO-100 leader and follower arms" title="SO-100 leader and follower arms" width="50%">
|
||||||
|
<p>We just added a new tutorial on how to build a more affordable robot, at the price of $110 per arm!</p>
|
||||||
|
<p>Teach it new skills by showing it a few moves with just a laptop.</p>
|
||||||
|
<p>Then watch your homemade robot act autonomously 🤯</p>
|
||||||
|
<p>Follow the link to the <a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">full tutorial for SO-100</a>.</p>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<br/>
|
||||||
|
|
||||||
<h3 align="center">
|
<h3 align="center">
|
||||||
<p>State-of-the-art Machine Learning for real-world robotics</p>
|
<p>LeRobot: State-of-the-art AI for real-world robotics</p>
|
||||||
</h3>
|
</h3>
|
||||||
|
|
||||||
---
|
---
|
||||||
@@ -41,9 +55,9 @@
|
|||||||
|
|
||||||
<table>
|
<table>
|
||||||
<tr>
|
<tr>
|
||||||
<td><img src="http://remicadene.com/assets/gif/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
|
<td><img src="media/gym/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
|
||||||
<td><img src="http://remicadene.com/assets/gif/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
|
<td><img src="media/gym/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
|
||||||
<td><img src="http://remicadene.com/assets/gif/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
|
<td><img src="media/gym/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td align="center">ACT policy on ALOHA env</td>
|
<td align="center">ACT policy on ALOHA env</td>
|
||||||
@@ -58,25 +72,32 @@
|
|||||||
- Thanks to Cheng Chi, Zhenjia Xu and colleagues for open sourcing Diffusion policy, Pusht environment and datasets, as well as UMI datasets. Ours are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu) and [UMI Gripper](https://umi-gripper.github.io).
|
- Thanks to Cheng Chi, Zhenjia Xu and colleagues for open sourcing Diffusion policy, Pusht environment and datasets, as well as UMI datasets. Ours are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu) and [UMI Gripper](https://umi-gripper.github.io).
|
||||||
- Thanks to Nicklas Hansen, Yunhai Feng and colleagues for open sourcing TDMPC policy, Simxarm environments and datasets. Ours are adapted from [TDMPC](https://github.com/nicklashansen/tdmpc) and [FOWM](https://www.yunhaifeng.com/FOWM).
|
- Thanks to Nicklas Hansen, Yunhai Feng and colleagues for open sourcing TDMPC policy, Simxarm environments and datasets. Ours are adapted from [TDMPC](https://github.com/nicklashansen/tdmpc) and [FOWM](https://www.yunhaifeng.com/FOWM).
|
||||||
- Thanks to Antonio Loquercio and Ashish Kumar for their early support.
|
- Thanks to Antonio Loquercio and Ashish Kumar for their early support.
|
||||||
|
- Thanks to [Seungjae (Jay) Lee](https://sjlee.cc/), [Mahi Shafiullah](https://mahis.life/) and colleagues for open sourcing [VQ-BeT](https://sjlee.cc/vq-bet/) policy and helping us adapt the codebase to our repository. The policy is adapted from [VQ-BeT repo](https://github.com/jayLEE0301/vq_bet_official).
|
||||||
|
|
||||||
|
|
||||||
## Installation
|
## Installation
|
||||||
|
|
||||||
Download our source code:
|
Download our source code:
|
||||||
```bash
|
```bash
|
||||||
git clone https://github.com/huggingface/lerobot.git && cd lerobot
|
git clone https://github.com/huggingface/lerobot.git
|
||||||
|
cd lerobot
|
||||||
```
|
```
|
||||||
|
|
||||||
Create a virtual environment with Python 3.10 and activate it, e.g. with [`miniconda`](https://docs.anaconda.com/free/miniconda/index.html):
|
Create a virtual environment with Python 3.10 and activate it, e.g. with [`miniconda`](https://docs.anaconda.com/free/miniconda/index.html):
|
||||||
```bash
|
```bash
|
||||||
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
conda create -y -n lerobot python=3.10
|
||||||
|
conda activate lerobot
|
||||||
```
|
```
|
||||||
|
|
||||||
Install 🤗 LeRobot:
|
Install 🤗 LeRobot:
|
||||||
```bash
|
```bash
|
||||||
pip install .
|
pip install -e .
|
||||||
```
|
```
|
||||||
|
|
||||||
|
> **NOTE:** Depending on your platform, If you encounter any build errors during this step
|
||||||
|
you may need to install `cmake` and `build-essential` for building some of our dependencies.
|
||||||
|
On linux: `sudo apt-get install cmake build-essential`
|
||||||
|
|
||||||
For simulations, 🤗 LeRobot comes with gymnasium environments that can be installed as extras:
|
For simulations, 🤗 LeRobot comes with gymnasium environments that can be installed as extras:
|
||||||
- [aloha](https://github.com/huggingface/gym-aloha)
|
- [aloha](https://github.com/huggingface/gym-aloha)
|
||||||
- [xarm](https://github.com/huggingface/gym-xarm)
|
- [xarm](https://github.com/huggingface/gym-xarm)
|
||||||
@@ -84,7 +105,7 @@ For simulations, 🤗 LeRobot comes with gymnasium environments that can be inst
|
|||||||
|
|
||||||
For instance, to install 🤗 LeRobot with aloha and pusht, use:
|
For instance, to install 🤗 LeRobot with aloha and pusht, use:
|
||||||
```bash
|
```bash
|
||||||
pip install ".[aloha, pusht]"
|
pip install -e ".[aloha, pusht]"
|
||||||
```
|
```
|
||||||
|
|
||||||
To use [Weights and Biases](https://docs.wandb.ai/quickstart) for experiment tracking, log in with
|
To use [Weights and Biases](https://docs.wandb.ai/quickstart) for experiment tracking, log in with
|
||||||
@@ -99,6 +120,7 @@ wandb login
|
|||||||
```
|
```
|
||||||
.
|
.
|
||||||
├── examples # contains demonstration examples, start here to learn about LeRobot
|
├── examples # contains demonstration examples, start here to learn about LeRobot
|
||||||
|
| └── advanced # contains even more examples for those who have mastered the basics
|
||||||
├── lerobot
|
├── lerobot
|
||||||
| ├── configs # contains hydra yaml files with all options that you can override in the command line
|
| ├── configs # contains hydra yaml files with all options that you can override in the command line
|
||||||
| | ├── default.yaml # selected by default, it loads pusht environment and diffusion policy
|
| | ├── default.yaml # selected by default, it loads pusht environment and diffusion policy
|
||||||
@@ -108,10 +130,12 @@ wandb login
|
|||||||
| | ├── datasets # various datasets of human demonstrations: aloha, pusht, xarm
|
| | ├── datasets # various datasets of human demonstrations: aloha, pusht, xarm
|
||||||
| | ├── envs # various sim environments: aloha, pusht, xarm
|
| | ├── envs # various sim environments: aloha, pusht, xarm
|
||||||
| | ├── policies # various policies: act, diffusion, tdmpc
|
| | ├── policies # various policies: act, diffusion, tdmpc
|
||||||
|
| | ├── robot_devices # various real devices: dynamixel motors, opencv cameras, koch robots
|
||||||
| | └── utils # various utilities
|
| | └── utils # various utilities
|
||||||
| └── scripts # contains functions to execute via command line
|
| └── scripts # contains functions to execute via command line
|
||||||
| ├── eval.py # load policy and evaluate it on an environment
|
| ├── eval.py # load policy and evaluate it on an environment
|
||||||
| ├── train.py # train a policy via imitation learning and/or reinforcement learning
|
| ├── train.py # train a policy via imitation learning and/or reinforcement learning
|
||||||
|
| ├── control_robot.py # teleoperate a real robot, record data, run a policy
|
||||||
| ├── push_dataset_to_hub.py # convert your dataset into LeRobot dataset format and upload it to the Hugging Face hub
|
| ├── push_dataset_to_hub.py # convert your dataset into LeRobot dataset format and upload it to the Hugging Face hub
|
||||||
| └── visualize_dataset.py # load a dataset and render its demonstrations
|
| └── visualize_dataset.py # load a dataset and render its demonstrations
|
||||||
├── outputs # contains results of scripts execution: logs, videos, model checkpoints
|
├── outputs # contains results of scripts execution: logs, videos, model checkpoints
|
||||||
@@ -120,15 +144,25 @@ wandb login
|
|||||||
|
|
||||||
### Visualize datasets
|
### Visualize datasets
|
||||||
|
|
||||||
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically download data from the Hugging Face hub.
|
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically downloads data from the Hugging Face hub.
|
||||||
|
|
||||||
You can also locally visualize episodes from a dataset by executing our script from the command line:
|
You can also locally visualize episodes from a dataset on the hub by executing our script from the command line:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/visualize_dataset.py \
|
python lerobot/scripts/visualize_dataset.py \
|
||||||
--repo-id lerobot/pusht \
|
--repo-id lerobot/pusht \
|
||||||
--episode-index 0
|
--episode-index 0
|
||||||
```
|
```
|
||||||
|
|
||||||
|
or from a dataset in a local folder with the `root` option and the `--local-files-only` (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/visualize_dataset.py \
|
||||||
|
--repo-id lerobot/pusht \
|
||||||
|
--root ./my_local_data_dir \
|
||||||
|
--local-files-only 1 \
|
||||||
|
--episode-index 0
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
It will open `rerun.io` and display the camera streams, robot states and actions, like this:
|
It will open `rerun.io` and display the camera streams, robot states and actions, like this:
|
||||||
|
|
||||||
https://github-production-user-asset-6210df.s3.amazonaws.com/4681518/328035972-fd46b787-b532-47e2-bb6f-fd536a55a7ed.mov?X-Amz-Algorithm=AWS4-HMAC-SHA256&X-Amz-Credential=AKIAVCODYLSA53PQK4ZA%2F20240505%2Fus-east-1%2Fs3%2Faws4_request&X-Amz-Date=20240505T172924Z&X-Amz-Expires=300&X-Amz-Signature=d680b26c532eeaf80740f08af3320d22ad0b8a4e4da1bcc4f33142c15b509eda&X-Amz-SignedHeaders=host&actor_id=24889239&key_id=0&repo_id=748713144
|
https://github-production-user-asset-6210df.s3.amazonaws.com/4681518/328035972-fd46b787-b532-47e2-bb6f-fd536a55a7ed.mov?X-Amz-Algorithm=AWS4-HMAC-SHA256&X-Amz-Credential=AKIAVCODYLSA53PQK4ZA%2F20240505%2Fus-east-1%2Fs3%2Faws4_request&X-Amz-Date=20240505T172924Z&X-Amz-Expires=300&X-Amz-Signature=d680b26c532eeaf80740f08af3320d22ad0b8a4e4da1bcc4f33142c15b509eda&X-Amz-SignedHeaders=host&actor_id=24889239&key_id=0&repo_id=748713144
|
||||||
@@ -136,6 +170,51 @@ https://github-production-user-asset-6210df.s3.amazonaws.com/4681518/328035972-f
|
|||||||
|
|
||||||
Our script can also visualize datasets stored on a distant server. See `python lerobot/scripts/visualize_dataset.py --help` for more instructions.
|
Our script can also visualize datasets stored on a distant server. See `python lerobot/scripts/visualize_dataset.py --help` for more instructions.
|
||||||
|
|
||||||
|
### The `LeRobotDataset` format
|
||||||
|
|
||||||
|
A dataset in `LeRobotDataset` format is very simple to use. It can be loaded from a repository on the Hugging Face hub or a local folder simply with e.g. `dataset = LeRobotDataset("lerobot/aloha_static_coffee")` and can be indexed into like any Hugging Face and PyTorch dataset. For instance `dataset[0]` will retrieve a single temporal frame from the dataset containing observation(s) and an action as PyTorch tensors ready to be fed to a model.
|
||||||
|
|
||||||
|
A specificity of `LeRobotDataset` is that, rather than retrieving a single frame by its index, we can retrieve several frames based on their temporal relationship with the indexed frame, by setting `delta_timestamps` to a list of relative times with respect to the indexed frame. For example, with `delta_timestamps = {"observation.image": [-1, -0.5, -0.2, 0]}` one can retrieve, for a given index, 4 frames: 3 "previous" frames 1 second, 0.5 seconds, and 0.2 seconds before the indexed frame, and the indexed frame itself (corresponding to the 0 entry). See example [1_load_lerobot_dataset.py](examples/1_load_lerobot_dataset.py) for more details on `delta_timestamps`.
|
||||||
|
|
||||||
|
Under the hood, the `LeRobotDataset` format makes use of several ways to serialize data which can be useful to understand if you plan to work more closely with this format. We tried to make a flexible yet simple dataset format that would cover most type of features and specificities present in reinforcement learning and robotics, in simulation and in real-world, with a focus on cameras and robot states but easily extended to other types of sensory inputs as long as they can be represented by a tensor.
|
||||||
|
|
||||||
|
Here are the important details and internal structure organization of a typical `LeRobotDataset` instantiated with `dataset = LeRobotDataset("lerobot/aloha_static_coffee")`. The exact features will change from dataset to dataset but not the main aspects:
|
||||||
|
|
||||||
|
```
|
||||||
|
dataset attributes:
|
||||||
|
├ hf_dataset: a Hugging Face dataset (backed by Arrow/parquet). Typical features example:
|
||||||
|
│ ├ observation.images.cam_high (VideoFrame):
|
||||||
|
│ │ VideoFrame = {'path': path to a mp4 video, 'timestamp' (float32): timestamp in the video}
|
||||||
|
│ ├ observation.state (list of float32): position of an arm joints (for instance)
|
||||||
|
│ ... (more observations)
|
||||||
|
│ ├ action (list of float32): goal position of an arm joints (for instance)
|
||||||
|
│ ├ episode_index (int64): index of the episode for this sample
|
||||||
|
│ ├ frame_index (int64): index of the frame for this sample in the episode ; starts at 0 for each episode
|
||||||
|
│ ├ timestamp (float32): timestamp in the episode
|
||||||
|
│ ├ next.done (bool): indicates the end of en episode ; True for the last frame in each episode
|
||||||
|
│ └ index (int64): general index in the whole dataset
|
||||||
|
├ episode_data_index: contains 2 tensors with the start and end indices of each episode
|
||||||
|
│ ├ from (1D int64 tensor): first frame index for each episode — shape (num episodes,) starts with 0
|
||||||
|
│ └ to: (1D int64 tensor): last frame index for each episode — shape (num episodes,)
|
||||||
|
├ stats: a dictionary of statistics (max, mean, min, std) for each feature in the dataset, for instance
|
||||||
|
│ ├ observation.images.cam_high: {'max': tensor with same number of dimensions (e.g. `(c, 1, 1)` for images, `(c,)` for states), etc.}
|
||||||
|
│ ...
|
||||||
|
├ info: a dictionary of metadata on the dataset
|
||||||
|
│ ├ codebase_version (str): this is to keep track of the codebase version the dataset was created with
|
||||||
|
│ ├ fps (float): frame per second the dataset is recorded/synchronized to
|
||||||
|
│ ├ video (bool): indicates if frames are encoded in mp4 video files to save space or stored as png files
|
||||||
|
│ └ encoding (dict): if video, this documents the main options that were used with ffmpeg to encode the videos
|
||||||
|
├ videos_dir (Path): where the mp4 videos or png images are stored/accessed
|
||||||
|
└ camera_keys (list of string): the keys to access camera features in the item returned by the dataset (e.g. `["observation.images.cam_high", ...]`)
|
||||||
|
```
|
||||||
|
|
||||||
|
A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
|
||||||
|
- hf_dataset stored using Hugging Face datasets library serialization to parquet
|
||||||
|
- videos are stored in mp4 format to save space
|
||||||
|
- metadata are stored in plain json/jsonl files
|
||||||
|
|
||||||
|
Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can use the `local_files_only` argument and specify its location with the `root` argument if it's not in the default `~/.cache/huggingface/lerobot` location.
|
||||||
|
|
||||||
### Evaluate a pretrained policy
|
### Evaluate a pretrained policy
|
||||||
|
|
||||||
Check out [example 2](./examples/2_evaluate_pretrained_policy.py) that illustrates how to download a pretrained policy from Hugging Face hub, and run an evaluation on its corresponding environment.
|
Check out [example 2](./examples/2_evaluate_pretrained_policy.py) that illustrates how to download a pretrained policy from Hugging Face hub, and run an evaluation on its corresponding environment.
|
||||||
@@ -149,18 +228,19 @@ python lerobot/scripts/eval.py \
|
|||||||
```
|
```
|
||||||
|
|
||||||
Note: After training your own policy, you can re-evaluate the checkpoints with:
|
Note: After training your own policy, you can re-evaluate the checkpoints with:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/eval.py \
|
python lerobot/scripts/eval.py -p {OUTPUT_DIR}/checkpoints/last/pretrained_model
|
||||||
-p PATH/TO/TRAIN/OUTPUT/FOLDER
|
|
||||||
```
|
```
|
||||||
|
|
||||||
See `python lerobot/scripts/eval.py --help` for more instructions.
|
See `python lerobot/scripts/eval.py --help` for more instructions.
|
||||||
|
|
||||||
### Train your own policy
|
### Train your own policy
|
||||||
|
|
||||||
Check out [example 3](./examples/3_train_policy.py) that illustrates how to start training a model.
|
Check out [example 3](./examples/3_train_policy.py) that illustrates how to train a model using our core library in python, and [example 4](./examples/4_train_policy_with_script.md) that shows how to use our training script from command line.
|
||||||
|
|
||||||
In general, you can use our training script to easily train any policy. Here is an example of training the ACT policy on trajectories collected by humans on the Aloha simulation environment for the insertion task:
|
In general, you can use our training script to easily train any policy. Here is an example of training the ACT policy on trajectories collected by humans on the Aloha simulation environment for the insertion task:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/train.py \
|
python lerobot/scripts/train.py \
|
||||||
policy=act \
|
policy=act \
|
||||||
@@ -174,17 +254,49 @@ The experiment directory is automatically generated and will show up in yellow i
|
|||||||
hydra.run.dir=your/new/experiment/dir
|
hydra.run.dir=your/new/experiment/dir
|
||||||
```
|
```
|
||||||
|
|
||||||
|
In the experiment directory there will be a folder called `checkpoints` which will have the following structure:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
checkpoints
|
||||||
|
├── 000250 # checkpoint_dir for training step 250
|
||||||
|
│ ├── pretrained_model # Hugging Face pretrained model dir
|
||||||
|
│ │ ├── config.json # Hugging Face pretrained model config
|
||||||
|
│ │ ├── config.yaml # consolidated Hydra config
|
||||||
|
│ │ ├── model.safetensors # model weights
|
||||||
|
│ │ └── README.md # Hugging Face model card
|
||||||
|
│ └── training_state.pth # optimizer/scheduler/rng state and training step
|
||||||
|
```
|
||||||
|
|
||||||
|
To resume training from a checkpoint, you can add these to the `train.py` python command:
|
||||||
|
```bash
|
||||||
|
hydra.run.dir=your/original/experiment/dir resume=true
|
||||||
|
```
|
||||||
|
|
||||||
|
It will load the pretrained model, optimizer and scheduler states for training. For more information please see our tutorial on training resumption [here](https://github.com/huggingface/lerobot/blob/main/examples/5_resume_training.md).
|
||||||
|
|
||||||
To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding:
|
To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding:
|
||||||
|
|
||||||
```bash
|
```bash
|
||||||
wandb.enable=true
|
wandb.enable=true
|
||||||
```
|
```
|
||||||
|
|
||||||
A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser:
|
A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser. Please also check [here](https://github.com/huggingface/lerobot/blob/main/examples/4_train_policy_with_script.md#typical-logs-and-metrics) for the explanation of some commonly used metrics in logs.
|
||||||
|
|
||||||

|

|
||||||
|
|
||||||
Note: For efficiency, during training every checkpoint is evaluated on a low number of episodes. After training, you may want to re-evaluate your best checkpoints on more episodes or change the evaluation settings. See `python lerobot/scripts/eval.py --help` for more instructions.
|
Note: For efficiency, during training every checkpoint is evaluated on a low number of episodes. You may use `eval.n_episodes=500` to evaluate on more episodes than the default. Or, after training, you may want to re-evaluate your best checkpoints on more episodes or change the evaluation settings. See `python lerobot/scripts/eval.py --help` for more instructions.
|
||||||
|
|
||||||
|
#### Reproduce state-of-the-art (SOTA)
|
||||||
|
|
||||||
|
We have organized our configuration files (found under [`lerobot/configs`](./lerobot/configs)) such that they reproduce SOTA results from a given model variant in their respective original works. Simply running:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py policy=diffusion env=pusht
|
||||||
|
```
|
||||||
|
|
||||||
|
reproduces SOTA results for Diffusion Policy on the PushT task.
|
||||||
|
|
||||||
|
Pretrained policies, along with reproduction details, can be found under the "Models" section of https://huggingface.co/lerobot.
|
||||||
|
|
||||||
## Contribute
|
## Contribute
|
||||||
|
|
||||||
@@ -197,13 +309,13 @@ To add a dataset to the hub, you need to login using a write-access token, which
|
|||||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
```
|
```
|
||||||
|
|
||||||
Then move your dataset folder in `data` directory (e.g. `data/aloha_static_pingpong_test`), and push your dataset to the hub with:
|
Then point to your raw dataset folder (e.g. `data/aloha_static_pingpong_test_raw`), and push your dataset to the hub with:
|
||||||
```bash
|
```bash
|
||||||
python lerobot/scripts/push_dataset_to_hub.py \
|
python lerobot/scripts/push_dataset_to_hub.py \
|
||||||
--data-dir data \
|
--raw-dir data/aloha_static_pingpong_test_raw \
|
||||||
--dataset-id aloha_static_pingpong_test \
|
--out-dir data \
|
||||||
--raw-format aloha_hdf5 \
|
--repo-id lerobot/aloha_static_pingpong_test \
|
||||||
--community-id lerobot
|
--raw-format aloha_hdf5
|
||||||
```
|
```
|
||||||
|
|
||||||
See `python lerobot/scripts/push_dataset_to_hub.py --help` for more instructions.
|
See `python lerobot/scripts/push_dataset_to_hub.py --help` for more instructions.
|
||||||
@@ -215,14 +327,14 @@ If your dataset format is not supported, implement your own in `lerobot/common/d
|
|||||||
|
|
||||||
Once you have trained a policy you may upload it to the Hugging Face hub using a hub id that looks like `${hf_user}/${repo_name}` (e.g. [lerobot/diffusion_pusht](https://huggingface.co/lerobot/diffusion_pusht)).
|
Once you have trained a policy you may upload it to the Hugging Face hub using a hub id that looks like `${hf_user}/${repo_name}` (e.g. [lerobot/diffusion_pusht](https://huggingface.co/lerobot/diffusion_pusht)).
|
||||||
|
|
||||||
You first need to find the checkpoint located inside your experiment directory (e.g. `outputs/train/2024-05-05/20-21-12_aloha_act_default/checkpoints/002500`). It should contain:
|
You first need to find the checkpoint folder located inside your experiment directory (e.g. `outputs/train/2024-05-05/20-21-12_aloha_act_default/checkpoints/002500`). Within that there is a `pretrained_model` directory which should contain:
|
||||||
- `config.json`: A serialized version of the policy configuration (following the policy's dataclass config).
|
- `config.json`: A serialized version of the policy configuration (following the policy's dataclass config).
|
||||||
- `model.safetensors`: A set of `torch.nn.Module` parameters, saved in [Hugging Face Safetensors](https://huggingface.co/docs/safetensors/index) format.
|
- `model.safetensors`: A set of `torch.nn.Module` parameters, saved in [Hugging Face Safetensors](https://huggingface.co/docs/safetensors/index) format.
|
||||||
- `config.yaml`: A consolidated Hydra training configuration containing the policy, environment, and dataset configs. The policy configuration should match `config.json` exactly. The environment config is useful for anyone who wants to evaluate your policy. The dataset config just serves as a paper trail for reproducibility.
|
- `config.yaml`: A consolidated Hydra training configuration containing the policy, environment, and dataset configs. The policy configuration should match `config.json` exactly. The environment config is useful for anyone who wants to evaluate your policy. The dataset config just serves as a paper trail for reproducibility.
|
||||||
|
|
||||||
To upload these to the hub, run the following:
|
To upload these to the hub, run the following:
|
||||||
```bash
|
```bash
|
||||||
huggingface-cli upload ${hf_user}/${repo_name} path/to/checkpoint/dir
|
huggingface-cli upload ${hf_user}/${repo_name} path/to/pretrained_model
|
||||||
```
|
```
|
||||||
|
|
||||||
See [eval.py](https://github.com/huggingface/lerobot/blob/main/lerobot/scripts/eval.py) for an example of how other people may use your policy.
|
See [eval.py](https://github.com/huggingface/lerobot/blob/main/lerobot/scripts/eval.py) for an example of how other people may use your policy.
|
||||||
@@ -255,7 +367,7 @@ with profile(
|
|||||||
## Citation
|
## Citation
|
||||||
|
|
||||||
If you want, you can cite this work with:
|
If you want, you can cite this work with:
|
||||||
```
|
```bibtex
|
||||||
@misc{cadene2024lerobot,
|
@misc{cadene2024lerobot,
|
||||||
author = {Cadene, Remi and Alibert, Simon and Soare, Alexander and Gallouedec, Quentin and Zouitine, Adil and Wolf, Thomas},
|
author = {Cadene, Remi and Alibert, Simon and Soare, Alexander and Gallouedec, Quentin and Zouitine, Adil and Wolf, Thomas},
|
||||||
title = {LeRobot: State-of-the-art Machine Learning for Real-World Robotics in Pytorch},
|
title = {LeRobot: State-of-the-art Machine Learning for Real-World Robotics in Pytorch},
|
||||||
@@ -263,3 +375,45 @@ If you want, you can cite this work with:
|
|||||||
year = {2024}
|
year = {2024}
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
||||||
|
Additionally, if you are using any of the particular policy architecture, pretrained models, or datasets, it is recommended to cite the original authors of the work as they appear below:
|
||||||
|
|
||||||
|
- [Diffusion Policy](https://diffusion-policy.cs.columbia.edu)
|
||||||
|
```bibtex
|
||||||
|
@article{chi2024diffusionpolicy,
|
||||||
|
author = {Cheng Chi and Zhenjia Xu and Siyuan Feng and Eric Cousineau and Yilun Du and Benjamin Burchfiel and Russ Tedrake and Shuran Song},
|
||||||
|
title ={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||||
|
journal = {The International Journal of Robotics Research},
|
||||||
|
year = {2024},
|
||||||
|
}
|
||||||
|
```
|
||||||
|
- [ACT or ALOHA](https://tonyzhaozh.github.io/aloha)
|
||||||
|
```bibtex
|
||||||
|
@article{zhao2023learning,
|
||||||
|
title={Learning fine-grained bimanual manipulation with low-cost hardware},
|
||||||
|
author={Zhao, Tony Z and Kumar, Vikash and Levine, Sergey and Finn, Chelsea},
|
||||||
|
journal={arXiv preprint arXiv:2304.13705},
|
||||||
|
year={2023}
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
- [TDMPC](https://www.nicklashansen.com/td-mpc/)
|
||||||
|
|
||||||
|
```bibtex
|
||||||
|
@inproceedings{Hansen2022tdmpc,
|
||||||
|
title={Temporal Difference Learning for Model Predictive Control},
|
||||||
|
author={Nicklas Hansen and Xiaolong Wang and Hao Su},
|
||||||
|
booktitle={ICML},
|
||||||
|
year={2022}
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
- [VQ-BeT](https://sjlee.cc/vq-bet/)
|
||||||
|
```bibtex
|
||||||
|
@article{lee2024behavior,
|
||||||
|
title={Behavior generation with latent actions},
|
||||||
|
author={Lee, Seungjae and Wang, Yibin and Etukuru, Haritheja and Kim, H Jin and Shafiullah, Nur Muhammad Mahi and Pinto, Lerrel},
|
||||||
|
journal={arXiv preprint arXiv:2403.03181},
|
||||||
|
year={2024}
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|||||||
271
benchmarks/video/README.md
Normal file
271
benchmarks/video/README.md
Normal file
@@ -0,0 +1,271 @@
|
|||||||
|
# Video benchmark
|
||||||
|
|
||||||
|
|
||||||
|
## Questions
|
||||||
|
What is the optimal trade-off between:
|
||||||
|
- maximizing loading time with random access,
|
||||||
|
- minimizing memory space on disk,
|
||||||
|
- maximizing success rate of policies,
|
||||||
|
- compatibility across devices/platforms for decoding videos (e.g. video players, web browsers).
|
||||||
|
|
||||||
|
How to encode videos?
|
||||||
|
- Which video codec (`-vcodec`) to use? h264, h265, AV1?
|
||||||
|
- What pixel format to use (`-pix_fmt`)? `yuv444p` or `yuv420p`?
|
||||||
|
- How much compression (`-crf`)? No compression with `0`, intermediate compression with `25` or extreme with `50+`?
|
||||||
|
- Which frequency to chose for key frames (`-g`)? A key frame every `10` frames?
|
||||||
|
|
||||||
|
How to decode videos?
|
||||||
|
- Which `decoder`? `torchvision`, `torchaudio`, `ffmpegio`, `decord`, or `nvc`?
|
||||||
|
- What scenarios to use for the requesting timestamps during benchmark? (`timestamps_mode`)
|
||||||
|
|
||||||
|
|
||||||
|
## Variables
|
||||||
|
**Image content & size**
|
||||||
|
We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an appartment, or in a factory, or outdoor, or with lots of moving objects in the scene, etc. Similarly, loading times might not vary linearly with the image size (resolution).
|
||||||
|
For these reasons, we run this benchmark on four representative datasets:
|
||||||
|
- `lerobot/pusht_image`: (96 x 96 pixels) simulation with simple geometric shapes, fixed camera.
|
||||||
|
- `aliberts/aloha_mobile_shrimp_image`: (480 x 640 pixels) real-world indoor, moving camera.
|
||||||
|
- `aliberts/paris_street`: (720 x 1280 pixels) real-world outdoor, moving camera.
|
||||||
|
- `aliberts/kitchen`: (1080 x 1920 pixels) real-world indoor, fixed camera.
|
||||||
|
|
||||||
|
Note: The datasets used for this benchmark need to be image datasets, not video datasets.
|
||||||
|
|
||||||
|
**Data augmentations**
|
||||||
|
We might revisit this benchmark and find better settings if we train our policies with various data augmentations to make them more robust (e.g. robust to color changes, compression, etc.).
|
||||||
|
|
||||||
|
### Encoding parameters
|
||||||
|
| parameter | values |
|
||||||
|
|-------------|--------------------------------------------------------------|
|
||||||
|
| **vcodec** | `libx264`, `libx265`, `libsvtav1` |
|
||||||
|
| **pix_fmt** | `yuv444p`, `yuv420p` |
|
||||||
|
| **g** | `1`, `2`, `3`, `4`, `5`, `6`, `10`, `15`, `20`, `40`, `None` |
|
||||||
|
| **crf** | `0`, `5`, `10`, `15`, `20`, `25`, `30`, `40`, `50`, `None` |
|
||||||
|
|
||||||
|
Note that `crf` value might be interpreted differently by various video codecs. In other words, the same value used with one codec doesn't necessarily translate into the same compression level with another codec. In fact, the default value (`None`) isn't the same amongst the different video codecs. Importantly, it is also the case for many other ffmpeg arguments like `g` which specifies the frequency of the key frames.
|
||||||
|
|
||||||
|
For a comprehensive list and documentation of these parameters, see the ffmpeg documentation depending on the video codec used:
|
||||||
|
- h264: https://trac.ffmpeg.org/wiki/Encode/H.264
|
||||||
|
- h265: https://trac.ffmpeg.org/wiki/Encode/H.265
|
||||||
|
- AV1: https://trac.ffmpeg.org/wiki/Encode/AV1
|
||||||
|
|
||||||
|
### Decoding parameters
|
||||||
|
**Decoder**
|
||||||
|
We tested two video decoding backends from torchvision:
|
||||||
|
- `pyav` (default)
|
||||||
|
- `video_reader` (requires to build torchvision from source)
|
||||||
|
|
||||||
|
**Requested timestamps**
|
||||||
|
Given the way video decoding works, once a keyframe has been loaded, the decoding of subsequent frames is fast.
|
||||||
|
This of course is affected by the `-g` parameter during encoding, which specifies the frequency of the keyframes. Given our typical use cases in robotics policies which might request a few timestamps in different random places, we want to replicate these use cases with the following scenarios:
|
||||||
|
- `1_frame`: 1 frame,
|
||||||
|
- `2_frames`: 2 consecutive frames (e.g. `[t, t + 1 / fps]`),
|
||||||
|
- `6_frames`: 6 consecutive frames (e.g. `[t + i / fps for i in range(6)]`)
|
||||||
|
|
||||||
|
Note that this differs significantly from a typical use case like watching a movie, in which every frame is loaded sequentially from the beginning to the end and it's acceptable to have big values for `-g`.
|
||||||
|
|
||||||
|
Additionally, because some policies might request single timestamps that are a few frames appart, we also have the following scenario:
|
||||||
|
- `2_frames_4_space`: 2 frames with 4 consecutive frames of spacing in between (e.g `[t, t + 5 / fps]`),
|
||||||
|
|
||||||
|
However, due to how video decoding is implemented with `pyav`, we don't have access to an accurate seek so in practice this scenario is essentially the same as `6_frames` since all 6 frames between `t` and `t + 5 / fps` will be decoded.
|
||||||
|
|
||||||
|
|
||||||
|
## Metrics
|
||||||
|
**Data compression ratio (lower is better)**
|
||||||
|
`video_images_size_ratio` is the ratio of the memory space on disk taken by the encoded video over the memory space taken by the original images. For instance, `video_images_size_ratio=25%` means that the video takes 4 times less memory space on disk compared to the original images.
|
||||||
|
|
||||||
|
**Loading time ratio (lower is better)**
|
||||||
|
`video_images_load_time_ratio` is the ratio of the time it takes to decode frames from the video at a given timestamps over the time it takes to load the exact same original images. Lower is better. For instance, `video_images_load_time_ratio=200%` means that decoding from video is 2 times slower than loading the original images.
|
||||||
|
|
||||||
|
**Average Mean Square Error (lower is better)**
|
||||||
|
`avg_mse` is the average mean square error between each decoded frame and its corresponding original image over all requested timestamps, and also divided by the number of pixels in the image to be comparable when switching to different image sizes.
|
||||||
|
|
||||||
|
**Average Peak Signal to Noise Ratio (higher is better)**
|
||||||
|
`avg_psnr` measures the ratio between the maximum possible power of a signal and the power of corrupting noise that affects the fidelity of its representation. Higher PSNR indicates better quality.
|
||||||
|
|
||||||
|
**Average Structural Similarity Index Measure (higher is better)**
|
||||||
|
`avg_ssim` evaluates the perceived quality of images by comparing luminance, contrast, and structure. SSIM values range from -1 to 1, where 1 indicates perfect similarity.
|
||||||
|
|
||||||
|
One aspect that can't be measured here with those metrics is the compatibility of the encoding accross platforms, in particular on web browser, for visualization purposes.
|
||||||
|
h264, h265 and AV1 are all commonly used codecs and should not be pose an issue. However, the chroma subsampling (`pix_fmt`) format might affect compatibility:
|
||||||
|
- `yuv420p` is more widely supported across various platforms, including web browsers.
|
||||||
|
- `yuv444p` offers higher color fidelity but might not be supported as broadly.
|
||||||
|
|
||||||
|
|
||||||
|
<!-- **Loss of a pretrained policy (higher is better)** (not available)
|
||||||
|
`loss_pretrained` is the result of evaluating with the selected encoding/decoding settings a policy pretrained on original images. It is easier to understand than `avg_l2_error`.
|
||||||
|
|
||||||
|
**Success rate after retraining (higher is better)** (not available)
|
||||||
|
`success_rate` is the result of training and evaluating a policy with the selected encoding/decoding settings. It is the most difficult metric to get but also the very best. -->
|
||||||
|
|
||||||
|
|
||||||
|
## How the benchmark works
|
||||||
|
The benchmark evaluates both encoding and decoding of video frames on the first episode of each dataset.
|
||||||
|
|
||||||
|
**Encoding:** for each `vcodec` and `pix_fmt` pair, we use a default value for `g` and `crf` upon which we change a single value (either `g` or `crf`) to one of the specified values (we don't test every combination of those as this would be computationally too heavy).
|
||||||
|
This gives a unique set of encoding parameters which is used to encode the episode.
|
||||||
|
|
||||||
|
**Decoding:** Then, for each of those unique encodings, we iterate through every combination of the decoding parameters `backend` and `timestamps_mode`. For each of them, we record the metrics of a number of samples (given by `--num-samples`). This is parallelized for efficiency and the number of processes can be controlled with `--num-workers`. Ideally, it's best to have a `--num-samples` that is divisible by `--num-workers`.
|
||||||
|
|
||||||
|
Intermediate results saved for each `vcodec` and `pix_fmt` combination in csv tables.
|
||||||
|
These are then all concatenated to a single table ready for analysis.
|
||||||
|
|
||||||
|
## Caveats
|
||||||
|
We tried to measure the most impactful parameters for both encoding and decoding. However, for computational reasons we can't test out every combination.
|
||||||
|
|
||||||
|
Additional encoding parameters exist that are not included in this benchmark. In particular:
|
||||||
|
- `-preset` which allows for selecting encoding presets. This represents a collection of options that will provide a certain encoding speed to compression ratio. By leaving this parameter unspecified, it is considered to be `medium` for libx264 and libx265 and `8` for libsvtav1.
|
||||||
|
- `-tune` which allows to optimize the encoding for certains aspects (e.g. film quality, fast decoding, etc.).
|
||||||
|
|
||||||
|
See the documentation mentioned above for more detailled info on these settings and for a more comprehensive list of other parameters.
|
||||||
|
|
||||||
|
Similarly on the decoding side, other decoders exist but are not implemented in our current benchmark. To name a few:
|
||||||
|
- `torchaudio`
|
||||||
|
- `ffmpegio`
|
||||||
|
- `decord`
|
||||||
|
- `nvc`
|
||||||
|
|
||||||
|
Note as well that since we are mostly interested in the performance at decoding time (also because encoding is done only once before uploading a dataset), we did not measure encoding times nor have any metrics regarding encoding.
|
||||||
|
However, besides the necessity to build ffmpeg from source, encoding did not pose any issue and it didn't take a significant amount of time during this benchmark.
|
||||||
|
|
||||||
|
|
||||||
|
## Install
|
||||||
|
Building ffmpeg from source is required to include libx265 and libaom/libsvtav1 (av1) video codecs ([compilation guide](https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu)).
|
||||||
|
|
||||||
|
**Note:** While you still need to build torchvision with a conda-installed `ffmpeg<4.3` to use the `video_reader` decoder (as described in [#220](https://github.com/huggingface/lerobot/pull/220)), you also need another version which is custom-built with all the video codecs for encoding. For the script to then use that version, you can prepend the command above with `PATH="$HOME/bin:$PATH"`, which is where ffmpeg should be built.
|
||||||
|
|
||||||
|
|
||||||
|
## Adding a video decoder
|
||||||
|
Right now, we're only benchmarking the two video decoder available with torchvision: `pyav` and `video_reader`.
|
||||||
|
You can easily add a new decoder to benchmark by adding it to this function in the script:
|
||||||
|
```diff
|
||||||
|
def decode_video_frames(
|
||||||
|
video_path: str,
|
||||||
|
timestamps: list[float],
|
||||||
|
tolerance_s: float,
|
||||||
|
backend: str,
|
||||||
|
) -> torch.Tensor:
|
||||||
|
if backend in ["pyav", "video_reader"]:
|
||||||
|
return decode_video_frames_torchvision(
|
||||||
|
video_path, timestamps, tolerance_s, backend
|
||||||
|
)
|
||||||
|
+ elif backend == ["your_decoder"]:
|
||||||
|
+ return your_decoder_function(
|
||||||
|
+ video_path, timestamps, tolerance_s, backend
|
||||||
|
+ )
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(backend)
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
## Example
|
||||||
|
For a quick run, you can try these parameters:
|
||||||
|
```bash
|
||||||
|
python benchmark/video/run_video_benchmark.py \
|
||||||
|
--output-dir outputs/video_benchmark \
|
||||||
|
--repo-ids \
|
||||||
|
lerobot/pusht_image \
|
||||||
|
aliberts/aloha_mobile_shrimp_image \
|
||||||
|
--vcodec libx264 libx265 \
|
||||||
|
--pix-fmt yuv444p yuv420p \
|
||||||
|
--g 2 20 None \
|
||||||
|
--crf 10 40 None \
|
||||||
|
--timestamps-modes 1_frame 2_frames \
|
||||||
|
--backends pyav video_reader \
|
||||||
|
--num-samples 5 \
|
||||||
|
--num-workers 5 \
|
||||||
|
--save-frames 0
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
## Results
|
||||||
|
|
||||||
|
### Reproduce
|
||||||
|
We ran the benchmark with the following parameters:
|
||||||
|
```bash
|
||||||
|
# h264 and h265 encodings
|
||||||
|
python benchmark/video/run_video_benchmark.py \
|
||||||
|
--output-dir outputs/video_benchmark \
|
||||||
|
--repo-ids \
|
||||||
|
lerobot/pusht_image \
|
||||||
|
aliberts/aloha_mobile_shrimp_image \
|
||||||
|
aliberts/paris_street \
|
||||||
|
aliberts/kitchen \
|
||||||
|
--vcodec libx264 libx265 \
|
||||||
|
--pix-fmt yuv444p yuv420p \
|
||||||
|
--g 1 2 3 4 5 6 10 15 20 40 None \
|
||||||
|
--crf 0 5 10 15 20 25 30 40 50 None \
|
||||||
|
--timestamps-modes 1_frame 2_frames 6_frames \
|
||||||
|
--backends pyav video_reader \
|
||||||
|
--num-samples 50 \
|
||||||
|
--num-workers 5 \
|
||||||
|
--save-frames 1
|
||||||
|
|
||||||
|
# av1 encoding (only compatible with yuv420p and pyav decoder)
|
||||||
|
python benchmark/video/run_video_benchmark.py \
|
||||||
|
--output-dir outputs/video_benchmark \
|
||||||
|
--repo-ids \
|
||||||
|
lerobot/pusht_image \
|
||||||
|
aliberts/aloha_mobile_shrimp_image \
|
||||||
|
aliberts/paris_street \
|
||||||
|
aliberts/kitchen \
|
||||||
|
--vcodec libsvtav1 \
|
||||||
|
--pix-fmt yuv420p \
|
||||||
|
--g 1 2 3 4 5 6 10 15 20 40 None \
|
||||||
|
--crf 0 5 10 15 20 25 30 40 50 None \
|
||||||
|
--timestamps-modes 1_frame 2_frames 6_frames \
|
||||||
|
--backends pyav \
|
||||||
|
--num-samples 50 \
|
||||||
|
--num-workers 5 \
|
||||||
|
--save-frames 1
|
||||||
|
```
|
||||||
|
|
||||||
|
The full results are available [here](https://docs.google.com/spreadsheets/d/1OYJB43Qu8fC26k_OyoMFgGBBKfQRCi4BIuYitQnq3sw/edit?usp=sharing)
|
||||||
|
|
||||||
|
|
||||||
|
### Parameters selected for LeRobotDataset
|
||||||
|
Considering these results, we chose what we think is the best set of encoding parameter:
|
||||||
|
- vcodec: `libsvtav1`
|
||||||
|
- pix-fmt: `yuv420p`
|
||||||
|
- g: `2`
|
||||||
|
- crf: `30`
|
||||||
|
|
||||||
|
Since we're using av1 encoding, we're choosing the `pyav` decoder as `video_reader` does not support it (and `pyav` doesn't require a custom build of `torchvision`).
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
These tables show the results for `g=2` and `crf=30`, using `timestamps-modes=6_frames` and `backend=pyav`
|
||||||
|
|
||||||
|
| video_images_size_ratio | vcodec | pix_fmt | | | |
|
||||||
|
|------------------------------------|------------|---------|-----------|-----------|-----------|
|
||||||
|
| | libx264 | | libx265 | | libsvtav1 |
|
||||||
|
| repo_id | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||||
|
| lerobot/pusht_image | **16.97%** | 17.58% | 18.57% | 18.86% | 22.06% |
|
||||||
|
| aliberts/aloha_mobile_shrimp_image | 2.14% | 2.11% | 1.38% | **1.37%** | 5.59% |
|
||||||
|
| aliberts/paris_street | 2.12% | 2.13% | **1.54%** | **1.54%** | 4.43% |
|
||||||
|
| aliberts/kitchen | 1.40% | 1.39% | **1.00%** | **1.00%** | 2.52% |
|
||||||
|
|
||||||
|
| video_images_load_time_ratio | vcodec | pix_fmt | | | |
|
||||||
|
|------------------------------------|---------|---------|----------|---------|-----------|
|
||||||
|
| | libx264 | | libx265 | | libsvtav1 |
|
||||||
|
| repo_id | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||||
|
| lerobot/pusht_image | 6.45 | 5.19 | **1.90** | 2.12 | 2.47 |
|
||||||
|
| aliberts/aloha_mobile_shrimp_image | 11.80 | 7.92 | 0.71 | 0.85 | **0.48** |
|
||||||
|
| aliberts/paris_street | 2.21 | 2.05 | 0.36 | 0.49 | **0.30** |
|
||||||
|
| aliberts/kitchen | 1.46 | 1.46 | 0.28 | 0.51 | **0.26** |
|
||||||
|
|
||||||
|
| | | vcodec | pix_fmt | | | |
|
||||||
|
|------------------------------------|----------|----------|--------------|----------|-----------|--------------|
|
||||||
|
| | | libx264 | | libx265 | | libsvtav1 |
|
||||||
|
| repo_id | metric | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||||
|
| lerobot/pusht_image | avg_mse | 2.90E-04 | **2.03E-04** | 3.13E-04 | 2.29E-04 | 2.19E-04 |
|
||||||
|
| | avg_psnr | 35.44 | 37.07 | 35.49 | **37.30** | 37.20 |
|
||||||
|
| | avg_ssim | 98.28% | **98.85%** | 98.31% | 98.84% | 98.72% |
|
||||||
|
| aliberts/aloha_mobile_shrimp_image | avg_mse | 2.76E-04 | 2.59E-04 | 3.17E-04 | 3.06E-04 | **1.30E-04** |
|
||||||
|
| | avg_psnr | 35.91 | 36.21 | 35.88 | 36.09 | **40.17** |
|
||||||
|
| | avg_ssim | 95.19% | 95.18% | 95.00% | 95.05% | **97.73%** |
|
||||||
|
| aliberts/paris_street | avg_mse | 6.89E-04 | 6.70E-04 | 4.03E-03 | 4.02E-03 | **3.09E-04** |
|
||||||
|
| | avg_psnr | 33.48 | 33.68 | 32.05 | 32.15 | **35.40** |
|
||||||
|
| | avg_ssim | 93.76% | 93.75% | 89.46% | 89.46% | **95.46%** |
|
||||||
|
| aliberts/kitchen | avg_mse | 2.50E-04 | 2.24E-04 | 4.28E-04 | 4.18E-04 | **1.53E-04** |
|
||||||
|
| | avg_psnr | 36.73 | 37.33 | 36.56 | 36.75 | **39.12** |
|
||||||
|
| | avg_ssim | 95.47% | 95.58% | 95.52% | 95.53% | **96.82%** |
|
||||||
90
benchmarks/video/capture_camera_feed.py
Normal file
90
benchmarks/video/capture_camera_feed.py
Normal file
@@ -0,0 +1,90 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""Capture video feed from a camera as raw images."""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import datetime as dt
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
|
||||||
|
def display_and_save_video_stream(output_dir: Path, fps: int, width: int, height: int):
|
||||||
|
now = dt.datetime.now()
|
||||||
|
capture_dir = output_dir / f"{now:%Y-%m-%d}" / f"{now:%H-%M-%S}"
|
||||||
|
if not capture_dir.exists():
|
||||||
|
capture_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
# Opens the default webcam
|
||||||
|
cap = cv2.VideoCapture(0)
|
||||||
|
if not cap.isOpened():
|
||||||
|
print("Error: Could not open video stream.")
|
||||||
|
return
|
||||||
|
|
||||||
|
cap.set(cv2.CAP_PROP_FPS, fps)
|
||||||
|
cap.set(cv2.CAP_PROP_FRAME_WIDTH, width)
|
||||||
|
cap.set(cv2.CAP_PROP_FRAME_HEIGHT, height)
|
||||||
|
|
||||||
|
frame_index = 0
|
||||||
|
while True:
|
||||||
|
ret, frame = cap.read()
|
||||||
|
|
||||||
|
if not ret:
|
||||||
|
print("Error: Could not read frame.")
|
||||||
|
break
|
||||||
|
|
||||||
|
cv2.imshow("Video Stream", frame)
|
||||||
|
cv2.imwrite(str(capture_dir / f"frame_{frame_index:06d}.png"), frame)
|
||||||
|
frame_index += 1
|
||||||
|
|
||||||
|
# Break the loop on 'q' key press
|
||||||
|
if cv2.waitKey(1) & 0xFF == ord("q"):
|
||||||
|
break
|
||||||
|
|
||||||
|
# Release the capture and destroy all windows
|
||||||
|
cap.release()
|
||||||
|
cv2.destroyAllWindows()
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
|
||||||
|
parser.add_argument(
|
||||||
|
"--output-dir",
|
||||||
|
type=Path,
|
||||||
|
default=Path("outputs/cam_capture/"),
|
||||||
|
help="Directory where the capture images are written. A subfolder named with the current date & time will be created inside it for each capture.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--fps",
|
||||||
|
type=int,
|
||||||
|
default=30,
|
||||||
|
help="Frames Per Second of the capture.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--width",
|
||||||
|
type=int,
|
||||||
|
default=1280,
|
||||||
|
help="Width of the captured images.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--height",
|
||||||
|
type=int,
|
||||||
|
default=720,
|
||||||
|
help="Height of the captured images.",
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
display_and_save_video_stream(**vars(args))
|
||||||
490
benchmarks/video/run_video_benchmark.py
Normal file
490
benchmarks/video/run_video_benchmark.py
Normal file
@@ -0,0 +1,490 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""Assess the performance of video decoding in various configurations.
|
||||||
|
|
||||||
|
This script will benchmark different video encoding and decoding parameters.
|
||||||
|
See the provided README.md or run `python benchmark/video/run_video_benchmark.py --help` for usage info.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import datetime as dt
|
||||||
|
import random
|
||||||
|
import shutil
|
||||||
|
from collections import OrderedDict
|
||||||
|
from concurrent.futures import ThreadPoolExecutor, as_completed
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import einops
|
||||||
|
import numpy as np
|
||||||
|
import pandas as pd
|
||||||
|
import PIL
|
||||||
|
import torch
|
||||||
|
from skimage.metrics import mean_squared_error, peak_signal_noise_ratio, structural_similarity
|
||||||
|
from tqdm import tqdm
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
from lerobot.common.datasets.video_utils import (
|
||||||
|
decode_video_frames_torchvision,
|
||||||
|
encode_video_frames,
|
||||||
|
)
|
||||||
|
from lerobot.common.utils.benchmark import TimeBenchmark
|
||||||
|
|
||||||
|
BASE_ENCODING = OrderedDict(
|
||||||
|
[
|
||||||
|
("vcodec", "libx264"),
|
||||||
|
("pix_fmt", "yuv444p"),
|
||||||
|
("g", 2),
|
||||||
|
("crf", None),
|
||||||
|
# TODO(aliberts): Add fastdecode
|
||||||
|
# ("fastdecode", 0),
|
||||||
|
]
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
# TODO(rcadene, aliberts): move to `utils.py` folder when we want to refactor
|
||||||
|
def parse_int_or_none(value) -> int | None:
|
||||||
|
if value.lower() == "none":
|
||||||
|
return None
|
||||||
|
try:
|
||||||
|
return int(value)
|
||||||
|
except ValueError as e:
|
||||||
|
raise argparse.ArgumentTypeError(f"Invalid int or None: {value}") from e
|
||||||
|
|
||||||
|
|
||||||
|
def check_datasets_formats(repo_ids: list) -> None:
|
||||||
|
for repo_id in repo_ids:
|
||||||
|
dataset = LeRobotDataset(repo_id)
|
||||||
|
if dataset.video:
|
||||||
|
raise ValueError(
|
||||||
|
f"Use only image dataset for running this benchmark. Video dataset provided: {repo_id}"
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def get_directory_size(directory: Path) -> int:
|
||||||
|
total_size = 0
|
||||||
|
for item in directory.rglob("*"):
|
||||||
|
if item.is_file():
|
||||||
|
total_size += item.stat().st_size
|
||||||
|
return total_size
|
||||||
|
|
||||||
|
|
||||||
|
def load_original_frames(imgs_dir: Path, timestamps: list[float], fps: int) -> torch.Tensor:
|
||||||
|
frames = []
|
||||||
|
for ts in timestamps:
|
||||||
|
idx = int(ts * fps)
|
||||||
|
frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
||||||
|
frame = torch.from_numpy(np.array(frame))
|
||||||
|
frame = frame.type(torch.float32) / 255
|
||||||
|
frame = einops.rearrange(frame, "h w c -> c h w")
|
||||||
|
frames.append(frame)
|
||||||
|
return torch.stack(frames)
|
||||||
|
|
||||||
|
|
||||||
|
def save_decoded_frames(
|
||||||
|
imgs_dir: Path, save_dir: Path, frames: torch.Tensor, timestamps: list[float], fps: int
|
||||||
|
) -> None:
|
||||||
|
if save_dir.exists() and len(list(save_dir.glob("frame_*.png"))) == len(timestamps):
|
||||||
|
return
|
||||||
|
|
||||||
|
save_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
for i, ts in enumerate(timestamps):
|
||||||
|
idx = int(ts * fps)
|
||||||
|
frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
|
||||||
|
PIL.Image.fromarray(frame_hwc).save(save_dir / f"frame_{idx:06d}_decoded.png")
|
||||||
|
shutil.copyfile(imgs_dir / f"frame_{idx:06d}.png", save_dir / f"frame_{idx:06d}_original.png")
|
||||||
|
|
||||||
|
|
||||||
|
def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
|
||||||
|
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||||
|
if imgs_dir.exists() and len(list(imgs_dir.glob("frame_*.png"))) == ep_num_images:
|
||||||
|
return
|
||||||
|
|
||||||
|
imgs_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
hf_dataset = dataset.hf_dataset.with_format(None)
|
||||||
|
|
||||||
|
# We only save images from the first camera
|
||||||
|
img_keys = [key for key in hf_dataset.features if key.startswith("observation.image")]
|
||||||
|
imgs_dataset = hf_dataset.select_columns(img_keys[0])
|
||||||
|
|
||||||
|
for i, item in enumerate(
|
||||||
|
tqdm(imgs_dataset, desc=f"saving {dataset.repo_id} first episode images", leave=False)
|
||||||
|
):
|
||||||
|
img = item[img_keys[0]]
|
||||||
|
img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
|
||||||
|
|
||||||
|
if i >= ep_num_images - 1:
|
||||||
|
break
|
||||||
|
|
||||||
|
|
||||||
|
def sample_timestamps(timestamps_mode: str, ep_num_images: int, fps: int) -> list[float]:
|
||||||
|
# Start at 5 to allow for 2_frames_4_space and 6_frames
|
||||||
|
idx = random.randint(5, ep_num_images - 1)
|
||||||
|
match timestamps_mode:
|
||||||
|
case "1_frame":
|
||||||
|
frame_indexes = [idx]
|
||||||
|
case "2_frames":
|
||||||
|
frame_indexes = [idx - 1, idx]
|
||||||
|
case "2_frames_4_space":
|
||||||
|
frame_indexes = [idx - 5, idx]
|
||||||
|
case "6_frames":
|
||||||
|
frame_indexes = [idx - i for i in range(6)][::-1]
|
||||||
|
case _:
|
||||||
|
raise ValueError(timestamps_mode)
|
||||||
|
|
||||||
|
return [idx / fps for idx in frame_indexes]
|
||||||
|
|
||||||
|
|
||||||
|
def decode_video_frames(
|
||||||
|
video_path: str,
|
||||||
|
timestamps: list[float],
|
||||||
|
tolerance_s: float,
|
||||||
|
backend: str,
|
||||||
|
) -> torch.Tensor:
|
||||||
|
if backend in ["pyav", "video_reader"]:
|
||||||
|
return decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(backend)
|
||||||
|
|
||||||
|
|
||||||
|
def benchmark_decoding(
|
||||||
|
imgs_dir: Path,
|
||||||
|
video_path: Path,
|
||||||
|
timestamps_mode: str,
|
||||||
|
backend: str,
|
||||||
|
ep_num_images: int,
|
||||||
|
fps: int,
|
||||||
|
num_samples: int = 50,
|
||||||
|
num_workers: int = 4,
|
||||||
|
save_frames: bool = False,
|
||||||
|
) -> dict:
|
||||||
|
def process_sample(sample: int):
|
||||||
|
time_benchmark = TimeBenchmark()
|
||||||
|
timestamps = sample_timestamps(timestamps_mode, ep_num_images, fps)
|
||||||
|
num_frames = len(timestamps)
|
||||||
|
result = {
|
||||||
|
"psnr_values": [],
|
||||||
|
"ssim_values": [],
|
||||||
|
"mse_values": [],
|
||||||
|
}
|
||||||
|
|
||||||
|
with time_benchmark:
|
||||||
|
frames = decode_video_frames(video_path, timestamps=timestamps, tolerance_s=5e-1, backend=backend)
|
||||||
|
result["load_time_video_ms"] = time_benchmark.result_ms / num_frames
|
||||||
|
|
||||||
|
with time_benchmark:
|
||||||
|
original_frames = load_original_frames(imgs_dir, timestamps, fps)
|
||||||
|
result["load_time_images_ms"] = time_benchmark.result_ms / num_frames
|
||||||
|
|
||||||
|
frames_np, original_frames_np = frames.numpy(), original_frames.numpy()
|
||||||
|
for i in range(num_frames):
|
||||||
|
result["mse_values"].append(mean_squared_error(original_frames_np[i], frames_np[i]))
|
||||||
|
result["psnr_values"].append(
|
||||||
|
peak_signal_noise_ratio(original_frames_np[i], frames_np[i], data_range=1.0)
|
||||||
|
)
|
||||||
|
result["ssim_values"].append(
|
||||||
|
structural_similarity(original_frames_np[i], frames_np[i], data_range=1.0, channel_axis=0)
|
||||||
|
)
|
||||||
|
|
||||||
|
if save_frames and sample == 0:
|
||||||
|
save_dir = video_path.with_suffix("") / f"{timestamps_mode}_{backend}"
|
||||||
|
save_decoded_frames(imgs_dir, save_dir, frames, timestamps, fps)
|
||||||
|
|
||||||
|
return result
|
||||||
|
|
||||||
|
load_times_video_ms = []
|
||||||
|
load_times_images_ms = []
|
||||||
|
mse_values = []
|
||||||
|
psnr_values = []
|
||||||
|
ssim_values = []
|
||||||
|
|
||||||
|
# A sample is a single set of decoded frames specified by timestamps_mode (e.g. a single frame, 2 frames, etc.).
|
||||||
|
# For each sample, we record metrics (loading time and quality metrics) which are then averaged over all samples.
|
||||||
|
# As these samples are independent, we run them in parallel threads to speed up the benchmark.
|
||||||
|
with ThreadPoolExecutor(max_workers=num_workers) as executor:
|
||||||
|
futures = [executor.submit(process_sample, i) for i in range(num_samples)]
|
||||||
|
for future in tqdm(as_completed(futures), total=num_samples, desc="samples", leave=False):
|
||||||
|
result = future.result()
|
||||||
|
load_times_video_ms.append(result["load_time_video_ms"])
|
||||||
|
load_times_images_ms.append(result["load_time_images_ms"])
|
||||||
|
psnr_values.extend(result["psnr_values"])
|
||||||
|
ssim_values.extend(result["ssim_values"])
|
||||||
|
mse_values.extend(result["mse_values"])
|
||||||
|
|
||||||
|
avg_load_time_video_ms = float(np.array(load_times_video_ms).mean())
|
||||||
|
avg_load_time_images_ms = float(np.array(load_times_images_ms).mean())
|
||||||
|
video_images_load_time_ratio = avg_load_time_video_ms / avg_load_time_images_ms
|
||||||
|
|
||||||
|
return {
|
||||||
|
"avg_load_time_video_ms": avg_load_time_video_ms,
|
||||||
|
"avg_load_time_images_ms": avg_load_time_images_ms,
|
||||||
|
"video_images_load_time_ratio": video_images_load_time_ratio,
|
||||||
|
"avg_mse": float(np.mean(mse_values)),
|
||||||
|
"avg_psnr": float(np.mean(psnr_values)),
|
||||||
|
"avg_ssim": float(np.mean(ssim_values)),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def benchmark_encoding_decoding(
|
||||||
|
dataset: LeRobotDataset,
|
||||||
|
video_path: Path,
|
||||||
|
imgs_dir: Path,
|
||||||
|
encoding_cfg: dict,
|
||||||
|
decoding_cfg: dict,
|
||||||
|
num_samples: int,
|
||||||
|
num_workers: int,
|
||||||
|
save_frames: bool,
|
||||||
|
overwrite: bool = False,
|
||||||
|
seed: int = 1337,
|
||||||
|
) -> list[dict]:
|
||||||
|
fps = dataset.fps
|
||||||
|
|
||||||
|
if overwrite or not video_path.is_file():
|
||||||
|
tqdm.write(f"encoding {video_path}")
|
||||||
|
encode_video_frames(
|
||||||
|
imgs_dir=imgs_dir,
|
||||||
|
video_path=video_path,
|
||||||
|
fps=fps,
|
||||||
|
vcodec=encoding_cfg["vcodec"],
|
||||||
|
pix_fmt=encoding_cfg["pix_fmt"],
|
||||||
|
g=encoding_cfg.get("g"),
|
||||||
|
crf=encoding_cfg.get("crf"),
|
||||||
|
# fast_decode=encoding_cfg.get("fastdecode"),
|
||||||
|
overwrite=True,
|
||||||
|
)
|
||||||
|
|
||||||
|
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||||
|
width, height = tuple(dataset[0][dataset.meta.camera_keys[0]].shape[-2:])
|
||||||
|
num_pixels = width * height
|
||||||
|
video_size_bytes = video_path.stat().st_size
|
||||||
|
images_size_bytes = get_directory_size(imgs_dir)
|
||||||
|
video_images_size_ratio = video_size_bytes / images_size_bytes
|
||||||
|
|
||||||
|
random.seed(seed)
|
||||||
|
benchmark_table = []
|
||||||
|
for timestamps_mode in tqdm(
|
||||||
|
decoding_cfg["timestamps_modes"], desc="decodings (timestamps_modes)", leave=False
|
||||||
|
):
|
||||||
|
for backend in tqdm(decoding_cfg["backends"], desc="decodings (backends)", leave=False):
|
||||||
|
benchmark_row = benchmark_decoding(
|
||||||
|
imgs_dir,
|
||||||
|
video_path,
|
||||||
|
timestamps_mode,
|
||||||
|
backend,
|
||||||
|
ep_num_images,
|
||||||
|
fps,
|
||||||
|
num_samples,
|
||||||
|
num_workers,
|
||||||
|
save_frames,
|
||||||
|
)
|
||||||
|
benchmark_row.update(
|
||||||
|
**{
|
||||||
|
"repo_id": dataset.repo_id,
|
||||||
|
"resolution": f"{width} x {height}",
|
||||||
|
"num_pixels": num_pixels,
|
||||||
|
"video_size_bytes": video_size_bytes,
|
||||||
|
"images_size_bytes": images_size_bytes,
|
||||||
|
"video_images_size_ratio": video_images_size_ratio,
|
||||||
|
"timestamps_mode": timestamps_mode,
|
||||||
|
"backend": backend,
|
||||||
|
},
|
||||||
|
**encoding_cfg,
|
||||||
|
)
|
||||||
|
benchmark_table.append(benchmark_row)
|
||||||
|
|
||||||
|
return benchmark_table
|
||||||
|
|
||||||
|
|
||||||
|
def main(
|
||||||
|
output_dir: Path,
|
||||||
|
repo_ids: list[str],
|
||||||
|
vcodec: list[str],
|
||||||
|
pix_fmt: list[str],
|
||||||
|
g: list[int],
|
||||||
|
crf: list[int],
|
||||||
|
# fastdecode: list[int],
|
||||||
|
timestamps_modes: list[str],
|
||||||
|
backends: list[str],
|
||||||
|
num_samples: int,
|
||||||
|
num_workers: int,
|
||||||
|
save_frames: bool,
|
||||||
|
):
|
||||||
|
check_datasets_formats(repo_ids)
|
||||||
|
encoding_benchmarks = {
|
||||||
|
"g": g,
|
||||||
|
"crf": crf,
|
||||||
|
# "fastdecode": fastdecode,
|
||||||
|
}
|
||||||
|
decoding_benchmarks = {
|
||||||
|
"timestamps_modes": timestamps_modes,
|
||||||
|
"backends": backends,
|
||||||
|
}
|
||||||
|
headers = ["repo_id", "resolution", "num_pixels"]
|
||||||
|
headers += list(BASE_ENCODING.keys())
|
||||||
|
headers += [
|
||||||
|
"timestamps_mode",
|
||||||
|
"backend",
|
||||||
|
"video_size_bytes",
|
||||||
|
"images_size_bytes",
|
||||||
|
"video_images_size_ratio",
|
||||||
|
"avg_load_time_video_ms",
|
||||||
|
"avg_load_time_images_ms",
|
||||||
|
"video_images_load_time_ratio",
|
||||||
|
"avg_mse",
|
||||||
|
"avg_psnr",
|
||||||
|
"avg_ssim",
|
||||||
|
]
|
||||||
|
file_paths = []
|
||||||
|
for video_codec in tqdm(vcodec, desc="encodings (vcodec)"):
|
||||||
|
for pixel_format in tqdm(pix_fmt, desc="encodings (pix_fmt)", leave=False):
|
||||||
|
benchmark_table = []
|
||||||
|
for repo_id in tqdm(repo_ids, desc="encodings (datasets)", leave=False):
|
||||||
|
dataset = LeRobotDataset(repo_id)
|
||||||
|
imgs_dir = output_dir / "images" / dataset.repo_id.replace("/", "_")
|
||||||
|
# We only use the first episode
|
||||||
|
save_first_episode(imgs_dir, dataset)
|
||||||
|
for key, values in tqdm(encoding_benchmarks.items(), desc="encodings (g, crf)", leave=False):
|
||||||
|
for value in tqdm(values, desc=f"encodings ({key})", leave=False):
|
||||||
|
encoding_cfg = BASE_ENCODING.copy()
|
||||||
|
encoding_cfg["vcodec"] = video_codec
|
||||||
|
encoding_cfg["pix_fmt"] = pixel_format
|
||||||
|
encoding_cfg[key] = value
|
||||||
|
args_path = Path("_".join(str(value) for value in encoding_cfg.values()))
|
||||||
|
video_path = output_dir / "videos" / args_path / f"{repo_id.replace('/', '_')}.mp4"
|
||||||
|
benchmark_table += benchmark_encoding_decoding(
|
||||||
|
dataset,
|
||||||
|
video_path,
|
||||||
|
imgs_dir,
|
||||||
|
encoding_cfg,
|
||||||
|
decoding_benchmarks,
|
||||||
|
num_samples,
|
||||||
|
num_workers,
|
||||||
|
save_frames,
|
||||||
|
)
|
||||||
|
|
||||||
|
# Save intermediate results
|
||||||
|
benchmark_df = pd.DataFrame(benchmark_table, columns=headers)
|
||||||
|
now = dt.datetime.now()
|
||||||
|
csv_path = (
|
||||||
|
output_dir
|
||||||
|
/ f"{now:%Y-%m-%d}_{now:%H-%M-%S}_{video_codec}_{pixel_format}_{num_samples}-samples.csv"
|
||||||
|
)
|
||||||
|
benchmark_df.to_csv(csv_path, header=True, index=False)
|
||||||
|
file_paths.append(csv_path)
|
||||||
|
del benchmark_df
|
||||||
|
|
||||||
|
# Concatenate all results
|
||||||
|
df_list = [pd.read_csv(csv_path) for csv_path in file_paths]
|
||||||
|
concatenated_df = pd.concat(df_list, ignore_index=True)
|
||||||
|
concatenated_path = output_dir / f"{now:%Y-%m-%d}_{now:%H-%M-%S}_all_{num_samples}-samples.csv"
|
||||||
|
concatenated_df.to_csv(concatenated_path, header=True, index=False)
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
parser.add_argument(
|
||||||
|
"--output-dir",
|
||||||
|
type=Path,
|
||||||
|
default=Path("outputs/video_benchmark"),
|
||||||
|
help="Directory where the video benchmark outputs are written.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--repo-ids",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
default=[
|
||||||
|
"lerobot/pusht_image",
|
||||||
|
"aliberts/aloha_mobile_shrimp_image",
|
||||||
|
"aliberts/paris_street",
|
||||||
|
"aliberts/kitchen",
|
||||||
|
],
|
||||||
|
help="Datasets repo-ids to test against. First episodes only are used. Must be images.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--vcodec",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
default=["libx264", "libx265", "libsvtav1"],
|
||||||
|
help="Video codecs to be tested",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--pix-fmt",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
default=["yuv444p", "yuv420p"],
|
||||||
|
help="Pixel formats (chroma subsampling) to be tested",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--g",
|
||||||
|
type=parse_int_or_none,
|
||||||
|
nargs="*",
|
||||||
|
default=[1, 2, 3, 4, 5, 6, 10, 15, 20, 40, 100, None],
|
||||||
|
help="Group of pictures sizes to be tested.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--crf",
|
||||||
|
type=parse_int_or_none,
|
||||||
|
nargs="*",
|
||||||
|
default=[0, 5, 10, 15, 20, 25, 30, 40, 50, None],
|
||||||
|
help="Constant rate factors to be tested.",
|
||||||
|
)
|
||||||
|
# parser.add_argument(
|
||||||
|
# "--fastdecode",
|
||||||
|
# type=int,
|
||||||
|
# nargs="*",
|
||||||
|
# default=[0, 1],
|
||||||
|
# help="Use the fastdecode tuning option. 0 disables it. "
|
||||||
|
# "For libx264 and libx265, only 1 is possible. "
|
||||||
|
# "For libsvtav1, 1, 2 or 3 are possible values with a higher number meaning a faster decoding optimization",
|
||||||
|
# )
|
||||||
|
parser.add_argument(
|
||||||
|
"--timestamps-modes",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
default=[
|
||||||
|
"1_frame",
|
||||||
|
"2_frames",
|
||||||
|
"2_frames_4_space",
|
||||||
|
"6_frames",
|
||||||
|
],
|
||||||
|
help="Timestamps scenarios to be tested.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--backends",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
default=["pyav", "video_reader"],
|
||||||
|
help="Torchvision decoding backend to be tested.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--num-samples",
|
||||||
|
type=int,
|
||||||
|
default=50,
|
||||||
|
help="Number of samples for each encoding x decoding config.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--num-workers",
|
||||||
|
type=int,
|
||||||
|
default=10,
|
||||||
|
help="Number of processes for parallelized sample processing.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--save-frames",
|
||||||
|
type=int,
|
||||||
|
default=0,
|
||||||
|
help="Whether to save decoded frames or not. Enter a non-zero number for true.",
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
main(**vars(args))
|
||||||
@@ -8,7 +8,8 @@ ARG DEBIAN_FRONTEND=noninteractive
|
|||||||
# Install apt dependencies
|
# Install apt dependencies
|
||||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||||
build-essential cmake \
|
build-essential cmake \
|
||||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||||
|
speech-dispatcher \
|
||||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||||
|
|
||||||
# Create virtual environment
|
# Create virtual environment
|
||||||
@@ -21,7 +22,7 @@ RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
|||||||
COPY . /lerobot
|
COPY . /lerobot
|
||||||
WORKDIR /lerobot
|
WORKDIR /lerobot
|
||||||
RUN pip install --upgrade --no-cache-dir pip
|
RUN pip install --upgrade --no-cache-dir pip
|
||||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht]" \
|
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]" \
|
||||||
--extra-index-url https://download.pytorch.org/whl/cpu
|
--extra-index-url https://download.pytorch.org/whl/cpu
|
||||||
|
|
||||||
# Set EGL as the rendering backend for MuJoCo
|
# Set EGL as the rendering backend for MuJoCo
|
||||||
|
|||||||
68
docker/lerobot-gpu-dev/Dockerfile
Normal file
68
docker/lerobot-gpu-dev/Dockerfile
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
FROM nvidia/cuda:12.2.2-devel-ubuntu22.04
|
||||||
|
|
||||||
|
# Configure image
|
||||||
|
ARG PYTHON_VERSION=3.10
|
||||||
|
ARG DEBIAN_FRONTEND=noninteractive
|
||||||
|
|
||||||
|
# Install apt dependencies
|
||||||
|
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||||
|
build-essential cmake \
|
||||||
|
git git-lfs openssh-client \
|
||||||
|
nano vim less util-linux tree \
|
||||||
|
htop atop nvtop \
|
||||||
|
sed gawk grep curl wget zip unzip \
|
||||||
|
tcpdump sysstat screen tmux \
|
||||||
|
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
||||||
|
speech-dispatcher \
|
||||||
|
python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
|
||||||
|
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||||
|
|
||||||
|
# Install ffmpeg build dependencies. See:
|
||||||
|
# https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu
|
||||||
|
# TODO(aliberts): create image to build dependencies from source instead
|
||||||
|
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||||
|
autoconf automake yasm \
|
||||||
|
libass-dev \
|
||||||
|
libfreetype6-dev \
|
||||||
|
libgnutls28-dev \
|
||||||
|
libunistring-dev \
|
||||||
|
libmp3lame-dev \
|
||||||
|
libtool \
|
||||||
|
libvorbis-dev \
|
||||||
|
meson \
|
||||||
|
ninja-build \
|
||||||
|
pkg-config \
|
||||||
|
texinfo \
|
||||||
|
yasm \
|
||||||
|
zlib1g-dev \
|
||||||
|
nasm \
|
||||||
|
libx264-dev \
|
||||||
|
libx265-dev libnuma-dev \
|
||||||
|
libvpx-dev \
|
||||||
|
libfdk-aac-dev \
|
||||||
|
libopus-dev \
|
||||||
|
libsvtav1-dev libsvtav1enc-dev libsvtav1dec-dev \
|
||||||
|
libdav1d-dev
|
||||||
|
|
||||||
|
# Install gh cli tool
|
||||||
|
RUN (type -p wget >/dev/null || (apt update && apt-get install wget -y)) \
|
||||||
|
&& mkdir -p -m 755 /etc/apt/keyrings \
|
||||||
|
&& wget -qO- https://cli.github.com/packages/githubcli-archive-keyring.gpg | tee /etc/apt/keyrings/githubcli-archive-keyring.gpg > /dev/null \
|
||||||
|
&& chmod go+r /etc/apt/keyrings/githubcli-archive-keyring.gpg \
|
||||||
|
&& echo "deb [arch=$(dpkg --print-architecture) signed-by=/etc/apt/keyrings/githubcli-archive-keyring.gpg] https://cli.github.com/packages stable main" | tee /etc/apt/sources.list.d/github-cli.list > /dev/null \
|
||||||
|
&& apt update \
|
||||||
|
&& apt install gh -y \
|
||||||
|
&& apt clean && rm -rf /var/lib/apt/lists/*
|
||||||
|
|
||||||
|
# Setup `python`
|
||||||
|
RUN ln -s /usr/bin/python3 /usr/bin/python
|
||||||
|
|
||||||
|
# Install poetry
|
||||||
|
RUN curl -sSL https://install.python-poetry.org | python -
|
||||||
|
ENV PATH="/root/.local/bin:$PATH"
|
||||||
|
RUN echo 'if [ "$HOME" != "/root" ]; then ln -sf /root/.local/bin/poetry $HOME/.local/bin/poetry; fi' >> /root/.bashrc
|
||||||
|
RUN poetry config virtualenvs.create false
|
||||||
|
RUN poetry config virtualenvs.in-project true
|
||||||
|
|
||||||
|
# Set EGL as the rendering backend for MuJoCo
|
||||||
|
ENV MUJOCO_GL="egl"
|
||||||
@@ -4,18 +4,16 @@ FROM nvidia/cuda:12.4.1-base-ubuntu22.04
|
|||||||
ARG PYTHON_VERSION=3.10
|
ARG PYTHON_VERSION=3.10
|
||||||
ARG DEBIAN_FRONTEND=noninteractive
|
ARG DEBIAN_FRONTEND=noninteractive
|
||||||
|
|
||||||
|
|
||||||
# Install apt dependencies
|
# Install apt dependencies
|
||||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||||
build-essential cmake \
|
build-essential cmake \
|
||||||
git git-lfs openssh-client \
|
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||||
nano vim ffmpeg \
|
speech-dispatcher \
|
||||||
htop atop nvtop \
|
python${PYTHON_VERSION}-dev python${PYTHON_VERSION}-venv \
|
||||||
sed gawk grep curl wget \
|
|
||||||
tcpdump sysstat screen \
|
|
||||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
|
||||||
python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
|
|
||||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||||
|
|
||||||
|
|
||||||
# Create virtual environment
|
# Create virtual environment
|
||||||
RUN ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python
|
RUN ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python
|
||||||
RUN python -m venv /opt/venv
|
RUN python -m venv /opt/venv
|
||||||
@@ -23,11 +21,10 @@ ENV PATH="/opt/venv/bin:$PATH"
|
|||||||
RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
||||||
|
|
||||||
# Install LeRobot
|
# Install LeRobot
|
||||||
RUN git lfs install
|
COPY . /lerobot
|
||||||
RUN git clone https://github.com/huggingface/lerobot.git
|
|
||||||
WORKDIR /lerobot
|
WORKDIR /lerobot
|
||||||
RUN pip install --upgrade --no-cache-dir pip
|
RUN pip install --upgrade --no-cache-dir pip
|
||||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht]"
|
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]"
|
||||||
|
|
||||||
# Set EGL as the rendering backend for MuJoCo
|
# Set EGL as the rendering backend for MuJoCo
|
||||||
ENV MUJOCO_GL="egl"
|
ENV MUJOCO_GL="egl"
|
||||||
|
|||||||
275
examples/10_use_so100.md
Normal file
275
examples/10_use_so100.md
Normal file
@@ -0,0 +1,275 @@
|
|||||||
|
This tutorial explains how to use [SO-100](https://github.com/TheRobotStudio/SO-ARM100) with LeRobot.
|
||||||
|
|
||||||
|
## Source the parts
|
||||||
|
|
||||||
|
Follow this [README](https://github.com/TheRobotStudio/SO-ARM100). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
|
||||||
|
|
||||||
|
**Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
|
||||||
|
|
||||||
|
## Install LeRobot
|
||||||
|
|
||||||
|
On your computer:
|
||||||
|
|
||||||
|
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||||
|
```bash
|
||||||
|
mkdir -p ~/miniconda3
|
||||||
|
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||||
|
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||||
|
rm ~/miniconda3/miniconda.sh
|
||||||
|
~/miniconda3/bin/conda init bash
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Restart shell or `source ~/.bashrc`
|
||||||
|
|
||||||
|
3. Create and activate a fresh conda environment for lerobot
|
||||||
|
```bash
|
||||||
|
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
4. Clone LeRobot:
|
||||||
|
```bash
|
||||||
|
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
5. Install LeRobot with dependencies for the feetech motors:
|
||||||
|
```bash
|
||||||
|
cd ~/lerobot && pip install -e ".[feetech]"
|
||||||
|
```
|
||||||
|
|
||||||
|
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||||
|
```bash
|
||||||
|
conda install -y -c conda-forge ffmpeg
|
||||||
|
pip uninstall -y opencv-python
|
||||||
|
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
## Configure the motors
|
||||||
|
|
||||||
|
Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the use of our scripts below.
|
||||||
|
|
||||||
|
**Find USB ports associated to your arms**
|
||||||
|
To find the correct ports for each arm, run the utility script twice:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
```
|
||||||
|
|
||||||
|
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
||||||
|
```
|
||||||
|
Finding all available ports for the MotorBus.
|
||||||
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
|
[...Disconnect leader arm and press Enter...]
|
||||||
|
|
||||||
|
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
|
||||||
|
Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
||||||
|
```
|
||||||
|
Finding all available ports for the MotorBus.
|
||||||
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
|
[...Disconnect follower arm and press Enter...]
|
||||||
|
|
||||||
|
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
|
||||||
|
Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Troubleshooting: On Linux, you might need to give access to the USB ports by running:
|
||||||
|
```bash
|
||||||
|
sudo chmod 666 /dev/ttyACM0
|
||||||
|
sudo chmod 666 /dev/ttyACM1
|
||||||
|
```
|
||||||
|
|
||||||
|
**Configure your motors**
|
||||||
|
Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 1
|
||||||
|
```
|
||||||
|
|
||||||
|
Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).
|
||||||
|
|
||||||
|
Then unplug your motor and plug the second motor and set its ID to 2.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 2
|
||||||
|
```
|
||||||
|
|
||||||
|
Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
|
||||||
|
|
||||||
|
**Remove the gears of the 6 leader motors**
|
||||||
|
Follow step 2 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
|
||||||
|
|
||||||
|
**Add motor horn to the motors**
|
||||||
|
Follow step 3 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). For SO-100, you need to align the holes on the motor horn to the motor spline to be approximately 1:30, 4:30, 7:30 and 10:30.
|
||||||
|
Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
|
||||||
|
|
||||||
|
## Assemble the arms
|
||||||
|
|
||||||
|
Follow step 4 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
|
||||||
|
|
||||||
|
## Calibrate
|
||||||
|
|
||||||
|
Next, you'll need to calibrate your SO-100 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one SO-100 robot to work on another.
|
||||||
|
|
||||||
|
**Manual calibration of follower arm**
|
||||||
|
/!\ Contrarily to step 6 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the auto calibration, we will actually do manual calibration of follower for now.
|
||||||
|
|
||||||
|
You will need to move the follower arm to these positions sequentially:
|
||||||
|
|
||||||
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|
|---|---|---|
|
||||||
|
| <img src="../media/so100/follower_zero.webp?raw=true" alt="SO-100 follower arm zero position" title="SO-100 follower arm zero position" style="width:100%;"> | <img src="../media/so100/follower_rotated.webp?raw=true" alt="SO-100 follower arm rotated position" title="SO-100 follower arm rotated position" style="width:100%;"> | <img src="../media/so100/follower_rest.webp?raw=true" alt="SO-100 follower arm rest position" title="SO-100 follower arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
|
Make sure both arms are connected and run this script to launch manual calibration:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--robot-overrides '~cameras' --arms main_follower
|
||||||
|
```
|
||||||
|
|
||||||
|
**Manual calibration of leader arm**
|
||||||
|
Follow step 6 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
|
||||||
|
|
||||||
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|
|---|---|---|
|
||||||
|
| <img src="../media/so100/leader_zero.webp?raw=true" alt="SO-100 leader arm zero position" title="SO-100 leader arm zero position" style="width:100%;"> | <img src="../media/so100/leader_rotated.webp?raw=true" alt="SO-100 leader arm rotated position" title="SO-100 leader arm rotated position" style="width:100%;"> | <img src="../media/so100/leader_rest.webp?raw=true" alt="SO-100 leader arm rest position" title="SO-100 leader arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
|
Run this script to launch manual calibration:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--robot-overrides '~cameras' --arms main_leader
|
||||||
|
```
|
||||||
|
|
||||||
|
## Teleoperate
|
||||||
|
|
||||||
|
**Simple teleop**
|
||||||
|
Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--robot-overrides '~cameras' \
|
||||||
|
--display-cameras 0
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
**Teleop with displaying cameras**
|
||||||
|
Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml
|
||||||
|
```
|
||||||
|
|
||||||
|
## Record a dataset
|
||||||
|
|
||||||
|
Once you're familiar with teleoperation, you can record your first dataset with SO-100.
|
||||||
|
|
||||||
|
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
|
```bash
|
||||||
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
|
```
|
||||||
|
|
||||||
|
Store your Hugging Face repository name in a variable to run these commands:
|
||||||
|
```bash
|
||||||
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
|
echo $HF_USER
|
||||||
|
```
|
||||||
|
|
||||||
|
Record 2 episodes and upload your dataset to the hub:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/so100_test \
|
||||||
|
--tags so100 tutorial \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 2 \
|
||||||
|
--push-to-hub 1
|
||||||
|
```
|
||||||
|
|
||||||
|
## Visualize a dataset
|
||||||
|
|
||||||
|
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||||
|
```bash
|
||||||
|
echo ${HF_USER}/so100_test
|
||||||
|
```
|
||||||
|
|
||||||
|
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/visualize_dataset_html.py \
|
||||||
|
--repo-id ${HF_USER}/so100_test
|
||||||
|
```
|
||||||
|
|
||||||
|
## Replay an episode
|
||||||
|
|
||||||
|
Now try to replay the first episode on your robot:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/so100_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
|
||||||
|
## Train a policy
|
||||||
|
|
||||||
|
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
dataset_repo_id=${HF_USER}/so100_test \
|
||||||
|
policy=act_so100_real \
|
||||||
|
env=so100_real \
|
||||||
|
hydra.run.dir=outputs/train/act_so100_test \
|
||||||
|
hydra.job.name=act_so100_test \
|
||||||
|
device=cuda \
|
||||||
|
wandb.enable=true
|
||||||
|
```
|
||||||
|
|
||||||
|
Let's explain it:
|
||||||
|
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/so100_test`.
|
||||||
|
2. We provided the policy with `policy=act_so100_real`. This loads configurations from [`lerobot/configs/policy/act_so100_real.yaml`](../lerobot/configs/policy/act_so100_real.yaml). Importantly, this policy uses 2 cameras as input `laptop`, `phone`.
|
||||||
|
3. We provided an environment as argument with `env=so100_real`. This loads configurations from [`lerobot/configs/env/so100_real.yaml`](../lerobot/configs/env/so100_real.yaml).
|
||||||
|
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
|
||||||
|
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||||
|
|
||||||
|
Training should take several hours. You will find checkpoints in `outputs/train/act_so100_test/checkpoints`.
|
||||||
|
|
||||||
|
## Evaluate your policy
|
||||||
|
|
||||||
|
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/so100.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/eval_act_so100_test \
|
||||||
|
--tags so100 tutorial eval \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 10 \
|
||||||
|
-p outputs/train/act_so100_test/checkpoints/last/pretrained_model
|
||||||
|
```
|
||||||
|
|
||||||
|
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||||
|
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_so100_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_so100_test`).
|
||||||
|
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_so100_test`).
|
||||||
|
|
||||||
|
## More
|
||||||
|
|
||||||
|
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
|
||||||
|
|
||||||
|
If you have any question or need help, please reach out on Discord in the channel [`#so100-arm`](https://discord.com/channels/1216765309076115607/1237741463832363039).
|
||||||
275
examples/11_use_moss.md
Normal file
275
examples/11_use_moss.md
Normal file
@@ -0,0 +1,275 @@
|
|||||||
|
This tutorial explains how to use [Moss v1](https://github.com/jess-moss/moss-robot-arms) with LeRobot.
|
||||||
|
|
||||||
|
## Source the parts
|
||||||
|
|
||||||
|
Follow this [README](https://github.com/jess-moss/moss-robot-arms). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
|
||||||
|
|
||||||
|
**Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
|
||||||
|
|
||||||
|
## Install LeRobot
|
||||||
|
|
||||||
|
On your computer:
|
||||||
|
|
||||||
|
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||||
|
```bash
|
||||||
|
mkdir -p ~/miniconda3
|
||||||
|
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||||
|
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||||
|
rm ~/miniconda3/miniconda.sh
|
||||||
|
~/miniconda3/bin/conda init bash
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Restart shell or `source ~/.bashrc`
|
||||||
|
|
||||||
|
3. Create and activate a fresh conda environment for lerobot
|
||||||
|
```bash
|
||||||
|
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
4. Clone LeRobot:
|
||||||
|
```bash
|
||||||
|
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
5. Install LeRobot with dependencies for the feetech motors:
|
||||||
|
```bash
|
||||||
|
cd ~/lerobot && pip install -e ".[feetech]"
|
||||||
|
```
|
||||||
|
|
||||||
|
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||||
|
```bash
|
||||||
|
conda install -y -c conda-forge ffmpeg
|
||||||
|
pip uninstall -y opencv-python
|
||||||
|
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
## Configure the motors
|
||||||
|
|
||||||
|
Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the use of our scripts below.
|
||||||
|
|
||||||
|
**Find USB ports associated to your arms**
|
||||||
|
To find the correct ports for each arm, run the utility script twice:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
```
|
||||||
|
|
||||||
|
Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
|
||||||
|
```
|
||||||
|
Finding all available ports for the MotorBus.
|
||||||
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
|
[...Disconnect leader arm and press Enter...]
|
||||||
|
|
||||||
|
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
|
||||||
|
Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
|
||||||
|
```
|
||||||
|
Finding all available ports for the MotorBus.
|
||||||
|
['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
|
||||||
|
[...Disconnect follower arm and press Enter...]
|
||||||
|
|
||||||
|
The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
|
||||||
|
Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Troubleshooting: On Linux, you might need to give access to the USB ports by running:
|
||||||
|
```bash
|
||||||
|
sudo chmod 666 /dev/ttyACM0
|
||||||
|
sudo chmod 666 /dev/ttyACM1
|
||||||
|
```
|
||||||
|
|
||||||
|
**Configure your motors**
|
||||||
|
Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 1
|
||||||
|
```
|
||||||
|
|
||||||
|
Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).
|
||||||
|
|
||||||
|
Then unplug your motor and plug the second motor and set its ID to 2.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/configure_motor.py \
|
||||||
|
--port /dev/tty.usbmodem58760432961 \
|
||||||
|
--brand feetech \
|
||||||
|
--model sts3215 \
|
||||||
|
--baudrate 1000000 \
|
||||||
|
--ID 2
|
||||||
|
```
|
||||||
|
|
||||||
|
Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
|
||||||
|
|
||||||
|
**Remove the gears of the 6 leader motors**
|
||||||
|
Follow step 2 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
|
||||||
|
|
||||||
|
**Add motor horn to the motors**
|
||||||
|
Follow step 3 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). For Moss v1, you need to align the holes on the motor horn to the motor spline to be approximately 3, 6, 9 and 12 o'clock.
|
||||||
|
Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
|
||||||
|
|
||||||
|
## Assemble the arms
|
||||||
|
|
||||||
|
Follow step 4 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
|
||||||
|
|
||||||
|
## Calibrate
|
||||||
|
|
||||||
|
Next, you'll need to calibrate your Moss v1 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one Moss v1 robot to work on another.
|
||||||
|
|
||||||
|
**Manual calibration of follower arm**
|
||||||
|
/!\ Contrarily to step 6 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the auto calibration, we will actually do manual calibration of follower for now.
|
||||||
|
|
||||||
|
You will need to move the follower arm to these positions sequentially:
|
||||||
|
|
||||||
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|
|---|---|---|
|
||||||
|
| <img src="../media/moss/follower_zero.webp?raw=true" alt="Moss v1 follower arm zero position" title="Moss v1 follower arm zero position" style="width:100%;"> | <img src="../media/moss/follower_rotated.webp?raw=true" alt="Moss v1 follower arm rotated position" title="Moss v1 follower arm rotated position" style="width:100%;"> | <img src="../media/moss/follower_rest.webp?raw=true" alt="Moss v1 follower arm rest position" title="Moss v1 follower arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
|
Make sure both arms are connected and run this script to launch manual calibration:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--robot-overrides '~cameras' --arms main_follower
|
||||||
|
```
|
||||||
|
|
||||||
|
**Manual calibration of leader arm**
|
||||||
|
Follow step 6 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
|
||||||
|
|
||||||
|
| 1. Zero position | 2. Rotated position | 3. Rest position |
|
||||||
|
|---|---|---|
|
||||||
|
| <img src="../media/moss/leader_zero.webp?raw=true" alt="Moss v1 leader arm zero position" title="Moss v1 leader arm zero position" style="width:100%;"> | <img src="../media/moss/leader_rotated.webp?raw=true" alt="Moss v1 leader arm rotated position" title="Moss v1 leader arm rotated position" style="width:100%;"> | <img src="../media/moss/leader_rest.webp?raw=true" alt="Moss v1 leader arm rest position" title="Moss v1 leader arm rest position" style="width:100%;"> |
|
||||||
|
|
||||||
|
Run this script to launch manual calibration:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--robot-overrides '~cameras' --arms main_leader
|
||||||
|
```
|
||||||
|
|
||||||
|
## Teleoperate
|
||||||
|
|
||||||
|
**Simple teleop**
|
||||||
|
Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--robot-overrides '~cameras' \
|
||||||
|
--display-cameras 0
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
**Teleop with displaying cameras**
|
||||||
|
Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml
|
||||||
|
```
|
||||||
|
|
||||||
|
## Record a dataset
|
||||||
|
|
||||||
|
Once you're familiar with teleoperation, you can record your first dataset with Moss v1.
|
||||||
|
|
||||||
|
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
|
```bash
|
||||||
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
|
```
|
||||||
|
|
||||||
|
Store your Hugging Face repository name in a variable to run these commands:
|
||||||
|
```bash
|
||||||
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
|
echo $HF_USER
|
||||||
|
```
|
||||||
|
|
||||||
|
Record 2 episodes and upload your dataset to the hub:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/moss_test \
|
||||||
|
--tags moss tutorial \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 2 \
|
||||||
|
--push-to-hub 1
|
||||||
|
```
|
||||||
|
|
||||||
|
## Visualize a dataset
|
||||||
|
|
||||||
|
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||||
|
```bash
|
||||||
|
echo ${HF_USER}/moss_test
|
||||||
|
```
|
||||||
|
|
||||||
|
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/visualize_dataset_html.py \
|
||||||
|
--repo-id ${HF_USER}/moss_test
|
||||||
|
```
|
||||||
|
|
||||||
|
## Replay an episode
|
||||||
|
|
||||||
|
Now try to replay the first episode on your robot:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/moss_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
|
||||||
|
## Train a policy
|
||||||
|
|
||||||
|
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
dataset_repo_id=${HF_USER}/moss_test \
|
||||||
|
policy=act_moss_real \
|
||||||
|
env=moss_real \
|
||||||
|
hydra.run.dir=outputs/train/act_moss_test \
|
||||||
|
hydra.job.name=act_moss_test \
|
||||||
|
device=cuda \
|
||||||
|
wandb.enable=true
|
||||||
|
```
|
||||||
|
|
||||||
|
Let's explain it:
|
||||||
|
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/moss_test`.
|
||||||
|
2. We provided the policy with `policy=act_moss_real`. This loads configurations from [`lerobot/configs/policy/act_moss_real.yaml`](../lerobot/configs/policy/act_moss_real.yaml). Importantly, this policy uses 2 cameras as input `laptop`, `phone`.
|
||||||
|
3. We provided an environment as argument with `env=moss_real`. This loads configurations from [`lerobot/configs/env/moss_real.yaml`](../lerobot/configs/env/moss_real.yaml).
|
||||||
|
4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
|
||||||
|
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||||
|
|
||||||
|
Training should take several hours. You will find checkpoints in `outputs/train/act_moss_test/checkpoints`.
|
||||||
|
|
||||||
|
## Evaluate your policy
|
||||||
|
|
||||||
|
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/moss.yaml \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/eval_act_moss_test \
|
||||||
|
--tags moss tutorial eval \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 10 \
|
||||||
|
-p outputs/train/act_moss_test/checkpoints/last/pretrained_model
|
||||||
|
```
|
||||||
|
|
||||||
|
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||||
|
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_moss_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_moss_test`).
|
||||||
|
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_moss_test`).
|
||||||
|
|
||||||
|
## More
|
||||||
|
|
||||||
|
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
|
||||||
|
|
||||||
|
If you have any question or need help, please reach out on Discord in the channel [`#moss-arm`](https://discord.com/channels/1216765309076115607/1275374638985252925).
|
||||||
83
examples/12_train_hilserl_classifier.md
Normal file
83
examples/12_train_hilserl_classifier.md
Normal file
@@ -0,0 +1,83 @@
|
|||||||
|
# Training a HIL-SERL Reward Classifier with LeRobot
|
||||||
|
|
||||||
|
This tutorial provides step-by-step instructions for training a reward classifier using LeRobot.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Training Script Overview
|
||||||
|
|
||||||
|
LeRobot includes a ready-to-use training script located at [`lerobot/scripts/train_hilserl_classifier.py`](../../lerobot/scripts/train_hilserl_classifier.py). Here's an outline of its workflow:
|
||||||
|
|
||||||
|
1. **Configuration Loading**
|
||||||
|
The script uses Hydra to load a configuration file for subsequent steps. (Details on Hydra follow below.)
|
||||||
|
|
||||||
|
2. **Dataset Initialization**
|
||||||
|
It loads a `LeRobotDataset` containing images and rewards. To optimize performance, a weighted random sampler is used to balance class sampling.
|
||||||
|
|
||||||
|
3. **Classifier Initialization**
|
||||||
|
A lightweight classification head is built on top of a frozen, pretrained image encoder from HuggingFace. The classifier outputs either:
|
||||||
|
- A single probability (binary classification), or
|
||||||
|
- Logits (multi-class classification).
|
||||||
|
|
||||||
|
4. **Training Loop Execution**
|
||||||
|
The script performs:
|
||||||
|
- Forward and backward passes,
|
||||||
|
- Optimization steps,
|
||||||
|
- Periodic logging, evaluation, and checkpoint saving.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Configuring with Hydra
|
||||||
|
|
||||||
|
For detailed information about Hydra usage, refer to [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md). However, note that training the reward classifier differs slightly and requires a separate configuration file.
|
||||||
|
|
||||||
|
### Config File Setup
|
||||||
|
|
||||||
|
The default `default.yaml` cannot launch the reward classifier training directly. Instead, you need a configuration file like [`lerobot/configs/policy/hilserl_classifier.yaml`](../../lerobot/configs/policy/hilserl_classifier.yaml), with the following adjustment:
|
||||||
|
|
||||||
|
Replace the `dataset_repo_id` field with the identifier for your dataset, which contains images and sparse rewards:
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
# Example: lerobot/configs/policy/reward_classifier.yaml
|
||||||
|
dataset_repo_id: "my_dataset_repo_id"
|
||||||
|
## Typical logs and metrics
|
||||||
|
```
|
||||||
|
When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
|
||||||
|
|
||||||
|
After that, you will see training log like this one:
|
||||||
|
|
||||||
|
```
|
||||||
|
[2024-11-29 18:26:36,999][root][INFO] -
|
||||||
|
Epoch 5/5
|
||||||
|
Training: 82%|██████████████████████████████████████████████████████████████████████████████▋ | 91/111 [00:50<00:09, 2.04it/s, loss=0.2999, acc=69.99%]
|
||||||
|
```
|
||||||
|
|
||||||
|
or evaluation log like:
|
||||||
|
|
||||||
|
```
|
||||||
|
Validation: 100%|████████████████████████████████████████████████████████████████████████████████████████████████████████████████████████| 28/28 [00:20<00:00, 1.37it/s]
|
||||||
|
```
|
||||||
|
|
||||||
|
### Metrics Tracking with Weights & Biases (WandB)
|
||||||
|
|
||||||
|
If `wandb.enable` is set to `true`, the training and evaluation logs will also be saved in WandB. This allows you to track key metrics in real-time, including:
|
||||||
|
|
||||||
|
- **Training Metrics**:
|
||||||
|
- `train/accuracy`
|
||||||
|
- `train/loss`
|
||||||
|
- `train/dataloading_s`
|
||||||
|
- **Evaluation Metrics**:
|
||||||
|
- `eval/accuracy`
|
||||||
|
- `eval/loss`
|
||||||
|
- `eval/eval_s`
|
||||||
|
|
||||||
|
#### Additional Features
|
||||||
|
|
||||||
|
You can also log sample predictions during evaluation. Each logged sample will include:
|
||||||
|
|
||||||
|
- The **input image**.
|
||||||
|
- The **predicted label**.
|
||||||
|
- The **true label**.
|
||||||
|
- The **classifier's "confidence" (logits/probability)**.
|
||||||
|
|
||||||
|
These logs can be useful for diagnosing and debugging performance issues.
|
||||||
@@ -3,78 +3,120 @@ This script demonstrates the use of `LeRobotDataset` class for handling and proc
|
|||||||
It illustrates how to load datasets, manipulate them, and apply transformations suitable for machine learning tasks in PyTorch.
|
It illustrates how to load datasets, manipulate them, and apply transformations suitable for machine learning tasks in PyTorch.
|
||||||
|
|
||||||
Features included in this script:
|
Features included in this script:
|
||||||
- Loading a dataset and accessing its properties.
|
- Viewing a dataset's metadata and exploring its properties.
|
||||||
- Filtering data by episode number.
|
- Loading an existing dataset from the hub or a subset of it.
|
||||||
- Converting tensor data for visualization.
|
- Accessing frames by episode number.
|
||||||
- Saving video files from dataset frames.
|
|
||||||
- Using advanced dataset features like timestamp-based frame selection.
|
- Using advanced dataset features like timestamp-based frame selection.
|
||||||
- Demonstrating compatibility with PyTorch DataLoader for batch processing.
|
- Demonstrating compatibility with PyTorch DataLoader for batch processing.
|
||||||
|
|
||||||
The script ends with examples of how to batch process data using PyTorch's DataLoader.
|
The script ends with examples of how to batch process data using PyTorch's DataLoader.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from pathlib import Path
|
|
||||||
from pprint import pprint
|
from pprint import pprint
|
||||||
|
|
||||||
import imageio
|
|
||||||
import torch
|
import torch
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
|
||||||
import lerobot
|
import lerobot
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
|
||||||
|
|
||||||
|
# We ported a number of existing datasets ourselves, use this to see the list:
|
||||||
print("List of available datasets:")
|
print("List of available datasets:")
|
||||||
pprint(lerobot.available_datasets)
|
pprint(lerobot.available_datasets)
|
||||||
|
|
||||||
# Let's take one for this example
|
# You can also browse through the datasets created/ported by the community on the hub using the hub api:
|
||||||
repo_id = "lerobot/pusht"
|
hub_api = HfApi()
|
||||||
|
repo_ids = [info.id for info in hub_api.list_datasets(task_categories="robotics", tags=["LeRobot"])]
|
||||||
|
pprint(repo_ids)
|
||||||
|
|
||||||
# You can easily load a dataset from a Hugging Face repository
|
# Or simply explore them in your web browser directly at:
|
||||||
|
# https://huggingface.co/datasets?other=LeRobot
|
||||||
|
|
||||||
|
# Let's take this one for this example
|
||||||
|
repo_id = "lerobot/aloha_mobile_cabinet"
|
||||||
|
# We can have a look and fetch its metadata to know more about it:
|
||||||
|
ds_meta = LeRobotDatasetMetadata(repo_id)
|
||||||
|
|
||||||
|
# By instantiating just this class, you can quickly access useful information about the content and the
|
||||||
|
# structure of the dataset without downloading the actual data yet (only metadata files — which are
|
||||||
|
# lightweight).
|
||||||
|
print(f"Total number of episodes: {ds_meta.total_episodes}")
|
||||||
|
print(f"Average number of frames per episode: {ds_meta.total_frames / ds_meta.total_episodes:.3f}")
|
||||||
|
print(f"Frames per second used during data collection: {ds_meta.fps}")
|
||||||
|
print(f"Robot type: {ds_meta.robot_type}")
|
||||||
|
print(f"keys to access images from cameras: {ds_meta.camera_keys=}\n")
|
||||||
|
|
||||||
|
print("Tasks:")
|
||||||
|
print(ds_meta.tasks)
|
||||||
|
print("Features:")
|
||||||
|
pprint(ds_meta.features)
|
||||||
|
|
||||||
|
# You can also get a short summary by simply printing the object:
|
||||||
|
print(ds_meta)
|
||||||
|
|
||||||
|
# You can then load the actual dataset from the hub.
|
||||||
|
# Either load any subset of episodes:
|
||||||
|
dataset = LeRobotDataset(repo_id, episodes=[0, 10, 11, 23])
|
||||||
|
|
||||||
|
# And see how many frames you have:
|
||||||
|
print(f"Selected episodes: {dataset.episodes}")
|
||||||
|
print(f"Number of episodes selected: {dataset.num_episodes}")
|
||||||
|
print(f"Number of frames selected: {dataset.num_frames}")
|
||||||
|
|
||||||
|
# Or simply load the entire dataset:
|
||||||
dataset = LeRobotDataset(repo_id)
|
dataset = LeRobotDataset(repo_id)
|
||||||
|
print(f"Number of episodes selected: {dataset.num_episodes}")
|
||||||
|
print(f"Number of frames selected: {dataset.num_frames}")
|
||||||
|
|
||||||
# LeRobotDataset is actually a thin wrapper around an underlying Hugging Face dataset
|
# The previous metadata class is contained in the 'meta' attribute of the dataset:
|
||||||
# (see https://huggingface.co/docs/datasets/index for more information).
|
print(dataset.meta)
|
||||||
print(dataset)
|
|
||||||
|
# LeRobotDataset actually wraps an underlying Hugging Face dataset
|
||||||
|
# (see https://huggingface.co/docs/datasets for more information).
|
||||||
print(dataset.hf_dataset)
|
print(dataset.hf_dataset)
|
||||||
|
|
||||||
# And provides additional utilities for robotics and compatibility with Pytorch
|
# LeRobot datasets also subclasses PyTorch datasets so you can do everything you know and love from working
|
||||||
print(f"\naverage number of frames per episode: {dataset.num_samples / dataset.num_episodes:.3f}")
|
# with the latter, like iterating through the dataset.
|
||||||
print(f"frames per second used during data collection: {dataset.fps=}")
|
# The __getitem__ iterates over the frames of the dataset. Since our datasets are also structured by
|
||||||
print(f"keys to access images from cameras: {dataset.camera_keys=}\n")
|
# episodes, you can access the frame indices of any episode using the episode_data_index. Here, we access
|
||||||
|
# frame indices associated to the first episode:
|
||||||
# Access frame indexes associated to first episode
|
|
||||||
episode_index = 0
|
episode_index = 0
|
||||||
from_idx = dataset.episode_data_index["from"][episode_index].item()
|
from_idx = dataset.episode_data_index["from"][episode_index].item()
|
||||||
to_idx = dataset.episode_data_index["to"][episode_index].item()
|
to_idx = dataset.episode_data_index["to"][episode_index].item()
|
||||||
|
|
||||||
# LeRobot datasets actually subclass PyTorch datasets so you can do everything you know and love from working
|
# Then we grab all the image frames from the first camera:
|
||||||
# with the latter, like iterating through the dataset. Here we grab all the image frames.
|
camera_key = dataset.meta.camera_keys[0]
|
||||||
frames = [dataset[idx]["observation.image"] for idx in range(from_idx, to_idx)]
|
frames = [dataset[idx][camera_key] for idx in range(from_idx, to_idx)]
|
||||||
|
|
||||||
# Video frames are now float32 in range [0,1] channel first (c,h,w) to follow pytorch convention. To visualize
|
# The objects returned by the dataset are all torch.Tensors
|
||||||
# them, we convert to uint8 in range [0,255]
|
print(type(frames[0]))
|
||||||
frames = [(frame * 255).type(torch.uint8) for frame in frames]
|
print(frames[0].shape)
|
||||||
# and to channel last (h,w,c).
|
|
||||||
frames = [frame.permute((1, 2, 0)).numpy() for frame in frames]
|
|
||||||
|
|
||||||
# Finally, we save the frames to a mp4 video for visualization.
|
# Since we're using pytorch, the shape is in pytorch, channel-first convention (c, h, w).
|
||||||
Path("outputs/examples/1_load_lerobot_dataset").mkdir(parents=True, exist_ok=True)
|
# We can compare this shape with the information available for that feature
|
||||||
imageio.mimsave("outputs/examples/1_load_lerobot_dataset/episode_0.mp4", frames, fps=dataset.fps)
|
pprint(dataset.features[camera_key])
|
||||||
|
# In particular:
|
||||||
|
print(dataset.features[camera_key]["shape"])
|
||||||
|
# The shape is in (h, w, c) which is a more universal format.
|
||||||
|
|
||||||
# For many machine learning applications we need to load the history of past observations or trajectories of
|
# For many machine learning applications we need to load the history of past observations or trajectories of
|
||||||
# future actions. Our datasets can load previous and future frames for each key/modality, using timestamps
|
# future actions. Our datasets can load previous and future frames for each key/modality, using timestamps
|
||||||
# differences with the current loaded frame. For instance:
|
# differences with the current loaded frame. For instance:
|
||||||
delta_timestamps = {
|
delta_timestamps = {
|
||||||
# loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
|
# loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
|
||||||
"observation.image": [-1, -0.5, -0.20, 0],
|
camera_key: [-1, -0.5, -0.20, 0],
|
||||||
# loads 8 state vectors: 1.5 seconds before, 1 second before, ... 20 ms, 10 ms, and current frame
|
# loads 8 state vectors: 1.5 seconds before, 1 second before, ... 200 ms, 100 ms, and current frame
|
||||||
"observation.state": [-1.5, -1, -0.5, -0.20, -0.10, -0.02, -0.01, 0],
|
"observation.state": [-1.5, -1, -0.5, -0.20, -0.10, 0],
|
||||||
# loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
|
# loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
|
||||||
"action": [t / dataset.fps for t in range(64)],
|
"action": [t / dataset.fps for t in range(64)],
|
||||||
}
|
}
|
||||||
|
# Note that in any case, these delta_timestamps values need to be multiples of (1/fps) so that added to any
|
||||||
|
# timestamp, you still get a valid timestamp.
|
||||||
|
|
||||||
dataset = LeRobotDataset(repo_id, delta_timestamps=delta_timestamps)
|
dataset = LeRobotDataset(repo_id, delta_timestamps=delta_timestamps)
|
||||||
print(f"\n{dataset[0]['observation.image'].shape=}") # (4,c,h,w)
|
print(f"\n{dataset[0][camera_key].shape=}") # (4, c, h, w)
|
||||||
print(f"{dataset[0]['observation.state'].shape=}") # (8,c)
|
print(f"{dataset[0]['observation.state'].shape=}") # (6, c)
|
||||||
print(f"{dataset[0]['action'].shape=}\n") # (64,c)
|
print(f"{dataset[0]['action'].shape=}\n") # (64, c)
|
||||||
|
|
||||||
# Finally, our datasets are fully compatible with PyTorch dataloaders and samplers because they are just
|
# Finally, our datasets are fully compatible with PyTorch dataloaders and samplers because they are just
|
||||||
# PyTorch datasets.
|
# PyTorch datasets.
|
||||||
@@ -84,8 +126,9 @@ dataloader = torch.utils.data.DataLoader(
|
|||||||
batch_size=32,
|
batch_size=32,
|
||||||
shuffle=True,
|
shuffle=True,
|
||||||
)
|
)
|
||||||
|
|
||||||
for batch in dataloader:
|
for batch in dataloader:
|
||||||
print(f"{batch['observation.image'].shape=}") # (32,4,c,h,w)
|
print(f"{batch[camera_key].shape=}") # (32, 4, c, h, w)
|
||||||
print(f"{batch['observation.state'].shape=}") # (32,8,c)
|
print(f"{batch['observation.state'].shape=}") # (32, 5, c)
|
||||||
print(f"{batch['action'].shape=}") # (32,64,c)
|
print(f"{batch['action'].shape=}") # (32, 64, c)
|
||||||
break
|
break
|
||||||
|
|||||||
@@ -18,8 +18,6 @@ from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
|||||||
output_directory = Path("outputs/eval/example_pusht_diffusion")
|
output_directory = Path("outputs/eval/example_pusht_diffusion")
|
||||||
output_directory.mkdir(parents=True, exist_ok=True)
|
output_directory.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
device = torch.device("cuda")
|
|
||||||
|
|
||||||
# Download the diffusion policy for pusht environment
|
# Download the diffusion policy for pusht environment
|
||||||
pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
|
pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
|
||||||
# OR uncomment the following to evaluate a policy from the local outputs/train folder.
|
# OR uncomment the following to evaluate a policy from the local outputs/train folder.
|
||||||
@@ -27,6 +25,17 @@ pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
|
|||||||
|
|
||||||
policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
|
policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
|
||||||
policy.eval()
|
policy.eval()
|
||||||
|
|
||||||
|
# Check if GPU is available
|
||||||
|
if torch.cuda.is_available():
|
||||||
|
device = torch.device("cuda")
|
||||||
|
print("GPU is available. Device set to:", device)
|
||||||
|
else:
|
||||||
|
device = torch.device("cpu")
|
||||||
|
print(f"GPU is not available. Device set to: {device}. Inference will be slower than on GPU.")
|
||||||
|
# Decrease the number of reverse-diffusion steps (trades off a bit of quality for 10x speed)
|
||||||
|
policy.diffusion.num_inference_steps = 10
|
||||||
|
|
||||||
policy.to(device)
|
policy.to(device)
|
||||||
|
|
||||||
# Initialize evaluation environment to render two observation types:
|
# Initialize evaluation environment to render two observation types:
|
||||||
|
|||||||
@@ -40,7 +40,7 @@ dataset = LeRobotDataset("lerobot/pusht", delta_timestamps=delta_timestamps)
|
|||||||
# For this example, no arguments need to be passed because the defaults are set up for PushT.
|
# For this example, no arguments need to be passed because the defaults are set up for PushT.
|
||||||
# If you're doing something different, you will likely need to change at least some of the defaults.
|
# If you're doing something different, you will likely need to change at least some of the defaults.
|
||||||
cfg = DiffusionConfig()
|
cfg = DiffusionConfig()
|
||||||
policy = DiffusionPolicy(cfg, dataset_stats=dataset.stats)
|
policy = DiffusionPolicy(cfg, dataset_stats=dataset.meta.stats)
|
||||||
policy.train()
|
policy.train()
|
||||||
policy.to(device)
|
policy.to(device)
|
||||||
|
|
||||||
|
|||||||
213
examples/4_train_policy_with_script.md
Normal file
213
examples/4_train_policy_with_script.md
Normal file
@@ -0,0 +1,213 @@
|
|||||||
|
This tutorial will explain the training script, how to use it, and particularly the use of Hydra to configure everything needed for the training run.
|
||||||
|
|
||||||
|
## The training script
|
||||||
|
|
||||||
|
LeRobot offers a training script at [`lerobot/scripts/train.py`](../../lerobot/scripts/train.py). At a high level it does the following:
|
||||||
|
|
||||||
|
- Loads a Hydra configuration file for the following steps (more on Hydra in a moment).
|
||||||
|
- Makes a simulation environment.
|
||||||
|
- Makes a dataset corresponding to that simulation environment.
|
||||||
|
- Makes a policy.
|
||||||
|
- Runs a standard training loop with forward pass, backward pass, optimization step, and occasional logging, evaluation (of the policy on the environment), and checkpointing.
|
||||||
|
|
||||||
|
## Basics of how we use Hydra
|
||||||
|
|
||||||
|
Explaining the ins and outs of [Hydra](https://hydra.cc/docs/intro/) is beyond the scope of this document, but here we'll share the main points you need to know.
|
||||||
|
|
||||||
|
First, `lerobot/configs` has a directory structure like this:
|
||||||
|
|
||||||
|
```
|
||||||
|
.
|
||||||
|
├── default.yaml
|
||||||
|
├── env
|
||||||
|
│ ├── aloha.yaml
|
||||||
|
│ ├── pusht.yaml
|
||||||
|
│ └── xarm.yaml
|
||||||
|
└── policy
|
||||||
|
├── act.yaml
|
||||||
|
├── diffusion.yaml
|
||||||
|
└── tdmpc.yaml
|
||||||
|
```
|
||||||
|
|
||||||
|
**_For brevity, in the rest of this document we'll drop the leading `lerobot/configs` path. So `default.yaml` really refers to `lerobot/configs/default.yaml`._**
|
||||||
|
|
||||||
|
When you run the training script with
|
||||||
|
|
||||||
|
```python
|
||||||
|
python lerobot/scripts/train.py
|
||||||
|
```
|
||||||
|
|
||||||
|
Hydra is set up to read `default.yaml` (via the `@hydra.main` decorator). If you take a look at the `@hydra.main`'s arguments you will see `config_path="../configs", config_name="default"`. At the top of `default.yaml`, is a `defaults` section which looks likes this:
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
defaults:
|
||||||
|
- _self_
|
||||||
|
- env: pusht
|
||||||
|
- policy: diffusion
|
||||||
|
```
|
||||||
|
|
||||||
|
This logic tells Hydra to incorporate configuration parameters from `env/pusht.yaml` and `policy/diffusion.yaml`. _Note: Be aware of the order as any configuration parameters with the same name will be overidden. Thus, `default.yaml` is overridden by `env/pusht.yaml` which is overidden by `policy/diffusion.yaml`_.
|
||||||
|
|
||||||
|
Then, `default.yaml` also contains common configuration parameters such as `device: cuda` or `use_amp: false` (for enabling fp16 training). Some other parameters are set to `???` which indicates that they are expected to be set in additional yaml files. For instance, `training.offline_steps: ???` in `default.yaml` is set to `200000` in `diffusion.yaml`.
|
||||||
|
|
||||||
|
Thanks to this `defaults` section in `default.yaml`, if you want to train Diffusion Policy with PushT, you really only need to run:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py
|
||||||
|
```
|
||||||
|
|
||||||
|
However, you can be more explicit and launch the exact same Diffusion Policy training on PushT with:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py policy=diffusion env=pusht
|
||||||
|
```
|
||||||
|
|
||||||
|
This way of overriding defaults via the CLI is especially useful when you want to change the policy and/or environment. For instance, you can train ACT on the default Aloha environment with:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py policy=act env=aloha
|
||||||
|
```
|
||||||
|
|
||||||
|
There are two things to note here:
|
||||||
|
- Config overrides are passed as `param_name=param_value`.
|
||||||
|
- Here we have overridden the defaults section. `policy=act` tells Hydra to use `policy/act.yaml`, and `env=aloha` tells Hydra to use `env/aloha.yaml`.
|
||||||
|
|
||||||
|
_As an aside: we've set up all of our configurations so that they reproduce state-of-the-art results from papers in the literature._
|
||||||
|
|
||||||
|
## Overriding configuration parameters in the CLI
|
||||||
|
|
||||||
|
Now let's say that we want to train on a different task in the Aloha environment. If you look in `env/aloha.yaml` you will see something like:
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
# lerobot/configs/env/aloha.yaml
|
||||||
|
env:
|
||||||
|
task: AlohaInsertion-v0
|
||||||
|
```
|
||||||
|
|
||||||
|
And if you look in `policy/act.yaml` you will see something like:
|
||||||
|
|
||||||
|
```yaml
|
||||||
|
# lerobot/configs/policy/act.yaml
|
||||||
|
dataset_repo_id: lerobot/aloha_sim_insertion_human
|
||||||
|
```
|
||||||
|
|
||||||
|
But our Aloha environment actually supports a cube transfer task as well. To train for this task, you could manually modify the two yaml configuration files respectively.
|
||||||
|
|
||||||
|
First, we'd need to switch to using the cube transfer task for the ALOHA environment.
|
||||||
|
|
||||||
|
```diff
|
||||||
|
# lerobot/configs/env/aloha.yaml
|
||||||
|
env:
|
||||||
|
- task: AlohaInsertion-v0
|
||||||
|
+ task: AlohaTransferCube-v0
|
||||||
|
```
|
||||||
|
|
||||||
|
Then, we'd also need to switch to using the cube transfer dataset.
|
||||||
|
|
||||||
|
```diff
|
||||||
|
# lerobot/configs/policy/act.yaml
|
||||||
|
-dataset_repo_id: lerobot/aloha_sim_insertion_human
|
||||||
|
+dataset_repo_id: lerobot/aloha_sim_transfer_cube_human
|
||||||
|
```
|
||||||
|
|
||||||
|
Then, you'd be able to run:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py policy=act env=aloha
|
||||||
|
```
|
||||||
|
|
||||||
|
and you'd be training and evaluating on the cube transfer task.
|
||||||
|
|
||||||
|
An alternative approach to editing the yaml configuration files, would be to override the defaults via the command line:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
policy=act \
|
||||||
|
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||||
|
env=aloha \
|
||||||
|
env.task=AlohaTransferCube-v0
|
||||||
|
```
|
||||||
|
|
||||||
|
There's something new here. Notice the `.` delimiter used to traverse the configuration hierarchy. _But be aware that the `defaults` section is an exception. As you saw above, we didn't need to write `defaults.policy=act` in the CLI. `policy=act` was enough._
|
||||||
|
|
||||||
|
Putting all that knowledge together, here's the command that was used to train https://huggingface.co/lerobot/act_aloha_sim_transfer_cube_human.
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
hydra.run.dir=outputs/train/act_aloha_sim_transfer_cube_human \
|
||||||
|
device=cuda
|
||||||
|
env=aloha \
|
||||||
|
env.task=AlohaTransferCube-v0 \
|
||||||
|
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||||
|
policy=act \
|
||||||
|
training.eval_freq=10000 \
|
||||||
|
training.log_freq=250 \
|
||||||
|
training.offline_steps=100000 \
|
||||||
|
training.save_model=true \
|
||||||
|
training.save_freq=25000 \
|
||||||
|
eval.n_episodes=50 \
|
||||||
|
eval.batch_size=50 \
|
||||||
|
wandb.enable=false \
|
||||||
|
```
|
||||||
|
|
||||||
|
There's one new thing here: `hydra.run.dir=outputs/train/act_aloha_sim_transfer_cube_human`, which specifies where to save the training output.
|
||||||
|
|
||||||
|
## Using a configuration file not in `lerobot/configs`
|
||||||
|
|
||||||
|
Above we discusses the our training script is set up such that Hydra looks for `default.yaml` in `lerobot/configs`. But, if you have a configuration file elsewhere in your filesystem you may use:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py --config-dir PARENT/PATH --config-name FILE_NAME_WITHOUT_EXTENSION
|
||||||
|
```
|
||||||
|
|
||||||
|
Note: here we use regular syntax for providing CLI arguments to a Python script, not Hydra's `param_name=param_value` syntax.
|
||||||
|
|
||||||
|
As a concrete example, this becomes particularly handy when you have a folder with training outputs, and would like to re-run the training. For example, say you previously ran the training script with one of the earlier commands and have `outputs/train/my_experiment/checkpoints/pretrained_model/config.yaml`. This `config.yaml` file will have the full set of configuration parameters within it. To run the training with the same configuration again, do:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py --config-dir outputs/train/my_experiment/checkpoints/last/pretrained_model --config-name config
|
||||||
|
```
|
||||||
|
|
||||||
|
Note that you may still use the regular syntax for config parameter overrides (eg: by adding `training.offline_steps=200000`).
|
||||||
|
|
||||||
|
## Typical logs and metrics
|
||||||
|
|
||||||
|
When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
|
||||||
|
|
||||||
|
After that, you will see training log like this one:
|
||||||
|
|
||||||
|
```
|
||||||
|
INFO 2024-08-14 13:35:12 ts/train.py:192 step:0 smpl:64 ep:1 epch:0.00 loss:1.112 grdn:15.387 lr:2.0e-07 updt_s:1.738 data_s:4.774
|
||||||
|
```
|
||||||
|
|
||||||
|
or evaluation log like:
|
||||||
|
|
||||||
|
```
|
||||||
|
INFO 2024-08-14 13:38:45 ts/train.py:226 step:100 smpl:6K ep:52 epch:0.25 ∑rwrd:20.693 success:0.0% eval_s:120.266
|
||||||
|
```
|
||||||
|
|
||||||
|
These logs will also be saved in wandb if `wandb.enable` is set to `true`. Here are the meaning of some abbreviations:
|
||||||
|
|
||||||
|
- `smpl`: number of samples seen during training.
|
||||||
|
- `ep`: number of episodes seen during training. An episode contains multiple samples in a complete manipulation task.
|
||||||
|
- `epch`: number of time all unique samples are seen (epoch).
|
||||||
|
- `grdn`: gradient norm.
|
||||||
|
- `∑rwrd`: compute the sum of rewards in every evaluation episode and then take an average of them.
|
||||||
|
- `success`: average success rate of eval episodes. Reward and success are usually different except for the sparsing reward setting, where reward=1 only when the task is completed successfully.
|
||||||
|
- `eval_s`: time to evaluate the policy in the environment, in second.
|
||||||
|
- `updt_s`: time to update the network parameters, in second.
|
||||||
|
- `data_s`: time to load a batch of data, in second.
|
||||||
|
|
||||||
|
Some metrics are useful for initial performance profiling. For example, if you find the current GPU utilization is low via the `nvidia-smi` command and `data_s` sometimes is too high, you may need to modify batch size or number of dataloading workers to accelerate dataloading. We also recommend [pytorch profiler](https://github.com/huggingface/lerobot?tab=readme-ov-file#improve-your-code-with-profiling) for detailed performance probing.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
So far we've seen how to train Diffusion Policy for PushT and ACT for ALOHA. Now, what if we want to train ACT for PushT? Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py policy=act env=pusht dataset_repo_id=lerobot/pusht
|
||||||
|
```
|
||||||
|
|
||||||
|
Please, head on over to our [advanced tutorial on adapting policy configuration to various environments](./advanced/train_act_pusht/train_act_pusht.md) to learn more.
|
||||||
|
|
||||||
|
Or in the meantime, happy coding! 🤗
|
||||||
37
examples/5_resume_training.md
Normal file
37
examples/5_resume_training.md
Normal file
@@ -0,0 +1,37 @@
|
|||||||
|
This tutorial explains how to resume a training run that you've started with the training script. If you don't know how our training script and configuration system works, please read [4_train_policy_with_script.md](./4_train_policy_with_script.md) first.
|
||||||
|
|
||||||
|
## Basic training resumption
|
||||||
|
|
||||||
|
Let's consider the example of training ACT for one of the ALOHA tasks. Here's a command that can achieve that:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
hydra.run.dir=outputs/train/run_resumption \
|
||||||
|
policy=act \
|
||||||
|
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||||
|
env=aloha \
|
||||||
|
env.task=AlohaTransferCube-v0 \
|
||||||
|
training.log_freq=25 \
|
||||||
|
training.save_checkpoint=true \
|
||||||
|
training.save_freq=100
|
||||||
|
```
|
||||||
|
|
||||||
|
Here we're using the default dataset and environment for ACT, and we've taken care to set up the log frequency and checkpointing frequency to low numbers so we can test resumption. You should be able to see some logging and have a first checkpoint within 1 minute. Please interrupt the training after the first checkpoint.
|
||||||
|
|
||||||
|
To resume, all that we have to do is run the training script, providing the run directory, and the resume option:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
hydra.run.dir=outputs/train/run_resumption \
|
||||||
|
resume=true
|
||||||
|
```
|
||||||
|
|
||||||
|
You should see from the logging that your training picks up from where it left off.
|
||||||
|
|
||||||
|
Note that with `resume=true`, the configuration file from the last checkpoint in the training output directory is loaded. So it doesn't matter that we haven't provided all the other configuration parameters from our previous command (although there may be warnings to notify you that your command has a different configuration than than the checkpoint).
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
Now you should know how to resume your training run in case it gets interrupted or you want to extend a finished training run.
|
||||||
|
|
||||||
|
Happy coding! 🤗
|
||||||
53
examples/6_add_image_transforms.py
Normal file
53
examples/6_add_image_transforms.py
Normal file
@@ -0,0 +1,53 @@
|
|||||||
|
"""
|
||||||
|
This script demonstrates how to use torchvision's image transformation with LeRobotDataset for data
|
||||||
|
augmentation purposes. The transformations are passed to the dataset as an argument upon creation, and
|
||||||
|
transforms are applied to the observation images before they are returned in the dataset's __getitem__.
|
||||||
|
"""
|
||||||
|
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
from torchvision.transforms import ToPILImage, v2
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
|
||||||
|
dataset_repo_id = "lerobot/aloha_static_screw_driver"
|
||||||
|
|
||||||
|
# Create a LeRobotDataset with no transformations
|
||||||
|
dataset = LeRobotDataset(dataset_repo_id, episodes=[0])
|
||||||
|
# This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
|
||||||
|
|
||||||
|
# Get the index of the first observation in the first episode
|
||||||
|
first_idx = dataset.episode_data_index["from"][0].item()
|
||||||
|
|
||||||
|
# Get the frame corresponding to the first camera
|
||||||
|
frame = dataset[first_idx][dataset.meta.camera_keys[0]]
|
||||||
|
|
||||||
|
|
||||||
|
# Define the transformations
|
||||||
|
transforms = v2.Compose(
|
||||||
|
[
|
||||||
|
v2.ColorJitter(brightness=(0.5, 1.5)),
|
||||||
|
v2.ColorJitter(contrast=(0.5, 1.5)),
|
||||||
|
v2.ColorJitter(hue=(-0.1, 0.1)),
|
||||||
|
v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
|
||||||
|
]
|
||||||
|
)
|
||||||
|
|
||||||
|
# Create another LeRobotDataset with the defined transformations
|
||||||
|
transformed_dataset = LeRobotDataset(dataset_repo_id, episodes=[0], image_transforms=transforms)
|
||||||
|
|
||||||
|
# Get a frame from the transformed dataset
|
||||||
|
transformed_frame = transformed_dataset[first_idx][transformed_dataset.meta.camera_keys[0]]
|
||||||
|
|
||||||
|
# Create a directory to store output images
|
||||||
|
output_dir = Path("outputs/image_transforms")
|
||||||
|
output_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
# Save the original frame
|
||||||
|
to_pil = ToPILImage()
|
||||||
|
to_pil(frame).save(output_dir / "original_frame.png", quality=100)
|
||||||
|
print(f"Original frame saved to {output_dir / 'original_frame.png'}.")
|
||||||
|
|
||||||
|
# Save the transformed frame
|
||||||
|
to_pil(transformed_frame).save(output_dir / "transformed_frame.png", quality=100)
|
||||||
|
print(f"Transformed frame saved to {output_dir / 'transformed_frame.png'}.")
|
||||||
1013
examples/7_get_started_with_real_robot.md
Normal file
1013
examples/7_get_started_with_real_robot.md
Normal file
File diff suppressed because it is too large
Load Diff
156
examples/8_use_stretch.md
Normal file
156
examples/8_use_stretch.md
Normal file
@@ -0,0 +1,156 @@
|
|||||||
|
This tutorial explains how to use [Stretch 3](https://hello-robot.com/stretch-3-product) with LeRobot.
|
||||||
|
|
||||||
|
## Setup
|
||||||
|
|
||||||
|
Familiarize yourself with Stretch by following its [tutorials](https://docs.hello-robot.com/0.3/getting_started/hello_robot/) (recommended).
|
||||||
|
|
||||||
|
To use LeRobot on Stretch, 3 options are available:
|
||||||
|
- [tethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#tethered-setup)
|
||||||
|
- [untethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#untethered-setup)
|
||||||
|
- ssh directly into Stretch (you will first need to install and configure openssh-server on stretch using one of the two above setups)
|
||||||
|
|
||||||
|
|
||||||
|
## Install LeRobot
|
||||||
|
|
||||||
|
On Stretch's CLI, follow these steps:
|
||||||
|
|
||||||
|
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||||
|
```bash
|
||||||
|
mkdir -p ~/miniconda3
|
||||||
|
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||||
|
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||||
|
rm ~/miniconda3/miniconda.sh
|
||||||
|
~/miniconda3/bin/conda init bash
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Comment out these lines in `~/.profile` (this can mess up paths used by conda and ~/.local/bin should already be in your PATH)
|
||||||
|
```
|
||||||
|
# set PATH so it includes user's private bin if it exists
|
||||||
|
if [ -d "$HOME/.local/bin" ] ; then
|
||||||
|
PATH="$HOME/.local/bin:$PATH"
|
||||||
|
fi
|
||||||
|
```
|
||||||
|
|
||||||
|
3. Restart shell or `source ~/.bashrc`
|
||||||
|
|
||||||
|
4. Create and activate a fresh conda environment for lerobot
|
||||||
|
```bash
|
||||||
|
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
5. Clone LeRobot:
|
||||||
|
```bash
|
||||||
|
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
6. Install LeRobot with stretch dependencies:
|
||||||
|
```bash
|
||||||
|
cd ~/lerobot && pip install -e ".[stretch]"
|
||||||
|
```
|
||||||
|
|
||||||
|
> **Note:** If you get this message, you can ignore it: `ERROR: pip's dependency resolver does not currently take into account all the packages that are installed.`
|
||||||
|
|
||||||
|
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||||
|
```bash
|
||||||
|
conda install -y -c conda-forge ffmpeg
|
||||||
|
pip uninstall -y opencv-python
|
||||||
|
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
7. Run a [system check](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#system-check) to make sure your robot is ready:
|
||||||
|
```bash
|
||||||
|
stretch_system_check.py
|
||||||
|
```
|
||||||
|
|
||||||
|
> **Note:** You may need to free the "robot process" after booting Stretch by running `stretch_free_robot_process.py`. For more info this Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#turning-off-gamepad-teleoperation).
|
||||||
|
|
||||||
|
You should get something like this:
|
||||||
|
```bash
|
||||||
|
For use with S T R E T C H (R) from Hello Robot Inc.
|
||||||
|
---------------------------------------------------------------------
|
||||||
|
|
||||||
|
Model = Stretch 3
|
||||||
|
Tool = DexWrist 3 w/ Gripper
|
||||||
|
Serial Number = stretch-se3-3054
|
||||||
|
|
||||||
|
---- Checking Hardware ----
|
||||||
|
[Pass] Comms are ready
|
||||||
|
[Pass] Actuators are ready
|
||||||
|
[Warn] Sensors not ready (IMU AZ = -10.19 out of range -10.1 to -9.5)
|
||||||
|
[Pass] Battery voltage is 13.6 V
|
||||||
|
|
||||||
|
---- Checking Software ----
|
||||||
|
[Pass] Ubuntu 22.04 is ready
|
||||||
|
[Pass] All APT pkgs are setup correctly
|
||||||
|
[Pass] Firmware is up-to-date
|
||||||
|
[Pass] Python pkgs are up-to-date
|
||||||
|
[Pass] ROS2 Humble is ready
|
||||||
|
```
|
||||||
|
|
||||||
|
## Teleoperate, record a dataset and run a policy
|
||||||
|
|
||||||
|
**Calibrate (Optional)**
|
||||||
|
Before operating Stretch, you need to [home](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#homing) it first. Be mindful about giving Stretch some space as this procedure will move the robot's arm and gripper. Now run this command:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py calibrate \
|
||||||
|
--robot-path lerobot/configs/robot/stretch.yaml
|
||||||
|
```
|
||||||
|
This is equivalent to running `stretch_robot_home.py`
|
||||||
|
|
||||||
|
> **Note:** If you run any of the LeRobot scripts below and Stretch is not poperly homed, it will automatically home/calibrate first.
|
||||||
|
|
||||||
|
**Teleoperate**
|
||||||
|
Before trying teleoperation, you need activate the gamepad controller by pressing the middle button. For more info, see Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/hello_robot/#gamepad-teleoperation).
|
||||||
|
|
||||||
|
Now try out teleoperation (see above documentation to learn about the gamepad controls):
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/stretch.yaml
|
||||||
|
```
|
||||||
|
This is essentially the same as running `stretch_gamepad_teleop.py`
|
||||||
|
|
||||||
|
**Record a dataset**
|
||||||
|
Once you're familiar with the gamepad controls and after a bit of practice, you can try to record your first dataset with Stretch.
|
||||||
|
|
||||||
|
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
|
```bash
|
||||||
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
|
```
|
||||||
|
|
||||||
|
Store your Hugging Face repository name in a variable to run these commands:
|
||||||
|
```bash
|
||||||
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
|
echo $HF_USER
|
||||||
|
```
|
||||||
|
|
||||||
|
Record one episode:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/stretch.yaml \
|
||||||
|
--fps 20 \
|
||||||
|
--repo-id ${HF_USER}/stretch_test \
|
||||||
|
--tags stretch tutorial \
|
||||||
|
--warmup-time-s 3 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 1 \
|
||||||
|
--push-to-hub 0
|
||||||
|
```
|
||||||
|
|
||||||
|
> **Note:** If you're using ssh to connect to Stretch and run this script, you won't be able to visualize its cameras feed (though they will still be recording). To see the cameras stream, use [tethered](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#tethered-setup) or [untethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#untethered-setup).
|
||||||
|
|
||||||
|
**Replay an episode**
|
||||||
|
Now try to replay this episode (make sure the robot's initial position is the same):
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/stretch.yaml \
|
||||||
|
--fps 20 \
|
||||||
|
--repo-id ${HF_USER}/stretch_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
|
||||||
|
Follow [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) to train a policy on your data and run inference on your robot. You will need to adapt the code for Stretch.
|
||||||
|
|
||||||
|
> TODO(rcadene, aliberts): Add already setup environment and policy yaml configuration files
|
||||||
|
|
||||||
|
If you need help, please reach out on Discord in the channel `#stretch3-mobile-arm`.
|
||||||
174
examples/9_use_aloha.md
Normal file
174
examples/9_use_aloha.md
Normal file
@@ -0,0 +1,174 @@
|
|||||||
|
This tutorial explains how to use [Aloha and Aloha 2 stationary](https://www.trossenrobotics.com/aloha-stationary) with LeRobot.
|
||||||
|
|
||||||
|
## Setup
|
||||||
|
|
||||||
|
Follow the [documentation from Trossen Robotics](https://docs.trossenrobotics.com/aloha_docs/getting_started/stationary/hardware_setup.html) for setting up the hardware and plugging the 4 arms and 4 cameras to your computer.
|
||||||
|
|
||||||
|
|
||||||
|
## Install LeRobot
|
||||||
|
|
||||||
|
On your computer:
|
||||||
|
|
||||||
|
1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
|
||||||
|
```bash
|
||||||
|
mkdir -p ~/miniconda3
|
||||||
|
wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
|
||||||
|
bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
|
||||||
|
rm ~/miniconda3/miniconda.sh
|
||||||
|
~/miniconda3/bin/conda init bash
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Restart shell or `source ~/.bashrc`
|
||||||
|
|
||||||
|
3. Create and activate a fresh conda environment for lerobot
|
||||||
|
```bash
|
||||||
|
conda create -y -n lerobot python=3.10 && conda activate lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
4. Clone LeRobot:
|
||||||
|
```bash
|
||||||
|
git clone https://github.com/huggingface/lerobot.git ~/lerobot
|
||||||
|
```
|
||||||
|
|
||||||
|
5. Install LeRobot with dependencies for the Aloha motors (dynamixel) and cameras (intelrealsense):
|
||||||
|
```bash
|
||||||
|
cd ~/lerobot && pip install -e ".[dynamixel, intelrealsense]"
|
||||||
|
```
|
||||||
|
|
||||||
|
For Linux only (not Mac), install extra dependencies for recording datasets:
|
||||||
|
```bash
|
||||||
|
conda install -y -c conda-forge ffmpeg
|
||||||
|
pip uninstall -y opencv-python
|
||||||
|
conda install -y -c conda-forge "opencv>=4.10.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
## Teleoperate
|
||||||
|
|
||||||
|
**/!\ FOR SAFETY, READ THIS /!\**
|
||||||
|
Teleoperation consists in manually operating the leader arms to move the follower arms. Importantly:
|
||||||
|
1. Make sure your leader arms are in the same position as the follower arms, so that the follower arms don't move too fast to match the leader arms,
|
||||||
|
2. Our code assumes that your robot has been assembled following Trossen Robotics instructions. This allows us to skip calibration, as we use the pre-defined calibration files in `.cache/calibration/aloha_default`. If you replace a motor, make sure you follow the exact instructions from Trossen Robotics.
|
||||||
|
|
||||||
|
By running the following code, you can start your first **SAFE** teleoperation:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=5
|
||||||
|
```
|
||||||
|
|
||||||
|
By adding `--robot-overrides max_relative_target=5`, we override the default value for `max_relative_target` defined in `lerobot/configs/robot/aloha.yaml`. It is expected to be `5` to limit the magnitude of the movement for more safety, but the teleoperation won't be smooth. When you feel confident, you can disable this limit by adding `--robot-overrides max_relative_target=null` to the command line:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py teleoperate \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=null
|
||||||
|
```
|
||||||
|
|
||||||
|
## Record a dataset
|
||||||
|
|
||||||
|
Once you're familiar with teleoperation, you can record your first dataset with Aloha.
|
||||||
|
|
||||||
|
If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
|
||||||
|
```bash
|
||||||
|
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||||
|
```
|
||||||
|
|
||||||
|
Store your Hugging Face repository name in a variable to run these commands:
|
||||||
|
```bash
|
||||||
|
HF_USER=$(huggingface-cli whoami | head -n 1)
|
||||||
|
echo $HF_USER
|
||||||
|
```
|
||||||
|
|
||||||
|
Record 2 episodes and upload your dataset to the hub:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=null \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/aloha_test \
|
||||||
|
--tags aloha tutorial \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 2 \
|
||||||
|
--push-to-hub 1
|
||||||
|
```
|
||||||
|
|
||||||
|
## Visualize a dataset
|
||||||
|
|
||||||
|
If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
|
||||||
|
```bash
|
||||||
|
echo ${HF_USER}/aloha_test
|
||||||
|
```
|
||||||
|
|
||||||
|
If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/visualize_dataset_html.py \
|
||||||
|
--repo-id ${HF_USER}/aloha_test
|
||||||
|
```
|
||||||
|
|
||||||
|
## Replay an episode
|
||||||
|
|
||||||
|
**/!\ FOR SAFETY, READ THIS /!\**
|
||||||
|
Replay consists in automatically replaying the sequence of actions (i.e. goal positions for your motors) recorded in a given dataset episode. Make sure the current initial position of your robot is similar to the one in your episode, so that your follower arms don't move too fast to go to the first goal positions. For safety, you might want to add `--robot-overrides max_relative_target=5` to your command line as explained above.
|
||||||
|
|
||||||
|
Now try to replay the first episode on your robot:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py replay \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=null \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/aloha_test \
|
||||||
|
--episode 0
|
||||||
|
```
|
||||||
|
|
||||||
|
## Train a policy
|
||||||
|
|
||||||
|
To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py \
|
||||||
|
dataset_repo_id=${HF_USER}/aloha_test \
|
||||||
|
policy=act_aloha_real \
|
||||||
|
env=aloha_real \
|
||||||
|
hydra.run.dir=outputs/train/act_aloha_test \
|
||||||
|
hydra.job.name=act_aloha_test \
|
||||||
|
device=cuda \
|
||||||
|
wandb.enable=true
|
||||||
|
```
|
||||||
|
|
||||||
|
Let's explain it:
|
||||||
|
1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/aloha_test`.
|
||||||
|
2. We provided the policy with `policy=act_aloha_real`. This loads configurations from [`lerobot/configs/policy/act_aloha_real.yaml`](../lerobot/configs/policy/act_aloha_real.yaml). Importantly, this policy uses 4 cameras as input `cam_right_wrist`, `cam_left_wrist`, `cam_high`, and `cam_low`.
|
||||||
|
3. We provided an environment as argument with `env=aloha_real`. This loads configurations from [`lerobot/configs/env/aloha_real.yaml`](../lerobot/configs/env/aloha_real.yaml). Note: this yaml defines 18 dimensions for the `state_dim` and `action_dim`, corresponding to 18 motors, not 14 motors as used in previous Aloha work. This is because, we include the `shoulder_shadow` and `elbow_shadow` motors for simplicity.
|
||||||
|
4. We provided `device=cuda` since we are training on a Nvidia GPU.
|
||||||
|
5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
|
||||||
|
|
||||||
|
Training should take several hours. You will find checkpoints in `outputs/train/act_aloha_test/checkpoints`.
|
||||||
|
|
||||||
|
## Evaluate your policy
|
||||||
|
|
||||||
|
You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/control_robot.py record \
|
||||||
|
--robot-path lerobot/configs/robot/aloha.yaml \
|
||||||
|
--robot-overrides max_relative_target=null \
|
||||||
|
--fps 30 \
|
||||||
|
--repo-id ${HF_USER}/eval_act_aloha_test \
|
||||||
|
--tags aloha tutorial eval \
|
||||||
|
--warmup-time-s 5 \
|
||||||
|
--episode-time-s 40 \
|
||||||
|
--reset-time-s 10 \
|
||||||
|
--num-episodes 10 \
|
||||||
|
--num-image-writer-processes 1 \
|
||||||
|
-p outputs/train/act_aloha_test/checkpoints/last/pretrained_model
|
||||||
|
```
|
||||||
|
|
||||||
|
As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
|
||||||
|
1. There is an additional `-p` argument which indicates the path to your policy checkpoint with (e.g. `-p outputs/train/eval_aloha_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_aloha_test`).
|
||||||
|
2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_aloha_test`).
|
||||||
|
3. We use `--num-image-writer-processes 1` instead of the default value (`0`). On our computer, using a dedicated process to write images from the 4 cameras on disk allows to reach constent 30 fps during inference. Feel free to explore different values for `--num-image-writer-processes`.
|
||||||
|
|
||||||
|
## More
|
||||||
|
|
||||||
|
Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth explaination.
|
||||||
|
|
||||||
|
If you have any question or need help, please reach out on Discord in the channel `#aloha-arm`.
|
||||||
87
examples/advanced/1_train_act_pusht/act_pusht.yaml
Normal file
87
examples/advanced/1_train_act_pusht/act_pusht.yaml
Normal file
@@ -0,0 +1,87 @@
|
|||||||
|
# @package _global_
|
||||||
|
|
||||||
|
# Change the seed to match what PushT eval uses
|
||||||
|
# (to avoid evaluating on seeds used for generating the training data).
|
||||||
|
seed: 100000
|
||||||
|
# Change the dataset repository to the PushT one.
|
||||||
|
dataset_repo_id: lerobot/pusht
|
||||||
|
|
||||||
|
override_dataset_stats:
|
||||||
|
observation.image:
|
||||||
|
# stats from imagenet, since we use a pretrained vision model
|
||||||
|
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||||
|
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||||
|
|
||||||
|
training:
|
||||||
|
offline_steps: 80000
|
||||||
|
online_steps: 0
|
||||||
|
eval_freq: 10000
|
||||||
|
save_freq: 100000
|
||||||
|
log_freq: 250
|
||||||
|
save_model: true
|
||||||
|
|
||||||
|
batch_size: 8
|
||||||
|
lr: 1e-5
|
||||||
|
lr_backbone: 1e-5
|
||||||
|
weight_decay: 1e-4
|
||||||
|
grad_clip_norm: 10
|
||||||
|
online_steps_between_rollouts: 1
|
||||||
|
|
||||||
|
delta_timestamps:
|
||||||
|
action: "[i / ${fps} for i in range(${policy.chunk_size})]"
|
||||||
|
|
||||||
|
eval:
|
||||||
|
n_episodes: 50
|
||||||
|
batch_size: 50
|
||||||
|
|
||||||
|
# See `configuration_act.py` for more details.
|
||||||
|
policy:
|
||||||
|
name: act
|
||||||
|
|
||||||
|
# Input / output structure.
|
||||||
|
n_obs_steps: 1
|
||||||
|
chunk_size: 100 # chunk_size
|
||||||
|
n_action_steps: 100
|
||||||
|
|
||||||
|
input_shapes:
|
||||||
|
observation.image: [3, 96, 96]
|
||||||
|
observation.state: ["${env.state_dim}"]
|
||||||
|
output_shapes:
|
||||||
|
action: ["${env.action_dim}"]
|
||||||
|
|
||||||
|
# Normalization / Unnormalization
|
||||||
|
input_normalization_modes:
|
||||||
|
observation.image: mean_std
|
||||||
|
# Use min_max normalization just because it's more standard.
|
||||||
|
observation.state: min_max
|
||||||
|
output_normalization_modes:
|
||||||
|
# Use min_max normalization just because it's more standard.
|
||||||
|
action: min_max
|
||||||
|
|
||||||
|
# Architecture.
|
||||||
|
# Vision backbone.
|
||||||
|
vision_backbone: resnet18
|
||||||
|
pretrained_backbone_weights: ResNet18_Weights.IMAGENET1K_V1
|
||||||
|
replace_final_stride_with_dilation: false
|
||||||
|
# Transformer layers.
|
||||||
|
pre_norm: false
|
||||||
|
dim_model: 512
|
||||||
|
n_heads: 8
|
||||||
|
dim_feedforward: 3200
|
||||||
|
feedforward_activation: relu
|
||||||
|
n_encoder_layers: 4
|
||||||
|
# Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
|
||||||
|
# that means only the first layer is used. Here we match the original implementation by setting this to 1.
|
||||||
|
# See this issue https://github.com/tonyzhaozh/act/issues/25#issue-2258740521.
|
||||||
|
n_decoder_layers: 1
|
||||||
|
# VAE.
|
||||||
|
use_vae: true
|
||||||
|
latent_dim: 32
|
||||||
|
n_vae_encoder_layers: 4
|
||||||
|
|
||||||
|
# Inference.
|
||||||
|
temporal_ensemble_coeff: null
|
||||||
|
|
||||||
|
# Training and loss computation.
|
||||||
|
dropout: 0.1
|
||||||
|
kl_weight: 10.0
|
||||||
70
examples/advanced/1_train_act_pusht/train_act_pusht.md
Normal file
70
examples/advanced/1_train_act_pusht/train_act_pusht.md
Normal file
@@ -0,0 +1,70 @@
|
|||||||
|
In this tutorial we will learn how to adapt a policy configuration to be compatible with a new environment and dataset. As a concrete example, we will adapt the default configuration for ACT to be compatible with the PushT environment and dataset.
|
||||||
|
|
||||||
|
If you haven't already read our tutorial on the [training script and configuration tooling](../4_train_policy_with_script.md) please do so prior to tackling this tutorial.
|
||||||
|
|
||||||
|
Let's get started!
|
||||||
|
|
||||||
|
Suppose we want to train ACT for PushT. Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py policy=act env=pusht dataset_repo_id=lerobot/pusht
|
||||||
|
```
|
||||||
|
|
||||||
|
We need to adapt the parameters of the ACT policy configuration to the PushT environment. The most important ones are the image keys.
|
||||||
|
|
||||||
|
ALOHA's datasets and environments typically use a variable number of cameras. In `lerobot/configs/policy/act.yaml` you may notice two relevant sections. Here we show you the minimal diff needed to adjust to PushT:
|
||||||
|
|
||||||
|
```diff
|
||||||
|
override_dataset_stats:
|
||||||
|
- observation.images.top:
|
||||||
|
+ observation.image:
|
||||||
|
# stats from imagenet, since we use a pretrained vision model
|
||||||
|
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||||
|
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||||
|
|
||||||
|
policy:
|
||||||
|
input_shapes:
|
||||||
|
- observation.images.top: [3, 480, 640]
|
||||||
|
+ observation.image: [3, 96, 96]
|
||||||
|
observation.state: ["${env.state_dim}"]
|
||||||
|
output_shapes:
|
||||||
|
action: ["${env.action_dim}"]
|
||||||
|
|
||||||
|
input_normalization_modes:
|
||||||
|
- observation.images.top: mean_std
|
||||||
|
+ observation.image: mean_std
|
||||||
|
observation.state: min_max
|
||||||
|
output_normalization_modes:
|
||||||
|
action: min_max
|
||||||
|
```
|
||||||
|
|
||||||
|
Here we've accounted for the following:
|
||||||
|
- PushT uses "observation.image" for its image key.
|
||||||
|
- PushT provides smaller images.
|
||||||
|
|
||||||
|
_Side note: technically we could override these via the CLI, but with many changes it gets a bit messy, and we also have a bit of a challenge in that we're using `.` in our observation keys which is treated by Hydra as a hierarchical separator_.
|
||||||
|
|
||||||
|
For your convenience, we provide [`act_pusht.yaml`](./act_pusht.yaml) in this directory. It contains the diff above, plus some other (optional) ones that are explained within. Please copy it into `lerobot/configs/policy` with:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
cp examples/advanced/1_train_act_pusht/act_pusht.yaml lerobot/configs/policy/act_pusht.yaml
|
||||||
|
```
|
||||||
|
|
||||||
|
(remember from a [previous tutorial](../4_train_policy_with_script.md) that Hydra will look in the `lerobot/configs` directory). Now try running the following.
|
||||||
|
|
||||||
|
<!-- Note to contributor: are you changing this command? Note that it's tested in `Makefile`, so change it there too! -->
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/train.py policy=act_pusht env=pusht
|
||||||
|
```
|
||||||
|
|
||||||
|
Notice that this is much the same as the command that failed at the start of the tutorial, only:
|
||||||
|
- Now we are using `policy=act_pusht` to point to our new configuration file.
|
||||||
|
- We can drop `dataset_repo_id=lerobot/pusht` as the change is incorporated in our new configuration file.
|
||||||
|
|
||||||
|
Hurrah! You're now training ACT for the PushT environment.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
The bottom line of this tutorial is that when training policies for different environments and datasets you will need to understand what parts of the policy configuration are specific to those and make changes accordingly.
|
||||||
|
|
||||||
|
Happy coding! 🤗
|
||||||
@@ -14,7 +14,7 @@ from pathlib import Path
|
|||||||
import torch
|
import torch
|
||||||
from huggingface_hub import snapshot_download
|
from huggingface_hub import snapshot_download
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
|
||||||
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
|
||||||
|
|
||||||
device = torch.device("cuda")
|
device = torch.device("cuda")
|
||||||
@@ -41,26 +41,20 @@ delta_timestamps = {
|
|||||||
}
|
}
|
||||||
|
|
||||||
# Load the last 10% of episodes of the dataset as a validation set.
|
# Load the last 10% of episodes of the dataset as a validation set.
|
||||||
# - Load full dataset
|
# - Load dataset metadata
|
||||||
full_dataset = LeRobotDataset("lerobot/pusht", split="train")
|
dataset_metadata = LeRobotDatasetMetadata("lerobot/pusht")
|
||||||
# - Calculate train and val subsets
|
# - Calculate train and val episodes
|
||||||
num_train_episodes = math.floor(full_dataset.num_episodes * 90 / 100)
|
total_episodes = dataset_metadata.total_episodes
|
||||||
num_val_episodes = full_dataset.num_episodes - num_train_episodes
|
episodes = list(range(dataset_metadata.total_episodes))
|
||||||
print(f"Number of episodes in full dataset: {full_dataset.num_episodes}")
|
num_train_episodes = math.floor(total_episodes * 90 / 100)
|
||||||
print(f"Number of episodes in training dataset (90% subset): {num_train_episodes}")
|
train_episodes = episodes[:num_train_episodes]
|
||||||
print(f"Number of episodes in validation dataset (10% subset): {num_val_episodes}")
|
val_episodes = episodes[num_train_episodes:]
|
||||||
# - Get first frame index of the validation set
|
print(f"Number of episodes in full dataset: {total_episodes}")
|
||||||
first_val_frame_index = full_dataset.episode_data_index["from"][num_train_episodes].item()
|
print(f"Number of episodes in training dataset (90% subset): {len(train_episodes)}")
|
||||||
# - Load frames subset belonging to validation set using the `split` argument.
|
print(f"Number of episodes in validation dataset (10% subset): {len(val_episodes)}")
|
||||||
# It utilizes the `datasets` library's syntax for slicing datasets.
|
# - Load train an val datasets
|
||||||
# For more information on the Slice API, please see:
|
train_dataset = LeRobotDataset("lerobot/pusht", episodes=train_episodes, delta_timestamps=delta_timestamps)
|
||||||
# https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
|
val_dataset = LeRobotDataset("lerobot/pusht", episodes=val_episodes, delta_timestamps=delta_timestamps)
|
||||||
train_dataset = LeRobotDataset(
|
|
||||||
"lerobot/pusht", split=f"train[:{first_val_frame_index}]", delta_timestamps=delta_timestamps
|
|
||||||
)
|
|
||||||
val_dataset = LeRobotDataset(
|
|
||||||
"lerobot/pusht", split=f"train[{first_val_frame_index}:]", delta_timestamps=delta_timestamps
|
|
||||||
)
|
|
||||||
print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
|
print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
|
||||||
print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
|
print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
|
||||||
|
|
||||||
222
examples/port_datasets/pusht_zarr.py
Normal file
222
examples/port_datasets/pusht_zarr.py
Normal file
@@ -0,0 +1,222 @@
|
|||||||
|
import shutil
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import torch
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LEROBOT_HOME, LeRobotDataset
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub._download_raw import download_raw
|
||||||
|
|
||||||
|
PUSHT_TASK = "Push the T-shaped blue block onto the T-shaped green target surface."
|
||||||
|
PUSHT_FEATURES = {
|
||||||
|
"observation.state": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (2,),
|
||||||
|
"names": {
|
||||||
|
"axes": ["x", "y"],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
"action": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (2,),
|
||||||
|
"names": {
|
||||||
|
"axes": ["x", "y"],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
"next.reward": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"next.success": {
|
||||||
|
"dtype": "bool",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
},
|
||||||
|
"observation.environment_state": {
|
||||||
|
"dtype": "float32",
|
||||||
|
"shape": (16,),
|
||||||
|
"names": [
|
||||||
|
"keypoints",
|
||||||
|
],
|
||||||
|
},
|
||||||
|
"observation.image": {
|
||||||
|
"dtype": None,
|
||||||
|
"shape": (3, 96, 96),
|
||||||
|
"names": [
|
||||||
|
"channel",
|
||||||
|
"height",
|
||||||
|
"width",
|
||||||
|
],
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def build_features(mode: str) -> dict:
|
||||||
|
features = PUSHT_FEATURES
|
||||||
|
if mode == "keypoints":
|
||||||
|
features.pop("observation.image")
|
||||||
|
else:
|
||||||
|
features.pop("observation.environment_state")
|
||||||
|
features["observation.image"]["dtype"] = mode
|
||||||
|
|
||||||
|
return features
|
||||||
|
|
||||||
|
|
||||||
|
def load_raw_dataset(zarr_path: Path):
|
||||||
|
try:
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub._diffusion_policy_replay_buffer import (
|
||||||
|
ReplayBuffer as DiffusionPolicyReplayBuffer,
|
||||||
|
)
|
||||||
|
except ModuleNotFoundError as e:
|
||||||
|
print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
|
||||||
|
raise e
|
||||||
|
|
||||||
|
zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
|
||||||
|
return zarr_data
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_coverage(zarr_data):
|
||||||
|
try:
|
||||||
|
import pymunk
|
||||||
|
from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
|
||||||
|
except ModuleNotFoundError as e:
|
||||||
|
print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
|
||||||
|
raise e
|
||||||
|
|
||||||
|
block_pos = zarr_data["state"][:, 2:4]
|
||||||
|
block_angle = zarr_data["state"][:, 4]
|
||||||
|
|
||||||
|
num_frames = len(block_pos)
|
||||||
|
|
||||||
|
coverage = np.zeros((num_frames,))
|
||||||
|
# 8 keypoints with 2 coords each
|
||||||
|
keypoints = np.zeros((num_frames, 16))
|
||||||
|
|
||||||
|
# Set x, y, theta (in radians)
|
||||||
|
goal_pos_angle = np.array([256, 256, np.pi / 4])
|
||||||
|
goal_body = PushTEnv.get_goal_pose_body(goal_pos_angle)
|
||||||
|
|
||||||
|
for i in range(num_frames):
|
||||||
|
space = pymunk.Space()
|
||||||
|
space.gravity = 0, 0
|
||||||
|
space.damping = 0
|
||||||
|
|
||||||
|
# Add walls.
|
||||||
|
walls = [
|
||||||
|
PushTEnv.add_segment(space, (5, 506), (5, 5), 2),
|
||||||
|
PushTEnv.add_segment(space, (5, 5), (506, 5), 2),
|
||||||
|
PushTEnv.add_segment(space, (506, 5), (506, 506), 2),
|
||||||
|
PushTEnv.add_segment(space, (5, 506), (506, 506), 2),
|
||||||
|
]
|
||||||
|
space.add(*walls)
|
||||||
|
|
||||||
|
block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
|
||||||
|
goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
|
||||||
|
block_geom = pymunk_to_shapely(block_body, block_body.shapes)
|
||||||
|
intersection_area = goal_geom.intersection(block_geom).area
|
||||||
|
goal_area = goal_geom.area
|
||||||
|
coverage[i] = intersection_area / goal_area
|
||||||
|
keypoints[i] = torch.from_numpy(PushTEnv.get_keypoints(block_shapes).flatten())
|
||||||
|
|
||||||
|
return coverage, keypoints
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_success(coverage: float, success_threshold: float):
|
||||||
|
return coverage > success_threshold
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_reward(coverage: float, success_threshold: float):
|
||||||
|
return np.clip(coverage / success_threshold, 0, 1)
|
||||||
|
|
||||||
|
|
||||||
|
def main(raw_dir: Path, repo_id: str, mode: str = "video", push_to_hub: bool = True):
|
||||||
|
if mode not in ["video", "image", "keypoints"]:
|
||||||
|
raise ValueError(mode)
|
||||||
|
|
||||||
|
if (LEROBOT_HOME / repo_id).exists():
|
||||||
|
shutil.rmtree(LEROBOT_HOME / repo_id)
|
||||||
|
|
||||||
|
if not raw_dir.exists():
|
||||||
|
download_raw(raw_dir, repo_id="lerobot-raw/pusht_raw")
|
||||||
|
|
||||||
|
zarr_data = load_raw_dataset(zarr_path=raw_dir / "pusht_cchi_v7_replay.zarr")
|
||||||
|
|
||||||
|
env_state = zarr_data["state"][:]
|
||||||
|
agent_pos = env_state[:, :2]
|
||||||
|
|
||||||
|
action = zarr_data["action"][:]
|
||||||
|
image = zarr_data["img"] # (b, h, w, c)
|
||||||
|
|
||||||
|
episode_data_index = {
|
||||||
|
"from": np.concatenate(([0], zarr_data.meta["episode_ends"][:-1])),
|
||||||
|
"to": zarr_data.meta["episode_ends"],
|
||||||
|
}
|
||||||
|
|
||||||
|
# Calculate success and reward based on the overlapping area
|
||||||
|
# of the T-object and the T-area.
|
||||||
|
coverage, keypoints = calculate_coverage(zarr_data)
|
||||||
|
success = calculate_success(coverage, success_threshold=0.95)
|
||||||
|
reward = calculate_reward(coverage, success_threshold=0.95)
|
||||||
|
|
||||||
|
features = build_features(mode)
|
||||||
|
dataset = LeRobotDataset.create(
|
||||||
|
repo_id=repo_id,
|
||||||
|
fps=10,
|
||||||
|
robot_type="2d pointer",
|
||||||
|
features=features,
|
||||||
|
image_writer_threads=4,
|
||||||
|
)
|
||||||
|
episodes = range(len(episode_data_index["from"]))
|
||||||
|
for ep_idx in episodes:
|
||||||
|
from_idx = episode_data_index["from"][ep_idx]
|
||||||
|
to_idx = episode_data_index["to"][ep_idx]
|
||||||
|
num_frames = to_idx - from_idx
|
||||||
|
|
||||||
|
for frame_idx in range(num_frames):
|
||||||
|
i = from_idx + frame_idx
|
||||||
|
frame = {
|
||||||
|
"action": torch.from_numpy(action[i]),
|
||||||
|
# Shift reward and success by +1 until the last item of the episode
|
||||||
|
"next.reward": reward[i + (frame_idx < num_frames - 1)],
|
||||||
|
"next.success": success[i + (frame_idx < num_frames - 1)],
|
||||||
|
}
|
||||||
|
|
||||||
|
frame["observation.state"] = torch.from_numpy(agent_pos[i])
|
||||||
|
|
||||||
|
if mode == "keypoints":
|
||||||
|
frame["observation.environment_state"] = torch.from_numpy(keypoints[i])
|
||||||
|
else:
|
||||||
|
frame["observation.image"] = torch.from_numpy(image[i])
|
||||||
|
|
||||||
|
dataset.add_frame(frame)
|
||||||
|
|
||||||
|
dataset.save_episode(task=PUSHT_TASK)
|
||||||
|
|
||||||
|
dataset.consolidate()
|
||||||
|
|
||||||
|
if push_to_hub:
|
||||||
|
dataset.push_to_hub()
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
# To try this script, modify the repo id with your own HuggingFace user (e.g cadene/pusht)
|
||||||
|
repo_id = "lerobot/pusht"
|
||||||
|
|
||||||
|
modes = ["video", "image", "keypoints"]
|
||||||
|
# Uncomment if you want to try with a specific mode
|
||||||
|
# modes = ["video"]
|
||||||
|
# modes = ["image"]
|
||||||
|
# modes = ["keypoints"]
|
||||||
|
|
||||||
|
raw_dir = Path("data/lerobot-raw/pusht_raw")
|
||||||
|
for mode in modes:
|
||||||
|
if mode in ["image", "keypoints"]:
|
||||||
|
repo_id += f"_{mode}"
|
||||||
|
|
||||||
|
# download and load raw dataset, create LeRobotDataset, populate it, push to hub
|
||||||
|
main(raw_dir, repo_id=repo_id, mode=mode)
|
||||||
|
|
||||||
|
# Uncomment if you want to load the local dataset and explore it
|
||||||
|
# dataset = LeRobotDataset(repo_id=repo_id, local_files_only=True)
|
||||||
|
# breakpoint()
|
||||||
@@ -1 +0,0 @@
|
|||||||
# gym_dora
|
|
||||||
@@ -1,17 +0,0 @@
|
|||||||
import gymnasium as gym
|
|
||||||
|
|
||||||
import gym_dora # noqa: F401
|
|
||||||
|
|
||||||
env = gym.make("gym_dora/DoraAloha-v0", disable_env_checker=True)
|
|
||||||
obs = env.reset()
|
|
||||||
|
|
||||||
policy = ... # make_policy
|
|
||||||
|
|
||||||
done = False
|
|
||||||
while not done:
|
|
||||||
actions = policy.select_action(obs)
|
|
||||||
observation, reward, terminated, truncated, info = env.step(actions)
|
|
||||||
|
|
||||||
done = terminated | truncated | done
|
|
||||||
|
|
||||||
env.close()
|
|
||||||
@@ -1,17 +0,0 @@
|
|||||||
from gymnasium.envs.registration import register
|
|
||||||
|
|
||||||
register(
|
|
||||||
id="gym_dora/DoraAloha-v0",
|
|
||||||
entry_point="gym_dora.env:DoraEnv",
|
|
||||||
max_episode_steps=300,
|
|
||||||
nondeterministic=True,
|
|
||||||
kwargs={"model": "aloha"},
|
|
||||||
)
|
|
||||||
|
|
||||||
register(
|
|
||||||
id="gym_dora/DoraKoch-v0",
|
|
||||||
entry_point="gym_dora.env:DoraEnv",
|
|
||||||
max_episode_steps=300,
|
|
||||||
nondeterministic=True,
|
|
||||||
kwargs={"model": "koch"},
|
|
||||||
)
|
|
||||||
@@ -1,199 +0,0 @@
|
|||||||
import os
|
|
||||||
|
|
||||||
import gymnasium as gym
|
|
||||||
import numpy as np
|
|
||||||
import pyarrow as pa
|
|
||||||
from dora import Node
|
|
||||||
from gymnasium import spaces
|
|
||||||
|
|
||||||
FPS = int(os.getenv("FPS", "30"))
|
|
||||||
IMAGE_WIDTH = int(os.getenv("IMAGE_WIDTH", "640"))
|
|
||||||
IMAGE_HEIGHT = int(os.getenv("IMAGE_HEIGHT", "480"))
|
|
||||||
|
|
||||||
ALOHA_JOINTS = [
|
|
||||||
# absolute joint position
|
|
||||||
"left_arm_waist",
|
|
||||||
"left_arm_shoulder",
|
|
||||||
"left_arm_elbow",
|
|
||||||
"left_arm_forearm_roll",
|
|
||||||
"left_arm_wrist_angle",
|
|
||||||
"left_arm_wrist_rotate",
|
|
||||||
# normalized gripper position 0: close, 1: open
|
|
||||||
"left_arm_gripper",
|
|
||||||
# absolute joint position
|
|
||||||
"right_arm_waist",
|
|
||||||
"right_arm_shoulder",
|
|
||||||
"right_arm_elbow",
|
|
||||||
"right_arm_forearm_roll",
|
|
||||||
"right_arm_wrist_angle",
|
|
||||||
"right_arm_wrist_rotate",
|
|
||||||
# normalized gripper position 0: close, 1: open
|
|
||||||
"right_arm_gripper",
|
|
||||||
]
|
|
||||||
ALOHA_ACTIONS = [
|
|
||||||
# position and quaternion for end effector
|
|
||||||
"left_arm_waist",
|
|
||||||
"left_arm_shoulder",
|
|
||||||
"left_arm_elbow",
|
|
||||||
"left_arm_forearm_roll",
|
|
||||||
"left_arm_wrist_angle",
|
|
||||||
"left_arm_wrist_rotate",
|
|
||||||
# normalized gripper position (0: close, 1: open)
|
|
||||||
"left_arm_gripper",
|
|
||||||
"right_arm_waist",
|
|
||||||
"right_arm_shoulder",
|
|
||||||
"right_arm_elbow",
|
|
||||||
"right_arm_forearm_roll",
|
|
||||||
"right_arm_wrist_angle",
|
|
||||||
"right_arm_wrist_rotate",
|
|
||||||
# normalized gripper position (0: close, 1: open)
|
|
||||||
"right_arm_gripper",
|
|
||||||
]
|
|
||||||
|
|
||||||
|
|
||||||
class DoraEnv(gym.Env):
|
|
||||||
metadata = {"render_modes": ["rgb_array"], "render_fps": FPS}
|
|
||||||
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
model="aloha",
|
|
||||||
observation_width=IMAGE_WIDTH,
|
|
||||||
observation_height=IMAGE_HEIGHT,
|
|
||||||
cameras_names=None,
|
|
||||||
num_joints=None,
|
|
||||||
num_actions=None,
|
|
||||||
):
|
|
||||||
"""Initializes the Dora environment.
|
|
||||||
|
|
||||||
Args:
|
|
||||||
model (str): The model to use. Either 'aloha' or 'custom'.
|
|
||||||
observation_width (int): The width of the observation image.
|
|
||||||
observation_height (int): The height of the observation image.
|
|
||||||
cameras_names (list): A list of camera names to use. If not provided, the default is ['cam_high', 'cam_low', 'cam_left_wrist', 'cam_right_wrist'].
|
|
||||||
num_joints (int): The number of joints in the model. If not provided, the default is 14 for 'aloha' and 6 for 'fivedof'.
|
|
||||||
num_actions (int): The number of actions in the model. If not provided, the default is 14 for 'aloha' and 6 for 'fivedof'.
|
|
||||||
"""
|
|
||||||
super().__init__()
|
|
||||||
|
|
||||||
# Initialize a new node
|
|
||||||
self.node = Node() if os.environ.get("DORA_NODE_CONFIG", None) is not None else None
|
|
||||||
self.observation = {"pixels": {}, "agent_pos": None}
|
|
||||||
self.terminated = False
|
|
||||||
|
|
||||||
self.observation_height = observation_height
|
|
||||||
self.observation_width = observation_width
|
|
||||||
|
|
||||||
# Observation space
|
|
||||||
if model == "aloha":
|
|
||||||
self.observation_space = spaces.Dict(
|
|
||||||
{
|
|
||||||
"pixels": spaces.Dict(
|
|
||||||
{
|
|
||||||
"cam_high": spaces.Box(
|
|
||||||
low=0,
|
|
||||||
high=255,
|
|
||||||
shape=(self.observation_height, self.observation_width, 3),
|
|
||||||
dtype=np.uint8,
|
|
||||||
),
|
|
||||||
"cam_low": spaces.Box(
|
|
||||||
low=0,
|
|
||||||
high=255,
|
|
||||||
shape=(self.observation_height, self.observation_width, 3),
|
|
||||||
dtype=np.uint8,
|
|
||||||
),
|
|
||||||
"cam_left_wrist": spaces.Box(
|
|
||||||
low=0,
|
|
||||||
high=255,
|
|
||||||
shape=(self.observation_height, self.observation_width, 3),
|
|
||||||
dtype=np.uint8,
|
|
||||||
),
|
|
||||||
"cam_right_wrist": spaces.Box(
|
|
||||||
low=0,
|
|
||||||
high=255,
|
|
||||||
shape=(self.observation_height, self.observation_width, 3),
|
|
||||||
dtype=np.uint8,
|
|
||||||
),
|
|
||||||
}
|
|
||||||
),
|
|
||||||
"agent_pos": spaces.Box(
|
|
||||||
low=-1000.0,
|
|
||||||
high=1000.0,
|
|
||||||
shape=(len(ALOHA_JOINTS),),
|
|
||||||
dtype=np.float64,
|
|
||||||
),
|
|
||||||
}
|
|
||||||
)
|
|
||||||
elif model == "custom":
|
|
||||||
pixel_dict = {}
|
|
||||||
for camera in cameras_names:
|
|
||||||
assert camera.startswith("cam"), "Camera names must start with 'cam'"
|
|
||||||
pixel_dict[camera] = spaces.Box(
|
|
||||||
low=0,
|
|
||||||
high=255,
|
|
||||||
shape=(self.observation_height, self.observation_width, 3),
|
|
||||||
dtype=np.uint8,
|
|
||||||
)
|
|
||||||
self.observation_space = spaces.Dict(
|
|
||||||
{
|
|
||||||
"pixels": spaces.Dict(pixel_dict),
|
|
||||||
"agent_pos": spaces.Box(
|
|
||||||
low=-1000.0,
|
|
||||||
high=1000.0,
|
|
||||||
shape=(num_joints,),
|
|
||||||
dtype=np.float64,
|
|
||||||
),
|
|
||||||
}
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
raise ValueError("Model must be either 'aloha' or 'custom'.")
|
|
||||||
|
|
||||||
# Action space
|
|
||||||
if model == "aloha":
|
|
||||||
self.action_space = spaces.Box(low=-1, high=1, shape=(len(ALOHA_ACTIONS),), dtype=np.float32)
|
|
||||||
elif model == "custom":
|
|
||||||
self.action_space = spaces.Box(low=-1, high=1, shape=(num_actions,), dtype=np.float32)
|
|
||||||
|
|
||||||
def _get_obs(self):
|
|
||||||
while True:
|
|
||||||
event = self.node.next(timeout=0.001)
|
|
||||||
|
|
||||||
## If event is None, the node event stream is closed and we should terminate the env
|
|
||||||
if event is None:
|
|
||||||
self.terminated = True
|
|
||||||
break
|
|
||||||
|
|
||||||
if event["type"] == "INPUT":
|
|
||||||
# Map Image input into pixels key within Aloha environment
|
|
||||||
if "cam" in event["id"]:
|
|
||||||
self.observation["pixels"][event["id"]] = (
|
|
||||||
event["value"].to_numpy().reshape(self.observation_height, self.observation_width, 3)
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
# Map other inputs into the observation dictionary using the event id as key
|
|
||||||
self.observation[event["id"]] = event["value"].to_numpy()
|
|
||||||
|
|
||||||
# If the event is a timeout error break the update loop.
|
|
||||||
elif event["type"] == "ERROR":
|
|
||||||
break
|
|
||||||
|
|
||||||
def reset(self, seed: int | None = None):
|
|
||||||
self.node.send_output("reset")
|
|
||||||
self._get_obs()
|
|
||||||
self.terminated = False
|
|
||||||
info = {}
|
|
||||||
return self.observation, info
|
|
||||||
|
|
||||||
def step(self, action: np.ndarray):
|
|
||||||
# Send the action to the dataflow as action key.
|
|
||||||
self.node.send_output("action", pa.array(action))
|
|
||||||
self._get_obs()
|
|
||||||
reward = 0
|
|
||||||
terminated = truncated = self.terminated
|
|
||||||
info = {}
|
|
||||||
return self.observation, reward, terminated, truncated, info
|
|
||||||
|
|
||||||
def render(self): ...
|
|
||||||
|
|
||||||
def close(self):
|
|
||||||
# Drop the node
|
|
||||||
del self.node
|
|
||||||
182
gym_dora/poetry.lock
generated
182
gym_dora/poetry.lock
generated
@@ -1,182 +0,0 @@
|
|||||||
# This file is automatically @generated by Poetry 1.8.2 and should not be changed by hand.
|
|
||||||
|
|
||||||
[[package]]
|
|
||||||
name = "cloudpickle"
|
|
||||||
version = "3.0.0"
|
|
||||||
description = "Pickler class to extend the standard pickle.Pickler functionality"
|
|
||||||
optional = false
|
|
||||||
python-versions = ">=3.8"
|
|
||||||
files = [
|
|
||||||
{file = "cloudpickle-3.0.0-py3-none-any.whl", hash = "sha256:246ee7d0c295602a036e86369c77fecda4ab17b506496730f2f576d9016fd9c7"},
|
|
||||||
{file = "cloudpickle-3.0.0.tar.gz", hash = "sha256:996d9a482c6fb4f33c1a35335cf8afd065d2a56e973270364840712d9131a882"},
|
|
||||||
]
|
|
||||||
|
|
||||||
[[package]]
|
|
||||||
name = "dora-rs"
|
|
||||||
version = "0.3.4"
|
|
||||||
description = "`dora` goal is to be a low latency, composable, and distributed data flow."
|
|
||||||
optional = false
|
|
||||||
python-versions = "*"
|
|
||||||
files = [
|
|
||||||
{file = "dora_rs-0.3.4-cp37-abi3-macosx_10_12_x86_64.whl", hash = "sha256:d1b738eea5a4966d731c26c6b6a0a50a491a24f7e9e335475f983cfc6f0da19e"},
|
|
||||||
{file = "dora_rs-0.3.4-cp37-abi3-macosx_11_0_arm64.whl", hash = "sha256:80b724871618c78a4e5863938fa66724176cc40352771087aebe1e62a8141157"},
|
|
||||||
{file = "dora_rs-0.3.4-cp37-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3a3919e157b47dc1dbc74c040a73087a4485f0d1bee99b6adcdbc36559400fe2"},
|
|
||||||
{file = "dora_rs-0.3.4-cp37-abi3-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f7c95f6e5858fd651d6cd220e4f052e99db2944b9c37fb0b5402d60ac4b41a63"},
|
|
||||||
{file = "dora_rs-0.3.4-cp37-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:37d915fbbca282446235c98a9ca08389aa3ef3155d4e88c6c136326e9a830042"},
|
|
||||||
{file = "dora_rs-0.3.4-cp37-abi3-win32.whl", hash = "sha256:c9f7f22f65c884ec9bee0245ce98d0c7fad25dec0f982e566f844b5e8e58818f"},
|
|
||||||
{file = "dora_rs-0.3.4-cp37-abi3-win_amd64.whl", hash = "sha256:0a6a37f96a9f6e13b58b02a6ea75af192af5fbe4f456f6a67b1f239c3cee3276"},
|
|
||||||
{file = "dora_rs-0.3.4.tar.gz", hash = "sha256:05c5d0db0d23d7c4669995ae34db11cd636dbf91f5705d832669bd04e7452903"},
|
|
||||||
]
|
|
||||||
|
|
||||||
[package.dependencies]
|
|
||||||
pyarrow = "*"
|
|
||||||
|
|
||||||
[[package]]
|
|
||||||
name = "farama-notifications"
|
|
||||||
version = "0.0.4"
|
|
||||||
description = "Notifications for all Farama Foundation maintained libraries."
|
|
||||||
optional = false
|
|
||||||
python-versions = "*"
|
|
||||||
files = [
|
|
||||||
{file = "Farama-Notifications-0.0.4.tar.gz", hash = "sha256:13fceff2d14314cf80703c8266462ebf3733c7d165336eee998fc58e545efd18"},
|
|
||||||
{file = "Farama_Notifications-0.0.4-py3-none-any.whl", hash = "sha256:14de931035a41961f7c056361dc7f980762a143d05791ef5794a751a2caf05ae"},
|
|
||||||
]
|
|
||||||
|
|
||||||
[[package]]
|
|
||||||
name = "gymnasium"
|
|
||||||
version = "0.29.1"
|
|
||||||
description = "A standard API for reinforcement learning and a diverse set of reference environments (formerly Gym)."
|
|
||||||
optional = false
|
|
||||||
python-versions = ">=3.8"
|
|
||||||
files = [
|
|
||||||
{file = "gymnasium-0.29.1-py3-none-any.whl", hash = "sha256:61c3384b5575985bb7f85e43213bcb40f36fcdff388cae6bc229304c71f2843e"},
|
|
||||||
{file = "gymnasium-0.29.1.tar.gz", hash = "sha256:1a532752efcb7590478b1cc7aa04f608eb7a2fdad5570cd217b66b6a35274bb1"},
|
|
||||||
]
|
|
||||||
|
|
||||||
[package.dependencies]
|
|
||||||
cloudpickle = ">=1.2.0"
|
|
||||||
farama-notifications = ">=0.0.1"
|
|
||||||
numpy = ">=1.21.0"
|
|
||||||
typing-extensions = ">=4.3.0"
|
|
||||||
|
|
||||||
[package.extras]
|
|
||||||
accept-rom-license = ["autorom[accept-rom-license] (>=0.4.2,<0.5.0)"]
|
|
||||||
all = ["box2d-py (==2.3.5)", "cython (<3)", "imageio (>=2.14.1)", "jax (>=0.4.0)", "jaxlib (>=0.4.0)", "lz4 (>=3.1.0)", "matplotlib (>=3.0)", "moviepy (>=1.0.0)", "mujoco (>=2.3.3)", "mujoco-py (>=2.1,<2.2)", "opencv-python (>=3.0)", "pygame (>=2.1.3)", "shimmy[atari] (>=0.1.0,<1.0)", "swig (==4.*)", "torch (>=1.0.0)"]
|
|
||||||
atari = ["shimmy[atari] (>=0.1.0,<1.0)"]
|
|
||||||
box2d = ["box2d-py (==2.3.5)", "pygame (>=2.1.3)", "swig (==4.*)"]
|
|
||||||
classic-control = ["pygame (>=2.1.3)", "pygame (>=2.1.3)"]
|
|
||||||
jax = ["jax (>=0.4.0)", "jaxlib (>=0.4.0)"]
|
|
||||||
mujoco = ["imageio (>=2.14.1)", "mujoco (>=2.3.3)"]
|
|
||||||
mujoco-py = ["cython (<3)", "cython (<3)", "mujoco-py (>=2.1,<2.2)", "mujoco-py (>=2.1,<2.2)"]
|
|
||||||
other = ["lz4 (>=3.1.0)", "matplotlib (>=3.0)", "moviepy (>=1.0.0)", "opencv-python (>=3.0)", "torch (>=1.0.0)"]
|
|
||||||
testing = ["pytest (==7.1.3)", "scipy (>=1.7.3)"]
|
|
||||||
toy-text = ["pygame (>=2.1.3)", "pygame (>=2.1.3)"]
|
|
||||||
|
|
||||||
[[package]]
|
|
||||||
name = "numpy"
|
|
||||||
version = "1.26.4"
|
|
||||||
description = "Fundamental package for array computing in Python"
|
|
||||||
optional = false
|
|
||||||
python-versions = ">=3.9"
|
|
||||||
files = [
|
|
||||||
{file = "numpy-1.26.4-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:9ff0f4f29c51e2803569d7a51c2304de5554655a60c5d776e35b4a41413830d0"},
|
|
||||||
{file = "numpy-1.26.4-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:2e4ee3380d6de9c9ec04745830fd9e2eccb3e6cf790d39d7b98ffd19b0dd754a"},
|
|
||||||
{file = "numpy-1.26.4-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d209d8969599b27ad20994c8e41936ee0964e6da07478d6c35016bc386b66ad4"},
|
|
||||||
{file = "numpy-1.26.4-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ffa75af20b44f8dba823498024771d5ac50620e6915abac414251bd971b4529f"},
|
|
||||||
{file = "numpy-1.26.4-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:62b8e4b1e28009ef2846b4c7852046736bab361f7aeadeb6a5b89ebec3c7055a"},
|
|
||||||
{file = "numpy-1.26.4-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:a4abb4f9001ad2858e7ac189089c42178fcce737e4169dc61321660f1a96c7d2"},
|
|
||||||
{file = "numpy-1.26.4-cp310-cp310-win32.whl", hash = "sha256:bfe25acf8b437eb2a8b2d49d443800a5f18508cd811fea3181723922a8a82b07"},
|
|
||||||
{file = "numpy-1.26.4-cp310-cp310-win_amd64.whl", hash = "sha256:b97fe8060236edf3662adfc2c633f56a08ae30560c56310562cb4f95500022d5"},
|
|
||||||
{file = "numpy-1.26.4-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:4c66707fabe114439db9068ee468c26bbdf909cac0fb58686a42a24de1760c71"},
|
|
||||||
{file = "numpy-1.26.4-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:edd8b5fe47dab091176d21bb6de568acdd906d1887a4584a15a9a96a1dca06ef"},
|
|
||||||
{file = "numpy-1.26.4-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:7ab55401287bfec946ced39700c053796e7cc0e3acbef09993a9ad2adba6ca6e"},
|
|
||||||
{file = "numpy-1.26.4-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:666dbfb6ec68962c033a450943ded891bed2d54e6755e35e5835d63f4f6931d5"},
|
|
||||||
{file = "numpy-1.26.4-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:96ff0b2ad353d8f990b63294c8986f1ec3cb19d749234014f4e7eb0112ceba5a"},
|
|
||||||
{file = "numpy-1.26.4-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:60dedbb91afcbfdc9bc0b1f3f402804070deed7392c23eb7a7f07fa857868e8a"},
|
|
||||||
{file = "numpy-1.26.4-cp311-cp311-win32.whl", hash = "sha256:1af303d6b2210eb850fcf03064d364652b7120803a0b872f5211f5234b399f20"},
|
|
||||||
{file = "numpy-1.26.4-cp311-cp311-win_amd64.whl", hash = "sha256:cd25bcecc4974d09257ffcd1f098ee778f7834c3ad767fe5db785be9a4aa9cb2"},
|
|
||||||
{file = "numpy-1.26.4-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:b3ce300f3644fb06443ee2222c2201dd3a89ea6040541412b8fa189341847218"},
|
|
||||||
{file = "numpy-1.26.4-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:03a8c78d01d9781b28a6989f6fa1bb2c4f2d51201cf99d3dd875df6fbd96b23b"},
|
|
||||||
{file = "numpy-1.26.4-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9fad7dcb1aac3c7f0584a5a8133e3a43eeb2fe127f47e3632d43d677c66c102b"},
|
|
||||||
{file = "numpy-1.26.4-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:675d61ffbfa78604709862923189bad94014bef562cc35cf61d3a07bba02a7ed"},
|
|
||||||
{file = "numpy-1.26.4-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:ab47dbe5cc8210f55aa58e4805fe224dac469cde56b9f731a4c098b91917159a"},
|
|
||||||
{file = "numpy-1.26.4-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:1dda2e7b4ec9dd512f84935c5f126c8bd8b9f2fc001e9f54af255e8c5f16b0e0"},
|
|
||||||
{file = "numpy-1.26.4-cp312-cp312-win32.whl", hash = "sha256:50193e430acfc1346175fcbdaa28ffec49947a06918b7b92130744e81e640110"},
|
|
||||||
{file = "numpy-1.26.4-cp312-cp312-win_amd64.whl", hash = "sha256:08beddf13648eb95f8d867350f6a018a4be2e5ad54c8d8caed89ebca558b2818"},
|
|
||||||
{file = "numpy-1.26.4-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:7349ab0fa0c429c82442a27a9673fc802ffdb7c7775fad780226cb234965e53c"},
|
|
||||||
{file = "numpy-1.26.4-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:52b8b60467cd7dd1e9ed082188b4e6bb35aa5cdd01777621a1658910745b90be"},
|
|
||||||
{file = "numpy-1.26.4-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d5241e0a80d808d70546c697135da2c613f30e28251ff8307eb72ba696945764"},
|
|
||||||
{file = "numpy-1.26.4-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f870204a840a60da0b12273ef34f7051e98c3b5961b61b0c2c1be6dfd64fbcd3"},
|
|
||||||
{file = "numpy-1.26.4-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:679b0076f67ecc0138fd2ede3a8fd196dddc2ad3254069bcb9faf9a79b1cebcd"},
|
|
||||||
{file = "numpy-1.26.4-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:47711010ad8555514b434df65f7d7b076bb8261df1ca9bb78f53d3b2db02e95c"},
|
|
||||||
{file = "numpy-1.26.4-cp39-cp39-win32.whl", hash = "sha256:a354325ee03388678242a4d7ebcd08b5c727033fcff3b2f536aea978e15ee9e6"},
|
|
||||||
{file = "numpy-1.26.4-cp39-cp39-win_amd64.whl", hash = "sha256:3373d5d70a5fe74a2c1bb6d2cfd9609ecf686d47a2d7b1d37a8f3b6bf6003aea"},
|
|
||||||
{file = "numpy-1.26.4-pp39-pypy39_pp73-macosx_10_9_x86_64.whl", hash = "sha256:afedb719a9dcfc7eaf2287b839d8198e06dcd4cb5d276a3df279231138e83d30"},
|
|
||||||
{file = "numpy-1.26.4-pp39-pypy39_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:95a7476c59002f2f6c590b9b7b998306fba6a5aa646b1e22ddfeaf8f78c3a29c"},
|
|
||||||
{file = "numpy-1.26.4-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:7e50d0a0cc3189f9cb0aeb3a6a6af18c16f59f004b866cd2be1c14b36134a4a0"},
|
|
||||||
{file = "numpy-1.26.4.tar.gz", hash = "sha256:2a02aba9ed12e4ac4eb3ea9421c420301a0c6460d9830d74a9df87efa4912010"},
|
|
||||||
]
|
|
||||||
|
|
||||||
[[package]]
|
|
||||||
name = "pyarrow"
|
|
||||||
version = "16.1.0"
|
|
||||||
description = "Python library for Apache Arrow"
|
|
||||||
optional = false
|
|
||||||
python-versions = ">=3.8"
|
|
||||||
files = [
|
|
||||||
{file = "pyarrow-16.1.0-cp310-cp310-macosx_10_15_x86_64.whl", hash = "sha256:17e23b9a65a70cc733d8b738baa6ad3722298fa0c81d88f63ff94bf25eaa77b9"},
|
|
||||||
{file = "pyarrow-16.1.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:4740cc41e2ba5d641071d0ab5e9ef9b5e6e8c7611351a5cb7c1d175eaf43674a"},
|
|
||||||
{file = "pyarrow-16.1.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:98100e0268d04e0eec47b73f20b39c45b4006f3c4233719c3848aa27a03c1aef"},
|
|
||||||
{file = "pyarrow-16.1.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f68f409e7b283c085f2da014f9ef81e885d90dcd733bd648cfba3ef265961848"},
|
|
||||||
{file = "pyarrow-16.1.0-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:a8914cd176f448e09746037b0c6b3a9d7688cef451ec5735094055116857580c"},
|
|
||||||
{file = "pyarrow-16.1.0-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:48be160782c0556156d91adbdd5a4a7e719f8d407cb46ae3bb4eaee09b3111bd"},
|
|
||||||
{file = "pyarrow-16.1.0-cp310-cp310-win_amd64.whl", hash = "sha256:9cf389d444b0f41d9fe1444b70650fea31e9d52cfcb5f818b7888b91b586efff"},
|
|
||||||
{file = "pyarrow-16.1.0-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:d0ebea336b535b37eee9eee31761813086d33ed06de9ab6fc6aaa0bace7b250c"},
|
|
||||||
{file = "pyarrow-16.1.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:2e73cfc4a99e796727919c5541c65bb88b973377501e39b9842ea71401ca6c1c"},
|
|
||||||
{file = "pyarrow-16.1.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:bf9251264247ecfe93e5f5a0cd43b8ae834f1e61d1abca22da55b20c788417f6"},
|
|
||||||
{file = "pyarrow-16.1.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ddf5aace92d520d3d2a20031d8b0ec27b4395cab9f74e07cc95edf42a5cc0147"},
|
|
||||||
{file = "pyarrow-16.1.0-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:25233642583bf658f629eb230b9bb79d9af4d9f9229890b3c878699c82f7d11e"},
|
|
||||||
{file = "pyarrow-16.1.0-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:a33a64576fddfbec0a44112eaf844c20853647ca833e9a647bfae0582b2ff94b"},
|
|
||||||
{file = "pyarrow-16.1.0-cp311-cp311-win_amd64.whl", hash = "sha256:185d121b50836379fe012753cf15c4ba9638bda9645183ab36246923875f8d1b"},
|
|
||||||
{file = "pyarrow-16.1.0-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:2e51ca1d6ed7f2e9d5c3c83decf27b0d17bb207a7dea986e8dc3e24f80ff7d6f"},
|
|
||||||
{file = "pyarrow-16.1.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:06ebccb6f8cb7357de85f60d5da50e83507954af617d7b05f48af1621d331c9a"},
|
|
||||||
{file = "pyarrow-16.1.0-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b04707f1979815f5e49824ce52d1dceb46e2f12909a48a6a753fe7cafbc44a0c"},
|
|
||||||
{file = "pyarrow-16.1.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0d32000693deff8dc5df444b032b5985a48592c0697cb6e3071a5d59888714e2"},
|
|
||||||
{file = "pyarrow-16.1.0-cp312-cp312-manylinux_2_28_aarch64.whl", hash = "sha256:8785bb10d5d6fd5e15d718ee1d1f914fe768bf8b4d1e5e9bf253de8a26cb1628"},
|
|
||||||
{file = "pyarrow-16.1.0-cp312-cp312-manylinux_2_28_x86_64.whl", hash = "sha256:e1369af39587b794873b8a307cc6623a3b1194e69399af0efd05bb202195a5a7"},
|
|
||||||
{file = "pyarrow-16.1.0-cp312-cp312-win_amd64.whl", hash = "sha256:febde33305f1498f6df85e8020bca496d0e9ebf2093bab9e0f65e2b4ae2b3444"},
|
|
||||||
{file = "pyarrow-16.1.0-cp38-cp38-macosx_10_15_x86_64.whl", hash = "sha256:b5f5705ab977947a43ac83b52ade3b881eb6e95fcc02d76f501d549a210ba77f"},
|
|
||||||
{file = "pyarrow-16.1.0-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:0d27bf89dfc2576f6206e9cd6cf7a107c9c06dc13d53bbc25b0bd4556f19cf5f"},
|
|
||||||
{file = "pyarrow-16.1.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0d07de3ee730647a600037bc1d7b7994067ed64d0eba797ac74b2bc77384f4c2"},
|
|
||||||
{file = "pyarrow-16.1.0-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:fbef391b63f708e103df99fbaa3acf9f671d77a183a07546ba2f2c297b361e83"},
|
|
||||||
{file = "pyarrow-16.1.0-cp38-cp38-manylinux_2_28_aarch64.whl", hash = "sha256:19741c4dbbbc986d38856ee7ddfdd6a00fc3b0fc2d928795b95410d38bb97d15"},
|
|
||||||
{file = "pyarrow-16.1.0-cp38-cp38-manylinux_2_28_x86_64.whl", hash = "sha256:f2c5fb249caa17b94e2b9278b36a05ce03d3180e6da0c4c3b3ce5b2788f30eed"},
|
|
||||||
{file = "pyarrow-16.1.0-cp38-cp38-win_amd64.whl", hash = "sha256:e6b6d3cd35fbb93b70ade1336022cc1147b95ec6af7d36906ca7fe432eb09710"},
|
|
||||||
{file = "pyarrow-16.1.0-cp39-cp39-macosx_10_15_x86_64.whl", hash = "sha256:18da9b76a36a954665ccca8aa6bd9f46c1145f79c0bb8f4f244f5f8e799bca55"},
|
|
||||||
{file = "pyarrow-16.1.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:99f7549779b6e434467d2aa43ab2b7224dd9e41bdde486020bae198978c9e05e"},
|
|
||||||
{file = "pyarrow-16.1.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:f07fdffe4fd5b15f5ec15c8b64584868d063bc22b86b46c9695624ca3505b7b4"},
|
|
||||||
{file = "pyarrow-16.1.0-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ddfe389a08ea374972bd4065d5f25d14e36b43ebc22fc75f7b951f24378bf0b5"},
|
|
||||||
{file = "pyarrow-16.1.0-cp39-cp39-manylinux_2_28_aarch64.whl", hash = "sha256:3b20bd67c94b3a2ea0a749d2a5712fc845a69cb5d52e78e6449bbd295611f3aa"},
|
|
||||||
{file = "pyarrow-16.1.0-cp39-cp39-manylinux_2_28_x86_64.whl", hash = "sha256:ba8ac20693c0bb0bf4b238751d4409e62852004a8cf031c73b0e0962b03e45e3"},
|
|
||||||
{file = "pyarrow-16.1.0-cp39-cp39-win_amd64.whl", hash = "sha256:31a1851751433d89a986616015841977e0a188662fcffd1a5677453f1df2de0a"},
|
|
||||||
{file = "pyarrow-16.1.0.tar.gz", hash = "sha256:15fbb22ea96d11f0b5768504a3f961edab25eaf4197c341720c4a387f6c60315"},
|
|
||||||
]
|
|
||||||
|
|
||||||
[package.dependencies]
|
|
||||||
numpy = ">=1.16.6"
|
|
||||||
|
|
||||||
[[package]]
|
|
||||||
name = "typing-extensions"
|
|
||||||
version = "4.11.0"
|
|
||||||
description = "Backported and Experimental Type Hints for Python 3.8+"
|
|
||||||
optional = false
|
|
||||||
python-versions = ">=3.8"
|
|
||||||
files = [
|
|
||||||
{file = "typing_extensions-4.11.0-py3-none-any.whl", hash = "sha256:c1f94d72897edaf4ce775bb7558d5b79d8126906a14ea5ed1635921406c0387a"},
|
|
||||||
{file = "typing_extensions-4.11.0.tar.gz", hash = "sha256:83f085bd5ca59c80295fc2a82ab5dac679cbe02b9f33f7d83af68e241bea51b0"},
|
|
||||||
]
|
|
||||||
|
|
||||||
[metadata]
|
|
||||||
lock-version = "2.0"
|
|
||||||
python-versions = "^3.10"
|
|
||||||
content-hash = "7e437b5c547ebe11095f1ce4ff1851d636f8e707ad7de8a6224b0f9ad978240f"
|
|
||||||
@@ -1,17 +0,0 @@
|
|||||||
[tool.poetry]
|
|
||||||
name = "gym-dora"
|
|
||||||
version = "0.1.0"
|
|
||||||
description = ""
|
|
||||||
authors = ["Simon Alibert <alibert.sim@gmail.com>"]
|
|
||||||
readme = "README.md"
|
|
||||||
packages = [{ include = "gym_dora" }]
|
|
||||||
|
|
||||||
[tool.poetry.dependencies]
|
|
||||||
python = "^3.10"
|
|
||||||
gymnasium = ">=0.29.1"
|
|
||||||
dora-rs = ">=0.3.4"
|
|
||||||
pyarrow = ">=12.0.0"
|
|
||||||
|
|
||||||
[build-system]
|
|
||||||
requires = ["poetry-core"]
|
|
||||||
build-backend = "poetry.core.masonry.api"
|
|
||||||
@@ -27,6 +27,9 @@ Example:
|
|||||||
print(lerobot.available_real_world_datasets)
|
print(lerobot.available_real_world_datasets)
|
||||||
print(lerobot.available_policies)
|
print(lerobot.available_policies)
|
||||||
print(lerobot.available_policies_per_env)
|
print(lerobot.available_policies_per_env)
|
||||||
|
print(lerobot.available_robots)
|
||||||
|
print(lerobot.available_cameras)
|
||||||
|
print(lerobot.available_motors)
|
||||||
```
|
```
|
||||||
|
|
||||||
When implementing a new dataset loadable with LeRobotDataset follow these steps:
|
When implementing a new dataset loadable with LeRobotDataset follow these steps:
|
||||||
@@ -45,6 +48,9 @@ import itertools
|
|||||||
|
|
||||||
from lerobot.__version__ import __version__ # noqa: F401
|
from lerobot.__version__ import __version__ # noqa: F401
|
||||||
|
|
||||||
|
# TODO(rcadene): Improve policies and envs. As of now, an item in `available_policies`
|
||||||
|
# refers to a yaml file AND a modeling name. Same for `available_envs` which refers to
|
||||||
|
# a yaml file AND a environment name. The difference should be more obvious.
|
||||||
available_tasks_per_env = {
|
available_tasks_per_env = {
|
||||||
"aloha": [
|
"aloha": [
|
||||||
"AlohaInsertion-v0",
|
"AlohaInsertion-v0",
|
||||||
@@ -52,6 +58,7 @@ available_tasks_per_env = {
|
|||||||
],
|
],
|
||||||
"pusht": ["PushT-v0"],
|
"pusht": ["PushT-v0"],
|
||||||
"xarm": ["XarmLift-v0"],
|
"xarm": ["XarmLift-v0"],
|
||||||
|
"dora_aloha_real": ["DoraAloha-v0", "DoraKoch-v0", "DoraReachy2-v0"],
|
||||||
}
|
}
|
||||||
available_envs = list(available_tasks_per_env.keys())
|
available_envs = list(available_tasks_per_env.keys())
|
||||||
|
|
||||||
@@ -66,6 +73,8 @@ available_datasets_per_env = {
|
|||||||
"lerobot/aloha_sim_transfer_cube_human_image",
|
"lerobot/aloha_sim_transfer_cube_human_image",
|
||||||
"lerobot/aloha_sim_transfer_cube_scripted_image",
|
"lerobot/aloha_sim_transfer_cube_scripted_image",
|
||||||
],
|
],
|
||||||
|
# TODO(alexander-soare): Add "lerobot/pusht_keypoints". Right now we can't because this is too tightly
|
||||||
|
# coupled with tests.
|
||||||
"pusht": ["lerobot/pusht", "lerobot/pusht_image"],
|
"pusht": ["lerobot/pusht", "lerobot/pusht_image"],
|
||||||
"xarm": [
|
"xarm": [
|
||||||
"lerobot/xarm_lift_medium",
|
"lerobot/xarm_lift_medium",
|
||||||
@@ -77,6 +86,23 @@ available_datasets_per_env = {
|
|||||||
"lerobot/xarm_push_medium_image",
|
"lerobot/xarm_push_medium_image",
|
||||||
"lerobot/xarm_push_medium_replay_image",
|
"lerobot/xarm_push_medium_replay_image",
|
||||||
],
|
],
|
||||||
|
"dora_aloha_real": [
|
||||||
|
"lerobot/aloha_static_battery",
|
||||||
|
"lerobot/aloha_static_candy",
|
||||||
|
"lerobot/aloha_static_coffee",
|
||||||
|
"lerobot/aloha_static_coffee_new",
|
||||||
|
"lerobot/aloha_static_cups_open",
|
||||||
|
"lerobot/aloha_static_fork_pick_up",
|
||||||
|
"lerobot/aloha_static_pingpong_test",
|
||||||
|
"lerobot/aloha_static_pro_pencil",
|
||||||
|
"lerobot/aloha_static_screw_driver",
|
||||||
|
"lerobot/aloha_static_tape",
|
||||||
|
"lerobot/aloha_static_thread_velcro",
|
||||||
|
"lerobot/aloha_static_towel",
|
||||||
|
"lerobot/aloha_static_vinh_cup",
|
||||||
|
"lerobot/aloha_static_vinh_cup_left",
|
||||||
|
"lerobot/aloha_static_ziploc_slide",
|
||||||
|
],
|
||||||
}
|
}
|
||||||
|
|
||||||
available_real_world_datasets = [
|
available_real_world_datasets = [
|
||||||
@@ -102,22 +128,100 @@ available_real_world_datasets = [
|
|||||||
"lerobot/aloha_static_vinh_cup_left",
|
"lerobot/aloha_static_vinh_cup_left",
|
||||||
"lerobot/aloha_static_ziploc_slide",
|
"lerobot/aloha_static_ziploc_slide",
|
||||||
"lerobot/umi_cup_in_the_wild",
|
"lerobot/umi_cup_in_the_wild",
|
||||||
|
"lerobot/unitreeh1_fold_clothes",
|
||||||
|
"lerobot/unitreeh1_rearrange_objects",
|
||||||
|
"lerobot/unitreeh1_two_robot_greeting",
|
||||||
|
"lerobot/unitreeh1_warehouse",
|
||||||
|
"lerobot/nyu_rot_dataset",
|
||||||
|
"lerobot/utokyo_saytap",
|
||||||
|
"lerobot/imperialcollege_sawyer_wrist_cam",
|
||||||
|
"lerobot/utokyo_xarm_bimanual",
|
||||||
|
"lerobot/tokyo_u_lsmo",
|
||||||
|
"lerobot/utokyo_pr2_opening_fridge",
|
||||||
|
"lerobot/cmu_franka_exploration_dataset",
|
||||||
|
"lerobot/cmu_stretch",
|
||||||
|
"lerobot/asu_table_top",
|
||||||
|
"lerobot/utokyo_pr2_tabletop_manipulation",
|
||||||
|
"lerobot/utokyo_xarm_pick_and_place",
|
||||||
|
"lerobot/ucsd_kitchen_dataset",
|
||||||
|
"lerobot/austin_buds_dataset",
|
||||||
|
"lerobot/dlr_sara_grid_clamp",
|
||||||
|
"lerobot/conq_hose_manipulation",
|
||||||
|
"lerobot/columbia_cairlab_pusht_real",
|
||||||
|
"lerobot/dlr_sara_pour",
|
||||||
|
"lerobot/dlr_edan_shared_control",
|
||||||
|
"lerobot/ucsd_pick_and_place_dataset",
|
||||||
|
"lerobot/berkeley_cable_routing",
|
||||||
|
"lerobot/nyu_franka_play_dataset",
|
||||||
|
"lerobot/austin_sirius_dataset",
|
||||||
|
"lerobot/cmu_play_fusion",
|
||||||
|
"lerobot/berkeley_gnm_sac_son",
|
||||||
|
"lerobot/nyu_door_opening_surprising_effectiveness",
|
||||||
|
"lerobot/berkeley_fanuc_manipulation",
|
||||||
|
"lerobot/jaco_play",
|
||||||
|
"lerobot/viola",
|
||||||
|
"lerobot/kaist_nonprehensile",
|
||||||
|
"lerobot/berkeley_mvp",
|
||||||
|
"lerobot/uiuc_d3field",
|
||||||
|
"lerobot/berkeley_gnm_recon",
|
||||||
|
"lerobot/austin_sailor_dataset",
|
||||||
|
"lerobot/utaustin_mutex",
|
||||||
|
"lerobot/roboturk",
|
||||||
|
"lerobot/stanford_hydra_dataset",
|
||||||
|
"lerobot/berkeley_autolab_ur5",
|
||||||
|
"lerobot/stanford_robocook",
|
||||||
|
"lerobot/toto",
|
||||||
|
"lerobot/fmb",
|
||||||
|
"lerobot/droid_100",
|
||||||
|
"lerobot/berkeley_rpt",
|
||||||
|
"lerobot/stanford_kuka_multimodal_dataset",
|
||||||
|
"lerobot/iamlab_cmu_pickup_insert",
|
||||||
|
"lerobot/taco_play",
|
||||||
|
"lerobot/berkeley_gnm_cory_hall",
|
||||||
|
"lerobot/usc_cloth_sim",
|
||||||
]
|
]
|
||||||
|
|
||||||
available_datasets = list(
|
available_datasets = sorted(
|
||||||
itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets)
|
set(itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets))
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# lists all available policies from `lerobot/common/policies`
|
||||||
available_policies = [
|
available_policies = [
|
||||||
"act",
|
"act",
|
||||||
"diffusion",
|
"diffusion",
|
||||||
"tdmpc",
|
"tdmpc",
|
||||||
|
"vqbet",
|
||||||
]
|
]
|
||||||
|
|
||||||
|
# lists all available robots from `lerobot/common/robot_devices/robots`
|
||||||
|
available_robots = [
|
||||||
|
"koch",
|
||||||
|
"koch_bimanual",
|
||||||
|
"aloha",
|
||||||
|
"so100",
|
||||||
|
"moss",
|
||||||
|
]
|
||||||
|
|
||||||
|
# lists all available cameras from `lerobot/common/robot_devices/cameras`
|
||||||
|
available_cameras = [
|
||||||
|
"opencv",
|
||||||
|
"intelrealsense",
|
||||||
|
]
|
||||||
|
|
||||||
|
# lists all available motors from `lerobot/common/robot_devices/motors`
|
||||||
|
available_motors = [
|
||||||
|
"dynamixel",
|
||||||
|
"feetech",
|
||||||
|
]
|
||||||
|
|
||||||
|
# keys and values refer to yaml files
|
||||||
available_policies_per_env = {
|
available_policies_per_env = {
|
||||||
"aloha": ["act"],
|
"aloha": ["act"],
|
||||||
"pusht": ["diffusion"],
|
"pusht": ["diffusion", "vqbet"],
|
||||||
"xarm": ["tdmpc"],
|
"xarm": ["tdmpc"],
|
||||||
|
"koch_real": ["act_koch_real"],
|
||||||
|
"aloha_real": ["act_aloha_real"],
|
||||||
|
"dora_aloha_real": ["act_aloha_real"],
|
||||||
}
|
}
|
||||||
|
|
||||||
env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
|
env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
|
||||||
|
|||||||
@@ -1,334 +0,0 @@
|
|||||||
# Video benchmark
|
|
||||||
|
|
||||||
|
|
||||||
## Questions
|
|
||||||
|
|
||||||
What is the optimal trade-off between:
|
|
||||||
- maximizing loading time with random access,
|
|
||||||
- minimizing memory space on disk,
|
|
||||||
- maximizing success rate of policies?
|
|
||||||
|
|
||||||
How to encode videos?
|
|
||||||
- How much compression (`-crf`)? Low compression with `0`, normal compression with `20` or extreme with `56`?
|
|
||||||
- What pixel format to use (`-pix_fmt`)? `yuv444p` or `yuv420p`?
|
|
||||||
- How many key frames (`-g`)? A key frame every `10` frames?
|
|
||||||
|
|
||||||
How to decode videos?
|
|
||||||
- Which `decoder`? `torchvision`, `torchaudio`, `ffmpegio`, `decord`, or `nvc`?
|
|
||||||
|
|
||||||
## Metrics
|
|
||||||
|
|
||||||
**Percentage of data compression (higher is better)**
|
|
||||||
`compression_factor` is the ratio of the memory space on disk taken by the original images to encode, to the memory space taken by the encoded video. For instance, `compression_factor=4` means that the video takes 4 times less memory space on disk compared to the original images.
|
|
||||||
|
|
||||||
**Percentage of loading time (higher is better)**
|
|
||||||
`load_time_factor` is the ratio of the time it takes to load original images at given timestamps, to the time it takes to decode the exact same frames from the video. Higher is better. For instance, `load_time_factor=0.5` means that decoding from video is 2 times slower than loading the original images.
|
|
||||||
|
|
||||||
**Average L2 error per pixel (lower is better)**
|
|
||||||
`avg_per_pixel_l2_error` is the average L2 error between each decoded frame and its corresponding original image over all requested timestamps, and also divided by the number of pixels in the image to be comparable when switching to different image sizes.
|
|
||||||
|
|
||||||
**Loss of a pretrained policy (higher is better)** (not available)
|
|
||||||
`loss_pretrained` is the result of evaluating with the selected encoding/decoding settings a policy pretrained on original images. It is easier to understand than `avg_l2_error`.
|
|
||||||
|
|
||||||
**Success rate after retraining (higher is better)** (not available)
|
|
||||||
`success_rate` is the result of training and evaluating a policy with the selected encoding/decoding settings. It is the most difficult metric to get but also the very best.
|
|
||||||
|
|
||||||
|
|
||||||
## Variables
|
|
||||||
|
|
||||||
**Image content**
|
|
||||||
We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an appartment, or in a factory, or outdoor, etc. Hence, we run this benchmark on two datasets: `pusht` (simulation) and `umi` (real-world outdoor).
|
|
||||||
|
|
||||||
**Requested timestamps**
|
|
||||||
In this benchmark, we focus on the loading time of random access, so we are not interested in sequentially loading all frames of a video like in a movie. However, the number of consecutive timestamps requested and their spacing can greatly affect the `load_time_factor`. In fact, it is expected to get faster loading time by decoding a large number of consecutive frames from a video, than to load the same data from individual images. To reflect our robotics use case, we consider a few settings:
|
|
||||||
- `single_frame`: 1 frame,
|
|
||||||
- `2_frames`: 2 consecutive frames (e.g. `[t, t + 1 / fps]`),
|
|
||||||
- `2_frames_4_space`: 2 consecutive frames with 4 frames of spacing (e.g `[t, t + 4 / fps]`),
|
|
||||||
|
|
||||||
**Data augmentations**
|
|
||||||
We might revisit this benchmark and find better settings if we train our policies with various data augmentations to make them more robust (e.g. robust to color changes, compression, etc.).
|
|
||||||
|
|
||||||
|
|
||||||
## Results
|
|
||||||
|
|
||||||
**`decoder`**
|
|
||||||
| repo_id | decoder | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | <span style="color: #32CD32;">torchvision</span> | 0.166 | 0.0000119 |
|
|
||||||
| lerobot/pusht | ffmpegio | 0.009 | 0.0001182 |
|
|
||||||
| lerobot/pusht | torchaudio | 0.138 | 0.0000359 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | <span style="color: #32CD32;">torchvision</span> | 0.174 | 0.0000174 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | ffmpegio | 0.010 | 0.0000735 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | torchaudio | 0.154 | 0.0000340 |
|
|
||||||
|
|
||||||
### `1_frame`
|
|
||||||
|
|
||||||
**`pix_fmt`**
|
|
||||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | yuv420p | 3.788 | 0.224 | 0.0000760 |
|
|
||||||
| lerobot/pusht | yuv444p | 3.646 | 0.185 | 0.0000443 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.388 | 0.0000469 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.329 | 0.0000397 |
|
|
||||||
|
|
||||||
**`g`**
|
|
||||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 1 | 2.543 | 0.204 | 0.0000556 |
|
|
||||||
| lerobot/pusht | 2 | 3.646 | 0.182 | 0.0000443 |
|
|
||||||
| lerobot/pusht | 3 | 4.431 | 0.174 | 0.0000450 |
|
|
||||||
| lerobot/pusht | 4 | 5.103 | 0.163 | 0.0000448 |
|
|
||||||
| lerobot/pusht | 5 | 5.625 | 0.163 | 0.0000436 |
|
|
||||||
| lerobot/pusht | 6 | 5.974 | 0.155 | 0.0000427 |
|
|
||||||
| lerobot/pusht | 10 | 6.814 | 0.130 | 0.0000410 |
|
|
||||||
| lerobot/pusht | 15 | 7.431 | 0.105 | 0.0000406 |
|
|
||||||
| lerobot/pusht | 20 | 7.662 | 0.097 | 0.0000400 |
|
|
||||||
| lerobot/pusht | 40 | 8.163 | 0.061 | 0.0000405 |
|
|
||||||
| lerobot/pusht | 100 | 8.761 | 0.039 | 0.0000422 |
|
|
||||||
| lerobot/pusht | None | 8.909 | 0.024 | 0.0000431 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.444 | 0.0000601 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.345 | 0.0000397 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.282 | 0.0000416 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.271 | 0.0000415 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.260 | 0.0000415 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.249 | 0.0000415 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.195 | 0.0000399 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.169 | 0.0000394 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.140 | 0.0000390 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.096 | 0.0000384 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.046 | 0.0000390 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.022 | 0.0000400 |
|
|
||||||
|
|
||||||
**`crf`**
|
|
||||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 0 | 1.699 | 0.175 | 0.0000035 |
|
|
||||||
| lerobot/pusht | 5 | 1.409 | 0.181 | 0.0000080 |
|
|
||||||
| lerobot/pusht | 10 | 1.842 | 0.172 | 0.0000123 |
|
|
||||||
| lerobot/pusht | 15 | 2.322 | 0.187 | 0.0000211 |
|
|
||||||
| lerobot/pusht | 20 | 3.050 | 0.181 | 0.0000346 |
|
|
||||||
| lerobot/pusht | None | 3.646 | 0.189 | 0.0000443 |
|
|
||||||
| lerobot/pusht | 25 | 3.969 | 0.186 | 0.0000521 |
|
|
||||||
| lerobot/pusht | 30 | 5.687 | 0.184 | 0.0000850 |
|
|
||||||
| lerobot/pusht | 40 | 10.818 | 0.193 | 0.0001726 |
|
|
||||||
| lerobot/pusht | 50 | 18.185 | 0.183 | 0.0002606 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.165 | 0.0000056 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.171 | 0.0000111 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.212 | 0.0000153 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.261 | 0.0000218 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.312 | 0.0000317 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.339 | 0.0000397 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.297 | 0.0000452 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.406 | 0.0000629 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.468 | 0.0001184 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.515 | 0.0001879 |
|
|
||||||
|
|
||||||
**best**
|
|
||||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 3.646 | 0.188 | 0.0000443 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.339 | 0.0000397 |
|
|
||||||
|
|
||||||
### `2_frames`
|
|
||||||
|
|
||||||
**`pix_fmt`**
|
|
||||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | yuv420p | 3.788 | 0.314 | 0.0000799 |
|
|
||||||
| lerobot/pusht | yuv444p | 3.646 | 0.303 | 0.0000496 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.642 | 0.0000503 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.529 | 0.0000436 |
|
|
||||||
|
|
||||||
**`g`**
|
|
||||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 1 | 2.543 | 0.308 | 0.0000599 |
|
|
||||||
| lerobot/pusht | 2 | 3.646 | 0.279 | 0.0000496 |
|
|
||||||
| lerobot/pusht | 3 | 4.431 | 0.259 | 0.0000498 |
|
|
||||||
| lerobot/pusht | 4 | 5.103 | 0.243 | 0.0000501 |
|
|
||||||
| lerobot/pusht | 5 | 5.625 | 0.235 | 0.0000492 |
|
|
||||||
| lerobot/pusht | 6 | 5.974 | 0.230 | 0.0000481 |
|
|
||||||
| lerobot/pusht | 10 | 6.814 | 0.194 | 0.0000468 |
|
|
||||||
| lerobot/pusht | 15 | 7.431 | 0.152 | 0.0000460 |
|
|
||||||
| lerobot/pusht | 20 | 7.662 | 0.151 | 0.0000455 |
|
|
||||||
| lerobot/pusht | 40 | 8.163 | 0.095 | 0.0000454 |
|
|
||||||
| lerobot/pusht | 100 | 8.761 | 0.062 | 0.0000472 |
|
|
||||||
| lerobot/pusht | None | 8.909 | 0.037 | 0.0000479 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.638 | 0.0000625 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.537 | 0.0000436 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.493 | 0.0000437 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.458 | 0.0000446 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.438 | 0.0000445 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.424 | 0.0000444 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.345 | 0.0000435 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.313 | 0.0000417 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.264 | 0.0000421 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.185 | 0.0000414 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.090 | 0.0000420 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.042 | 0.0000424 |
|
|
||||||
|
|
||||||
**`crf`**
|
|
||||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 0 | 1.699 | 0.302 | 0.0000097 |
|
|
||||||
| lerobot/pusht | 5 | 1.409 | 0.287 | 0.0000142 |
|
|
||||||
| lerobot/pusht | 10 | 1.842 | 0.283 | 0.0000184 |
|
|
||||||
| lerobot/pusht | 15 | 2.322 | 0.305 | 0.0000268 |
|
|
||||||
| lerobot/pusht | 20 | 3.050 | 0.285 | 0.0000402 |
|
|
||||||
| lerobot/pusht | None | 3.646 | 0.285 | 0.0000496 |
|
|
||||||
| lerobot/pusht | 25 | 3.969 | 0.293 | 0.0000572 |
|
|
||||||
| lerobot/pusht | 30 | 5.687 | 0.293 | 0.0000893 |
|
|
||||||
| lerobot/pusht | 40 | 10.818 | 0.319 | 0.0001762 |
|
|
||||||
| lerobot/pusht | 50 | 18.185 | 0.304 | 0.0002626 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.235 | 0.0000112 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.261 | 0.0000166 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.333 | 0.0000207 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.406 | 0.0000267 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.489 | 0.0000361 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.537 | 0.0000436 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.578 | 0.0000487 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.453 | 0.0000655 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.767 | 0.0001192 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.816 | 0.0001881 |
|
|
||||||
|
|
||||||
**best**
|
|
||||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 3.646 | 0.283 | 0.0000496 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.543 | 0.0000436 |
|
|
||||||
|
|
||||||
### `2_frames_4_space`
|
|
||||||
|
|
||||||
**`pix_fmt`**
|
|
||||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | yuv420p | 3.788 | 0.257 | 0.0000855 |
|
|
||||||
| lerobot/pusht | yuv444p | 3.646 | 0.261 | 0.0000556 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.493 | 0.0000476 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.371 | 0.0000404 |
|
|
||||||
|
|
||||||
**`g`**
|
|
||||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 1 | 2.543 | 0.226 | 0.0000670 |
|
|
||||||
| lerobot/pusht | 2 | 3.646 | 0.222 | 0.0000556 |
|
|
||||||
| lerobot/pusht | 3 | 4.431 | 0.217 | 0.0000567 |
|
|
||||||
| lerobot/pusht | 4 | 5.103 | 0.204 | 0.0000555 |
|
|
||||||
| lerobot/pusht | 5 | 5.625 | 0.179 | 0.0000556 |
|
|
||||||
| lerobot/pusht | 6 | 5.974 | 0.188 | 0.0000544 |
|
|
||||||
| lerobot/pusht | 10 | 6.814 | 0.160 | 0.0000531 |
|
|
||||||
| lerobot/pusht | 15 | 7.431 | 0.150 | 0.0000521 |
|
|
||||||
| lerobot/pusht | 20 | 7.662 | 0.123 | 0.0000519 |
|
|
||||||
| lerobot/pusht | 40 | 8.163 | 0.092 | 0.0000519 |
|
|
||||||
| lerobot/pusht | 100 | 8.761 | 0.053 | 0.0000533 |
|
|
||||||
| lerobot/pusht | None | 8.909 | 0.034 | 0.0000541 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.409 | 0.0000607 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.381 | 0.0000404 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.355 | 0.0000418 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.346 | 0.0000425 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.354 | 0.0000419 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.336 | 0.0000419 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.314 | 0.0000402 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.269 | 0.0000397 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.246 | 0.0000395 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.171 | 0.0000390 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.091 | 0.0000399 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.043 | 0.0000409 |
|
|
||||||
|
|
||||||
**`crf`**
|
|
||||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 0 | 1.699 | 0.212 | 0.0000193 |
|
|
||||||
| lerobot/pusht | 5 | 1.409 | 0.211 | 0.0000232 |
|
|
||||||
| lerobot/pusht | 10 | 1.842 | 0.199 | 0.0000270 |
|
|
||||||
| lerobot/pusht | 15 | 2.322 | 0.198 | 0.0000347 |
|
|
||||||
| lerobot/pusht | 20 | 3.050 | 0.211 | 0.0000469 |
|
|
||||||
| lerobot/pusht | None | 3.646 | 0.206 | 0.0000556 |
|
|
||||||
| lerobot/pusht | 25 | 3.969 | 0.210 | 0.0000626 |
|
|
||||||
| lerobot/pusht | 30 | 5.687 | 0.223 | 0.0000927 |
|
|
||||||
| lerobot/pusht | 40 | 10.818 | 0.227 | 0.0001763 |
|
|
||||||
| lerobot/pusht | 50 | 18.185 | 0.223 | 0.0002625 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.147 | 0.0000071 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.182 | 0.0000125 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.222 | 0.0000166 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.270 | 0.0000229 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.325 | 0.0000326 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.362 | 0.0000404 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.390 | 0.0000459 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.437 | 0.0000633 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.499 | 0.0001186 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.564 | 0.0001879 |
|
|
||||||
|
|
||||||
**best**
|
|
||||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 3.646 | 0.224 | 0.0000556 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.368 | 0.0000404 |
|
|
||||||
|
|
||||||
### `6_frames`
|
|
||||||
|
|
||||||
**`pix_fmt`**
|
|
||||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | yuv420p | 3.788 | 0.660 | 0.0000839 |
|
|
||||||
| lerobot/pusht | yuv444p | 3.646 | 0.546 | 0.0000542 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 1.225 | 0.0000497 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.908 | 0.0000428 |
|
|
||||||
|
|
||||||
**`g`**
|
|
||||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 1 | 2.543 | 0.552 | 0.0000646 |
|
|
||||||
| lerobot/pusht | 2 | 3.646 | 0.534 | 0.0000542 |
|
|
||||||
| lerobot/pusht | 3 | 4.431 | 0.563 | 0.0000546 |
|
|
||||||
| lerobot/pusht | 4 | 5.103 | 0.537 | 0.0000545 |
|
|
||||||
| lerobot/pusht | 5 | 5.625 | 0.477 | 0.0000532 |
|
|
||||||
| lerobot/pusht | 6 | 5.974 | 0.515 | 0.0000530 |
|
|
||||||
| lerobot/pusht | 10 | 6.814 | 0.410 | 0.0000512 |
|
|
||||||
| lerobot/pusht | 15 | 7.431 | 0.405 | 0.0000503 |
|
|
||||||
| lerobot/pusht | 20 | 7.662 | 0.345 | 0.0000500 |
|
|
||||||
| lerobot/pusht | 40 | 8.163 | 0.247 | 0.0000496 |
|
|
||||||
| lerobot/pusht | 100 | 8.761 | 0.147 | 0.0000510 |
|
|
||||||
| lerobot/pusht | None | 8.909 | 0.100 | 0.0000519 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.997 | 0.0000620 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.911 | 0.0000428 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.869 | 0.0000433 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.874 | 0.0000438 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.864 | 0.0000439 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.834 | 0.0000440 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.781 | 0.0000421 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.679 | 0.0000411 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.652 | 0.0000410 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.465 | 0.0000404 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.245 | 0.0000413 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.116 | 0.0000417 |
|
|
||||||
|
|
||||||
**`crf`**
|
|
||||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 0 | 1.699 | 0.534 | 0.0000163 |
|
|
||||||
| lerobot/pusht | 5 | 1.409 | 0.524 | 0.0000205 |
|
|
||||||
| lerobot/pusht | 10 | 1.842 | 0.510 | 0.0000245 |
|
|
||||||
| lerobot/pusht | 15 | 2.322 | 0.512 | 0.0000324 |
|
|
||||||
| lerobot/pusht | 20 | 3.050 | 0.508 | 0.0000452 |
|
|
||||||
| lerobot/pusht | None | 3.646 | 0.518 | 0.0000542 |
|
|
||||||
| lerobot/pusht | 25 | 3.969 | 0.534 | 0.0000616 |
|
|
||||||
| lerobot/pusht | 30 | 5.687 | 0.530 | 0.0000927 |
|
|
||||||
| lerobot/pusht | 40 | 10.818 | 0.552 | 0.0001777 |
|
|
||||||
| lerobot/pusht | 50 | 18.185 | 0.564 | 0.0002644 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.401 | 0.0000101 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.499 | 0.0000156 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.599 | 0.0000197 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.704 | 0.0000258 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.834 | 0.0000352 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.925 | 0.0000428 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.978 | 0.0000480 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 1.088 | 0.0000648 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 1.324 | 0.0001190 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 1.436 | 0.0001880 |
|
|
||||||
|
|
||||||
**best**
|
|
||||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
|
||||||
| --- | --- | --- | --- |
|
|
||||||
| lerobot/pusht | 3.646 | 0.546 | 0.0000542 |
|
|
||||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.934 | 0.0000428 |
|
|
||||||
@@ -1,372 +0,0 @@
|
|||||||
#!/usr/bin/env python
|
|
||||||
|
|
||||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
import json
|
|
||||||
import random
|
|
||||||
import shutil
|
|
||||||
import subprocess
|
|
||||||
import time
|
|
||||||
from pathlib import Path
|
|
||||||
|
|
||||||
import einops
|
|
||||||
import numpy
|
|
||||||
import PIL
|
|
||||||
import torch
|
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
|
||||||
from lerobot.common.datasets.video_utils import (
|
|
||||||
decode_video_frames_torchvision,
|
|
||||||
)
|
|
||||||
|
|
||||||
|
|
||||||
def get_directory_size(directory):
|
|
||||||
total_size = 0
|
|
||||||
# Iterate over all files and subdirectories recursively
|
|
||||||
for item in directory.rglob("*"):
|
|
||||||
if item.is_file():
|
|
||||||
# Add the file size to the total
|
|
||||||
total_size += item.stat().st_size
|
|
||||||
return total_size
|
|
||||||
|
|
||||||
|
|
||||||
def run_video_benchmark(
|
|
||||||
output_dir,
|
|
||||||
cfg,
|
|
||||||
timestamps_mode,
|
|
||||||
seed=1337,
|
|
||||||
):
|
|
||||||
output_dir = Path(output_dir)
|
|
||||||
if output_dir.exists():
|
|
||||||
shutil.rmtree(output_dir)
|
|
||||||
output_dir.mkdir(parents=True, exist_ok=True)
|
|
||||||
|
|
||||||
repo_id = cfg["repo_id"]
|
|
||||||
|
|
||||||
# TODO(rcadene): rewrite with hardcoding of original images and episodes
|
|
||||||
dataset = LeRobotDataset(repo_id)
|
|
||||||
|
|
||||||
# Get fps
|
|
||||||
fps = dataset.fps
|
|
||||||
|
|
||||||
# we only load first episode
|
|
||||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
|
||||||
|
|
||||||
# Save/Load image directory for the first episode
|
|
||||||
imgs_dir = Path(f"tmp/data/images/{repo_id}/observation.image_episode_000000")
|
|
||||||
if not imgs_dir.exists():
|
|
||||||
imgs_dir.mkdir(parents=True, exist_ok=True)
|
|
||||||
hf_dataset = dataset.hf_dataset.with_format(None)
|
|
||||||
imgs_dataset = hf_dataset.select_columns("observation.image")
|
|
||||||
|
|
||||||
for i, item in enumerate(imgs_dataset):
|
|
||||||
img = item["observation.image"]
|
|
||||||
img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
|
|
||||||
|
|
||||||
if i >= ep_num_images - 1:
|
|
||||||
break
|
|
||||||
|
|
||||||
sum_original_frames_size_bytes = get_directory_size(imgs_dir)
|
|
||||||
|
|
||||||
# Encode images into video
|
|
||||||
video_path = output_dir / "episode_0.mp4"
|
|
||||||
|
|
||||||
g = cfg.get("g")
|
|
||||||
crf = cfg.get("crf")
|
|
||||||
pix_fmt = cfg["pix_fmt"]
|
|
||||||
|
|
||||||
cmd = f"ffmpeg -r {fps} "
|
|
||||||
cmd += "-f image2 "
|
|
||||||
cmd += "-loglevel error "
|
|
||||||
cmd += f"-i {str(imgs_dir / 'frame_%06d.png')} "
|
|
||||||
cmd += "-vcodec libx264 "
|
|
||||||
if g is not None:
|
|
||||||
cmd += f"-g {g} " # ensures at least 1 keyframe every 10 frames
|
|
||||||
# cmd += "-keyint_min 10 " set a minimum of 10 frames between 2 key frames
|
|
||||||
# cmd += "-sc_threshold 0 " disable scene change detection to lower the number of key frames
|
|
||||||
if crf is not None:
|
|
||||||
cmd += f"-crf {crf} "
|
|
||||||
cmd += f"-pix_fmt {pix_fmt} "
|
|
||||||
cmd += f"{str(video_path)}"
|
|
||||||
subprocess.run(cmd.split(" "), check=True)
|
|
||||||
|
|
||||||
video_size_bytes = video_path.stat().st_size
|
|
||||||
|
|
||||||
# Set decoder
|
|
||||||
|
|
||||||
decoder = cfg["decoder"]
|
|
||||||
decoder_kwgs = cfg["decoder_kwgs"]
|
|
||||||
device = cfg["device"]
|
|
||||||
|
|
||||||
if decoder == "torchvision":
|
|
||||||
decode_frames_fn = decode_video_frames_torchvision
|
|
||||||
else:
|
|
||||||
raise ValueError(decoder)
|
|
||||||
|
|
||||||
# Estimate average loading time
|
|
||||||
|
|
||||||
def load_original_frames(imgs_dir, timestamps):
|
|
||||||
frames = []
|
|
||||||
for ts in timestamps:
|
|
||||||
idx = int(ts * fps)
|
|
||||||
frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
|
||||||
frame = torch.from_numpy(numpy.array(frame))
|
|
||||||
frame = frame.type(torch.float32) / 255
|
|
||||||
frame = einops.rearrange(frame, "h w c -> c h w")
|
|
||||||
frames.append(frame)
|
|
||||||
return frames
|
|
||||||
|
|
||||||
list_avg_load_time = []
|
|
||||||
list_avg_load_time_from_images = []
|
|
||||||
per_pixel_l2_errors = []
|
|
||||||
|
|
||||||
random.seed(seed)
|
|
||||||
|
|
||||||
for t in range(50):
|
|
||||||
# test loading 2 frames that are 4 frames appart, which might be a common setting
|
|
||||||
ts = random.randint(fps, ep_num_images - fps) / fps
|
|
||||||
|
|
||||||
if timestamps_mode == "1_frame":
|
|
||||||
timestamps = [ts]
|
|
||||||
elif timestamps_mode == "2_frames":
|
|
||||||
timestamps = [ts - 1 / fps, ts]
|
|
||||||
elif timestamps_mode == "2_frames_4_space":
|
|
||||||
timestamps = [ts - 4 / fps, ts]
|
|
||||||
elif timestamps_mode == "6_frames":
|
|
||||||
timestamps = [ts - i / fps for i in range(6)][::-1]
|
|
||||||
else:
|
|
||||||
raise ValueError(timestamps_mode)
|
|
||||||
|
|
||||||
num_frames = len(timestamps)
|
|
||||||
|
|
||||||
start_time_s = time.monotonic()
|
|
||||||
frames = decode_frames_fn(
|
|
||||||
video_path, timestamps=timestamps, tolerance_s=1e-4, device=device, **decoder_kwgs
|
|
||||||
)
|
|
||||||
avg_load_time = (time.monotonic() - start_time_s) / num_frames
|
|
||||||
list_avg_load_time.append(avg_load_time)
|
|
||||||
|
|
||||||
start_time_s = time.monotonic()
|
|
||||||
original_frames = load_original_frames(imgs_dir, timestamps)
|
|
||||||
avg_load_time_from_images = (time.monotonic() - start_time_s) / num_frames
|
|
||||||
list_avg_load_time_from_images.append(avg_load_time_from_images)
|
|
||||||
|
|
||||||
# Estimate average L2 error between original frames and decoded frames
|
|
||||||
for i, ts in enumerate(timestamps):
|
|
||||||
# are_close = torch.allclose(frames[i], original_frames[i], atol=0.02)
|
|
||||||
num_pixels = original_frames[i].numel()
|
|
||||||
per_pixel_l2_error = torch.norm(frames[i] - original_frames[i], p=2).item() / num_pixels
|
|
||||||
|
|
||||||
# save decoded frames
|
|
||||||
if t == 0:
|
|
||||||
frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
|
|
||||||
PIL.Image.fromarray(frame_hwc).save(output_dir / f"frame_{i:06d}.png")
|
|
||||||
|
|
||||||
# save original_frames
|
|
||||||
idx = int(ts * fps)
|
|
||||||
if t == 0:
|
|
||||||
original_frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
|
||||||
original_frame.save(output_dir / f"original_frame_{i:06d}.png")
|
|
||||||
|
|
||||||
per_pixel_l2_errors.append(per_pixel_l2_error)
|
|
||||||
|
|
||||||
avg_load_time = float(numpy.array(list_avg_load_time).mean())
|
|
||||||
avg_load_time_from_images = float(numpy.array(list_avg_load_time_from_images).mean())
|
|
||||||
avg_per_pixel_l2_error = float(numpy.array(per_pixel_l2_errors).mean())
|
|
||||||
|
|
||||||
# Save benchmark info
|
|
||||||
|
|
||||||
info = {
|
|
||||||
"sum_original_frames_size_bytes": sum_original_frames_size_bytes,
|
|
||||||
"video_size_bytes": video_size_bytes,
|
|
||||||
"avg_load_time_from_images": avg_load_time_from_images,
|
|
||||||
"avg_load_time": avg_load_time,
|
|
||||||
"compression_factor": sum_original_frames_size_bytes / video_size_bytes,
|
|
||||||
"load_time_factor": avg_load_time_from_images / avg_load_time,
|
|
||||||
"avg_per_pixel_l2_error": avg_per_pixel_l2_error,
|
|
||||||
}
|
|
||||||
|
|
||||||
with open(output_dir / "info.json", "w") as f:
|
|
||||||
json.dump(info, f)
|
|
||||||
|
|
||||||
return info
|
|
||||||
|
|
||||||
|
|
||||||
def display_markdown_table(headers, rows):
|
|
||||||
for i, row in enumerate(rows):
|
|
||||||
new_row = []
|
|
||||||
for col in row:
|
|
||||||
if col is None:
|
|
||||||
new_col = "None"
|
|
||||||
elif isinstance(col, float):
|
|
||||||
new_col = f"{col:.3f}"
|
|
||||||
if new_col == "0.000":
|
|
||||||
new_col = f"{col:.7f}"
|
|
||||||
elif isinstance(col, int):
|
|
||||||
new_col = f"{col}"
|
|
||||||
else:
|
|
||||||
new_col = col
|
|
||||||
new_row.append(new_col)
|
|
||||||
rows[i] = new_row
|
|
||||||
|
|
||||||
header_line = "| " + " | ".join(headers) + " |"
|
|
||||||
separator_line = "| " + " | ".join(["---" for _ in headers]) + " |"
|
|
||||||
body_lines = ["| " + " | ".join(row) + " |" for row in rows]
|
|
||||||
markdown_table = "\n".join([header_line, separator_line] + body_lines)
|
|
||||||
print(markdown_table)
|
|
||||||
print()
|
|
||||||
|
|
||||||
|
|
||||||
def load_info(out_dir):
|
|
||||||
with open(out_dir / "info.json") as f:
|
|
||||||
info = json.load(f)
|
|
||||||
return info
|
|
||||||
|
|
||||||
|
|
||||||
def main():
|
|
||||||
out_dir = Path("tmp/run_video_benchmark")
|
|
||||||
dry_run = False
|
|
||||||
repo_ids = ["lerobot/pusht", "lerobot/umi_cup_in_the_wild"]
|
|
||||||
timestamps_modes = [
|
|
||||||
"1_frame",
|
|
||||||
"2_frames",
|
|
||||||
"2_frames_4_space",
|
|
||||||
"6_frames",
|
|
||||||
]
|
|
||||||
for timestamps_mode in timestamps_modes:
|
|
||||||
bench_dir = out_dir / timestamps_mode
|
|
||||||
|
|
||||||
print(f"### `{timestamps_mode}`")
|
|
||||||
print()
|
|
||||||
|
|
||||||
print("**`pix_fmt`**")
|
|
||||||
headers = ["repo_id", "pix_fmt", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
|
||||||
rows = []
|
|
||||||
for repo_id in repo_ids:
|
|
||||||
for pix_fmt in ["yuv420p", "yuv444p"]:
|
|
||||||
cfg = {
|
|
||||||
"repo_id": repo_id,
|
|
||||||
# video encoding
|
|
||||||
"g": 2,
|
|
||||||
"crf": None,
|
|
||||||
"pix_fmt": pix_fmt,
|
|
||||||
# video decoding
|
|
||||||
"device": "cpu",
|
|
||||||
"decoder": "torchvision",
|
|
||||||
"decoder_kwgs": {},
|
|
||||||
}
|
|
||||||
if not dry_run:
|
|
||||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_{pix_fmt}", cfg, timestamps_mode)
|
|
||||||
info = load_info(bench_dir / repo_id / f"torchvision_{pix_fmt}")
|
|
||||||
rows.append(
|
|
||||||
[
|
|
||||||
repo_id,
|
|
||||||
pix_fmt,
|
|
||||||
info["compression_factor"],
|
|
||||||
info["load_time_factor"],
|
|
||||||
info["avg_per_pixel_l2_error"],
|
|
||||||
]
|
|
||||||
)
|
|
||||||
display_markdown_table(headers, rows)
|
|
||||||
|
|
||||||
print("**`g`**")
|
|
||||||
headers = ["repo_id", "g", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
|
||||||
rows = []
|
|
||||||
for repo_id in repo_ids:
|
|
||||||
for g in [1, 2, 3, 4, 5, 6, 10, 15, 20, 40, 100, None]:
|
|
||||||
cfg = {
|
|
||||||
"repo_id": repo_id,
|
|
||||||
# video encoding
|
|
||||||
"g": g,
|
|
||||||
"pix_fmt": "yuv444p",
|
|
||||||
# video decoding
|
|
||||||
"device": "cpu",
|
|
||||||
"decoder": "torchvision",
|
|
||||||
"decoder_kwgs": {},
|
|
||||||
}
|
|
||||||
if not dry_run:
|
|
||||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_g_{g}", cfg, timestamps_mode)
|
|
||||||
info = load_info(bench_dir / repo_id / f"torchvision_g_{g}")
|
|
||||||
rows.append(
|
|
||||||
[
|
|
||||||
repo_id,
|
|
||||||
g,
|
|
||||||
info["compression_factor"],
|
|
||||||
info["load_time_factor"],
|
|
||||||
info["avg_per_pixel_l2_error"],
|
|
||||||
]
|
|
||||||
)
|
|
||||||
display_markdown_table(headers, rows)
|
|
||||||
|
|
||||||
print("**`crf`**")
|
|
||||||
headers = ["repo_id", "crf", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
|
||||||
rows = []
|
|
||||||
for repo_id in repo_ids:
|
|
||||||
for crf in [0, 5, 10, 15, 20, None, 25, 30, 40, 50]:
|
|
||||||
cfg = {
|
|
||||||
"repo_id": repo_id,
|
|
||||||
# video encoding
|
|
||||||
"g": 2,
|
|
||||||
"crf": crf,
|
|
||||||
"pix_fmt": "yuv444p",
|
|
||||||
# video decoding
|
|
||||||
"device": "cpu",
|
|
||||||
"decoder": "torchvision",
|
|
||||||
"decoder_kwgs": {},
|
|
||||||
}
|
|
||||||
if not dry_run:
|
|
||||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_crf_{crf}", cfg, timestamps_mode)
|
|
||||||
info = load_info(bench_dir / repo_id / f"torchvision_crf_{crf}")
|
|
||||||
rows.append(
|
|
||||||
[
|
|
||||||
repo_id,
|
|
||||||
crf,
|
|
||||||
info["compression_factor"],
|
|
||||||
info["load_time_factor"],
|
|
||||||
info["avg_per_pixel_l2_error"],
|
|
||||||
]
|
|
||||||
)
|
|
||||||
display_markdown_table(headers, rows)
|
|
||||||
|
|
||||||
print("**best**")
|
|
||||||
headers = ["repo_id", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
|
||||||
rows = []
|
|
||||||
for repo_id in repo_ids:
|
|
||||||
cfg = {
|
|
||||||
"repo_id": repo_id,
|
|
||||||
# video encoding
|
|
||||||
"g": 2,
|
|
||||||
"crf": None,
|
|
||||||
"pix_fmt": "yuv444p",
|
|
||||||
# video decoding
|
|
||||||
"device": "cpu",
|
|
||||||
"decoder": "torchvision",
|
|
||||||
"decoder_kwgs": {},
|
|
||||||
}
|
|
||||||
if not dry_run:
|
|
||||||
run_video_benchmark(bench_dir / repo_id / "torchvision_best", cfg, timestamps_mode)
|
|
||||||
info = load_info(bench_dir / repo_id / "torchvision_best")
|
|
||||||
rows.append(
|
|
||||||
[
|
|
||||||
repo_id,
|
|
||||||
info["compression_factor"],
|
|
||||||
info["load_time_factor"],
|
|
||||||
info["avg_per_pixel_l2_error"],
|
|
||||||
]
|
|
||||||
)
|
|
||||||
display_markdown_table(headers, rows)
|
|
||||||
|
|
||||||
|
|
||||||
if __name__ == "__main__":
|
|
||||||
main()
|
|
||||||
27
lerobot/common/datasets/card_template.md
Normal file
27
lerobot/common/datasets/card_template.md
Normal file
@@ -0,0 +1,27 @@
|
|||||||
|
---
|
||||||
|
# For reference on dataset card metadata, see the spec: https://github.com/huggingface/hub-docs/blob/main/datasetcard.md?plain=1
|
||||||
|
# Doc / guide: https://huggingface.co/docs/hub/datasets-cards
|
||||||
|
{{ card_data }}
|
||||||
|
---
|
||||||
|
|
||||||
|
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
|
||||||
|
|
||||||
|
## Dataset Description
|
||||||
|
|
||||||
|
{{ dataset_description | default("", true) }}
|
||||||
|
|
||||||
|
- **Homepage:** {{ url | default("[More Information Needed]", true)}}
|
||||||
|
- **Paper:** {{ paper | default("[More Information Needed]", true)}}
|
||||||
|
- **License:** {{ license | default("[More Information Needed]", true)}}
|
||||||
|
|
||||||
|
## Dataset Structure
|
||||||
|
|
||||||
|
{{ dataset_structure | default("[More Information Needed]", true)}}
|
||||||
|
|
||||||
|
## Citation
|
||||||
|
|
||||||
|
**BibTeX:**
|
||||||
|
|
||||||
|
```bibtex
|
||||||
|
{{ citation_bibtex | default("[More Information Needed]", true)}}
|
||||||
|
```
|
||||||
@@ -16,17 +16,12 @@
|
|||||||
from copy import deepcopy
|
from copy import deepcopy
|
||||||
from math import ceil
|
from math import ceil
|
||||||
|
|
||||||
import datasets
|
|
||||||
import einops
|
import einops
|
||||||
import torch
|
import torch
|
||||||
import tqdm
|
import tqdm
|
||||||
from datasets import Image
|
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame
|
|
||||||
|
|
||||||
|
|
||||||
def get_stats_einops_patterns(dataset: LeRobotDataset | datasets.Dataset, num_workers=0):
|
def get_stats_einops_patterns(dataset, num_workers=0):
|
||||||
"""These einops patterns will be used to aggregate batches and compute statistics.
|
"""These einops patterns will be used to aggregate batches and compute statistics.
|
||||||
|
|
||||||
Note: We assume the images are in channel first format
|
Note: We assume the images are in channel first format
|
||||||
@@ -41,11 +36,13 @@ def get_stats_einops_patterns(dataset: LeRobotDataset | datasets.Dataset, num_wo
|
|||||||
batch = next(iter(dataloader))
|
batch = next(iter(dataloader))
|
||||||
|
|
||||||
stats_patterns = {}
|
stats_patterns = {}
|
||||||
for key, feats_type in dataset.features.items():
|
|
||||||
|
for key in dataset.features:
|
||||||
# sanity check that tensors are not float64
|
# sanity check that tensors are not float64
|
||||||
assert batch[key].dtype != torch.float64
|
assert batch[key].dtype != torch.float64
|
||||||
|
|
||||||
if isinstance(feats_type, (VideoFrame, Image)):
|
# if isinstance(feats_type, (VideoFrame, Image)):
|
||||||
|
if key in dataset.meta.camera_keys:
|
||||||
# sanity check that images are channel first
|
# sanity check that images are channel first
|
||||||
_, c, h, w = batch[key].shape
|
_, c, h, w = batch[key].shape
|
||||||
assert c < h and c < w, f"expect channel first images, but instead {batch[key].shape}"
|
assert c < h and c < w, f"expect channel first images, but instead {batch[key].shape}"
|
||||||
@@ -61,14 +58,13 @@ def get_stats_einops_patterns(dataset: LeRobotDataset | datasets.Dataset, num_wo
|
|||||||
elif batch[key].ndim == 1:
|
elif batch[key].ndim == 1:
|
||||||
stats_patterns[key] = "b -> 1"
|
stats_patterns[key] = "b -> 1"
|
||||||
else:
|
else:
|
||||||
raise ValueError(f"{key}, {feats_type}, {batch[key].shape}")
|
raise ValueError(f"{key}, {batch[key].shape}")
|
||||||
|
|
||||||
return stats_patterns
|
return stats_patterns
|
||||||
|
|
||||||
|
|
||||||
def compute_stats(
|
def compute_stats(dataset, batch_size=8, num_workers=8, max_num_samples=None):
|
||||||
dataset: LeRobotDataset | datasets.Dataset, batch_size=32, num_workers=16, max_num_samples=None
|
"""Compute mean/std and min/max statistics of all data keys in a LeRobotDataset."""
|
||||||
):
|
|
||||||
if max_num_samples is None:
|
if max_num_samples is None:
|
||||||
max_num_samples = len(dataset)
|
max_num_samples = len(dataset)
|
||||||
|
|
||||||
@@ -159,3 +155,60 @@ def compute_stats(
|
|||||||
"min": min[key],
|
"min": min[key],
|
||||||
}
|
}
|
||||||
return stats
|
return stats
|
||||||
|
|
||||||
|
|
||||||
|
def aggregate_stats(ls_datasets) -> dict[str, torch.Tensor]:
|
||||||
|
"""Aggregate stats of multiple LeRobot datasets into one set of stats without recomputing from scratch.
|
||||||
|
|
||||||
|
The final stats will have the union of all data keys from each of the datasets.
|
||||||
|
|
||||||
|
The final stats will have the union of all data keys from each of the datasets. For instance:
|
||||||
|
- new_max = max(max_dataset_0, max_dataset_1, ...)
|
||||||
|
- new_min = min(min_dataset_0, min_dataset_1, ...)
|
||||||
|
- new_mean = (mean of all data)
|
||||||
|
- new_std = (std of all data)
|
||||||
|
"""
|
||||||
|
data_keys = set()
|
||||||
|
for dataset in ls_datasets:
|
||||||
|
data_keys.update(dataset.meta.stats.keys())
|
||||||
|
stats = {k: {} for k in data_keys}
|
||||||
|
for data_key in data_keys:
|
||||||
|
for stat_key in ["min", "max"]:
|
||||||
|
# compute `max(dataset_0["max"], dataset_1["max"], ...)`
|
||||||
|
stats[data_key][stat_key] = einops.reduce(
|
||||||
|
torch.stack(
|
||||||
|
[ds.meta.stats[data_key][stat_key] for ds in ls_datasets if data_key in ds.meta.stats],
|
||||||
|
dim=0,
|
||||||
|
),
|
||||||
|
"n ... -> ...",
|
||||||
|
stat_key,
|
||||||
|
)
|
||||||
|
total_samples = sum(d.num_frames for d in ls_datasets if data_key in d.meta.stats)
|
||||||
|
# Compute the "sum" statistic by multiplying each mean by the number of samples in the respective
|
||||||
|
# dataset, then divide by total_samples to get the overall "mean".
|
||||||
|
# NOTE: the brackets around (d.num_frames / total_samples) are needed tor minimize the risk of
|
||||||
|
# numerical overflow!
|
||||||
|
stats[data_key]["mean"] = sum(
|
||||||
|
d.meta.stats[data_key]["mean"] * (d.num_frames / total_samples)
|
||||||
|
for d in ls_datasets
|
||||||
|
if data_key in d.meta.stats
|
||||||
|
)
|
||||||
|
# The derivation for standard deviation is a little more involved but is much in the same spirit as
|
||||||
|
# the computation of the mean.
|
||||||
|
# Given two sets of data where the statistics are known:
|
||||||
|
# σ_combined = sqrt[ (n1 * (σ1^2 + d1^2) + n2 * (σ2^2 + d2^2)) / (n1 + n2) ]
|
||||||
|
# where d1 = μ1 - μ_combined, d2 = μ2 - μ_combined
|
||||||
|
# NOTE: the brackets around (d.num_frames / total_samples) are needed tor minimize the risk of
|
||||||
|
# numerical overflow!
|
||||||
|
stats[data_key]["std"] = torch.sqrt(
|
||||||
|
sum(
|
||||||
|
(
|
||||||
|
d.meta.stats[data_key]["std"] ** 2
|
||||||
|
+ (d.meta.stats[data_key]["mean"] - stats[data_key]["mean"]) ** 2
|
||||||
|
)
|
||||||
|
* (d.num_frames / total_samples)
|
||||||
|
for d in ls_datasets
|
||||||
|
if data_key in d.meta.stats
|
||||||
|
)
|
||||||
|
)
|
||||||
|
return stats
|
||||||
@@ -16,40 +16,101 @@
|
|||||||
import logging
|
import logging
|
||||||
|
|
||||||
import torch
|
import torch
|
||||||
from omegaconf import OmegaConf
|
from omegaconf import ListConfig, OmegaConf
|
||||||
|
|
||||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, MultiLeRobotDataset
|
||||||
|
from lerobot.common.datasets.transforms import get_image_transforms
|
||||||
|
|
||||||
|
|
||||||
def make_dataset(
|
def resolve_delta_timestamps(cfg):
|
||||||
cfg,
|
"""Resolves delta_timestamps config key (in-place) by using `eval`.
|
||||||
split="train",
|
|
||||||
):
|
|
||||||
if cfg.env.name not in cfg.dataset_repo_id:
|
|
||||||
logging.warning(
|
|
||||||
f"There might be a mismatch between your training dataset ({cfg.dataset_repo_id=}) and your "
|
|
||||||
f"environment ({cfg.env.name=})."
|
|
||||||
)
|
|
||||||
|
|
||||||
|
Doesn't do anything if delta_timestamps is not specified or has already been resolve (as evidenced by
|
||||||
|
the data type of its values).
|
||||||
|
"""
|
||||||
delta_timestamps = cfg.training.get("delta_timestamps")
|
delta_timestamps = cfg.training.get("delta_timestamps")
|
||||||
if delta_timestamps is not None:
|
if delta_timestamps is not None:
|
||||||
for key in delta_timestamps:
|
for key in delta_timestamps:
|
||||||
if isinstance(delta_timestamps[key], str):
|
if isinstance(delta_timestamps[key], str):
|
||||||
delta_timestamps[key] = eval(delta_timestamps[key])
|
# TODO(rcadene, alexander-soare): remove `eval` to avoid exploit
|
||||||
|
cfg.training.delta_timestamps[key] = eval(delta_timestamps[key])
|
||||||
|
|
||||||
# TODO(rcadene): add data augmentations
|
|
||||||
|
|
||||||
dataset = LeRobotDataset(
|
def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotDataset:
|
||||||
cfg.dataset_repo_id,
|
"""
|
||||||
split=split,
|
Args:
|
||||||
delta_timestamps=delta_timestamps,
|
cfg: A Hydra config as per the LeRobot config scheme.
|
||||||
)
|
split: Select the data subset used to create an instance of LeRobotDataset.
|
||||||
|
All datasets hosted on [lerobot](https://huggingface.co/lerobot) contain only one subset: "train".
|
||||||
|
Thus, by default, `split="train"` selects all the available data. `split` aims to work like the
|
||||||
|
slicer in the hugging face datasets:
|
||||||
|
https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
|
||||||
|
As of now, it only supports `split="train[:n]"` to load the first n frames of the dataset or
|
||||||
|
`split="train[n:]"` to load the last n frames. For instance `split="train[:1000]"`.
|
||||||
|
Returns:
|
||||||
|
The LeRobotDataset.
|
||||||
|
"""
|
||||||
|
if not isinstance(cfg.dataset_repo_id, (str, ListConfig)):
|
||||||
|
raise ValueError(
|
||||||
|
"Expected cfg.dataset_repo_id to be either a single string to load one dataset or a list of "
|
||||||
|
"strings to load multiple datasets."
|
||||||
|
)
|
||||||
|
|
||||||
|
# A soft check to warn if the environment matches the dataset. Don't check if we are using a real world env (dora).
|
||||||
|
if cfg.env.name != "dora":
|
||||||
|
if isinstance(cfg.dataset_repo_id, str):
|
||||||
|
dataset_repo_ids = [cfg.dataset_repo_id] # single dataset
|
||||||
|
else:
|
||||||
|
dataset_repo_ids = cfg.dataset_repo_id # multiple datasets
|
||||||
|
|
||||||
|
for dataset_repo_id in dataset_repo_ids:
|
||||||
|
if cfg.env.name not in dataset_repo_id:
|
||||||
|
logging.warning(
|
||||||
|
f"There might be a mismatch between your training dataset ({dataset_repo_id=}) and your "
|
||||||
|
f"environment ({cfg.env.name=})."
|
||||||
|
)
|
||||||
|
|
||||||
|
resolve_delta_timestamps(cfg)
|
||||||
|
|
||||||
|
image_transforms = None
|
||||||
|
if cfg.training.image_transforms.enable:
|
||||||
|
cfg_tf = cfg.training.image_transforms
|
||||||
|
image_transforms = get_image_transforms(
|
||||||
|
brightness_weight=cfg_tf.brightness.weight,
|
||||||
|
brightness_min_max=cfg_tf.brightness.min_max,
|
||||||
|
contrast_weight=cfg_tf.contrast.weight,
|
||||||
|
contrast_min_max=cfg_tf.contrast.min_max,
|
||||||
|
saturation_weight=cfg_tf.saturation.weight,
|
||||||
|
saturation_min_max=cfg_tf.saturation.min_max,
|
||||||
|
hue_weight=cfg_tf.hue.weight,
|
||||||
|
hue_min_max=cfg_tf.hue.min_max,
|
||||||
|
sharpness_weight=cfg_tf.sharpness.weight,
|
||||||
|
sharpness_min_max=cfg_tf.sharpness.min_max,
|
||||||
|
max_num_transforms=cfg_tf.max_num_transforms,
|
||||||
|
random_order=cfg_tf.random_order,
|
||||||
|
)
|
||||||
|
|
||||||
|
if isinstance(cfg.dataset_repo_id, str):
|
||||||
|
# TODO (aliberts): add 'episodes' arg from config after removing hydra
|
||||||
|
dataset = LeRobotDataset(
|
||||||
|
cfg.dataset_repo_id,
|
||||||
|
delta_timestamps=cfg.training.get("delta_timestamps"),
|
||||||
|
image_transforms=image_transforms,
|
||||||
|
video_backend=cfg.video_backend,
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
dataset = MultiLeRobotDataset(
|
||||||
|
cfg.dataset_repo_id,
|
||||||
|
delta_timestamps=cfg.training.get("delta_timestamps"),
|
||||||
|
image_transforms=image_transforms,
|
||||||
|
video_backend=cfg.video_backend,
|
||||||
|
)
|
||||||
|
|
||||||
if cfg.get("override_dataset_stats"):
|
if cfg.get("override_dataset_stats"):
|
||||||
for key, stats_dict in cfg.override_dataset_stats.items():
|
for key, stats_dict in cfg.override_dataset_stats.items():
|
||||||
for stats_type, listconfig in stats_dict.items():
|
for stats_type, listconfig in stats_dict.items():
|
||||||
# example of stats_type: min, max, mean, std
|
# example of stats_type: min, max, mean, std
|
||||||
stats = OmegaConf.to_container(listconfig, resolve=True)
|
stats = OmegaConf.to_container(listconfig, resolve=True)
|
||||||
dataset.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
|
dataset.meta.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
|
||||||
|
|
||||||
return dataset
|
return dataset
|
||||||
|
|||||||
160
lerobot/common/datasets/image_writer.py
Normal file
160
lerobot/common/datasets/image_writer.py
Normal file
@@ -0,0 +1,160 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
import multiprocessing
|
||||||
|
import queue
|
||||||
|
import threading
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import PIL.Image
|
||||||
|
import torch
|
||||||
|
|
||||||
|
|
||||||
|
def safe_stop_image_writer(func):
|
||||||
|
def wrapper(*args, **kwargs):
|
||||||
|
try:
|
||||||
|
return func(*args, **kwargs)
|
||||||
|
except Exception as e:
|
||||||
|
dataset = kwargs.get("dataset")
|
||||||
|
image_writer = getattr(dataset, "image_writer", None) if dataset else None
|
||||||
|
if image_writer is not None:
|
||||||
|
print("Waiting for image writer to terminate...")
|
||||||
|
image_writer.stop()
|
||||||
|
raise e
|
||||||
|
|
||||||
|
return wrapper
|
||||||
|
|
||||||
|
|
||||||
|
def image_array_to_image(image_array: np.ndarray) -> PIL.Image.Image:
|
||||||
|
# TODO(aliberts): handle 1 channel and 4 for depth images
|
||||||
|
if image_array.ndim == 3 and image_array.shape[0] in [1, 3]:
|
||||||
|
# Transpose from pytorch convention (C, H, W) to (H, W, C)
|
||||||
|
image_array = image_array.transpose(1, 2, 0)
|
||||||
|
if image_array.dtype != np.uint8:
|
||||||
|
# Assume the image is in [0, 1] range for floating-point data
|
||||||
|
image_array = np.clip(image_array, 0, 1)
|
||||||
|
image_array = (image_array * 255).astype(np.uint8)
|
||||||
|
return PIL.Image.fromarray(image_array)
|
||||||
|
|
||||||
|
|
||||||
|
def write_image(image: np.ndarray | PIL.Image.Image, fpath: Path):
|
||||||
|
try:
|
||||||
|
if isinstance(image, np.ndarray):
|
||||||
|
img = image_array_to_image(image)
|
||||||
|
elif isinstance(image, PIL.Image.Image):
|
||||||
|
img = image
|
||||||
|
else:
|
||||||
|
raise TypeError(f"Unsupported image type: {type(image)}")
|
||||||
|
img.save(fpath)
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error writing image {fpath}: {e}")
|
||||||
|
|
||||||
|
|
||||||
|
def worker_thread_loop(queue: queue.Queue):
|
||||||
|
while True:
|
||||||
|
item = queue.get()
|
||||||
|
if item is None:
|
||||||
|
queue.task_done()
|
||||||
|
break
|
||||||
|
image_array, fpath = item
|
||||||
|
write_image(image_array, fpath)
|
||||||
|
queue.task_done()
|
||||||
|
|
||||||
|
|
||||||
|
def worker_process(queue: queue.Queue, num_threads: int):
|
||||||
|
threads = []
|
||||||
|
for _ in range(num_threads):
|
||||||
|
t = threading.Thread(target=worker_thread_loop, args=(queue,))
|
||||||
|
t.daemon = True
|
||||||
|
t.start()
|
||||||
|
threads.append(t)
|
||||||
|
for t in threads:
|
||||||
|
t.join()
|
||||||
|
|
||||||
|
|
||||||
|
class AsyncImageWriter:
|
||||||
|
"""
|
||||||
|
This class abstract away the initialisation of processes or/and threads to
|
||||||
|
save images on disk asynchrounously, which is critical to control a robot and record data
|
||||||
|
at a high frame rate.
|
||||||
|
|
||||||
|
When `num_processes=0`, it creates a threads pool of size `num_threads`.
|
||||||
|
When `num_processes>0`, it creates processes pool of size `num_processes`, where each subprocess starts
|
||||||
|
their own threads pool of size `num_threads`.
|
||||||
|
|
||||||
|
The optimal number of processes and threads depends on your computer capabilities.
|
||||||
|
We advise to use 4 threads per camera with 0 processes. If the fps is not stable, try to increase or lower
|
||||||
|
the number of threads. If it is still not stable, try to use 1 subprocess, or more.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, num_processes: int = 0, num_threads: int = 1):
|
||||||
|
self.num_processes = num_processes
|
||||||
|
self.num_threads = num_threads
|
||||||
|
self.queue = None
|
||||||
|
self.threads = []
|
||||||
|
self.processes = []
|
||||||
|
self._stopped = False
|
||||||
|
|
||||||
|
if num_threads <= 0 and num_processes <= 0:
|
||||||
|
raise ValueError("Number of threads and processes must be greater than zero.")
|
||||||
|
|
||||||
|
if self.num_processes == 0:
|
||||||
|
# Use threading
|
||||||
|
self.queue = queue.Queue()
|
||||||
|
for _ in range(self.num_threads):
|
||||||
|
t = threading.Thread(target=worker_thread_loop, args=(self.queue,))
|
||||||
|
t.daemon = True
|
||||||
|
t.start()
|
||||||
|
self.threads.append(t)
|
||||||
|
else:
|
||||||
|
# Use multiprocessing
|
||||||
|
self.queue = multiprocessing.JoinableQueue()
|
||||||
|
for _ in range(self.num_processes):
|
||||||
|
p = multiprocessing.Process(target=worker_process, args=(self.queue, self.num_threads))
|
||||||
|
p.daemon = True
|
||||||
|
p.start()
|
||||||
|
self.processes.append(p)
|
||||||
|
|
||||||
|
def save_image(self, image: torch.Tensor | np.ndarray | PIL.Image.Image, fpath: Path):
|
||||||
|
if isinstance(image, torch.Tensor):
|
||||||
|
# Convert tensor to numpy array to minimize main process time
|
||||||
|
image = image.cpu().numpy()
|
||||||
|
self.queue.put((image, fpath))
|
||||||
|
|
||||||
|
def wait_until_done(self):
|
||||||
|
self.queue.join()
|
||||||
|
|
||||||
|
def stop(self):
|
||||||
|
if self._stopped:
|
||||||
|
return
|
||||||
|
|
||||||
|
if self.num_processes == 0:
|
||||||
|
for _ in self.threads:
|
||||||
|
self.queue.put(None)
|
||||||
|
for t in self.threads:
|
||||||
|
t.join()
|
||||||
|
else:
|
||||||
|
num_nones = self.num_processes * self.num_threads
|
||||||
|
for _ in range(num_nones):
|
||||||
|
self.queue.put(None)
|
||||||
|
for p in self.processes:
|
||||||
|
p.join()
|
||||||
|
if p.is_alive():
|
||||||
|
p.terminate()
|
||||||
|
self.queue.close()
|
||||||
|
self.queue.join_thread()
|
||||||
|
|
||||||
|
self._stopped = True
|
||||||
File diff suppressed because it is too large
Load Diff
384
lerobot/common/datasets/online_buffer.py
Normal file
384
lerobot/common/datasets/online_buffer.py
Normal file
@@ -0,0 +1,384 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""An online buffer for the online training loop in train.py
|
||||||
|
|
||||||
|
Note to maintainers: This duplicates some logic from LeRobotDataset and EpisodeAwareSampler. We should
|
||||||
|
consider converging to one approach. Here we have opted to use numpy.memmap to back the data buffer. It's much
|
||||||
|
faster than using HuggingFace Datasets as there's no conversion to an intermediate non-python object. Also it
|
||||||
|
supports in-place slicing and mutation which is very handy for a dynamic buffer.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import os
|
||||||
|
from pathlib import Path
|
||||||
|
from typing import Any
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import torch
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
|
||||||
|
|
||||||
|
def _make_memmap_safe(**kwargs) -> np.memmap:
|
||||||
|
"""Make a numpy memmap with checks on available disk space first.
|
||||||
|
|
||||||
|
Expected kwargs are: "filename", "dtype" (must by np.dtype), "mode" and "shape"
|
||||||
|
|
||||||
|
For information on dtypes:
|
||||||
|
https://numpy.org/doc/stable/reference/arrays.dtypes.html#arrays-dtypes-constructing
|
||||||
|
"""
|
||||||
|
if kwargs["mode"].startswith("w"):
|
||||||
|
required_space = kwargs["dtype"].itemsize * np.prod(kwargs["shape"]) # bytes
|
||||||
|
stats = os.statvfs(Path(kwargs["filename"]).parent)
|
||||||
|
available_space = stats.f_bavail * stats.f_frsize # bytes
|
||||||
|
if required_space >= available_space * 0.8:
|
||||||
|
raise RuntimeError(
|
||||||
|
f"You're about to take up {required_space} of {available_space} bytes available."
|
||||||
|
)
|
||||||
|
return np.memmap(**kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
class OnlineBuffer(torch.utils.data.Dataset):
|
||||||
|
"""FIFO data buffer for the online training loop in train.py.
|
||||||
|
|
||||||
|
Follows the protocol of LeRobotDataset as much as is required to have it be used by the online training
|
||||||
|
loop in the same way that a LeRobotDataset would be used.
|
||||||
|
|
||||||
|
The underlying data structure will have data inserted in a circular fashion. Always insert after the
|
||||||
|
last index, and when you reach the end, wrap around to the start.
|
||||||
|
|
||||||
|
The data is stored in a numpy memmap.
|
||||||
|
"""
|
||||||
|
|
||||||
|
NEXT_INDEX_KEY = "_next_index"
|
||||||
|
OCCUPANCY_MASK_KEY = "_occupancy_mask"
|
||||||
|
INDEX_KEY = "index"
|
||||||
|
FRAME_INDEX_KEY = "frame_index"
|
||||||
|
EPISODE_INDEX_KEY = "episode_index"
|
||||||
|
TIMESTAMP_KEY = "timestamp"
|
||||||
|
IS_PAD_POSTFIX = "_is_pad"
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
write_dir: str | Path,
|
||||||
|
data_spec: dict[str, Any] | None,
|
||||||
|
buffer_capacity: int | None,
|
||||||
|
fps: float | None = None,
|
||||||
|
delta_timestamps: dict[str, list[float]] | dict[str, np.ndarray] | None = None,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
The online buffer can be provided from scratch or you can load an existing online buffer by passing
|
||||||
|
a `write_dir` associated with an existing buffer.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
write_dir: Where to keep the numpy memmap files. One memmap file will be stored for each data key.
|
||||||
|
Note that if the files already exist, they are opened in read-write mode (used for training
|
||||||
|
resumption.)
|
||||||
|
data_spec: A mapping from data key to data specification, like {data_key: {"shape": tuple[int],
|
||||||
|
"dtype": np.dtype}}. This should include all the data that you wish to record into the buffer,
|
||||||
|
but note that "index", "frame_index" and "episode_index" are already accounted for by this
|
||||||
|
class, so you don't need to include them.
|
||||||
|
buffer_capacity: How many frames should be stored in the buffer as a maximum. Be aware of your
|
||||||
|
system's available disk space when choosing this.
|
||||||
|
fps: Same as the fps concept in LeRobot dataset. Here it needs to be provided for the
|
||||||
|
delta_timestamps logic. You can pass None if you are not using delta_timestamps.
|
||||||
|
delta_timestamps: Same as the delta_timestamps concept in LeRobotDataset. This is internally
|
||||||
|
converted to dict[str, np.ndarray] for optimization purposes.
|
||||||
|
|
||||||
|
"""
|
||||||
|
self.set_delta_timestamps(delta_timestamps)
|
||||||
|
self._fps = fps
|
||||||
|
# Tolerance in seconds used to discard loaded frames when their timestamps are not close enough from
|
||||||
|
# the requested frames. It is only used when `delta_timestamps` is provided.
|
||||||
|
# minus 1e-4 to account for possible numerical error
|
||||||
|
self.tolerance_s = 1 / self.fps - 1e-4 if fps is not None else None
|
||||||
|
self._buffer_capacity = buffer_capacity
|
||||||
|
data_spec = self._make_data_spec(data_spec, buffer_capacity)
|
||||||
|
Path(write_dir).mkdir(parents=True, exist_ok=True)
|
||||||
|
self._data = {}
|
||||||
|
for k, v in data_spec.items():
|
||||||
|
self._data[k] = _make_memmap_safe(
|
||||||
|
filename=Path(write_dir) / k,
|
||||||
|
dtype=v["dtype"] if v is not None else None,
|
||||||
|
mode="r+" if (Path(write_dir) / k).exists() else "w+",
|
||||||
|
shape=tuple(v["shape"]) if v is not None else None,
|
||||||
|
)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def delta_timestamps(self) -> dict[str, np.ndarray] | None:
|
||||||
|
return self._delta_timestamps
|
||||||
|
|
||||||
|
def set_delta_timestamps(self, value: dict[str, list[float]] | None):
|
||||||
|
"""Set delta_timestamps converting the values to numpy arrays.
|
||||||
|
|
||||||
|
The conversion is for an optimization in the __getitem__. The loop is much slower if the arrays
|
||||||
|
need to be converted into numpy arrays.
|
||||||
|
"""
|
||||||
|
if value is not None:
|
||||||
|
self._delta_timestamps = {k: np.array(v) for k, v in value.items()}
|
||||||
|
else:
|
||||||
|
self._delta_timestamps = None
|
||||||
|
|
||||||
|
def _make_data_spec(self, data_spec: dict[str, Any], buffer_capacity: int) -> dict[str, dict[str, Any]]:
|
||||||
|
"""Makes the data spec for np.memmap."""
|
||||||
|
if any(k.startswith("_") for k in data_spec):
|
||||||
|
raise ValueError(
|
||||||
|
"data_spec keys should not start with '_'. This prefix is reserved for internal logic."
|
||||||
|
)
|
||||||
|
preset_keys = {
|
||||||
|
OnlineBuffer.INDEX_KEY,
|
||||||
|
OnlineBuffer.FRAME_INDEX_KEY,
|
||||||
|
OnlineBuffer.EPISODE_INDEX_KEY,
|
||||||
|
OnlineBuffer.TIMESTAMP_KEY,
|
||||||
|
}
|
||||||
|
if len(intersection := set(data_spec).intersection(preset_keys)) > 0:
|
||||||
|
raise ValueError(
|
||||||
|
f"data_spec should not contain any of {preset_keys} as these are handled internally. "
|
||||||
|
f"The provided data_spec has {intersection}."
|
||||||
|
)
|
||||||
|
complete_data_spec = {
|
||||||
|
# _next_index will be a pointer to the next index that we should start filling from when we add
|
||||||
|
# more data.
|
||||||
|
OnlineBuffer.NEXT_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": ()},
|
||||||
|
# Since the memmap is initialized with all-zeros, this keeps track of which indices are occupied
|
||||||
|
# with real data rather than the dummy initialization.
|
||||||
|
OnlineBuffer.OCCUPANCY_MASK_KEY: {"dtype": np.dtype("?"), "shape": (buffer_capacity,)},
|
||||||
|
OnlineBuffer.INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
|
||||||
|
OnlineBuffer.FRAME_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
|
||||||
|
OnlineBuffer.EPISODE_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
|
||||||
|
OnlineBuffer.TIMESTAMP_KEY: {"dtype": np.dtype("float64"), "shape": (buffer_capacity,)},
|
||||||
|
}
|
||||||
|
for k, v in data_spec.items():
|
||||||
|
complete_data_spec[k] = {"dtype": v["dtype"], "shape": (buffer_capacity, *v["shape"])}
|
||||||
|
return complete_data_spec
|
||||||
|
|
||||||
|
def add_data(self, data: dict[str, np.ndarray]):
|
||||||
|
"""Add new data to the buffer, which could potentially mean shifting old data out.
|
||||||
|
|
||||||
|
The new data should contain all the frames (in order) of any number of episodes. The indices should
|
||||||
|
start from 0 (note to the developer: this can easily be generalized). See the `rollout` and
|
||||||
|
`eval_policy` functions in `eval.py` for more information on how the data is constructed.
|
||||||
|
|
||||||
|
Shift the incoming data index and episode_index to continue on from the last frame. Note that this
|
||||||
|
will be done in place!
|
||||||
|
"""
|
||||||
|
if len(missing_keys := (set(self.data_keys).difference(set(data)))) > 0:
|
||||||
|
raise ValueError(f"Missing data keys: {missing_keys}")
|
||||||
|
new_data_length = len(data[self.data_keys[0]])
|
||||||
|
if not all(len(data[k]) == new_data_length for k in self.data_keys):
|
||||||
|
raise ValueError("All data items should have the same length")
|
||||||
|
|
||||||
|
next_index = self._data[OnlineBuffer.NEXT_INDEX_KEY]
|
||||||
|
|
||||||
|
# Sanity check to make sure that the new data indices start from 0.
|
||||||
|
assert data[OnlineBuffer.EPISODE_INDEX_KEY][0].item() == 0
|
||||||
|
assert data[OnlineBuffer.INDEX_KEY][0].item() == 0
|
||||||
|
|
||||||
|
# Shift the incoming indices if necessary.
|
||||||
|
if self.num_frames > 0:
|
||||||
|
last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][next_index - 1]
|
||||||
|
last_data_index = self._data[OnlineBuffer.INDEX_KEY][next_index - 1]
|
||||||
|
data[OnlineBuffer.EPISODE_INDEX_KEY] += last_episode_index + 1
|
||||||
|
data[OnlineBuffer.INDEX_KEY] += last_data_index + 1
|
||||||
|
|
||||||
|
# Insert the new data starting from next_index. It may be necessary to wrap around to the start.
|
||||||
|
n_surplus = max(0, new_data_length - (self._buffer_capacity - next_index))
|
||||||
|
for k in self.data_keys:
|
||||||
|
if n_surplus == 0:
|
||||||
|
slc = slice(next_index, next_index + new_data_length)
|
||||||
|
self._data[k][slc] = data[k]
|
||||||
|
self._data[OnlineBuffer.OCCUPANCY_MASK_KEY][slc] = True
|
||||||
|
else:
|
||||||
|
self._data[k][next_index:] = data[k][:-n_surplus]
|
||||||
|
self._data[OnlineBuffer.OCCUPANCY_MASK_KEY][next_index:] = True
|
||||||
|
self._data[k][:n_surplus] = data[k][-n_surplus:]
|
||||||
|
if n_surplus == 0:
|
||||||
|
self._data[OnlineBuffer.NEXT_INDEX_KEY] = next_index + new_data_length
|
||||||
|
else:
|
||||||
|
self._data[OnlineBuffer.NEXT_INDEX_KEY] = n_surplus
|
||||||
|
|
||||||
|
@property
|
||||||
|
def data_keys(self) -> list[str]:
|
||||||
|
keys = set(self._data)
|
||||||
|
keys.remove(OnlineBuffer.OCCUPANCY_MASK_KEY)
|
||||||
|
keys.remove(OnlineBuffer.NEXT_INDEX_KEY)
|
||||||
|
return sorted(keys)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def fps(self) -> float | None:
|
||||||
|
return self._fps
|
||||||
|
|
||||||
|
@property
|
||||||
|
def num_episodes(self) -> int:
|
||||||
|
return len(
|
||||||
|
np.unique(self._data[OnlineBuffer.EPISODE_INDEX_KEY][self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]])
|
||||||
|
)
|
||||||
|
|
||||||
|
@property
|
||||||
|
def num_frames(self) -> int:
|
||||||
|
return np.count_nonzero(self._data[OnlineBuffer.OCCUPANCY_MASK_KEY])
|
||||||
|
|
||||||
|
def __len__(self):
|
||||||
|
return self.num_frames
|
||||||
|
|
||||||
|
def _item_to_tensors(self, item: dict) -> dict:
|
||||||
|
item_ = {}
|
||||||
|
for k, v in item.items():
|
||||||
|
if isinstance(v, torch.Tensor):
|
||||||
|
item_[k] = v
|
||||||
|
elif isinstance(v, np.ndarray):
|
||||||
|
item_[k] = torch.from_numpy(v)
|
||||||
|
else:
|
||||||
|
item_[k] = torch.tensor(v)
|
||||||
|
return item_
|
||||||
|
|
||||||
|
def __getitem__(self, idx: int) -> dict[str, torch.Tensor]:
|
||||||
|
if idx >= len(self) or idx < -len(self):
|
||||||
|
raise IndexError
|
||||||
|
|
||||||
|
item = {k: v[idx] for k, v in self._data.items() if not k.startswith("_")}
|
||||||
|
|
||||||
|
if self.delta_timestamps is None:
|
||||||
|
return self._item_to_tensors(item)
|
||||||
|
|
||||||
|
episode_index = item[OnlineBuffer.EPISODE_INDEX_KEY]
|
||||||
|
current_ts = item[OnlineBuffer.TIMESTAMP_KEY]
|
||||||
|
episode_data_indices = np.where(
|
||||||
|
np.bitwise_and(
|
||||||
|
self._data[OnlineBuffer.EPISODE_INDEX_KEY] == episode_index,
|
||||||
|
self._data[OnlineBuffer.OCCUPANCY_MASK_KEY],
|
||||||
|
)
|
||||||
|
)[0]
|
||||||
|
episode_timestamps = self._data[OnlineBuffer.TIMESTAMP_KEY][episode_data_indices]
|
||||||
|
|
||||||
|
for data_key in self.delta_timestamps:
|
||||||
|
# Note: The logic in this loop is copied from `load_previous_and_future_frames`.
|
||||||
|
# Get timestamps used as query to retrieve data of previous/future frames.
|
||||||
|
query_ts = current_ts + self.delta_timestamps[data_key]
|
||||||
|
|
||||||
|
# Compute distances between each query timestamp and all timestamps of all the frames belonging to
|
||||||
|
# the episode.
|
||||||
|
dist = np.abs(query_ts[:, None] - episode_timestamps[None, :])
|
||||||
|
argmin_ = np.argmin(dist, axis=1)
|
||||||
|
min_ = dist[np.arange(dist.shape[0]), argmin_]
|
||||||
|
|
||||||
|
is_pad = min_ > self.tolerance_s
|
||||||
|
|
||||||
|
# Check violated query timestamps are all outside the episode range.
|
||||||
|
assert (
|
||||||
|
(query_ts[is_pad] < episode_timestamps[0]) | (episode_timestamps[-1] < query_ts[is_pad])
|
||||||
|
).all(), (
|
||||||
|
f"One or several timestamps unexpectedly violate the tolerance ({min_} > {self.tolerance_s=}"
|
||||||
|
") inside the episode range."
|
||||||
|
)
|
||||||
|
|
||||||
|
# Load frames for this data key.
|
||||||
|
item[data_key] = self._data[data_key][episode_data_indices[argmin_]]
|
||||||
|
|
||||||
|
item[f"{data_key}{OnlineBuffer.IS_PAD_POSTFIX}"] = is_pad
|
||||||
|
|
||||||
|
return self._item_to_tensors(item)
|
||||||
|
|
||||||
|
def get_data_by_key(self, key: str) -> torch.Tensor:
|
||||||
|
"""Returns all data for a given data key as a Tensor."""
|
||||||
|
return torch.from_numpy(self._data[key][self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]])
|
||||||
|
|
||||||
|
|
||||||
|
def compute_sampler_weights(
|
||||||
|
offline_dataset: LeRobotDataset,
|
||||||
|
offline_drop_n_last_frames: int = 0,
|
||||||
|
online_dataset: OnlineBuffer | None = None,
|
||||||
|
online_sampling_ratio: float | None = None,
|
||||||
|
online_drop_n_last_frames: int = 0,
|
||||||
|
) -> torch.Tensor:
|
||||||
|
"""Compute the sampling weights for the online training dataloader in train.py.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
offline_dataset: The LeRobotDataset used for offline pre-training.
|
||||||
|
online_drop_n_last_frames: Number of frames to drop from the end of each offline dataset episode.
|
||||||
|
online_dataset: The OnlineBuffer used in online training.
|
||||||
|
online_sampling_ratio: The proportion of data that should be sampled from the online dataset. If an
|
||||||
|
online dataset is provided, this value must also be provided.
|
||||||
|
online_drop_n_first_frames: See `offline_drop_n_last_frames`. This is the same, but for the online
|
||||||
|
dataset.
|
||||||
|
Returns:
|
||||||
|
Tensor of weights for [offline_dataset; online_dataset], normalized to 1.
|
||||||
|
|
||||||
|
Notes to maintainers:
|
||||||
|
- This duplicates some logic from EpisodeAwareSampler. We should consider converging to one approach.
|
||||||
|
- When used with `torch.utils.data.WeightedRandomSampler`, it could completely replace
|
||||||
|
`EpisodeAwareSampler` as the online dataset related arguments are optional. The only missing feature
|
||||||
|
is the ability to turn shuffling off.
|
||||||
|
- Options `drop_first_n_frames` and `episode_indices_to_use` can be added easily. They were not
|
||||||
|
included here to avoid adding complexity.
|
||||||
|
"""
|
||||||
|
if len(offline_dataset) == 0 and (online_dataset is None or len(online_dataset) == 0):
|
||||||
|
raise ValueError("At least one of `offline_dataset` or `online_dataset` should be contain data.")
|
||||||
|
if (online_dataset is None) ^ (online_sampling_ratio is None):
|
||||||
|
raise ValueError(
|
||||||
|
"`online_dataset` and `online_sampling_ratio` must be provided together or not at all."
|
||||||
|
)
|
||||||
|
offline_sampling_ratio = 0 if online_sampling_ratio is None else 1 - online_sampling_ratio
|
||||||
|
|
||||||
|
weights = []
|
||||||
|
|
||||||
|
if len(offline_dataset) > 0:
|
||||||
|
offline_data_mask_indices = []
|
||||||
|
for start_index, end_index in zip(
|
||||||
|
offline_dataset.episode_data_index["from"],
|
||||||
|
offline_dataset.episode_data_index["to"],
|
||||||
|
strict=True,
|
||||||
|
):
|
||||||
|
offline_data_mask_indices.extend(
|
||||||
|
range(start_index.item(), end_index.item() - offline_drop_n_last_frames)
|
||||||
|
)
|
||||||
|
offline_data_mask = torch.zeros(len(offline_dataset), dtype=torch.bool)
|
||||||
|
offline_data_mask[torch.tensor(offline_data_mask_indices)] = True
|
||||||
|
weights.append(
|
||||||
|
torch.full(
|
||||||
|
size=(len(offline_dataset),),
|
||||||
|
fill_value=offline_sampling_ratio / offline_data_mask.sum(),
|
||||||
|
)
|
||||||
|
* offline_data_mask
|
||||||
|
)
|
||||||
|
|
||||||
|
if online_dataset is not None and len(online_dataset) > 0:
|
||||||
|
online_data_mask_indices = []
|
||||||
|
episode_indices = online_dataset.get_data_by_key("episode_index")
|
||||||
|
for episode_idx in torch.unique(episode_indices):
|
||||||
|
where_episode = torch.where(episode_indices == episode_idx)
|
||||||
|
start_index = where_episode[0][0]
|
||||||
|
end_index = where_episode[0][-1] + 1
|
||||||
|
online_data_mask_indices.extend(
|
||||||
|
range(start_index.item(), end_index.item() - online_drop_n_last_frames)
|
||||||
|
)
|
||||||
|
online_data_mask = torch.zeros(len(online_dataset), dtype=torch.bool)
|
||||||
|
online_data_mask[torch.tensor(online_data_mask_indices)] = True
|
||||||
|
weights.append(
|
||||||
|
torch.full(
|
||||||
|
size=(len(online_dataset),),
|
||||||
|
fill_value=online_sampling_ratio / online_data_mask.sum(),
|
||||||
|
)
|
||||||
|
* online_data_mask
|
||||||
|
)
|
||||||
|
|
||||||
|
weights = torch.cat(weights)
|
||||||
|
|
||||||
|
if weights.sum() == 0:
|
||||||
|
weights += 1 / len(weights)
|
||||||
|
else:
|
||||||
|
weights /= weights.sum()
|
||||||
|
|
||||||
|
return weights
|
||||||
@@ -0,0 +1,56 @@
|
|||||||
|
## Using / Updating `CODEBASE_VERSION` (for maintainers)
|
||||||
|
|
||||||
|
Since our dataset pushed to the hub are decoupled with the evolution of this repo, we ensure compatibility of
|
||||||
|
the datasets with our code, we use a `CODEBASE_VERSION` (defined in
|
||||||
|
lerobot/common/datasets/lerobot_dataset.py) variable.
|
||||||
|
|
||||||
|
For instance, [`lerobot/pusht`](https://huggingface.co/datasets/lerobot/pusht) has many versions to maintain backward compatibility between LeRobot codebase versions:
|
||||||
|
- [v1.0](https://huggingface.co/datasets/lerobot/pusht/tree/v1.0)
|
||||||
|
- [v1.1](https://huggingface.co/datasets/lerobot/pusht/tree/v1.1)
|
||||||
|
- [v1.2](https://huggingface.co/datasets/lerobot/pusht/tree/v1.2)
|
||||||
|
- [v1.3](https://huggingface.co/datasets/lerobot/pusht/tree/v1.3)
|
||||||
|
- [v1.4](https://huggingface.co/datasets/lerobot/pusht/tree/v1.4)
|
||||||
|
- [v1.5](https://huggingface.co/datasets/lerobot/pusht/tree/v1.5)
|
||||||
|
- [v1.6](https://huggingface.co/datasets/lerobot/pusht/tree/v1.6) <-- last version
|
||||||
|
- [main](https://huggingface.co/datasets/lerobot/pusht/tree/main) <-- points to the last version
|
||||||
|
|
||||||
|
Starting with v1.6, every dataset pushed to the hub or saved locally also have this version number in their
|
||||||
|
`info.json` metadata.
|
||||||
|
|
||||||
|
### Uploading a new dataset
|
||||||
|
If you are pushing a new dataset, you don't need to worry about any of the instructions below, nor to be
|
||||||
|
compatible with previous codebase versions. The `push_dataset_to_hub.py` script will automatically tag your
|
||||||
|
dataset with the current `CODEBASE_VERSION`.
|
||||||
|
|
||||||
|
### Updating an existing dataset
|
||||||
|
If you want to update an existing dataset, you need to change the `CODEBASE_VERSION` from `lerobot_dataset.py`
|
||||||
|
before running `push_dataset_to_hub.py`. This is especially useful if you introduce a breaking change
|
||||||
|
intentionally or not (i.e. something not backward compatible such as modifying the reward functions used,
|
||||||
|
deleting some frames at the end of an episode, etc.). That way, people running a previous version of the
|
||||||
|
codebase won't be affected by your change and backward compatibility is maintained.
|
||||||
|
|
||||||
|
However, you will need to update the version of ALL the other datasets so that they have the new
|
||||||
|
`CODEBASE_VERSION` as a branch in their hugging face dataset repository. Don't worry, there is an easy way
|
||||||
|
that doesn't require to run `push_dataset_to_hub.py`. You can just "branch-out" from the `main` branch on HF
|
||||||
|
dataset repo by running this script which corresponds to a `git checkout -b` (so no copy or upload needed):
|
||||||
|
|
||||||
|
```python
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
|
||||||
|
from lerobot import available_datasets
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
|
||||||
|
api = HfApi()
|
||||||
|
|
||||||
|
for repo_id in available_datasets:
|
||||||
|
dataset_info = api.list_repo_refs(repo_id, repo_type="dataset")
|
||||||
|
branches = [b.name for b in dataset_info.branches]
|
||||||
|
if CODEBASE_VERSION in branches:
|
||||||
|
print(f"{repo_id} already @{CODEBASE_VERSION}, skipping.")
|
||||||
|
continue
|
||||||
|
else:
|
||||||
|
# Now create a branch named after the new version by branching out from "main"
|
||||||
|
# which is expected to be the preceding version
|
||||||
|
api.create_branch(repo_id, repo_type="dataset", branch=CODEBASE_VERSION, revision="main")
|
||||||
|
print(f"{repo_id} successfully updated @{CODEBASE_VERSION}")
|
||||||
|
```
|
||||||
@@ -14,156 +14,189 @@
|
|||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
"""
|
"""
|
||||||
This file contains all obsolete download scripts. They are centralized here to not have to load
|
This file contains download scripts for raw datasets.
|
||||||
useless dependencies when using datasets.
|
|
||||||
|
Example of usage:
|
||||||
|
```
|
||||||
|
python lerobot/common/datasets/push_dataset_to_hub/_download_raw.py \
|
||||||
|
--raw-dir data/lerobot-raw/pusht_raw \
|
||||||
|
--repo-id lerobot-raw/pusht_raw
|
||||||
|
```
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import io
|
import argparse
|
||||||
import logging
|
import logging
|
||||||
import shutil
|
import warnings
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
|
||||||
import tqdm
|
|
||||||
from huggingface_hub import snapshot_download
|
from huggingface_hub import snapshot_download
|
||||||
|
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
|
||||||
|
|
||||||
def download_raw(raw_dir, dataset_id):
|
# {raw_repo_id: raw_format}
|
||||||
if "aloha" in dataset_id or "image" in dataset_id:
|
AVAILABLE_RAW_REPO_IDS = {
|
||||||
download_hub(raw_dir, dataset_id)
|
"lerobot-raw/aloha_mobile_cabinet_raw": "aloha_hdf5",
|
||||||
elif "pusht" in dataset_id:
|
"lerobot-raw/aloha_mobile_chair_raw": "aloha_hdf5",
|
||||||
download_pusht(raw_dir)
|
"lerobot-raw/aloha_mobile_elevator_raw": "aloha_hdf5",
|
||||||
elif "xarm" in dataset_id:
|
"lerobot-raw/aloha_mobile_shrimp_raw": "aloha_hdf5",
|
||||||
download_xarm(raw_dir)
|
"lerobot-raw/aloha_mobile_wash_pan_raw": "aloha_hdf5",
|
||||||
elif "umi" in dataset_id:
|
"lerobot-raw/aloha_mobile_wipe_wine_raw": "aloha_hdf5",
|
||||||
download_umi(raw_dir)
|
"lerobot-raw/aloha_sim_insertion_human_raw": "aloha_hdf5",
|
||||||
else:
|
"lerobot-raw/aloha_sim_insertion_scripted_raw": "aloha_hdf5",
|
||||||
raise ValueError(dataset_id)
|
"lerobot-raw/aloha_sim_transfer_cube_human_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_sim_transfer_cube_scripted_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_battery_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_candy_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_coffee_new_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_coffee_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_cups_open_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_fork_pick_up_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_pingpong_test_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_pro_pencil_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_screw_driver_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_tape_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_thread_velcro_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_towel_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
|
||||||
|
"lerobot-raw/pusht_raw": "pusht_zarr",
|
||||||
|
"lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/unitreeh1_warehouse_raw": "aloha_hdf5",
|
||||||
|
"lerobot-raw/xarm_lift_medium_raw": "xarm_pkl",
|
||||||
|
"lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
|
||||||
|
"lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
|
||||||
|
"lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
|
||||||
|
"lerobot-raw/fractal20220817_data_raw": "openx_rlds.fractal20220817_data",
|
||||||
|
"lerobot-raw/kuka_raw": "openx_rlds.kuka",
|
||||||
|
"lerobot-raw/bridge_openx_raw": "openx_rlds.bridge_openx",
|
||||||
|
"lerobot-raw/taco_play_raw": "openx_rlds.taco_play",
|
||||||
|
"lerobot-raw/jaco_play_raw": "openx_rlds.jaco_play",
|
||||||
|
"lerobot-raw/berkeley_cable_routing_raw": "openx_rlds.berkeley_cable_routing",
|
||||||
|
"lerobot-raw/roboturk_raw": "openx_rlds.roboturk",
|
||||||
|
"lerobot-raw/nyu_door_opening_surprising_effectiveness_raw": "openx_rlds.nyu_door_opening_surprising_effectiveness",
|
||||||
|
"lerobot-raw/viola_raw": "openx_rlds.viola",
|
||||||
|
"lerobot-raw/berkeley_autolab_ur5_raw": "openx_rlds.berkeley_autolab_ur5",
|
||||||
|
"lerobot-raw/toto_raw": "openx_rlds.toto",
|
||||||
|
"lerobot-raw/language_table_raw": "openx_rlds.language_table",
|
||||||
|
"lerobot-raw/columbia_cairlab_pusht_real_raw": "openx_rlds.columbia_cairlab_pusht_real",
|
||||||
|
"lerobot-raw/stanford_kuka_multimodal_dataset_raw": "openx_rlds.stanford_kuka_multimodal_dataset",
|
||||||
|
"lerobot-raw/nyu_rot_dataset_raw": "openx_rlds.nyu_rot_dataset",
|
||||||
|
"lerobot-raw/io_ai_tech_raw": "openx_rlds.io_ai_tech",
|
||||||
|
"lerobot-raw/stanford_hydra_dataset_raw": "openx_rlds.stanford_hydra_dataset",
|
||||||
|
"lerobot-raw/austin_buds_dataset_raw": "openx_rlds.austin_buds_dataset",
|
||||||
|
"lerobot-raw/nyu_franka_play_dataset_raw": "openx_rlds.nyu_franka_play_dataset",
|
||||||
|
"lerobot-raw/maniskill_dataset_raw": "openx_rlds.maniskill_dataset",
|
||||||
|
"lerobot-raw/furniture_bench_dataset_raw": "openx_rlds.furniture_bench_dataset",
|
||||||
|
"lerobot-raw/cmu_franka_exploration_dataset_raw": "openx_rlds.cmu_franka_exploration_dataset",
|
||||||
|
"lerobot-raw/ucsd_kitchen_dataset_raw": "openx_rlds.ucsd_kitchen_dataset",
|
||||||
|
"lerobot-raw/ucsd_pick_and_place_dataset_raw": "openx_rlds.ucsd_pick_and_place_dataset",
|
||||||
|
"lerobot-raw/spoc_raw": "openx_rlds.spoc",
|
||||||
|
"lerobot-raw/austin_sailor_dataset_raw": "openx_rlds.austin_sailor_dataset",
|
||||||
|
"lerobot-raw/austin_sirius_dataset_raw": "openx_rlds.austin_sirius_dataset",
|
||||||
|
"lerobot-raw/bc_z_raw": "openx_rlds.bc_z",
|
||||||
|
"lerobot-raw/utokyo_pr2_opening_fridge_raw": "openx_rlds.utokyo_pr2_opening_fridge",
|
||||||
|
"lerobot-raw/utokyo_pr2_tabletop_manipulation_raw": "openx_rlds.utokyo_pr2_tabletop_manipulation",
|
||||||
|
"lerobot-raw/utokyo_xarm_pick_and_place_raw": "openx_rlds.utokyo_xarm_pick_and_place",
|
||||||
|
"lerobot-raw/utokyo_xarm_bimanual_raw": "openx_rlds.utokyo_xarm_bimanual",
|
||||||
|
"lerobot-raw/utokyo_saytap_raw": "openx_rlds.utokyo_saytap",
|
||||||
|
"lerobot-raw/robo_net_raw": "openx_rlds.robo_net",
|
||||||
|
"lerobot-raw/robo_set_raw": "openx_rlds.robo_set",
|
||||||
|
"lerobot-raw/berkeley_mvp_raw": "openx_rlds.berkeley_mvp",
|
||||||
|
"lerobot-raw/berkeley_rpt_raw": "openx_rlds.berkeley_rpt",
|
||||||
|
"lerobot-raw/kaist_nonprehensile_raw": "openx_rlds.kaist_nonprehensile",
|
||||||
|
"lerobot-raw/stanford_mask_vit_raw": "openx_rlds.stanford_mask_vit",
|
||||||
|
"lerobot-raw/tokyo_u_lsmo_raw": "openx_rlds.tokyo_u_lsmo",
|
||||||
|
"lerobot-raw/dlr_sara_pour_raw": "openx_rlds.dlr_sara_pour",
|
||||||
|
"lerobot-raw/dlr_sara_grid_clamp_raw": "openx_rlds.dlr_sara_grid_clamp",
|
||||||
|
"lerobot-raw/dlr_edan_shared_control_raw": "openx_rlds.dlr_edan_shared_control",
|
||||||
|
"lerobot-raw/asu_table_top_raw": "openx_rlds.asu_table_top",
|
||||||
|
"lerobot-raw/stanford_robocook_raw": "openx_rlds.stanford_robocook",
|
||||||
|
"lerobot-raw/imperialcollege_sawyer_wrist_cam_raw": "openx_rlds.imperialcollege_sawyer_wrist_cam",
|
||||||
|
"lerobot-raw/iamlab_cmu_pickup_insert_raw": "openx_rlds.iamlab_cmu_pickup_insert",
|
||||||
|
"lerobot-raw/uiuc_d3field_raw": "openx_rlds.uiuc_d3field",
|
||||||
|
"lerobot-raw/utaustin_mutex_raw": "openx_rlds.utaustin_mutex",
|
||||||
|
"lerobot-raw/berkeley_fanuc_manipulation_raw": "openx_rlds.berkeley_fanuc_manipulation",
|
||||||
|
"lerobot-raw/cmu_playing_with_food_raw": "openx_rlds.cmu_playing_with_food",
|
||||||
|
"lerobot-raw/cmu_play_fusion_raw": "openx_rlds.cmu_play_fusion",
|
||||||
|
"lerobot-raw/cmu_stretch_raw": "openx_rlds.cmu_stretch",
|
||||||
|
"lerobot-raw/berkeley_gnm_recon_raw": "openx_rlds.berkeley_gnm_recon",
|
||||||
|
"lerobot-raw/berkeley_gnm_cory_hall_raw": "openx_rlds.berkeley_gnm_cory_hall",
|
||||||
|
"lerobot-raw/berkeley_gnm_sac_son_raw": "openx_rlds.berkeley_gnm_sac_son",
|
||||||
|
"lerobot-raw/droid_raw": "openx_rlds.droid",
|
||||||
|
"lerobot-raw/droid_100_raw": "openx_rlds.droid100",
|
||||||
|
"lerobot-raw/fmb_raw": "openx_rlds.fmb",
|
||||||
|
"lerobot-raw/dobbe_raw": "openx_rlds.dobbe",
|
||||||
|
"lerobot-raw/usc_cloth_sim_raw": "openx_rlds.usc_cloth_sim",
|
||||||
|
"lerobot-raw/plex_robosuite_raw": "openx_rlds.plex_robosuite",
|
||||||
|
"lerobot-raw/conq_hose_manipulation_raw": "openx_rlds.conq_hose_manipulation",
|
||||||
|
"lerobot-raw/vima_raw": "openx_rlds.vima",
|
||||||
|
"lerobot-raw/robot_vqa_raw": "openx_rlds.robot_vqa",
|
||||||
|
"lerobot-raw/mimic_play_raw": "openx_rlds.mimic_play",
|
||||||
|
"lerobot-raw/tidybot_raw": "openx_rlds.tidybot",
|
||||||
|
"lerobot-raw/eth_agent_affordances_raw": "openx_rlds.eth_agent_affordances",
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
def download_and_extract_zip(url: str, destination_folder: Path) -> bool:
|
def download_raw(raw_dir: Path, repo_id: str):
|
||||||
import zipfile
|
check_repo_id(repo_id)
|
||||||
|
user_id, dataset_id = repo_id.split("/")
|
||||||
|
|
||||||
import requests
|
if not dataset_id.endswith("_raw"):
|
||||||
|
warnings.warn(
|
||||||
|
f"""`dataset_id` ({dataset_id}) doesn't end with '_raw' (e.g. 'lerobot/pusht_raw'). Following this
|
||||||
|
naming convention by renaming your repository is advised, but not mandatory.""",
|
||||||
|
stacklevel=1,
|
||||||
|
)
|
||||||
|
|
||||||
print(f"downloading from {url}")
|
# Send warning if raw_dir isn't well formated
|
||||||
response = requests.get(url, stream=True)
|
if raw_dir.parts[-2] != user_id or raw_dir.parts[-1] != dataset_id:
|
||||||
if response.status_code == 200:
|
warnings.warn(
|
||||||
total_size = int(response.headers.get("content-length", 0))
|
f"""`raw_dir` ({raw_dir}) doesn't contain a community or user id `/` the name of the dataset that
|
||||||
progress_bar = tqdm.tqdm(total=total_size, unit="B", unit_scale=True)
|
match the `repo_id` (e.g. 'data/lerobot/pusht_raw'). Following this naming convention is advised,
|
||||||
|
but not mandatory.""",
|
||||||
zip_file = io.BytesIO()
|
stacklevel=1,
|
||||||
for chunk in response.iter_content(chunk_size=1024):
|
)
|
||||||
if chunk:
|
|
||||||
zip_file.write(chunk)
|
|
||||||
progress_bar.update(len(chunk))
|
|
||||||
|
|
||||||
progress_bar.close()
|
|
||||||
|
|
||||||
zip_file.seek(0)
|
|
||||||
|
|
||||||
with zipfile.ZipFile(zip_file, "r") as zip_ref:
|
|
||||||
zip_ref.extractall(destination_folder)
|
|
||||||
|
|
||||||
|
|
||||||
def download_pusht(raw_dir: str):
|
|
||||||
pusht_url = "https://diffusion-policy.cs.columbia.edu/data/training/pusht.zip"
|
|
||||||
|
|
||||||
raw_dir = Path(raw_dir)
|
|
||||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
|
||||||
download_and_extract_zip(pusht_url, raw_dir)
|
|
||||||
# file is created inside a useful "pusht" directory, so we move it out and delete the dir
|
|
||||||
zarr_path = raw_dir / "pusht_cchi_v7_replay.zarr"
|
|
||||||
shutil.move(raw_dir / "pusht" / "pusht_cchi_v7_replay.zarr", zarr_path)
|
|
||||||
shutil.rmtree(raw_dir / "pusht")
|
|
||||||
|
|
||||||
|
|
||||||
def download_xarm(raw_dir: Path):
|
|
||||||
"""Download all xarm datasets at once"""
|
|
||||||
import zipfile
|
|
||||||
|
|
||||||
import gdown
|
|
||||||
|
|
||||||
raw_dir = Path(raw_dir)
|
|
||||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
|
||||||
# from https://github.com/fyhMer/fowm/blob/main/scripts/download_datasets.py
|
|
||||||
url = "https://drive.google.com/uc?id=1nhxpykGtPDhmQKm-_B8zBSywVRdgeVya"
|
|
||||||
zip_path = raw_dir / "data.zip"
|
|
||||||
gdown.download(url, str(zip_path), quiet=False)
|
|
||||||
print("Extracting...")
|
|
||||||
with zipfile.ZipFile(str(zip_path), "r") as zip_f:
|
|
||||||
for pkl_path in zip_f.namelist():
|
|
||||||
if pkl_path.startswith("data/xarm") and pkl_path.endswith(".pkl"):
|
|
||||||
zip_f.extract(member=pkl_path)
|
|
||||||
# move to corresponding raw directory
|
|
||||||
extract_dir = pkl_path.replace("/buffer.pkl", "")
|
|
||||||
raw_pkl_path = raw_dir / "buffer.pkl"
|
|
||||||
shutil.move(pkl_path, raw_pkl_path)
|
|
||||||
shutil.rmtree(extract_dir)
|
|
||||||
zip_path.unlink()
|
|
||||||
|
|
||||||
|
|
||||||
def download_hub(raw_dir: Path, dataset_id: str):
|
|
||||||
raw_dir = Path(raw_dir)
|
|
||||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
logging.info(f"Start downloading from huggingface.co/cadene for {dataset_id}")
|
logging.info(f"Start downloading from huggingface.co/{user_id} for {dataset_id}")
|
||||||
snapshot_download(f"cadene/{dataset_id}_raw", repo_type="dataset", local_dir=raw_dir)
|
snapshot_download(repo_id, repo_type="dataset", local_dir=raw_dir)
|
||||||
logging.info(f"Finish downloading from huggingface.co/cadene for {dataset_id}")
|
logging.info(f"Finish downloading from huggingface.co/{user_id} for {dataset_id}")
|
||||||
|
|
||||||
|
|
||||||
def download_umi(raw_dir: Path):
|
def download_all_raw_datasets(data_dir: Path | None = None):
|
||||||
url_cup_in_the_wild = "https://real.stanford.edu/umi/data/zarr_datasets/cup_in_the_wild.zarr.zip"
|
if data_dir is None:
|
||||||
zarr_path = raw_dir / "cup_in_the_wild.zarr"
|
data_dir = Path("data")
|
||||||
|
for repo_id in AVAILABLE_RAW_REPO_IDS:
|
||||||
|
raw_dir = data_dir / repo_id
|
||||||
|
download_raw(raw_dir, repo_id)
|
||||||
|
|
||||||
raw_dir = Path(raw_dir)
|
|
||||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
def main():
|
||||||
download_and_extract_zip(url_cup_in_the_wild, zarr_path)
|
parser = argparse.ArgumentParser(
|
||||||
|
description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
|
||||||
|
non exhaustive list of available repositories to use in `--repo-id`: {list(AVAILABLE_RAW_REPO_IDS.keys())}""",
|
||||||
|
)
|
||||||
|
|
||||||
|
parser.add_argument(
|
||||||
|
"--raw-dir",
|
||||||
|
type=Path,
|
||||||
|
required=True,
|
||||||
|
help="Directory containing input raw datasets (e.g. `data/aloha_mobile_chair_raw` or `data/pusht_raw).",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--repo-id",
|
||||||
|
type=str,
|
||||||
|
required=True,
|
||||||
|
help="""Repositery identifier on Hugging Face: a community or a user name `/` the name of
|
||||||
|
the dataset (e.g. `lerobot/pusht_raw`, `cadene/aloha_sim_insertion_human_raw`).""",
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
download_raw(**vars(args))
|
||||||
|
|
||||||
|
|
||||||
if __name__ == "__main__":
|
if __name__ == "__main__":
|
||||||
data_dir = Path("data")
|
main()
|
||||||
dataset_ids = [
|
|
||||||
"pusht_image",
|
|
||||||
"xarm_lift_medium_image",
|
|
||||||
"xarm_lift_medium_replay_image",
|
|
||||||
"xarm_push_medium_image",
|
|
||||||
"xarm_push_medium_replay_image",
|
|
||||||
"aloha_sim_insertion_human_image",
|
|
||||||
"aloha_sim_insertion_scripted_image",
|
|
||||||
"aloha_sim_transfer_cube_human_image",
|
|
||||||
"aloha_sim_transfer_cube_scripted_image",
|
|
||||||
"pusht",
|
|
||||||
"xarm_lift_medium",
|
|
||||||
"xarm_lift_medium_replay",
|
|
||||||
"xarm_push_medium",
|
|
||||||
"xarm_push_medium_replay",
|
|
||||||
"aloha_sim_insertion_human",
|
|
||||||
"aloha_sim_insertion_scripted",
|
|
||||||
"aloha_sim_transfer_cube_human",
|
|
||||||
"aloha_sim_transfer_cube_scripted",
|
|
||||||
"aloha_mobile_cabinet",
|
|
||||||
"aloha_mobile_chair",
|
|
||||||
"aloha_mobile_elevator",
|
|
||||||
"aloha_mobile_shrimp",
|
|
||||||
"aloha_mobile_wash_pan",
|
|
||||||
"aloha_mobile_wipe_wine",
|
|
||||||
"aloha_static_battery",
|
|
||||||
"aloha_static_candy",
|
|
||||||
"aloha_static_coffee",
|
|
||||||
"aloha_static_coffee_new",
|
|
||||||
"aloha_static_cups_open",
|
|
||||||
"aloha_static_fork_pick_up",
|
|
||||||
"aloha_static_pingpong_test",
|
|
||||||
"aloha_static_pro_pencil",
|
|
||||||
"aloha_static_screw_driver",
|
|
||||||
"aloha_static_tape",
|
|
||||||
"aloha_static_thread_velcro",
|
|
||||||
"aloha_static_towel",
|
|
||||||
"aloha_static_vinh_cup",
|
|
||||||
"aloha_static_vinh_cup_left",
|
|
||||||
"aloha_static_ziploc_slide",
|
|
||||||
"umi_cup_in_the_wild",
|
|
||||||
]
|
|
||||||
for dataset_id in dataset_ids:
|
|
||||||
raw_dir = data_dir / f"{dataset_id}_raw"
|
|
||||||
download_raw(raw_dir, dataset_id)
|
|
||||||
|
|||||||
184
lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py
Normal file
184
lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py
Normal file
@@ -0,0 +1,184 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""
|
||||||
|
Use this script to batch encode lerobot dataset from their raw format to LeRobotDataset and push their updated
|
||||||
|
version to the hub. Under the hood, this script reuses 'push_dataset_to_hub.py'. It assumes that you already
|
||||||
|
downloaded raw datasets, which you can do with the related '_download_raw.py' script.
|
||||||
|
|
||||||
|
For instance, for codebase_version = 'v1.6', the following command was run, assuming raw datasets from
|
||||||
|
lerobot-raw were downloaded in 'raw/datasets/directory':
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py \
|
||||||
|
--raw-dir raw/datasets/directory \
|
||||||
|
--raw-repo-ids lerobot-raw \
|
||||||
|
--local-dir push/datasets/directory \
|
||||||
|
--tests-data-dir tests/data \
|
||||||
|
--push-repo lerobot \
|
||||||
|
--vcodec libsvtav1 \
|
||||||
|
--pix-fmt yuv420p \
|
||||||
|
--g 2 \
|
||||||
|
--crf 30
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub._download_raw import AVAILABLE_RAW_REPO_IDS
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
|
||||||
|
from lerobot.scripts.push_dataset_to_hub import push_dataset_to_hub
|
||||||
|
|
||||||
|
|
||||||
|
def get_push_repo_id_from_raw(raw_repo_id: str, push_repo: str) -> str:
|
||||||
|
dataset_id_raw = raw_repo_id.split("/")[1]
|
||||||
|
dataset_id = dataset_id_raw.removesuffix("_raw")
|
||||||
|
return f"{push_repo}/{dataset_id}"
|
||||||
|
|
||||||
|
|
||||||
|
def encode_datasets(
|
||||||
|
raw_dir: Path,
|
||||||
|
raw_repo_ids: list[str],
|
||||||
|
push_repo: str,
|
||||||
|
vcodec: str,
|
||||||
|
pix_fmt: str,
|
||||||
|
g: int,
|
||||||
|
crf: int,
|
||||||
|
local_dir: Path | None = None,
|
||||||
|
tests_data_dir: Path | None = None,
|
||||||
|
raw_format: str | None = None,
|
||||||
|
dry_run: bool = False,
|
||||||
|
) -> None:
|
||||||
|
if len(raw_repo_ids) == 1 and raw_repo_ids[0].lower() == "lerobot-raw":
|
||||||
|
raw_repo_ids_format = AVAILABLE_RAW_REPO_IDS
|
||||||
|
else:
|
||||||
|
if raw_format is None:
|
||||||
|
raise ValueError(raw_format)
|
||||||
|
raw_repo_ids_format = {id_: raw_format for id_ in raw_repo_ids}
|
||||||
|
|
||||||
|
for raw_repo_id, repo_raw_format in raw_repo_ids_format.items():
|
||||||
|
check_repo_id(raw_repo_id)
|
||||||
|
dataset_repo_id_push = get_push_repo_id_from_raw(raw_repo_id, push_repo)
|
||||||
|
dataset_raw_dir = raw_dir / raw_repo_id
|
||||||
|
dataset_dir = local_dir / dataset_repo_id_push if local_dir is not None else None
|
||||||
|
encoding = {
|
||||||
|
"vcodec": vcodec,
|
||||||
|
"pix_fmt": pix_fmt,
|
||||||
|
"g": g,
|
||||||
|
"crf": crf,
|
||||||
|
}
|
||||||
|
|
||||||
|
if not (dataset_raw_dir).is_dir():
|
||||||
|
raise NotADirectoryError(dataset_raw_dir)
|
||||||
|
|
||||||
|
if not dry_run:
|
||||||
|
push_dataset_to_hub(
|
||||||
|
dataset_raw_dir,
|
||||||
|
raw_format=repo_raw_format,
|
||||||
|
repo_id=dataset_repo_id_push,
|
||||||
|
local_dir=dataset_dir,
|
||||||
|
resume=True,
|
||||||
|
encoding=encoding,
|
||||||
|
tests_data_dir=tests_data_dir,
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
print(
|
||||||
|
f"DRY RUN: {dataset_raw_dir} --> {dataset_dir} --> {dataset_repo_id_push}@{CODEBASE_VERSION}"
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def main():
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
parser.add_argument(
|
||||||
|
"--raw-dir",
|
||||||
|
type=Path,
|
||||||
|
default=Path("data"),
|
||||||
|
help="Directory where raw datasets are located.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--raw-repo-ids",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
default=["lerobot-raw"],
|
||||||
|
help="""Raw dataset repo ids. if 'lerobot-raw', the keys from `AVAILABLE_RAW_REPO_IDS` will be
|
||||||
|
used and raw datasets will be fetched from the 'lerobot-raw/' repo and pushed with their
|
||||||
|
associated format. It is assumed that each dataset is located at `raw_dir / raw_repo_id` """,
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--raw-format",
|
||||||
|
type=str,
|
||||||
|
default=None,
|
||||||
|
help="""Raw format to use for the raw repo-ids. Must be specified if --raw-repo-ids is not
|
||||||
|
'lerobot-raw'""",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--local-dir",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help="""When provided, writes the dataset converted to LeRobotDataset format in this directory
|
||||||
|
(e.g. `data/lerobot/aloha_mobile_chair`).""",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--push-repo",
|
||||||
|
type=str,
|
||||||
|
default="lerobot",
|
||||||
|
help="Repo to upload datasets to",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--vcodec",
|
||||||
|
type=str,
|
||||||
|
default="libsvtav1",
|
||||||
|
help="Codec to use for encoding videos",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--pix-fmt",
|
||||||
|
type=str,
|
||||||
|
default="yuv420p",
|
||||||
|
help="Pixel formats (chroma subsampling) to be used for encoding",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--g",
|
||||||
|
type=int,
|
||||||
|
default=2,
|
||||||
|
help="Group of pictures sizes to be used for encoding.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--crf",
|
||||||
|
type=int,
|
||||||
|
default=30,
|
||||||
|
help="Constant rate factors to be used for encoding.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--tests-data-dir",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help=(
|
||||||
|
"When provided, save tests artifacts into the given directory "
|
||||||
|
"(e.g. `--tests-data-dir tests/data` will save to tests/data/{--repo-id})."
|
||||||
|
),
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--dry-run",
|
||||||
|
type=int,
|
||||||
|
default=0,
|
||||||
|
help="If not set to 0, this script won't download or upload anything.",
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
encode_datasets(**vars(args))
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
main()
|
||||||
@@ -28,7 +28,13 @@ import tqdm
|
|||||||
from datasets import Dataset, Features, Image, Sequence, Value
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
from PIL import Image as PILImage
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
get_default_encoding,
|
||||||
|
save_images_concurrently,
|
||||||
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
@@ -70,16 +76,24 @@ def check_format(raw_dir) -> bool:
|
|||||||
assert c < h and c < w, f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
|
assert c < h and c < w, f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
|
||||||
|
|
||||||
|
|
||||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
def load_from_raw(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int,
|
||||||
|
video: bool,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
# only frames from simulation are uncompressed
|
# only frames from simulation are uncompressed
|
||||||
compressed_images = "sim" not in raw_dir.name
|
compressed_images = "sim" not in raw_dir.name
|
||||||
|
|
||||||
hdf5_files = list(raw_dir.glob("*.hdf5"))
|
hdf5_files = sorted(raw_dir.glob("episode_*.hdf5"))
|
||||||
ep_dicts = []
|
num_episodes = len(hdf5_files)
|
||||||
episode_data_index = {"from": [], "to": []}
|
|
||||||
|
|
||||||
id_from = 0
|
ep_dicts = []
|
||||||
for ep_idx, ep_path in tqdm.tqdm(enumerate(hdf5_files), total=len(hdf5_files)):
|
ep_ids = episodes if episodes else range(num_episodes)
|
||||||
|
for ep_idx in tqdm.tqdm(ep_ids):
|
||||||
|
ep_path = hdf5_files[ep_idx]
|
||||||
with h5py.File(ep_path, "r") as ep:
|
with h5py.File(ep_path, "r") as ep:
|
||||||
num_frames = ep["/action"].shape[0]
|
num_frames = ep["/action"].shape[0]
|
||||||
|
|
||||||
@@ -114,13 +128,13 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
|
|
||||||
if video:
|
if video:
|
||||||
# save png images in temporary directory
|
# save png images in temporary directory
|
||||||
tmp_imgs_dir = out_dir / "tmp_images"
|
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||||
|
|
||||||
# encode images to a mp4 video
|
# encode images to a mp4 video
|
||||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||||
video_path = out_dir / "videos" / fname
|
video_path = videos_dir / fname
|
||||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||||
|
|
||||||
# clean temporary images directory
|
# clean temporary images directory
|
||||||
shutil.rmtree(tmp_imgs_dir)
|
shutil.rmtree(tmp_imgs_dir)
|
||||||
@@ -147,19 +161,13 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
assert isinstance(ep_idx, int)
|
assert isinstance(ep_idx, int)
|
||||||
ep_dicts.append(ep_dict)
|
ep_dicts.append(ep_dict)
|
||||||
|
|
||||||
episode_data_index["from"].append(id_from)
|
|
||||||
episode_data_index["to"].append(id_from + num_frames)
|
|
||||||
|
|
||||||
id_from += num_frames
|
|
||||||
|
|
||||||
gc.collect()
|
gc.collect()
|
||||||
|
|
||||||
# process first episode only
|
|
||||||
if debug:
|
|
||||||
break
|
|
||||||
|
|
||||||
data_dict = concatenate_episodes(ep_dicts)
|
data_dict = concatenate_episodes(ep_dicts)
|
||||||
return data_dict, episode_data_index
|
|
||||||
|
total_frames = data_dict["frame_index"].shape[0]
|
||||||
|
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||||
|
return data_dict
|
||||||
|
|
||||||
|
|
||||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||||
@@ -197,18 +205,29 @@ def to_hf_dataset(data_dict, video) -> Dataset:
|
|||||||
return hf_dataset
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
def from_raw_to_lerobot_format(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int | None = None,
|
||||||
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
# sanity check
|
# sanity check
|
||||||
check_format(raw_dir)
|
check_format(raw_dir)
|
||||||
|
|
||||||
if fps is None:
|
if fps is None:
|
||||||
fps = 50
|
fps = 50
|
||||||
|
|
||||||
data_dir, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||||
hf_dataset = to_hf_dataset(data_dir, video)
|
hf_dataset = to_hf_dataset(data_dict, video)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
info = {
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
"fps": fps,
|
"fps": fps,
|
||||||
"video": video,
|
"video": video,
|
||||||
}
|
}
|
||||||
|
if video:
|
||||||
|
info["encoding"] = get_default_encoding()
|
||||||
|
|
||||||
return hf_dataset, episode_data_index, info
|
return hf_dataset, episode_data_index, info
|
||||||
|
|||||||
107
lerobot/common/datasets/push_dataset_to_hub/cam_png_format.py
Normal file
107
lerobot/common/datasets/push_dataset_to_hub/cam_png_format.py
Normal file
@@ -0,0 +1,107 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""
|
||||||
|
Contains utilities to process raw data format of png images files recorded with capture_camera_feed.py
|
||||||
|
"""
|
||||||
|
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import torch
|
||||||
|
from datasets import Dataset, Features, Image, Value
|
||||||
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.utils import hf_transform_to_torch
|
||||||
|
from lerobot.common.datasets.video_utils import VideoFrame
|
||||||
|
|
||||||
|
|
||||||
|
def check_format(raw_dir: Path) -> bool:
|
||||||
|
image_paths = list(raw_dir.glob("frame_*.png"))
|
||||||
|
if len(image_paths) == 0:
|
||||||
|
raise ValueError
|
||||||
|
|
||||||
|
|
||||||
|
def load_from_raw(raw_dir: Path, fps: int, episodes: list[int] | None = None):
|
||||||
|
if episodes is not None:
|
||||||
|
# TODO(aliberts): add support for multi-episodes.
|
||||||
|
raise NotImplementedError()
|
||||||
|
|
||||||
|
ep_dict = {}
|
||||||
|
ep_idx = 0
|
||||||
|
|
||||||
|
image_paths = sorted(raw_dir.glob("frame_*.png"))
|
||||||
|
num_frames = len(image_paths)
|
||||||
|
|
||||||
|
ep_dict["observation.image"] = [PILImage.open(x) for x in image_paths]
|
||||||
|
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
|
||||||
|
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||||
|
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||||
|
|
||||||
|
ep_dicts = [ep_dict]
|
||||||
|
data_dict = concatenate_episodes(ep_dicts)
|
||||||
|
total_frames = data_dict["frame_index"].shape[0]
|
||||||
|
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||||
|
return data_dict
|
||||||
|
|
||||||
|
|
||||||
|
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||||
|
features = {}
|
||||||
|
if video:
|
||||||
|
features["observation.image"] = VideoFrame()
|
||||||
|
else:
|
||||||
|
features["observation.image"] = Image()
|
||||||
|
|
||||||
|
features["episode_index"] = Value(dtype="int64", id=None)
|
||||||
|
features["frame_index"] = Value(dtype="int64", id=None)
|
||||||
|
features["timestamp"] = Value(dtype="float32", id=None)
|
||||||
|
features["index"] = Value(dtype="int64", id=None)
|
||||||
|
|
||||||
|
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||||
|
hf_dataset.set_transform(hf_transform_to_torch)
|
||||||
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
|
def from_raw_to_lerobot_format(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int | None = None,
|
||||||
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
|
if video or episodes or encoding is not None:
|
||||||
|
# TODO(aliberts): support this
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
# sanity check
|
||||||
|
check_format(raw_dir)
|
||||||
|
|
||||||
|
if fps is None:
|
||||||
|
fps = 30
|
||||||
|
|
||||||
|
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes)
|
||||||
|
hf_dataset = to_hf_dataset(data_dict, video)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
|
"fps": fps,
|
||||||
|
"video": video,
|
||||||
|
}
|
||||||
|
return hf_dataset, episode_data_index, info
|
||||||
@@ -17,18 +17,20 @@
|
|||||||
Contains utilities to process raw data format from dora-record
|
Contains utilities to process raw data format from dora-record
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import logging
|
import re
|
||||||
|
import warnings
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
|
||||||
import pandas as pd
|
import pandas as pd
|
||||||
import torch
|
import torch
|
||||||
from datasets import Dataset, Features, Image, Sequence, Value
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import calculate_episode_data_index
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
from lerobot.common.datasets.video_utils import VideoFrame
|
from lerobot.common.datasets.video_utils import VideoFrame
|
||||||
from lerobot.common.utils.utils import init_logging
|
|
||||||
|
|
||||||
|
|
||||||
def check_format(raw_dir) -> bool:
|
def check_format(raw_dir) -> bool:
|
||||||
@@ -40,7 +42,7 @@ def check_format(raw_dir) -> bool:
|
|||||||
return True
|
return True
|
||||||
|
|
||||||
|
|
||||||
def load_from_raw(raw_dir: Path, out_dir: Path):
|
def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episodes: list[int] | None = None):
|
||||||
# Load data stream that will be used as reference for the timestamps synchronization
|
# Load data stream that will be used as reference for the timestamps synchronization
|
||||||
reference_files = list(raw_dir.glob("observation.images.cam_*.parquet"))
|
reference_files = list(raw_dir.glob("observation.images.cam_*.parquet"))
|
||||||
if len(reference_files) == 0:
|
if len(reference_files) == 0:
|
||||||
@@ -56,24 +58,45 @@ def load_from_raw(raw_dir: Path, out_dir: Path):
|
|||||||
key = path.stem # action or observation.state or ...
|
key = path.stem # action or observation.state or ...
|
||||||
if key == reference_key:
|
if key == reference_key:
|
||||||
continue
|
continue
|
||||||
|
if "failed_episode_index" in key:
|
||||||
|
# TODO(rcadene): add support for removing episodes that are tagged as "failed"
|
||||||
|
continue
|
||||||
modality_df = pd.read_parquet(path)
|
modality_df = pd.read_parquet(path)
|
||||||
modality_df = modality_df[["timestamp_utc", key]]
|
modality_df = modality_df[["timestamp_utc", key]]
|
||||||
df = pd.merge_asof(
|
df = pd.merge_asof(
|
||||||
df,
|
df,
|
||||||
modality_df,
|
modality_df,
|
||||||
on="timestamp_utc",
|
on="timestamp_utc",
|
||||||
direction="backward",
|
# "nearest" is the best option over "backward", since the latter can desynchronizes camera timestamps by
|
||||||
|
# matching timestamps that are too far appart, in order to fit the backward constraints. It's not the case for "nearest".
|
||||||
|
# However, note that "nearest" might synchronize the reference camera with other cameras on slightly future timestamps.
|
||||||
|
# are too far appart.
|
||||||
|
direction="nearest",
|
||||||
|
tolerance=pd.Timedelta(f"{1/fps} seconds"),
|
||||||
)
|
)
|
||||||
|
# Remove rows with episode_index -1 which indicates data that correspond to in-between episodes
|
||||||
# Remove rows with a NaN in any column. It can happened during the first frames of an episode,
|
|
||||||
# because some cameras didnt start recording yet.
|
|
||||||
df = df.dropna(axis=0)
|
|
||||||
|
|
||||||
# Remove rows with episode_index -1 which indicates a failed episode
|
|
||||||
df = df[df["episode_index"] != -1]
|
df = df[df["episode_index"] != -1]
|
||||||
|
|
||||||
|
image_keys = [key for key in df if "observation.images." in key]
|
||||||
|
|
||||||
|
def get_episode_index(row):
|
||||||
|
episode_index_per_cam = {}
|
||||||
|
for key in image_keys:
|
||||||
|
path = row[key][0]["path"]
|
||||||
|
match = re.search(r"_(\d{6}).mp4", path)
|
||||||
|
if not match:
|
||||||
|
raise ValueError(path)
|
||||||
|
episode_index = int(match.group(1))
|
||||||
|
episode_index_per_cam[key] = episode_index
|
||||||
|
if len(set(episode_index_per_cam.values())) != 1:
|
||||||
|
raise ValueError(
|
||||||
|
f"All cameras are expected to belong to the same episode, but getting {episode_index_per_cam}"
|
||||||
|
)
|
||||||
|
return episode_index
|
||||||
|
|
||||||
|
df["episode_index"] = df.apply(get_episode_index, axis=1)
|
||||||
|
|
||||||
# dora only use arrays, so single values are encapsulated into a list
|
# dora only use arrays, so single values are encapsulated into a list
|
||||||
df["episode_index"] = df["episode_index"].map(lambda x: x[0])
|
|
||||||
df["frame_index"] = df.groupby("episode_index").cumcount()
|
df["frame_index"] = df.groupby("episode_index").cumcount()
|
||||||
df = df.reset_index()
|
df = df.reset_index()
|
||||||
df["index"] = df.index
|
df["index"] = df.index
|
||||||
@@ -88,14 +111,19 @@ def load_from_raw(raw_dir: Path, out_dir: Path):
|
|||||||
|
|
||||||
del df["timestamp_utc"]
|
del df["timestamp_utc"]
|
||||||
|
|
||||||
|
# sanity check
|
||||||
|
has_nan = df.isna().any().any()
|
||||||
|
if has_nan:
|
||||||
|
raise ValueError("Dataset contains Nan values.")
|
||||||
|
|
||||||
# sanity check episode indices go from 0 to n-1
|
# sanity check episode indices go from 0 to n-1
|
||||||
ep_ids = [ep_idx for ep_idx, _ in df.groupby("episode_index")]
|
ep_ids = [ep_idx for ep_idx, _ in df.groupby("episode_index")]
|
||||||
expected_ep_ids = list(range(df["episode_index"].max() + 1))
|
expected_ep_ids = list(range(df["episode_index"].max() + 1))
|
||||||
assert ep_ids == expected_ep_ids, f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}"
|
if ep_ids != expected_ep_ids:
|
||||||
|
raise ValueError(f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}")
|
||||||
|
|
||||||
# Create symlink to raw videos directory (that needs to be absolute not relative)
|
# Create symlink to raw videos directory (that needs to be absolute not relative)
|
||||||
out_dir.mkdir(parents=True, exist_ok=True)
|
videos_dir.parent.mkdir(parents=True, exist_ok=True)
|
||||||
videos_dir = out_dir / "videos"
|
|
||||||
videos_dir.symlink_to((raw_dir / "videos").absolute())
|
videos_dir.symlink_to((raw_dir / "videos").absolute())
|
||||||
|
|
||||||
# sanity check the video paths are well formated
|
# sanity check the video paths are well formated
|
||||||
@@ -104,7 +132,8 @@ def load_from_raw(raw_dir: Path, out_dir: Path):
|
|||||||
continue
|
continue
|
||||||
for ep_idx in ep_ids:
|
for ep_idx in ep_ids:
|
||||||
video_path = videos_dir / f"{key}_episode_{ep_idx:06d}.mp4"
|
video_path = videos_dir / f"{key}_episode_{ep_idx:06d}.mp4"
|
||||||
assert video_path.exists(), f"Video file not found in {video_path}"
|
if not video_path.exists():
|
||||||
|
raise ValueError(f"Video file not found in {video_path}")
|
||||||
|
|
||||||
data_dict = {}
|
data_dict = {}
|
||||||
for key in df:
|
for key in df:
|
||||||
@@ -116,7 +145,8 @@ def load_from_raw(raw_dir: Path, out_dir: Path):
|
|||||||
|
|
||||||
# sanity check the video path is well formated
|
# sanity check the video path is well formated
|
||||||
video_path = videos_dir.parent / data_dict[key][0]["path"]
|
video_path = videos_dir.parent / data_dict[key][0]["path"]
|
||||||
assert video_path.exists(), f"Video file not found in {video_path}"
|
if not video_path.exists():
|
||||||
|
raise ValueError(f"Video file not found in {video_path}")
|
||||||
# is number
|
# is number
|
||||||
elif df[key].iloc[0].ndim == 0 or df[key].iloc[0].shape[0] == 1:
|
elif df[key].iloc[0].ndim == 0 or df[key].iloc[0].shape[0] == 1:
|
||||||
data_dict[key] = torch.from_numpy(df[key].values)
|
data_dict[key] = torch.from_numpy(df[key].values)
|
||||||
@@ -126,16 +156,7 @@ def load_from_raw(raw_dir: Path, out_dir: Path):
|
|||||||
else:
|
else:
|
||||||
raise ValueError(key)
|
raise ValueError(key)
|
||||||
|
|
||||||
# Get the episode index containing for each unique episode index
|
return data_dict
|
||||||
first_ep_index_df = df.groupby("episode_index").agg(start_index=("index", "first")).reset_index()
|
|
||||||
from_ = first_ep_index_df["start_index"].tolist()
|
|
||||||
to_ = from_[1:] + [len(df)]
|
|
||||||
episode_data_index = {
|
|
||||||
"from": from_,
|
|
||||||
"to": to_,
|
|
||||||
}
|
|
||||||
|
|
||||||
return data_dict, episode_data_index
|
|
||||||
|
|
||||||
|
|
||||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||||
@@ -173,12 +194,14 @@ def to_hf_dataset(data_dict, video) -> Dataset:
|
|||||||
return hf_dataset
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
def from_raw_to_lerobot_format(
|
||||||
init_logging()
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
if debug:
|
fps: int | None = None,
|
||||||
logging.warning("debug=True not implemented. Falling back to debug=False.")
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
# sanity check
|
# sanity check
|
||||||
check_format(raw_dir)
|
check_format(raw_dir)
|
||||||
|
|
||||||
@@ -190,11 +213,21 @@ def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=Tru
|
|||||||
if not video:
|
if not video:
|
||||||
raise NotImplementedError()
|
raise NotImplementedError()
|
||||||
|
|
||||||
data_df, episode_data_index = load_from_raw(raw_dir, out_dir)
|
if encoding is not None:
|
||||||
hf_dataset = to_hf_dataset(data_df, video)
|
warnings.warn(
|
||||||
|
"Video encoding is currently done outside of LeRobot for the dora_parquet format.",
|
||||||
|
stacklevel=1,
|
||||||
|
)
|
||||||
|
|
||||||
|
data_df = load_from_raw(raw_dir, videos_dir, fps, episodes)
|
||||||
|
hf_dataset = to_hf_dataset(data_df, video)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
info = {
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
"fps": fps,
|
"fps": fps,
|
||||||
"video": video,
|
"video": video,
|
||||||
}
|
}
|
||||||
|
if video:
|
||||||
|
info["encoding"] = "unknown"
|
||||||
|
|
||||||
return hf_dataset, episode_data_index, info
|
return hf_dataset, episode_data_index, info
|
||||||
312
lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py
Normal file
312
lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py
Normal file
@@ -0,0 +1,312 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
"""
|
||||||
|
For all datasets in the RLDS format.
|
||||||
|
For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets.
|
||||||
|
|
||||||
|
NOTE: You need to install tensorflow and tensorflow_datsets before running this script.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
python lerobot/scripts/push_dataset_to_hub.py \
|
||||||
|
--raw-dir /path/to/data/bridge_dataset/1.0.0/ \
|
||||||
|
--repo-id your_hub/sampled_bridge_data_v2 \
|
||||||
|
--raw-format rlds \
|
||||||
|
--episodes 3 4 5 8 9
|
||||||
|
|
||||||
|
Exact dataset fps defined in openx/config.py, obtained from:
|
||||||
|
https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R
|
||||||
|
"""
|
||||||
|
|
||||||
|
import shutil
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import tensorflow as tf
|
||||||
|
import tensorflow_datasets as tfds
|
||||||
|
import torch
|
||||||
|
import tqdm
|
||||||
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
get_default_encoding,
|
||||||
|
save_images_concurrently,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.utils import (
|
||||||
|
hf_transform_to_torch,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||||
|
|
||||||
|
np.set_printoptions(precision=2)
|
||||||
|
|
||||||
|
|
||||||
|
def tf_to_torch(data):
|
||||||
|
return torch.from_numpy(data.numpy())
|
||||||
|
|
||||||
|
|
||||||
|
def tf_img_convert(img):
|
||||||
|
if img.dtype == tf.string:
|
||||||
|
img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8)
|
||||||
|
elif img.dtype != tf.uint8:
|
||||||
|
raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}")
|
||||||
|
return img.numpy()
|
||||||
|
|
||||||
|
|
||||||
|
def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict:
|
||||||
|
"""
|
||||||
|
In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps"
|
||||||
|
entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the
|
||||||
|
trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`.
|
||||||
|
|
||||||
|
NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/
|
||||||
|
"""
|
||||||
|
steps = traj.pop("steps")
|
||||||
|
|
||||||
|
traj_len = tf.shape(tf.nest.flatten(steps)[0])[0]
|
||||||
|
|
||||||
|
# broadcast metadata to the length of the trajectory
|
||||||
|
metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj)
|
||||||
|
|
||||||
|
# put steps back in
|
||||||
|
assert "traj_metadata" not in steps
|
||||||
|
traj = {**steps, "traj_metadata": metadata}
|
||||||
|
|
||||||
|
assert "_len" not in traj
|
||||||
|
assert "_traj_index" not in traj
|
||||||
|
assert "_frame_index" not in traj
|
||||||
|
traj["_len"] = tf.repeat(traj_len, traj_len)
|
||||||
|
traj["_traj_index"] = tf.repeat(i, traj_len)
|
||||||
|
traj["_frame_index"] = tf.range(traj_len)
|
||||||
|
|
||||||
|
return traj
|
||||||
|
|
||||||
|
|
||||||
|
def load_from_raw(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int,
|
||||||
|
video: bool,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
raw_dir (Path): _description_
|
||||||
|
videos_dir (Path): _description_
|
||||||
|
fps (int): _description_
|
||||||
|
video (bool): _description_
|
||||||
|
episodes (list[int] | None, optional): _description_. Defaults to None.
|
||||||
|
"""
|
||||||
|
ds_builder = tfds.builder_from_directory(str(raw_dir))
|
||||||
|
dataset = ds_builder.as_dataset(
|
||||||
|
split="all",
|
||||||
|
decoders={"steps": tfds.decode.SkipDecoding()},
|
||||||
|
)
|
||||||
|
|
||||||
|
dataset_info = ds_builder.info
|
||||||
|
print("dataset_info: ", dataset_info)
|
||||||
|
|
||||||
|
ds_length = len(dataset)
|
||||||
|
dataset = dataset.take(ds_length)
|
||||||
|
# "flatten" the dataset as such we can apply trajectory level map() easily
|
||||||
|
# each [obs][key] has a shape of (frame_size, ...)
|
||||||
|
dataset = dataset.enumerate().map(_broadcast_metadata_rlds)
|
||||||
|
|
||||||
|
# we will apply the standardization transform if the dataset_name is provided
|
||||||
|
# if the dataset name is not provided and the goal is to convert any rlds formatted dataset
|
||||||
|
# search for 'image' keys in the observations
|
||||||
|
image_keys = []
|
||||||
|
state_keys = []
|
||||||
|
observation_info = dataset_info.features["steps"]["observation"]
|
||||||
|
for key in observation_info:
|
||||||
|
# check whether the key is for an image or a vector observation
|
||||||
|
if len(observation_info[key].shape) == 3:
|
||||||
|
# only adding uint8 images discards depth images
|
||||||
|
if observation_info[key].dtype == tf.uint8:
|
||||||
|
image_keys.append(key)
|
||||||
|
else:
|
||||||
|
state_keys.append(key)
|
||||||
|
|
||||||
|
lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None
|
||||||
|
|
||||||
|
print(" - image_keys: ", image_keys)
|
||||||
|
print(" - lang_key: ", lang_key)
|
||||||
|
|
||||||
|
it = iter(dataset)
|
||||||
|
|
||||||
|
ep_dicts = []
|
||||||
|
# Init temp path to save ep_dicts in case of crash
|
||||||
|
tmp_ep_dicts_dir = videos_dir.parent.joinpath("ep_dicts")
|
||||||
|
tmp_ep_dicts_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
# check if ep_dicts have already been saved in /tmp
|
||||||
|
starting_ep_idx = 0
|
||||||
|
saved_ep_dicts = [ep.__str__() for ep in tmp_ep_dicts_dir.iterdir()]
|
||||||
|
if len(saved_ep_dicts) > 0:
|
||||||
|
saved_ep_dicts.sort()
|
||||||
|
# get last ep_idx number
|
||||||
|
starting_ep_idx = int(saved_ep_dicts[-1][-13:-3]) + 1
|
||||||
|
for i in range(starting_ep_idx):
|
||||||
|
episode = next(it)
|
||||||
|
ep_dicts.append(torch.load(saved_ep_dicts[i]))
|
||||||
|
|
||||||
|
# if we user specified episodes, skip the ones not in the list
|
||||||
|
if episodes is not None:
|
||||||
|
if ds_length == 0:
|
||||||
|
raise ValueError("No episodes found.")
|
||||||
|
# convert episodes index to sorted list
|
||||||
|
episodes = sorted(episodes)
|
||||||
|
|
||||||
|
for ep_idx in tqdm.tqdm(range(starting_ep_idx, ds_length)):
|
||||||
|
episode = next(it)
|
||||||
|
|
||||||
|
# if user specified episodes, skip the ones not in the list
|
||||||
|
if episodes is not None:
|
||||||
|
if len(episodes) == 0:
|
||||||
|
break
|
||||||
|
if ep_idx == episodes[0]:
|
||||||
|
# process this episode
|
||||||
|
print(" selecting episode idx: ", ep_idx)
|
||||||
|
episodes.pop(0)
|
||||||
|
else:
|
||||||
|
continue # skip
|
||||||
|
|
||||||
|
num_frames = episode["action"].shape[0]
|
||||||
|
|
||||||
|
ep_dict = {}
|
||||||
|
for key in state_keys:
|
||||||
|
ep_dict[f"observation.{key}"] = tf_to_torch(episode["observation"][key])
|
||||||
|
|
||||||
|
ep_dict["action"] = tf_to_torch(episode["action"])
|
||||||
|
ep_dict["next.reward"] = tf_to_torch(episode["reward"]).float()
|
||||||
|
ep_dict["next.done"] = tf_to_torch(episode["is_last"])
|
||||||
|
ep_dict["is_terminal"] = tf_to_torch(episode["is_terminal"])
|
||||||
|
ep_dict["is_first"] = tf_to_torch(episode["is_first"])
|
||||||
|
ep_dict["discount"] = tf_to_torch(episode["discount"])
|
||||||
|
|
||||||
|
# If lang_key is present, convert the entire tensor at once
|
||||||
|
if lang_key is not None:
|
||||||
|
ep_dict["language_instruction"] = [x.numpy().decode("utf-8") for x in episode[lang_key]]
|
||||||
|
|
||||||
|
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||||
|
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
|
||||||
|
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||||
|
|
||||||
|
image_array_dict = {key: [] for key in image_keys}
|
||||||
|
|
||||||
|
for im_key in image_keys:
|
||||||
|
imgs = episode["observation"][im_key]
|
||||||
|
image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
|
||||||
|
|
||||||
|
# loop through all cameras
|
||||||
|
for im_key in image_keys:
|
||||||
|
img_key = f"observation.images.{im_key}"
|
||||||
|
imgs_array = image_array_dict[im_key]
|
||||||
|
imgs_array = np.array(imgs_array)
|
||||||
|
if video:
|
||||||
|
# save png images in temporary directory
|
||||||
|
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||||
|
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||||
|
|
||||||
|
# encode images to a mp4 video
|
||||||
|
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||||
|
video_path = videos_dir / fname
|
||||||
|
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||||
|
|
||||||
|
# clean temporary images directory
|
||||||
|
shutil.rmtree(tmp_imgs_dir)
|
||||||
|
|
||||||
|
# store the reference to the video frame
|
||||||
|
ep_dict[img_key] = [
|
||||||
|
{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||||
|
|
||||||
|
path_ep_dict = tmp_ep_dicts_dir.joinpath(
|
||||||
|
"ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt"
|
||||||
|
)
|
||||||
|
torch.save(ep_dict, path_ep_dict)
|
||||||
|
|
||||||
|
ep_dicts.append(ep_dict)
|
||||||
|
|
||||||
|
data_dict = concatenate_episodes(ep_dicts)
|
||||||
|
|
||||||
|
total_frames = data_dict["frame_index"].shape[0]
|
||||||
|
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||||
|
return data_dict
|
||||||
|
|
||||||
|
|
||||||
|
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||||
|
features = {}
|
||||||
|
|
||||||
|
for key in data_dict:
|
||||||
|
# check if vector state obs
|
||||||
|
if key.startswith("observation.") and "observation.images." not in key:
|
||||||
|
features[key] = Sequence(length=data_dict[key].shape[1], feature=Value(dtype="float32", id=None))
|
||||||
|
# check if image obs
|
||||||
|
elif "observation.images." in key:
|
||||||
|
if video:
|
||||||
|
features[key] = VideoFrame()
|
||||||
|
else:
|
||||||
|
features[key] = Image()
|
||||||
|
|
||||||
|
if "language_instruction" in data_dict:
|
||||||
|
features["language_instruction"] = Value(dtype="string", id=None)
|
||||||
|
|
||||||
|
features["action"] = Sequence(
|
||||||
|
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||||
|
)
|
||||||
|
|
||||||
|
features["is_terminal"] = Value(dtype="bool", id=None)
|
||||||
|
features["is_first"] = Value(dtype="bool", id=None)
|
||||||
|
features["discount"] = Value(dtype="float32", id=None)
|
||||||
|
|
||||||
|
features["episode_index"] = Value(dtype="int64", id=None)
|
||||||
|
features["frame_index"] = Value(dtype="int64", id=None)
|
||||||
|
features["timestamp"] = Value(dtype="float32", id=None)
|
||||||
|
features["next.reward"] = Value(dtype="float32", id=None)
|
||||||
|
features["next.done"] = Value(dtype="bool", id=None)
|
||||||
|
features["index"] = Value(dtype="int64", id=None)
|
||||||
|
|
||||||
|
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||||
|
hf_dataset.set_transform(hf_transform_to_torch)
|
||||||
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
|
def from_raw_to_lerobot_format(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int | None = None,
|
||||||
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
|
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||||
|
hf_dataset = to_hf_dataset(data_dict, video)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
|
"fps": fps,
|
||||||
|
"video": video,
|
||||||
|
}
|
||||||
|
if video:
|
||||||
|
info["encoding"] = get_default_encoding()
|
||||||
|
|
||||||
|
return hf_dataset, episode_data_index, info
|
||||||
@@ -25,7 +25,13 @@ import zarr
|
|||||||
from datasets import Dataset, Features, Image, Sequence, Value
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
from PIL import Image as PILImage
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
get_default_encoding,
|
||||||
|
save_images_concurrently,
|
||||||
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
@@ -53,7 +59,15 @@ def check_format(raw_dir):
|
|||||||
assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
|
assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
|
||||||
|
|
||||||
|
|
||||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
def load_from_raw(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int,
|
||||||
|
video: bool,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
keypoints_instead_of_image: bool = False,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
try:
|
try:
|
||||||
import pymunk
|
import pymunk
|
||||||
from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
|
from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
|
||||||
@@ -71,7 +85,6 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
|
zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
|
||||||
|
|
||||||
episode_ids = torch.from_numpy(zarr_data.get_episode_idxs())
|
episode_ids = torch.from_numpy(zarr_data.get_episode_idxs())
|
||||||
num_episodes = zarr_data.meta["episode_ends"].shape[0]
|
|
||||||
assert len(
|
assert len(
|
||||||
{zarr_data[key].shape[0] for key in zarr_data.keys()} # noqa: SIM118
|
{zarr_data[key].shape[0] for key in zarr_data.keys()} # noqa: SIM118
|
||||||
), "Some data type dont have the same number of total frames."
|
), "Some data type dont have the same number of total frames."
|
||||||
@@ -84,32 +97,44 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
states = torch.from_numpy(zarr_data["state"])
|
states = torch.from_numpy(zarr_data["state"])
|
||||||
actions = torch.from_numpy(zarr_data["action"])
|
actions = torch.from_numpy(zarr_data["action"])
|
||||||
|
|
||||||
ep_dicts = []
|
# load data indices from which each episode starts and ends
|
||||||
episode_data_index = {"from": [], "to": []}
|
from_ids, to_ids = [], []
|
||||||
|
from_idx = 0
|
||||||
|
for to_idx in zarr_data.meta["episode_ends"]:
|
||||||
|
from_ids.append(from_idx)
|
||||||
|
to_ids.append(to_idx)
|
||||||
|
from_idx = to_idx
|
||||||
|
|
||||||
id_from = 0
|
num_episodes = len(from_ids)
|
||||||
for ep_idx in tqdm.tqdm(range(num_episodes)):
|
|
||||||
id_to = zarr_data.meta["episode_ends"][ep_idx]
|
ep_dicts = []
|
||||||
num_frames = id_to - id_from
|
ep_ids = episodes if episodes else range(num_episodes)
|
||||||
|
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||||
|
from_idx = from_ids[selected_ep_idx]
|
||||||
|
to_idx = to_ids[selected_ep_idx]
|
||||||
|
num_frames = to_idx - from_idx
|
||||||
|
|
||||||
# sanity check
|
# sanity check
|
||||||
assert (episode_ids[id_from:id_to] == ep_idx).all()
|
assert (episode_ids[from_idx:to_idx] == ep_idx).all()
|
||||||
|
|
||||||
# get image
|
# get image
|
||||||
image = imgs[id_from:id_to]
|
if not keypoints_instead_of_image:
|
||||||
assert image.min() >= 0.0
|
image = imgs[from_idx:to_idx]
|
||||||
assert image.max() <= 255.0
|
assert image.min() >= 0.0
|
||||||
image = image.type(torch.uint8)
|
assert image.max() <= 255.0
|
||||||
|
image = image.type(torch.uint8)
|
||||||
|
|
||||||
# get state
|
# get state
|
||||||
state = states[id_from:id_to]
|
state = states[from_idx:to_idx]
|
||||||
agent_pos = state[:, :2]
|
agent_pos = state[:, :2]
|
||||||
block_pos = state[:, 2:4]
|
block_pos = state[:, 2:4]
|
||||||
block_angle = state[:, 4]
|
block_angle = state[:, 4]
|
||||||
|
|
||||||
# get reward, success, done
|
# get reward, success, done, and (maybe) keypoints
|
||||||
reward = torch.zeros(num_frames)
|
reward = torch.zeros(num_frames)
|
||||||
success = torch.zeros(num_frames, dtype=torch.bool)
|
success = torch.zeros(num_frames, dtype=torch.bool)
|
||||||
|
if keypoints_instead_of_image:
|
||||||
|
keypoints = torch.zeros(num_frames, 16) # 8 keypoints each with 2 coords
|
||||||
done = torch.zeros(num_frames, dtype=torch.bool)
|
done = torch.zeros(num_frames, dtype=torch.bool)
|
||||||
for i in range(num_frames):
|
for i in range(num_frames):
|
||||||
space = pymunk.Space()
|
space = pymunk.Space()
|
||||||
@@ -125,7 +150,7 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
]
|
]
|
||||||
space.add(*walls)
|
space.add(*walls)
|
||||||
|
|
||||||
block_body = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
|
block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
|
||||||
goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
|
goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
|
||||||
block_geom = pymunk_to_shapely(block_body, block_body.shapes)
|
block_geom = pymunk_to_shapely(block_body, block_body.shapes)
|
||||||
intersection_area = goal_geom.intersection(block_geom).area
|
intersection_area = goal_geom.intersection(block_geom).area
|
||||||
@@ -133,34 +158,41 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
coverage = intersection_area / goal_area
|
coverage = intersection_area / goal_area
|
||||||
reward[i] = np.clip(coverage / success_threshold, 0, 1)
|
reward[i] = np.clip(coverage / success_threshold, 0, 1)
|
||||||
success[i] = coverage > success_threshold
|
success[i] = coverage > success_threshold
|
||||||
|
if keypoints_instead_of_image:
|
||||||
|
keypoints[i] = torch.from_numpy(PushTEnv.get_keypoints(block_shapes).flatten())
|
||||||
|
|
||||||
# last step of demonstration is considered done
|
# last step of demonstration is considered done
|
||||||
done[-1] = True
|
done[-1] = True
|
||||||
|
|
||||||
ep_dict = {}
|
ep_dict = {}
|
||||||
|
|
||||||
imgs_array = [x.numpy() for x in image]
|
if not keypoints_instead_of_image:
|
||||||
img_key = "observation.image"
|
imgs_array = [x.numpy() for x in image]
|
||||||
if video:
|
img_key = "observation.image"
|
||||||
# save png images in temporary directory
|
if video:
|
||||||
tmp_imgs_dir = out_dir / "tmp_images"
|
# save png images in temporary directory
|
||||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||||
|
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||||
|
|
||||||
# encode images to a mp4 video
|
# encode images to a mp4 video
|
||||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||||
video_path = out_dir / "videos" / fname
|
video_path = videos_dir / fname
|
||||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||||
|
|
||||||
# clean temporary images directory
|
# clean temporary images directory
|
||||||
shutil.rmtree(tmp_imgs_dir)
|
shutil.rmtree(tmp_imgs_dir)
|
||||||
|
|
||||||
# store the reference to the video frame
|
# store the reference to the video frame
|
||||||
ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
|
ep_dict[img_key] = [
|
||||||
else:
|
{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
|
||||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
]
|
||||||
|
else:
|
||||||
|
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||||
|
|
||||||
ep_dict["observation.state"] = agent_pos
|
ep_dict["observation.state"] = agent_pos
|
||||||
ep_dict["action"] = actions[id_from:id_to]
|
if keypoints_instead_of_image:
|
||||||
|
ep_dict["observation.environment_state"] = keypoints
|
||||||
|
ep_dict["action"] = actions[from_idx:to_idx]
|
||||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
||||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||||
@@ -171,31 +203,30 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
ep_dict["next.done"] = torch.cat([done[1:], done[[-1]]])
|
ep_dict["next.done"] = torch.cat([done[1:], done[[-1]]])
|
||||||
ep_dict["next.success"] = torch.cat([success[1:], success[[-1]]])
|
ep_dict["next.success"] = torch.cat([success[1:], success[[-1]]])
|
||||||
ep_dicts.append(ep_dict)
|
ep_dicts.append(ep_dict)
|
||||||
|
|
||||||
episode_data_index["from"].append(id_from)
|
|
||||||
episode_data_index["to"].append(id_from + num_frames)
|
|
||||||
|
|
||||||
id_from += num_frames
|
|
||||||
|
|
||||||
# process first episode only
|
|
||||||
if debug:
|
|
||||||
break
|
|
||||||
|
|
||||||
data_dict = concatenate_episodes(ep_dicts)
|
data_dict = concatenate_episodes(ep_dicts)
|
||||||
return data_dict, episode_data_index
|
|
||||||
|
total_frames = data_dict["frame_index"].shape[0]
|
||||||
|
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||||
|
return data_dict
|
||||||
|
|
||||||
|
|
||||||
def to_hf_dataset(data_dict, video):
|
def to_hf_dataset(data_dict, video, keypoints_instead_of_image: bool = False):
|
||||||
features = {}
|
features = {}
|
||||||
|
|
||||||
if video:
|
if not keypoints_instead_of_image:
|
||||||
features["observation.image"] = VideoFrame()
|
if video:
|
||||||
else:
|
features["observation.image"] = VideoFrame()
|
||||||
features["observation.image"] = Image()
|
else:
|
||||||
|
features["observation.image"] = Image()
|
||||||
|
|
||||||
features["observation.state"] = Sequence(
|
features["observation.state"] = Sequence(
|
||||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||||
)
|
)
|
||||||
|
if keypoints_instead_of_image:
|
||||||
|
features["observation.environment_state"] = Sequence(
|
||||||
|
length=data_dict["observation.environment_state"].shape[1],
|
||||||
|
feature=Value(dtype="float32", id=None),
|
||||||
|
)
|
||||||
features["action"] = Sequence(
|
features["action"] = Sequence(
|
||||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||||
)
|
)
|
||||||
@@ -212,18 +243,33 @@ def to_hf_dataset(data_dict, video):
|
|||||||
return hf_dataset
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
def from_raw_to_lerobot_format(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int | None = None,
|
||||||
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
|
# Manually change this to True to use keypoints of the T instead of an image observation (but don't merge
|
||||||
|
# with True). Also make sure to use video = 0 in the `push_dataset_to_hub.py` script.
|
||||||
|
keypoints_instead_of_image = False
|
||||||
|
|
||||||
# sanity check
|
# sanity check
|
||||||
check_format(raw_dir)
|
check_format(raw_dir)
|
||||||
|
|
||||||
if fps is None:
|
if fps is None:
|
||||||
fps = 10
|
fps = 10
|
||||||
|
|
||||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, keypoints_instead_of_image, encoding)
|
||||||
hf_dataset = to_hf_dataset(data_dict, video)
|
hf_dataset = to_hf_dataset(data_dict, video, keypoints_instead_of_image)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
info = {
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
"fps": fps,
|
"fps": fps,
|
||||||
"video": video,
|
"video": video if not keypoints_instead_of_image else 0,
|
||||||
}
|
}
|
||||||
|
if video:
|
||||||
|
info["encoding"] = get_default_encoding()
|
||||||
|
|
||||||
return hf_dataset, episode_data_index, info
|
return hf_dataset, episode_data_index, info
|
||||||
|
|||||||
@@ -19,15 +19,20 @@ import logging
|
|||||||
import shutil
|
import shutil
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
|
||||||
import numpy as np
|
|
||||||
import torch
|
import torch
|
||||||
import tqdm
|
import tqdm
|
||||||
import zarr
|
import zarr
|
||||||
from datasets import Dataset, Features, Image, Sequence, Value
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
from PIL import Image as PILImage
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
|
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
get_default_encoding,
|
||||||
|
save_images_concurrently,
|
||||||
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
@@ -59,23 +64,14 @@ def check_format(raw_dir) -> bool:
|
|||||||
assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
|
assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
|
||||||
|
|
||||||
|
|
||||||
def get_episode_idxs(episode_ends: np.ndarray) -> np.ndarray:
|
def load_from_raw(
|
||||||
# Optimized and simplified version of this function: https://github.com/real-stanford/universal_manipulation_interface/blob/298776ce251f33b6b3185a98d6e7d1f9ad49168b/diffusion_policy/common/replay_buffer.py#L374
|
raw_dir: Path,
|
||||||
from numba import jit
|
videos_dir: Path,
|
||||||
|
fps: int,
|
||||||
@jit(nopython=True)
|
video: bool,
|
||||||
def _get_episode_idxs(episode_ends):
|
episodes: list[int] | None = None,
|
||||||
result = np.zeros((episode_ends[-1],), dtype=np.int64)
|
encoding: dict | None = None,
|
||||||
start_idx = 0
|
):
|
||||||
for episode_number, end_idx in enumerate(episode_ends):
|
|
||||||
result[start_idx:end_idx] = episode_number
|
|
||||||
start_idx = end_idx
|
|
||||||
return result
|
|
||||||
|
|
||||||
return _get_episode_idxs(episode_ends)
|
|
||||||
|
|
||||||
|
|
||||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|
||||||
zarr_path = raw_dir / "cup_in_the_wild.zarr"
|
zarr_path = raw_dir / "cup_in_the_wild.zarr"
|
||||||
zarr_data = zarr.open(zarr_path, mode="r")
|
zarr_data = zarr.open(zarr_path, mode="r")
|
||||||
|
|
||||||
@@ -92,74 +88,79 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
episode_ends = zarr_data["meta/episode_ends"][:]
|
episode_ends = zarr_data["meta/episode_ends"][:]
|
||||||
num_episodes = episode_ends.shape[0]
|
num_episodes = episode_ends.shape[0]
|
||||||
|
|
||||||
episode_ids = torch.from_numpy(get_episode_idxs(episode_ends))
|
|
||||||
|
|
||||||
# We convert it in torch tensor later because the jit function does not support torch tensors
|
# We convert it in torch tensor later because the jit function does not support torch tensors
|
||||||
episode_ends = torch.from_numpy(episode_ends)
|
episode_ends = torch.from_numpy(episode_ends)
|
||||||
|
|
||||||
|
# load data indices from which each episode starts and ends
|
||||||
|
from_ids, to_ids = [], []
|
||||||
|
from_idx = 0
|
||||||
|
for to_idx in episode_ends:
|
||||||
|
from_ids.append(from_idx)
|
||||||
|
to_ids.append(to_idx)
|
||||||
|
from_idx = to_idx
|
||||||
|
|
||||||
|
ep_dicts_dir = videos_dir / "ep_dicts"
|
||||||
|
ep_dicts_dir.mkdir(exist_ok=True, parents=True)
|
||||||
ep_dicts = []
|
ep_dicts = []
|
||||||
episode_data_index = {"from": [], "to": []}
|
|
||||||
|
|
||||||
id_from = 0
|
ep_ids = episodes if episodes else range(num_episodes)
|
||||||
for ep_idx in tqdm.tqdm(range(num_episodes)):
|
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||||
id_to = episode_ends[ep_idx]
|
ep_dict_path = ep_dicts_dir / f"{ep_idx}"
|
||||||
num_frames = id_to - id_from
|
if not ep_dict_path.is_file():
|
||||||
|
from_idx = from_ids[selected_ep_idx]
|
||||||
|
to_idx = to_ids[selected_ep_idx]
|
||||||
|
num_frames = to_idx - from_idx
|
||||||
|
|
||||||
# sanity heck
|
# TODO(rcadene): save temporary images of the episode?
|
||||||
assert (episode_ids[id_from:id_to] == ep_idx).all()
|
|
||||||
|
|
||||||
# TODO(rcadene): save temporary images of the episode?
|
state = states[from_idx:to_idx]
|
||||||
|
|
||||||
state = states[id_from:id_to]
|
ep_dict = {}
|
||||||
|
|
||||||
ep_dict = {}
|
# load 57MB of images in RAM (400x224x224x3 uint8)
|
||||||
|
imgs_array = zarr_data["data/camera0_rgb"][from_idx:to_idx]
|
||||||
|
img_key = "observation.image"
|
||||||
|
if video:
|
||||||
|
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||||
|
video_path = videos_dir / fname
|
||||||
|
if not video_path.is_file():
|
||||||
|
# save png images in temporary directory
|
||||||
|
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||||
|
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||||
|
|
||||||
# load 57MB of images in RAM (400x224x224x3 uint8)
|
# encode images to a mp4 video
|
||||||
imgs_array = zarr_data["data/camera0_rgb"][id_from:id_to]
|
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||||
img_key = "observation.image"
|
|
||||||
if video:
|
|
||||||
# save png images in temporary directory
|
|
||||||
tmp_imgs_dir = out_dir / "tmp_images"
|
|
||||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
|
||||||
|
|
||||||
# encode images to a mp4 video
|
# clean temporary images directory
|
||||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
shutil.rmtree(tmp_imgs_dir)
|
||||||
video_path = out_dir / "videos" / fname
|
|
||||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
|
||||||
|
|
||||||
# clean temporary images directory
|
# store the reference to the video frame
|
||||||
shutil.rmtree(tmp_imgs_dir)
|
ep_dict[img_key] = [
|
||||||
|
{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||||
|
|
||||||
# store the reference to the video frame
|
ep_dict["observation.state"] = state
|
||||||
ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
|
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
||||||
|
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||||
|
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||||
|
ep_dict["episode_data_index_from"] = torch.tensor([from_idx] * num_frames)
|
||||||
|
ep_dict["episode_data_index_to"] = torch.tensor([from_idx + num_frames] * num_frames)
|
||||||
|
ep_dict["end_pose"] = end_pose[from_idx:to_idx]
|
||||||
|
ep_dict["start_pos"] = start_pos[from_idx:to_idx]
|
||||||
|
ep_dict["gripper_width"] = gripper_width[from_idx:to_idx]
|
||||||
|
torch.save(ep_dict, ep_dict_path)
|
||||||
else:
|
else:
|
||||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
ep_dict = torch.load(ep_dict_path)
|
||||||
|
|
||||||
ep_dict["observation.state"] = state
|
|
||||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
|
||||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
|
||||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
|
||||||
ep_dict["episode_data_index_from"] = torch.tensor([id_from] * num_frames)
|
|
||||||
ep_dict["episode_data_index_to"] = torch.tensor([id_from + num_frames] * num_frames)
|
|
||||||
ep_dict["end_pose"] = end_pose[id_from:id_to]
|
|
||||||
ep_dict["start_pos"] = start_pos[id_from:id_to]
|
|
||||||
ep_dict["gripper_width"] = gripper_width[id_from:id_to]
|
|
||||||
ep_dicts.append(ep_dict)
|
ep_dicts.append(ep_dict)
|
||||||
|
|
||||||
episode_data_index["from"].append(id_from)
|
|
||||||
episode_data_index["to"].append(id_from + num_frames)
|
|
||||||
id_from += num_frames
|
|
||||||
|
|
||||||
# process first episode only
|
|
||||||
if debug:
|
|
||||||
break
|
|
||||||
|
|
||||||
data_dict = concatenate_episodes(ep_dicts)
|
data_dict = concatenate_episodes(ep_dicts)
|
||||||
|
|
||||||
total_frames = id_from
|
total_frames = data_dict["frame_index"].shape[0]
|
||||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||||
|
return data_dict
|
||||||
return data_dict, episode_data_index
|
|
||||||
|
|
||||||
|
|
||||||
def to_hf_dataset(data_dict, video):
|
def to_hf_dataset(data_dict, video):
|
||||||
@@ -199,7 +200,14 @@ def to_hf_dataset(data_dict, video):
|
|||||||
return hf_dataset
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
def from_raw_to_lerobot_format(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int | None = None,
|
||||||
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
# sanity check
|
# sanity check
|
||||||
check_format(raw_dir)
|
check_format(raw_dir)
|
||||||
|
|
||||||
@@ -212,11 +220,15 @@ def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=Tru
|
|||||||
"Generating UMI dataset without `video=True` creates ~150GB on disk and requires ~80GB in RAM."
|
"Generating UMI dataset without `video=True` creates ~150GB on disk and requires ~80GB in RAM."
|
||||||
)
|
)
|
||||||
|
|
||||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||||
hf_dataset = to_hf_dataset(data_dict, video)
|
hf_dataset = to_hf_dataset(data_dict, video)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
info = {
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
"fps": fps,
|
"fps": fps,
|
||||||
"video": video,
|
"video": video,
|
||||||
}
|
}
|
||||||
|
if video:
|
||||||
|
info["encoding"] = get_default_encoding()
|
||||||
|
|
||||||
return hf_dataset, episode_data_index, info
|
return hf_dataset, episode_data_index, info
|
||||||
|
|||||||
@@ -13,13 +13,18 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
import inspect
|
||||||
from concurrent.futures import ThreadPoolExecutor
|
from concurrent.futures import ThreadPoolExecutor
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
from typing import Dict
|
||||||
|
|
||||||
|
import datasets
|
||||||
import numpy
|
import numpy
|
||||||
import PIL
|
import PIL
|
||||||
import torch
|
import torch
|
||||||
|
|
||||||
|
from lerobot.common.datasets.video_utils import encode_video_frames
|
||||||
|
|
||||||
|
|
||||||
def concatenate_episodes(ep_dicts):
|
def concatenate_episodes(ep_dicts):
|
||||||
data_dict = {}
|
data_dict = {}
|
||||||
@@ -51,3 +56,76 @@ def save_images_concurrently(imgs_array: numpy.array, out_dir: Path, max_workers
|
|||||||
num_images = len(imgs_array)
|
num_images = len(imgs_array)
|
||||||
with ThreadPoolExecutor(max_workers=max_workers) as executor:
|
with ThreadPoolExecutor(max_workers=max_workers) as executor:
|
||||||
[executor.submit(save_image, imgs_array[i], i, out_dir) for i in range(num_images)]
|
[executor.submit(save_image, imgs_array[i], i, out_dir) for i in range(num_images)]
|
||||||
|
|
||||||
|
|
||||||
|
def get_default_encoding() -> dict:
|
||||||
|
"""Returns the default ffmpeg encoding parameters used by `encode_video_frames`."""
|
||||||
|
signature = inspect.signature(encode_video_frames)
|
||||||
|
return {
|
||||||
|
k: v.default
|
||||||
|
for k, v in signature.parameters.items()
|
||||||
|
if v.default is not inspect.Parameter.empty and k in ["vcodec", "pix_fmt", "g", "crf"]
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def check_repo_id(repo_id: str) -> None:
|
||||||
|
if len(repo_id.split("/")) != 2:
|
||||||
|
raise ValueError(
|
||||||
|
f"""`repo_id` is expected to contain a community or user id `/` the name of the dataset
|
||||||
|
(e.g. 'lerobot/pusht'), but contains '{repo_id}'."""
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
# TODO(aliberts): remove
|
||||||
|
def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torch.Tensor]:
|
||||||
|
"""
|
||||||
|
Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
|
||||||
|
|
||||||
|
Parameters:
|
||||||
|
- hf_dataset (datasets.Dataset): A HuggingFace dataset containing the episode index.
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
- episode_data_index: A dictionary containing the data index for each episode. The dictionary has two keys:
|
||||||
|
- "from": A tensor containing the starting index of each episode.
|
||||||
|
- "to": A tensor containing the ending index of each episode.
|
||||||
|
"""
|
||||||
|
episode_data_index = {"from": [], "to": []}
|
||||||
|
|
||||||
|
current_episode = None
|
||||||
|
"""
|
||||||
|
The episode_index is a list of integers, each representing the episode index of the corresponding example.
|
||||||
|
For instance, the following is a valid episode_index:
|
||||||
|
[0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 2]
|
||||||
|
|
||||||
|
Below, we iterate through the episode_index and populate the episode_data_index dictionary with the starting and
|
||||||
|
ending index of each episode. For the episode_index above, the episode_data_index dictionary will look like this:
|
||||||
|
{
|
||||||
|
"from": [0, 3, 7],
|
||||||
|
"to": [3, 7, 12]
|
||||||
|
}
|
||||||
|
"""
|
||||||
|
if len(hf_dataset) == 0:
|
||||||
|
episode_data_index = {
|
||||||
|
"from": torch.tensor([]),
|
||||||
|
"to": torch.tensor([]),
|
||||||
|
}
|
||||||
|
return episode_data_index
|
||||||
|
for idx, episode_idx in enumerate(hf_dataset["episode_index"]):
|
||||||
|
if episode_idx != current_episode:
|
||||||
|
# We encountered a new episode, so we append its starting location to the "from" list
|
||||||
|
episode_data_index["from"].append(idx)
|
||||||
|
# If this is not the first episode, we append the ending location of the previous episode to the "to" list
|
||||||
|
if current_episode is not None:
|
||||||
|
episode_data_index["to"].append(idx)
|
||||||
|
# Let's keep track of the current episode index
|
||||||
|
current_episode = episode_idx
|
||||||
|
else:
|
||||||
|
# We are still in the same episode, so there is nothing for us to do here
|
||||||
|
pass
|
||||||
|
# We have reached the end of the dataset, so we append the ending location of the last episode to the "to" list
|
||||||
|
episode_data_index["to"].append(idx + 1)
|
||||||
|
|
||||||
|
for k in ["from", "to"]:
|
||||||
|
episode_data_index[k] = torch.tensor(episode_data_index[k])
|
||||||
|
|
||||||
|
return episode_data_index
|
||||||
|
|||||||
@@ -25,7 +25,13 @@ import tqdm
|
|||||||
from datasets import Dataset, Features, Image, Sequence, Value
|
from datasets import Dataset, Features, Image, Sequence, Value
|
||||||
from PIL import Image as PILImage
|
from PIL import Image as PILImage
|
||||||
|
|
||||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||||
|
from lerobot.common.datasets.push_dataset_to_hub.utils import (
|
||||||
|
calculate_episode_data_index,
|
||||||
|
concatenate_episodes,
|
||||||
|
get_default_encoding,
|
||||||
|
save_images_concurrently,
|
||||||
|
)
|
||||||
from lerobot.common.datasets.utils import (
|
from lerobot.common.datasets.utils import (
|
||||||
hf_transform_to_torch,
|
hf_transform_to_torch,
|
||||||
)
|
)
|
||||||
@@ -54,37 +60,49 @@ def check_format(raw_dir):
|
|||||||
assert all(len(nested_dict[subkey]) == expected_len for subkey in subkeys if subkey in nested_dict)
|
assert all(len(nested_dict[subkey]) == expected_len for subkey in subkeys if subkey in nested_dict)
|
||||||
|
|
||||||
|
|
||||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
def load_from_raw(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int,
|
||||||
|
video: bool,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
pkl_path = raw_dir / "buffer.pkl"
|
pkl_path = raw_dir / "buffer.pkl"
|
||||||
|
|
||||||
with open(pkl_path, "rb") as f:
|
with open(pkl_path, "rb") as f:
|
||||||
pkl_data = pickle.load(f)
|
pkl_data = pickle.load(f)
|
||||||
|
|
||||||
ep_dicts = []
|
# load data indices from which each episode starts and ends
|
||||||
episode_data_index = {"from": [], "to": []}
|
from_ids, to_ids = [], []
|
||||||
|
from_idx, to_idx = 0, 0
|
||||||
id_from = 0
|
for done in pkl_data["dones"]:
|
||||||
id_to = 0
|
to_idx += 1
|
||||||
ep_idx = 0
|
if not done:
|
||||||
total_frames = pkl_data["actions"].shape[0]
|
|
||||||
for i in tqdm.tqdm(range(total_frames)):
|
|
||||||
id_to += 1
|
|
||||||
|
|
||||||
if not pkl_data["dones"][i]:
|
|
||||||
continue
|
continue
|
||||||
|
from_ids.append(from_idx)
|
||||||
|
to_ids.append(to_idx)
|
||||||
|
from_idx = to_idx
|
||||||
|
|
||||||
num_frames = id_to - id_from
|
num_episodes = len(from_ids)
|
||||||
|
|
||||||
image = torch.tensor(pkl_data["observations"]["rgb"][id_from:id_to])
|
ep_dicts = []
|
||||||
|
ep_ids = episodes if episodes else range(num_episodes)
|
||||||
|
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||||
|
from_idx = from_ids[selected_ep_idx]
|
||||||
|
to_idx = to_ids[selected_ep_idx]
|
||||||
|
num_frames = to_idx - from_idx
|
||||||
|
|
||||||
|
image = torch.tensor(pkl_data["observations"]["rgb"][from_idx:to_idx])
|
||||||
image = einops.rearrange(image, "b c h w -> b h w c")
|
image = einops.rearrange(image, "b c h w -> b h w c")
|
||||||
state = torch.tensor(pkl_data["observations"]["state"][id_from:id_to])
|
state = torch.tensor(pkl_data["observations"]["state"][from_idx:to_idx])
|
||||||
action = torch.tensor(pkl_data["actions"][id_from:id_to])
|
action = torch.tensor(pkl_data["actions"][from_idx:to_idx])
|
||||||
# TODO(rcadene): we have a missing last frame which is the observation when the env is done
|
# TODO(rcadene): we have a missing last frame which is the observation when the env is done
|
||||||
# it is critical to have this frame for tdmpc to predict a "done observation/state"
|
# it is critical to have this frame for tdmpc to predict a "done observation/state"
|
||||||
# next_image = torch.tensor(pkl_data["next_observations"]["rgb"][id_from:id_to])
|
# next_image = torch.tensor(pkl_data["next_observations"]["rgb"][from_idx:to_idx])
|
||||||
# next_state = torch.tensor(pkl_data["next_observations"]["state"][id_from:id_to])
|
# next_state = torch.tensor(pkl_data["next_observations"]["state"][from_idx:to_idx])
|
||||||
next_reward = torch.tensor(pkl_data["rewards"][id_from:id_to])
|
next_reward = torch.tensor(pkl_data["rewards"][from_idx:to_idx])
|
||||||
next_done = torch.tensor(pkl_data["dones"][id_from:id_to])
|
next_done = torch.tensor(pkl_data["dones"][from_idx:to_idx])
|
||||||
|
|
||||||
ep_dict = {}
|
ep_dict = {}
|
||||||
|
|
||||||
@@ -92,13 +110,13 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
img_key = "observation.image"
|
img_key = "observation.image"
|
||||||
if video:
|
if video:
|
||||||
# save png images in temporary directory
|
# save png images in temporary directory
|
||||||
tmp_imgs_dir = out_dir / "tmp_images"
|
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||||
|
|
||||||
# encode images to a mp4 video
|
# encode images to a mp4 video
|
||||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||||
video_path = out_dir / "videos" / fname
|
video_path = videos_dir / fname
|
||||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
|
||||||
|
|
||||||
# clean temporary images directory
|
# clean temporary images directory
|
||||||
shutil.rmtree(tmp_imgs_dir)
|
shutil.rmtree(tmp_imgs_dir)
|
||||||
@@ -119,18 +137,11 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
|||||||
ep_dict["next.done"] = next_done
|
ep_dict["next.done"] = next_done
|
||||||
ep_dicts.append(ep_dict)
|
ep_dicts.append(ep_dict)
|
||||||
|
|
||||||
episode_data_index["from"].append(id_from)
|
|
||||||
episode_data_index["to"].append(id_from + num_frames)
|
|
||||||
|
|
||||||
id_from = id_to
|
|
||||||
ep_idx += 1
|
|
||||||
|
|
||||||
# process first episode only
|
|
||||||
if debug:
|
|
||||||
break
|
|
||||||
|
|
||||||
data_dict = concatenate_episodes(ep_dicts)
|
data_dict = concatenate_episodes(ep_dicts)
|
||||||
return data_dict, episode_data_index
|
|
||||||
|
total_frames = data_dict["frame_index"].shape[0]
|
||||||
|
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||||
|
return data_dict
|
||||||
|
|
||||||
|
|
||||||
def to_hf_dataset(data_dict, video):
|
def to_hf_dataset(data_dict, video):
|
||||||
@@ -161,18 +172,29 @@ def to_hf_dataset(data_dict, video):
|
|||||||
return hf_dataset
|
return hf_dataset
|
||||||
|
|
||||||
|
|
||||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
def from_raw_to_lerobot_format(
|
||||||
|
raw_dir: Path,
|
||||||
|
videos_dir: Path,
|
||||||
|
fps: int | None = None,
|
||||||
|
video: bool = True,
|
||||||
|
episodes: list[int] | None = None,
|
||||||
|
encoding: dict | None = None,
|
||||||
|
):
|
||||||
# sanity check
|
# sanity check
|
||||||
check_format(raw_dir)
|
check_format(raw_dir)
|
||||||
|
|
||||||
if fps is None:
|
if fps is None:
|
||||||
fps = 15
|
fps = 15
|
||||||
|
|
||||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
|
||||||
hf_dataset = to_hf_dataset(data_dict, video)
|
hf_dataset = to_hf_dataset(data_dict, video)
|
||||||
|
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||||
info = {
|
info = {
|
||||||
|
"codebase_version": CODEBASE_VERSION,
|
||||||
"fps": fps,
|
"fps": fps,
|
||||||
"video": video,
|
"video": video,
|
||||||
}
|
}
|
||||||
|
if video:
|
||||||
|
info["encoding"] = get_default_encoding()
|
||||||
|
|
||||||
return hf_dataset, episode_data_index, info
|
return hf_dataset, episode_data_index, info
|
||||||
|
|||||||
61
lerobot/common/datasets/sampler.py
Normal file
61
lerobot/common/datasets/sampler.py
Normal file
@@ -0,0 +1,61 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
from typing import Iterator, Union
|
||||||
|
|
||||||
|
import torch
|
||||||
|
|
||||||
|
|
||||||
|
class EpisodeAwareSampler:
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
episode_data_index: dict,
|
||||||
|
episode_indices_to_use: Union[list, None] = None,
|
||||||
|
drop_n_first_frames: int = 0,
|
||||||
|
drop_n_last_frames: int = 0,
|
||||||
|
shuffle: bool = False,
|
||||||
|
):
|
||||||
|
"""Sampler that optionally incorporates episode boundary information.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
episode_data_index: Dictionary with keys 'from' and 'to' containing the start and end indices of each episode.
|
||||||
|
episode_indices_to_use: List of episode indices to use. If None, all episodes are used.
|
||||||
|
Assumes that episodes are indexed from 0 to N-1.
|
||||||
|
drop_n_first_frames: Number of frames to drop from the start of each episode.
|
||||||
|
drop_n_last_frames: Number of frames to drop from the end of each episode.
|
||||||
|
shuffle: Whether to shuffle the indices.
|
||||||
|
"""
|
||||||
|
indices = []
|
||||||
|
for episode_idx, (start_index, end_index) in enumerate(
|
||||||
|
zip(episode_data_index["from"], episode_data_index["to"], strict=True)
|
||||||
|
):
|
||||||
|
if episode_indices_to_use is None or episode_idx in episode_indices_to_use:
|
||||||
|
indices.extend(
|
||||||
|
range(start_index.item() + drop_n_first_frames, end_index.item() - drop_n_last_frames)
|
||||||
|
)
|
||||||
|
|
||||||
|
self.indices = indices
|
||||||
|
self.shuffle = shuffle
|
||||||
|
|
||||||
|
def __iter__(self) -> Iterator[int]:
|
||||||
|
if self.shuffle:
|
||||||
|
for i in torch.randperm(len(self.indices)):
|
||||||
|
yield self.indices[i]
|
||||||
|
else:
|
||||||
|
for i in self.indices:
|
||||||
|
yield i
|
||||||
|
|
||||||
|
def __len__(self) -> int:
|
||||||
|
return len(self.indices)
|
||||||
197
lerobot/common/datasets/transforms.py
Normal file
197
lerobot/common/datasets/transforms.py
Normal file
@@ -0,0 +1,197 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
import collections
|
||||||
|
from typing import Any, Callable, Dict, Sequence
|
||||||
|
|
||||||
|
import torch
|
||||||
|
from torchvision.transforms import v2
|
||||||
|
from torchvision.transforms.v2 import Transform
|
||||||
|
from torchvision.transforms.v2 import functional as F # noqa: N812
|
||||||
|
|
||||||
|
|
||||||
|
class RandomSubsetApply(Transform):
|
||||||
|
"""Apply a random subset of N transformations from a list of transformations.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
transforms: list of transformations.
|
||||||
|
p: represents the multinomial probabilities (with no replacement) used for sampling the transform.
|
||||||
|
If the sum of the weights is not 1, they will be normalized. If ``None`` (default), all transforms
|
||||||
|
have the same probability.
|
||||||
|
n_subset: number of transformations to apply. If ``None``, all transforms are applied.
|
||||||
|
Must be in [1, len(transforms)].
|
||||||
|
random_order: apply transformations in a random order.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
transforms: Sequence[Callable],
|
||||||
|
p: list[float] | None = None,
|
||||||
|
n_subset: int | None = None,
|
||||||
|
random_order: bool = False,
|
||||||
|
) -> None:
|
||||||
|
super().__init__()
|
||||||
|
if not isinstance(transforms, Sequence):
|
||||||
|
raise TypeError("Argument transforms should be a sequence of callables")
|
||||||
|
if p is None:
|
||||||
|
p = [1] * len(transforms)
|
||||||
|
elif len(p) != len(transforms):
|
||||||
|
raise ValueError(
|
||||||
|
f"Length of p doesn't match the number of transforms: {len(p)} != {len(transforms)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
if n_subset is None:
|
||||||
|
n_subset = len(transforms)
|
||||||
|
elif not isinstance(n_subset, int):
|
||||||
|
raise TypeError("n_subset should be an int or None")
|
||||||
|
elif not (1 <= n_subset <= len(transforms)):
|
||||||
|
raise ValueError(f"n_subset should be in the interval [1, {len(transforms)}]")
|
||||||
|
|
||||||
|
self.transforms = transforms
|
||||||
|
total = sum(p)
|
||||||
|
self.p = [prob / total for prob in p]
|
||||||
|
self.n_subset = n_subset
|
||||||
|
self.random_order = random_order
|
||||||
|
|
||||||
|
def forward(self, *inputs: Any) -> Any:
|
||||||
|
needs_unpacking = len(inputs) > 1
|
||||||
|
|
||||||
|
selected_indices = torch.multinomial(torch.tensor(self.p), self.n_subset)
|
||||||
|
if not self.random_order:
|
||||||
|
selected_indices = selected_indices.sort().values
|
||||||
|
|
||||||
|
selected_transforms = [self.transforms[i] for i in selected_indices]
|
||||||
|
|
||||||
|
for transform in selected_transforms:
|
||||||
|
outputs = transform(*inputs)
|
||||||
|
inputs = outputs if needs_unpacking else (outputs,)
|
||||||
|
|
||||||
|
return outputs
|
||||||
|
|
||||||
|
def extra_repr(self) -> str:
|
||||||
|
return (
|
||||||
|
f"transforms={self.transforms}, "
|
||||||
|
f"p={self.p}, "
|
||||||
|
f"n_subset={self.n_subset}, "
|
||||||
|
f"random_order={self.random_order}"
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
class SharpnessJitter(Transform):
|
||||||
|
"""Randomly change the sharpness of an image or video.
|
||||||
|
|
||||||
|
Similar to a v2.RandomAdjustSharpness with p=1 and a sharpness_factor sampled randomly.
|
||||||
|
While v2.RandomAdjustSharpness applies — with a given probability — a fixed sharpness_factor to an image,
|
||||||
|
SharpnessJitter applies a random sharpness_factor each time. This is to have a more diverse set of
|
||||||
|
augmentations as a result.
|
||||||
|
|
||||||
|
A sharpness_factor of 0 gives a blurred image, 1 gives the original image while 2 increases the sharpness
|
||||||
|
by a factor of 2.
|
||||||
|
|
||||||
|
If the input is a :class:`torch.Tensor`,
|
||||||
|
it is expected to have [..., 1 or 3, H, W] shape, where ... means an arbitrary number of leading dimensions.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
sharpness: How much to jitter sharpness. sharpness_factor is chosen uniformly from
|
||||||
|
[max(0, 1 - sharpness), 1 + sharpness] or the given
|
||||||
|
[min, max]. Should be non negative numbers.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, sharpness: float | Sequence[float]) -> None:
|
||||||
|
super().__init__()
|
||||||
|
self.sharpness = self._check_input(sharpness)
|
||||||
|
|
||||||
|
def _check_input(self, sharpness):
|
||||||
|
if isinstance(sharpness, (int, float)):
|
||||||
|
if sharpness < 0:
|
||||||
|
raise ValueError("If sharpness is a single number, it must be non negative.")
|
||||||
|
sharpness = [1.0 - sharpness, 1.0 + sharpness]
|
||||||
|
sharpness[0] = max(sharpness[0], 0.0)
|
||||||
|
elif isinstance(sharpness, collections.abc.Sequence) and len(sharpness) == 2:
|
||||||
|
sharpness = [float(v) for v in sharpness]
|
||||||
|
else:
|
||||||
|
raise TypeError(f"{sharpness=} should be a single number or a sequence with length 2.")
|
||||||
|
|
||||||
|
if not 0.0 <= sharpness[0] <= sharpness[1]:
|
||||||
|
raise ValueError(f"sharpnesss values should be between (0., inf), but got {sharpness}.")
|
||||||
|
|
||||||
|
return float(sharpness[0]), float(sharpness[1])
|
||||||
|
|
||||||
|
def _generate_value(self, left: float, right: float) -> float:
|
||||||
|
return torch.empty(1).uniform_(left, right).item()
|
||||||
|
|
||||||
|
def _transform(self, inpt: Any, params: Dict[str, Any]) -> Any:
|
||||||
|
sharpness_factor = self._generate_value(self.sharpness[0], self.sharpness[1])
|
||||||
|
return self._call_kernel(F.adjust_sharpness, inpt, sharpness_factor=sharpness_factor)
|
||||||
|
|
||||||
|
|
||||||
|
def get_image_transforms(
|
||||||
|
brightness_weight: float = 1.0,
|
||||||
|
brightness_min_max: tuple[float, float] | None = None,
|
||||||
|
contrast_weight: float = 1.0,
|
||||||
|
contrast_min_max: tuple[float, float] | None = None,
|
||||||
|
saturation_weight: float = 1.0,
|
||||||
|
saturation_min_max: tuple[float, float] | None = None,
|
||||||
|
hue_weight: float = 1.0,
|
||||||
|
hue_min_max: tuple[float, float] | None = None,
|
||||||
|
sharpness_weight: float = 1.0,
|
||||||
|
sharpness_min_max: tuple[float, float] | None = None,
|
||||||
|
max_num_transforms: int | None = None,
|
||||||
|
random_order: bool = False,
|
||||||
|
):
|
||||||
|
def check_value(name, weight, min_max):
|
||||||
|
if min_max is not None:
|
||||||
|
if len(min_max) != 2:
|
||||||
|
raise ValueError(
|
||||||
|
f"`{name}_min_max` is expected to be a tuple of 2 dimensions, but {min_max} provided."
|
||||||
|
)
|
||||||
|
if weight < 0.0:
|
||||||
|
raise ValueError(
|
||||||
|
f"`{name}_weight` is expected to be 0 or positive, but is negative ({weight})."
|
||||||
|
)
|
||||||
|
|
||||||
|
check_value("brightness", brightness_weight, brightness_min_max)
|
||||||
|
check_value("contrast", contrast_weight, contrast_min_max)
|
||||||
|
check_value("saturation", saturation_weight, saturation_min_max)
|
||||||
|
check_value("hue", hue_weight, hue_min_max)
|
||||||
|
check_value("sharpness", sharpness_weight, sharpness_min_max)
|
||||||
|
|
||||||
|
weights = []
|
||||||
|
transforms = []
|
||||||
|
if brightness_min_max is not None and brightness_weight > 0.0:
|
||||||
|
weights.append(brightness_weight)
|
||||||
|
transforms.append(v2.ColorJitter(brightness=brightness_min_max))
|
||||||
|
if contrast_min_max is not None and contrast_weight > 0.0:
|
||||||
|
weights.append(contrast_weight)
|
||||||
|
transforms.append(v2.ColorJitter(contrast=contrast_min_max))
|
||||||
|
if saturation_min_max is not None and saturation_weight > 0.0:
|
||||||
|
weights.append(saturation_weight)
|
||||||
|
transforms.append(v2.ColorJitter(saturation=saturation_min_max))
|
||||||
|
if hue_min_max is not None and hue_weight > 0.0:
|
||||||
|
weights.append(hue_weight)
|
||||||
|
transforms.append(v2.ColorJitter(hue=hue_min_max))
|
||||||
|
if sharpness_min_max is not None and sharpness_weight > 0.0:
|
||||||
|
weights.append(sharpness_weight)
|
||||||
|
transforms.append(SharpnessJitter(sharpness=sharpness_min_max))
|
||||||
|
|
||||||
|
n_subset = len(transforms)
|
||||||
|
if max_num_transforms is not None:
|
||||||
|
n_subset = min(n_subset, max_num_transforms)
|
||||||
|
|
||||||
|
if n_subset == 0:
|
||||||
|
return v2.Identity()
|
||||||
|
else:
|
||||||
|
# TODO(rcadene, aliberts): add v2.ToDtype float16?
|
||||||
|
return RandomSubsetApply(transforms, p=weights, n_subset=n_subset, random_order=random_order)
|
||||||
@@ -13,21 +13,58 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
import importlib.resources
|
||||||
import json
|
import json
|
||||||
import re
|
import logging
|
||||||
|
import textwrap
|
||||||
|
from itertools import accumulate
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from typing import Dict
|
from pprint import pformat
|
||||||
|
from typing import Any
|
||||||
|
|
||||||
import datasets
|
import datasets
|
||||||
|
import jsonlines
|
||||||
|
import numpy as np
|
||||||
|
import pyarrow.compute as pc
|
||||||
import torch
|
import torch
|
||||||
from datasets import load_dataset, load_from_disk
|
from datasets.table import embed_table_storage
|
||||||
from huggingface_hub import hf_hub_download, snapshot_download
|
from huggingface_hub import DatasetCard, DatasetCardData, HfApi
|
||||||
from PIL import Image as PILImage
|
from PIL import Image as PILImage
|
||||||
from safetensors.torch import load_file
|
|
||||||
from torchvision import transforms
|
from torchvision import transforms
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.robots.utils import Robot
|
||||||
|
|
||||||
def flatten_dict(d, parent_key="", sep="/"):
|
DEFAULT_CHUNK_SIZE = 1000 # Max number of episodes per chunk
|
||||||
|
|
||||||
|
INFO_PATH = "meta/info.json"
|
||||||
|
EPISODES_PATH = "meta/episodes.jsonl"
|
||||||
|
STATS_PATH = "meta/stats.json"
|
||||||
|
TASKS_PATH = "meta/tasks.jsonl"
|
||||||
|
|
||||||
|
DEFAULT_VIDEO_PATH = "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4"
|
||||||
|
DEFAULT_PARQUET_PATH = "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet"
|
||||||
|
DEFAULT_IMAGE_PATH = "images/{image_key}/episode_{episode_index:06d}/frame_{frame_index:06d}.png"
|
||||||
|
|
||||||
|
DATASET_CARD_TEMPLATE = """
|
||||||
|
---
|
||||||
|
# Metadata will go there
|
||||||
|
---
|
||||||
|
This dataset was created using [LeRobot](https://github.com/huggingface/lerobot).
|
||||||
|
|
||||||
|
## {}
|
||||||
|
|
||||||
|
"""
|
||||||
|
|
||||||
|
DEFAULT_FEATURES = {
|
||||||
|
"timestamp": {"dtype": "float32", "shape": (1,), "names": None},
|
||||||
|
"frame_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||||
|
"episode_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||||
|
"index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||||
|
"task_index": {"dtype": "int64", "shape": (1,), "names": None},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def flatten_dict(d: dict, parent_key: str = "", sep: str = "/") -> dict:
|
||||||
"""Flatten a nested dictionary structure by collapsing nested keys into one key with a separator.
|
"""Flatten a nested dictionary structure by collapsing nested keys into one key with a separator.
|
||||||
|
|
||||||
For example:
|
For example:
|
||||||
@@ -46,7 +83,7 @@ def flatten_dict(d, parent_key="", sep="/"):
|
|||||||
return dict(items)
|
return dict(items)
|
||||||
|
|
||||||
|
|
||||||
def unflatten_dict(d, sep="/"):
|
def unflatten_dict(d: dict, sep: str = "/") -> dict:
|
||||||
outdict = {}
|
outdict = {}
|
||||||
for key, value in d.items():
|
for key, value in d.items():
|
||||||
parts = key.split(sep)
|
parts = key.split(sep)
|
||||||
@@ -59,7 +96,83 @@ def unflatten_dict(d, sep="/"):
|
|||||||
return outdict
|
return outdict
|
||||||
|
|
||||||
|
|
||||||
def hf_transform_to_torch(items_dict):
|
def serialize_dict(stats: dict[str, torch.Tensor | np.ndarray | dict]) -> dict:
|
||||||
|
serialized_dict = {key: value.tolist() for key, value in flatten_dict(stats).items()}
|
||||||
|
return unflatten_dict(serialized_dict)
|
||||||
|
|
||||||
|
|
||||||
|
def write_parquet(dataset: datasets.Dataset, fpath: Path) -> None:
|
||||||
|
# Embed image bytes into the table before saving to parquet
|
||||||
|
format = dataset.format
|
||||||
|
dataset = dataset.with_format("arrow")
|
||||||
|
dataset = dataset.map(embed_table_storage, batched=False)
|
||||||
|
dataset = dataset.with_format(**format)
|
||||||
|
dataset.to_parquet(fpath)
|
||||||
|
|
||||||
|
|
||||||
|
def load_json(fpath: Path) -> Any:
|
||||||
|
with open(fpath) as f:
|
||||||
|
return json.load(f)
|
||||||
|
|
||||||
|
|
||||||
|
def write_json(data: dict, fpath: Path) -> None:
|
||||||
|
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with open(fpath, "w") as f:
|
||||||
|
json.dump(data, f, indent=4, ensure_ascii=False)
|
||||||
|
|
||||||
|
|
||||||
|
def load_jsonlines(fpath: Path) -> list[Any]:
|
||||||
|
with jsonlines.open(fpath, "r") as reader:
|
||||||
|
return list(reader)
|
||||||
|
|
||||||
|
|
||||||
|
def write_jsonlines(data: dict, fpath: Path) -> None:
|
||||||
|
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with jsonlines.open(fpath, "w") as writer:
|
||||||
|
writer.write_all(data)
|
||||||
|
|
||||||
|
|
||||||
|
def append_jsonlines(data: dict, fpath: Path) -> None:
|
||||||
|
fpath.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with jsonlines.open(fpath, "a") as writer:
|
||||||
|
writer.write(data)
|
||||||
|
|
||||||
|
|
||||||
|
def load_info(local_dir: Path) -> dict:
|
||||||
|
info = load_json(local_dir / INFO_PATH)
|
||||||
|
for ft in info["features"].values():
|
||||||
|
ft["shape"] = tuple(ft["shape"])
|
||||||
|
return info
|
||||||
|
|
||||||
|
|
||||||
|
def load_stats(local_dir: Path) -> dict:
|
||||||
|
if not (local_dir / STATS_PATH).exists():
|
||||||
|
return None
|
||||||
|
stats = load_json(local_dir / STATS_PATH)
|
||||||
|
stats = {key: torch.tensor(value) for key, value in flatten_dict(stats).items()}
|
||||||
|
return unflatten_dict(stats)
|
||||||
|
|
||||||
|
|
||||||
|
def load_tasks(local_dir: Path) -> dict:
|
||||||
|
tasks = load_jsonlines(local_dir / TASKS_PATH)
|
||||||
|
return {item["task_index"]: item["task"] for item in sorted(tasks, key=lambda x: x["task_index"])}
|
||||||
|
|
||||||
|
|
||||||
|
def load_episodes(local_dir: Path) -> dict:
|
||||||
|
return load_jsonlines(local_dir / EPISODES_PATH)
|
||||||
|
|
||||||
|
|
||||||
|
def load_image_as_numpy(fpath: str | Path, dtype="float32", channel_first: bool = True) -> np.ndarray:
|
||||||
|
img = PILImage.open(fpath).convert("RGB")
|
||||||
|
img_array = np.array(img, dtype=dtype)
|
||||||
|
if channel_first: # (H, W, C) -> (C, H, W)
|
||||||
|
img_array = np.transpose(img_array, (2, 0, 1))
|
||||||
|
if "float" in dtype:
|
||||||
|
img_array /= 255.0
|
||||||
|
return img_array
|
||||||
|
|
||||||
|
|
||||||
|
def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
|
||||||
"""Get a transform function that convert items from Hugging Face dataset (pyarrow)
|
"""Get a transform function that convert items from Hugging Face dataset (pyarrow)
|
||||||
to torch tensors. Importantly, images are converted from PIL, which corresponds to
|
to torch tensors. Importantly, images are converted from PIL, which corresponds to
|
||||||
a channel last representation (h w c) of uint8 type, to a torch image representation
|
a channel last representation (h w c) of uint8 type, to a torch image representation
|
||||||
@@ -70,275 +183,260 @@ def hf_transform_to_torch(items_dict):
|
|||||||
if isinstance(first_item, PILImage.Image):
|
if isinstance(first_item, PILImage.Image):
|
||||||
to_tensor = transforms.ToTensor()
|
to_tensor = transforms.ToTensor()
|
||||||
items_dict[key] = [to_tensor(img) for img in items_dict[key]]
|
items_dict[key] = [to_tensor(img) for img in items_dict[key]]
|
||||||
elif isinstance(first_item, dict) and "path" in first_item and "timestamp" in first_item:
|
elif first_item is None:
|
||||||
# video frame will be processed downstream
|
|
||||||
pass
|
pass
|
||||||
else:
|
else:
|
||||||
items_dict[key] = [torch.tensor(x) for x in items_dict[key]]
|
items_dict[key] = [torch.tensor(x) for x in items_dict[key]]
|
||||||
return items_dict
|
return items_dict
|
||||||
|
|
||||||
|
|
||||||
def load_hf_dataset(repo_id, version, root, split) -> datasets.Dataset:
|
def _get_major_minor(version: str) -> tuple[int]:
|
||||||
"""hf_dataset contains all the observations, states, actions, rewards, etc."""
|
split = version.strip("v").split(".")
|
||||||
if root is not None:
|
return int(split[0]), int(split[1])
|
||||||
hf_dataset = load_from_disk(str(Path(root) / repo_id / "train"))
|
|
||||||
# TODO(rcadene): clean this which enables getting a subset of dataset
|
|
||||||
if split != "train":
|
|
||||||
if "%" in split:
|
|
||||||
raise NotImplementedError(f"We dont support splitting based on percentage for now ({split}).")
|
|
||||||
match_from = re.search(r"train\[(\d+):\]", split)
|
|
||||||
match_to = re.search(r"train\[:(\d+)\]", split)
|
|
||||||
if match_from:
|
|
||||||
from_frame_index = int(match_from.group(1))
|
|
||||||
hf_dataset = hf_dataset.select(range(from_frame_index, len(hf_dataset)))
|
|
||||||
elif match_to:
|
|
||||||
to_frame_index = int(match_to.group(1))
|
|
||||||
hf_dataset = hf_dataset.select(range(to_frame_index))
|
|
||||||
else:
|
|
||||||
raise ValueError(
|
|
||||||
f'`split` ({split}) should either be "train", "train[INT:]", or "train[:INT]"'
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
hf_dataset = load_dataset(repo_id, revision=version, split=split)
|
|
||||||
hf_dataset.set_transform(hf_transform_to_torch)
|
|
||||||
return hf_dataset
|
|
||||||
|
|
||||||
|
|
||||||
def load_episode_data_index(repo_id, version, root) -> dict[str, torch.Tensor]:
|
class BackwardCompatibilityError(Exception):
|
||||||
"""episode_data_index contains the range of indices for each episode
|
def __init__(self, repo_id, version):
|
||||||
|
message = textwrap.dedent(f"""
|
||||||
|
BackwardCompatibilityError: The dataset you requested ({repo_id}) is in {version} format.
|
||||||
|
|
||||||
Example:
|
We introduced a new format since v2.0 which is not backward compatible with v1.x.
|
||||||
```python
|
Please, use our conversion script. Modify the following command with your own task description:
|
||||||
from_id = episode_data_index["from"][episode_id].item()
|
```
|
||||||
to_id = episode_data_index["to"][episode_id].item()
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \\
|
||||||
episode_frames = [dataset[i] for i in range(from_id, to_id)]
|
--repo-id {repo_id} \\
|
||||||
```
|
--single-task "TASK DESCRIPTION." # <---- /!\\ Replace TASK DESCRIPTION /!\\
|
||||||
"""
|
```
|
||||||
if root is not None:
|
|
||||||
path = Path(root) / repo_id / "meta_data" / "episode_data_index.safetensors"
|
A few examples to replace TASK DESCRIPTION: "Pick up the blue cube and place it into the bin.",
|
||||||
else:
|
"Insert the peg into the socket.", "Slide open the ziploc bag.", "Take the elevator to the 1st floor.",
|
||||||
path = hf_hub_download(
|
"Open the top cabinet, store the pot inside it then close the cabinet.", "Push the T-shaped block onto the T-shaped target.",
|
||||||
repo_id, "meta_data/episode_data_index.safetensors", repo_type="dataset", revision=version
|
"Grab the spray paint on the shelf and place it in the bin on top of the robot dog.", "Fold the sweatshirt.", ...
|
||||||
|
|
||||||
|
If you encounter a problem, contact LeRobot maintainers on [Discord](https://discord.com/invite/s3KuuzsPFb)
|
||||||
|
or open an [issue on GitHub](https://github.com/huggingface/lerobot/issues/new/choose).
|
||||||
|
""")
|
||||||
|
super().__init__(message)
|
||||||
|
|
||||||
|
|
||||||
|
def check_version_compatibility(
|
||||||
|
repo_id: str, version_to_check: str, current_version: str, enforce_breaking_major: bool = True
|
||||||
|
) -> None:
|
||||||
|
current_major, _ = _get_major_minor(current_version)
|
||||||
|
major_to_check, _ = _get_major_minor(version_to_check)
|
||||||
|
if major_to_check < current_major and enforce_breaking_major:
|
||||||
|
raise BackwardCompatibilityError(repo_id, version_to_check)
|
||||||
|
elif float(version_to_check.strip("v")) < float(current_version.strip("v")):
|
||||||
|
logging.warning(
|
||||||
|
f"""The dataset you requested ({repo_id}) was created with a previous version ({version_to_check}) of the
|
||||||
|
codebase. The current codebase version is {current_version}. You should be fine since
|
||||||
|
backward compatibility is maintained. If you encounter a problem, contact LeRobot maintainers on
|
||||||
|
Discord ('https://discord.com/invite/s3KuuzsPFb') or open an issue on github.""",
|
||||||
)
|
)
|
||||||
|
|
||||||
return load_file(path)
|
|
||||||
|
|
||||||
|
def get_hub_safe_version(repo_id: str, version: str) -> str:
|
||||||
|
api = HfApi()
|
||||||
|
dataset_info = api.list_repo_refs(repo_id, repo_type="dataset")
|
||||||
|
branches = [b.name for b in dataset_info.branches]
|
||||||
|
if version not in branches:
|
||||||
|
num_version = float(version.strip("v"))
|
||||||
|
hub_num_versions = [float(v.strip("v")) for v in branches if v.startswith("v")]
|
||||||
|
if num_version >= 2.0 and all(v < 2.0 for v in hub_num_versions):
|
||||||
|
raise BackwardCompatibilityError(repo_id, version)
|
||||||
|
|
||||||
def load_stats(repo_id, version, root) -> dict[str, dict[str, torch.Tensor]]:
|
logging.warning(
|
||||||
"""stats contains the statistics per modality computed over the full dataset, such as max, min, mean, std
|
f"""You are trying to load a dataset from {repo_id} created with a previous version of the
|
||||||
|
codebase. The following versions are available: {branches}.
|
||||||
Example:
|
The requested version ('{version}') is not found. You should be fine since
|
||||||
```python
|
backward compatibility is maintained. If you encounter a problem, contact LeRobot maintainers on
|
||||||
normalized_action = (action - stats["action"]["mean"]) / stats["action"]["std"]
|
Discord ('https://discord.com/invite/s3KuuzsPFb') or open an issue on github.""",
|
||||||
```
|
|
||||||
"""
|
|
||||||
if root is not None:
|
|
||||||
path = Path(root) / repo_id / "meta_data" / "stats.safetensors"
|
|
||||||
else:
|
|
||||||
path = hf_hub_download(repo_id, "meta_data/stats.safetensors", repo_type="dataset", revision=version)
|
|
||||||
|
|
||||||
stats = load_file(path)
|
|
||||||
return unflatten_dict(stats)
|
|
||||||
|
|
||||||
|
|
||||||
def load_info(repo_id, version, root) -> dict:
|
|
||||||
"""info contains useful information regarding the dataset that are not stored elsewhere
|
|
||||||
|
|
||||||
Example:
|
|
||||||
```python
|
|
||||||
print("frame per second used to collect the video", info["fps"])
|
|
||||||
```
|
|
||||||
"""
|
|
||||||
if root is not None:
|
|
||||||
path = Path(root) / repo_id / "meta_data" / "info.json"
|
|
||||||
else:
|
|
||||||
path = hf_hub_download(repo_id, "meta_data/info.json", repo_type="dataset", revision=version)
|
|
||||||
|
|
||||||
with open(path) as f:
|
|
||||||
info = json.load(f)
|
|
||||||
return info
|
|
||||||
|
|
||||||
|
|
||||||
def load_videos(repo_id, version, root) -> Path:
|
|
||||||
if root is not None:
|
|
||||||
path = Path(root) / repo_id / "videos"
|
|
||||||
else:
|
|
||||||
# TODO(rcadene): we download the whole repo here. see if we can avoid this
|
|
||||||
repo_dir = snapshot_download(repo_id, repo_type="dataset", revision=version)
|
|
||||||
path = Path(repo_dir) / "videos"
|
|
||||||
|
|
||||||
return path
|
|
||||||
|
|
||||||
|
|
||||||
def load_previous_and_future_frames(
|
|
||||||
item: dict[str, torch.Tensor],
|
|
||||||
hf_dataset: datasets.Dataset,
|
|
||||||
episode_data_index: dict[str, torch.Tensor],
|
|
||||||
delta_timestamps: dict[str, list[float]],
|
|
||||||
tolerance_s: float,
|
|
||||||
) -> dict[torch.Tensor]:
|
|
||||||
"""
|
|
||||||
Given a current item in the dataset containing a timestamp (e.g. 0.6 seconds), and a list of time differences of
|
|
||||||
some modalities (e.g. delta_timestamps={"observation.image": [-0.8, -0.2, 0, 0.2]}), this function computes for each
|
|
||||||
given modality (e.g. "observation.image") a list of query timestamps (e.g. [-0.2, 0.4, 0.6, 0.8]) and loads the closest
|
|
||||||
frames in the dataset.
|
|
||||||
|
|
||||||
Importantly, when no frame can be found around a query timestamp within a specified tolerance window, this function
|
|
||||||
raises an AssertionError. When a timestamp is queried before the first available timestamp of the episode or after
|
|
||||||
the last available timestamp, the violation of the tolerance doesnt raise an AssertionError, and the function
|
|
||||||
populates a boolean array indicating which frames are outside of the episode range. For instance, this boolean array
|
|
||||||
is useful during batched training to not supervise actions associated to timestamps coming after the end of the
|
|
||||||
episode, or to pad the observations in a specific way. Note that by default the observation frames before the start
|
|
||||||
of the episode are the same as the first frame of the episode.
|
|
||||||
|
|
||||||
Parameters:
|
|
||||||
- item (dict): A dictionary containing all the data related to a frame. It is the result of `dataset[idx]`. Each key
|
|
||||||
corresponds to a different modality (e.g., "timestamp", "observation.image", "action").
|
|
||||||
- hf_dataset (datasets.Dataset): A dictionary containing the full dataset. Each key corresponds to a different
|
|
||||||
modality (e.g., "timestamp", "observation.image", "action").
|
|
||||||
- episode_data_index (dict): A dictionary containing two keys ("from" and "to") associated to dataset indices.
|
|
||||||
They indicate the start index and end index of each episode in the dataset.
|
|
||||||
- delta_timestamps (dict): A dictionary containing lists of delta timestamps for each possible modality to be
|
|
||||||
retrieved. These deltas are added to the item timestamp to form the query timestamps.
|
|
||||||
- tolerance_s (float, optional): The tolerance level (in seconds) used to determine if a data point is close enough to the query
|
|
||||||
timestamp by asserting `tol > difference`. It is suggested to set `tol` to a smaller value than the
|
|
||||||
smallest expected inter-frame period, but large enough to account for jitter.
|
|
||||||
|
|
||||||
Returns:
|
|
||||||
- The same item with the queried frames for each modality specified in delta_timestamps, with an additional key for
|
|
||||||
each modality (e.g. "observation.image_is_pad").
|
|
||||||
|
|
||||||
Raises:
|
|
||||||
- AssertionError: If any of the frames unexpectedly violate the tolerance level. This could indicate synchronization
|
|
||||||
issues with timestamps during data collection.
|
|
||||||
"""
|
|
||||||
# get indices of the frames associated to the episode, and their timestamps
|
|
||||||
ep_id = item["episode_index"].item()
|
|
||||||
ep_data_id_from = episode_data_index["from"][ep_id].item()
|
|
||||||
ep_data_id_to = episode_data_index["to"][ep_id].item()
|
|
||||||
ep_data_ids = torch.arange(ep_data_id_from, ep_data_id_to, 1)
|
|
||||||
|
|
||||||
# load timestamps
|
|
||||||
ep_timestamps = hf_dataset.select_columns("timestamp")[ep_data_id_from:ep_data_id_to]["timestamp"]
|
|
||||||
ep_timestamps = torch.stack(ep_timestamps)
|
|
||||||
|
|
||||||
# we make the assumption that the timestamps are sorted
|
|
||||||
ep_first_ts = ep_timestamps[0]
|
|
||||||
ep_last_ts = ep_timestamps[-1]
|
|
||||||
current_ts = item["timestamp"].item()
|
|
||||||
|
|
||||||
for key in delta_timestamps:
|
|
||||||
# get timestamps used as query to retrieve data of previous/future frames
|
|
||||||
delta_ts = delta_timestamps[key]
|
|
||||||
query_ts = current_ts + torch.tensor(delta_ts)
|
|
||||||
|
|
||||||
# compute distances between each query timestamp and all timestamps of all the frames belonging to the episode
|
|
||||||
dist = torch.cdist(query_ts[:, None], ep_timestamps[:, None], p=1)
|
|
||||||
min_, argmin_ = dist.min(1)
|
|
||||||
|
|
||||||
# TODO(rcadene): synchronize timestamps + interpolation if needed
|
|
||||||
|
|
||||||
is_pad = min_ > tolerance_s
|
|
||||||
|
|
||||||
# check violated query timestamps are all outside the episode range
|
|
||||||
assert ((query_ts[is_pad] < ep_first_ts) | (ep_last_ts < query_ts[is_pad])).all(), (
|
|
||||||
f"One or several timestamps unexpectedly violate the tolerance ({min_} > {tolerance_s=}) inside episode range."
|
|
||||||
"This might be due to synchronization issues with timestamps during data collection."
|
|
||||||
)
|
)
|
||||||
|
if "main" not in branches:
|
||||||
|
raise ValueError(f"Version 'main' not found on {repo_id}")
|
||||||
|
return "main"
|
||||||
|
else:
|
||||||
|
return version
|
||||||
|
|
||||||
# get dataset indices corresponding to frames to be loaded
|
|
||||||
data_ids = ep_data_ids[argmin_]
|
|
||||||
|
|
||||||
# load frames modality
|
def get_hf_features_from_features(features: dict) -> datasets.Features:
|
||||||
item[key] = hf_dataset.select_columns(key)[data_ids][key]
|
hf_features = {}
|
||||||
|
for key, ft in features.items():
|
||||||
if isinstance(item[key][0], dict) and "path" in item[key][0]:
|
if ft["dtype"] == "video":
|
||||||
# video mode where frame are expressed as dict of path and timestamp
|
continue
|
||||||
item[key] = item[key]
|
elif ft["dtype"] == "image":
|
||||||
|
hf_features[key] = datasets.Image()
|
||||||
|
elif ft["shape"] == (1,):
|
||||||
|
hf_features[key] = datasets.Value(dtype=ft["dtype"])
|
||||||
else:
|
else:
|
||||||
item[key] = torch.stack(item[key])
|
assert len(ft["shape"]) == 1
|
||||||
|
hf_features[key] = datasets.Sequence(
|
||||||
|
length=ft["shape"][0], feature=datasets.Value(dtype=ft["dtype"])
|
||||||
|
)
|
||||||
|
|
||||||
item[f"{key}_is_pad"] = is_pad
|
return datasets.Features(hf_features)
|
||||||
|
|
||||||
return item
|
|
||||||
|
|
||||||
|
|
||||||
def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torch.Tensor]:
|
def get_features_from_robot(robot: Robot, use_videos: bool = True) -> dict:
|
||||||
"""
|
camera_ft = {}
|
||||||
Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
|
if robot.cameras:
|
||||||
|
camera_ft = {
|
||||||
Parameters:
|
key: {"dtype": "video" if use_videos else "image", **ft}
|
||||||
- hf_dataset (datasets.Dataset): A HuggingFace dataset containing the episode index.
|
for key, ft in robot.camera_features.items()
|
||||||
|
|
||||||
Returns:
|
|
||||||
- episode_data_index: A dictionary containing the data index for each episode. The dictionary has two keys:
|
|
||||||
- "from": A tensor containing the starting index of each episode.
|
|
||||||
- "to": A tensor containing the ending index of each episode.
|
|
||||||
"""
|
|
||||||
episode_data_index = {"from": [], "to": []}
|
|
||||||
|
|
||||||
current_episode = None
|
|
||||||
"""
|
|
||||||
The episode_index is a list of integers, each representing the episode index of the corresponding example.
|
|
||||||
For instance, the following is a valid episode_index:
|
|
||||||
[0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 2]
|
|
||||||
|
|
||||||
Below, we iterate through the episode_index and populate the episode_data_index dictionary with the starting and
|
|
||||||
ending index of each episode. For the episode_index above, the episode_data_index dictionary will look like this:
|
|
||||||
{
|
|
||||||
"from": [0, 3, 7],
|
|
||||||
"to": [3, 7, 12]
|
|
||||||
}
|
}
|
||||||
"""
|
return {**robot.motor_features, **camera_ft, **DEFAULT_FEATURES}
|
||||||
if len(hf_dataset) == 0:
|
|
||||||
episode_data_index = {
|
|
||||||
"from": torch.tensor([]),
|
|
||||||
"to": torch.tensor([]),
|
|
||||||
}
|
|
||||||
return episode_data_index
|
|
||||||
for idx, episode_idx in enumerate(hf_dataset["episode_index"]):
|
|
||||||
if episode_idx != current_episode:
|
|
||||||
# We encountered a new episode, so we append its starting location to the "from" list
|
|
||||||
episode_data_index["from"].append(idx)
|
|
||||||
# If this is not the first episode, we append the ending location of the previous episode to the "to" list
|
|
||||||
if current_episode is not None:
|
|
||||||
episode_data_index["to"].append(idx)
|
|
||||||
# Let's keep track of the current episode index
|
|
||||||
current_episode = episode_idx
|
|
||||||
else:
|
|
||||||
# We are still in the same episode, so there is nothing for us to do here
|
|
||||||
pass
|
|
||||||
# We have reached the end of the dataset, so we append the ending location of the last episode to the "to" list
|
|
||||||
episode_data_index["to"].append(idx + 1)
|
|
||||||
|
|
||||||
for k in ["from", "to"]:
|
|
||||||
episode_data_index[k] = torch.tensor(episode_data_index[k])
|
|
||||||
|
|
||||||
return episode_data_index
|
|
||||||
|
|
||||||
|
|
||||||
def reset_episode_index(hf_dataset: datasets.Dataset) -> datasets.Dataset:
|
def create_empty_dataset_info(
|
||||||
"""
|
codebase_version: str,
|
||||||
Reset the `episode_index` of the provided HuggingFace Dataset.
|
fps: int,
|
||||||
|
robot_type: str,
|
||||||
`episode_data_index` (and related functionality such as `load_previous_and_future_frames`) requires the
|
features: dict,
|
||||||
`episode_index` to be sorted, continuous (1,1,1 and not 1,2,1) and start at 0.
|
use_videos: bool,
|
||||||
|
) -> dict:
|
||||||
This brings the `episode_index` to the required format.
|
return {
|
||||||
"""
|
"codebase_version": codebase_version,
|
||||||
if len(hf_dataset) == 0:
|
"robot_type": robot_type,
|
||||||
return hf_dataset
|
"total_episodes": 0,
|
||||||
unique_episode_idxs = torch.stack(hf_dataset["episode_index"]).unique().tolist()
|
"total_frames": 0,
|
||||||
episode_idx_to_reset_idx_mapping = {
|
"total_tasks": 0,
|
||||||
ep_id: reset_ep_id for reset_ep_id, ep_id in enumerate(unique_episode_idxs)
|
"total_videos": 0,
|
||||||
|
"total_chunks": 0,
|
||||||
|
"chunks_size": DEFAULT_CHUNK_SIZE,
|
||||||
|
"fps": fps,
|
||||||
|
"splits": {},
|
||||||
|
"data_path": DEFAULT_PARQUET_PATH,
|
||||||
|
"video_path": DEFAULT_VIDEO_PATH if use_videos else None,
|
||||||
|
"features": features,
|
||||||
}
|
}
|
||||||
|
|
||||||
def modify_ep_idx_func(example):
|
|
||||||
example["episode_index"] = episode_idx_to_reset_idx_mapping[example["episode_index"].item()]
|
|
||||||
return example
|
|
||||||
|
|
||||||
hf_dataset = hf_dataset.map(modify_ep_idx_func)
|
def get_episode_data_index(
|
||||||
return hf_dataset
|
episode_dicts: list[dict], episodes: list[int] | None = None
|
||||||
|
) -> dict[str, torch.Tensor]:
|
||||||
|
episode_lengths = {ep_idx: ep_dict["length"] for ep_idx, ep_dict in enumerate(episode_dicts)}
|
||||||
|
if episodes is not None:
|
||||||
|
episode_lengths = {ep_idx: episode_lengths[ep_idx] for ep_idx in episodes}
|
||||||
|
|
||||||
|
cumulative_lenghts = list(accumulate(episode_lengths.values()))
|
||||||
|
return {
|
||||||
|
"from": torch.LongTensor([0] + cumulative_lenghts[:-1]),
|
||||||
|
"to": torch.LongTensor(cumulative_lenghts),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_total_episode(
|
||||||
|
hf_dataset: datasets.Dataset, raise_if_not_contiguous: bool = True
|
||||||
|
) -> dict[str, torch.Tensor]:
|
||||||
|
episode_indices = sorted(hf_dataset.unique("episode_index"))
|
||||||
|
total_episodes = len(episode_indices)
|
||||||
|
if raise_if_not_contiguous and episode_indices != list(range(total_episodes)):
|
||||||
|
raise ValueError("episode_index values are not sorted and contiguous.")
|
||||||
|
return total_episodes
|
||||||
|
|
||||||
|
|
||||||
|
def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> dict[str, torch.Tensor]:
|
||||||
|
episode_lengths = []
|
||||||
|
table = hf_dataset.data.table
|
||||||
|
total_episodes = calculate_total_episode(hf_dataset)
|
||||||
|
for ep_idx in range(total_episodes):
|
||||||
|
ep_table = table.filter(pc.equal(table["episode_index"], ep_idx))
|
||||||
|
episode_lengths.insert(ep_idx, len(ep_table))
|
||||||
|
|
||||||
|
cumulative_lenghts = list(accumulate(episode_lengths))
|
||||||
|
return {
|
||||||
|
"from": torch.LongTensor([0] + cumulative_lenghts[:-1]),
|
||||||
|
"to": torch.LongTensor(cumulative_lenghts),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def check_timestamps_sync(
|
||||||
|
hf_dataset: datasets.Dataset,
|
||||||
|
episode_data_index: dict[str, torch.Tensor],
|
||||||
|
fps: int,
|
||||||
|
tolerance_s: float,
|
||||||
|
raise_value_error: bool = True,
|
||||||
|
) -> bool:
|
||||||
|
"""
|
||||||
|
This check is to make sure that each timestamps is separated to the next by 1/fps +/- tolerance to
|
||||||
|
account for possible numerical error.
|
||||||
|
"""
|
||||||
|
timestamps = torch.stack(hf_dataset["timestamp"])
|
||||||
|
diffs = torch.diff(timestamps)
|
||||||
|
within_tolerance = torch.abs(diffs - 1 / fps) <= tolerance_s
|
||||||
|
|
||||||
|
# We mask differences between the timestamp at the end of an episode
|
||||||
|
# and the one at the start of the next episode since these are expected
|
||||||
|
# to be outside tolerance.
|
||||||
|
mask = torch.ones(len(diffs), dtype=torch.bool)
|
||||||
|
ignored_diffs = episode_data_index["to"][:-1] - 1
|
||||||
|
mask[ignored_diffs] = False
|
||||||
|
filtered_within_tolerance = within_tolerance[mask]
|
||||||
|
|
||||||
|
if not torch.all(filtered_within_tolerance):
|
||||||
|
# Track original indices before masking
|
||||||
|
original_indices = torch.arange(len(diffs))
|
||||||
|
filtered_indices = original_indices[mask]
|
||||||
|
outside_tolerance_filtered_indices = torch.nonzero(~filtered_within_tolerance) # .squeeze()
|
||||||
|
outside_tolerance_indices = filtered_indices[outside_tolerance_filtered_indices]
|
||||||
|
episode_indices = torch.stack(hf_dataset["episode_index"])
|
||||||
|
|
||||||
|
outside_tolerances = []
|
||||||
|
for idx in outside_tolerance_indices:
|
||||||
|
entry = {
|
||||||
|
"timestamps": [timestamps[idx], timestamps[idx + 1]],
|
||||||
|
"diff": diffs[idx],
|
||||||
|
"episode_index": episode_indices[idx].item(),
|
||||||
|
}
|
||||||
|
outside_tolerances.append(entry)
|
||||||
|
|
||||||
|
if raise_value_error:
|
||||||
|
raise ValueError(
|
||||||
|
f"""One or several timestamps unexpectedly violate the tolerance inside episode range.
|
||||||
|
This might be due to synchronization issues with timestamps during data collection.
|
||||||
|
\n{pformat(outside_tolerances)}"""
|
||||||
|
)
|
||||||
|
return False
|
||||||
|
|
||||||
|
return True
|
||||||
|
|
||||||
|
|
||||||
|
def check_delta_timestamps(
|
||||||
|
delta_timestamps: dict[str, list[float]], fps: int, tolerance_s: float, raise_value_error: bool = True
|
||||||
|
) -> bool:
|
||||||
|
"""This will check if all the values in delta_timestamps are multiples of 1/fps +/- tolerance.
|
||||||
|
This is to ensure that these delta_timestamps added to any timestamp from a dataset will themselves be
|
||||||
|
actual timestamps from the dataset.
|
||||||
|
"""
|
||||||
|
outside_tolerance = {}
|
||||||
|
for key, delta_ts in delta_timestamps.items():
|
||||||
|
within_tolerance = [abs(ts * fps - round(ts * fps)) / fps <= tolerance_s for ts in delta_ts]
|
||||||
|
if not all(within_tolerance):
|
||||||
|
outside_tolerance[key] = [
|
||||||
|
ts for ts, is_within in zip(delta_ts, within_tolerance, strict=True) if not is_within
|
||||||
|
]
|
||||||
|
|
||||||
|
if len(outside_tolerance) > 0:
|
||||||
|
if raise_value_error:
|
||||||
|
raise ValueError(
|
||||||
|
f"""
|
||||||
|
The following delta_timestamps are found outside of tolerance range.
|
||||||
|
Please make sure they are multiples of 1/{fps} +/- tolerance and adjust
|
||||||
|
their values accordingly.
|
||||||
|
\n{pformat(outside_tolerance)}
|
||||||
|
"""
|
||||||
|
)
|
||||||
|
return False
|
||||||
|
|
||||||
|
return True
|
||||||
|
|
||||||
|
|
||||||
|
def get_delta_indices(delta_timestamps: dict[str, list[float]], fps: int) -> dict[str, list[int]]:
|
||||||
|
delta_indices = {}
|
||||||
|
for key, delta_ts in delta_timestamps.items():
|
||||||
|
delta_indices[key] = (torch.tensor(delta_ts) * fps).long().tolist()
|
||||||
|
|
||||||
|
return delta_indices
|
||||||
|
|
||||||
|
|
||||||
def cycle(iterable):
|
def cycle(iterable):
|
||||||
@@ -352,3 +450,55 @@ def cycle(iterable):
|
|||||||
yield next(iterator)
|
yield next(iterator)
|
||||||
except StopIteration:
|
except StopIteration:
|
||||||
iterator = iter(iterable)
|
iterator = iter(iterable)
|
||||||
|
|
||||||
|
|
||||||
|
def create_branch(repo_id, *, branch: str, repo_type: str | None = None) -> None:
|
||||||
|
"""Create a branch on a existing Hugging Face repo. Delete the branch if it already
|
||||||
|
exists before creating it.
|
||||||
|
"""
|
||||||
|
api = HfApi()
|
||||||
|
|
||||||
|
branches = api.list_repo_refs(repo_id, repo_type=repo_type).branches
|
||||||
|
refs = [branch.ref for branch in branches]
|
||||||
|
ref = f"refs/heads/{branch}"
|
||||||
|
if ref in refs:
|
||||||
|
api.delete_branch(repo_id, repo_type=repo_type, branch=branch)
|
||||||
|
|
||||||
|
api.create_branch(repo_id, repo_type=repo_type, branch=branch)
|
||||||
|
|
||||||
|
|
||||||
|
def create_lerobot_dataset_card(
|
||||||
|
tags: list | None = None,
|
||||||
|
dataset_info: dict | None = None,
|
||||||
|
**kwargs,
|
||||||
|
) -> DatasetCard:
|
||||||
|
"""
|
||||||
|
Keyword arguments will be used to replace values in ./lerobot/common/datasets/card_template.md.
|
||||||
|
Note: If specified, license must be one of https://huggingface.co/docs/hub/repositories-licenses.
|
||||||
|
"""
|
||||||
|
card_tags = ["LeRobot"]
|
||||||
|
card_template_path = importlib.resources.path("lerobot.common.datasets", "card_template.md")
|
||||||
|
|
||||||
|
if tags:
|
||||||
|
card_tags += tags
|
||||||
|
if dataset_info:
|
||||||
|
dataset_structure = "[meta/info.json](meta/info.json):\n"
|
||||||
|
dataset_structure += f"```json\n{json.dumps(dataset_info, indent=4)}\n```\n"
|
||||||
|
kwargs = {**kwargs, "dataset_structure": dataset_structure}
|
||||||
|
card_data = DatasetCardData(
|
||||||
|
license=kwargs.get("license"),
|
||||||
|
tags=card_tags,
|
||||||
|
task_categories=["robotics"],
|
||||||
|
configs=[
|
||||||
|
{
|
||||||
|
"config_name": "default",
|
||||||
|
"data_files": "data/*/*.parquet",
|
||||||
|
}
|
||||||
|
],
|
||||||
|
)
|
||||||
|
|
||||||
|
return DatasetCard.from_template(
|
||||||
|
card_data=card_data,
|
||||||
|
template_path=str(card_template_path),
|
||||||
|
**kwargs,
|
||||||
|
)
|
||||||
|
|||||||
882
lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py
Normal file
882
lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py
Normal file
@@ -0,0 +1,882 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This script is for internal use to convert all datasets under the 'lerobot' hub user account to v2.
|
||||||
|
|
||||||
|
Note: Since the original Aloha datasets don't use shadow motors, you need to comment those out in
|
||||||
|
lerobot/configs/robot/aloha.yaml before running this script.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import traceback
|
||||||
|
from pathlib import Path
|
||||||
|
from textwrap import dedent
|
||||||
|
|
||||||
|
from lerobot import available_datasets
|
||||||
|
from lerobot.common.datasets.v2.convert_dataset_v1_to_v2 import convert_dataset, parse_robot_config
|
||||||
|
|
||||||
|
LOCAL_DIR = Path("data/")
|
||||||
|
|
||||||
|
ALOHA_CONFIG = Path("lerobot/configs/robot/aloha.yaml")
|
||||||
|
ALOHA_MOBILE_INFO = {
|
||||||
|
"robot_config": parse_robot_config(ALOHA_CONFIG),
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://mobile-aloha.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.02117",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{fu2024mobile,
|
||||||
|
author = {Fu, Zipeng and Zhao, Tony Z. and Finn, Chelsea},
|
||||||
|
title = {Mobile ALOHA: Learning Bimanual Mobile Manipulation with Low-Cost Whole-Body Teleoperation},
|
||||||
|
booktitle = {arXiv},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
ALOHA_STATIC_INFO = {
|
||||||
|
"robot_config": parse_robot_config(ALOHA_CONFIG),
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://tonyzhaozh.github.io/aloha/",
|
||||||
|
"paper": "https://arxiv.org/abs/2304.13705",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{Zhao2023LearningFB,
|
||||||
|
title={Learning Fine-Grained Bimanual Manipulation with Low-Cost Hardware},
|
||||||
|
author={Tony Zhao and Vikash Kumar and Sergey Levine and Chelsea Finn},
|
||||||
|
journal={RSS},
|
||||||
|
year={2023},
|
||||||
|
volume={abs/2304.13705},
|
||||||
|
url={https://arxiv.org/abs/2304.13705}
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
PUSHT_INFO = {
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://diffusion-policy.cs.columbia.edu/",
|
||||||
|
"paper": "https://arxiv.org/abs/2303.04137v5",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{chi2024diffusionpolicy,
|
||||||
|
author = {Cheng Chi and Zhenjia Xu and Siyuan Feng and Eric Cousineau and Yilun Du and Benjamin Burchfiel and Russ Tedrake and Shuran Song},
|
||||||
|
title ={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||||
|
journal = {The International Journal of Robotics Research},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
}
|
||||||
|
XARM_INFO = {
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://www.nicklashansen.com/td-mpc/",
|
||||||
|
"paper": "https://arxiv.org/abs/2203.04955",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{Hansen2022tdmpc,
|
||||||
|
title={Temporal Difference Learning for Model Predictive Control},
|
||||||
|
author={Nicklas Hansen and Xiaolong Wang and Hao Su},
|
||||||
|
booktitle={ICML},
|
||||||
|
year={2022}
|
||||||
|
}
|
||||||
|
"""),
|
||||||
|
}
|
||||||
|
UNITREEH_INFO = {
|
||||||
|
"license": "apache-2.0",
|
||||||
|
}
|
||||||
|
|
||||||
|
DATASETS = {
|
||||||
|
"aloha_mobile_cabinet": {
|
||||||
|
"single_task": "Open the top cabinet, store the pot inside it then close the cabinet.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_chair": {
|
||||||
|
"single_task": "Push the chairs in front of the desk to place them against it.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_elevator": {
|
||||||
|
"single_task": "Take the elevator to the 1st floor.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_shrimp": {
|
||||||
|
"single_task": "Sauté the raw shrimp on both sides, then serve it in the bowl.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_wash_pan": {
|
||||||
|
"single_task": "Pick up the pan, rinse it in the sink and then place it in the drying rack.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_mobile_wipe_wine": {
|
||||||
|
"single_task": "Pick up the wet cloth on the faucet and use it to clean the spilled wine on the table and underneath the glass.",
|
||||||
|
**ALOHA_MOBILE_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_battery": {
|
||||||
|
"single_task": "Place the battery into the slot of the remote controller.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_candy": {"single_task": "Pick up the candy and unwrap it.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_static_coffee": {
|
||||||
|
"single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray, then push the 'Hot Water' and 'Travel Mug' buttons.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_coffee_new": {
|
||||||
|
"single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_cups_open": {
|
||||||
|
"single_task": "Pick up the plastic cup and open its lid.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_fork_pick_up": {
|
||||||
|
"single_task": "Pick up the fork and place it on the plate.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_pingpong_test": {
|
||||||
|
"single_task": "Transfer one of the two balls in the right glass into the left glass, then transfer it back to the right glass.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_pro_pencil": {
|
||||||
|
"single_task": "Pick up the pencil with the right arm, hand it over to the left arm then place it back onto the table.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_screw_driver": {
|
||||||
|
"single_task": "Pick up the screwdriver with the right arm, hand it over to the left arm then place it into the cup.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_tape": {
|
||||||
|
"single_task": "Cut a small piece of tape from the tape dispenser then place it on the cardboard box's edge.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_thread_velcro": {
|
||||||
|
"single_task": "Pick up the velcro cable tie with the left arm, then insert the end of the velcro tie into the other end's loop with the right arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_towel": {
|
||||||
|
"single_task": "Pick up a piece of paper towel and place it on the spilled liquid.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_vinh_cup": {
|
||||||
|
"single_task": "Pick up the platic cup with the right arm, then pop its lid open with the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_vinh_cup_left": {
|
||||||
|
"single_task": "Pick up the platic cup with the left arm, then pop its lid open with the right arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_static_ziploc_slide": {"single_task": "Slide open the ziploc bag.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_scripted": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_scripted_image": {
|
||||||
|
"single_task": "Insert the peg into the socket.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_insertion_human": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
|
||||||
|
"aloha_sim_insertion_human_image": {
|
||||||
|
"single_task": "Insert the peg into the socket.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_scripted": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_scripted_image": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_human": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"aloha_sim_transfer_cube_human_image": {
|
||||||
|
"single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
|
||||||
|
**ALOHA_STATIC_INFO,
|
||||||
|
},
|
||||||
|
"pusht": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
|
||||||
|
"pusht_image": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
|
||||||
|
"unitreeh1_fold_clothes": {"single_task": "Fold the sweatshirt.", **UNITREEH_INFO},
|
||||||
|
"unitreeh1_rearrange_objects": {"single_task": "Put the object into the bin.", **UNITREEH_INFO},
|
||||||
|
"unitreeh1_two_robot_greeting": {
|
||||||
|
"single_task": "Greet the other robot with a high five.",
|
||||||
|
**UNITREEH_INFO,
|
||||||
|
},
|
||||||
|
"unitreeh1_warehouse": {
|
||||||
|
"single_task": "Grab the spray paint on the shelf and place it in the bin on top of the robot dog.",
|
||||||
|
**UNITREEH_INFO,
|
||||||
|
},
|
||||||
|
"xarm_lift_medium": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_replay": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_lift_medium_replay_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
|
||||||
|
"xarm_push_medium": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_replay": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"xarm_push_medium_replay_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
|
||||||
|
"umi_cup_in_the_wild": {
|
||||||
|
"single_task": "Put the cup on the plate.",
|
||||||
|
"license": "apache-2.0",
|
||||||
|
},
|
||||||
|
"asu_table_top": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://link.springer.com/article/10.1007/s10514-023-10129-1",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{zhou2023modularity,
|
||||||
|
title={Modularity through Attention: Efficient Training and Transfer of Language-Conditioned Policies for Robot Manipulation},
|
||||||
|
author={Zhou, Yifan and Sonawani, Shubham and Phielipp, Mariano and Stepputtis, Simon and Amor, Heni},
|
||||||
|
booktitle={Conference on Robot Learning},
|
||||||
|
pages={1684--1695},
|
||||||
|
year={2023},
|
||||||
|
organization={PMLR}
|
||||||
|
}
|
||||||
|
@article{zhou2023learning,
|
||||||
|
title={Learning modular language-conditioned robot policies through attention},
|
||||||
|
author={Zhou, Yifan and Sonawani, Shubham and Phielipp, Mariano and Ben Amor, Heni and Stepputtis, Simon},
|
||||||
|
journal={Autonomous Robots},
|
||||||
|
pages={1--21},
|
||||||
|
year={2023},
|
||||||
|
publisher={Springer}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_buds_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/BUDS-website/",
|
||||||
|
"paper": "https://arxiv.org/abs/2109.13841",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{zhu2022bottom,
|
||||||
|
title={Bottom-Up Skill Discovery From Unsegmented Demonstrations for Long-Horizon Robot Manipulation},
|
||||||
|
author={Zhu, Yifeng and Stone, Peter and Zhu, Yuke},
|
||||||
|
journal={IEEE Robotics and Automation Letters},
|
||||||
|
volume={7},
|
||||||
|
number={2},
|
||||||
|
pages={4126--4133},
|
||||||
|
year={2022},
|
||||||
|
publisher={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_sailor_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/sailor/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.11435",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{nasiriany2022sailor,
|
||||||
|
title={Learning and Retrieval from Prior Data for Skill-based Imitation Learning},
|
||||||
|
author={Soroush Nasiriany and Tian Gao and Ajay Mandlekar and Yuke Zhu},
|
||||||
|
booktitle={Conference on Robot Learning (CoRL)},
|
||||||
|
year={2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"austin_sirius_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/sirius/",
|
||||||
|
"paper": "https://arxiv.org/abs/2211.08416",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{liu2022robot,
|
||||||
|
title = {Robot Learning on the Job: Human-in-the-Loop Autonomy and Learning During Deployment},
|
||||||
|
author = {Huihan Liu and Soroush Nasiriany and Lance Zhang and Zhiyao Bao and Yuke Zhu},
|
||||||
|
booktitle = {Robotics: Science and Systems (RSS)},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_autolab_ur5": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://sites.google.com/view/berkeley-ur5/home",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{BerkeleyUR5Website,
|
||||||
|
title = {Berkeley {UR5} Demonstration Dataset},
|
||||||
|
author = {Lawrence Yunliang Chen and Simeon Adebola and Ken Goldberg},
|
||||||
|
howpublished = {https://sites.google.com/view/berkeley-ur5/home},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_cable_routing": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://sites.google.com/view/cablerouting/home",
|
||||||
|
"paper": "https://arxiv.org/abs/2307.08927",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{luo2023multistage,
|
||||||
|
author = {Jianlan Luo and Charles Xu and Xinyang Geng and Gilbert Feng and Kuan Fang and Liam Tan and Stefan Schaal and Sergey Levine},
|
||||||
|
title = {Multi-Stage Cable Routing through Hierarchical Imitation Learning},
|
||||||
|
journal = {arXiv pre-print},
|
||||||
|
year = {2023},
|
||||||
|
url = {https://arxiv.org/abs/2307.08927},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_fanuc_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/berkeley.edu/fanuc-manipulation",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{fanuc_manipulation2023,
|
||||||
|
title={Fanuc Manipulation: A Dataset for Learning-based Manipulation with FANUC Mate 200iD Robot},
|
||||||
|
author={Zhu, Xinghao and Tian, Ran and Xu, Chenfeng and Ding, Mingyu and Zhan, Wei and Tomizuka, Masayoshi},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_cory_hall": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/1709.10489",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{kahn2018self,
|
||||||
|
title={Self-supervised deep reinforcement learning with generalized computation graphs for robot navigation},
|
||||||
|
author={Kahn, Gregory and Villaflor, Adam and Ding, Bosen and Abbeel, Pieter and Levine, Sergey},
|
||||||
|
booktitle={2018 IEEE international conference on robotics and automation (ICRA)},
|
||||||
|
pages={5129--5136},
|
||||||
|
year={2018},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_recon": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/recon-robot",
|
||||||
|
"paper": "https://arxiv.org/abs/2104.05859",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{shah2021rapid,
|
||||||
|
title={Rapid Exploration for Open-World Navigation with Latent Goal Models},
|
||||||
|
author={Dhruv Shah and Benjamin Eysenbach and Nicholas Rhinehart and Sergey Levine},
|
||||||
|
booktitle={5th Annual Conference on Robot Learning },
|
||||||
|
year={2021},
|
||||||
|
url={https://openreview.net/forum?id=d_SWJhyKfVw}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_gnm_sac_son": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/SACSoN-review",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.01874",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{hirose2023sacson,
|
||||||
|
title={SACSoN: Scalable Autonomous Data Collection for Social Navigation},
|
||||||
|
author={Hirose, Noriaki and Shah, Dhruv and Sridhar, Ajay and Levine, Sergey},
|
||||||
|
journal={arXiv preprint arXiv:2306.01874},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_mvp": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/2203.06173",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@InProceedings{Radosavovic2022,
|
||||||
|
title = {Real-World Robot Learning with Masked Visual Pre-training},
|
||||||
|
author = {Ilija Radosavovic and Tete Xiao and Stephen James and Pieter Abbeel and Jitendra Malik and Trevor Darrell},
|
||||||
|
booktitle = {CoRL},
|
||||||
|
year = {2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"berkeley_rpt": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.10007",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{Radosavovic2023,
|
||||||
|
title={Robot Learning with Sensorimotor Pre-training},
|
||||||
|
author={Ilija Radosavovic and Baifeng Shi and Letian Fu and Ken Goldberg and Trevor Darrell and Jitendra Malik},
|
||||||
|
year={2023},
|
||||||
|
journal={arXiv:2306.10007}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_franka_exploration_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://human-world-model.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2308.10901",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{mendonca2023structured,
|
||||||
|
title={Structured World Models from Human Videos},
|
||||||
|
author={Mendonca, Russell and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
journal={RSS},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_play_fusion": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://play-fusion.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2312.04549",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{chen2023playfusion,
|
||||||
|
title={PlayFusion: Skill Acquisition via Diffusion from Language-Annotated Play},
|
||||||
|
author={Chen, Lili and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
booktitle={CoRL},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"cmu_stretch": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://robo-affordances.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2304.08488",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{bahl2023affordances,
|
||||||
|
title={Affordances from Human Videos as a Versatile Representation for Robotics},
|
||||||
|
author={Bahl, Shikhar and Mendonca, Russell and Chen, Lili and Jain, Unnat and Pathak, Deepak},
|
||||||
|
booktitle={CVPR},
|
||||||
|
year={2023}
|
||||||
|
}
|
||||||
|
@article{mendonca2023structured,
|
||||||
|
title={Structured World Models from Human Videos},
|
||||||
|
author={Mendonca, Russell and Bahl, Shikhar and Pathak, Deepak},
|
||||||
|
journal={CoRL},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"columbia_cairlab_pusht_real": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://diffusion-policy.cs.columbia.edu/",
|
||||||
|
"paper": "https://arxiv.org/abs/2303.04137v5",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{chi2023diffusionpolicy,
|
||||||
|
title={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||||
|
author={Chi, Cheng and Feng, Siyuan and Du, Yilun and Xu, Zhenjia and Cousineau, Eric and Burchfiel, Benjamin and Song, Shuran},
|
||||||
|
booktitle={Proceedings of Robotics: Science and Systems (RSS)},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"conq_hose_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/conq-hose-manipulation-dataset/home",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{ConqHoseManipData,
|
||||||
|
author={Peter Mitrano and Dmitry Berenson},
|
||||||
|
title={Conq Hose Manipulation Dataset, v1.15.0},
|
||||||
|
year={2024},
|
||||||
|
howpublished={https://sites.google.com/view/conq-hose-manipulation-dataset}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_edan_shared_control": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://ieeexplore.ieee.org/document/9341156",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{vogel_edan_2020,
|
||||||
|
title = {EDAN - an EMG-Controlled Daily Assistant to Help People with Physical Disabilities},
|
||||||
|
language = {en},
|
||||||
|
booktitle = {2020 {IEEE}/{RSJ} {International} {Conference} on {Intelligent} {Robots} and {Systems} ({IROS})},
|
||||||
|
author = {Vogel, Jörn and Hagengruber, Annette and Iskandar, Maged and Quere, Gabriel and Leipscher, Ulrike and Bustamante, Samuel and Dietrich, Alexander and Hoeppner, Hannes and Leidner, Daniel and Albu-Schäffer, Alin},
|
||||||
|
year = {2020}
|
||||||
|
}
|
||||||
|
@inproceedings{quere_shared_2020,
|
||||||
|
address = {Paris, France},
|
||||||
|
title = {Shared {Control} {Templates} for {Assistive} {Robotics}},
|
||||||
|
language = {en},
|
||||||
|
booktitle = {2020 {IEEE} {International} {Conference} on {Robotics} and {Automation} ({ICRA})},
|
||||||
|
author = {Quere, Gabriel and Hagengruber, Annette and Iskandar, Maged and Bustamante, Samuel and Leidner, Daniel and Stulp, Freek and Vogel, Joern},
|
||||||
|
year = {2020},
|
||||||
|
pages = {7},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_sara_grid_clamp": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://www.researchsquare.com/article/rs-3289569/v1",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{padalkar2023guided,
|
||||||
|
title={A guided reinforcement learning approach using shared control templates for learning manipulation skills in the real world},
|
||||||
|
author={Padalkar, Abhishek and Quere, Gabriel and Raffin, Antonin and Silv{\'e}rio, Jo{\~a}o and Stulp, Freek},
|
||||||
|
journal={Research square preprint rs-3289569/v1},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"dlr_sara_pour": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"paper": "https://elib.dlr.de/193739/1/padalkar2023rlsct.pdf",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{padalkar2023guiding,
|
||||||
|
title={Guiding Reinforcement Learning with Shared Control Templates},
|
||||||
|
author={Padalkar, Abhishek and Quere, Gabriel and Steinmetz, Franz and Raffin, Antonin and Nieuwenhuisen, Matthias and Silv{\'e}rio, Jo{\~a}o and Stulp, Freek},
|
||||||
|
booktitle={40th IEEE International Conference on Robotics and Automation, ICRA 2023},
|
||||||
|
year={2023},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"droid_100": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://droid-dataset.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2403.12945",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{khazatsky2024droid,
|
||||||
|
title = {DROID: A Large-Scale In-The-Wild Robot Manipulation Dataset},
|
||||||
|
author = {Alexander Khazatsky and Karl Pertsch and Suraj Nair and Ashwin Balakrishna and Sudeep Dasari and Siddharth Karamcheti and Soroush Nasiriany and Mohan Kumar Srirama and Lawrence Yunliang Chen and Kirsty Ellis and Peter David Fagan and Joey Hejna and Masha Itkina and Marion Lepert and Yecheng Jason Ma and Patrick Tree Miller and Jimmy Wu and Suneel Belkhale and Shivin Dass and Huy Ha and Arhan Jain and Abraham Lee and Youngwoon Lee and Marius Memmel and Sungjae Park and Ilija Radosavovic and Kaiyuan Wang and Albert Zhan and Kevin Black and Cheng Chi and Kyle Beltran Hatch and Shan Lin and Jingpei Lu and Jean Mercat and Abdul Rehman and Pannag R Sanketi and Archit Sharma and Cody Simpson and Quan Vuong and Homer Rich Walke and Blake Wulfe and Ted Xiao and Jonathan Heewon Yang and Arefeh Yavary and Tony Z. Zhao and Christopher Agia and Rohan Baijal and Mateo Guaman Castro and Daphne Chen and Qiuyu Chen and Trinity Chung and Jaimyn Drake and Ethan Paul Foster and Jensen Gao and David Antonio Herrera and Minho Heo and Kyle Hsu and Jiaheng Hu and Donovon Jackson and Charlotte Le and Yunshuang Li and Kevin Lin and Roy Lin and Zehan Ma and Abhiram Maddukuri and Suvir Mirchandani and Daniel Morton and Tony Nguyen and Abigail O'Neill and Rosario Scalise and Derick Seale and Victor Son and Stephen Tian and Emi Tran and Andrew E. Wang and Yilin Wu and Annie Xie and Jingyun Yang and Patrick Yin and Yunchu Zhang and Osbert Bastani and Glen Berseth and Jeannette Bohg and Ken Goldberg and Abhinav Gupta and Abhishek Gupta and Dinesh Jayaraman and Joseph J Lim and Jitendra Malik and Roberto Martín-Martín and Subramanian Ramamoorthy and Dorsa Sadigh and Shuran Song and Jiajun Wu and Michael C. Yip and Yuke Zhu and Thomas Kollar and Sergey Levine and Chelsea Finn},
|
||||||
|
year = {2024},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"fmb": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://functional-manipulation-benchmark.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.08553",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{luo2024fmb,
|
||||||
|
title={FMB: a Functional Manipulation Benchmark for Generalizable Robotic Learning},
|
||||||
|
author={Luo, Jianlan and Xu, Charles and Liu, Fangchen and Tan, Liam and Lin, Zipeng and Wu, Jeffrey and Abbeel, Pieter and Levine, Sergey},
|
||||||
|
journal={arXiv preprint arXiv:2401.08553},
|
||||||
|
year={2024}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"iamlab_cmu_pickup_insert": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://openreview.net/forum?id=WuBv9-IGDUA",
|
||||||
|
"paper": "https://arxiv.org/abs/2401.14502",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{saxena2023multiresolution,
|
||||||
|
title={Multi-Resolution Sensing for Real-Time Control with Vision-Language Models},
|
||||||
|
author={Saumya Saxena and Mohit Sharma and Oliver Kroemer},
|
||||||
|
booktitle={7th Annual Conference on Robot Learning},
|
||||||
|
year={2023},
|
||||||
|
url={https://openreview.net/forum?id=WuBv9-IGDUA}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"imperialcollege_sawyer_wrist_cam": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
},
|
||||||
|
"jaco_play": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://github.com/clvrai/clvr_jaco_play_dataset",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@software{dass2023jacoplay,
|
||||||
|
author = {Dass, Shivin and Yapeter, Jullian and Zhang, Jesse and Zhang, Jiahui
|
||||||
|
and Pertsch, Karl and Nikolaidis, Stefanos and Lim, Joseph J.},
|
||||||
|
title = {CLVR Jaco Play Dataset},
|
||||||
|
url = {https://github.com/clvrai/clvr_jaco_play_dataset},
|
||||||
|
version = {1.0.0},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"kaist_nonprehensile": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://github.com/JaeHyung-Kim/rlds_dataset_builder",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{kimpre,
|
||||||
|
title={Pre-and post-contact policy decomposition for non-prehensile manipulation with zero-shot sim-to-real transfer},
|
||||||
|
author={Kim, Minchan and Han, Junhyek and Kim, Jaehyung and Kim, Beomjoon},
|
||||||
|
booktitle={2023 IEEE/RSJ International Conference on Intelligent Robots and Systems (IROS)},
|
||||||
|
year={2023},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_door_opening_surprising_effectiveness": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://jyopari.github.io/VINN/",
|
||||||
|
"paper": "https://arxiv.org/abs/2112.01511",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{pari2021surprising,
|
||||||
|
title={The Surprising Effectiveness of Representation Learning for Visual Imitation},
|
||||||
|
author={Jyothish Pari and Nur Muhammad Shafiullah and Sridhar Pandian Arunachalam and Lerrel Pinto},
|
||||||
|
year={2021},
|
||||||
|
eprint={2112.01511},
|
||||||
|
archivePrefix={arXiv},
|
||||||
|
primaryClass={cs.RO}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_franka_play_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://play-to-policy.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.10047",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{cui2022play,
|
||||||
|
title = {From Play to Policy: Conditional Behavior Generation from Uncurated Robot Data},
|
||||||
|
author = {Cui, Zichen Jeff and Wang, Yibin and Shafiullah, Nur Muhammad Mahi and Pinto, Lerrel},
|
||||||
|
journal = {arXiv preprint arXiv:2210.10047},
|
||||||
|
year = {2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"nyu_rot_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://rot-robot.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2206.15469",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{haldar2023watch,
|
||||||
|
title={Watch and match: Supercharging imitation with regularized optimal transport},
|
||||||
|
author={Haldar, Siddhant and Mathur, Vaibhav and Yarats, Denis and Pinto, Lerrel},
|
||||||
|
booktitle={Conference on Robot Learning},
|
||||||
|
pages={32--43},
|
||||||
|
year={2023},
|
||||||
|
organization={PMLR}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"roboturk": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://roboturk.stanford.edu/dataset_real.html",
|
||||||
|
"paper": "PAPER",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{mandlekar2019scaling,
|
||||||
|
title={Scaling robot supervision to hundreds of hours with roboturk: Robotic manipulation dataset through human reasoning and dexterity},
|
||||||
|
author={Mandlekar, Ajay and Booher, Jonathan and Spero, Max and Tung, Albert and Gupta, Anchit and Zhu, Yuke and Garg, Animesh and Savarese, Silvio and Fei-Fei, Li},
|
||||||
|
booktitle={2019 IEEE/RSJ International Conference on Intelligent Robots and Systems (IROS)},
|
||||||
|
pages={1048--1055},
|
||||||
|
year={2019},
|
||||||
|
organization={IEEE}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_hydra_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/hydra-il-2023",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.17237",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{belkhale2023hydra,
|
||||||
|
title={HYDRA: Hybrid Robot Actions for Imitation Learning},
|
||||||
|
author={Belkhale, Suneel and Cui, Yuchen and Sadigh, Dorsa},
|
||||||
|
journal={arxiv},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_kuka_multimodal_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://sites.google.com/view/visionandtouch",
|
||||||
|
"paper": "https://arxiv.org/abs/1810.10191",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{lee2019icra,
|
||||||
|
title={Making sense of vision and touch: Self-supervised learning of multimodal representations for contact-rich tasks},
|
||||||
|
author={Lee, Michelle A and Zhu, Yuke and Srinivasan, Krishnan and Shah, Parth and Savarese, Silvio and Fei-Fei, Li and Garg, Animesh and Bohg, Jeannette},
|
||||||
|
booktitle={2019 IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
year={2019},
|
||||||
|
url={https://arxiv.org/abs/1810.10191}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"stanford_robocook": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://hshi74.github.io/robocook/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.14447",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{shi2023robocook,
|
||||||
|
title={RoboCook: Long-Horizon Elasto-Plastic Object Manipulation with Diverse Tools},
|
||||||
|
author={Shi, Haochen and Xu, Huazhe and Clarke, Samuel and Li, Yunzhu and Wu, Jiajun},
|
||||||
|
journal={arXiv preprint arXiv:2306.14447},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"taco_play": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"url": "https://www.kaggle.com/datasets/oiermees/taco-robot",
|
||||||
|
"paper": "https://arxiv.org/abs/2209.08959, https://arxiv.org/abs/2210.01911",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{rosete2022tacorl,
|
||||||
|
author = {Erick Rosete-Beas and Oier Mees and Gabriel Kalweit and Joschka Boedecker and Wolfram Burgard},
|
||||||
|
title = {Latent Plans for Task Agnostic Offline Reinforcement Learning},
|
||||||
|
journal = {Proceedings of the 6th Conference on Robot Learning (CoRL)},
|
||||||
|
year = {2022}
|
||||||
|
}
|
||||||
|
@inproceedings{mees23hulc2,
|
||||||
|
title={Grounding Language with Visual Affordances over Unstructured Data},
|
||||||
|
author={Oier Mees and Jessica Borja-Diaz and Wolfram Burgard},
|
||||||
|
booktitle = {Proceedings of the IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
year={2023},
|
||||||
|
address = {London, UK}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"tokyo_u_lsmo": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "URL",
|
||||||
|
"paper": "https://arxiv.org/abs/2107.05842",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@Article{Osa22,
|
||||||
|
author = {Takayuki Osa},
|
||||||
|
journal = {The International Journal of Robotics Research},
|
||||||
|
title = {Motion Planning by Learning the Solution Manifold in Trajectory Optimization},
|
||||||
|
year = {2022},
|
||||||
|
number = {3},
|
||||||
|
pages = {291--311},
|
||||||
|
volume = {41},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"toto": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://toto-benchmark.org/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.00942",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{zhou2023train,
|
||||||
|
author={Zhou, Gaoyue and Dean, Victoria and Srirama, Mohan Kumar and Rajeswaran, Aravind and Pari, Jyothish and Hatch, Kyle and Jain, Aryan and Yu, Tianhe and Abbeel, Pieter and Pinto, Lerrel and Finn, Chelsea and Gupta, Abhinav},
|
||||||
|
booktitle={2023 IEEE International Conference on Robotics and Automation (ICRA)},
|
||||||
|
title={Train Offline, Test Online: A Real Robot Learning Benchmark},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"ucsd_kitchen_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@ARTICLE{ucsd_kitchens,
|
||||||
|
author = {Ge Yan, Kris Wu, and Xiaolong Wang},
|
||||||
|
title = {{ucsd kitchens Dataset}},
|
||||||
|
year = {2023},
|
||||||
|
month = {August}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"ucsd_pick_and_place_dataset": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://owmcorl.github.io/#",
|
||||||
|
"paper": "https://arxiv.org/abs/2310.16029",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@preprint{Feng2023Finetuning,
|
||||||
|
title={Finetuning Offline World Models in the Real World},
|
||||||
|
author={Yunhai Feng, Nicklas Hansen, Ziyan Xiong, Chandramouli Rajagopalan, Xiaolong Wang},
|
||||||
|
year={2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"uiuc_d3field": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://robopil.github.io/d3fields/",
|
||||||
|
"paper": "https://arxiv.org/abs/2309.16118",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{wang2023d3field,
|
||||||
|
title={D^3Field: Dynamic 3D Descriptor Fields for Generalizable Robotic Manipulation},
|
||||||
|
author={Wang, Yixuan and Li, Zhuoran and Zhang, Mingtong and Driggs-Campbell, Katherine and Wu, Jiajun and Fei-Fei, Li and Li, Yunzhu},
|
||||||
|
journal={arXiv preprint arXiv:},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"usc_cloth_sim": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://uscresl.github.io/dmfd/",
|
||||||
|
"paper": "https://arxiv.org/abs/2207.10148",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{salhotra2022dmfd,
|
||||||
|
author={Salhotra, Gautam and Liu, I-Chun Arthur and Dominguez-Kuhne, Marcus and Sukhatme, Gaurav S.},
|
||||||
|
journal={IEEE Robotics and Automation Letters},
|
||||||
|
title={Learning Deformable Object Manipulation From Expert Demonstrations},
|
||||||
|
year={2022},
|
||||||
|
volume={7},
|
||||||
|
number={4},
|
||||||
|
pages={8775-8782},
|
||||||
|
doi={10.1109/LRA.2022.3187843}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utaustin_mutex": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/MUTEX/",
|
||||||
|
"paper": "https://arxiv.org/abs/2309.14320",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@inproceedings{shah2023mutex,
|
||||||
|
title={{MUTEX}: Learning Unified Policies from Multimodal Task Specifications},
|
||||||
|
author={Rutav Shah and Roberto Mart{\'\i}n-Mart{\'\i}n and Yuke Zhu},
|
||||||
|
booktitle={7th Annual Conference on Robot Learning},
|
||||||
|
year={2023},
|
||||||
|
url={https://openreview.net/forum?id=PwqiqaaEzJ}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_pr2_opening_fridge": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{oh2023pr2utokyodatasets,
|
||||||
|
author={Jihoon Oh and Naoaki Kanazawa and Kento Kawaharazuka},
|
||||||
|
title={X-Embodiment U-Tokyo PR2 Datasets},
|
||||||
|
year={2023},
|
||||||
|
url={https://github.com/ojh6404/rlds_dataset_builder},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_pr2_tabletop_manipulation": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{oh2023pr2utokyodatasets,
|
||||||
|
author={Jihoon Oh and Naoaki Kanazawa and Kento Kawaharazuka},
|
||||||
|
title={X-Embodiment U-Tokyo PR2 Datasets},
|
||||||
|
year={2023},
|
||||||
|
url={https://github.com/ojh6404/rlds_dataset_builder},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_saytap": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://saytap.github.io/",
|
||||||
|
"paper": "https://arxiv.org/abs/2306.07580",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{saytap2023,
|
||||||
|
author = {Yujin Tang and Wenhao Yu and Jie Tan and Heiga Zen and Aleksandra Faust and
|
||||||
|
Tatsuya Harada},
|
||||||
|
title = {SayTap: Language to Quadrupedal Locomotion},
|
||||||
|
eprint = {arXiv:2306.07580},
|
||||||
|
url = {https://saytap.github.io},
|
||||||
|
note = {https://saytap.github.io},
|
||||||
|
year = {2023}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_xarm_bimanual": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{matsushima2023weblab,
|
||||||
|
title={Weblab xArm Dataset},
|
||||||
|
author={Tatsuya Matsushima and Hiroki Furuta and Yusuke Iwasawa and Yutaka Matsuo},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"utokyo_xarm_pick_and_place": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "cc-by-4.0",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@misc{matsushima2023weblab,
|
||||||
|
title={Weblab xArm Dataset},
|
||||||
|
author={Tatsuya Matsushima and Hiroki Furuta and Yusuke Iwasawa and Yutaka Matsuo},
|
||||||
|
year={2023},
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
"viola": {
|
||||||
|
"tasks_col": "language_instruction",
|
||||||
|
"license": "mit",
|
||||||
|
"url": "https://ut-austin-rpl.github.io/VIOLA/",
|
||||||
|
"paper": "https://arxiv.org/abs/2210.11339",
|
||||||
|
"citation_bibtex": dedent(r"""
|
||||||
|
@article{zhu2022viola,
|
||||||
|
title={VIOLA: Imitation Learning for Vision-Based Manipulation with Object Proposal Priors},
|
||||||
|
author={Zhu, Yifeng and Joshi, Abhishek and Stone, Peter and Zhu, Yuke},
|
||||||
|
journal={6th Annual Conference on Robot Learning (CoRL)},
|
||||||
|
year={2022}
|
||||||
|
}""").lstrip(),
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def batch_convert():
|
||||||
|
status = {}
|
||||||
|
logfile = LOCAL_DIR / "conversion_log.txt"
|
||||||
|
assert set(DATASETS) == {id_.split("/")[1] for id_ in available_datasets}
|
||||||
|
for num, (name, kwargs) in enumerate(DATASETS.items()):
|
||||||
|
repo_id = f"lerobot/{name}"
|
||||||
|
print(f"\nConverting {repo_id} ({num}/{len(DATASETS)})")
|
||||||
|
print("---------------------------------------------------------")
|
||||||
|
try:
|
||||||
|
convert_dataset(repo_id, LOCAL_DIR, **kwargs)
|
||||||
|
status = f"{repo_id}: success."
|
||||||
|
with open(logfile, "a") as file:
|
||||||
|
file.write(status + "\n")
|
||||||
|
except Exception:
|
||||||
|
status = f"{repo_id}: failed\n {traceback.format_exc()}"
|
||||||
|
with open(logfile, "a") as file:
|
||||||
|
file.write(status + "\n")
|
||||||
|
continue
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
batch_convert()
|
||||||
665
lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py
Normal file
665
lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py
Normal file
@@ -0,0 +1,665 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
"""
|
||||||
|
This script will help you convert any LeRobot dataset already pushed to the hub from codebase version 1.6 to
|
||||||
|
2.0. You will be required to provide the 'tasks', which is a short but accurate description in plain English
|
||||||
|
for each of the task performed in the dataset. This will allow to easily train models with task-conditionning.
|
||||||
|
|
||||||
|
We support 3 different scenarios for these tasks (see instructions below):
|
||||||
|
1. Single task dataset: all episodes of your dataset have the same single task.
|
||||||
|
2. Single task episodes: the episodes of your dataset each contain a single task but they can differ from
|
||||||
|
one episode to the next.
|
||||||
|
3. Multi task episodes: episodes of your dataset may each contain several different tasks.
|
||||||
|
|
||||||
|
|
||||||
|
Can you can also provide a robot config .yaml file (not mandatory) to this script via the option
|
||||||
|
'--robot-config' so that it writes information about the robot (robot type, motors names) this dataset was
|
||||||
|
recorded with. For now, only Aloha/Koch type robots are supported with this option.
|
||||||
|
|
||||||
|
|
||||||
|
# 1. Single task dataset
|
||||||
|
If your dataset contains a single task, you can simply provide it directly via the CLI with the
|
||||||
|
'--single-task' option.
|
||||||
|
|
||||||
|
Examples:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/aloha_sim_insertion_human_image \
|
||||||
|
--single-task "Insert the peg into the socket." \
|
||||||
|
--robot-config lerobot/configs/robot/aloha.yaml \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id aliberts/koch_tutorial \
|
||||||
|
--single-task "Pick the Lego block and drop it in the box on the right." \
|
||||||
|
--robot-config lerobot/configs/robot/koch.yaml \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
|
||||||
|
# 2. Single task episodes
|
||||||
|
If your dataset is a multi-task dataset, you have two options to provide the tasks to this script:
|
||||||
|
|
||||||
|
- If your dataset already contains a language instruction column in its parquet file, you can simply provide
|
||||||
|
this column's name with the '--tasks-col' arg.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/stanford_kuka_multimodal_dataset \
|
||||||
|
--tasks-col "language_instruction" \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
|
||||||
|
- If your dataset doesn't contain a language instruction, you should provide the path to a .json file with the
|
||||||
|
'--tasks-path' arg. This file should have the following structure where keys correspond to each
|
||||||
|
episode_index in the dataset, and values are the language instruction for that episode.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```json
|
||||||
|
{
|
||||||
|
"0": "Do something",
|
||||||
|
"1": "Do something else",
|
||||||
|
"2": "Do something",
|
||||||
|
"3": "Go there",
|
||||||
|
...
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
# 3. Multi task episodes
|
||||||
|
If you have multiple tasks per episodes, your dataset should contain a language instruction column in its
|
||||||
|
parquet file, and you must provide this column's name with the '--tasks-col' arg.
|
||||||
|
|
||||||
|
Example:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
python lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py \
|
||||||
|
--repo-id lerobot/stanford_kuka_multimodal_dataset \
|
||||||
|
--tasks-col "language_instruction" \
|
||||||
|
--local-dir data
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import contextlib
|
||||||
|
import filecmp
|
||||||
|
import json
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import shutil
|
||||||
|
import subprocess
|
||||||
|
import tempfile
|
||||||
|
from pathlib import Path
|
||||||
|
|
||||||
|
import datasets
|
||||||
|
import pyarrow.compute as pc
|
||||||
|
import pyarrow.parquet as pq
|
||||||
|
import torch
|
||||||
|
from datasets import Dataset
|
||||||
|
from huggingface_hub import HfApi
|
||||||
|
from huggingface_hub.errors import EntryNotFoundError, HfHubHTTPError
|
||||||
|
from safetensors.torch import load_file
|
||||||
|
|
||||||
|
from lerobot.common.datasets.utils import (
|
||||||
|
DEFAULT_CHUNK_SIZE,
|
||||||
|
DEFAULT_PARQUET_PATH,
|
||||||
|
DEFAULT_VIDEO_PATH,
|
||||||
|
EPISODES_PATH,
|
||||||
|
INFO_PATH,
|
||||||
|
STATS_PATH,
|
||||||
|
TASKS_PATH,
|
||||||
|
create_branch,
|
||||||
|
create_lerobot_dataset_card,
|
||||||
|
flatten_dict,
|
||||||
|
get_hub_safe_version,
|
||||||
|
load_json,
|
||||||
|
unflatten_dict,
|
||||||
|
write_json,
|
||||||
|
write_jsonlines,
|
||||||
|
)
|
||||||
|
from lerobot.common.datasets.video_utils import (
|
||||||
|
VideoFrame, # noqa: F401
|
||||||
|
get_image_pixel_channels,
|
||||||
|
get_video_info,
|
||||||
|
)
|
||||||
|
from lerobot.common.utils.utils import init_hydra_config
|
||||||
|
|
||||||
|
V16 = "v1.6"
|
||||||
|
V20 = "v2.0"
|
||||||
|
|
||||||
|
GITATTRIBUTES_REF = "aliberts/gitattributes_reference"
|
||||||
|
V1_VIDEO_FILE = "{video_key}_episode_{episode_index:06d}.mp4"
|
||||||
|
V1_INFO_PATH = "meta_data/info.json"
|
||||||
|
V1_STATS_PATH = "meta_data/stats.safetensors"
|
||||||
|
|
||||||
|
|
||||||
|
def parse_robot_config(config_path: Path, config_overrides: list[str] | None = None) -> tuple[str, dict]:
|
||||||
|
robot_cfg = init_hydra_config(config_path, config_overrides)
|
||||||
|
if robot_cfg["robot_type"] in ["aloha", "koch"]:
|
||||||
|
state_names = [
|
||||||
|
f"{arm}_{motor}" if len(robot_cfg["follower_arms"]) > 1 else motor
|
||||||
|
for arm in robot_cfg["follower_arms"]
|
||||||
|
for motor in robot_cfg["follower_arms"][arm]["motors"]
|
||||||
|
]
|
||||||
|
action_names = [
|
||||||
|
# f"{arm}_{motor}" for arm in ["left", "right"] for motor in robot_cfg["leader_arms"][arm]["motors"]
|
||||||
|
f"{arm}_{motor}" if len(robot_cfg["leader_arms"]) > 1 else motor
|
||||||
|
for arm in robot_cfg["leader_arms"]
|
||||||
|
for motor in robot_cfg["leader_arms"][arm]["motors"]
|
||||||
|
]
|
||||||
|
# elif robot_cfg["robot_type"] == "stretch3": TODO
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(
|
||||||
|
"Please provide robot_config={'robot_type': ..., 'names': ...} directly to convert_dataset()."
|
||||||
|
)
|
||||||
|
|
||||||
|
return {
|
||||||
|
"robot_type": robot_cfg["robot_type"],
|
||||||
|
"names": {
|
||||||
|
"observation.state": state_names,
|
||||||
|
"observation.effort": state_names,
|
||||||
|
"action": action_names,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def convert_stats_to_json(v1_dir: Path, v2_dir: Path) -> None:
|
||||||
|
safetensor_path = v1_dir / V1_STATS_PATH
|
||||||
|
stats = load_file(safetensor_path)
|
||||||
|
serialized_stats = {key: value.tolist() for key, value in stats.items()}
|
||||||
|
serialized_stats = unflatten_dict(serialized_stats)
|
||||||
|
|
||||||
|
json_path = v2_dir / STATS_PATH
|
||||||
|
json_path.parent.mkdir(exist_ok=True, parents=True)
|
||||||
|
with open(json_path, "w") as f:
|
||||||
|
json.dump(serialized_stats, f, indent=4)
|
||||||
|
|
||||||
|
# Sanity check
|
||||||
|
with open(json_path) as f:
|
||||||
|
stats_json = json.load(f)
|
||||||
|
|
||||||
|
stats_json = flatten_dict(stats_json)
|
||||||
|
stats_json = {key: torch.tensor(value) for key, value in stats_json.items()}
|
||||||
|
for key in stats:
|
||||||
|
torch.testing.assert_close(stats_json[key], stats[key])
|
||||||
|
|
||||||
|
|
||||||
|
def get_features_from_hf_dataset(dataset: Dataset, robot_config: dict | None = None) -> dict[str, list]:
|
||||||
|
features = {}
|
||||||
|
for key, ft in dataset.features.items():
|
||||||
|
if isinstance(ft, datasets.Value):
|
||||||
|
dtype = ft.dtype
|
||||||
|
shape = (1,)
|
||||||
|
names = None
|
||||||
|
if isinstance(ft, datasets.Sequence):
|
||||||
|
assert isinstance(ft.feature, datasets.Value)
|
||||||
|
dtype = ft.feature.dtype
|
||||||
|
shape = (ft.length,)
|
||||||
|
motor_names = (
|
||||||
|
robot_config["names"][key] if robot_config else [f"motor_{i}" for i in range(ft.length)]
|
||||||
|
)
|
||||||
|
assert len(motor_names) == shape[0]
|
||||||
|
names = {"motors": motor_names}
|
||||||
|
elif isinstance(ft, datasets.Image):
|
||||||
|
dtype = "image"
|
||||||
|
image = dataset[0][key] # Assuming first row
|
||||||
|
channels = get_image_pixel_channels(image)
|
||||||
|
shape = (image.height, image.width, channels)
|
||||||
|
names = ["height", "width", "channel"]
|
||||||
|
elif ft._type == "VideoFrame":
|
||||||
|
dtype = "video"
|
||||||
|
shape = None # Add shape later
|
||||||
|
names = ["height", "width", "channel"]
|
||||||
|
|
||||||
|
features[key] = {
|
||||||
|
"dtype": dtype,
|
||||||
|
"shape": shape,
|
||||||
|
"names": names,
|
||||||
|
}
|
||||||
|
|
||||||
|
return features
|
||||||
|
|
||||||
|
|
||||||
|
def add_task_index_by_episodes(dataset: Dataset, tasks_by_episodes: dict) -> tuple[Dataset, list[str]]:
|
||||||
|
df = dataset.to_pandas()
|
||||||
|
tasks = list(set(tasks_by_episodes.values()))
|
||||||
|
tasks_to_task_index = {task: task_idx for task_idx, task in enumerate(tasks)}
|
||||||
|
episodes_to_task_index = {ep_idx: tasks_to_task_index[task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
df["task_index"] = df["episode_index"].map(episodes_to_task_index).astype(int)
|
||||||
|
|
||||||
|
features = dataset.features
|
||||||
|
features["task_index"] = datasets.Value(dtype="int64")
|
||||||
|
dataset = Dataset.from_pandas(df, features=features, split="train")
|
||||||
|
return dataset, tasks
|
||||||
|
|
||||||
|
|
||||||
|
def add_task_index_from_tasks_col(
|
||||||
|
dataset: Dataset, tasks_col: str
|
||||||
|
) -> tuple[Dataset, dict[str, list[str]], list[str]]:
|
||||||
|
df = dataset.to_pandas()
|
||||||
|
|
||||||
|
# HACK: This is to clean some of the instructions in our version of Open X datasets
|
||||||
|
prefix_to_clean = "tf.Tensor(b'"
|
||||||
|
suffix_to_clean = "', shape=(), dtype=string)"
|
||||||
|
df[tasks_col] = df[tasks_col].str.removeprefix(prefix_to_clean).str.removesuffix(suffix_to_clean)
|
||||||
|
|
||||||
|
# Create task_index col
|
||||||
|
tasks_by_episode = df.groupby("episode_index")[tasks_col].unique().apply(lambda x: x.tolist()).to_dict()
|
||||||
|
tasks = df[tasks_col].unique().tolist()
|
||||||
|
tasks_to_task_index = {task: idx for idx, task in enumerate(tasks)}
|
||||||
|
df["task_index"] = df[tasks_col].map(tasks_to_task_index).astype(int)
|
||||||
|
|
||||||
|
# Build the dataset back from df
|
||||||
|
features = dataset.features
|
||||||
|
features["task_index"] = datasets.Value(dtype="int64")
|
||||||
|
dataset = Dataset.from_pandas(df, features=features, split="train")
|
||||||
|
dataset = dataset.remove_columns(tasks_col)
|
||||||
|
|
||||||
|
return dataset, tasks, tasks_by_episode
|
||||||
|
|
||||||
|
|
||||||
|
def split_parquet_by_episodes(
|
||||||
|
dataset: Dataset,
|
||||||
|
total_episodes: int,
|
||||||
|
total_chunks: int,
|
||||||
|
output_dir: Path,
|
||||||
|
) -> list:
|
||||||
|
table = dataset.data.table
|
||||||
|
episode_lengths = []
|
||||||
|
for ep_chunk in range(total_chunks):
|
||||||
|
ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
|
||||||
|
ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
|
||||||
|
chunk_dir = "/".join(DEFAULT_PARQUET_PATH.split("/")[:-1]).format(episode_chunk=ep_chunk)
|
||||||
|
(output_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
|
||||||
|
for ep_idx in range(ep_chunk_start, ep_chunk_end):
|
||||||
|
ep_table = table.filter(pc.equal(table["episode_index"], ep_idx))
|
||||||
|
episode_lengths.insert(ep_idx, len(ep_table))
|
||||||
|
output_file = output_dir / DEFAULT_PARQUET_PATH.format(
|
||||||
|
episode_chunk=ep_chunk, episode_index=ep_idx
|
||||||
|
)
|
||||||
|
pq.write_table(ep_table, output_file)
|
||||||
|
|
||||||
|
return episode_lengths
|
||||||
|
|
||||||
|
|
||||||
|
def move_videos(
|
||||||
|
repo_id: str,
|
||||||
|
video_keys: list[str],
|
||||||
|
total_episodes: int,
|
||||||
|
total_chunks: int,
|
||||||
|
work_dir: Path,
|
||||||
|
clean_gittatributes: Path,
|
||||||
|
branch: str = "main",
|
||||||
|
) -> None:
|
||||||
|
"""
|
||||||
|
HACK: Since HfApi() doesn't provide a way to move files directly in a repo, this function will run git
|
||||||
|
commands to fetch git lfs video files references to move them into subdirectories without having to
|
||||||
|
actually download them.
|
||||||
|
"""
|
||||||
|
_lfs_clone(repo_id, work_dir, branch)
|
||||||
|
|
||||||
|
videos_moved = False
|
||||||
|
video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*.mp4")]
|
||||||
|
if len(video_files) == 0:
|
||||||
|
video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*/*/*.mp4")]
|
||||||
|
videos_moved = True # Videos have already been moved
|
||||||
|
|
||||||
|
assert len(video_files) == total_episodes * len(video_keys)
|
||||||
|
|
||||||
|
lfs_untracked_videos = _get_lfs_untracked_videos(work_dir, video_files)
|
||||||
|
|
||||||
|
current_gittatributes = work_dir / ".gitattributes"
|
||||||
|
if not filecmp.cmp(current_gittatributes, clean_gittatributes, shallow=False):
|
||||||
|
fix_gitattributes(work_dir, current_gittatributes, clean_gittatributes)
|
||||||
|
|
||||||
|
if lfs_untracked_videos:
|
||||||
|
fix_lfs_video_files_tracking(work_dir, video_files)
|
||||||
|
|
||||||
|
if videos_moved:
|
||||||
|
return
|
||||||
|
|
||||||
|
video_dirs = sorted(work_dir.glob("videos*/"))
|
||||||
|
for ep_chunk in range(total_chunks):
|
||||||
|
ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
|
||||||
|
ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
|
||||||
|
for vid_key in video_keys:
|
||||||
|
chunk_dir = "/".join(DEFAULT_VIDEO_PATH.split("/")[:-1]).format(
|
||||||
|
episode_chunk=ep_chunk, video_key=vid_key
|
||||||
|
)
|
||||||
|
(work_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
for ep_idx in range(ep_chunk_start, ep_chunk_end):
|
||||||
|
target_path = DEFAULT_VIDEO_PATH.format(
|
||||||
|
episode_chunk=ep_chunk, video_key=vid_key, episode_index=ep_idx
|
||||||
|
)
|
||||||
|
video_file = V1_VIDEO_FILE.format(video_key=vid_key, episode_index=ep_idx)
|
||||||
|
if len(video_dirs) == 1:
|
||||||
|
video_path = video_dirs[0] / video_file
|
||||||
|
else:
|
||||||
|
for dir in video_dirs:
|
||||||
|
if (dir / video_file).is_file():
|
||||||
|
video_path = dir / video_file
|
||||||
|
break
|
||||||
|
|
||||||
|
video_path.rename(work_dir / target_path)
|
||||||
|
|
||||||
|
commit_message = "Move video files into chunk subdirectories"
|
||||||
|
subprocess.run(["git", "add", "."], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "commit", "-m", commit_message], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def fix_lfs_video_files_tracking(work_dir: Path, lfs_untracked_videos: list[str]) -> None:
|
||||||
|
"""
|
||||||
|
HACK: This function fixes the tracking by git lfs which was not properly set on some repos. In that case,
|
||||||
|
there's no other option than to download the actual files and reupload them with lfs tracking.
|
||||||
|
"""
|
||||||
|
for i in range(0, len(lfs_untracked_videos), 100):
|
||||||
|
files = lfs_untracked_videos[i : i + 100]
|
||||||
|
try:
|
||||||
|
subprocess.run(["git", "rm", "--cached", *files], cwd=work_dir, capture_output=True, check=True)
|
||||||
|
except subprocess.CalledProcessError as e:
|
||||||
|
print("git rm --cached ERROR:")
|
||||||
|
print(e.stderr)
|
||||||
|
subprocess.run(["git", "add", *files], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
commit_message = "Track video files with git lfs"
|
||||||
|
subprocess.run(["git", "commit", "-m", commit_message], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def fix_gitattributes(work_dir: Path, current_gittatributes: Path, clean_gittatributes: Path) -> None:
|
||||||
|
shutil.copyfile(clean_gittatributes, current_gittatributes)
|
||||||
|
subprocess.run(["git", "add", ".gitattributes"], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "commit", "-m", "Fix .gitattributes"], cwd=work_dir, check=True)
|
||||||
|
subprocess.run(["git", "push"], cwd=work_dir, check=True)
|
||||||
|
|
||||||
|
|
||||||
|
def _lfs_clone(repo_id: str, work_dir: Path, branch: str) -> None:
|
||||||
|
subprocess.run(["git", "lfs", "install"], cwd=work_dir, check=True)
|
||||||
|
repo_url = f"https://huggingface.co/datasets/{repo_id}"
|
||||||
|
env = {"GIT_LFS_SKIP_SMUDGE": "1"} # Prevent downloading LFS files
|
||||||
|
subprocess.run(
|
||||||
|
["git", "clone", "--branch", branch, "--single-branch", "--depth", "1", repo_url, str(work_dir)],
|
||||||
|
check=True,
|
||||||
|
env=env,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def _get_lfs_untracked_videos(work_dir: Path, video_files: list[str]) -> list[str]:
|
||||||
|
lfs_tracked_files = subprocess.run(
|
||||||
|
["git", "lfs", "ls-files", "-n"], cwd=work_dir, capture_output=True, text=True, check=True
|
||||||
|
)
|
||||||
|
lfs_tracked_files = set(lfs_tracked_files.stdout.splitlines())
|
||||||
|
return [f for f in video_files if f not in lfs_tracked_files]
|
||||||
|
|
||||||
|
|
||||||
|
def get_videos_info(repo_id: str, local_dir: Path, video_keys: list[str], branch: str) -> dict:
|
||||||
|
# Assumes first episode
|
||||||
|
video_files = [
|
||||||
|
DEFAULT_VIDEO_PATH.format(episode_chunk=0, video_key=vid_key, episode_index=0)
|
||||||
|
for vid_key in video_keys
|
||||||
|
]
|
||||||
|
hub_api = HfApi()
|
||||||
|
hub_api.snapshot_download(
|
||||||
|
repo_id=repo_id, repo_type="dataset", local_dir=local_dir, revision=branch, allow_patterns=video_files
|
||||||
|
)
|
||||||
|
videos_info_dict = {}
|
||||||
|
for vid_key, vid_path in zip(video_keys, video_files, strict=True):
|
||||||
|
videos_info_dict[vid_key] = get_video_info(local_dir / vid_path)
|
||||||
|
|
||||||
|
return videos_info_dict
|
||||||
|
|
||||||
|
|
||||||
|
def convert_dataset(
|
||||||
|
repo_id: str,
|
||||||
|
local_dir: Path,
|
||||||
|
single_task: str | None = None,
|
||||||
|
tasks_path: Path | None = None,
|
||||||
|
tasks_col: Path | None = None,
|
||||||
|
robot_config: dict | None = None,
|
||||||
|
test_branch: str | None = None,
|
||||||
|
**card_kwargs,
|
||||||
|
):
|
||||||
|
v1 = get_hub_safe_version(repo_id, V16)
|
||||||
|
v1x_dir = local_dir / V16 / repo_id
|
||||||
|
v20_dir = local_dir / V20 / repo_id
|
||||||
|
v1x_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
v20_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
hub_api = HfApi()
|
||||||
|
hub_api.snapshot_download(
|
||||||
|
repo_id=repo_id, repo_type="dataset", revision=v1, local_dir=v1x_dir, ignore_patterns="videos*/"
|
||||||
|
)
|
||||||
|
branch = "main"
|
||||||
|
if test_branch:
|
||||||
|
branch = test_branch
|
||||||
|
create_branch(repo_id=repo_id, branch=test_branch, repo_type="dataset")
|
||||||
|
|
||||||
|
metadata_v1 = load_json(v1x_dir / V1_INFO_PATH)
|
||||||
|
dataset = datasets.load_dataset("parquet", data_dir=v1x_dir / "data", split="train")
|
||||||
|
features = get_features_from_hf_dataset(dataset, robot_config)
|
||||||
|
video_keys = [key for key, ft in features.items() if ft["dtype"] == "video"]
|
||||||
|
|
||||||
|
if single_task and "language_instruction" in dataset.column_names:
|
||||||
|
logging.warning(
|
||||||
|
"'single_task' provided but 'language_instruction' tasks_col found. Using 'language_instruction'.",
|
||||||
|
)
|
||||||
|
single_task = None
|
||||||
|
tasks_col = "language_instruction"
|
||||||
|
|
||||||
|
# Episodes & chunks
|
||||||
|
episode_indices = sorted(dataset.unique("episode_index"))
|
||||||
|
total_episodes = len(episode_indices)
|
||||||
|
assert episode_indices == list(range(total_episodes))
|
||||||
|
total_videos = total_episodes * len(video_keys)
|
||||||
|
total_chunks = total_episodes // DEFAULT_CHUNK_SIZE
|
||||||
|
if total_episodes % DEFAULT_CHUNK_SIZE != 0:
|
||||||
|
total_chunks += 1
|
||||||
|
|
||||||
|
# Tasks
|
||||||
|
if single_task:
|
||||||
|
tasks_by_episodes = {ep_idx: single_task for ep_idx in episode_indices}
|
||||||
|
dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
|
||||||
|
tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
elif tasks_path:
|
||||||
|
tasks_by_episodes = load_json(tasks_path)
|
||||||
|
tasks_by_episodes = {int(ep_idx): task for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
|
||||||
|
tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
|
||||||
|
elif tasks_col:
|
||||||
|
dataset, tasks, tasks_by_episodes = add_task_index_from_tasks_col(dataset, tasks_col)
|
||||||
|
else:
|
||||||
|
raise ValueError
|
||||||
|
|
||||||
|
assert set(tasks) == {task for ep_tasks in tasks_by_episodes.values() for task in ep_tasks}
|
||||||
|
tasks = [{"task_index": task_idx, "task": task} for task_idx, task in enumerate(tasks)]
|
||||||
|
write_jsonlines(tasks, v20_dir / TASKS_PATH)
|
||||||
|
features["task_index"] = {
|
||||||
|
"dtype": "int64",
|
||||||
|
"shape": (1,),
|
||||||
|
"names": None,
|
||||||
|
}
|
||||||
|
|
||||||
|
# Videos
|
||||||
|
if video_keys:
|
||||||
|
assert metadata_v1.get("video", False)
|
||||||
|
dataset = dataset.remove_columns(video_keys)
|
||||||
|
clean_gitattr = Path(
|
||||||
|
hub_api.hf_hub_download(
|
||||||
|
repo_id=GITATTRIBUTES_REF, repo_type="dataset", local_dir=local_dir, filename=".gitattributes"
|
||||||
|
)
|
||||||
|
).absolute()
|
||||||
|
with tempfile.TemporaryDirectory() as tmp_video_dir:
|
||||||
|
move_videos(
|
||||||
|
repo_id, video_keys, total_episodes, total_chunks, Path(tmp_video_dir), clean_gitattr, branch
|
||||||
|
)
|
||||||
|
videos_info = get_videos_info(repo_id, v1x_dir, video_keys=video_keys, branch=branch)
|
||||||
|
for key in video_keys:
|
||||||
|
features[key]["shape"] = (
|
||||||
|
videos_info[key].pop("video.height"),
|
||||||
|
videos_info[key].pop("video.width"),
|
||||||
|
videos_info[key].pop("video.channels"),
|
||||||
|
)
|
||||||
|
features[key]["video_info"] = videos_info[key]
|
||||||
|
assert math.isclose(videos_info[key]["video.fps"], metadata_v1["fps"], rel_tol=1e-3)
|
||||||
|
if "encoding" in metadata_v1:
|
||||||
|
assert videos_info[key]["video.pix_fmt"] == metadata_v1["encoding"]["pix_fmt"]
|
||||||
|
else:
|
||||||
|
assert metadata_v1.get("video", 0) == 0
|
||||||
|
videos_info = None
|
||||||
|
|
||||||
|
# Split data into 1 parquet file by episode
|
||||||
|
episode_lengths = split_parquet_by_episodes(dataset, total_episodes, total_chunks, v20_dir)
|
||||||
|
|
||||||
|
if robot_config is not None:
|
||||||
|
robot_type = robot_config["robot_type"]
|
||||||
|
repo_tags = [robot_type]
|
||||||
|
else:
|
||||||
|
robot_type = "unknown"
|
||||||
|
repo_tags = None
|
||||||
|
|
||||||
|
# Episodes
|
||||||
|
episodes = [
|
||||||
|
{"episode_index": ep_idx, "tasks": tasks_by_episodes[ep_idx], "length": episode_lengths[ep_idx]}
|
||||||
|
for ep_idx in episode_indices
|
||||||
|
]
|
||||||
|
write_jsonlines(episodes, v20_dir / EPISODES_PATH)
|
||||||
|
|
||||||
|
# Assemble metadata v2.0
|
||||||
|
metadata_v2_0 = {
|
||||||
|
"codebase_version": V20,
|
||||||
|
"robot_type": robot_type,
|
||||||
|
"total_episodes": total_episodes,
|
||||||
|
"total_frames": len(dataset),
|
||||||
|
"total_tasks": len(tasks),
|
||||||
|
"total_videos": total_videos,
|
||||||
|
"total_chunks": total_chunks,
|
||||||
|
"chunks_size": DEFAULT_CHUNK_SIZE,
|
||||||
|
"fps": metadata_v1["fps"],
|
||||||
|
"splits": {"train": f"0:{total_episodes}"},
|
||||||
|
"data_path": DEFAULT_PARQUET_PATH,
|
||||||
|
"video_path": DEFAULT_VIDEO_PATH if video_keys else None,
|
||||||
|
"features": features,
|
||||||
|
}
|
||||||
|
write_json(metadata_v2_0, v20_dir / INFO_PATH)
|
||||||
|
convert_stats_to_json(v1x_dir, v20_dir)
|
||||||
|
card = create_lerobot_dataset_card(tags=repo_tags, dataset_info=metadata_v2_0, **card_kwargs)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="data", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta_data", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
|
||||||
|
hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta", repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
hub_api.upload_folder(
|
||||||
|
repo_id=repo_id,
|
||||||
|
path_in_repo="data",
|
||||||
|
folder_path=v20_dir / "data",
|
||||||
|
repo_type="dataset",
|
||||||
|
revision=branch,
|
||||||
|
)
|
||||||
|
hub_api.upload_folder(
|
||||||
|
repo_id=repo_id,
|
||||||
|
path_in_repo="meta",
|
||||||
|
folder_path=v20_dir / "meta",
|
||||||
|
repo_type="dataset",
|
||||||
|
revision=branch,
|
||||||
|
)
|
||||||
|
|
||||||
|
card.push_to_hub(repo_id=repo_id, repo_type="dataset", revision=branch)
|
||||||
|
|
||||||
|
if not test_branch:
|
||||||
|
create_branch(repo_id=repo_id, branch=V20, repo_type="dataset")
|
||||||
|
|
||||||
|
|
||||||
|
def main():
|
||||||
|
parser = argparse.ArgumentParser()
|
||||||
|
task_args = parser.add_mutually_exclusive_group(required=True)
|
||||||
|
|
||||||
|
parser.add_argument(
|
||||||
|
"--repo-id",
|
||||||
|
type=str,
|
||||||
|
required=True,
|
||||||
|
help="Repository identifier on Hugging Face: a community or a user name `/` the name of the dataset (e.g. `lerobot/pusht`, `cadene/aloha_sim_insertion_human`).",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--single-task",
|
||||||
|
type=str,
|
||||||
|
help="A short but accurate description of the single task performed in the dataset.",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--tasks-col",
|
||||||
|
type=str,
|
||||||
|
help="The name of the column containing language instructions",
|
||||||
|
)
|
||||||
|
task_args.add_argument(
|
||||||
|
"--tasks-path",
|
||||||
|
type=Path,
|
||||||
|
help="The path to a .json file containing one language instruction for each episode_index",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--robot-config",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help="Path to the robot's config yaml the dataset during conversion.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--robot-overrides",
|
||||||
|
type=str,
|
||||||
|
nargs="*",
|
||||||
|
help="Any key=value arguments to override the robot config values (use dots for.nested=overrides)",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--local-dir",
|
||||||
|
type=Path,
|
||||||
|
default=None,
|
||||||
|
help="Local directory to store the dataset during conversion. Defaults to /tmp/lerobot_dataset_v2",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--license",
|
||||||
|
type=str,
|
||||||
|
default="apache-2.0",
|
||||||
|
help="Repo license. Must be one of https://huggingface.co/docs/hub/repositories-licenses. Defaults to mit.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--test-branch",
|
||||||
|
type=str,
|
||||||
|
default=None,
|
||||||
|
help="Repo branch to test your conversion first (e.g. 'v2.0.test')",
|
||||||
|
)
|
||||||
|
|
||||||
|
args = parser.parse_args()
|
||||||
|
if not args.local_dir:
|
||||||
|
args.local_dir = Path("/tmp/lerobot_dataset_v2")
|
||||||
|
|
||||||
|
robot_config = parse_robot_config(args.robot_config, args.robot_overrides) if args.robot_config else None
|
||||||
|
del args.robot_config, args.robot_overrides
|
||||||
|
|
||||||
|
convert_dataset(**vars(args), robot_config=robot_config)
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
main()
|
||||||
@@ -13,9 +13,11 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
import json
|
||||||
import logging
|
import logging
|
||||||
import subprocess
|
import subprocess
|
||||||
import warnings
|
import warnings
|
||||||
|
from collections import OrderedDict
|
||||||
from dataclasses import dataclass, field
|
from dataclasses import dataclass, field
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from typing import Any, ClassVar
|
from typing import Any, ClassVar
|
||||||
@@ -24,50 +26,29 @@ import pyarrow as pa
|
|||||||
import torch
|
import torch
|
||||||
import torchvision
|
import torchvision
|
||||||
from datasets.features.features import register_feature
|
from datasets.features.features import register_feature
|
||||||
|
from PIL import Image
|
||||||
|
|
||||||
def load_from_videos(
|
|
||||||
item: dict[str, torch.Tensor], video_frame_keys: list[str], videos_dir: Path, tolerance_s: float
|
|
||||||
):
|
|
||||||
"""Note: When using data workers (e.g. DataLoader with num_workers>0), do not call this function
|
|
||||||
in the main process (e.g. by using a second Dataloader with num_workers=0). It will result in a Segmentation Fault.
|
|
||||||
This probably happens because a memory reference to the video loader is created in the main process and a
|
|
||||||
subprocess fails to access it.
|
|
||||||
"""
|
|
||||||
# since video path already contains "videos" (e.g. videos_dir="data/videos", path="videos/episode_0.mp4")
|
|
||||||
data_dir = videos_dir.parent
|
|
||||||
|
|
||||||
for key in video_frame_keys:
|
|
||||||
if isinstance(item[key], list):
|
|
||||||
# load multiple frames at once (expected when delta_timestamps is not None)
|
|
||||||
timestamps = [frame["timestamp"] for frame in item[key]]
|
|
||||||
paths = [frame["path"] for frame in item[key]]
|
|
||||||
if len(set(paths)) > 1:
|
|
||||||
raise NotImplementedError("All video paths are expected to be the same for now.")
|
|
||||||
video_path = data_dir / paths[0]
|
|
||||||
|
|
||||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s)
|
|
||||||
item[key] = frames
|
|
||||||
else:
|
|
||||||
# load one frame
|
|
||||||
timestamps = [item[key]["timestamp"]]
|
|
||||||
video_path = data_dir / item[key]["path"]
|
|
||||||
|
|
||||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s)
|
|
||||||
item[key] = frames[0]
|
|
||||||
|
|
||||||
return item
|
|
||||||
|
|
||||||
|
|
||||||
def decode_video_frames_torchvision(
|
def decode_video_frames_torchvision(
|
||||||
video_path: str,
|
video_path: Path | str,
|
||||||
timestamps: list[float],
|
timestamps: list[float],
|
||||||
tolerance_s: float,
|
tolerance_s: float,
|
||||||
device: str = "cpu",
|
backend: str = "pyav",
|
||||||
log_loaded_timestamps: bool = False,
|
log_loaded_timestamps: bool = False,
|
||||||
):
|
) -> torch.Tensor:
|
||||||
"""Loads frames associated to the requested timestamps of a video
|
"""Loads frames associated to the requested timestamps of a video
|
||||||
|
|
||||||
|
The backend can be either "pyav" (default) or "video_reader".
|
||||||
|
"video_reader" requires installing torchvision from source, see:
|
||||||
|
https://github.com/pytorch/vision/blob/main/torchvision/csrc/io/decoder/gpu/README.rst
|
||||||
|
(note that you need to compile against ffmpeg<4.3)
|
||||||
|
|
||||||
|
While both use cpu, "video_reader" is supposedly faster than "pyav" but requires additional setup.
|
||||||
|
For more info on video decoding, see `benchmark/video/README.md`
|
||||||
|
|
||||||
|
See torchvision doc for more info on these two backends:
|
||||||
|
https://pytorch.org/vision/0.18/index.html?highlight=backend#torchvision.set_video_backend
|
||||||
|
|
||||||
Note: Video benefits from inter-frame compression. Instead of storing every frame individually,
|
Note: Video benefits from inter-frame compression. Instead of storing every frame individually,
|
||||||
the encoder stores a reference frame (or a key frame) and subsequent frames as differences relative to
|
the encoder stores a reference frame (or a key frame) and subsequent frames as differences relative to
|
||||||
that key frame. As a consequence, to access a requested frame, we need to load the preceding key frame,
|
that key frame. As a consequence, to access a requested frame, we need to load the preceding key frame,
|
||||||
@@ -78,21 +59,9 @@ def decode_video_frames_torchvision(
|
|||||||
|
|
||||||
# set backend
|
# set backend
|
||||||
keyframes_only = False
|
keyframes_only = False
|
||||||
if device == "cpu":
|
torchvision.set_video_backend(backend)
|
||||||
# explicitely use pyav
|
if backend == "pyav":
|
||||||
torchvision.set_video_backend("pyav")
|
|
||||||
keyframes_only = True # pyav doesnt support accuracte seek
|
keyframes_only = True # pyav doesnt support accuracte seek
|
||||||
elif device == "cuda":
|
|
||||||
# TODO(rcadene, aliberts): implement video decoding with GPU
|
|
||||||
# torchvision.set_video_backend("cuda")
|
|
||||||
# torchvision.set_video_backend("video_reader")
|
|
||||||
# requires installing torchvision from source, see: https://github.com/pytorch/vision/blob/main/torchvision/csrc/io/decoder/gpu/README.rst
|
|
||||||
# check possible bug: https://github.com/pytorch/vision/issues/7745
|
|
||||||
raise NotImplementedError(
|
|
||||||
"Video decoding on gpu with cuda is currently not supported. Use `device='cpu'`."
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
raise ValueError(device)
|
|
||||||
|
|
||||||
# set a video stream reader
|
# set a video stream reader
|
||||||
# TODO(rcadene): also load audio stream at the same time
|
# TODO(rcadene): also load audio stream at the same time
|
||||||
@@ -120,7 +89,9 @@ def decode_video_frames_torchvision(
|
|||||||
if current_ts >= last_ts:
|
if current_ts >= last_ts:
|
||||||
break
|
break
|
||||||
|
|
||||||
reader.container.close()
|
if backend == "pyav":
|
||||||
|
reader.container.close()
|
||||||
|
|
||||||
reader = None
|
reader = None
|
||||||
|
|
||||||
query_ts = torch.tensor(timestamps)
|
query_ts = torch.tensor(timestamps)
|
||||||
@@ -136,6 +107,10 @@ def decode_video_frames_torchvision(
|
|||||||
"It means that the closest frame that can be loaded from the video is too far away in time."
|
"It means that the closest frame that can be loaded from the video is too far away in time."
|
||||||
"This might be due to synchronization issues with timestamps during data collection."
|
"This might be due to synchronization issues with timestamps during data collection."
|
||||||
"To be safe, we advise to ignore this item during training."
|
"To be safe, we advise to ignore this item during training."
|
||||||
|
f"\nqueried timestamps: {query_ts}"
|
||||||
|
f"\nloaded timestamps: {loaded_ts}"
|
||||||
|
f"\nvideo: {video_path}"
|
||||||
|
f"\nbackend: {backend}"
|
||||||
)
|
)
|
||||||
|
|
||||||
# get closest frames to the query timestamps
|
# get closest frames to the query timestamps
|
||||||
@@ -152,22 +127,59 @@ def decode_video_frames_torchvision(
|
|||||||
return closest_frames
|
return closest_frames
|
||||||
|
|
||||||
|
|
||||||
def encode_video_frames(imgs_dir: Path, video_path: Path, fps: int):
|
def encode_video_frames(
|
||||||
"""More info on ffmpeg arguments tuning on `lerobot/common/datasets/_video_benchmark/README.md`"""
|
imgs_dir: Path | str,
|
||||||
|
video_path: Path | str,
|
||||||
|
fps: int,
|
||||||
|
vcodec: str = "libsvtav1",
|
||||||
|
pix_fmt: str = "yuv420p",
|
||||||
|
g: int | None = 2,
|
||||||
|
crf: int | None = 30,
|
||||||
|
fast_decode: int = 0,
|
||||||
|
log_level: str | None = "error",
|
||||||
|
overwrite: bool = False,
|
||||||
|
) -> None:
|
||||||
|
"""More info on ffmpeg arguments tuning on `benchmark/video/README.md`"""
|
||||||
video_path = Path(video_path)
|
video_path = Path(video_path)
|
||||||
video_path.parent.mkdir(parents=True, exist_ok=True)
|
video_path.parent.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
ffmpeg_cmd = (
|
ffmpeg_args = OrderedDict(
|
||||||
f"ffmpeg -r {fps} "
|
[
|
||||||
"-f image2 "
|
("-f", "image2"),
|
||||||
"-loglevel error "
|
("-r", str(fps)),
|
||||||
f"-i {str(imgs_dir / 'frame_%06d.png')} "
|
("-i", str(imgs_dir / "frame_%06d.png")),
|
||||||
"-vcodec libx264 "
|
("-vcodec", vcodec),
|
||||||
"-g 2 "
|
("-pix_fmt", pix_fmt),
|
||||||
"-pix_fmt yuv444p "
|
]
|
||||||
f"{str(video_path)}"
|
|
||||||
)
|
)
|
||||||
subprocess.run(ffmpeg_cmd.split(" "), check=True)
|
|
||||||
|
if g is not None:
|
||||||
|
ffmpeg_args["-g"] = str(g)
|
||||||
|
|
||||||
|
if crf is not None:
|
||||||
|
ffmpeg_args["-crf"] = str(crf)
|
||||||
|
|
||||||
|
if fast_decode:
|
||||||
|
key = "-svtav1-params" if vcodec == "libsvtav1" else "-tune"
|
||||||
|
value = f"fast-decode={fast_decode}" if vcodec == "libsvtav1" else "fastdecode"
|
||||||
|
ffmpeg_args[key] = value
|
||||||
|
|
||||||
|
if log_level is not None:
|
||||||
|
ffmpeg_args["-loglevel"] = str(log_level)
|
||||||
|
|
||||||
|
ffmpeg_args = [item for pair in ffmpeg_args.items() for item in pair]
|
||||||
|
if overwrite:
|
||||||
|
ffmpeg_args.append("-y")
|
||||||
|
|
||||||
|
ffmpeg_cmd = ["ffmpeg"] + ffmpeg_args + [str(video_path)]
|
||||||
|
# redirect stdin to subprocess.DEVNULL to prevent reading random keyboard inputs from terminal
|
||||||
|
subprocess.run(ffmpeg_cmd, check=True, stdin=subprocess.DEVNULL)
|
||||||
|
|
||||||
|
if not video_path.exists():
|
||||||
|
raise OSError(
|
||||||
|
f"Video encoding did not work. File not found: {video_path}. "
|
||||||
|
f"Try running the command manually to debug: `{''.join(ffmpeg_cmd)}`"
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
@dataclass
|
@dataclass
|
||||||
@@ -200,3 +212,104 @@ with warnings.catch_warnings():
|
|||||||
)
|
)
|
||||||
# to make VideoFrame available in HuggingFace `datasets`
|
# to make VideoFrame available in HuggingFace `datasets`
|
||||||
register_feature(VideoFrame, "VideoFrame")
|
register_feature(VideoFrame, "VideoFrame")
|
||||||
|
|
||||||
|
|
||||||
|
def get_audio_info(video_path: Path | str) -> dict:
|
||||||
|
ffprobe_audio_cmd = [
|
||||||
|
"ffprobe",
|
||||||
|
"-v",
|
||||||
|
"error",
|
||||||
|
"-select_streams",
|
||||||
|
"a:0",
|
||||||
|
"-show_entries",
|
||||||
|
"stream=channels,codec_name,bit_rate,sample_rate,bit_depth,channel_layout,duration",
|
||||||
|
"-of",
|
||||||
|
"json",
|
||||||
|
str(video_path),
|
||||||
|
]
|
||||||
|
result = subprocess.run(ffprobe_audio_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True)
|
||||||
|
if result.returncode != 0:
|
||||||
|
raise RuntimeError(f"Error running ffprobe: {result.stderr}")
|
||||||
|
|
||||||
|
info = json.loads(result.stdout)
|
||||||
|
audio_stream_info = info["streams"][0] if info.get("streams") else None
|
||||||
|
if audio_stream_info is None:
|
||||||
|
return {"has_audio": False}
|
||||||
|
|
||||||
|
# Return the information, defaulting to None if no audio stream is present
|
||||||
|
return {
|
||||||
|
"has_audio": True,
|
||||||
|
"audio.channels": audio_stream_info.get("channels", None),
|
||||||
|
"audio.codec": audio_stream_info.get("codec_name", None),
|
||||||
|
"audio.bit_rate": int(audio_stream_info["bit_rate"]) if audio_stream_info.get("bit_rate") else None,
|
||||||
|
"audio.sample_rate": int(audio_stream_info["sample_rate"])
|
||||||
|
if audio_stream_info.get("sample_rate")
|
||||||
|
else None,
|
||||||
|
"audio.bit_depth": audio_stream_info.get("bit_depth", None),
|
||||||
|
"audio.channel_layout": audio_stream_info.get("channel_layout", None),
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def get_video_info(video_path: Path | str) -> dict:
|
||||||
|
ffprobe_video_cmd = [
|
||||||
|
"ffprobe",
|
||||||
|
"-v",
|
||||||
|
"error",
|
||||||
|
"-select_streams",
|
||||||
|
"v:0",
|
||||||
|
"-show_entries",
|
||||||
|
"stream=r_frame_rate,width,height,codec_name,nb_frames,duration,pix_fmt",
|
||||||
|
"-of",
|
||||||
|
"json",
|
||||||
|
str(video_path),
|
||||||
|
]
|
||||||
|
result = subprocess.run(ffprobe_video_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True)
|
||||||
|
if result.returncode != 0:
|
||||||
|
raise RuntimeError(f"Error running ffprobe: {result.stderr}")
|
||||||
|
|
||||||
|
info = json.loads(result.stdout)
|
||||||
|
video_stream_info = info["streams"][0]
|
||||||
|
|
||||||
|
# Calculate fps from r_frame_rate
|
||||||
|
r_frame_rate = video_stream_info["r_frame_rate"]
|
||||||
|
num, denom = map(int, r_frame_rate.split("/"))
|
||||||
|
fps = num / denom
|
||||||
|
|
||||||
|
pixel_channels = get_video_pixel_channels(video_stream_info["pix_fmt"])
|
||||||
|
|
||||||
|
video_info = {
|
||||||
|
"video.fps": fps,
|
||||||
|
"video.height": video_stream_info["height"],
|
||||||
|
"video.width": video_stream_info["width"],
|
||||||
|
"video.channels": pixel_channels,
|
||||||
|
"video.codec": video_stream_info["codec_name"],
|
||||||
|
"video.pix_fmt": video_stream_info["pix_fmt"],
|
||||||
|
"video.is_depth_map": False,
|
||||||
|
**get_audio_info(video_path),
|
||||||
|
}
|
||||||
|
|
||||||
|
return video_info
|
||||||
|
|
||||||
|
|
||||||
|
def get_video_pixel_channels(pix_fmt: str) -> int:
|
||||||
|
if "gray" in pix_fmt or "depth" in pix_fmt or "monochrome" in pix_fmt:
|
||||||
|
return 1
|
||||||
|
elif "rgba" in pix_fmt or "yuva" in pix_fmt:
|
||||||
|
return 4
|
||||||
|
elif "rgb" in pix_fmt or "yuv" in pix_fmt:
|
||||||
|
return 3
|
||||||
|
else:
|
||||||
|
raise ValueError("Unknown format")
|
||||||
|
|
||||||
|
|
||||||
|
def get_image_pixel_channels(image: Image):
|
||||||
|
if image.mode == "L":
|
||||||
|
return 1 # Grayscale
|
||||||
|
elif image.mode == "LA":
|
||||||
|
return 2 # Grayscale + Alpha
|
||||||
|
elif image.mode == "RGB":
|
||||||
|
return 3 # RGB
|
||||||
|
elif image.mode == "RGBA":
|
||||||
|
return 4 # RGBA
|
||||||
|
else:
|
||||||
|
raise ValueError("Unknown format")
|
||||||
|
|||||||
@@ -19,7 +19,7 @@ import gymnasium as gym
|
|||||||
from omegaconf import DictConfig
|
from omegaconf import DictConfig
|
||||||
|
|
||||||
|
|
||||||
def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv:
|
def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv | None:
|
||||||
"""Makes a gym vector environment according to the evaluation config.
|
"""Makes a gym vector environment according to the evaluation config.
|
||||||
|
|
||||||
n_envs can be used to override eval.batch_size in the configuration. Must be at least 1.
|
n_envs can be used to override eval.batch_size in the configuration. Must be at least 1.
|
||||||
@@ -27,13 +27,8 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
|
|||||||
if n_envs is not None and n_envs < 1:
|
if n_envs is not None and n_envs < 1:
|
||||||
raise ValueError("`n_envs must be at least 1")
|
raise ValueError("`n_envs must be at least 1")
|
||||||
|
|
||||||
kwargs = {
|
if cfg.env.name == "real_world":
|
||||||
# "obs_type": "pixels_agent_pos",
|
return
|
||||||
# "render_mode": "rgb_array",
|
|
||||||
"max_episode_steps": cfg.env.episode_length,
|
|
||||||
# "visualization_width": 384,
|
|
||||||
# "visualization_height": 384,
|
|
||||||
}
|
|
||||||
|
|
||||||
package_name = f"gym_{cfg.env.name}"
|
package_name = f"gym_{cfg.env.name}"
|
||||||
|
|
||||||
@@ -46,12 +41,16 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
|
|||||||
raise e
|
raise e
|
||||||
|
|
||||||
gym_handle = f"{package_name}/{cfg.env.task}"
|
gym_handle = f"{package_name}/{cfg.env.task}"
|
||||||
|
gym_kwgs = dict(cfg.env.get("gym", {}))
|
||||||
|
|
||||||
|
if cfg.env.get("episode_length"):
|
||||||
|
gym_kwgs["max_episode_steps"] = cfg.env.episode_length
|
||||||
|
|
||||||
# batched version of the env that returns an observation of shape (b, c)
|
# batched version of the env that returns an observation of shape (b, c)
|
||||||
env_cls = gym.vector.AsyncVectorEnv if cfg.eval.use_async_envs else gym.vector.SyncVectorEnv
|
env_cls = gym.vector.AsyncVectorEnv if cfg.eval.use_async_envs else gym.vector.SyncVectorEnv
|
||||||
env = env_cls(
|
env = env_cls(
|
||||||
[
|
[
|
||||||
lambda: gym.make(gym_handle, disable_env_checker=True, **kwargs)
|
lambda: gym.make(gym_handle, disable_env_checker=True, **gym_kwgs)
|
||||||
for _ in range(n_envs if n_envs is not None else cfg.eval.batch_size)
|
for _ in range(n_envs if n_envs is not None else cfg.eval.batch_size)
|
||||||
]
|
]
|
||||||
)
|
)
|
||||||
|
|||||||
@@ -28,31 +28,35 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
|
|||||||
"""
|
"""
|
||||||
# map to expected inputs for the policy
|
# map to expected inputs for the policy
|
||||||
return_observations = {}
|
return_observations = {}
|
||||||
|
if "pixels" in observations:
|
||||||
|
if isinstance(observations["pixels"], dict):
|
||||||
|
imgs = {f"observation.images.{key}": img for key, img in observations["pixels"].items()}
|
||||||
|
else:
|
||||||
|
imgs = {"observation.image": observations["pixels"]}
|
||||||
|
|
||||||
if isinstance(observations["pixels"], dict):
|
for imgkey, img in imgs.items():
|
||||||
imgs = {f"observation.images.{key}": img for key, img in observations["pixels"].items()}
|
img = torch.from_numpy(img)
|
||||||
else:
|
|
||||||
imgs = {"observation.image": observations["pixels"]}
|
|
||||||
|
|
||||||
for imgkey, img in imgs.items():
|
# sanity check that images are channel last
|
||||||
img = torch.from_numpy(img)
|
_, h, w, c = img.shape
|
||||||
|
assert c < h and c < w, f"expect channel last images, but instead got {img.shape=}"
|
||||||
|
|
||||||
# sanity check that images are channel last
|
# sanity check that images are uint8
|
||||||
_, h, w, c = img.shape
|
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
||||||
assert c < h and c < w, f"expect channel first images, but instead {img.shape}"
|
|
||||||
|
|
||||||
# sanity check that images are uint8
|
# convert to channel first of type float32 in range [0,1]
|
||||||
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
|
||||||
|
img = img.type(torch.float32)
|
||||||
|
img /= 255
|
||||||
|
|
||||||
# convert to channel first of type float32 in range [0,1]
|
return_observations[imgkey] = img
|
||||||
img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
|
|
||||||
img = img.type(torch.float32)
|
|
||||||
img /= 255
|
|
||||||
|
|
||||||
return_observations[imgkey] = img
|
if "environment_state" in observations:
|
||||||
|
return_observations["observation.environment_state"] = torch.from_numpy(
|
||||||
|
observations["environment_state"]
|
||||||
|
).float()
|
||||||
|
|
||||||
# TODO(rcadene): enable pixels only baseline with `obs_type="pixels"` in environment by removing
|
# TODO(rcadene): enable pixels only baseline with `obs_type="pixels"` in environment by removing
|
||||||
# requirement for "agent_pos"
|
# requirement for "agent_pos"
|
||||||
return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
|
return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
|
||||||
|
|
||||||
return return_observations
|
return return_observations
|
||||||
|
|||||||
@@ -13,25 +13,34 @@
|
|||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
# See the License for the specific language governing permissions and
|
# See the License for the specific language governing permissions and
|
||||||
# limitations under the License.
|
# limitations under the License.
|
||||||
|
"""Borrowed from https://github.com/fyhMer/fowm/blob/main/src/logger.py
|
||||||
|
|
||||||
# TODO(rcadene, alexander-soare): clean this file
|
# TODO(rcadene, alexander-soare): clean this file
|
||||||
"""Borrowed from https://github.com/fyhMer/fowm/blob/main/src/logger.py"""
|
"""
|
||||||
|
|
||||||
import logging
|
import logging
|
||||||
import os
|
import os
|
||||||
|
import re
|
||||||
|
from glob import glob
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
|
|
||||||
|
import torch
|
||||||
|
import wandb
|
||||||
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE
|
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE
|
||||||
from omegaconf import OmegaConf
|
from omegaconf import DictConfig, OmegaConf
|
||||||
from termcolor import colored
|
from termcolor import colored
|
||||||
|
from torch.optim import Optimizer
|
||||||
|
from torch.optim.lr_scheduler import LRScheduler
|
||||||
|
|
||||||
from lerobot.common.policies.policy_protocol import Policy
|
from lerobot.common.policies.policy_protocol import Policy
|
||||||
|
from lerobot.common.utils.utils import get_global_random_state, set_global_random_state
|
||||||
|
|
||||||
|
|
||||||
def log_output_dir(out_dir):
|
def log_output_dir(out_dir):
|
||||||
logging.info(colored("Output dir:", "yellow", attrs=["bold"]) + f" {out_dir}")
|
logging.info(colored("Output dir:", "yellow", attrs=["bold"]) + f" {out_dir}")
|
||||||
|
|
||||||
|
|
||||||
def cfg_to_group(cfg, return_list=False):
|
def cfg_to_group(cfg: DictConfig, return_list: bool = False) -> list[str] | str:
|
||||||
"""Return a group name for logging. Optionally returns group name as list."""
|
"""Return a group name for logging. Optionally returns group name as list."""
|
||||||
lst = [
|
lst = [
|
||||||
f"policy:{cfg.policy.name}",
|
f"policy:{cfg.policy.name}",
|
||||||
@@ -42,22 +51,54 @@ def cfg_to_group(cfg, return_list=False):
|
|||||||
return lst if return_list else "-".join(lst)
|
return lst if return_list else "-".join(lst)
|
||||||
|
|
||||||
|
|
||||||
class Logger:
|
def get_wandb_run_id_from_filesystem(checkpoint_dir: Path) -> str:
|
||||||
"""Primary logger object. Logs either locally or using wandb."""
|
# Get the WandB run ID.
|
||||||
|
paths = glob(str(checkpoint_dir / "../wandb/latest-run/run-*"))
|
||||||
|
if len(paths) != 1:
|
||||||
|
raise RuntimeError("Couldn't get the previous WandB run ID for run resumption.")
|
||||||
|
match = re.search(r"run-([^\.]+).wandb", paths[0].split("/")[-1])
|
||||||
|
if match is None:
|
||||||
|
raise RuntimeError("Couldn't get the previous WandB run ID for run resumption.")
|
||||||
|
wandb_run_id = match.groups(0)[0]
|
||||||
|
return wandb_run_id
|
||||||
|
|
||||||
def __init__(self, log_dir, job_name, cfg):
|
|
||||||
self._log_dir = Path(log_dir)
|
class Logger:
|
||||||
self._log_dir.mkdir(parents=True, exist_ok=True)
|
"""Primary logger object. Logs either locally or using wandb.
|
||||||
self._job_name = job_name
|
|
||||||
self._model_dir = self._log_dir / "checkpoints"
|
The logger creates the following directory structure:
|
||||||
self._buffer_dir = self._log_dir / "buffers"
|
|
||||||
self._save_model = cfg.training.save_model
|
provided_log_dir
|
||||||
self._disable_wandb_artifact = cfg.wandb.disable_artifact
|
├── .hydra # hydra's configuration cache
|
||||||
self._save_buffer = cfg.training.get("save_buffer", False)
|
├── checkpoints
|
||||||
self._group = cfg_to_group(cfg)
|
│ ├── specific_checkpoint_name
|
||||||
self._seed = cfg.seed
|
│ │ ├── pretrained_model # Hugging Face pretrained model directory
|
||||||
|
│ │ │ ├── ...
|
||||||
|
│ │ └── training_state.pth # optimizer, scheduler, and random states + training step
|
||||||
|
| ├── another_specific_checkpoint_name
|
||||||
|
│ │ ├── ...
|
||||||
|
| ├── ...
|
||||||
|
│ └── last # a softlink to the last logged checkpoint
|
||||||
|
"""
|
||||||
|
|
||||||
|
pretrained_model_dir_name = "pretrained_model"
|
||||||
|
training_state_file_name = "training_state.pth"
|
||||||
|
|
||||||
|
def __init__(self, cfg: DictConfig, log_dir: str, wandb_job_name: str | None = None):
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
log_dir: The directory to save all logs and training outputs to.
|
||||||
|
job_name: The WandB job name.
|
||||||
|
"""
|
||||||
self._cfg = cfg
|
self._cfg = cfg
|
||||||
self._eval = []
|
self.log_dir = Path(log_dir)
|
||||||
|
self.log_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
self.checkpoints_dir = self.get_checkpoints_dir(log_dir)
|
||||||
|
self.last_checkpoint_dir = self.get_last_checkpoint_dir(log_dir)
|
||||||
|
self.last_pretrained_model_dir = self.get_last_pretrained_model_dir(log_dir)
|
||||||
|
|
||||||
|
# Set up WandB.
|
||||||
|
self._group = cfg_to_group(cfg)
|
||||||
project = cfg.get("wandb", {}).get("project")
|
project = cfg.get("wandb", {}).get("project")
|
||||||
entity = cfg.get("wandb", {}).get("entity")
|
entity = cfg.get("wandb", {}).get("entity")
|
||||||
enable_wandb = cfg.get("wandb", {}).get("enable", False)
|
enable_wandb = cfg.get("wandb", {}).get("enable", False)
|
||||||
@@ -67,70 +108,130 @@ class Logger:
|
|||||||
self._wandb = None
|
self._wandb = None
|
||||||
else:
|
else:
|
||||||
os.environ["WANDB_SILENT"] = "true"
|
os.environ["WANDB_SILENT"] = "true"
|
||||||
import wandb
|
wandb_run_id = None
|
||||||
|
if cfg.resume:
|
||||||
|
wandb_run_id = get_wandb_run_id_from_filesystem(self.checkpoints_dir)
|
||||||
|
|
||||||
wandb.init(
|
wandb.init(
|
||||||
|
id=wandb_run_id,
|
||||||
project=project,
|
project=project,
|
||||||
entity=entity,
|
entity=entity,
|
||||||
name=job_name,
|
name=wandb_job_name,
|
||||||
notes=cfg.get("wandb", {}).get("notes"),
|
notes=cfg.get("wandb", {}).get("notes"),
|
||||||
# group=self._group,
|
|
||||||
tags=cfg_to_group(cfg, return_list=True),
|
tags=cfg_to_group(cfg, return_list=True),
|
||||||
dir=self._log_dir,
|
dir=log_dir,
|
||||||
config=OmegaConf.to_container(cfg, resolve=True),
|
config=OmegaConf.to_container(cfg, resolve=True),
|
||||||
# TODO(rcadene): try set to True
|
# TODO(rcadene): try set to True
|
||||||
save_code=False,
|
save_code=False,
|
||||||
# TODO(rcadene): split train and eval, and run async eval with job_type="eval"
|
# TODO(rcadene): split train and eval, and run async eval with job_type="eval"
|
||||||
job_type="train_eval",
|
job_type="train_eval",
|
||||||
# TODO(rcadene): add resume option
|
resume="must" if cfg.resume else None,
|
||||||
resume=None,
|
|
||||||
)
|
)
|
||||||
print(colored("Logs will be synced with wandb.", "blue", attrs=["bold"]))
|
print(colored("Logs will be synced with wandb.", "blue", attrs=["bold"]))
|
||||||
logging.info(f"Track this run --> {colored(wandb.run.get_url(), 'yellow', attrs=['bold'])}")
|
logging.info(f"Track this run --> {colored(wandb.run.get_url(), 'yellow', attrs=['bold'])}")
|
||||||
self._wandb = wandb
|
self._wandb = wandb
|
||||||
|
|
||||||
def save_model(self, policy: Policy, identifier):
|
@classmethod
|
||||||
if self._save_model:
|
def get_checkpoints_dir(cls, log_dir: str | Path) -> Path:
|
||||||
self._model_dir.mkdir(parents=True, exist_ok=True)
|
"""Given the log directory, get the sub-directory in which checkpoints will be saved."""
|
||||||
save_dir = self._model_dir / str(identifier)
|
return Path(log_dir) / "checkpoints"
|
||||||
policy.save_pretrained(save_dir)
|
|
||||||
# Also save the full Hydra config for the env configuration.
|
|
||||||
OmegaConf.save(self._cfg, save_dir / "config.yaml")
|
|
||||||
if self._wandb and not self._disable_wandb_artifact:
|
|
||||||
# note wandb artifact does not accept ":" or "/" in its name
|
|
||||||
artifact = self._wandb.Artifact(
|
|
||||||
f"{self._group.replace(':', '_').replace('/', '_')}-{self._seed}-{identifier}",
|
|
||||||
type="model",
|
|
||||||
)
|
|
||||||
artifact.add_file(save_dir / SAFETENSORS_SINGLE_FILE)
|
|
||||||
self._wandb.log_artifact(artifact)
|
|
||||||
|
|
||||||
def save_buffer(self, buffer, identifier):
|
@classmethod
|
||||||
self._buffer_dir.mkdir(parents=True, exist_ok=True)
|
def get_last_checkpoint_dir(cls, log_dir: str | Path) -> Path:
|
||||||
fp = self._buffer_dir / f"{str(identifier)}.pkl"
|
"""Given the log directory, get the sub-directory in which the last checkpoint will be saved."""
|
||||||
buffer.save(fp)
|
return cls.get_checkpoints_dir(log_dir) / "last"
|
||||||
if self._wandb and not self._disable_wandb_artifact:
|
|
||||||
|
@classmethod
|
||||||
|
def get_last_pretrained_model_dir(cls, log_dir: str | Path) -> Path:
|
||||||
|
"""
|
||||||
|
Given the log directory, get the sub-directory in which the last checkpoint's pretrained weights will
|
||||||
|
be saved.
|
||||||
|
"""
|
||||||
|
return cls.get_last_checkpoint_dir(log_dir) / cls.pretrained_model_dir_name
|
||||||
|
|
||||||
|
def save_model(self, save_dir: Path, policy: Policy, wandb_artifact_name: str | None = None):
|
||||||
|
"""Save the weights of the Policy model using PyTorchModelHubMixin.
|
||||||
|
|
||||||
|
The weights are saved in a folder called "pretrained_model" under the checkpoint directory.
|
||||||
|
|
||||||
|
Optionally also upload the model to WandB.
|
||||||
|
"""
|
||||||
|
self.checkpoints_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
policy.save_pretrained(save_dir)
|
||||||
|
# Also save the full Hydra config for the env configuration.
|
||||||
|
OmegaConf.save(self._cfg, save_dir / "config.yaml")
|
||||||
|
if self._wandb and not self._cfg.wandb.disable_artifact:
|
||||||
# note wandb artifact does not accept ":" or "/" in its name
|
# note wandb artifact does not accept ":" or "/" in its name
|
||||||
artifact = self._wandb.Artifact(
|
artifact = self._wandb.Artifact(wandb_artifact_name, type="model")
|
||||||
f"{self._group.replace(':', '_').replace('/', '_')}-{self._seed}-{identifier}",
|
artifact.add_file(save_dir / SAFETENSORS_SINGLE_FILE)
|
||||||
type="buffer",
|
|
||||||
)
|
|
||||||
artifact.add_file(fp)
|
|
||||||
self._wandb.log_artifact(artifact)
|
self._wandb.log_artifact(artifact)
|
||||||
|
if self.last_checkpoint_dir.exists():
|
||||||
|
os.remove(self.last_checkpoint_dir)
|
||||||
|
|
||||||
def finish(self, agent, buffer):
|
def save_training_state(
|
||||||
if self._save_model:
|
self,
|
||||||
self.save_model(agent, identifier="final")
|
save_dir: Path,
|
||||||
if self._save_buffer:
|
train_step: int,
|
||||||
self.save_buffer(buffer, identifier="buffer")
|
optimizer: Optimizer,
|
||||||
if self._wandb:
|
scheduler: LRScheduler | None,
|
||||||
self._wandb.finish()
|
):
|
||||||
|
"""Checkpoint the global training_step, optimizer state, scheduler state, and random state.
|
||||||
|
|
||||||
|
All of these are saved as "training_state.pth" under the checkpoint directory.
|
||||||
|
"""
|
||||||
|
training_state = {
|
||||||
|
"step": train_step,
|
||||||
|
"optimizer": optimizer.state_dict(),
|
||||||
|
**get_global_random_state(),
|
||||||
|
}
|
||||||
|
if scheduler is not None:
|
||||||
|
training_state["scheduler"] = scheduler.state_dict()
|
||||||
|
torch.save(training_state, save_dir / self.training_state_file_name)
|
||||||
|
|
||||||
|
def save_checkpoint(
|
||||||
|
self,
|
||||||
|
train_step: int,
|
||||||
|
policy: Policy,
|
||||||
|
optimizer: Optimizer,
|
||||||
|
scheduler: LRScheduler | None,
|
||||||
|
identifier: str,
|
||||||
|
):
|
||||||
|
"""Checkpoint the model weights and the training state."""
|
||||||
|
checkpoint_dir = self.checkpoints_dir / str(identifier)
|
||||||
|
wandb_artifact_name = (
|
||||||
|
None
|
||||||
|
if self._wandb is None
|
||||||
|
else f"{self._group.replace(':', '_').replace('/', '_')}-{self._cfg.seed}-{identifier}"
|
||||||
|
)
|
||||||
|
self.save_model(
|
||||||
|
checkpoint_dir / self.pretrained_model_dir_name, policy, wandb_artifact_name=wandb_artifact_name
|
||||||
|
)
|
||||||
|
self.save_training_state(checkpoint_dir, train_step, optimizer, scheduler)
|
||||||
|
os.symlink(checkpoint_dir.absolute(), self.last_checkpoint_dir)
|
||||||
|
|
||||||
|
def load_last_training_state(self, optimizer: Optimizer, scheduler: LRScheduler | None) -> int:
|
||||||
|
"""
|
||||||
|
Given the last checkpoint in the logging directory, load the optimizer state, scheduler state, and
|
||||||
|
random state, and return the global training step.
|
||||||
|
"""
|
||||||
|
training_state = torch.load(self.last_checkpoint_dir / self.training_state_file_name)
|
||||||
|
optimizer.load_state_dict(training_state["optimizer"])
|
||||||
|
if scheduler is not None:
|
||||||
|
scheduler.load_state_dict(training_state["scheduler"])
|
||||||
|
elif "scheduler" in training_state:
|
||||||
|
raise ValueError(
|
||||||
|
"The checkpoint contains a scheduler state_dict, but no LRScheduler was provided."
|
||||||
|
)
|
||||||
|
# Small hack to get the expected keys: use `get_global_random_state`.
|
||||||
|
set_global_random_state({k: training_state[k] for k in get_global_random_state()})
|
||||||
|
return training_state["step"]
|
||||||
|
|
||||||
def log_dict(self, d, step, mode="train"):
|
def log_dict(self, d, step, mode="train"):
|
||||||
assert mode in {"train", "eval"}
|
assert mode in {"train", "eval"}
|
||||||
|
# TODO(alexander-soare): Add local text log.
|
||||||
if self._wandb is not None:
|
if self._wandb is not None:
|
||||||
for k, v in d.items():
|
for k, v in d.items():
|
||||||
if not isinstance(v, (int, float, str)):
|
if not isinstance(v, (int, float, str, wandb.Table)):
|
||||||
logging.warning(
|
logging.warning(
|
||||||
f'WandB logging of key "{k}" was ignored as its type is not handled by this wrapper.'
|
f'WandB logging of key "{k}" was ignored as its type is not handled by this wrapper.'
|
||||||
)
|
)
|
||||||
@@ -139,5 +240,6 @@ class Logger:
|
|||||||
|
|
||||||
def log_video(self, video_path: str, step: int, mode: str = "train"):
|
def log_video(self, video_path: str, step: int, mode: str = "train"):
|
||||||
assert mode in {"train", "eval"}
|
assert mode in {"train", "eval"}
|
||||||
|
assert self._wandb is not None
|
||||||
wandb_video = self._wandb.Video(video_path, fps=self._cfg.fps, format="mp4")
|
wandb_video = self._wandb.Video(video_path, fps=self._cfg.fps, format="mp4")
|
||||||
self._wandb.log({f"{mode}/video": wandb_video}, step=step)
|
self._wandb.log({f"{mode}/video": wandb_video}, step=step)
|
||||||
|
|||||||
@@ -25,6 +25,16 @@ class ACTConfig:
|
|||||||
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||||
Those are: `input_shapes` and 'output_shapes`.
|
Those are: `input_shapes` and 'output_shapes`.
|
||||||
|
|
||||||
|
Notes on the inputs and outputs:
|
||||||
|
- Either:
|
||||||
|
- At least one key starting with "observation.image is required as an input.
|
||||||
|
AND/OR
|
||||||
|
- The key "observation.environment_state" is required as input.
|
||||||
|
- If there are multiple keys beginning with "observation.images." they are treated as multiple camera
|
||||||
|
views. Right now we only support all images having the same shape.
|
||||||
|
- May optionally work without an "observation.state" key for the proprioceptive robot state.
|
||||||
|
- "action" is required as an output key.
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
||||||
current step and additional steps going back).
|
current step and additional steps going back).
|
||||||
@@ -33,15 +43,15 @@ class ACTConfig:
|
|||||||
This should be no greater than the chunk size. For example, if the chunk size size 100, you may
|
This should be no greater than the chunk size. For example, if the chunk size size 100, you may
|
||||||
set this to 50. This would mean that the model predicts 100 steps worth of actions, runs 50 in the
|
set this to 50. This would mean that the model predicts 100 steps worth of actions, runs 50 in the
|
||||||
environment, and throws the other 50 out.
|
environment, and throws the other 50 out.
|
||||||
input_shapes: A dictionary defining the shapes of the input data for the policy.
|
input_shapes: A dictionary defining the shapes of the input data for the policy. The key represents
|
||||||
The key represents the input data name, and the value is a list indicating the dimensions
|
the input data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||||
of the corresponding data. For example, "observation.images.top" refers to an input from the
|
For example, "observation.image" refers to an input from a camera with dimensions [3, 96, 96],
|
||||||
"top" camera with dimensions [3, 96, 96], indicating it has three color channels and 96x96 resolution.
|
indicating it has three color channels and 96x96 resolution. Importantly, `input_shapes` doesn't
|
||||||
Importantly, shapes doesn't include batch dimension or temporal dimension.
|
include batch dimension or temporal dimension.
|
||||||
output_shapes: A dictionary defining the shapes of the output data for the policy.
|
output_shapes: A dictionary defining the shapes of the output data for the policy. The key represents
|
||||||
The key represents the output data name, and the value is a list indicating the dimensions
|
the output data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||||
of the corresponding data. For example, "action" refers to an output shape of [14], indicating
|
For example, "action" refers to an output shape of [14], indicating 14-dimensional actions.
|
||||||
14-dimensional actions. Importantly, shapes doesn't include batch dimension or temporal dimension.
|
Importantly, `output_shapes` doesn't include batch dimension or temporal dimension.
|
||||||
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||||
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||||
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||||
@@ -66,12 +76,10 @@ class ACTConfig:
|
|||||||
documentation in the policy class).
|
documentation in the policy class).
|
||||||
latent_dim: The VAE's latent dimension.
|
latent_dim: The VAE's latent dimension.
|
||||||
n_vae_encoder_layers: The number of transformer layers to use for the VAE's encoder.
|
n_vae_encoder_layers: The number of transformer layers to use for the VAE's encoder.
|
||||||
temporal_ensemble_momentum: Exponential moving average (EMA) momentum parameter (α) for ensembling
|
temporal_ensemble_coeff: Coefficient for the exponential weighting scheme to apply for temporal
|
||||||
actions for a given time step over multiple policy invocations. Updates are calculated as:
|
ensembling. Defaults to None which means temporal ensembling is not used. `n_action_steps` must be
|
||||||
x⁻ₙ = αx⁻ₙ₋₁ + (1-α)xₙ. Note that the ACT paper and original ACT code describes a different
|
1 when using this feature, as inference needs to happen at every step to form an ensemble. For
|
||||||
parameter here: they refer to a weighting scheme wᵢ = exp(-m⋅i) and set m = 0.01. With our
|
more information on how ensembling works, please see `ACTTemporalEnsembler`.
|
||||||
formulation, this is equivalent to α = exp(-0.01) ≈ 0.99. When this parameter is provided, we
|
|
||||||
require `n_action_steps == 1` (since we need to query the policy every step anyway).
|
|
||||||
dropout: Dropout to use in the transformer layers (see code for details).
|
dropout: Dropout to use in the transformer layers (see code for details).
|
||||||
kl_weight: The weight to use for the KL-divergence component of the loss if the variational objective
|
kl_weight: The weight to use for the KL-divergence component of the loss if the variational objective
|
||||||
is enabled. Loss is then calculated as: `reconstruction_loss + kl_weight * kld_loss`.
|
is enabled. Loss is then calculated as: `reconstruction_loss + kl_weight * kld_loss`.
|
||||||
@@ -129,7 +137,8 @@ class ACTConfig:
|
|||||||
n_vae_encoder_layers: int = 4
|
n_vae_encoder_layers: int = 4
|
||||||
|
|
||||||
# Inference.
|
# Inference.
|
||||||
temporal_ensemble_momentum: float | None = None
|
# Note: the value used in ACT when temporal ensembling is enabled is 0.01.
|
||||||
|
temporal_ensemble_coeff: float | None = None
|
||||||
|
|
||||||
# Training and loss computation.
|
# Training and loss computation.
|
||||||
dropout: float = 0.1
|
dropout: float = 0.1
|
||||||
@@ -141,7 +150,7 @@ class ACTConfig:
|
|||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||||
)
|
)
|
||||||
if self.temporal_ensemble_momentum is not None and self.n_action_steps > 1:
|
if self.temporal_ensemble_coeff is not None and self.n_action_steps > 1:
|
||||||
raise NotImplementedError(
|
raise NotImplementedError(
|
||||||
"`n_action_steps` must be 1 when using temporal ensembling. This is "
|
"`n_action_steps` must be 1 when using temporal ensembling. This is "
|
||||||
"because the policy needs to be queried every step to compute the ensembled action."
|
"because the policy needs to be queried every step to compute the ensembled action."
|
||||||
@@ -155,3 +164,8 @@ class ACTConfig:
|
|||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"Multiple observation steps not handled yet. Got `nobs_steps={self.n_obs_steps}`"
|
f"Multiple observation steps not handled yet. Got `nobs_steps={self.n_obs_steps}`"
|
||||||
)
|
)
|
||||||
|
if (
|
||||||
|
not any(k.startswith("observation.image") for k in self.input_shapes)
|
||||||
|
and "observation.environment_state" not in self.input_shapes
|
||||||
|
):
|
||||||
|
raise ValueError("You must provide at least one image or the environment state among the inputs.")
|
||||||
|
|||||||
@@ -38,7 +38,13 @@ from lerobot.common.policies.act.configuration_act import ACTConfig
|
|||||||
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||||
|
|
||||||
|
|
||||||
class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
class ACTPolicy(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "act"],
|
||||||
|
):
|
||||||
"""
|
"""
|
||||||
Action Chunking Transformer Policy as per Learning Fine-Grained Bimanual Manipulation with Low-Cost
|
Action Chunking Transformer Policy as per Learning Fine-Grained Bimanual Manipulation with Low-Cost
|
||||||
Hardware (paper: https://arxiv.org/abs/2304.13705, code: https://github.com/tonyzhaozh/act)
|
Hardware (paper: https://arxiv.org/abs/2304.13705, code: https://github.com/tonyzhaozh/act)
|
||||||
@@ -77,12 +83,15 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
|
|
||||||
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||||
|
|
||||||
|
if config.temporal_ensemble_coeff is not None:
|
||||||
|
self.temporal_ensembler = ACTTemporalEnsembler(config.temporal_ensemble_coeff, config.chunk_size)
|
||||||
|
|
||||||
self.reset()
|
self.reset()
|
||||||
|
|
||||||
def reset(self):
|
def reset(self):
|
||||||
"""This should be called whenever the environment is reset."""
|
"""This should be called whenever the environment is reset."""
|
||||||
if self.config.temporal_ensemble_momentum is not None:
|
if self.config.temporal_ensemble_coeff is not None:
|
||||||
self._ensembled_actions = None
|
self.temporal_ensembler.reset()
|
||||||
else:
|
else:
|
||||||
self._action_queue = deque([], maxlen=self.config.n_action_steps)
|
self._action_queue = deque([], maxlen=self.config.n_action_steps)
|
||||||
|
|
||||||
@@ -97,26 +106,16 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
self.eval()
|
self.eval()
|
||||||
|
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
if len(self.expected_image_keys) > 0:
|
||||||
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
|
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||||
|
|
||||||
# If we are doing temporal ensembling, keep track of the exponential moving average (EMA), and return
|
# If we are doing temporal ensembling, do online updates where we keep track of the number of actions
|
||||||
# the first action.
|
# we are ensembling over.
|
||||||
if self.config.temporal_ensemble_momentum is not None:
|
if self.config.temporal_ensemble_coeff is not None:
|
||||||
actions = self.model(batch)[0] # (batch_size, chunk_size, action_dim)
|
actions = self.model(batch)[0] # (batch_size, chunk_size, action_dim)
|
||||||
actions = self.unnormalize_outputs({"action": actions})["action"]
|
actions = self.unnormalize_outputs({"action": actions})["action"]
|
||||||
if self._ensembled_actions is None:
|
action = self.temporal_ensembler.update(actions)
|
||||||
# Initializes `self._ensembled_action` to the sequence of actions predicted during the first
|
|
||||||
# time step of the episode.
|
|
||||||
self._ensembled_actions = actions.clone()
|
|
||||||
else:
|
|
||||||
# self._ensembled_actions will have shape (batch_size, chunk_size - 1, action_dim). Compute
|
|
||||||
# the EMA update for those entries.
|
|
||||||
alpha = self.config.temporal_ensemble_momentum
|
|
||||||
self._ensembled_actions = alpha * self._ensembled_actions + (1 - alpha) * actions[:, :-1]
|
|
||||||
# The last action, which has no prior moving average, needs to get concatenated onto the end.
|
|
||||||
self._ensembled_actions = torch.cat([self._ensembled_actions, actions[:, -1:]], dim=1)
|
|
||||||
# "Consume" the first action.
|
|
||||||
action, self._ensembled_actions = self._ensembled_actions[:, 0], self._ensembled_actions[:, 1:]
|
|
||||||
return action
|
return action
|
||||||
|
|
||||||
# Action queue logic for n_action_steps > 1. When the action_queue is depleted, populate it by
|
# Action queue logic for n_action_steps > 1. When the action_queue is depleted, populate it by
|
||||||
@@ -135,7 +134,9 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||||
"""Run the batch through the model and compute the loss for training or validation."""
|
"""Run the batch through the model and compute the loss for training or validation."""
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
if len(self.expected_image_keys) > 0:
|
||||||
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
|
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||||
batch = self.normalize_targets(batch)
|
batch = self.normalize_targets(batch)
|
||||||
actions_hat, (mu_hat, log_sigma_x2_hat) = self.model(batch)
|
actions_hat, (mu_hat, log_sigma_x2_hat) = self.model(batch)
|
||||||
|
|
||||||
@@ -160,6 +161,97 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
return loss_dict
|
return loss_dict
|
||||||
|
|
||||||
|
|
||||||
|
class ACTTemporalEnsembler:
|
||||||
|
def __init__(self, temporal_ensemble_coeff: float, chunk_size: int) -> None:
|
||||||
|
"""Temporal ensembling as described in Algorithm 2 of https://arxiv.org/abs/2304.13705.
|
||||||
|
|
||||||
|
The weights are calculated as wᵢ = exp(-temporal_ensemble_coeff * i) where w₀ is the oldest action.
|
||||||
|
They are then normalized to sum to 1 by dividing by Σwᵢ. Here's some intuition around how the
|
||||||
|
coefficient works:
|
||||||
|
- Setting it to 0 uniformly weighs all actions.
|
||||||
|
- Setting it positive gives more weight to older actions.
|
||||||
|
- Setting it negative gives more weight to newer actions.
|
||||||
|
NOTE: The default value for `temporal_ensemble_coeff` used by the original ACT work is 0.01. This
|
||||||
|
results in older actions being weighed more highly than newer actions (the experiments documented in
|
||||||
|
https://github.com/huggingface/lerobot/pull/319 hint at why highly weighing new actions might be
|
||||||
|
detrimental: doing so aggressively may diminish the benefits of action chunking).
|
||||||
|
|
||||||
|
Here we use an online method for computing the average rather than caching a history of actions in
|
||||||
|
order to compute the average offline. For a simple 1D sequence it looks something like:
|
||||||
|
|
||||||
|
```
|
||||||
|
import torch
|
||||||
|
|
||||||
|
seq = torch.linspace(8, 8.5, 100)
|
||||||
|
print(seq)
|
||||||
|
|
||||||
|
m = 0.01
|
||||||
|
exp_weights = torch.exp(-m * torch.arange(len(seq)))
|
||||||
|
print(exp_weights)
|
||||||
|
|
||||||
|
# Calculate offline
|
||||||
|
avg = (exp_weights * seq).sum() / exp_weights.sum()
|
||||||
|
print("offline", avg)
|
||||||
|
|
||||||
|
# Calculate online
|
||||||
|
for i, item in enumerate(seq):
|
||||||
|
if i == 0:
|
||||||
|
avg = item
|
||||||
|
continue
|
||||||
|
avg *= exp_weights[:i].sum()
|
||||||
|
avg += item * exp_weights[i]
|
||||||
|
avg /= exp_weights[:i+1].sum()
|
||||||
|
print("online", avg)
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
self.chunk_size = chunk_size
|
||||||
|
self.ensemble_weights = torch.exp(-temporal_ensemble_coeff * torch.arange(chunk_size))
|
||||||
|
self.ensemble_weights_cumsum = torch.cumsum(self.ensemble_weights, dim=0)
|
||||||
|
self.reset()
|
||||||
|
|
||||||
|
def reset(self):
|
||||||
|
"""Resets the online computation variables."""
|
||||||
|
self.ensembled_actions = None
|
||||||
|
# (chunk_size,) count of how many actions are in the ensemble for each time step in the sequence.
|
||||||
|
self.ensembled_actions_count = None
|
||||||
|
|
||||||
|
def update(self, actions: Tensor) -> Tensor:
|
||||||
|
"""
|
||||||
|
Takes a (batch, chunk_size, action_dim) sequence of actions, update the temporal ensemble for all
|
||||||
|
time steps, and pop/return the next batch of actions in the sequence.
|
||||||
|
"""
|
||||||
|
self.ensemble_weights = self.ensemble_weights.to(device=actions.device)
|
||||||
|
self.ensemble_weights_cumsum = self.ensemble_weights_cumsum.to(device=actions.device)
|
||||||
|
if self.ensembled_actions is None:
|
||||||
|
# Initializes `self._ensembled_action` to the sequence of actions predicted during the first
|
||||||
|
# time step of the episode.
|
||||||
|
self.ensembled_actions = actions.clone()
|
||||||
|
# Note: The last dimension is unsqueeze to make sure we can broadcast properly for tensor
|
||||||
|
# operations later.
|
||||||
|
self.ensembled_actions_count = torch.ones(
|
||||||
|
(self.chunk_size, 1), dtype=torch.long, device=self.ensembled_actions.device
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
# self.ensembled_actions will have shape (batch_size, chunk_size - 1, action_dim). Compute
|
||||||
|
# the online update for those entries.
|
||||||
|
self.ensembled_actions *= self.ensemble_weights_cumsum[self.ensembled_actions_count - 1]
|
||||||
|
self.ensembled_actions += actions[:, :-1] * self.ensemble_weights[self.ensembled_actions_count]
|
||||||
|
self.ensembled_actions /= self.ensemble_weights_cumsum[self.ensembled_actions_count]
|
||||||
|
self.ensembled_actions_count = torch.clamp(self.ensembled_actions_count + 1, max=self.chunk_size)
|
||||||
|
# The last action, which has no prior online average, needs to get concatenated onto the end.
|
||||||
|
self.ensembled_actions = torch.cat([self.ensembled_actions, actions[:, -1:]], dim=1)
|
||||||
|
self.ensembled_actions_count = torch.cat(
|
||||||
|
[self.ensembled_actions_count, torch.ones_like(self.ensembled_actions_count[-1:])]
|
||||||
|
)
|
||||||
|
# "Consume" the first action.
|
||||||
|
action, self.ensembled_actions, self.ensembled_actions_count = (
|
||||||
|
self.ensembled_actions[:, 0],
|
||||||
|
self.ensembled_actions[:, 1:],
|
||||||
|
self.ensembled_actions_count[1:],
|
||||||
|
)
|
||||||
|
return action
|
||||||
|
|
||||||
|
|
||||||
class ACT(nn.Module):
|
class ACT(nn.Module):
|
||||||
"""Action Chunking Transformer: The underlying neural network for ACTPolicy.
|
"""Action Chunking Transformer: The underlying neural network for ACTPolicy.
|
||||||
|
|
||||||
@@ -198,56 +290,75 @@ class ACT(nn.Module):
|
|||||||
def __init__(self, config: ACTConfig):
|
def __init__(self, config: ACTConfig):
|
||||||
super().__init__()
|
super().__init__()
|
||||||
self.config = config
|
self.config = config
|
||||||
# BERT style VAE encoder with input [cls, *joint_space_configuration, *action_sequence].
|
# BERT style VAE encoder with input tokens [cls, robot_state, *action_sequence].
|
||||||
# The cls token forms parameters of the latent's distribution (like this [*means, *log_variances]).
|
# The cls token forms parameters of the latent's distribution (like this [*means, *log_variances]).
|
||||||
|
self.use_robot_state = "observation.state" in config.input_shapes
|
||||||
|
self.use_images = any(k.startswith("observation.image") for k in config.input_shapes)
|
||||||
|
self.use_env_state = "observation.environment_state" in config.input_shapes
|
||||||
if self.config.use_vae:
|
if self.config.use_vae:
|
||||||
self.vae_encoder = ACTEncoder(config)
|
self.vae_encoder = ACTEncoder(config, is_vae_encoder=True)
|
||||||
self.vae_encoder_cls_embed = nn.Embedding(1, config.dim_model)
|
self.vae_encoder_cls_embed = nn.Embedding(1, config.dim_model)
|
||||||
# Projection layer for joint-space configuration to hidden dimension.
|
# Projection layer for joint-space configuration to hidden dimension.
|
||||||
self.vae_encoder_robot_state_input_proj = nn.Linear(
|
if self.use_robot_state:
|
||||||
config.input_shapes["observation.state"][0], config.dim_model
|
self.vae_encoder_robot_state_input_proj = nn.Linear(
|
||||||
)
|
config.input_shapes["observation.state"][0], config.dim_model
|
||||||
|
)
|
||||||
# Projection layer for action (joint-space target) to hidden dimension.
|
# Projection layer for action (joint-space target) to hidden dimension.
|
||||||
self.vae_encoder_action_input_proj = nn.Linear(
|
self.vae_encoder_action_input_proj = nn.Linear(
|
||||||
config.input_shapes["observation.state"][0], config.dim_model
|
config.output_shapes["action"][0], config.dim_model
|
||||||
)
|
)
|
||||||
self.latent_dim = config.latent_dim
|
|
||||||
# Projection layer from the VAE encoder's output to the latent distribution's parameter space.
|
# Projection layer from the VAE encoder's output to the latent distribution's parameter space.
|
||||||
self.vae_encoder_latent_output_proj = nn.Linear(config.dim_model, self.latent_dim * 2)
|
self.vae_encoder_latent_output_proj = nn.Linear(config.dim_model, config.latent_dim * 2)
|
||||||
# Fixed sinusoidal positional embedding the whole input to the VAE encoder. Unsqueeze for batch
|
# Fixed sinusoidal positional embedding for the input to the VAE encoder. Unsqueeze for batch
|
||||||
# dimension.
|
# dimension.
|
||||||
|
num_input_token_encoder = 1 + config.chunk_size
|
||||||
|
if self.use_robot_state:
|
||||||
|
num_input_token_encoder += 1
|
||||||
self.register_buffer(
|
self.register_buffer(
|
||||||
"vae_encoder_pos_enc",
|
"vae_encoder_pos_enc",
|
||||||
create_sinusoidal_pos_embedding(1 + 1 + config.chunk_size, config.dim_model).unsqueeze(0),
|
create_sinusoidal_pos_embedding(num_input_token_encoder, config.dim_model).unsqueeze(0),
|
||||||
)
|
)
|
||||||
|
|
||||||
# Backbone for image feature extraction.
|
# Backbone for image feature extraction.
|
||||||
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
if self.use_images:
|
||||||
replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
|
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
||||||
weights=config.pretrained_backbone_weights,
|
replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
|
||||||
norm_layer=FrozenBatchNorm2d,
|
weights=config.pretrained_backbone_weights,
|
||||||
)
|
norm_layer=FrozenBatchNorm2d,
|
||||||
# Note: The assumption here is that we are using a ResNet model (and hence layer4 is the final feature
|
)
|
||||||
# map).
|
# Note: The assumption here is that we are using a ResNet model (and hence layer4 is the final
|
||||||
# Note: The forward method of this returns a dict: {"feature_map": output}.
|
# feature map).
|
||||||
self.backbone = IntermediateLayerGetter(backbone_model, return_layers={"layer4": "feature_map"})
|
# Note: The forward method of this returns a dict: {"feature_map": output}.
|
||||||
|
self.backbone = IntermediateLayerGetter(backbone_model, return_layers={"layer4": "feature_map"})
|
||||||
|
|
||||||
# Transformer (acts as VAE decoder when training with the variational objective).
|
# Transformer (acts as VAE decoder when training with the variational objective).
|
||||||
self.encoder = ACTEncoder(config)
|
self.encoder = ACTEncoder(config)
|
||||||
self.decoder = ACTDecoder(config)
|
self.decoder = ACTDecoder(config)
|
||||||
|
|
||||||
# Transformer encoder input projections. The tokens will be structured like
|
# Transformer encoder input projections. The tokens will be structured like
|
||||||
# [latent, robot_state, image_feature_map_pixels].
|
# [latent, (robot_state), (env_state), (image_feature_map_pixels)].
|
||||||
self.encoder_robot_state_input_proj = nn.Linear(
|
if self.use_robot_state:
|
||||||
config.input_shapes["observation.state"][0], config.dim_model
|
self.encoder_robot_state_input_proj = nn.Linear(
|
||||||
)
|
config.input_shapes["observation.state"][0], config.dim_model
|
||||||
self.encoder_latent_input_proj = nn.Linear(self.latent_dim, config.dim_model)
|
)
|
||||||
self.encoder_img_feat_input_proj = nn.Conv2d(
|
if self.use_env_state:
|
||||||
backbone_model.fc.in_features, config.dim_model, kernel_size=1
|
self.encoder_env_state_input_proj = nn.Linear(
|
||||||
)
|
config.input_shapes["observation.environment_state"][0], config.dim_model
|
||||||
|
)
|
||||||
|
self.encoder_latent_input_proj = nn.Linear(config.latent_dim, config.dim_model)
|
||||||
|
if self.use_images:
|
||||||
|
self.encoder_img_feat_input_proj = nn.Conv2d(
|
||||||
|
backbone_model.fc.in_features, config.dim_model, kernel_size=1
|
||||||
|
)
|
||||||
# Transformer encoder positional embeddings.
|
# Transformer encoder positional embeddings.
|
||||||
self.encoder_robot_and_latent_pos_embed = nn.Embedding(2, config.dim_model)
|
n_1d_tokens = 1 # for the latent
|
||||||
self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(config.dim_model // 2)
|
if self.use_robot_state:
|
||||||
|
n_1d_tokens += 1
|
||||||
|
if self.use_env_state:
|
||||||
|
n_1d_tokens += 1
|
||||||
|
self.encoder_1d_feature_pos_embed = nn.Embedding(n_1d_tokens, config.dim_model)
|
||||||
|
if self.use_images:
|
||||||
|
self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(config.dim_model // 2)
|
||||||
|
|
||||||
# Transformer decoder.
|
# Transformer decoder.
|
||||||
# Learnable positional embedding for the transformer's decoder (in the style of DETR object queries).
|
# Learnable positional embedding for the transformer's decoder (in the style of DETR object queries).
|
||||||
@@ -268,10 +379,13 @@ class ACT(nn.Module):
|
|||||||
"""A forward pass through the Action Chunking Transformer (with optional VAE encoder).
|
"""A forward pass through the Action Chunking Transformer (with optional VAE encoder).
|
||||||
|
|
||||||
`batch` should have the following structure:
|
`batch` should have the following structure:
|
||||||
|
|
||||||
{
|
{
|
||||||
"observation.state": (B, state_dim) batch of robot states.
|
"observation.state" (optional): (B, state_dim) batch of robot states.
|
||||||
|
|
||||||
"observation.images": (B, n_cameras, C, H, W) batch of images.
|
"observation.images": (B, n_cameras, C, H, W) batch of images.
|
||||||
|
AND/OR
|
||||||
|
"observation.environment_state": (B, env_dim) batch of environment states.
|
||||||
|
|
||||||
"action" (optional, only if training with VAE): (B, chunk_size, action dim) batch of actions.
|
"action" (optional, only if training with VAE): (B, chunk_size, action dim) batch of actions.
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -285,7 +399,11 @@ class ACT(nn.Module):
|
|||||||
"action" in batch
|
"action" in batch
|
||||||
), "actions must be provided when using the variational objective in training mode."
|
), "actions must be provided when using the variational objective in training mode."
|
||||||
|
|
||||||
batch_size = batch["observation.state"].shape[0]
|
batch_size = (
|
||||||
|
batch["observation.images"]
|
||||||
|
if "observation.images" in batch
|
||||||
|
else batch["observation.environment_state"]
|
||||||
|
).shape[0]
|
||||||
|
|
||||||
# Prepare the latent for input to the transformer encoder.
|
# Prepare the latent for input to the transformer encoder.
|
||||||
if self.config.use_vae and "action" in batch:
|
if self.config.use_vae and "action" in batch:
|
||||||
@@ -293,79 +411,102 @@ class ACT(nn.Module):
|
|||||||
cls_embed = einops.repeat(
|
cls_embed = einops.repeat(
|
||||||
self.vae_encoder_cls_embed.weight, "1 d -> b 1 d", b=batch_size
|
self.vae_encoder_cls_embed.weight, "1 d -> b 1 d", b=batch_size
|
||||||
) # (B, 1, D)
|
) # (B, 1, D)
|
||||||
robot_state_embed = self.vae_encoder_robot_state_input_proj(batch["observation.state"]).unsqueeze(
|
if self.use_robot_state:
|
||||||
1
|
robot_state_embed = self.vae_encoder_robot_state_input_proj(batch["observation.state"])
|
||||||
) # (B, 1, D)
|
robot_state_embed = robot_state_embed.unsqueeze(1) # (B, 1, D)
|
||||||
action_embed = self.vae_encoder_action_input_proj(batch["action"]) # (B, S, D)
|
action_embed = self.vae_encoder_action_input_proj(batch["action"]) # (B, S, D)
|
||||||
vae_encoder_input = torch.cat([cls_embed, robot_state_embed, action_embed], axis=1) # (B, S+2, D)
|
|
||||||
|
if self.use_robot_state:
|
||||||
|
vae_encoder_input = [cls_embed, robot_state_embed, action_embed] # (B, S+2, D)
|
||||||
|
else:
|
||||||
|
vae_encoder_input = [cls_embed, action_embed]
|
||||||
|
vae_encoder_input = torch.cat(vae_encoder_input, axis=1)
|
||||||
|
|
||||||
# Prepare fixed positional embedding.
|
# Prepare fixed positional embedding.
|
||||||
# Note: detach() shouldn't be necessary but leaving it the same as the original code just in case.
|
# Note: detach() shouldn't be necessary but leaving it the same as the original code just in case.
|
||||||
pos_embed = self.vae_encoder_pos_enc.clone().detach() # (1, S+2, D)
|
pos_embed = self.vae_encoder_pos_enc.clone().detach() # (1, S+2, D)
|
||||||
|
|
||||||
|
# Prepare key padding mask for the transformer encoder. We have 1 or 2 extra tokens at the start of the
|
||||||
|
# sequence depending whether we use the input states or not (cls and robot state)
|
||||||
|
# False means not a padding token.
|
||||||
|
cls_joint_is_pad = torch.full(
|
||||||
|
(batch_size, 2 if self.use_robot_state else 1),
|
||||||
|
False,
|
||||||
|
device=batch["observation.state"].device,
|
||||||
|
)
|
||||||
|
key_padding_mask = torch.cat(
|
||||||
|
[cls_joint_is_pad, batch["action_is_pad"]], axis=1
|
||||||
|
) # (bs, seq+1 or 2)
|
||||||
|
|
||||||
# Forward pass through VAE encoder to get the latent PDF parameters.
|
# Forward pass through VAE encoder to get the latent PDF parameters.
|
||||||
cls_token_out = self.vae_encoder(
|
cls_token_out = self.vae_encoder(
|
||||||
vae_encoder_input.permute(1, 0, 2), pos_embed=pos_embed.permute(1, 0, 2)
|
vae_encoder_input.permute(1, 0, 2),
|
||||||
|
pos_embed=pos_embed.permute(1, 0, 2),
|
||||||
|
key_padding_mask=key_padding_mask,
|
||||||
)[0] # select the class token, with shape (B, D)
|
)[0] # select the class token, with shape (B, D)
|
||||||
latent_pdf_params = self.vae_encoder_latent_output_proj(cls_token_out)
|
latent_pdf_params = self.vae_encoder_latent_output_proj(cls_token_out)
|
||||||
mu = latent_pdf_params[:, : self.latent_dim]
|
mu = latent_pdf_params[:, : self.config.latent_dim]
|
||||||
# This is 2log(sigma). Done this way to match the original implementation.
|
# This is 2log(sigma). Done this way to match the original implementation.
|
||||||
log_sigma_x2 = latent_pdf_params[:, self.latent_dim :]
|
log_sigma_x2 = latent_pdf_params[:, self.config.latent_dim :]
|
||||||
|
|
||||||
# Sample the latent with the reparameterization trick.
|
# Sample the latent with the reparameterization trick.
|
||||||
latent_sample = mu + log_sigma_x2.div(2).exp() * torch.randn_like(mu)
|
latent_sample = mu + log_sigma_x2.div(2).exp() * torch.randn_like(mu)
|
||||||
else:
|
else:
|
||||||
# When not using the VAE encoder, we set the latent to be all zeros.
|
# When not using the VAE encoder, we set the latent to be all zeros.
|
||||||
mu = log_sigma_x2 = None
|
mu = log_sigma_x2 = None
|
||||||
latent_sample = torch.zeros([batch_size, self.latent_dim], dtype=torch.float32).to(
|
# TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use buffer
|
||||||
|
latent_sample = torch.zeros([batch_size, self.config.latent_dim], dtype=torch.float32).to(
|
||||||
batch["observation.state"].device
|
batch["observation.state"].device
|
||||||
)
|
)
|
||||||
|
|
||||||
# Prepare all other transformer encoder inputs.
|
# Prepare transformer encoder inputs.
|
||||||
|
encoder_in_tokens = [self.encoder_latent_input_proj(latent_sample)]
|
||||||
|
encoder_in_pos_embed = list(self.encoder_1d_feature_pos_embed.weight.unsqueeze(1))
|
||||||
|
# Robot state token.
|
||||||
|
if self.use_robot_state:
|
||||||
|
encoder_in_tokens.append(self.encoder_robot_state_input_proj(batch["observation.state"]))
|
||||||
|
# Environment state token.
|
||||||
|
if self.use_env_state:
|
||||||
|
encoder_in_tokens.append(
|
||||||
|
self.encoder_env_state_input_proj(batch["observation.environment_state"])
|
||||||
|
)
|
||||||
|
|
||||||
# Camera observation features and positional embeddings.
|
# Camera observation features and positional embeddings.
|
||||||
all_cam_features = []
|
if self.use_images:
|
||||||
all_cam_pos_embeds = []
|
all_cam_features = []
|
||||||
images = batch["observation.images"]
|
all_cam_pos_embeds = []
|
||||||
for cam_index in range(images.shape[-4]):
|
|
||||||
cam_features = self.backbone(images[:, cam_index])["feature_map"]
|
|
||||||
cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(dtype=cam_features.dtype)
|
|
||||||
cam_features = self.encoder_img_feat_input_proj(cam_features) # (B, C, h, w)
|
|
||||||
all_cam_features.append(cam_features)
|
|
||||||
all_cam_pos_embeds.append(cam_pos_embed)
|
|
||||||
# Concatenate camera observation feature maps and positional embeddings along the width dimension.
|
|
||||||
encoder_in = torch.cat(all_cam_features, axis=-1)
|
|
||||||
cam_pos_embed = torch.cat(all_cam_pos_embeds, axis=-1)
|
|
||||||
|
|
||||||
# Get positional embeddings for robot state and latent.
|
for cam_index in range(batch["observation.images"].shape[-4]):
|
||||||
robot_state_embed = self.encoder_robot_state_input_proj(batch["observation.state"]) # (B, C)
|
cam_features = self.backbone(batch["observation.images"][:, cam_index])["feature_map"]
|
||||||
latent_embed = self.encoder_latent_input_proj(latent_sample) # (B, C)
|
# TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use
|
||||||
|
# buffer
|
||||||
|
cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(dtype=cam_features.dtype)
|
||||||
|
cam_features = self.encoder_img_feat_input_proj(cam_features) # (B, C, h, w)
|
||||||
|
all_cam_features.append(cam_features)
|
||||||
|
all_cam_pos_embeds.append(cam_pos_embed)
|
||||||
|
# Concatenate camera observation feature maps and positional embeddings along the width dimension,
|
||||||
|
# and move to (sequence, batch, dim).
|
||||||
|
all_cam_features = torch.cat(all_cam_features, axis=-1)
|
||||||
|
encoder_in_tokens.extend(einops.rearrange(all_cam_features, "b c h w -> (h w) b c"))
|
||||||
|
all_cam_pos_embeds = torch.cat(all_cam_pos_embeds, axis=-1)
|
||||||
|
encoder_in_pos_embed.extend(einops.rearrange(all_cam_pos_embeds, "b c h w -> (h w) b c"))
|
||||||
|
|
||||||
# Stack encoder input and positional embeddings moving to (S, B, C).
|
# Stack all tokens along the sequence dimension.
|
||||||
encoder_in = torch.cat(
|
encoder_in_tokens = torch.stack(encoder_in_tokens, axis=0)
|
||||||
[
|
encoder_in_pos_embed = torch.stack(encoder_in_pos_embed, axis=0)
|
||||||
torch.stack([latent_embed, robot_state_embed], axis=0),
|
|
||||||
einops.rearrange(encoder_in, "b c h w -> (h w) b c"),
|
|
||||||
]
|
|
||||||
)
|
|
||||||
pos_embed = torch.cat(
|
|
||||||
[
|
|
||||||
self.encoder_robot_and_latent_pos_embed.weight.unsqueeze(1),
|
|
||||||
cam_pos_embed.flatten(2).permute(2, 0, 1),
|
|
||||||
],
|
|
||||||
axis=0,
|
|
||||||
)
|
|
||||||
|
|
||||||
# Forward pass through the transformer modules.
|
# Forward pass through the transformer modules.
|
||||||
encoder_out = self.encoder(encoder_in, pos_embed=pos_embed)
|
encoder_out = self.encoder(encoder_in_tokens, pos_embed=encoder_in_pos_embed)
|
||||||
|
# TODO(rcadene, alexander-soare): remove call to `device` ; precompute and use buffer
|
||||||
decoder_in = torch.zeros(
|
decoder_in = torch.zeros(
|
||||||
(self.config.chunk_size, batch_size, self.config.dim_model),
|
(self.config.chunk_size, batch_size, self.config.dim_model),
|
||||||
dtype=pos_embed.dtype,
|
dtype=encoder_in_pos_embed.dtype,
|
||||||
device=pos_embed.device,
|
device=encoder_in_pos_embed.device,
|
||||||
)
|
)
|
||||||
decoder_out = self.decoder(
|
decoder_out = self.decoder(
|
||||||
decoder_in,
|
decoder_in,
|
||||||
encoder_out,
|
encoder_out,
|
||||||
encoder_pos_embed=pos_embed,
|
encoder_pos_embed=encoder_in_pos_embed,
|
||||||
decoder_pos_embed=self.decoder_pos_embed.weight.unsqueeze(1),
|
decoder_pos_embed=self.decoder_pos_embed.weight.unsqueeze(1),
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -380,14 +521,18 @@ class ACT(nn.Module):
|
|||||||
class ACTEncoder(nn.Module):
|
class ACTEncoder(nn.Module):
|
||||||
"""Convenience module for running multiple encoder layers, maybe followed by normalization."""
|
"""Convenience module for running multiple encoder layers, maybe followed by normalization."""
|
||||||
|
|
||||||
def __init__(self, config: ACTConfig):
|
def __init__(self, config: ACTConfig, is_vae_encoder: bool = False):
|
||||||
super().__init__()
|
super().__init__()
|
||||||
self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(config.n_encoder_layers)])
|
self.is_vae_encoder = is_vae_encoder
|
||||||
|
num_layers = config.n_vae_encoder_layers if self.is_vae_encoder else config.n_encoder_layers
|
||||||
|
self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(num_layers)])
|
||||||
self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
|
self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
|
||||||
|
|
||||||
def forward(self, x: Tensor, pos_embed: Tensor | None = None) -> Tensor:
|
def forward(
|
||||||
|
self, x: Tensor, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None
|
||||||
|
) -> Tensor:
|
||||||
for layer in self.layers:
|
for layer in self.layers:
|
||||||
x = layer(x, pos_embed=pos_embed)
|
x = layer(x, pos_embed=pos_embed, key_padding_mask=key_padding_mask)
|
||||||
x = self.norm(x)
|
x = self.norm(x)
|
||||||
return x
|
return x
|
||||||
|
|
||||||
@@ -410,12 +555,13 @@ class ACTEncoderLayer(nn.Module):
|
|||||||
self.activation = get_activation_fn(config.feedforward_activation)
|
self.activation = get_activation_fn(config.feedforward_activation)
|
||||||
self.pre_norm = config.pre_norm
|
self.pre_norm = config.pre_norm
|
||||||
|
|
||||||
def forward(self, x, pos_embed: Tensor | None = None) -> Tensor:
|
def forward(self, x, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None) -> Tensor:
|
||||||
skip = x
|
skip = x
|
||||||
if self.pre_norm:
|
if self.pre_norm:
|
||||||
x = self.norm1(x)
|
x = self.norm1(x)
|
||||||
q = k = x if pos_embed is None else x + pos_embed
|
q = k = x if pos_embed is None else x + pos_embed
|
||||||
x = self.self_attn(q, k, value=x)[0] # select just the output, not the attention weights
|
x = self.self_attn(q, k, value=x, key_padding_mask=key_padding_mask)
|
||||||
|
x = x[0] # note: [0] to select just the output, not the attention weights
|
||||||
x = skip + self.dropout1(x)
|
x = skip + self.dropout1(x)
|
||||||
if self.pre_norm:
|
if self.pre_norm:
|
||||||
skip = x
|
skip = x
|
||||||
|
|||||||
@@ -26,21 +26,31 @@ class DiffusionConfig:
|
|||||||
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||||
Those are: `input_shapes` and `output_shapes`.
|
Those are: `input_shapes` and `output_shapes`.
|
||||||
|
|
||||||
|
Notes on the inputs and outputs:
|
||||||
|
- "observation.state" is required as an input key.
|
||||||
|
- Either:
|
||||||
|
- At least one key starting with "observation.image is required as an input.
|
||||||
|
AND/OR
|
||||||
|
- The key "observation.environment_state" is required as input.
|
||||||
|
- If there are multiple keys beginning with "observation.image" they are treated as multiple camera
|
||||||
|
views. Right now we only support all images having the same shape.
|
||||||
|
- "action" is required as an output key.
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
||||||
current step and additional steps going back).
|
current step and additional steps going back).
|
||||||
horizon: Diffusion model action prediction size as detailed in `DiffusionPolicy.select_action`.
|
horizon: Diffusion model action prediction size as detailed in `DiffusionPolicy.select_action`.
|
||||||
n_action_steps: The number of action steps to run in the environment for one invocation of the policy.
|
n_action_steps: The number of action steps to run in the environment for one invocation of the policy.
|
||||||
See `DiffusionPolicy.select_action` for more details.
|
See `DiffusionPolicy.select_action` for more details.
|
||||||
input_shapes: A dictionary defining the shapes of the input data for the policy.
|
input_shapes: A dictionary defining the shapes of the input data for the policy. The key represents
|
||||||
The key represents the input data name, and the value is a list indicating the dimensions
|
the input data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||||
of the corresponding data. For example, "observation.image" refers to an input from
|
For example, "observation.image" refers to an input from a camera with dimensions [3, 96, 96],
|
||||||
a camera with dimensions [3, 96, 96], indicating it has three color channels and 96x96 resolution.
|
indicating it has three color channels and 96x96 resolution. Importantly, `input_shapes` doesn't
|
||||||
Importantly, shapes doesnt include batch dimension or temporal dimension.
|
include batch dimension or temporal dimension.
|
||||||
output_shapes: A dictionary defining the shapes of the output data for the policy.
|
output_shapes: A dictionary defining the shapes of the output data for the policy. The key represents
|
||||||
The key represents the output data name, and the value is a list indicating the dimensions
|
the output data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||||
of the corresponding data. For example, "action" refers to an output shape of [14], indicating
|
For example, "action" refers to an output shape of [14], indicating 14-dimensional actions.
|
||||||
14-dimensional actions. Importantly, shapes doesnt include batch dimension or temporal dimension.
|
Importantly, `output_shapes` doesn't include batch dimension or temporal dimension.
|
||||||
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||||
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||||
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||||
@@ -57,6 +67,7 @@ class DiffusionConfig:
|
|||||||
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
||||||
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
||||||
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
||||||
|
use_separate_rgb_encoders_per_camera: Whether to use a separate RGB encoder for each camera view.
|
||||||
down_dims: Feature dimension for each stage of temporal downsampling in the diffusion modeling Unet.
|
down_dims: Feature dimension for each stage of temporal downsampling in the diffusion modeling Unet.
|
||||||
You may provide a variable number of dimensions, therefore also controlling the degree of
|
You may provide a variable number of dimensions, therefore also controlling the degree of
|
||||||
downsampling.
|
downsampling.
|
||||||
@@ -120,6 +131,7 @@ class DiffusionConfig:
|
|||||||
pretrained_backbone_weights: str | None = None
|
pretrained_backbone_weights: str | None = None
|
||||||
use_group_norm: bool = True
|
use_group_norm: bool = True
|
||||||
spatial_softmax_num_keypoints: int = 32
|
spatial_softmax_num_keypoints: int = 32
|
||||||
|
use_separate_rgb_encoder_per_camera: bool = False
|
||||||
# Unet.
|
# Unet.
|
||||||
down_dims: tuple[int, ...] = (512, 1024, 2048)
|
down_dims: tuple[int, ...] = (512, 1024, 2048)
|
||||||
kernel_size: int = 5
|
kernel_size: int = 5
|
||||||
@@ -148,22 +160,33 @@ class DiffusionConfig:
|
|||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||||
)
|
)
|
||||||
# There should only be one image key.
|
|
||||||
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
||||||
if len(image_keys) != 1:
|
|
||||||
raise ValueError(
|
if len(image_keys) == 0 and "observation.environment_state" not in self.input_shapes:
|
||||||
f"{self.__class__.__name__} only handles one image for now. Got image keys {image_keys}."
|
raise ValueError("You must provide at least one image or the environment state among the inputs.")
|
||||||
)
|
|
||||||
image_key = next(iter(image_keys))
|
if len(image_keys) > 0:
|
||||||
if (
|
if self.crop_shape is not None:
|
||||||
self.crop_shape[0] > self.input_shapes[image_key][1]
|
for image_key in image_keys:
|
||||||
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
if (
|
||||||
):
|
self.crop_shape[0] > self.input_shapes[image_key][1]
|
||||||
raise ValueError(
|
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
||||||
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
):
|
||||||
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
raise ValueError(
|
||||||
"`input_shapes[{image_key}]`."
|
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
||||||
)
|
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
||||||
|
"`input_shapes[{image_key}]`."
|
||||||
|
)
|
||||||
|
# Check that all input images have the same shape.
|
||||||
|
first_image_key = next(iter(image_keys))
|
||||||
|
for image_key in image_keys:
|
||||||
|
if self.input_shapes[image_key] != self.input_shapes[first_image_key]:
|
||||||
|
raise ValueError(
|
||||||
|
f"`input_shapes[{image_key}]` does not match `input_shapes[{first_image_key}]`, but we "
|
||||||
|
"expect all image shapes to match."
|
||||||
|
)
|
||||||
|
|
||||||
supported_prediction_types = ["epsilon", "sample"]
|
supported_prediction_types = ["epsilon", "sample"]
|
||||||
if self.prediction_type not in supported_prediction_types:
|
if self.prediction_type not in supported_prediction_types:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
@@ -175,3 +198,12 @@ class DiffusionConfig:
|
|||||||
f"`noise_scheduler_type` must be one of {supported_noise_schedulers}. "
|
f"`noise_scheduler_type` must be one of {supported_noise_schedulers}. "
|
||||||
f"Got {self.noise_scheduler_type}."
|
f"Got {self.noise_scheduler_type}."
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# Check that the horizon size and U-Net downsampling is compatible.
|
||||||
|
# U-Net downsamples by 2 with each stage.
|
||||||
|
downsampling_factor = 2 ** len(self.down_dims)
|
||||||
|
if self.horizon % downsampling_factor != 0:
|
||||||
|
raise ValueError(
|
||||||
|
"The horizon should be an integer multiple of the downsampling factor (which is determined "
|
||||||
|
f"by `len(down_dims)`). Got {self.horizon=} and {self.down_dims=}"
|
||||||
|
)
|
||||||
|
|||||||
@@ -18,7 +18,6 @@
|
|||||||
|
|
||||||
TODO(alexander-soare):
|
TODO(alexander-soare):
|
||||||
- Remove reliance on diffusers for DDPMScheduler and LR scheduler.
|
- Remove reliance on diffusers for DDPMScheduler and LR scheduler.
|
||||||
- Make compatible with multiple image keys.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import math
|
import math
|
||||||
@@ -44,7 +43,13 @@ from lerobot.common.policies.utils import (
|
|||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
class DiffusionPolicy(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "diffusion-policy"],
|
||||||
|
):
|
||||||
"""
|
"""
|
||||||
Diffusion Policy as per "Diffusion Policy: Visuomotor Policy Learning via Action Diffusion"
|
Diffusion Policy as per "Diffusion Policy: Visuomotor Policy Learning via Action Diffusion"
|
||||||
(paper: https://arxiv.org/abs/2303.04137, code: https://github.com/real-stanford/diffusion_policy).
|
(paper: https://arxiv.org/abs/2303.04137, code: https://github.com/real-stanford/diffusion_policy).
|
||||||
@@ -83,23 +88,21 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
|
|
||||||
self.diffusion = DiffusionModel(config)
|
self.diffusion = DiffusionModel(config)
|
||||||
|
|
||||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||||
# Note: This check is covered in the post-init of the config but have a sanity check just in case.
|
self.use_env_state = "observation.environment_state" in config.input_shapes
|
||||||
if len(image_keys) != 1:
|
|
||||||
raise NotImplementedError(
|
|
||||||
f"{self.__class__.__name__} only handles one image for now. Got image keys {image_keys}."
|
|
||||||
)
|
|
||||||
self.input_image_key = image_keys[0]
|
|
||||||
|
|
||||||
self.reset()
|
self.reset()
|
||||||
|
|
||||||
def reset(self):
|
def reset(self):
|
||||||
"""Clear observation and action queues. Should be called on `env.reset()`"""
|
"""Clear observation and action queues. Should be called on `env.reset()`"""
|
||||||
self._queues = {
|
self._queues = {
|
||||||
"observation.image": deque(maxlen=self.config.n_obs_steps),
|
|
||||||
"observation.state": deque(maxlen=self.config.n_obs_steps),
|
"observation.state": deque(maxlen=self.config.n_obs_steps),
|
||||||
"action": deque(maxlen=self.config.n_action_steps),
|
"action": deque(maxlen=self.config.n_action_steps),
|
||||||
}
|
}
|
||||||
|
if len(self.expected_image_keys) > 0:
|
||||||
|
self._queues["observation.images"] = deque(maxlen=self.config.n_obs_steps)
|
||||||
|
if self.use_env_state:
|
||||||
|
self._queues["observation.environment_state"] = deque(maxlen=self.config.n_obs_steps)
|
||||||
|
|
||||||
@torch.no_grad
|
@torch.no_grad
|
||||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
@@ -114,18 +117,20 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
Schematically this looks like:
|
Schematically this looks like:
|
||||||
----------------------------------------------------------------------------------------------
|
----------------------------------------------------------------------------------------------
|
||||||
(legend: o = n_obs_steps, h = horizon, a = n_action_steps)
|
(legend: o = n_obs_steps, h = horizon, a = n_action_steps)
|
||||||
|timestep | n-o+1 | n-o+2 | ..... | n | ..... | n+a-1 | n+a | ..... |n-o+1+h|
|
|timestep | n-o+1 | n-o+2 | ..... | n | ..... | n+a-1 | n+a | ..... | n-o+h |
|
||||||
|observation is used | YES | YES | YES | NO | NO | NO | NO | NO | NO |
|
|observation is used | YES | YES | YES | YES | NO | NO | NO | NO | NO |
|
||||||
|action is generated | YES | YES | YES | YES | YES | YES | YES | YES | YES |
|
|action is generated | YES | YES | YES | YES | YES | YES | YES | YES | YES |
|
||||||
|action is used | NO | NO | NO | YES | YES | YES | NO | NO | NO |
|
|action is used | NO | NO | NO | YES | YES | YES | NO | NO | NO |
|
||||||
----------------------------------------------------------------------------------------------
|
----------------------------------------------------------------------------------------------
|
||||||
Note that this means we require: `n_action_steps < horizon - n_obs_steps + 1`. Also, note that
|
Note that this means we require: `n_action_steps <= horizon - n_obs_steps + 1`. Also, note that
|
||||||
"horizon" may not the best name to describe what the variable actually means, because this period is
|
"horizon" may not the best name to describe what the variable actually means, because this period is
|
||||||
actually measured from the first observation which (if `n_obs_steps` > 1) happened in the past.
|
actually measured from the first observation which (if `n_obs_steps` > 1) happened in the past.
|
||||||
"""
|
"""
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
batch["observation.image"] = batch[self.input_image_key]
|
if len(self.expected_image_keys) > 0:
|
||||||
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
|
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||||
|
# Note: It's important that this happens after stacking the images into a single key.
|
||||||
self._queues = populate_queues(self._queues, batch)
|
self._queues = populate_queues(self._queues, batch)
|
||||||
|
|
||||||
if len(self._queues["action"]) == 0:
|
if len(self._queues["action"]) == 0:
|
||||||
@@ -144,7 +149,9 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||||
"""Run the batch through the model and compute the loss for training or validation."""
|
"""Run the batch through the model and compute the loss for training or validation."""
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
batch["observation.image"] = batch[self.input_image_key]
|
if len(self.expected_image_keys) > 0:
|
||||||
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
|
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||||
batch = self.normalize_targets(batch)
|
batch = self.normalize_targets(batch)
|
||||||
loss = self.diffusion.compute_loss(batch)
|
loss = self.diffusion.compute_loss(batch)
|
||||||
return {"loss": loss}
|
return {"loss": loss}
|
||||||
@@ -168,12 +175,25 @@ class DiffusionModel(nn.Module):
|
|||||||
super().__init__()
|
super().__init__()
|
||||||
self.config = config
|
self.config = config
|
||||||
|
|
||||||
self.rgb_encoder = DiffusionRgbEncoder(config)
|
# Build observation encoders (depending on which observations are provided).
|
||||||
self.unet = DiffusionConditionalUnet1d(
|
global_cond_dim = config.input_shapes["observation.state"][0]
|
||||||
config,
|
num_images = len([k for k in config.input_shapes if k.startswith("observation.image")])
|
||||||
global_cond_dim=(config.output_shapes["action"][0] + self.rgb_encoder.feature_dim)
|
self._use_images = False
|
||||||
* config.n_obs_steps,
|
self._use_env_state = False
|
||||||
)
|
if num_images > 0:
|
||||||
|
self._use_images = True
|
||||||
|
if self.config.use_separate_rgb_encoder_per_camera:
|
||||||
|
encoders = [DiffusionRgbEncoder(config) for _ in range(num_images)]
|
||||||
|
self.rgb_encoder = nn.ModuleList(encoders)
|
||||||
|
global_cond_dim += encoders[0].feature_dim * num_images
|
||||||
|
else:
|
||||||
|
self.rgb_encoder = DiffusionRgbEncoder(config)
|
||||||
|
global_cond_dim += self.rgb_encoder.feature_dim * num_images
|
||||||
|
if "observation.environment_state" in config.input_shapes:
|
||||||
|
self._use_env_state = True
|
||||||
|
global_cond_dim += config.input_shapes["observation.environment_state"][0]
|
||||||
|
|
||||||
|
self.unet = DiffusionConditionalUnet1d(config, global_cond_dim=global_cond_dim * config.n_obs_steps)
|
||||||
|
|
||||||
self.noise_scheduler = _make_noise_scheduler(
|
self.noise_scheduler = _make_noise_scheduler(
|
||||||
config.noise_scheduler_type,
|
config.noise_scheduler_type,
|
||||||
@@ -220,29 +240,64 @@ class DiffusionModel(nn.Module):
|
|||||||
|
|
||||||
return sample
|
return sample
|
||||||
|
|
||||||
|
def _prepare_global_conditioning(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
|
"""Encode image features and concatenate them all together along with the state vector."""
|
||||||
|
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||||
|
global_cond_feats = [batch["observation.state"]]
|
||||||
|
# Extract image features.
|
||||||
|
if self._use_images:
|
||||||
|
if self.config.use_separate_rgb_encoder_per_camera:
|
||||||
|
# Combine batch and sequence dims while rearranging to make the camera index dimension first.
|
||||||
|
images_per_camera = einops.rearrange(batch["observation.images"], "b s n ... -> n (b s) ...")
|
||||||
|
img_features_list = torch.cat(
|
||||||
|
[
|
||||||
|
encoder(images)
|
||||||
|
for encoder, images in zip(self.rgb_encoder, images_per_camera, strict=True)
|
||||||
|
]
|
||||||
|
)
|
||||||
|
# Separate batch and sequence dims back out. The camera index dim gets absorbed into the
|
||||||
|
# feature dim (effectively concatenating the camera features).
|
||||||
|
img_features = einops.rearrange(
|
||||||
|
img_features_list, "(n b s) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
# Combine batch, sequence, and "which camera" dims before passing to shared encoder.
|
||||||
|
img_features = self.rgb_encoder(
|
||||||
|
einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
|
||||||
|
)
|
||||||
|
# Separate batch dim and sequence dim back out. The camera index dim gets absorbed into the
|
||||||
|
# feature dim (effectively concatenating the camera features).
|
||||||
|
img_features = einops.rearrange(
|
||||||
|
img_features, "(b s n) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
|
||||||
|
)
|
||||||
|
global_cond_feats.append(img_features)
|
||||||
|
|
||||||
|
if self._use_env_state:
|
||||||
|
global_cond_feats.append(batch["observation.environment_state"])
|
||||||
|
|
||||||
|
# Concatenate features then flatten to (B, global_cond_dim).
|
||||||
|
return torch.cat(global_cond_feats, dim=-1).flatten(start_dim=1)
|
||||||
|
|
||||||
def generate_actions(self, batch: dict[str, Tensor]) -> Tensor:
|
def generate_actions(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
"""
|
"""
|
||||||
This function expects `batch` to have:
|
This function expects `batch` to have:
|
||||||
{
|
{
|
||||||
"observation.state": (B, n_obs_steps, state_dim)
|
"observation.state": (B, n_obs_steps, state_dim)
|
||||||
"observation.image": (B, n_obs_steps, C, H, W)
|
|
||||||
|
"observation.images": (B, n_obs_steps, num_cameras, C, H, W)
|
||||||
|
AND/OR
|
||||||
|
"observation.environment_state": (B, environment_dim)
|
||||||
}
|
}
|
||||||
"""
|
"""
|
||||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||||
assert n_obs_steps == self.config.n_obs_steps
|
assert n_obs_steps == self.config.n_obs_steps
|
||||||
|
|
||||||
# Extract image feature (first combine batch and sequence dims).
|
# Encode image features and concatenate them all together along with the state vector.
|
||||||
img_features = self.rgb_encoder(einops.rearrange(batch["observation.image"], "b n ... -> (b n) ..."))
|
global_cond = self._prepare_global_conditioning(batch) # (B, global_cond_dim)
|
||||||
# Separate batch and sequence dims.
|
|
||||||
img_features = einops.rearrange(img_features, "(b n) ... -> b n ...", b=batch_size)
|
|
||||||
# Concatenate state and image features then flatten to (B, global_cond_dim).
|
|
||||||
global_cond = torch.cat([batch["observation.state"], img_features], dim=-1).flatten(start_dim=1)
|
|
||||||
|
|
||||||
# run sampling
|
# run sampling
|
||||||
sample = self.conditional_sample(batch_size, global_cond=global_cond)
|
actions = self.conditional_sample(batch_size, global_cond=global_cond)
|
||||||
|
|
||||||
# `horizon` steps worth of actions (from the first observation).
|
|
||||||
actions = sample[..., : self.config.output_shapes["action"][0]]
|
|
||||||
# Extract `n_action_steps` steps worth of actions (from the current observation).
|
# Extract `n_action_steps` steps worth of actions (from the current observation).
|
||||||
start = n_obs_steps - 1
|
start = n_obs_steps - 1
|
||||||
end = start + self.config.n_action_steps
|
end = start + self.config.n_action_steps
|
||||||
@@ -255,28 +310,28 @@ class DiffusionModel(nn.Module):
|
|||||||
This function expects `batch` to have (at least):
|
This function expects `batch` to have (at least):
|
||||||
{
|
{
|
||||||
"observation.state": (B, n_obs_steps, state_dim)
|
"observation.state": (B, n_obs_steps, state_dim)
|
||||||
"observation.image": (B, n_obs_steps, C, H, W)
|
|
||||||
|
"observation.images": (B, n_obs_steps, num_cameras, C, H, W)
|
||||||
|
AND/OR
|
||||||
|
"observation.environment_state": (B, environment_dim)
|
||||||
|
|
||||||
"action": (B, horizon, action_dim)
|
"action": (B, horizon, action_dim)
|
||||||
"action_is_pad": (B, horizon)
|
"action_is_pad": (B, horizon)
|
||||||
}
|
}
|
||||||
"""
|
"""
|
||||||
# Input validation.
|
# Input validation.
|
||||||
assert set(batch).issuperset({"observation.state", "observation.image", "action", "action_is_pad"})
|
assert set(batch).issuperset({"observation.state", "action", "action_is_pad"})
|
||||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
assert "observation.images" in batch or "observation.environment_state" in batch
|
||||||
|
n_obs_steps = batch["observation.state"].shape[1]
|
||||||
horizon = batch["action"].shape[1]
|
horizon = batch["action"].shape[1]
|
||||||
assert horizon == self.config.horizon
|
assert horizon == self.config.horizon
|
||||||
assert n_obs_steps == self.config.n_obs_steps
|
assert n_obs_steps == self.config.n_obs_steps
|
||||||
|
|
||||||
# Extract image feature (first combine batch and sequence dims).
|
# Encode image features and concatenate them all together along with the state vector.
|
||||||
img_features = self.rgb_encoder(einops.rearrange(batch["observation.image"], "b n ... -> (b n) ..."))
|
global_cond = self._prepare_global_conditioning(batch) # (B, global_cond_dim)
|
||||||
# Separate batch and sequence dims.
|
|
||||||
img_features = einops.rearrange(img_features, "(b n) ... -> b n ...", b=batch_size)
|
|
||||||
# Concatenate state and image features then flatten to (B, global_cond_dim).
|
|
||||||
global_cond = torch.cat([batch["observation.state"], img_features], dim=-1).flatten(start_dim=1)
|
|
||||||
|
|
||||||
trajectory = batch["action"]
|
|
||||||
|
|
||||||
# Forward diffusion.
|
# Forward diffusion.
|
||||||
|
trajectory = batch["action"]
|
||||||
# Sample noise to add to the trajectory.
|
# Sample noise to add to the trajectory.
|
||||||
eps = torch.randn(trajectory.shape, device=trajectory.device)
|
eps = torch.randn(trajectory.shape, device=trajectory.device)
|
||||||
# Sample a random noising timestep for each item in the batch.
|
# Sample a random noising timestep for each item in the batch.
|
||||||
@@ -304,7 +359,12 @@ class DiffusionModel(nn.Module):
|
|||||||
loss = F.mse_loss(pred, target, reduction="none")
|
loss = F.mse_loss(pred, target, reduction="none")
|
||||||
|
|
||||||
# Mask loss wherever the action is padded with copies (edges of the dataset trajectory).
|
# Mask loss wherever the action is padded with copies (edges of the dataset trajectory).
|
||||||
if self.config.do_mask_loss_for_padding and "action_is_pad" in batch:
|
if self.config.do_mask_loss_for_padding:
|
||||||
|
if "action_is_pad" not in batch:
|
||||||
|
raise ValueError(
|
||||||
|
"You need to provide 'action_is_pad' in the batch when "
|
||||||
|
f"{self.config.do_mask_loss_for_padding=}."
|
||||||
|
)
|
||||||
in_episode_bound = ~batch["action_is_pad"]
|
in_episode_bound = ~batch["action_is_pad"]
|
||||||
loss = loss * in_episode_bound.unsqueeze(-1)
|
loss = loss * in_episode_bound.unsqueeze(-1)
|
||||||
|
|
||||||
@@ -423,11 +483,15 @@ class DiffusionRgbEncoder(nn.Module):
|
|||||||
# Set up pooling and final layers.
|
# Set up pooling and final layers.
|
||||||
# Use a dry run to get the feature map shape.
|
# Use a dry run to get the feature map shape.
|
||||||
# The dummy input should take the number of image channels from `config.input_shapes` and it should
|
# The dummy input should take the number of image channels from `config.input_shapes` and it should
|
||||||
# use the height and width from `config.crop_shape`.
|
# use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
|
||||||
|
# height and width from `config.input_shapes`.
|
||||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||||
assert len(image_keys) == 1
|
# Note: we have a check in the config class to make sure all images have the same shape.
|
||||||
image_key = image_keys[0]
|
image_key = image_keys[0]
|
||||||
dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *config.crop_shape))
|
dummy_input_h_w = (
|
||||||
|
config.crop_shape if config.crop_shape is not None else config.input_shapes[image_key][1:]
|
||||||
|
)
|
||||||
|
dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *dummy_input_h_w))
|
||||||
with torch.inference_mode():
|
with torch.inference_mode():
|
||||||
dummy_feature_map = self.backbone(dummy_input)
|
dummy_feature_map = self.backbone(dummy_input)
|
||||||
feature_map_shape = tuple(dummy_feature_map.shape[1:])
|
feature_map_shape = tuple(dummy_feature_map.shape[1:])
|
||||||
|
|||||||
@@ -28,9 +28,15 @@ def _policy_cfg_from_hydra_cfg(policy_cfg_class, hydra_cfg):
|
|||||||
logging.warning(
|
logging.warning(
|
||||||
f"Hydra config is missing arguments: {set(expected_kwargs).difference(hydra_cfg.policy)}"
|
f"Hydra config is missing arguments: {set(expected_kwargs).difference(hydra_cfg.policy)}"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# OmegaConf.to_container returns lists where sequences are found, but our dataclasses use tuples to avoid
|
||||||
|
# issues with mutable defaults. This filter changes all lists to tuples.
|
||||||
|
def list_to_tuple(item):
|
||||||
|
return tuple(item) if isinstance(item, list) else item
|
||||||
|
|
||||||
policy_cfg = policy_cfg_class(
|
policy_cfg = policy_cfg_class(
|
||||||
**{
|
**{
|
||||||
k: v
|
k: list_to_tuple(v)
|
||||||
for k, v in OmegaConf.to_container(hydra_cfg.policy, resolve=True).items()
|
for k, v in OmegaConf.to_container(hydra_cfg.policy, resolve=True).items()
|
||||||
if k in expected_kwargs
|
if k in expected_kwargs
|
||||||
}
|
}
|
||||||
@@ -55,6 +61,11 @@ def get_policy_and_config_classes(name: str) -> tuple[Policy, object]:
|
|||||||
from lerobot.common.policies.act.modeling_act import ACTPolicy
|
from lerobot.common.policies.act.modeling_act import ACTPolicy
|
||||||
|
|
||||||
return ACTPolicy, ACTConfig
|
return ACTPolicy, ACTConfig
|
||||||
|
elif name == "vqbet":
|
||||||
|
from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
|
||||||
|
from lerobot.common.policies.vqbet.modeling_vqbet import VQBeTPolicy
|
||||||
|
|
||||||
|
return VQBeTPolicy, VQBeTConfig
|
||||||
else:
|
else:
|
||||||
raise NotImplementedError(f"Policy with name {name} is not implemented.")
|
raise NotImplementedError(f"Policy with name {name} is not implemented.")
|
||||||
|
|
||||||
@@ -75,7 +86,9 @@ def make_policy(
|
|||||||
policy. Therefore, this argument is mutually exclusive with `pretrained_policy_name_or_path`.
|
policy. Therefore, this argument is mutually exclusive with `pretrained_policy_name_or_path`.
|
||||||
"""
|
"""
|
||||||
if not (pretrained_policy_name_or_path is None) ^ (dataset_stats is None):
|
if not (pretrained_policy_name_or_path is None) ^ (dataset_stats is None):
|
||||||
raise ValueError("Only one of `pretrained_policy_name_or_path` and `dataset_stats` may be provided.")
|
raise ValueError(
|
||||||
|
"Exactly one of `pretrained_policy_name_or_path` and `dataset_stats` must be provided."
|
||||||
|
)
|
||||||
|
|
||||||
policy_cls, policy_cfg_class = get_policy_and_config_classes(hydra_cfg.policy.name)
|
policy_cls, policy_cfg_class = get_policy_and_config_classes(hydra_cfg.policy.name)
|
||||||
|
|
||||||
@@ -86,9 +99,10 @@ def make_policy(
|
|||||||
else:
|
else:
|
||||||
# Load a pretrained policy and override the config if needed (for example, if there are inference-time
|
# Load a pretrained policy and override the config if needed (for example, if there are inference-time
|
||||||
# hyperparameters that we want to vary).
|
# hyperparameters that we want to vary).
|
||||||
# TODO(alexander-soare): This hack makes use of huggingface_hub's tooling to load the policy with, pretrained
|
# TODO(alexander-soare): This hack makes use of huggingface_hub's tooling to load the policy with,
|
||||||
# weights which are then loaded into a fresh policy with the desired config. This PR in huggingface_hub should
|
# pretrained weights which are then loaded into a fresh policy with the desired config. This PR in
|
||||||
# make it possible to avoid the hack: https://github.com/huggingface/huggingface_hub/pull/2274.
|
# huggingface_hub should make it possible to avoid the hack:
|
||||||
|
# https://github.com/huggingface/huggingface_hub/pull/2274.
|
||||||
policy = policy_cls(policy_cfg)
|
policy = policy_cls(policy_cfg)
|
||||||
policy.load_state_dict(policy_cls.from_pretrained(pretrained_policy_name_or_path).state_dict())
|
policy.load_state_dict(policy_cls.from_pretrained(pretrained_policy_name_or_path).state_dict())
|
||||||
|
|
||||||
|
|||||||
@@ -0,0 +1,36 @@
|
|||||||
|
import json
|
||||||
|
import os
|
||||||
|
from dataclasses import asdict, dataclass
|
||||||
|
|
||||||
|
import torch
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class ClassifierConfig:
|
||||||
|
"""Configuration for the Classifier model."""
|
||||||
|
|
||||||
|
num_classes: int = 2
|
||||||
|
hidden_dim: int = 256
|
||||||
|
dropout_rate: float = 0.1
|
||||||
|
model_name: str = "microsoft/resnet-50"
|
||||||
|
device: str = "cuda" if torch.cuda.is_available() else "mps"
|
||||||
|
model_type: str = "cnn" # "transformer" or "cnn"
|
||||||
|
|
||||||
|
def save_pretrained(self, save_dir):
|
||||||
|
"""Save config to json file."""
|
||||||
|
os.makedirs(save_dir, exist_ok=True)
|
||||||
|
|
||||||
|
# Convert to dict and save as JSON
|
||||||
|
config_dict = asdict(self)
|
||||||
|
with open(os.path.join(save_dir, "config.json"), "w") as f:
|
||||||
|
json.dump(config_dict, f, indent=2)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def from_pretrained(cls, pretrained_model_name_or_path):
|
||||||
|
"""Load config from json file."""
|
||||||
|
config_file = os.path.join(pretrained_model_name_or_path, "config.json")
|
||||||
|
|
||||||
|
with open(config_file) as f:
|
||||||
|
config_dict = json.load(f)
|
||||||
|
|
||||||
|
return cls(**config_dict)
|
||||||
@@ -0,0 +1,134 @@
|
|||||||
|
import logging
|
||||||
|
from typing import Optional
|
||||||
|
|
||||||
|
import torch
|
||||||
|
from huggingface_hub import PyTorchModelHubMixin
|
||||||
|
from torch import Tensor, nn
|
||||||
|
from transformers import AutoImageProcessor, AutoModel
|
||||||
|
|
||||||
|
from .configuration_classifier import ClassifierConfig
|
||||||
|
|
||||||
|
logging.basicConfig(level=logging.INFO, format="%(asctime)s - %(name)s - %(levelname)s - %(message)s")
|
||||||
|
logger = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class ClassifierOutput:
|
||||||
|
"""Wrapper for classifier outputs with additional metadata."""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self, logits: Tensor, probabilities: Optional[Tensor] = None, hidden_states: Optional[Tensor] = None
|
||||||
|
):
|
||||||
|
self.logits = logits
|
||||||
|
self.probabilities = probabilities
|
||||||
|
self.hidden_states = hidden_states
|
||||||
|
|
||||||
|
|
||||||
|
class Classifier(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
# Add Hub metadata
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "vision-classifier"],
|
||||||
|
):
|
||||||
|
"""Image classifier built on top of a pre-trained encoder."""
|
||||||
|
|
||||||
|
# Add name attribute for factory
|
||||||
|
name = "classifier"
|
||||||
|
|
||||||
|
def __init__(self, config: ClassifierConfig):
|
||||||
|
super().__init__()
|
||||||
|
self.config = config
|
||||||
|
self.processor = AutoImageProcessor.from_pretrained(self.config.model_name, trust_remote_code=True)
|
||||||
|
encoder = AutoModel.from_pretrained(self.config.model_name, trust_remote_code=True)
|
||||||
|
# Extract vision model if we're given a multimodal model
|
||||||
|
if hasattr(encoder, "vision_model"):
|
||||||
|
logging.info("Multimodal model detected - using vision encoder only")
|
||||||
|
self.encoder = encoder.vision_model
|
||||||
|
self.vision_config = encoder.config.vision_config
|
||||||
|
else:
|
||||||
|
self.encoder = encoder
|
||||||
|
self.vision_config = getattr(encoder, "config", None)
|
||||||
|
|
||||||
|
# Model type from config
|
||||||
|
self.is_cnn = self.config.model_type == "cnn"
|
||||||
|
|
||||||
|
# For CNNs, initialize backbone
|
||||||
|
if self.is_cnn:
|
||||||
|
self._setup_cnn_backbone()
|
||||||
|
|
||||||
|
self._freeze_encoder()
|
||||||
|
self._build_classifier_head()
|
||||||
|
|
||||||
|
def _setup_cnn_backbone(self):
|
||||||
|
"""Set up CNN encoder"""
|
||||||
|
if hasattr(self.encoder, "fc"):
|
||||||
|
self.feature_dim = self.encoder.fc.in_features
|
||||||
|
self.encoder = nn.Sequential(*list(self.encoder.children())[:-1])
|
||||||
|
elif hasattr(self.encoder.config, "hidden_sizes"):
|
||||||
|
self.feature_dim = self.encoder.config.hidden_sizes[-1] # Last channel dimension
|
||||||
|
else:
|
||||||
|
raise ValueError("Unsupported CNN architecture")
|
||||||
|
|
||||||
|
def _freeze_encoder(self) -> None:
|
||||||
|
"""Freeze the encoder parameters."""
|
||||||
|
for param in self.encoder.parameters():
|
||||||
|
param.requires_grad = False
|
||||||
|
|
||||||
|
def _build_classifier_head(self) -> None:
|
||||||
|
"""Initialize the classifier head architecture."""
|
||||||
|
# Get input dimension based on model type
|
||||||
|
if self.is_cnn:
|
||||||
|
input_dim = self.feature_dim
|
||||||
|
else: # Transformer models
|
||||||
|
if hasattr(self.encoder.config, "hidden_size"):
|
||||||
|
input_dim = self.encoder.config.hidden_size
|
||||||
|
else:
|
||||||
|
raise ValueError("Unsupported transformer architecture since hidden_size is not found")
|
||||||
|
|
||||||
|
self.classifier_head = nn.Sequential(
|
||||||
|
nn.Linear(input_dim, self.config.hidden_dim),
|
||||||
|
nn.Dropout(self.config.dropout_rate),
|
||||||
|
nn.LayerNorm(self.config.hidden_dim),
|
||||||
|
nn.ReLU(),
|
||||||
|
nn.Linear(self.config.hidden_dim, 1 if self.config.num_classes == 2 else self.config.num_classes),
|
||||||
|
)
|
||||||
|
|
||||||
|
def _get_encoder_output(self, x: torch.Tensor) -> torch.Tensor:
|
||||||
|
"""Extract the appropriate output from the encoder."""
|
||||||
|
# Process images with the processor (handles resizing and normalization)
|
||||||
|
processed = self.processor(
|
||||||
|
images=x, # LeRobotDataset already provides proper tensor format
|
||||||
|
return_tensors="pt",
|
||||||
|
)
|
||||||
|
processed = processed["pixel_values"].to(x.device)
|
||||||
|
|
||||||
|
with torch.no_grad():
|
||||||
|
if self.is_cnn:
|
||||||
|
# The HF ResNet applies pooling internally
|
||||||
|
outputs = self.encoder(processed)
|
||||||
|
# Get pooled output directly
|
||||||
|
features = outputs.pooler_output
|
||||||
|
|
||||||
|
if features.dim() > 2:
|
||||||
|
features = features.squeeze(-1).squeeze(-1)
|
||||||
|
return features
|
||||||
|
else: # Transformer models
|
||||||
|
outputs = self.encoder(processed)
|
||||||
|
if hasattr(outputs, "pooler_output") and outputs.pooler_output is not None:
|
||||||
|
return outputs.pooler_output
|
||||||
|
return outputs.last_hidden_state[:, 0, :]
|
||||||
|
|
||||||
|
def forward(self, x: torch.Tensor) -> ClassifierOutput:
|
||||||
|
"""Forward pass of the classifier."""
|
||||||
|
# For training, we expect input to be a tensor directly from LeRobotDataset
|
||||||
|
encoder_output = self._get_encoder_output(x)
|
||||||
|
logits = self.classifier_head(encoder_output)
|
||||||
|
|
||||||
|
if self.config.num_classes == 2:
|
||||||
|
logits = logits.squeeze(-1)
|
||||||
|
probabilities = torch.sigmoid(logits)
|
||||||
|
else:
|
||||||
|
probabilities = torch.softmax(logits, dim=-1)
|
||||||
|
|
||||||
|
return ClassifierOutput(logits=logits, probabilities=probabilities, hidden_states=encoder_output)
|
||||||
23
lerobot/common/policies/hilserl/configuration_hilserl.py
Normal file
23
lerobot/common/policies/hilserl/configuration_hilserl.py
Normal file
@@ -0,0 +1,23 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team.
|
||||||
|
# All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from dataclasses import dataclass
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class HILSerlConfig:
|
||||||
|
pass
|
||||||
29
lerobot/common/policies/hilserl/modeling_hilserl.py
Normal file
29
lerobot/common/policies/hilserl/modeling_hilserl.py
Normal file
@@ -0,0 +1,29 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team.
|
||||||
|
# All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import torch.nn as nn
|
||||||
|
from huggingface_hub import PyTorchModelHubMixin
|
||||||
|
|
||||||
|
|
||||||
|
class HILSerlPolicy(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "hilserl"],
|
||||||
|
):
|
||||||
|
pass
|
||||||
@@ -132,6 +132,7 @@ class Normalize(nn.Module):
|
|||||||
# TODO(rcadene): should we remove torch.no_grad?
|
# TODO(rcadene): should we remove torch.no_grad?
|
||||||
@torch.no_grad
|
@torch.no_grad
|
||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||||
|
batch = dict(batch) # shallow copy avoids mutating the input batch
|
||||||
for key, mode in self.modes.items():
|
for key, mode in self.modes.items():
|
||||||
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
||||||
|
|
||||||
@@ -147,7 +148,7 @@ class Normalize(nn.Module):
|
|||||||
assert not torch.isinf(min).any(), _no_stats_error_str("min")
|
assert not torch.isinf(min).any(), _no_stats_error_str("min")
|
||||||
assert not torch.isinf(max).any(), _no_stats_error_str("max")
|
assert not torch.isinf(max).any(), _no_stats_error_str("max")
|
||||||
# normalize to [0,1]
|
# normalize to [0,1]
|
||||||
batch[key] = (batch[key] - min) / (max - min)
|
batch[key] = (batch[key] - min) / (max - min + 1e-8)
|
||||||
# normalize to [-1, 1]
|
# normalize to [-1, 1]
|
||||||
batch[key] = batch[key] * 2 - 1
|
batch[key] = batch[key] * 2 - 1
|
||||||
else:
|
else:
|
||||||
@@ -197,6 +198,7 @@ class Unnormalize(nn.Module):
|
|||||||
# TODO(rcadene): should we remove torch.no_grad?
|
# TODO(rcadene): should we remove torch.no_grad?
|
||||||
@torch.no_grad
|
@torch.no_grad
|
||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||||
|
batch = dict(batch) # shallow copy avoids mutating the input batch
|
||||||
for key, mode in self.modes.items():
|
for key, mode in self.modes.items():
|
||||||
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
buffer = getattr(self, "buffer_" + key.replace(".", "_"))
|
||||||
|
|
||||||
|
|||||||
@@ -57,7 +57,7 @@ class Policy(Protocol):
|
|||||||
other items should be logging-friendly, native Python types.
|
other items should be logging-friendly, native Python types.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def select_action(self, batch: dict[str, Tensor]):
|
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
"""Return one action to run in the environment (potentially in batch mode).
|
"""Return one action to run in the environment (potentially in batch mode).
|
||||||
|
|
||||||
When the model uses a history of observations, or outputs a sequence of actions, this method deals
|
When the model uses a history of observations, or outputs a sequence of actions, this method deals
|
||||||
|
|||||||
39
lerobot/common/policies/sac/configuration_sac.py
Normal file
39
lerobot/common/policies/sac/configuration_sac.py
Normal file
@@ -0,0 +1,39 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team.
|
||||||
|
# All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from dataclasses import dataclass
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class SACConfig:
|
||||||
|
discount = 0.99
|
||||||
|
temperature_init = 1.0
|
||||||
|
num_critics = 2
|
||||||
|
critic_lr = 3e-4
|
||||||
|
actor_lr = 3e-4
|
||||||
|
critic_network_kwargs = {
|
||||||
|
"hidden_dims": [256, 256],
|
||||||
|
"activate_final": True,
|
||||||
|
}
|
||||||
|
actor_network_kwargs = {
|
||||||
|
"hidden_dims": [256, 256],
|
||||||
|
"activate_final": True,
|
||||||
|
}
|
||||||
|
policy_kwargs = {
|
||||||
|
"tanh_squash_distribution": True,
|
||||||
|
"std_parameterization": "uniform",
|
||||||
|
}
|
||||||
683
lerobot/common/policies/sac/modeling_sac.py
Normal file
683
lerobot/common/policies/sac/modeling_sac.py
Normal file
@@ -0,0 +1,683 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 The HuggingFace Inc. team.
|
||||||
|
# All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
# TODO: (1) better device management
|
||||||
|
|
||||||
|
from collections import deque
|
||||||
|
from copy import deepcopy
|
||||||
|
from functools import partial
|
||||||
|
|
||||||
|
import einops
|
||||||
|
|
||||||
|
import torch
|
||||||
|
import torch.nn as nn
|
||||||
|
import torch.nn.functional as F # noqa: N812
|
||||||
|
from torch import Tensor
|
||||||
|
|
||||||
|
from huggingface_hub import PyTorchModelHubMixin
|
||||||
|
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||||
|
from lerobot.common.policies.sac.configuration_sac import SACConfig
|
||||||
|
import numpy as np
|
||||||
|
from typing import Callable, Optional, Tuple, Sequence
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
class SACPolicy(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "RL", "SAC"],
|
||||||
|
):
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self, config: SACConfig | None = None, dataset_stats: dict[str, dict[str, Tensor]] | None = None
|
||||||
|
):
|
||||||
|
|
||||||
|
super().__init__()
|
||||||
|
|
||||||
|
if config is None:
|
||||||
|
config = SACConfig()
|
||||||
|
self.config = config
|
||||||
|
|
||||||
|
if config.input_normalization_modes is not None:
|
||||||
|
self.normalize_inputs = Normalize(
|
||||||
|
config.input_shapes, config.input_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
self.normalize_inputs = nn.Identity()
|
||||||
|
self.normalize_targets = Normalize(
|
||||||
|
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
self.unnormalize_outputs = Unnormalize(
|
||||||
|
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
encoder = SACObservationEncoder(config)
|
||||||
|
# Define networks
|
||||||
|
critic_nets = []
|
||||||
|
for _ in range(config.num_critics):
|
||||||
|
critic_net = Critic(
|
||||||
|
encoder=encoder,
|
||||||
|
network=MLP(**config.critic_network_kwargs)
|
||||||
|
)
|
||||||
|
critic_nets.append(critic_net)
|
||||||
|
|
||||||
|
self.critic_ensemble = create_critic_ensemble(critic_nets, config.num_critics)
|
||||||
|
self.critic_target = deepcopy(self.critic_ensemble)
|
||||||
|
|
||||||
|
self.actor_network = Policy(
|
||||||
|
encoder=encoder,
|
||||||
|
network=MLP(**config.actor_network_kwargs),
|
||||||
|
action_dim=config.output_shapes["action"][0],
|
||||||
|
**config.policy_kwargs
|
||||||
|
)
|
||||||
|
|
||||||
|
self.temperature = LagrangeMultiplier(init_value=config.temperature_init)
|
||||||
|
|
||||||
|
def reset(self):
|
||||||
|
"""
|
||||||
|
Clear observation and action queues. Should be called on `env.reset()`
|
||||||
|
queues are populated during rollout of the policy, they contain the n latest observations and actions
|
||||||
|
"""
|
||||||
|
|
||||||
|
self._queues = {
|
||||||
|
"observation.state": deque(maxlen=1),
|
||||||
|
"action": deque(maxlen=1),
|
||||||
|
}
|
||||||
|
if self._use_image:
|
||||||
|
self._queues["observation.image"] = deque(maxlen=1)
|
||||||
|
if self._use_env_state:
|
||||||
|
self._queues["observation.environment_state"] = deque(maxlen=1)
|
||||||
|
|
||||||
|
@torch.no_grad()
|
||||||
|
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
|
actions, _ = self.actor_network(batch['observations'])###
|
||||||
|
|
||||||
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor | float]:
|
||||||
|
"""Run the batch through the model and compute the loss.
|
||||||
|
|
||||||
|
Returns a dictionary with loss as a tensor, and other information as native floats.
|
||||||
|
"""
|
||||||
|
batch = self.normalize_inputs(batch)
|
||||||
|
# batch shape is (b, 2, ...) where index 1 returns the current observation and
|
||||||
|
# the next observation for caluculating the right td index.
|
||||||
|
actions = batch["action"][:, 0]
|
||||||
|
rewards = batch["next.reward"][:, 0]
|
||||||
|
observations = {}
|
||||||
|
next_observations = {}
|
||||||
|
for k in batch:
|
||||||
|
if k.startswith("observation."):
|
||||||
|
observations[k] = batch[k][:, 0]
|
||||||
|
next_observations[k] = batch[k][:, 1]
|
||||||
|
|
||||||
|
# perform image augmentation
|
||||||
|
|
||||||
|
# reward bias
|
||||||
|
# from HIL-SERL code base
|
||||||
|
# add_or_replace={"rewards": batch["rewards"] + self.config["reward_bias"]} in reward_batch
|
||||||
|
|
||||||
|
|
||||||
|
# calculate critics loss
|
||||||
|
# 1- compute actions from policy
|
||||||
|
action_preds, log_probs = self.actor_network(observations)
|
||||||
|
# 2- compute q targets
|
||||||
|
q_targets = self.target_qs(next_observations, action_preds)
|
||||||
|
|
||||||
|
# critics subsample size
|
||||||
|
min_q = q_targets.min(dim=0)
|
||||||
|
|
||||||
|
# backup entropy
|
||||||
|
td_target = rewards + self.discount * min_q
|
||||||
|
|
||||||
|
# 3- compute predicted qs
|
||||||
|
q_preds = self.critic_ensemble(observations, actions)
|
||||||
|
|
||||||
|
# 4- Calculate loss
|
||||||
|
# Compute state-action value loss (TD loss) for all of the Q functions in the ensemble.
|
||||||
|
critics_loss = (
|
||||||
|
F.mse_loss(
|
||||||
|
q_preds,
|
||||||
|
einops.repeat(td_target, "t b -> e t b", e=q_preds.shape[0]),
|
||||||
|
reduction="none",
|
||||||
|
).sum(0) # sum over ensemble
|
||||||
|
# `q_preds_ensemble` depends on the first observation and the actions.
|
||||||
|
* ~batch["observation.state_is_pad"][0]
|
||||||
|
* ~batch["action_is_pad"]
|
||||||
|
# q_targets depends on the reward and the next observations.
|
||||||
|
* ~batch["next.reward_is_pad"]
|
||||||
|
* ~batch["observation.state_is_pad"][1:]
|
||||||
|
).sum(0).mean()
|
||||||
|
|
||||||
|
# calculate actors loss
|
||||||
|
# 1- temperature
|
||||||
|
temperature = self.temperature()
|
||||||
|
|
||||||
|
# 2- get actions (batch_size, action_dim) and log probs (batch_size,)
|
||||||
|
actions, log_probs = self.actor_network(observations) \
|
||||||
|
|
||||||
|
# 3- get q-value predictions
|
||||||
|
with torch.no_grad():
|
||||||
|
q_preds = self.critic_ensemble(observations, actions, return_type="mean")
|
||||||
|
actor_loss = (
|
||||||
|
-(q_preds - temperature * log_probs).mean()
|
||||||
|
* ~batch["observation.state_is_pad"][0]
|
||||||
|
* ~batch["action_is_pad"]
|
||||||
|
).mean()
|
||||||
|
|
||||||
|
|
||||||
|
# calculate temperature loss
|
||||||
|
# 1- calculate entropy
|
||||||
|
entropy = -log_probs.mean()
|
||||||
|
temperature_loss = temperature * (entropy - self.target_entropy).mean()
|
||||||
|
|
||||||
|
loss = critics_loss + actor_loss + temperature_loss
|
||||||
|
|
||||||
|
return {
|
||||||
|
"critics_loss": critics_loss.item(),
|
||||||
|
"actor_loss": actor_loss.item(),
|
||||||
|
"temperature_loss": temperature_loss.item(),
|
||||||
|
"temperature": temperature.item(),
|
||||||
|
"entropy": entropy.item(),
|
||||||
|
"loss": loss,
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
def update(self):
|
||||||
|
self.critic_target.lerp_(self.critic_ensemble, self.config.critic_target_update_weight)
|
||||||
|
#for target_param, param in zip(self.critic_target.parameters(), self.critic_ensemble.parameters()):
|
||||||
|
# target_param.data.copy_(target_param.data * (1.0 - self.config.critic_target_update_weight) + param.data * self.critic_target_update_weight)
|
||||||
|
|
||||||
|
|
||||||
|
class MLP(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
config: SACConfig,
|
||||||
|
activations: Callable[[torch.Tensor], torch.Tensor] | str = nn.SiLU(),
|
||||||
|
activate_final: bool = False,
|
||||||
|
dropout_rate: Optional[float] = None,
|
||||||
|
):
|
||||||
|
super().__init__()
|
||||||
|
self.activate_final = config.activate_final
|
||||||
|
layers = []
|
||||||
|
|
||||||
|
for i, size in enumerate(config.network_hidden_dims):
|
||||||
|
layers.append(nn.Linear(config.network_hidden_dims[i-1] if i > 0 else config.network_hidden_dims[0], size))
|
||||||
|
|
||||||
|
if i + 1 < len(config.network_hidden_dims) or activate_final:
|
||||||
|
if dropout_rate is not None and dropout_rate > 0:
|
||||||
|
layers.append(nn.Dropout(p=dropout_rate))
|
||||||
|
layers.append(nn.LayerNorm(size))
|
||||||
|
layers.append(activations if isinstance(activations, nn.Module) else getattr(nn, activations)())
|
||||||
|
|
||||||
|
self.net = nn.Sequential(*layers)
|
||||||
|
|
||||||
|
def forward(self, x: torch.Tensor, train: bool = False) -> torch.Tensor:
|
||||||
|
# in training mode or not. TODO: find better way to do this
|
||||||
|
self.train(train)
|
||||||
|
return self.net(x)
|
||||||
|
|
||||||
|
|
||||||
|
class Critic(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
encoder: Optional[nn.Module],
|
||||||
|
network: nn.Module,
|
||||||
|
init_final: Optional[float] = None,
|
||||||
|
activate_final: bool = False,
|
||||||
|
device: str = "cuda"
|
||||||
|
):
|
||||||
|
super().__init__()
|
||||||
|
self.device = torch.device(device)
|
||||||
|
self.encoder = encoder
|
||||||
|
self.network = network
|
||||||
|
self.init_final = init_final
|
||||||
|
self.activate_final = activate_final
|
||||||
|
|
||||||
|
# Output layer
|
||||||
|
if init_final is not None:
|
||||||
|
if self.activate_final:
|
||||||
|
self.output_layer = nn.Linear(network.net[-3].out_features, 1)
|
||||||
|
else:
|
||||||
|
self.output_layer = nn.Linear(network.net[-2].out_features, 1)
|
||||||
|
nn.init.uniform_(self.output_layer.weight, -init_final, init_final)
|
||||||
|
nn.init.uniform_(self.output_layer.bias, -init_final, init_final)
|
||||||
|
else:
|
||||||
|
if self.activate_final:
|
||||||
|
self.output_layer = nn.Linear(network.net[-3].out_features, 1)
|
||||||
|
else:
|
||||||
|
self.output_layer = nn.Linear(network.net[-2].out_features, 1)
|
||||||
|
orthogonal_init()(self.output_layer.weight)
|
||||||
|
|
||||||
|
self.to(self.device)
|
||||||
|
|
||||||
|
def forward(
|
||||||
|
self,
|
||||||
|
observations: torch.Tensor,
|
||||||
|
actions: torch.Tensor,
|
||||||
|
train: bool = False
|
||||||
|
) -> torch.Tensor:
|
||||||
|
self.train(train)
|
||||||
|
|
||||||
|
observations = observations.to(self.device)
|
||||||
|
actions = actions.to(self.device)
|
||||||
|
|
||||||
|
if self.encoder is not None:
|
||||||
|
obs_enc = self.encoder(observations)
|
||||||
|
else:
|
||||||
|
obs_enc = observations
|
||||||
|
|
||||||
|
inputs = torch.cat([obs_enc, actions], dim=-1)
|
||||||
|
x = self.network(inputs)
|
||||||
|
value = self.output_layer(x)
|
||||||
|
return value.squeeze(-1)
|
||||||
|
|
||||||
|
def q_value_ensemble(
|
||||||
|
self,
|
||||||
|
observations: torch.Tensor,
|
||||||
|
actions: torch.Tensor,
|
||||||
|
train: bool = False
|
||||||
|
) -> torch.Tensor:
|
||||||
|
observations = observations.to(self.device)
|
||||||
|
actions = actions.to(self.device)
|
||||||
|
|
||||||
|
if len(actions.shape) == 3: # [batch_size, num_actions, action_dim]
|
||||||
|
batch_size, num_actions = actions.shape[:2]
|
||||||
|
obs_expanded = observations.unsqueeze(1).expand(-1, num_actions, -1)
|
||||||
|
obs_flat = obs_expanded.reshape(-1, observations.shape[-1])
|
||||||
|
actions_flat = actions.reshape(-1, actions.shape[-1])
|
||||||
|
q_values = self(obs_flat, actions_flat, train)
|
||||||
|
return q_values.reshape(batch_size, num_actions)
|
||||||
|
else:
|
||||||
|
return self(observations, actions, train)
|
||||||
|
|
||||||
|
|
||||||
|
class Policy(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
encoder: Optional[nn.Module],
|
||||||
|
network: nn.Module,
|
||||||
|
action_dim: int,
|
||||||
|
std_parameterization: str = "exp",
|
||||||
|
std_min: float = 1e-5,
|
||||||
|
std_max: float = 10.0,
|
||||||
|
tanh_squash_distribution: bool = False,
|
||||||
|
fixed_std: Optional[torch.Tensor] = None,
|
||||||
|
init_final: Optional[float] = None,
|
||||||
|
activate_final: bool = False,
|
||||||
|
device: str = "cuda"
|
||||||
|
):
|
||||||
|
super().__init__()
|
||||||
|
self.device = torch.device(device)
|
||||||
|
self.encoder = encoder
|
||||||
|
self.network = network
|
||||||
|
self.action_dim = action_dim
|
||||||
|
self.std_parameterization = std_parameterization
|
||||||
|
self.std_min = std_min
|
||||||
|
self.std_max = std_max
|
||||||
|
self.tanh_squash_distribution = tanh_squash_distribution
|
||||||
|
self.fixed_std = fixed_std.to(self.device) if fixed_std is not None else None
|
||||||
|
self.activate_final = activate_final
|
||||||
|
|
||||||
|
# Mean layer
|
||||||
|
if self.activate_final:
|
||||||
|
self.mean_layer = nn.Linear(network.net[-3].out_features, action_dim)
|
||||||
|
else:
|
||||||
|
self.mean_layer = nn.Linear(network.net[-2].out_features, action_dim)
|
||||||
|
if init_final is not None:
|
||||||
|
nn.init.uniform_(self.mean_layer.weight, -init_final, init_final)
|
||||||
|
nn.init.uniform_(self.mean_layer.bias, -init_final, init_final)
|
||||||
|
else:
|
||||||
|
orthogonal_init()(self.mean_layer.weight)
|
||||||
|
|
||||||
|
# Standard deviation layer or parameter
|
||||||
|
if fixed_std is None:
|
||||||
|
if std_parameterization == "uniform":
|
||||||
|
self.log_stds = nn.Parameter(torch.zeros(action_dim, device=self.device))
|
||||||
|
else:
|
||||||
|
if self.activate_final:
|
||||||
|
self.std_layer = nn.Linear(network.net[-3].out_features, action_dim)
|
||||||
|
else:
|
||||||
|
self.std_layer = nn.Linear(network.net[-2].out_features, action_dim)
|
||||||
|
if init_final is not None:
|
||||||
|
nn.init.uniform_(self.std_layer.weight, -init_final, init_final)
|
||||||
|
nn.init.uniform_(self.std_layer.bias, -init_final, init_final)
|
||||||
|
else:
|
||||||
|
orthogonal_init()(self.std_layer.weight)
|
||||||
|
|
||||||
|
self.to(self.device)
|
||||||
|
|
||||||
|
def forward(
|
||||||
|
self,
|
||||||
|
observations: torch.Tensor,
|
||||||
|
temperature: float = 1.0,
|
||||||
|
train: bool = False,
|
||||||
|
non_squash_distribution: bool = False
|
||||||
|
) -> torch.distributions.Distribution:
|
||||||
|
self.train(train)
|
||||||
|
|
||||||
|
# Encode observations if encoder exists
|
||||||
|
if self.encoder is not None:
|
||||||
|
with torch.set_grad_enabled(train):
|
||||||
|
obs_enc = self.encoder(observations, train=train)
|
||||||
|
else:
|
||||||
|
obs_enc = observations
|
||||||
|
# Get network outputs
|
||||||
|
outputs = self.network(obs_enc)
|
||||||
|
means = self.mean_layer(outputs)
|
||||||
|
|
||||||
|
# Compute standard deviations
|
||||||
|
if self.fixed_std is None:
|
||||||
|
if self.std_parameterization == "exp":
|
||||||
|
log_stds = self.std_layer(outputs)
|
||||||
|
stds = torch.exp(log_stds)
|
||||||
|
elif self.std_parameterization == "softplus":
|
||||||
|
stds = torch.nn.functional.softplus(self.std_layer(outputs))
|
||||||
|
elif self.std_parameterization == "uniform":
|
||||||
|
stds = torch.exp(self.log_stds).expand_as(means)
|
||||||
|
else:
|
||||||
|
raise ValueError(
|
||||||
|
f"Invalid std_parameterization: {self.std_parameterization}"
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
assert self.std_parameterization == "fixed"
|
||||||
|
stds = self.fixed_std.expand_as(means)
|
||||||
|
|
||||||
|
# Clip standard deviations and scale with temperature
|
||||||
|
temperature = torch.tensor(temperature, device=self.device)
|
||||||
|
stds = torch.clamp(stds, self.std_min, self.std_max) * torch.sqrt(temperature)
|
||||||
|
|
||||||
|
# Create distribution
|
||||||
|
if self.tanh_squash_distribution and not non_squash_distribution:
|
||||||
|
distribution = TanhMultivariateNormalDiag(
|
||||||
|
loc=means,
|
||||||
|
scale_diag=stds,
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
distribution = torch.distributions.Normal(
|
||||||
|
loc=means,
|
||||||
|
scale=stds,
|
||||||
|
)
|
||||||
|
|
||||||
|
return distribution
|
||||||
|
|
||||||
|
def get_features(self, observations: torch.Tensor) -> torch.Tensor:
|
||||||
|
"""Get encoded features from observations"""
|
||||||
|
observations = observations.to(self.device)
|
||||||
|
if self.encoder is not None:
|
||||||
|
with torch.no_grad():
|
||||||
|
return self.encoder(observations, train=False)
|
||||||
|
return observations
|
||||||
|
|
||||||
|
|
||||||
|
class SACObservationEncoder(nn.Module):
|
||||||
|
"""Encode image and/or state vector observations.
|
||||||
|
TODO(ke-wang): The original work allows for (1) stacking multiple history frames and (2) using pretrained resnet encoders.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, config: SACConfig):
|
||||||
|
"""
|
||||||
|
Creates encoders for pixel and/or state modalities.
|
||||||
|
"""
|
||||||
|
super().__init__()
|
||||||
|
self.config = config
|
||||||
|
|
||||||
|
if "observation.image" in config.input_shapes:
|
||||||
|
self.image_enc_layers = nn.Sequential(
|
||||||
|
nn.Conv2d(
|
||||||
|
config.input_shapes["observation.image"][0], config.image_encoder_hidden_dim, 7, stride=2
|
||||||
|
),
|
||||||
|
nn.ReLU(),
|
||||||
|
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 5, stride=2),
|
||||||
|
nn.ReLU(),
|
||||||
|
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
|
||||||
|
nn.ReLU(),
|
||||||
|
nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
|
||||||
|
nn.ReLU(),
|
||||||
|
)
|
||||||
|
dummy_batch = torch.zeros(1, *config.input_shapes["observation.image"])
|
||||||
|
with torch.inference_mode():
|
||||||
|
out_shape = self.image_enc_layers(dummy_batch).shape[1:]
|
||||||
|
self.image_enc_layers.extend(
|
||||||
|
nn.Sequential(
|
||||||
|
nn.Flatten(),
|
||||||
|
nn.Linear(np.prod(out_shape), config.latent_dim),
|
||||||
|
nn.LayerNorm(config.latent_dim),
|
||||||
|
nn.Tanh(),
|
||||||
|
)
|
||||||
|
)
|
||||||
|
if "observation.state" in config.input_shapes:
|
||||||
|
self.state_enc_layers = nn.Sequential(
|
||||||
|
nn.Linear(config.input_shapes["observation.state"][0], config.state_encoder_hidden_dim),
|
||||||
|
nn.ELU(),
|
||||||
|
nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
|
||||||
|
nn.LayerNorm(config.latent_dim),
|
||||||
|
nn.Tanh(),
|
||||||
|
)
|
||||||
|
if "observation.environment_state" in config.input_shapes:
|
||||||
|
self.env_state_enc_layers = nn.Sequential(
|
||||||
|
nn.Linear(
|
||||||
|
config.input_shapes["observation.environment_state"][0], config.state_encoder_hidden_dim
|
||||||
|
),
|
||||||
|
nn.ELU(),
|
||||||
|
nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
|
||||||
|
nn.LayerNorm(config.latent_dim),
|
||||||
|
nn.Tanh(),
|
||||||
|
)
|
||||||
|
|
||||||
|
def forward(self, obs_dict: dict[str, Tensor]) -> Tensor:
|
||||||
|
"""Encode the image and/or state vector.
|
||||||
|
|
||||||
|
Each modality is encoded into a feature vector of size (latent_dim,) and then a uniform mean is taken
|
||||||
|
over all features.
|
||||||
|
"""
|
||||||
|
feat = []
|
||||||
|
# Concatenate all images along the channel dimension.
|
||||||
|
image_keys = [k for k in self.config.input_shapes if k.startswith("observation.image")]
|
||||||
|
for image_key in image_keys:
|
||||||
|
feat.append(flatten_forward_unflatten(self.image_enc_layers, obs_dict[image_key]))
|
||||||
|
if "observation.environment_state" in self.config.input_shapes:
|
||||||
|
feat.append(self.env_state_enc_layers(obs_dict["observation.environment_state"]))
|
||||||
|
if "observation.state" in self.config.input_shapes:
|
||||||
|
feat.append(self.state_enc_layers(obs_dict["observation.state"]))
|
||||||
|
return torch.stack(feat, dim=0).mean(0)
|
||||||
|
|
||||||
|
|
||||||
|
class LagrangeMultiplier(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
init_value: float = 1.0,
|
||||||
|
constraint_shape: Sequence[int] = (),
|
||||||
|
device: str = "cuda"
|
||||||
|
):
|
||||||
|
super().__init__()
|
||||||
|
self.device = torch.device(device)
|
||||||
|
init_value = torch.log(torch.exp(torch.tensor(init_value, device=self.device)) - 1)
|
||||||
|
|
||||||
|
# Initialize the Lagrange multiplier as a parameter
|
||||||
|
self.lagrange = nn.Parameter(
|
||||||
|
torch.full(constraint_shape, init_value, dtype=torch.float32, device=self.device)
|
||||||
|
)
|
||||||
|
|
||||||
|
self.to(self.device)
|
||||||
|
|
||||||
|
def forward(
|
||||||
|
self,
|
||||||
|
lhs: Optional[torch.Tensor] = None,
|
||||||
|
rhs: Optional[torch.Tensor] = None
|
||||||
|
) -> torch.Tensor:
|
||||||
|
# Get the multiplier value based on parameterization
|
||||||
|
multiplier = torch.nn.functional.softplus(self.lagrange)
|
||||||
|
|
||||||
|
# Return the raw multiplier if no constraint values provided
|
||||||
|
if lhs is None:
|
||||||
|
return multiplier
|
||||||
|
|
||||||
|
# Move inputs to device
|
||||||
|
lhs = lhs.to(self.device)
|
||||||
|
if rhs is not None:
|
||||||
|
rhs = rhs.to(self.device)
|
||||||
|
|
||||||
|
# Use the multiplier to compute the Lagrange penalty
|
||||||
|
if rhs is None:
|
||||||
|
rhs = torch.zeros_like(lhs, device=self.device)
|
||||||
|
|
||||||
|
diff = lhs - rhs
|
||||||
|
|
||||||
|
assert diff.shape == multiplier.shape, f"Shape mismatch: {diff.shape} vs {multiplier.shape}"
|
||||||
|
|
||||||
|
return multiplier * diff
|
||||||
|
|
||||||
|
|
||||||
|
# The TanhMultivariateNormalDiag is a probability distribution that represents a transformed normal (Gaussian) distribution where:
|
||||||
|
# 1. The base distribution is a diagonal multivariate normal distribution
|
||||||
|
# 2. The samples from this normal distribution are transformed through a tanh function, which squashes the values to be between -1 and 1
|
||||||
|
# 3. Optionally, the values can be further transformed to fit within arbitrary bounds [low, high] using an affine transformation
|
||||||
|
# This type of distribution is commonly used in reinforcement learning, particularly for continuous action spaces
|
||||||
|
class TanhMultivariateNormalDiag(torch.distributions.TransformedDistribution):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
loc: torch.Tensor,
|
||||||
|
scale_diag: torch.Tensor,
|
||||||
|
low: Optional[torch.Tensor] = None,
|
||||||
|
high: Optional[torch.Tensor] = None,
|
||||||
|
):
|
||||||
|
# Create base normal distribution
|
||||||
|
base_distribution = torch.distributions.Normal(loc=loc, scale=scale_diag)
|
||||||
|
|
||||||
|
# Create list of transforms
|
||||||
|
transforms = []
|
||||||
|
|
||||||
|
# Add tanh transform
|
||||||
|
transforms.append(torch.distributions.transforms.TanhTransform())
|
||||||
|
|
||||||
|
# Add rescaling transform if bounds are provided
|
||||||
|
if low is not None and high is not None:
|
||||||
|
transforms.append(
|
||||||
|
torch.distributions.transforms.AffineTransform(
|
||||||
|
loc=(high + low) / 2,
|
||||||
|
scale=(high - low) / 2
|
||||||
|
)
|
||||||
|
)
|
||||||
|
|
||||||
|
# Initialize parent class
|
||||||
|
super().__init__(
|
||||||
|
base_distribution=base_distribution,
|
||||||
|
transforms=transforms
|
||||||
|
)
|
||||||
|
|
||||||
|
# Store parameters
|
||||||
|
self.loc = loc
|
||||||
|
self.scale_diag = scale_diag
|
||||||
|
self.low = low
|
||||||
|
self.high = high
|
||||||
|
|
||||||
|
def mode(self) -> torch.Tensor:
|
||||||
|
"""Get the mode of the transformed distribution"""
|
||||||
|
# The mode of a normal distribution is its mean
|
||||||
|
mode = self.loc
|
||||||
|
|
||||||
|
# Apply transforms
|
||||||
|
for transform in self.transforms:
|
||||||
|
mode = transform(mode)
|
||||||
|
|
||||||
|
return mode
|
||||||
|
|
||||||
|
def rsample(self, sample_shape=torch.Size()) -> torch.Tensor:
|
||||||
|
"""
|
||||||
|
Reparameterized sample from the distribution
|
||||||
|
"""
|
||||||
|
# Sample from base distribution
|
||||||
|
x = self.base_dist.rsample(sample_shape)
|
||||||
|
|
||||||
|
# Apply transforms
|
||||||
|
for transform in self.transforms:
|
||||||
|
x = transform(x)
|
||||||
|
|
||||||
|
return x
|
||||||
|
|
||||||
|
def log_prob(self, value: torch.Tensor) -> torch.Tensor:
|
||||||
|
"""
|
||||||
|
Compute log probability of a value
|
||||||
|
Includes the log det jacobian for the transforms
|
||||||
|
"""
|
||||||
|
# Initialize log prob
|
||||||
|
log_prob = torch.zeros_like(value[..., 0])
|
||||||
|
|
||||||
|
# Inverse transforms to get back to normal distribution
|
||||||
|
q = value
|
||||||
|
for transform in reversed(self.transforms):
|
||||||
|
q = transform.inv(q)
|
||||||
|
log_prob = log_prob - transform.log_abs_det_jacobian(q, transform(q))
|
||||||
|
|
||||||
|
# Add base distribution log prob
|
||||||
|
log_prob = log_prob + self.base_dist.log_prob(q).sum(-1)
|
||||||
|
|
||||||
|
return log_prob
|
||||||
|
|
||||||
|
def sample_and_log_prob(self, sample_shape=torch.Size()) -> Tuple[torch.Tensor, torch.Tensor]:
|
||||||
|
"""
|
||||||
|
Sample from the distribution and compute log probability
|
||||||
|
"""
|
||||||
|
x = self.rsample(sample_shape)
|
||||||
|
log_prob = self.log_prob(x)
|
||||||
|
return x, log_prob
|
||||||
|
|
||||||
|
def entropy(self) -> torch.Tensor:
|
||||||
|
"""
|
||||||
|
Compute entropy of the distribution
|
||||||
|
"""
|
||||||
|
# Start with base distribution entropy
|
||||||
|
entropy = self.base_dist.entropy().sum(-1)
|
||||||
|
|
||||||
|
# Add log det jacobian for each transform
|
||||||
|
x = self.rsample()
|
||||||
|
for transform in self.transforms:
|
||||||
|
entropy = entropy + transform.log_abs_det_jacobian(x, transform(x))
|
||||||
|
x = transform(x)
|
||||||
|
|
||||||
|
return entropy
|
||||||
|
|
||||||
|
|
||||||
|
def create_critic_ensemble(critic_class, num_critics: int, device: str = "cuda") -> nn.ModuleList:
|
||||||
|
"""Creates an ensemble of critic networks"""
|
||||||
|
critics = nn.ModuleList([critic_class() for _ in range(num_critics)])
|
||||||
|
return critics.to(device)
|
||||||
|
|
||||||
|
|
||||||
|
def orthogonal_init():
|
||||||
|
return lambda x: torch.nn.init.orthogonal_(x, gain=1.0)
|
||||||
|
|
||||||
|
|
||||||
|
# borrowed from tdmpc
|
||||||
|
def flatten_forward_unflatten(fn: Callable[[Tensor], Tensor], image_tensor: Tensor) -> Tensor:
|
||||||
|
"""Helper to temporarily flatten extra dims at the start of the image tensor.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
fn: Callable that the image tensor will be passed to. It should accept (B, C, H, W) and return
|
||||||
|
(B, *), where * is any number of dimensions.
|
||||||
|
image_tensor: An image tensor of shape (**, C, H, W), where ** is any number of dimensions and
|
||||||
|
can be more than 1 dimensions, generally different from *.
|
||||||
|
Returns:
|
||||||
|
A return value from the callable reshaped to (**, *).
|
||||||
|
"""
|
||||||
|
if image_tensor.ndim == 4:
|
||||||
|
return fn(image_tensor)
|
||||||
|
start_dims = image_tensor.shape[:-3]
|
||||||
|
inp = torch.flatten(image_tensor, end_dim=-4)
|
||||||
|
flat_out = fn(inp)
|
||||||
|
return torch.reshape(flat_out, (*start_dims, *flat_out.shape[1:]))
|
||||||
|
|
||||||
@@ -25,12 +25,25 @@ class TDMPCConfig:
|
|||||||
camera observations.
|
camera observations.
|
||||||
|
|
||||||
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||||
Those are: `input_shapes`, `output_shapes`, and perhaps `max_random_shift`.
|
Those are: `input_shapes`, `output_shapes`, and perhaps `max_random_shift_ratio`.
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
n_action_repeats: The number of times to repeat the action returned by the planning. (hint: Google
|
n_action_repeats: The number of times to repeat the action returned by the planning. (hint: Google
|
||||||
action repeats in Q-learning or ask your favorite chatbot)
|
action repeats in Q-learning or ask your favorite chatbot)
|
||||||
horizon: Horizon for model predictive control.
|
horizon: Horizon for model predictive control.
|
||||||
|
n_action_steps: Number of action steps to take from the plan given by model predictive control. This
|
||||||
|
is an alternative to using action repeats. If this is set to more than 1, then we require
|
||||||
|
`n_action_repeats == 1`, `use_mpc == True` and `n_action_steps <= horizon`. Note that this
|
||||||
|
approach of using multiple steps from the plan is not in the original implementation.
|
||||||
|
input_shapes: A dictionary defining the shapes of the input data for the policy. The key represents
|
||||||
|
the input data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||||
|
For example, "observation.image" refers to an input from a camera with dimensions [3, 96, 96],
|
||||||
|
indicating it has three color channels and 96x96 resolution. Importantly, `input_shapes` doesn't
|
||||||
|
include batch dimension or temporal dimension.
|
||||||
|
output_shapes: A dictionary defining the shapes of the output data for the policy. The key represents
|
||||||
|
the output data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||||
|
For example, "action" refers to an output shape of [14], indicating 14-dimensional actions.
|
||||||
|
Importantly, `output_shapes` doesn't include batch dimension or temporal dimension.
|
||||||
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||||
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||||
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||||
@@ -91,6 +104,7 @@ class TDMPCConfig:
|
|||||||
# Input / output structure.
|
# Input / output structure.
|
||||||
n_action_repeats: int = 2
|
n_action_repeats: int = 2
|
||||||
horizon: int = 5
|
horizon: int = 5
|
||||||
|
n_action_steps: int = 1
|
||||||
|
|
||||||
input_shapes: dict[str, list[int]] = field(
|
input_shapes: dict[str, list[int]] = field(
|
||||||
default_factory=lambda: {
|
default_factory=lambda: {
|
||||||
@@ -149,17 +163,18 @@ class TDMPCConfig:
|
|||||||
"""Input validation (not exhaustive)."""
|
"""Input validation (not exhaustive)."""
|
||||||
# There should only be one image key.
|
# There should only be one image key.
|
||||||
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
||||||
if len(image_keys) != 1:
|
if len(image_keys) > 1:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"{self.__class__.__name__} only handles one image for now. Got image keys {image_keys}."
|
f"{self.__class__.__name__} handles at most one image for now. Got image keys {image_keys}."
|
||||||
)
|
|
||||||
image_key = next(iter(image_keys))
|
|
||||||
if self.input_shapes[image_key][-2] != self.input_shapes[image_key][-1]:
|
|
||||||
# TODO(alexander-soare): This limitation is solely because of code in the random shift
|
|
||||||
# augmentation. It should be able to be removed.
|
|
||||||
raise ValueError(
|
|
||||||
f"Only square images are handled now. Got image shape {self.input_shapes[image_key]}."
|
|
||||||
)
|
)
|
||||||
|
if len(image_keys) > 0:
|
||||||
|
image_key = next(iter(image_keys))
|
||||||
|
if self.input_shapes[image_key][-2] != self.input_shapes[image_key][-1]:
|
||||||
|
# TODO(alexander-soare): This limitation is solely because of code in the random shift
|
||||||
|
# augmentation. It should be able to be removed.
|
||||||
|
raise ValueError(
|
||||||
|
f"Only square images are handled now. Got image shape {self.input_shapes[image_key]}."
|
||||||
|
)
|
||||||
if self.n_gaussian_samples <= 0:
|
if self.n_gaussian_samples <= 0:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"The number of guassian samples for CEM should be non-zero. Got `{self.n_gaussian_samples=}`"
|
f"The number of guassian samples for CEM should be non-zero. Got `{self.n_gaussian_samples=}`"
|
||||||
@@ -170,3 +185,12 @@ class TDMPCConfig:
|
|||||||
f"advised that you stick with the default. See {self.__class__.__name__} docstring for more "
|
f"advised that you stick with the default. See {self.__class__.__name__} docstring for more "
|
||||||
"information."
|
"information."
|
||||||
)
|
)
|
||||||
|
if self.n_action_steps > 1:
|
||||||
|
if self.n_action_repeats != 1:
|
||||||
|
raise ValueError(
|
||||||
|
"If `n_action_steps > 1`, `n_action_repeats` must be left to its default value of 1."
|
||||||
|
)
|
||||||
|
if not self.use_mpc:
|
||||||
|
raise ValueError("If `n_action_steps > 1`, `use_mpc` must be set to `True`.")
|
||||||
|
if self.n_action_steps > self.horizon:
|
||||||
|
raise ValueError("`n_action_steps` must be less than or equal to `horizon`.")
|
||||||
|
|||||||
@@ -19,14 +19,10 @@
|
|||||||
The comments in this code may sometimes refer to these references:
|
The comments in this code may sometimes refer to these references:
|
||||||
TD-MPC paper: Temporal Difference Learning for Model Predictive Control (https://arxiv.org/abs/2203.04955)
|
TD-MPC paper: Temporal Difference Learning for Model Predictive Control (https://arxiv.org/abs/2203.04955)
|
||||||
FOWM paper: Finetuning Offline World Models in the Real World (https://arxiv.org/abs/2310.16029)
|
FOWM paper: Finetuning Offline World Models in the Real World (https://arxiv.org/abs/2310.16029)
|
||||||
|
|
||||||
TODO(alexander-soare): Make rollout work for batch sizes larger than 1.
|
|
||||||
TODO(alexander-soare): Use batch-first throughout.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
# ruff: noqa: N806
|
# ruff: noqa: N806
|
||||||
|
|
||||||
import logging
|
|
||||||
from collections import deque
|
from collections import deque
|
||||||
from copy import deepcopy
|
from copy import deepcopy
|
||||||
from functools import partial
|
from functools import partial
|
||||||
@@ -45,7 +41,13 @@ from lerobot.common.policies.tdmpc.configuration_tdmpc import TDMPCConfig
|
|||||||
from lerobot.common.policies.utils import get_device_from_parameters, populate_queues
|
from lerobot.common.policies.utils import get_device_from_parameters, populate_queues
|
||||||
|
|
||||||
|
|
||||||
class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
class TDMPCPolicy(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "tdmpc"],
|
||||||
|
):
|
||||||
"""Implementation of TD-MPC learning + inference.
|
"""Implementation of TD-MPC learning + inference.
|
||||||
|
|
||||||
Please note several warnings for this policy.
|
Please note several warnings for this policy.
|
||||||
@@ -56,9 +58,11 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
process communication to use the xarm environment from FOWM. This is because our xarm
|
process communication to use the xarm environment from FOWM. This is because our xarm
|
||||||
environment uses newer dependencies and does not match the environment in FOWM. See
|
environment uses newer dependencies and does not match the environment in FOWM. See
|
||||||
https://github.com/huggingface/lerobot/pull/103 for implementation details.
|
https://github.com/huggingface/lerobot/pull/103 for implementation details.
|
||||||
- We have NOT checked that training on LeRobot reproduces SOTA results. This is a TODO.
|
- We have NOT checked that training on LeRobot reproduces the results from FOWM.
|
||||||
|
- Nevertheless, we have verified that we can train TD-MPC for PushT. See
|
||||||
|
`lerobot/configs/policy/tdmpc_pusht_keypoints.yaml`.
|
||||||
- Our current xarm datasets were generated using the environment from FOWM. Therefore they do not
|
- Our current xarm datasets were generated using the environment from FOWM. Therefore they do not
|
||||||
match our xarm environment.
|
match our xarm environment.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
name = "tdmpc"
|
name = "tdmpc"
|
||||||
@@ -74,22 +78,6 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
that they will be passed with a call to `load_state_dict` before the policy is used.
|
that they will be passed with a call to `load_state_dict` before the policy is used.
|
||||||
"""
|
"""
|
||||||
super().__init__()
|
super().__init__()
|
||||||
logging.warning(
|
|
||||||
"""
|
|
||||||
Please note several warnings for this policy.
|
|
||||||
|
|
||||||
- Evaluation of pretrained weights created with the original FOWM code
|
|
||||||
(https://github.com/fyhMer/fowm) works as expected. To be precise: we trained and evaluated a
|
|
||||||
model with the FOWM code for the xarm_lift_medium_replay dataset. We ported the weights across
|
|
||||||
to LeRobot, and were able to evaluate with the same success metric. BUT, we had to use inter-
|
|
||||||
process communication to use the xarm environment from FOWM. This is because our xarm
|
|
||||||
environment uses newer dependencies and does not match the environment in FOWM. See
|
|
||||||
https://github.com/huggingface/lerobot/pull/103 for implementation details.
|
|
||||||
- We have NOT checked that training on LeRobot reproduces SOTA results. This is a TODO.
|
|
||||||
- Our current xarm datasets were generated using the environment from FOWM. Therefore they do not
|
|
||||||
match our xarm environment.
|
|
||||||
"""
|
|
||||||
)
|
|
||||||
|
|
||||||
if config is None:
|
if config is None:
|
||||||
config = TDMPCConfig()
|
config = TDMPCConfig()
|
||||||
@@ -114,8 +102,14 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
|
|
||||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||||
# Note: This check is covered in the post-init of the config but have a sanity check just in case.
|
# Note: This check is covered in the post-init of the config but have a sanity check just in case.
|
||||||
assert len(image_keys) == 1
|
self._use_image = False
|
||||||
self.input_image_key = image_keys[0]
|
self._use_env_state = False
|
||||||
|
if len(image_keys) > 0:
|
||||||
|
assert len(image_keys) == 1
|
||||||
|
self._use_image = True
|
||||||
|
self.input_image_key = image_keys[0]
|
||||||
|
if "observation.environment_state" in config.input_shapes:
|
||||||
|
self._use_env_state = True
|
||||||
|
|
||||||
self.reset()
|
self.reset()
|
||||||
|
|
||||||
@@ -125,19 +119,24 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
called on `env.reset()`
|
called on `env.reset()`
|
||||||
"""
|
"""
|
||||||
self._queues = {
|
self._queues = {
|
||||||
"observation.image": deque(maxlen=1),
|
|
||||||
"observation.state": deque(maxlen=1),
|
"observation.state": deque(maxlen=1),
|
||||||
"action": deque(maxlen=self.config.n_action_repeats),
|
"action": deque(maxlen=max(self.config.n_action_steps, self.config.n_action_repeats)),
|
||||||
}
|
}
|
||||||
|
if self._use_image:
|
||||||
|
self._queues["observation.image"] = deque(maxlen=1)
|
||||||
|
if self._use_env_state:
|
||||||
|
self._queues["observation.environment_state"] = deque(maxlen=1)
|
||||||
# Previous mean obtained from the cross-entropy method (CEM) used during MPC. It is used to warm start
|
# Previous mean obtained from the cross-entropy method (CEM) used during MPC. It is used to warm start
|
||||||
# CEM for the next step.
|
# CEM for the next step.
|
||||||
self._prev_mean: torch.Tensor | None = None
|
self._prev_mean: torch.Tensor | None = None
|
||||||
|
|
||||||
@torch.no_grad()
|
@torch.no_grad()
|
||||||
def select_action(self, batch: dict[str, Tensor]):
|
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
"""Select a single action given environment observations."""
|
"""Select a single action given environment observations."""
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
batch["observation.image"] = batch[self.input_image_key]
|
if self._use_image:
|
||||||
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
|
batch["observation.image"] = batch[self.input_image_key]
|
||||||
|
|
||||||
self._queues = populate_queues(self._queues, batch)
|
self._queues = populate_queues(self._queues, batch)
|
||||||
|
|
||||||
@@ -151,49 +150,57 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
batch[key] = batch[key][:, 0]
|
batch[key] = batch[key][:, 0]
|
||||||
|
|
||||||
# NOTE: Order of observations matters here.
|
# NOTE: Order of observations matters here.
|
||||||
z = self.model.encode({k: batch[k] for k in ["observation.image", "observation.state"]})
|
encode_keys = []
|
||||||
if self.config.use_mpc:
|
if self._use_image:
|
||||||
batch_size = batch["observation.image"].shape[0]
|
encode_keys.append("observation.image")
|
||||||
# Batch processing is not handled in MPC mode, so process the batch in a loop.
|
if self._use_env_state:
|
||||||
action = [] # will be a batch of actions for one step
|
encode_keys.append("observation.environment_state")
|
||||||
for i in range(batch_size):
|
encode_keys.append("observation.state")
|
||||||
# Note: self.plan does not handle batches, hence the squeeze.
|
z = self.model.encode({k: batch[k] for k in encode_keys})
|
||||||
action.append(self.plan(z[i]))
|
if self.config.use_mpc: # noqa: SIM108
|
||||||
action = torch.stack(action)
|
actions = self.plan(z) # (horizon, batch, action_dim)
|
||||||
else:
|
else:
|
||||||
# Plan with the policy (π) alone.
|
# Plan with the policy (π) alone. This always returns one action so unsqueeze to get a
|
||||||
action = self.model.pi(z)
|
# sequence dimension like in the MPC branch.
|
||||||
|
actions = self.model.pi(z).unsqueeze(0)
|
||||||
|
|
||||||
self.unnormalize_outputs({"action": action})["action"]
|
actions = torch.clamp(actions, -1, +1)
|
||||||
|
|
||||||
for _ in range(self.config.n_action_repeats):
|
actions = self.unnormalize_outputs({"action": actions})["action"]
|
||||||
self._queues["action"].append(action)
|
|
||||||
|
if self.config.n_action_repeats > 1:
|
||||||
|
for _ in range(self.config.n_action_repeats):
|
||||||
|
self._queues["action"].append(actions[0])
|
||||||
|
else:
|
||||||
|
# Action queue is (n_action_steps, batch_size, action_dim), so we transpose the action.
|
||||||
|
self._queues["action"].extend(actions[: self.config.n_action_steps])
|
||||||
|
|
||||||
action = self._queues["action"].popleft()
|
action = self._queues["action"].popleft()
|
||||||
return torch.clamp(action, -1, 1)
|
return action
|
||||||
|
|
||||||
@torch.no_grad()
|
@torch.no_grad()
|
||||||
def plan(self, z: Tensor) -> Tensor:
|
def plan(self, z: Tensor) -> Tensor:
|
||||||
"""Plan next action using TD-MPC inference.
|
"""Plan sequence of actions using TD-MPC inference.
|
||||||
|
|
||||||
Args:
|
Args:
|
||||||
z: (latent_dim,) tensor for the initial state.
|
z: (batch, latent_dim,) tensor for the initial state.
|
||||||
Returns:
|
Returns:
|
||||||
(action_dim,) tensor for the next action.
|
(horizon, batch, action_dim,) tensor for the planned trajectory of actions.
|
||||||
|
|
||||||
TODO(alexander-soare) Extend this to be able to work with batches.
|
|
||||||
"""
|
"""
|
||||||
device = get_device_from_parameters(self)
|
device = get_device_from_parameters(self)
|
||||||
|
|
||||||
|
batch_size = z.shape[0]
|
||||||
|
|
||||||
# Sample Nπ trajectories from the policy.
|
# Sample Nπ trajectories from the policy.
|
||||||
pi_actions = torch.empty(
|
pi_actions = torch.empty(
|
||||||
self.config.horizon,
|
self.config.horizon,
|
||||||
self.config.n_pi_samples,
|
self.config.n_pi_samples,
|
||||||
|
batch_size,
|
||||||
self.config.output_shapes["action"][0],
|
self.config.output_shapes["action"][0],
|
||||||
device=device,
|
device=device,
|
||||||
)
|
)
|
||||||
if self.config.n_pi_samples > 0:
|
if self.config.n_pi_samples > 0:
|
||||||
_z = einops.repeat(z, "d -> n d", n=self.config.n_pi_samples)
|
_z = einops.repeat(z, "b d -> n b d", n=self.config.n_pi_samples)
|
||||||
for t in range(self.config.horizon):
|
for t in range(self.config.horizon):
|
||||||
# Note: Adding a small amount of noise here doesn't hurt during inference and may even be
|
# Note: Adding a small amount of noise here doesn't hurt during inference and may even be
|
||||||
# helpful for CEM.
|
# helpful for CEM.
|
||||||
@@ -202,12 +209,14 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
|
|
||||||
# In the CEM loop we will need this for a call to estimate_value with the gaussian sampled
|
# In the CEM loop we will need this for a call to estimate_value with the gaussian sampled
|
||||||
# trajectories.
|
# trajectories.
|
||||||
z = einops.repeat(z, "d -> n d", n=self.config.n_gaussian_samples + self.config.n_pi_samples)
|
z = einops.repeat(z, "b d -> n b d", n=self.config.n_gaussian_samples + self.config.n_pi_samples)
|
||||||
|
|
||||||
# Model Predictive Path Integral (MPPI) with the cross-entropy method (CEM) as the optimization
|
# Model Predictive Path Integral (MPPI) with the cross-entropy method (CEM) as the optimization
|
||||||
# algorithm.
|
# algorithm.
|
||||||
# The initial mean and standard deviation for the cross-entropy method (CEM).
|
# The initial mean and standard deviation for the cross-entropy method (CEM).
|
||||||
mean = torch.zeros(self.config.horizon, self.config.output_shapes["action"][0], device=device)
|
mean = torch.zeros(
|
||||||
|
self.config.horizon, batch_size, self.config.output_shapes["action"][0], device=device
|
||||||
|
)
|
||||||
# Maybe warm start CEM with the mean from the previous step.
|
# Maybe warm start CEM with the mean from the previous step.
|
||||||
if self._prev_mean is not None:
|
if self._prev_mean is not None:
|
||||||
mean[:-1] = self._prev_mean[1:]
|
mean[:-1] = self._prev_mean[1:]
|
||||||
@@ -218,6 +227,7 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
std_normal_noise = torch.randn(
|
std_normal_noise = torch.randn(
|
||||||
self.config.horizon,
|
self.config.horizon,
|
||||||
self.config.n_gaussian_samples,
|
self.config.n_gaussian_samples,
|
||||||
|
batch_size,
|
||||||
self.config.output_shapes["action"][0],
|
self.config.output_shapes["action"][0],
|
||||||
device=std.device,
|
device=std.device,
|
||||||
)
|
)
|
||||||
@@ -226,21 +236,24 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
# Compute elite actions.
|
# Compute elite actions.
|
||||||
actions = torch.cat([gaussian_actions, pi_actions], dim=1)
|
actions = torch.cat([gaussian_actions, pi_actions], dim=1)
|
||||||
value = self.estimate_value(z, actions).nan_to_num_(0)
|
value = self.estimate_value(z, actions).nan_to_num_(0)
|
||||||
elite_idxs = torch.topk(value, self.config.n_elites, dim=0).indices
|
elite_idxs = torch.topk(value, self.config.n_elites, dim=0).indices # (n_elites, batch)
|
||||||
elite_value, elite_actions = value[elite_idxs], actions[:, elite_idxs]
|
elite_value = value.take_along_dim(elite_idxs, dim=0) # (n_elites, batch)
|
||||||
|
# (horizon, n_elites, batch, action_dim)
|
||||||
|
elite_actions = actions.take_along_dim(einops.rearrange(elite_idxs, "n b -> 1 n b 1"), dim=1)
|
||||||
|
|
||||||
# Update guassian PDF parameters to be the (weighted) mean and standard deviation of the elites.
|
# Update gaussian PDF parameters to be the (weighted) mean and standard deviation of the elites.
|
||||||
max_value = elite_value.max(0)[0]
|
max_value = elite_value.max(0, keepdim=True)[0] # (1, batch)
|
||||||
# The weighting is a softmax over trajectory values. Note that this is not the same as the usage
|
# The weighting is a softmax over trajectory values. Note that this is not the same as the usage
|
||||||
# of Ω in eqn 4 of the TD-MPC paper. Instead it is the normalized version of it: s = Ω/ΣΩ. This
|
# of Ω in eqn 4 of the TD-MPC paper. Instead it is the normalized version of it: s = Ω/ΣΩ. This
|
||||||
# makes the equations: μ = Σ(s⋅Γ), σ = Σ(s⋅(Γ-μ)²).
|
# makes the equations: μ = Σ(s⋅Γ), σ = Σ(s⋅(Γ-μ)²).
|
||||||
score = torch.exp(self.config.elite_weighting_temperature * (elite_value - max_value))
|
score = torch.exp(self.config.elite_weighting_temperature * (elite_value - max_value))
|
||||||
score /= score.sum()
|
score /= score.sum(axis=0, keepdim=True)
|
||||||
_mean = torch.sum(einops.rearrange(score, "n -> n 1") * elite_actions, dim=1)
|
# (horizon, batch, action_dim)
|
||||||
|
_mean = torch.sum(einops.rearrange(score, "n b -> n b 1") * elite_actions, dim=1)
|
||||||
_std = torch.sqrt(
|
_std = torch.sqrt(
|
||||||
torch.sum(
|
torch.sum(
|
||||||
einops.rearrange(score, "n -> n 1")
|
einops.rearrange(score, "n b -> n b 1")
|
||||||
* (elite_actions - einops.rearrange(_mean, "h d -> h 1 d")) ** 2,
|
* (elite_actions - einops.rearrange(_mean, "h b d -> h 1 b d")) ** 2,
|
||||||
dim=1,
|
dim=1,
|
||||||
)
|
)
|
||||||
)
|
)
|
||||||
@@ -255,11 +268,9 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
|
|
||||||
# Randomly select one of the elite actions from the last iteration of MPPI/CEM using the softmax
|
# Randomly select one of the elite actions from the last iteration of MPPI/CEM using the softmax
|
||||||
# scores from the last iteration.
|
# scores from the last iteration.
|
||||||
actions = elite_actions[:, torch.multinomial(score, 1).item()]
|
actions = elite_actions[:, torch.multinomial(score.T, 1).squeeze(), torch.arange(batch_size)]
|
||||||
|
|
||||||
# Select only the first action
|
return actions
|
||||||
action = actions[0]
|
|
||||||
return action
|
|
||||||
|
|
||||||
@torch.no_grad()
|
@torch.no_grad()
|
||||||
def estimate_value(self, z: Tensor, actions: Tensor):
|
def estimate_value(self, z: Tensor, actions: Tensor):
|
||||||
@@ -311,12 +322,17 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
G -= running_discount * self.config.uncertainty_regularizer_coeff * terminal_values.std(0)
|
G -= running_discount * self.config.uncertainty_regularizer_coeff * terminal_values.std(0)
|
||||||
return G
|
return G
|
||||||
|
|
||||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor | float]:
|
||||||
"""Run the batch through the model and compute the loss."""
|
"""Run the batch through the model and compute the loss.
|
||||||
|
|
||||||
|
Returns a dictionary with loss as a tensor, and other information as native floats.
|
||||||
|
"""
|
||||||
device = get_device_from_parameters(self)
|
device = get_device_from_parameters(self)
|
||||||
|
|
||||||
batch = self.normalize_inputs(batch)
|
batch = self.normalize_inputs(batch)
|
||||||
batch["observation.image"] = batch[self.input_image_key]
|
if self._use_image:
|
||||||
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
|
batch["observation.image"] = batch[self.input_image_key]
|
||||||
batch = self.normalize_targets(batch)
|
batch = self.normalize_targets(batch)
|
||||||
|
|
||||||
info = {}
|
info = {}
|
||||||
@@ -326,12 +342,12 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
if batch[key].ndim > 1:
|
if batch[key].ndim > 1:
|
||||||
batch[key] = batch[key].transpose(1, 0)
|
batch[key] = batch[key].transpose(1, 0)
|
||||||
|
|
||||||
action = batch["action"] # (t, b)
|
action = batch["action"] # (t, b, action_dim)
|
||||||
reward = batch["next.reward"] # (t,)
|
reward = batch["next.reward"] # (t, b)
|
||||||
observations = {k: v for k, v in batch.items() if k.startswith("observation.")}
|
observations = {k: v for k, v in batch.items() if k.startswith("observation.")}
|
||||||
|
|
||||||
# Apply random image augmentations.
|
# Apply random image augmentations.
|
||||||
if self.config.max_random_shift_ratio > 0:
|
if self._use_image and self.config.max_random_shift_ratio > 0:
|
||||||
observations["observation.image"] = flatten_forward_unflatten(
|
observations["observation.image"] = flatten_forward_unflatten(
|
||||||
partial(random_shifts_aug, max_random_shift_ratio=self.config.max_random_shift_ratio),
|
partial(random_shifts_aug, max_random_shift_ratio=self.config.max_random_shift_ratio),
|
||||||
observations["observation.image"],
|
observations["observation.image"],
|
||||||
@@ -343,7 +359,9 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
for k in observations:
|
for k in observations:
|
||||||
current_observation[k] = observations[k][0]
|
current_observation[k] = observations[k][0]
|
||||||
next_observations[k] = observations[k][1:]
|
next_observations[k] = observations[k][1:]
|
||||||
horizon = next_observations["observation.image"].shape[0]
|
horizon, batch_size = next_observations[
|
||||||
|
"observation.image" if self._use_image else "observation.environment_state"
|
||||||
|
].shape[:2]
|
||||||
|
|
||||||
# Run latent rollout using the latent dynamics model and policy model.
|
# Run latent rollout using the latent dynamics model and policy model.
|
||||||
# Note this has shape `horizon+1` because there are `horizon` actions and a current `z`. Each action
|
# Note this has shape `horizon+1` because there are `horizon` actions and a current `z`. Each action
|
||||||
@@ -413,7 +431,8 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
# Compute state-action value loss (TD loss) for all of the Q functions in the ensemble.
|
# Compute state-action value loss (TD loss) for all of the Q functions in the ensemble.
|
||||||
q_value_loss = (
|
q_value_loss = (
|
||||||
(
|
(
|
||||||
F.mse_loss(
|
temporal_loss_coeffs
|
||||||
|
* F.mse_loss(
|
||||||
q_preds_ensemble,
|
q_preds_ensemble,
|
||||||
einops.repeat(q_targets, "t b -> e t b", e=q_preds_ensemble.shape[0]),
|
einops.repeat(q_targets, "t b -> e t b", e=q_preds_ensemble.shape[0]),
|
||||||
reduction="none",
|
reduction="none",
|
||||||
@@ -462,10 +481,11 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
|||||||
action_preds = self.model.pi(z_preds[:-1]) # (t, b, a)
|
action_preds = self.model.pi(z_preds[:-1]) # (t, b, a)
|
||||||
# Calculate the MSE between the actions and the action predictions.
|
# Calculate the MSE between the actions and the action predictions.
|
||||||
# Note: FOWM's original code calculates the log probability (wrt to a unit standard deviation
|
# Note: FOWM's original code calculates the log probability (wrt to a unit standard deviation
|
||||||
# gaussian) and sums over the action dimension. Computing the log probability amounts to multiplying
|
# gaussian) and sums over the action dimension. Computing the (negative) log probability amounts to
|
||||||
# the MSE by 0.5 and adding a constant offset (the log(2*pi) term) . Here we drop the constant offset
|
# multiplying the MSE by 0.5 and adding a constant offset (the log(2*pi)/2 term, times the action
|
||||||
# as it doesn't change the optimization step, and we drop the 0.5 as we instead make a configuration
|
# dimension). Here we drop the constant offset as it doesn't change the optimization step, and we drop
|
||||||
# parameter for it (see below where we compute the total loss).
|
# the 0.5 as we instead make a configuration parameter for it (see below where we compute the total
|
||||||
|
# loss).
|
||||||
mse = F.mse_loss(action_preds, action, reduction="none").sum(-1) # (t, b)
|
mse = F.mse_loss(action_preds, action, reduction="none").sum(-1) # (t, b)
|
||||||
# NOTE: The original implementation does not take the sum over the temporal dimension like with the
|
# NOTE: The original implementation does not take the sum over the temporal dimension like with the
|
||||||
# other losses.
|
# other losses.
|
||||||
@@ -726,6 +746,16 @@ class TDMPCObservationEncoder(nn.Module):
|
|||||||
nn.LayerNorm(config.latent_dim),
|
nn.LayerNorm(config.latent_dim),
|
||||||
nn.Sigmoid(),
|
nn.Sigmoid(),
|
||||||
)
|
)
|
||||||
|
if "observation.environment_state" in config.input_shapes:
|
||||||
|
self.env_state_enc_layers = nn.Sequential(
|
||||||
|
nn.Linear(
|
||||||
|
config.input_shapes["observation.environment_state"][0], config.state_encoder_hidden_dim
|
||||||
|
),
|
||||||
|
nn.ELU(),
|
||||||
|
nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
|
||||||
|
nn.LayerNorm(config.latent_dim),
|
||||||
|
nn.Sigmoid(),
|
||||||
|
)
|
||||||
|
|
||||||
def forward(self, obs_dict: dict[str, Tensor]) -> Tensor:
|
def forward(self, obs_dict: dict[str, Tensor]) -> Tensor:
|
||||||
"""Encode the image and/or state vector.
|
"""Encode the image and/or state vector.
|
||||||
@@ -734,8 +764,11 @@ class TDMPCObservationEncoder(nn.Module):
|
|||||||
over all features.
|
over all features.
|
||||||
"""
|
"""
|
||||||
feat = []
|
feat = []
|
||||||
|
# NOTE: Order of observations matters here.
|
||||||
if "observation.image" in self.config.input_shapes:
|
if "observation.image" in self.config.input_shapes:
|
||||||
feat.append(flatten_forward_unflatten(self.image_enc_layers, obs_dict["observation.image"]))
|
feat.append(flatten_forward_unflatten(self.image_enc_layers, obs_dict["observation.image"]))
|
||||||
|
if "observation.environment_state" in self.config.input_shapes:
|
||||||
|
feat.append(self.env_state_enc_layers(obs_dict["observation.environment_state"]))
|
||||||
if "observation.state" in self.config.input_shapes:
|
if "observation.state" in self.config.input_shapes:
|
||||||
feat.append(self.state_enc_layers(obs_dict["observation.state"]))
|
feat.append(self.state_enc_layers(obs_dict["observation.state"]))
|
||||||
return torch.stack(feat, dim=0).mean(0)
|
return torch.stack(feat, dim=0).mean(0)
|
||||||
|
|||||||
167
lerobot/common/policies/vqbet/configuration_vqbet.py
Normal file
167
lerobot/common/policies/vqbet/configuration_vqbet.py
Normal file
@@ -0,0 +1,167 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 Seungjae Lee and Yibin Wang and Haritheja Etukuru
|
||||||
|
# and H. Jin Kim and Nur Muhammad Mahi Shafiullah and Lerrel Pinto
|
||||||
|
# and The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
from dataclasses import dataclass, field
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class VQBeTConfig:
|
||||||
|
"""Configuration class for VQ-BeT.
|
||||||
|
|
||||||
|
Defaults are configured for training with PushT providing proprioceptive and single camera observations.
|
||||||
|
|
||||||
|
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||||
|
Those are: `input_shapes` and `output_shapes`.
|
||||||
|
|
||||||
|
Notes on the inputs and outputs:
|
||||||
|
- "observation.state" is required as an input key.
|
||||||
|
- At least one key starting with "observation.image is required as an input.
|
||||||
|
- If there are multiple keys beginning with "observation.image" they are treated as multiple camera
|
||||||
|
views. Right now we only support all images having the same shape.
|
||||||
|
- "action" is required as an output key.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
||||||
|
current step and additional steps going back).
|
||||||
|
n_action_pred_token: Total number of current token and future tokens that VQ-BeT predicts.
|
||||||
|
action_chunk_size: Action chunk size of each action prediction token.
|
||||||
|
input_shapes: A dictionary defining the shapes of the input data for the policy.
|
||||||
|
The key represents the input data name, and the value is a list indicating the dimensions
|
||||||
|
of the corresponding data. For example, "observation.image" refers to an input from
|
||||||
|
a camera with dimensions [3, 96, 96], indicating it has three color channels and 96x96 resolution.
|
||||||
|
Importantly, shapes doesnt include batch dimension or temporal dimension.
|
||||||
|
output_shapes: A dictionary defining the shapes of the output data for the policy.
|
||||||
|
The key represents the output data name, and the value is a list indicating the dimensions
|
||||||
|
of the corresponding data. For example, "action" refers to an output shape of [14], indicating
|
||||||
|
14-dimensional actions. Importantly, shapes doesnt include batch dimension or temporal dimension.
|
||||||
|
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||||
|
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||||
|
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||||
|
[-1, 1] range.
|
||||||
|
output_normalization_modes: Similar dictionary as `normalize_input_modes`, but to unnormalize to the
|
||||||
|
original scale. Note that this is also used for normalizing the training targets.
|
||||||
|
vision_backbone: Name of the torchvision resnet backbone to use for encoding images.
|
||||||
|
crop_shape: (H, W) shape to crop images to as a preprocessing step for the vision backbone. Must fit
|
||||||
|
within the image size. If None, no cropping is done.
|
||||||
|
crop_is_random: Whether the crop should be random at training time (it's always a center crop in eval
|
||||||
|
mode).
|
||||||
|
pretrained_backbone_weights: Pretrained weights from torchvision to initalize the backbone.
|
||||||
|
`None` means no pretrained weights.
|
||||||
|
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
||||||
|
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
||||||
|
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
||||||
|
n_vqvae_training_steps: Number of optimization steps for training Residual VQ.
|
||||||
|
vqvae_n_embed: Number of embedding vectors in the RVQ dictionary (each layer).
|
||||||
|
vqvae_embedding_dim: Dimension of each embedding vector in the RVQ dictionary.
|
||||||
|
vqvae_enc_hidden_dim: Size of hidden dimensions of Encoder / Decoder part of Residaul VQ-VAE
|
||||||
|
gpt_block_size: Max block size of minGPT (should be larger than the number of input tokens)
|
||||||
|
gpt_input_dim: Size of output input of GPT. This is also used as the dimension of observation features.
|
||||||
|
gpt_output_dim: Size of output dimension of GPT. This is also used as a input dimension of offset / bin prediction headers.
|
||||||
|
gpt_n_layer: Number of layers of GPT
|
||||||
|
gpt_n_head: Number of headers of GPT
|
||||||
|
gpt_hidden_dim: Size of hidden dimensions of GPT
|
||||||
|
dropout: Dropout rate for GPT
|
||||||
|
mlp_hidden_dim: Size of hidden dimensions of offset header / bin prediction headers parts of VQ-BeT
|
||||||
|
offset_loss_weight: A constant that is multiplied to the offset loss
|
||||||
|
primary_code_loss_weight: A constant that is multiplied to the primary code prediction loss
|
||||||
|
secondary_code_loss_weight: A constant that is multiplied to the secondary code prediction loss
|
||||||
|
bet_softmax_temperature: Sampling temperature of code for rollout with VQ-BeT
|
||||||
|
sequentially_select: Whether select code of primary / secondary as sequentially (pick primary code,
|
||||||
|
and then select secodnary code), or at the same time.
|
||||||
|
"""
|
||||||
|
|
||||||
|
# Inputs / output structure.
|
||||||
|
n_obs_steps: int = 5
|
||||||
|
n_action_pred_token: int = 3
|
||||||
|
action_chunk_size: int = 5
|
||||||
|
|
||||||
|
input_shapes: dict[str, list[int]] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"observation.image": [3, 96, 96],
|
||||||
|
"observation.state": [2],
|
||||||
|
}
|
||||||
|
)
|
||||||
|
output_shapes: dict[str, list[int]] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"action": [2],
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
# Normalization / Unnormalization
|
||||||
|
input_normalization_modes: dict[str, str] = field(
|
||||||
|
default_factory=lambda: {
|
||||||
|
"observation.image": "mean_std",
|
||||||
|
"observation.state": "min_max",
|
||||||
|
}
|
||||||
|
)
|
||||||
|
output_normalization_modes: dict[str, str] = field(default_factory=lambda: {"action": "min_max"})
|
||||||
|
|
||||||
|
# Architecture / modeling.
|
||||||
|
# Vision backbone.
|
||||||
|
vision_backbone: str = "resnet18"
|
||||||
|
crop_shape: tuple[int, int] | None = (84, 84)
|
||||||
|
crop_is_random: bool = True
|
||||||
|
pretrained_backbone_weights: str | None = None
|
||||||
|
use_group_norm: bool = True
|
||||||
|
spatial_softmax_num_keypoints: int = 32
|
||||||
|
# VQ-VAE
|
||||||
|
n_vqvae_training_steps: int = 20000
|
||||||
|
vqvae_n_embed: int = 16
|
||||||
|
vqvae_embedding_dim: int = 256
|
||||||
|
vqvae_enc_hidden_dim: int = 128
|
||||||
|
# VQ-BeT
|
||||||
|
gpt_block_size: int = 500
|
||||||
|
gpt_input_dim: int = 512
|
||||||
|
gpt_output_dim: int = 512
|
||||||
|
gpt_n_layer: int = 8
|
||||||
|
gpt_n_head: int = 8
|
||||||
|
gpt_hidden_dim: int = 512
|
||||||
|
dropout: float = 0.1
|
||||||
|
mlp_hidden_dim: int = 1024
|
||||||
|
offset_loss_weight: float = 10000.0
|
||||||
|
primary_code_loss_weight: float = 5.0
|
||||||
|
secondary_code_loss_weight: float = 0.5
|
||||||
|
bet_softmax_temperature: float = 0.1
|
||||||
|
sequentially_select: bool = False
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
"""Input validation (not exhaustive)."""
|
||||||
|
if not self.vision_backbone.startswith("resnet"):
|
||||||
|
raise ValueError(
|
||||||
|
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||||
|
)
|
||||||
|
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
||||||
|
if self.crop_shape is not None:
|
||||||
|
for image_key in image_keys:
|
||||||
|
if (
|
||||||
|
self.crop_shape[0] > self.input_shapes[image_key][1]
|
||||||
|
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
||||||
|
):
|
||||||
|
raise ValueError(
|
||||||
|
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
||||||
|
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
||||||
|
"`input_shapes[{image_key}]`."
|
||||||
|
)
|
||||||
|
# Check that all input images have the same shape.
|
||||||
|
first_image_key = next(iter(image_keys))
|
||||||
|
for image_key in image_keys:
|
||||||
|
if self.input_shapes[image_key] != self.input_shapes[first_image_key]:
|
||||||
|
raise ValueError(
|
||||||
|
f"`input_shapes[{image_key}]` does not match `input_shapes[{first_image_key}]`, but we "
|
||||||
|
"expect all image shapes to match."
|
||||||
|
)
|
||||||
964
lerobot/common/policies/vqbet/modeling_vqbet.py
Normal file
964
lerobot/common/policies/vqbet/modeling_vqbet.py
Normal file
@@ -0,0 +1,964 @@
|
|||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
# Copyright 2024 Seungjae Lee and Yibin Wang and Haritheja Etukuru
|
||||||
|
# and H. Jin Kim and Nur Muhammad Mahi Shafiullah and Lerrel Pinto
|
||||||
|
# and The HuggingFace Inc. team. All rights reserved.
|
||||||
|
#
|
||||||
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
# you may not use this file except in compliance with the License.
|
||||||
|
# You may obtain a copy of the License at
|
||||||
|
#
|
||||||
|
# http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
#
|
||||||
|
# Unless required by applicable law or agreed to in writing, software
|
||||||
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
# See the License for the specific language governing permissions and
|
||||||
|
# limitations under the License.
|
||||||
|
|
||||||
|
import math
|
||||||
|
import warnings
|
||||||
|
from collections import deque
|
||||||
|
from typing import Callable, List
|
||||||
|
|
||||||
|
import einops
|
||||||
|
import numpy as np
|
||||||
|
import torch
|
||||||
|
import torch.nn.functional as F # noqa: N812
|
||||||
|
import torchvision
|
||||||
|
from huggingface_hub import PyTorchModelHubMixin
|
||||||
|
from torch import Tensor, nn
|
||||||
|
from torch.optim.lr_scheduler import LambdaLR
|
||||||
|
|
||||||
|
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||||
|
from lerobot.common.policies.utils import get_device_from_parameters, populate_queues
|
||||||
|
from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
|
||||||
|
from lerobot.common.policies.vqbet.vqbet_utils import GPT, ResidualVQ
|
||||||
|
|
||||||
|
# ruff: noqa: N806
|
||||||
|
|
||||||
|
|
||||||
|
class VQBeTPolicy(
|
||||||
|
nn.Module,
|
||||||
|
PyTorchModelHubMixin,
|
||||||
|
library_name="lerobot",
|
||||||
|
repo_url="https://github.com/huggingface/lerobot",
|
||||||
|
tags=["robotics", "vqbet"],
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
VQ-BeT Policy as per "Behavior Generation with Latent Actions"
|
||||||
|
"""
|
||||||
|
|
||||||
|
name = "vqbet"
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
config: VQBeTConfig | None = None,
|
||||||
|
dataset_stats: dict[str, dict[str, Tensor]] | None = None,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
config: Policy configuration class instance or None, in which case the default instantiation of
|
||||||
|
the configuration class is used.
|
||||||
|
dataset_stats: Dataset statistics to be used for normalization. If not passed here, it is expected
|
||||||
|
that they will be passed with a call to `load_state_dict` before the policy is used.
|
||||||
|
"""
|
||||||
|
super().__init__()
|
||||||
|
if config is None:
|
||||||
|
config = VQBeTConfig()
|
||||||
|
self.config = config
|
||||||
|
self.normalize_inputs = Normalize(
|
||||||
|
config.input_shapes, config.input_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
self.normalize_targets = Normalize(
|
||||||
|
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
self.unnormalize_outputs = Unnormalize(
|
||||||
|
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||||
|
)
|
||||||
|
|
||||||
|
self.vqbet = VQBeTModel(config)
|
||||||
|
|
||||||
|
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||||
|
|
||||||
|
self.reset()
|
||||||
|
|
||||||
|
def reset(self):
|
||||||
|
"""
|
||||||
|
Clear observation and action queues. Should be called on `env.reset()`
|
||||||
|
queues are populated during rollout of the policy, they contain the n latest observations and actions
|
||||||
|
"""
|
||||||
|
self._queues = {
|
||||||
|
"observation.images": deque(maxlen=self.config.n_obs_steps),
|
||||||
|
"observation.state": deque(maxlen=self.config.n_obs_steps),
|
||||||
|
"action": deque(maxlen=self.config.action_chunk_size),
|
||||||
|
}
|
||||||
|
|
||||||
|
@torch.no_grad
|
||||||
|
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||||
|
"""Select a single action given environment observations.
|
||||||
|
|
||||||
|
This method wraps `select_actions` in order to return one action at a time for execution in the
|
||||||
|
environment. It works by managing the actions in a queue and only calling `select_actions` when the
|
||||||
|
queue is empty.
|
||||||
|
"""
|
||||||
|
|
||||||
|
batch = self.normalize_inputs(batch)
|
||||||
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
|
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||||
|
# Note: It's important that this happens after stacking the images into a single key.
|
||||||
|
self._queues = populate_queues(self._queues, batch)
|
||||||
|
|
||||||
|
if not self.vqbet.action_head.vqvae_model.discretized.item():
|
||||||
|
warnings.warn(
|
||||||
|
"To evaluate in the environment, your VQ-BeT model should contain a pretrained Residual VQ.",
|
||||||
|
stacklevel=1,
|
||||||
|
)
|
||||||
|
|
||||||
|
if len(self._queues["action"]) == 0:
|
||||||
|
batch = {k: torch.stack(list(self._queues[k]), dim=1) for k in batch if k in self._queues}
|
||||||
|
actions = self.vqbet(batch, rollout=True)[:, : self.config.action_chunk_size]
|
||||||
|
|
||||||
|
# the dimension of returned action is (batch_size, action_chunk_size, action_dim)
|
||||||
|
actions = self.unnormalize_outputs({"action": actions})["action"]
|
||||||
|
# since the data in the action queue's dimension is (action_chunk_size, batch_size, action_dim), we transpose the action and fill the queue
|
||||||
|
self._queues["action"].extend(actions.transpose(0, 1))
|
||||||
|
|
||||||
|
action = self._queues["action"].popleft()
|
||||||
|
return action
|
||||||
|
|
||||||
|
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||||
|
"""Run the batch through the model and compute the loss for training or validation."""
|
||||||
|
batch = self.normalize_inputs(batch)
|
||||||
|
batch = dict(batch) # shallow copy so that adding a key doesn't modify the original
|
||||||
|
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||||
|
batch = self.normalize_targets(batch)
|
||||||
|
# VQ-BeT discretizes action using VQ-VAE before training BeT (please refer to section 3.2 in the VQ-BeT paper https://arxiv.org/pdf/2403.03181)
|
||||||
|
if not self.vqbet.action_head.vqvae_model.discretized.item():
|
||||||
|
# loss: total loss of training RVQ
|
||||||
|
# n_different_codes: how many of the total possible VQ codes are being used in single batch (how many of them have at least one encoder embedding as a nearest neighbor). This can be at most `vqvae_n_embed * number of layers of RVQ (=2)`.
|
||||||
|
# n_different_combinations: how many different code combinations are being used out of all possible combinations in single batch. This can be at most `vqvae_n_embed ^ number of layers of RVQ (=2)` (hint consider the RVQ as a decision tree).
|
||||||
|
loss, n_different_codes, n_different_combinations, recon_l1_error = (
|
||||||
|
self.vqbet.action_head.discretize(self.config.n_vqvae_training_steps, batch["action"])
|
||||||
|
)
|
||||||
|
return {
|
||||||
|
"loss": loss,
|
||||||
|
"n_different_codes": n_different_codes,
|
||||||
|
"n_different_combinations": n_different_combinations,
|
||||||
|
"recon_l1_error": recon_l1_error,
|
||||||
|
}
|
||||||
|
# if Residual VQ is already trained, VQ-BeT trains its GPT and bin prediction head / offset prediction head parts.
|
||||||
|
_, loss_dict = self.vqbet(batch, rollout=False)
|
||||||
|
|
||||||
|
return loss_dict
|
||||||
|
|
||||||
|
|
||||||
|
class SpatialSoftmax(nn.Module):
|
||||||
|
"""
|
||||||
|
Spatial Soft Argmax operation described in "Deep Spatial Autoencoders for Visuomotor Learning" by Finn et al.
|
||||||
|
(https://arxiv.org/pdf/1509.06113). A minimal port of the robomimic implementation.
|
||||||
|
|
||||||
|
At a high level, this takes 2D feature maps (from a convnet/ViT) and returns the "center of mass"
|
||||||
|
of activations of each channel, i.e., keypoints in the image space for the policy to focus on.
|
||||||
|
|
||||||
|
Example: take feature maps of size (512x10x12). We generate a grid of normalized coordinates (10x12x2):
|
||||||
|
-----------------------------------------------------
|
||||||
|
| (-1., -1.) | (-0.82, -1.) | ... | (1., -1.) |
|
||||||
|
| (-1., -0.78) | (-0.82, -0.78) | ... | (1., -0.78) |
|
||||||
|
| ... | ... | ... | ... |
|
||||||
|
| (-1., 1.) | (-0.82, 1.) | ... | (1., 1.) |
|
||||||
|
-----------------------------------------------------
|
||||||
|
This is achieved by applying channel-wise softmax over the activations (512x120) and computing the dot
|
||||||
|
product with the coordinates (120x2) to get expected points of maximal activation (512x2).
|
||||||
|
|
||||||
|
The example above results in 512 keypoints (corresponding to the 512 input channels). We can optionally
|
||||||
|
provide num_kp != None to control the number of keypoints. This is achieved by a first applying a learnable
|
||||||
|
linear mapping (in_channels, H, W) -> (num_kp, H, W).
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, input_shape, num_kp=None):
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
input_shape (list): (C, H, W) input feature map shape.
|
||||||
|
num_kp (int): number of keypoints in output. If None, output will have the same number of channels as input.
|
||||||
|
"""
|
||||||
|
super().__init__()
|
||||||
|
|
||||||
|
assert len(input_shape) == 3
|
||||||
|
self._in_c, self._in_h, self._in_w = input_shape
|
||||||
|
|
||||||
|
if num_kp is not None:
|
||||||
|
self.nets = torch.nn.Conv2d(self._in_c, num_kp, kernel_size=1)
|
||||||
|
self._out_c = num_kp
|
||||||
|
else:
|
||||||
|
self.nets = None
|
||||||
|
self._out_c = self._in_c
|
||||||
|
|
||||||
|
# we could use torch.linspace directly but that seems to behave slightly differently than numpy
|
||||||
|
# and causes a small degradation in pc_success of pre-trained models.
|
||||||
|
pos_x, pos_y = np.meshgrid(np.linspace(-1.0, 1.0, self._in_w), np.linspace(-1.0, 1.0, self._in_h))
|
||||||
|
pos_x = torch.from_numpy(pos_x.reshape(self._in_h * self._in_w, 1)).float()
|
||||||
|
pos_y = torch.from_numpy(pos_y.reshape(self._in_h * self._in_w, 1)).float()
|
||||||
|
# register as buffer so it's moved to the correct device.
|
||||||
|
self.register_buffer("pos_grid", torch.cat([pos_x, pos_y], dim=1))
|
||||||
|
|
||||||
|
def forward(self, features: Tensor) -> Tensor:
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
features: (B, C, H, W) input feature maps.
|
||||||
|
Returns:
|
||||||
|
(B, K, 2) image-space coordinates of keypoints.
|
||||||
|
"""
|
||||||
|
if self.nets is not None:
|
||||||
|
features = self.nets(features)
|
||||||
|
|
||||||
|
# [B, K, H, W] -> [B * K, H * W] where K is number of keypoints
|
||||||
|
features = features.reshape(-1, self._in_h * self._in_w)
|
||||||
|
# 2d softmax normalization
|
||||||
|
attention = F.softmax(features, dim=-1)
|
||||||
|
# [B * K, H * W] x [H * W, 2] -> [B * K, 2] for spatial coordinate mean in x and y dimensions
|
||||||
|
expected_xy = attention @ self.pos_grid
|
||||||
|
# reshape to [B, K, 2]
|
||||||
|
feature_keypoints = expected_xy.view(-1, self._out_c, 2)
|
||||||
|
|
||||||
|
return feature_keypoints
|
||||||
|
|
||||||
|
|
||||||
|
class VQBeTModel(nn.Module):
|
||||||
|
"""VQ-BeT: The underlying neural network for VQ-BeT
|
||||||
|
|
||||||
|
Note: In this code we use the terms `rgb_encoder`, 'policy', `action_head`. The meanings are as follows.
|
||||||
|
- The `rgb_encoder` process rgb-style image observations to one-dimensional embedding vectors
|
||||||
|
- A `policy` is a minGPT architecture, that takes observation sequences and action query tokens to generate `features`.
|
||||||
|
- These `features` pass through the action head, which passes through the code prediction, offset prediction head,
|
||||||
|
and finally generates a prediction for the action chunks.
|
||||||
|
|
||||||
|
-------------------------------** legend **-------------------------------
|
||||||
|
│ n = n_obs_steps, p = n_action_pred_token, c = action_chunk_size) │
|
||||||
|
│ o_{t} : visual observation at timestep {t} │
|
||||||
|
│ s_{t} : state observation at timestep {t} │
|
||||||
|
│ a_{t} : action at timestep {t} │
|
||||||
|
│ A_Q : action_query_token │
|
||||||
|
--------------------------------------------------------------------------
|
||||||
|
|
||||||
|
|
||||||
|
Training Phase 1. Discretize action using Residual VQ (for config.n_vqvae_training_steps steps)
|
||||||
|
|
||||||
|
|
||||||
|
┌─────────────────┐ ┌─────────────────┐ ┌─────────────────┐
|
||||||
|
│ │ │ │ │ │
|
||||||
|
│ RVQ encoder │ ─► │ Residual │ ─► │ RVQ Decoder │
|
||||||
|
│ (a_{t}~a_{t+p}) │ │ Code Quantizer │ │ │
|
||||||
|
│ │ │ │ │ │
|
||||||
|
└─────────────────┘ └─────────────────┘ └─────────────────┘
|
||||||
|
|
||||||
|
Training Phase 2.
|
||||||
|
|
||||||
|
timestep {t-n+1} timestep {t-n+2} timestep {t}
|
||||||
|
┌─────┴─────┐ ┌─────┴─────┐ ┌─────┴─────┐
|
||||||
|
|
||||||
|
o_{t-n+1} o_{t-n+2} ... o_{t}
|
||||||
|
│ │ │
|
||||||
|
│ s_{t-n+1} │ s_{t-n+2} ... │ s_{t} p
|
||||||
|
│ │ │ │ │ │ ┌───────┴───────┐
|
||||||
|
│ │ A_Q │ │ A_Q ... │ │ A_Q ... A_Q
|
||||||
|
│ │ │ │ │ │ │ │ │ │
|
||||||
|
┌───▼─────▼─────▼─────▼─────▼─────▼─────────────────▼─────▼─────▼───────────────▼───┐
|
||||||
|
│ │
|
||||||
|
│ GPT │ => policy
|
||||||
|
│ │
|
||||||
|
└───────────────▼─────────────────▼─────────────────────────────▼───────────────▼───┘
|
||||||
|
│ │ │ │
|
||||||
|
┌───┴───┐ ┌───┴───┐ ┌───┴───┐ ┌───┴───┐
|
||||||
|
code offset code offset code offset code offset
|
||||||
|
▼ │ ▼ │ ▼ │ ▼ │ => action_head
|
||||||
|
RVQ Decoder │ RVQ Decoder │ RVQ Decoder │ RVQ Decoder │
|
||||||
|
└── + ──┘ └── + ──┘ └── + ──┘ └── + ──┘
|
||||||
|
▼ ▼ ▼ ▼
|
||||||
|
action chunk action chunk action chunk action chunk
|
||||||
|
a_{t-n+1} ~ a_{t-n+2} ~ a_{t} ~ ... a_{t+p-1} ~
|
||||||
|
a_{t-n+c} a_{t-n+c+1} a_{t+c-1} a_{t+p+c-1}
|
||||||
|
|
||||||
|
▼
|
||||||
|
ONLY this chunk is used in rollout!
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, config: VQBeTConfig):
|
||||||
|
super().__init__()
|
||||||
|
self.config = config
|
||||||
|
|
||||||
|
self.rgb_encoder = VQBeTRgbEncoder(config)
|
||||||
|
self.num_images = len([k for k in config.input_shapes if k.startswith("observation.image")])
|
||||||
|
# This action query token is used as a prompt for querying action chunks. Please refer to "A_Q" in the image above.
|
||||||
|
# Note: During the forward pass, this token is repeated as many times as needed. The authors also experimented with initializing the necessary number of tokens independently and observed inferior results.
|
||||||
|
self.action_token = nn.Parameter(torch.randn(1, 1, self.config.gpt_input_dim))
|
||||||
|
|
||||||
|
# To input state and observation features into GPT layers, we first project the features to fit the shape of input size of GPT.
|
||||||
|
self.state_projector = MLP(
|
||||||
|
config.input_shapes["observation.state"][0], hidden_channels=[self.config.gpt_input_dim]
|
||||||
|
)
|
||||||
|
self.rgb_feature_projector = MLP(
|
||||||
|
self.rgb_encoder.feature_dim, hidden_channels=[self.config.gpt_input_dim]
|
||||||
|
)
|
||||||
|
|
||||||
|
# GPT part of VQ-BeT
|
||||||
|
self.policy = GPT(config)
|
||||||
|
# bin prediction head / offset prediction head part of VQ-BeT
|
||||||
|
self.action_head = VQBeTHead(config)
|
||||||
|
|
||||||
|
# Action tokens for: each observation step, the current action token, and all future action tokens.
|
||||||
|
num_tokens = self.config.n_action_pred_token + self.config.n_obs_steps - 1
|
||||||
|
self.register_buffer(
|
||||||
|
"select_target_actions_indices",
|
||||||
|
torch.row_stack([torch.arange(i, i + self.config.action_chunk_size) for i in range(num_tokens)]),
|
||||||
|
)
|
||||||
|
|
||||||
|
def forward(self, batch: dict[str, Tensor], rollout: bool) -> Tensor:
|
||||||
|
# Input validation.
|
||||||
|
assert set(batch).issuperset({"observation.state", "observation.images"})
|
||||||
|
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||||
|
assert n_obs_steps == self.config.n_obs_steps
|
||||||
|
|
||||||
|
# Extract image feature (first combine batch and sequence dims).
|
||||||
|
img_features = self.rgb_encoder(
|
||||||
|
einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
|
||||||
|
)
|
||||||
|
# Separate batch and sequence dims.
|
||||||
|
img_features = einops.rearrange(
|
||||||
|
img_features, "(b s n) ... -> b s n ...", b=batch_size, s=n_obs_steps, n=self.num_images
|
||||||
|
)
|
||||||
|
|
||||||
|
# Arrange prior and current observation step tokens as shown in the class docstring.
|
||||||
|
# First project features to token dimension.
|
||||||
|
rgb_tokens = self.rgb_feature_projector(
|
||||||
|
img_features
|
||||||
|
) # (batch, obs_step, number of different cameras, projection dims)
|
||||||
|
input_tokens = [rgb_tokens[:, :, i] for i in range(rgb_tokens.size(2))]
|
||||||
|
input_tokens.append(
|
||||||
|
self.state_projector(batch["observation.state"])
|
||||||
|
) # (batch, obs_step, projection dims)
|
||||||
|
input_tokens.append(einops.repeat(self.action_token, "1 1 d -> b n d", b=batch_size, n=n_obs_steps))
|
||||||
|
# Interleave tokens by stacking and rearranging.
|
||||||
|
input_tokens = torch.stack(input_tokens, dim=2)
|
||||||
|
input_tokens = einops.rearrange(input_tokens, "b n t d -> b (n t) d")
|
||||||
|
|
||||||
|
len_additional_action_token = self.config.n_action_pred_token - 1
|
||||||
|
future_action_tokens = self.action_token.repeat(batch_size, len_additional_action_token, 1)
|
||||||
|
|
||||||
|
# add additional action query tokens for predicting future action chunks
|
||||||
|
input_tokens = torch.cat([input_tokens, future_action_tokens], dim=1)
|
||||||
|
|
||||||
|
# get action features (pass through GPT)
|
||||||
|
features = self.policy(input_tokens)
|
||||||
|
# len(self.config.input_shapes) is the number of different observation modes.
|
||||||
|
# this line gets the index of action prompt tokens.
|
||||||
|
historical_act_pred_index = np.arange(0, n_obs_steps) * (len(self.config.input_shapes) + 1) + len(
|
||||||
|
self.config.input_shapes
|
||||||
|
)
|
||||||
|
|
||||||
|
# only extract the output tokens at the position of action query:
|
||||||
|
# Behavior Transformer (BeT), and VQ-BeT are both sequence-to-sequence prediction models,
|
||||||
|
# mapping sequential observation to sequential action (please refer to section 2.2 in BeT paper https://arxiv.org/pdf/2206.11251).
|
||||||
|
# Thus, it predicts a historical action sequence, in addition to current and future actions (predicting future actions : optional).
|
||||||
|
if len_additional_action_token > 0:
|
||||||
|
features = torch.cat(
|
||||||
|
[features[:, historical_act_pred_index], features[:, -len_additional_action_token:]], dim=1
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
features = features[:, historical_act_pred_index]
|
||||||
|
# pass through action head
|
||||||
|
action_head_output = self.action_head(features)
|
||||||
|
# if rollout, VQ-BeT don't calculate loss
|
||||||
|
if rollout:
|
||||||
|
return action_head_output["predicted_action"][:, n_obs_steps - 1, :].reshape(
|
||||||
|
batch_size, self.config.action_chunk_size, -1
|
||||||
|
)
|
||||||
|
# else, it calculate overall loss (bin prediction loss, and offset loss)
|
||||||
|
else:
|
||||||
|
output = batch["action"][:, self.select_target_actions_indices]
|
||||||
|
loss = self.action_head.loss_fn(action_head_output, output, reduction="mean")
|
||||||
|
return action_head_output, loss
|
||||||
|
|
||||||
|
|
||||||
|
class VQBeTHead(nn.Module):
|
||||||
|
def __init__(self, config: VQBeTConfig):
|
||||||
|
"""
|
||||||
|
VQBeTHead takes output of GPT layers, and pass the feature through bin prediction head (`self.map_to_cbet_preds_bin`), and offset prediction head (`self.map_to_cbet_preds_offset`)
|
||||||
|
|
||||||
|
self.map_to_cbet_preds_bin: outputs probability of each code (for each layer).
|
||||||
|
The input dimension of `self.map_to_cbet_preds_bin` is same with the output of GPT,
|
||||||
|
and the output dimension of `self.map_to_cbet_preds_bin` is `self.vqvae_model.vqvae_num_layers (=fixed as 2) * self.config.vqvae_n_embed`.
|
||||||
|
if the agent select the code sequentially, we use self.map_to_cbet_preds_primary_bin and self.map_to_cbet_preds_secondary_bin instead of self._map_to_cbet_preds_bin.
|
||||||
|
|
||||||
|
self.map_to_cbet_preds_offset: output the predicted offsets for all the codes in all the layers.
|
||||||
|
The input dimension of ` self.map_to_cbet_preds_offset` is same with the output of GPT,
|
||||||
|
and the output dimension of ` self.map_to_cbet_preds_offset` is `self.vqvae_model.vqvae_num_layers (=fixed as 2) * self.config.vqvae_n_embed * config.action_chunk_size * config.output_shapes["action"][0]`.
|
||||||
|
"""
|
||||||
|
|
||||||
|
super().__init__()
|
||||||
|
self.config = config
|
||||||
|
# init vqvae
|
||||||
|
self.vqvae_model = VqVae(config)
|
||||||
|
if config.sequentially_select:
|
||||||
|
self.map_to_cbet_preds_primary_bin = MLP(
|
||||||
|
in_channels=config.gpt_output_dim,
|
||||||
|
hidden_channels=[self.config.vqvae_n_embed],
|
||||||
|
)
|
||||||
|
self.map_to_cbet_preds_secondary_bin = MLP(
|
||||||
|
in_channels=config.gpt_output_dim + self.config.vqvae_n_embed,
|
||||||
|
hidden_channels=[self.config.vqvae_n_embed],
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
self.map_to_cbet_preds_bin = MLP(
|
||||||
|
in_channels=config.gpt_output_dim,
|
||||||
|
hidden_channels=[self.vqvae_model.vqvae_num_layers * self.config.vqvae_n_embed],
|
||||||
|
)
|
||||||
|
self.map_to_cbet_preds_offset = MLP(
|
||||||
|
in_channels=config.gpt_output_dim,
|
||||||
|
hidden_channels=[
|
||||||
|
self.vqvae_model.vqvae_num_layers
|
||||||
|
* self.config.vqvae_n_embed
|
||||||
|
* config.action_chunk_size
|
||||||
|
* config.output_shapes["action"][0],
|
||||||
|
],
|
||||||
|
)
|
||||||
|
# loss
|
||||||
|
self._focal_loss_fn = FocalLoss(gamma=2.0)
|
||||||
|
|
||||||
|
def discretize(self, n_vqvae_training_steps, actions):
|
||||||
|
# Resize the action sequence data to fit the action chunk size using a sliding window approach.
|
||||||
|
actions = torch.cat(
|
||||||
|
[
|
||||||
|
actions[:, j : j + self.config.action_chunk_size, :]
|
||||||
|
for j in range(actions.shape[1] + 1 - self.config.action_chunk_size)
|
||||||
|
],
|
||||||
|
dim=0,
|
||||||
|
)
|
||||||
|
# `actions` is a tensor of shape (new_batch, action_chunk_size, action_dim) where new_batch is the number of possible chunks created from the original sequences using the sliding window.
|
||||||
|
|
||||||
|
loss, metric = self.vqvae_model.vqvae_forward(actions)
|
||||||
|
n_different_codes = sum(
|
||||||
|
[len(torch.unique(metric[2][:, i])) for i in range(self.vqvae_model.vqvae_num_layers)]
|
||||||
|
)
|
||||||
|
n_different_combinations = len(torch.unique(metric[2], dim=0))
|
||||||
|
recon_l1_error = metric[0].detach().cpu().item()
|
||||||
|
self.vqvae_model.optimized_steps += 1
|
||||||
|
# if we updated RVQ more than `n_vqvae_training_steps` steps, we freeze the RVQ part.
|
||||||
|
if self.vqvae_model.optimized_steps >= n_vqvae_training_steps:
|
||||||
|
self.vqvae_model.discretized = torch.tensor(True)
|
||||||
|
self.vqvae_model.vq_layer.freeze_codebook = torch.tensor(True)
|
||||||
|
print("Finished discretizing action data!")
|
||||||
|
self.vqvae_model.eval()
|
||||||
|
for param in self.vqvae_model.vq_layer.parameters():
|
||||||
|
param.requires_grad = False
|
||||||
|
return loss, n_different_codes, n_different_combinations, recon_l1_error
|
||||||
|
|
||||||
|
def forward(self, x, **kwargs):
|
||||||
|
# N is the batch size, and T is number of action query tokens, which are process through same GPT
|
||||||
|
N, T, _ = x.shape
|
||||||
|
# we calculate N and T side parallely. Thus, the dimensions would be
|
||||||
|
# (batch size * number of action query tokens, action chunk size, action dimension)
|
||||||
|
x = einops.rearrange(x, "N T WA -> (N T) WA")
|
||||||
|
|
||||||
|
# sample offsets
|
||||||
|
cbet_offsets = self.map_to_cbet_preds_offset(x)
|
||||||
|
cbet_offsets = einops.rearrange(
|
||||||
|
cbet_offsets,
|
||||||
|
"(NT) (G C WA) -> (NT) G C WA",
|
||||||
|
G=self.vqvae_model.vqvae_num_layers,
|
||||||
|
C=self.config.vqvae_n_embed,
|
||||||
|
)
|
||||||
|
# if self.config.sequentially_select is True, bin prediction head first sample the primary code, and then sample secondary code
|
||||||
|
if self.config.sequentially_select:
|
||||||
|
cbet_primary_logits = self.map_to_cbet_preds_primary_bin(x)
|
||||||
|
|
||||||
|
# select primary bin first
|
||||||
|
cbet_primary_probs = torch.softmax(
|
||||||
|
cbet_primary_logits / self.config.bet_softmax_temperature, dim=-1
|
||||||
|
)
|
||||||
|
NT, choices = cbet_primary_probs.shape
|
||||||
|
sampled_primary_centers = einops.rearrange(
|
||||||
|
torch.multinomial(cbet_primary_probs.view(-1, choices), num_samples=1),
|
||||||
|
"(NT) 1 -> NT",
|
||||||
|
NT=NT,
|
||||||
|
)
|
||||||
|
|
||||||
|
cbet_secondary_logits = self.map_to_cbet_preds_secondary_bin(
|
||||||
|
torch.cat(
|
||||||
|
(x, F.one_hot(sampled_primary_centers, num_classes=self.config.vqvae_n_embed)),
|
||||||
|
axis=1,
|
||||||
|
)
|
||||||
|
)
|
||||||
|
cbet_secondary_probs = torch.softmax(
|
||||||
|
cbet_secondary_logits / self.config.bet_softmax_temperature, dim=-1
|
||||||
|
)
|
||||||
|
sampled_secondary_centers = einops.rearrange(
|
||||||
|
torch.multinomial(cbet_secondary_probs.view(-1, choices), num_samples=1),
|
||||||
|
"(NT) 1 -> NT",
|
||||||
|
NT=NT,
|
||||||
|
)
|
||||||
|
sampled_centers = torch.stack((sampled_primary_centers, sampled_secondary_centers), axis=1)
|
||||||
|
cbet_logits = torch.stack([cbet_primary_logits, cbet_secondary_logits], dim=1)
|
||||||
|
# if self.config.sequentially_select is False, bin prediction head samples primary and secondary code at once.
|
||||||
|
else:
|
||||||
|
cbet_logits = self.map_to_cbet_preds_bin(x)
|
||||||
|
cbet_logits = einops.rearrange(
|
||||||
|
cbet_logits, "(NT) (G C) -> (NT) G C", G=self.vqvae_model.vqvae_num_layers
|
||||||
|
)
|
||||||
|
cbet_probs = torch.softmax(cbet_logits / self.config.bet_softmax_temperature, dim=-1)
|
||||||
|
NT, G, choices = cbet_probs.shape
|
||||||
|
sampled_centers = einops.rearrange(
|
||||||
|
torch.multinomial(cbet_probs.view(-1, choices), num_samples=1),
|
||||||
|
"(NT G) 1 -> NT G",
|
||||||
|
NT=NT,
|
||||||
|
)
|
||||||
|
|
||||||
|
device = get_device_from_parameters(self)
|
||||||
|
indices = (
|
||||||
|
torch.arange(NT, device=device).unsqueeze(1),
|
||||||
|
torch.arange(self.vqvae_model.vqvae_num_layers, device=device).unsqueeze(0),
|
||||||
|
sampled_centers,
|
||||||
|
)
|
||||||
|
# Use advanced indexing to sample the values (Extract the only offsets corresponding to the sampled codes.)
|
||||||
|
sampled_offsets = cbet_offsets[indices]
|
||||||
|
# Then, sum the offsets over the RVQ layers to get a net offset for the bin prediction
|
||||||
|
sampled_offsets = sampled_offsets.sum(dim=1)
|
||||||
|
with torch.no_grad():
|
||||||
|
# Get the centroids (= vectors corresponding to the codes) of each layer to pass it through RVQ decoder
|
||||||
|
return_decoder_input = self.vqvae_model.get_embeddings_from_code(sampled_centers).clone().detach()
|
||||||
|
# pass the centroids through decoder to get actions.
|
||||||
|
decoded_action = self.vqvae_model.get_action_from_latent(return_decoder_input).clone().detach()
|
||||||
|
# reshaped extracted offset to match with decoded centroids
|
||||||
|
sampled_offsets = einops.rearrange(
|
||||||
|
sampled_offsets, "NT (W A) -> NT W A", W=self.config.action_chunk_size
|
||||||
|
)
|
||||||
|
# add offset and decoded centroids
|
||||||
|
predicted_action = decoded_action + sampled_offsets
|
||||||
|
predicted_action = einops.rearrange(
|
||||||
|
predicted_action,
|
||||||
|
"(N T) W A -> N T (W A)",
|
||||||
|
N=N,
|
||||||
|
T=T,
|
||||||
|
W=self.config.action_chunk_size,
|
||||||
|
)
|
||||||
|
|
||||||
|
return {
|
||||||
|
"cbet_logits": cbet_logits,
|
||||||
|
"predicted_action": predicted_action,
|
||||||
|
"sampled_centers": sampled_centers,
|
||||||
|
"decoded_action": decoded_action,
|
||||||
|
}
|
||||||
|
|
||||||
|
def loss_fn(self, pred, target, **kwargs):
|
||||||
|
"""
|
||||||
|
for given ground truth action values (target), and prediction (pred) this function calculates the overall loss.
|
||||||
|
|
||||||
|
predicted_action: predicted action chunk (offset + decoded centroids)
|
||||||
|
sampled_centers: sampled centroids (code of RVQ)
|
||||||
|
decoded_action: decoded action, which is produced by passing sampled_centers through RVQ decoder
|
||||||
|
NT: batch size * T
|
||||||
|
T: number of action query tokens, which are process through same GPT
|
||||||
|
cbet_logits: probability of all codes in each layer
|
||||||
|
"""
|
||||||
|
action_seq = target
|
||||||
|
predicted_action = pred["predicted_action"]
|
||||||
|
sampled_centers = pred["sampled_centers"]
|
||||||
|
decoded_action = pred["decoded_action"]
|
||||||
|
NT = predicted_action.shape[0] * predicted_action.shape[1]
|
||||||
|
|
||||||
|
cbet_logits = pred["cbet_logits"]
|
||||||
|
|
||||||
|
predicted_action = einops.rearrange(
|
||||||
|
predicted_action, "N T (W A) -> (N T) W A", W=self.config.action_chunk_size
|
||||||
|
)
|
||||||
|
|
||||||
|
action_seq = einops.rearrange(action_seq, "N T W A -> (N T) W A")
|
||||||
|
# Figure out the loss for the actions.
|
||||||
|
# First, we need to find the closest cluster center for each ground truth action.
|
||||||
|
with torch.no_grad():
|
||||||
|
state_vq, action_bins = self.vqvae_model.get_code(action_seq) # action_bins: NT, G
|
||||||
|
|
||||||
|
# Now we can compute the loss.
|
||||||
|
|
||||||
|
# offset loss is L1 distance between the predicted action and ground truth action
|
||||||
|
offset_loss = F.l1_loss(action_seq, predicted_action)
|
||||||
|
|
||||||
|
# calculate primary code prediction loss
|
||||||
|
cbet_loss1 = self._focal_loss_fn(
|
||||||
|
cbet_logits[:, 0, :],
|
||||||
|
action_bins[:, 0],
|
||||||
|
)
|
||||||
|
# calculate secondary code prediction loss
|
||||||
|
cbet_loss2 = self._focal_loss_fn(
|
||||||
|
cbet_logits[:, 1, :],
|
||||||
|
action_bins[:, 1],
|
||||||
|
)
|
||||||
|
# add all the prediction loss
|
||||||
|
cbet_loss = (
|
||||||
|
cbet_loss1 * self.config.primary_code_loss_weight
|
||||||
|
+ cbet_loss2 * self.config.secondary_code_loss_weight
|
||||||
|
)
|
||||||
|
|
||||||
|
equal_primary_code_rate = torch.sum((action_bins[:, 0] == sampled_centers[:, 0]).int()) / (NT)
|
||||||
|
equal_secondary_code_rate = torch.sum((action_bins[:, 1] == sampled_centers[:, 1]).int()) / (NT)
|
||||||
|
|
||||||
|
action_mse_error = torch.mean((action_seq - predicted_action) ** 2)
|
||||||
|
vq_action_error = torch.mean(torch.abs(action_seq - decoded_action))
|
||||||
|
offset_action_error = torch.mean(torch.abs(action_seq - predicted_action))
|
||||||
|
action_error_max = torch.max(torch.abs(action_seq - predicted_action))
|
||||||
|
|
||||||
|
loss = cbet_loss + self.config.offset_loss_weight * offset_loss
|
||||||
|
|
||||||
|
loss_dict = {
|
||||||
|
"loss": loss,
|
||||||
|
"classification_loss": cbet_loss.detach().cpu().item(),
|
||||||
|
"offset_loss": offset_loss.detach().cpu().item(),
|
||||||
|
"equal_primary_code_rate": equal_primary_code_rate.detach().cpu().item(),
|
||||||
|
"equal_secondary_code_rate": equal_secondary_code_rate.detach().cpu().item(),
|
||||||
|
"vq_action_error": vq_action_error.detach().cpu().item(),
|
||||||
|
"offset_action_error": offset_action_error.detach().cpu().item(),
|
||||||
|
"action_error_max": action_error_max.detach().cpu().item(),
|
||||||
|
"action_mse_error": action_mse_error.detach().cpu().item(),
|
||||||
|
}
|
||||||
|
return loss_dict
|
||||||
|
|
||||||
|
|
||||||
|
class VQBeTOptimizer(torch.optim.Adam):
|
||||||
|
def __init__(self, policy, cfg):
|
||||||
|
vqvae_params = (
|
||||||
|
list(policy.vqbet.action_head.vqvae_model.encoder.parameters())
|
||||||
|
+ list(policy.vqbet.action_head.vqvae_model.decoder.parameters())
|
||||||
|
+ list(policy.vqbet.action_head.vqvae_model.vq_layer.parameters())
|
||||||
|
)
|
||||||
|
decay_params, no_decay_params = policy.vqbet.policy.configure_parameters()
|
||||||
|
decay_params = (
|
||||||
|
decay_params
|
||||||
|
+ list(policy.vqbet.rgb_encoder.parameters())
|
||||||
|
+ list(policy.vqbet.state_projector.parameters())
|
||||||
|
+ list(policy.vqbet.rgb_feature_projector.parameters())
|
||||||
|
+ [policy.vqbet.action_token]
|
||||||
|
+ list(policy.vqbet.action_head.map_to_cbet_preds_offset.parameters())
|
||||||
|
)
|
||||||
|
|
||||||
|
if cfg.policy.sequentially_select:
|
||||||
|
decay_params = (
|
||||||
|
decay_params
|
||||||
|
+ list(policy.vqbet.action_head.map_to_cbet_preds_primary_bin.parameters())
|
||||||
|
+ list(policy.vqbet.action_head.map_to_cbet_preds_secondary_bin.parameters())
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
decay_params = decay_params + list(policy.vqbet.action_head.map_to_cbet_preds_bin.parameters())
|
||||||
|
|
||||||
|
optim_groups = [
|
||||||
|
{
|
||||||
|
"params": decay_params,
|
||||||
|
"weight_decay": cfg.training.adam_weight_decay,
|
||||||
|
"lr": cfg.training.lr,
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"params": vqvae_params,
|
||||||
|
"weight_decay": 0.0001,
|
||||||
|
"lr": cfg.training.vqvae_lr,
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"params": no_decay_params,
|
||||||
|
"weight_decay": 0.0,
|
||||||
|
"lr": cfg.training.lr,
|
||||||
|
},
|
||||||
|
]
|
||||||
|
super().__init__(
|
||||||
|
optim_groups,
|
||||||
|
cfg.training.lr,
|
||||||
|
cfg.training.adam_betas,
|
||||||
|
cfg.training.adam_eps,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
class VQBeTScheduler(nn.Module):
|
||||||
|
def __init__(self, optimizer, cfg):
|
||||||
|
super().__init__()
|
||||||
|
n_vqvae_training_steps = cfg.training.n_vqvae_training_steps
|
||||||
|
|
||||||
|
num_warmup_steps = cfg.training.lr_warmup_steps
|
||||||
|
num_training_steps = cfg.training.offline_steps
|
||||||
|
num_cycles = 0.5
|
||||||
|
|
||||||
|
def lr_lambda(current_step):
|
||||||
|
if current_step < n_vqvae_training_steps:
|
||||||
|
return float(1)
|
||||||
|
else:
|
||||||
|
current_step = current_step - n_vqvae_training_steps
|
||||||
|
if current_step < num_warmup_steps:
|
||||||
|
return float(current_step) / float(max(1, num_warmup_steps))
|
||||||
|
progress = float(current_step - num_warmup_steps) / float(
|
||||||
|
max(1, num_training_steps - num_warmup_steps)
|
||||||
|
)
|
||||||
|
return max(0.0, 0.5 * (1.0 + math.cos(math.pi * float(num_cycles) * 2.0 * progress)))
|
||||||
|
|
||||||
|
self.lr_scheduler = LambdaLR(optimizer, lr_lambda, -1)
|
||||||
|
|
||||||
|
def step(self):
|
||||||
|
self.lr_scheduler.step()
|
||||||
|
|
||||||
|
|
||||||
|
class VQBeTRgbEncoder(nn.Module):
|
||||||
|
"""Encode an RGB image into a 1D feature vector.
|
||||||
|
|
||||||
|
Includes the ability to normalize and crop the image first.
|
||||||
|
|
||||||
|
Same with DiffusionRgbEncoder from modeling_diffusion.py
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, config: VQBeTConfig):
|
||||||
|
super().__init__()
|
||||||
|
# Set up optional preprocessing.
|
||||||
|
if config.crop_shape is not None:
|
||||||
|
self.do_crop = True
|
||||||
|
# Always use center crop for eval
|
||||||
|
self.center_crop = torchvision.transforms.CenterCrop(config.crop_shape)
|
||||||
|
if config.crop_is_random:
|
||||||
|
self.maybe_random_crop = torchvision.transforms.RandomCrop(config.crop_shape)
|
||||||
|
else:
|
||||||
|
self.maybe_random_crop = self.center_crop
|
||||||
|
else:
|
||||||
|
self.do_crop = False
|
||||||
|
|
||||||
|
# Set up backbone.
|
||||||
|
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
||||||
|
weights=config.pretrained_backbone_weights
|
||||||
|
)
|
||||||
|
# Note: This assumes that the layer4 feature map is children()[-3]
|
||||||
|
# TODO(alexander-soare): Use a safer alternative.
|
||||||
|
self.backbone = nn.Sequential(*(list(backbone_model.children())[:-2]))
|
||||||
|
if config.use_group_norm:
|
||||||
|
if config.pretrained_backbone_weights:
|
||||||
|
raise ValueError(
|
||||||
|
"You can't replace BatchNorm in a pretrained model without ruining the weights!"
|
||||||
|
)
|
||||||
|
self.backbone = _replace_submodules(
|
||||||
|
root_module=self.backbone,
|
||||||
|
predicate=lambda x: isinstance(x, nn.BatchNorm2d),
|
||||||
|
func=lambda x: nn.GroupNorm(num_groups=x.num_features // 16, num_channels=x.num_features),
|
||||||
|
)
|
||||||
|
|
||||||
|
# Set up pooling and final layers.
|
||||||
|
# Use a dry run to get the feature map shape.
|
||||||
|
# The dummy input should take the number of image channels from `config.input_shapes` and it should
|
||||||
|
# use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
|
||||||
|
# height and width from `config.input_shapes`.
|
||||||
|
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||||
|
assert len(image_keys) == 1
|
||||||
|
image_key = image_keys[0]
|
||||||
|
dummy_input_h_w = (
|
||||||
|
config.crop_shape if config.crop_shape is not None else config.input_shapes[image_key][1:]
|
||||||
|
)
|
||||||
|
dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *dummy_input_h_w))
|
||||||
|
with torch.inference_mode():
|
||||||
|
dummy_feature_map = self.backbone(dummy_input)
|
||||||
|
feature_map_shape = tuple(dummy_feature_map.shape[1:])
|
||||||
|
self.pool = SpatialSoftmax(feature_map_shape, num_kp=config.spatial_softmax_num_keypoints)
|
||||||
|
self.feature_dim = config.spatial_softmax_num_keypoints * 2
|
||||||
|
self.out = nn.Linear(config.spatial_softmax_num_keypoints * 2, self.feature_dim)
|
||||||
|
self.relu = nn.ReLU()
|
||||||
|
|
||||||
|
def forward(self, x: Tensor) -> Tensor:
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
x: (B, C, H, W) image tensor with pixel values in [0, 1].
|
||||||
|
Returns:
|
||||||
|
(B, D) image feature.
|
||||||
|
"""
|
||||||
|
# Preprocess: maybe crop (if it was set up in the __init__).
|
||||||
|
if self.do_crop:
|
||||||
|
if self.training: # noqa: SIM108
|
||||||
|
x = self.maybe_random_crop(x)
|
||||||
|
else:
|
||||||
|
# Always use center crop for eval.
|
||||||
|
x = self.center_crop(x)
|
||||||
|
# Extract backbone feature.
|
||||||
|
x = torch.flatten(self.pool(self.backbone(x)), start_dim=1)
|
||||||
|
# Final linear layer with non-linearity.
|
||||||
|
x = self.relu(self.out(x))
|
||||||
|
return x
|
||||||
|
|
||||||
|
|
||||||
|
def _replace_submodules(
|
||||||
|
root_module: nn.Module, predicate: Callable[[nn.Module], bool], func: Callable[[nn.Module], nn.Module]
|
||||||
|
) -> nn.Module:
|
||||||
|
"""
|
||||||
|
Args:
|
||||||
|
root_module: The module for which the submodules need to be replaced
|
||||||
|
predicate: Takes a module as an argument and must return True if the that module is to be replaced.
|
||||||
|
func: Takes a module as an argument and returns a new module to replace it with.
|
||||||
|
Returns:
|
||||||
|
The root module with its submodules replaced.
|
||||||
|
"""
|
||||||
|
if predicate(root_module):
|
||||||
|
return func(root_module)
|
||||||
|
|
||||||
|
replace_list = [k.split(".") for k, m in root_module.named_modules(remove_duplicate=True) if predicate(m)]
|
||||||
|
for *parents, k in replace_list:
|
||||||
|
parent_module = root_module
|
||||||
|
if len(parents) > 0:
|
||||||
|
parent_module = root_module.get_submodule(".".join(parents))
|
||||||
|
if isinstance(parent_module, nn.Sequential):
|
||||||
|
src_module = parent_module[int(k)]
|
||||||
|
else:
|
||||||
|
src_module = getattr(parent_module, k)
|
||||||
|
tgt_module = func(src_module)
|
||||||
|
if isinstance(parent_module, nn.Sequential):
|
||||||
|
parent_module[int(k)] = tgt_module
|
||||||
|
else:
|
||||||
|
setattr(parent_module, k, tgt_module)
|
||||||
|
# verify that all BN are replaced
|
||||||
|
assert not any(predicate(m) for _, m in root_module.named_modules(remove_duplicate=True))
|
||||||
|
return root_module
|
||||||
|
|
||||||
|
|
||||||
|
class VqVae(nn.Module):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
config: VQBeTConfig,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
VQ-VAE is composed of three parts: encoder, vq_layer, and decoder.
|
||||||
|
Encoder and decoder are MLPs consisting of an input, output layer, and hidden layer, respectively.
|
||||||
|
The vq_layer uses residual VQs.
|
||||||
|
|
||||||
|
This class contains functions for training the encoder and decoder along with the residual VQ layer (for trainign phase 1),
|
||||||
|
as well as functions to help BeT training part in training phase 2.
|
||||||
|
"""
|
||||||
|
|
||||||
|
super().__init__()
|
||||||
|
self.config = config
|
||||||
|
# 'discretized' indicates whether the Residual VQ part is trained or not. (After finishing the training, we set discretized=True)
|
||||||
|
self.register_buffer("discretized", torch.tensor(False))
|
||||||
|
self.optimized_steps = 0
|
||||||
|
# we use the fixed number of layers for Residual VQ across all environments.
|
||||||
|
self.vqvae_num_layers = 2
|
||||||
|
|
||||||
|
self.vq_layer = ResidualVQ(
|
||||||
|
dim=config.vqvae_embedding_dim,
|
||||||
|
num_quantizers=self.vqvae_num_layers,
|
||||||
|
codebook_size=config.vqvae_n_embed,
|
||||||
|
)
|
||||||
|
|
||||||
|
self.encoder = MLP(
|
||||||
|
in_channels=self.config.output_shapes["action"][0] * self.config.action_chunk_size,
|
||||||
|
hidden_channels=[
|
||||||
|
config.vqvae_enc_hidden_dim,
|
||||||
|
config.vqvae_enc_hidden_dim,
|
||||||
|
config.vqvae_embedding_dim,
|
||||||
|
],
|
||||||
|
)
|
||||||
|
self.decoder = MLP(
|
||||||
|
in_channels=config.vqvae_embedding_dim,
|
||||||
|
hidden_channels=[
|
||||||
|
config.vqvae_enc_hidden_dim,
|
||||||
|
config.vqvae_enc_hidden_dim,
|
||||||
|
self.config.output_shapes["action"][0] * self.config.action_chunk_size,
|
||||||
|
],
|
||||||
|
)
|
||||||
|
|
||||||
|
def get_embeddings_from_code(self, encoding_indices):
|
||||||
|
# This function gets code indices as inputs, and outputs embedding vectors corresponding to the code indices.
|
||||||
|
with torch.no_grad():
|
||||||
|
z_embed = self.vq_layer.get_codebook_vector_from_indices(encoding_indices)
|
||||||
|
# since the RVQ has multiple layers, it adds the vectors in the axis of layers to provide a vector for that code combination.
|
||||||
|
z_embed = z_embed.sum(dim=0)
|
||||||
|
return z_embed
|
||||||
|
|
||||||
|
def get_action_from_latent(self, latent):
|
||||||
|
# given latent vector, this function outputs the decoded action.
|
||||||
|
output = self.decoder(latent)
|
||||||
|
if self.config.action_chunk_size == 1:
|
||||||
|
return einops.rearrange(output, "N (T A) -> N T A", A=self.config.output_shapes["action"][0])
|
||||||
|
else:
|
||||||
|
return einops.rearrange(output, "N (T A) -> N T A", A=self.config.output_shapes["action"][0])
|
||||||
|
|
||||||
|
def get_code(self, state):
|
||||||
|
# in phase 2 of VQ-BeT training, we need a `ground truth labels of action data` to calculate the Focal loss for code prediction head. (please refer to section 3.3 in the paper https://arxiv.org/pdf/2403.03181)
|
||||||
|
# this function outputs the `GT code` of given action using frozen encoder and quantization layers. (please refer to Figure 2. in the paper https://arxiv.org/pdf/2403.03181)
|
||||||
|
state = einops.rearrange(state, "N T A -> N (T A)")
|
||||||
|
with torch.no_grad():
|
||||||
|
state_rep = self.encoder(state)
|
||||||
|
state_rep_shape = state_rep.shape[:-1]
|
||||||
|
state_rep_flat = state_rep.view(state_rep.size(0), -1, state_rep.size(1))
|
||||||
|
state_rep_flat, vq_code, vq_loss_state = self.vq_layer(state_rep_flat)
|
||||||
|
state_vq = state_rep_flat.view(*state_rep_shape, -1)
|
||||||
|
vq_code = vq_code.view(*state_rep_shape, -1)
|
||||||
|
vq_loss_state = torch.sum(vq_loss_state)
|
||||||
|
return state_vq, vq_code
|
||||||
|
|
||||||
|
def vqvae_forward(self, state):
|
||||||
|
# This function passes the given data through Residual VQ with Encoder and Decoder. Please refer to section 3.2 in the paper https://arxiv.org/pdf/2403.03181).
|
||||||
|
state = einops.rearrange(state, "N T A -> N (T A)")
|
||||||
|
# We start with passing action (or action chunk) at:t+n through the encoder ϕ.
|
||||||
|
state_rep = self.encoder(state)
|
||||||
|
state_rep_shape = state_rep.shape[:-1]
|
||||||
|
state_rep_flat = state_rep.view(state_rep.size(0), -1, state_rep.size(1))
|
||||||
|
# The resulting latent embedding vector x = ϕ(at:t+n) is then mapped to an embedding vector in the codebook of the RVQ layers by the nearest neighbor look-up.
|
||||||
|
state_rep_flat, vq_code, vq_loss_state = self.vq_layer(state_rep_flat)
|
||||||
|
state_vq = state_rep_flat.view(*state_rep_shape, -1)
|
||||||
|
vq_code = vq_code.view(*state_rep_shape, -1)
|
||||||
|
# since the RVQ has multiple layers, it adds the vectors in the axis of layers to provide a vector for that code combination.
|
||||||
|
vq_loss_state = torch.sum(vq_loss_state)
|
||||||
|
# Then, the discretized vector zq(x) is reconstructed as ψ(zq(x)) by passing through the decoder ψ.
|
||||||
|
dec_out = self.decoder(state_vq)
|
||||||
|
# Calculate L1 reconstruction loss
|
||||||
|
encoder_loss = (state - dec_out).abs().mean()
|
||||||
|
# add encoder reconstruction loss and commitment loss
|
||||||
|
rep_loss = encoder_loss + vq_loss_state * 5
|
||||||
|
|
||||||
|
metric = (
|
||||||
|
encoder_loss.clone().detach(),
|
||||||
|
vq_loss_state.clone().detach(),
|
||||||
|
vq_code,
|
||||||
|
rep_loss.item(),
|
||||||
|
)
|
||||||
|
return rep_loss, metric
|
||||||
|
|
||||||
|
|
||||||
|
class FocalLoss(nn.Module):
|
||||||
|
"""
|
||||||
|
From https://github.com/notmahi/miniBET/blob/main/behavior_transformer/bet.py
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, gamma: float = 0, size_average: bool = True):
|
||||||
|
super().__init__()
|
||||||
|
self.gamma = gamma
|
||||||
|
self.size_average = size_average
|
||||||
|
|
||||||
|
def forward(self, input, target):
|
||||||
|
if len(input.shape) == 3:
|
||||||
|
N, T, _ = input.shape
|
||||||
|
logpt = F.log_softmax(input, dim=-1)
|
||||||
|
logpt = logpt.gather(-1, target.view(N, T, 1)).view(N, T)
|
||||||
|
elif len(input.shape) == 2:
|
||||||
|
logpt = F.log_softmax(input, dim=-1)
|
||||||
|
logpt = logpt.gather(-1, target.view(-1, 1)).view(-1)
|
||||||
|
pt = logpt.exp()
|
||||||
|
|
||||||
|
loss = -1 * (1 - pt) ** self.gamma * logpt
|
||||||
|
if self.size_average:
|
||||||
|
return loss.mean()
|
||||||
|
else:
|
||||||
|
return loss.sum()
|
||||||
|
|
||||||
|
|
||||||
|
class MLP(torch.nn.Sequential):
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
in_channels: int,
|
||||||
|
hidden_channels: List[int],
|
||||||
|
):
|
||||||
|
layers = []
|
||||||
|
in_dim = in_channels
|
||||||
|
for hidden_dim in hidden_channels[:-1]:
|
||||||
|
layers.append(torch.nn.Linear(in_dim, hidden_dim))
|
||||||
|
layers.append(torch.nn.ReLU())
|
||||||
|
in_dim = hidden_dim
|
||||||
|
|
||||||
|
layers.append(torch.nn.Linear(in_dim, hidden_channels[-1]))
|
||||||
|
|
||||||
|
super().__init__(*layers)
|
||||||
1462
lerobot/common/policies/vqbet/vqbet_utils.py
Normal file
1462
lerobot/common/policies/vqbet/vqbet_utils.py
Normal file
File diff suppressed because it is too large
Load Diff
561
lerobot/common/robot_devices/cameras/intelrealsense.py
Normal file
561
lerobot/common/robot_devices/cameras/intelrealsense.py
Normal file
@@ -0,0 +1,561 @@
|
|||||||
|
"""
|
||||||
|
This file contains utilities for recording frames from Intel Realsense cameras.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import concurrent.futures
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import shutil
|
||||||
|
import threading
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from collections import Counter
|
||||||
|
from dataclasses import dataclass, replace
|
||||||
|
from pathlib import Path
|
||||||
|
from threading import Thread
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
from PIL import Image
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.utils import (
|
||||||
|
RobotDeviceAlreadyConnectedError,
|
||||||
|
RobotDeviceNotConnectedError,
|
||||||
|
busy_wait,
|
||||||
|
)
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
SERIAL_NUMBER_INDEX = 1
|
||||||
|
|
||||||
|
|
||||||
|
def find_cameras(raise_when_empty=True, mock=False) -> list[dict]:
|
||||||
|
"""
|
||||||
|
Find the names and the serial numbers of the Intel RealSense cameras
|
||||||
|
connected to the computer.
|
||||||
|
"""
|
||||||
|
if mock:
|
||||||
|
import tests.mock_pyrealsense2 as rs
|
||||||
|
else:
|
||||||
|
import pyrealsense2 as rs
|
||||||
|
|
||||||
|
cameras = []
|
||||||
|
for device in rs.context().query_devices():
|
||||||
|
serial_number = int(device.get_info(rs.camera_info(SERIAL_NUMBER_INDEX)))
|
||||||
|
name = device.get_info(rs.camera_info.name)
|
||||||
|
cameras.append(
|
||||||
|
{
|
||||||
|
"serial_number": serial_number,
|
||||||
|
"name": name,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
if raise_when_empty and len(cameras) == 0:
|
||||||
|
raise OSError(
|
||||||
|
"Not a single camera was detected. Try re-plugging, or re-installing `librealsense` and its python wrapper `pyrealsense2`, or updating the firmware."
|
||||||
|
)
|
||||||
|
|
||||||
|
return cameras
|
||||||
|
|
||||||
|
|
||||||
|
def save_image(img_array, serial_number, frame_index, images_dir):
|
||||||
|
try:
|
||||||
|
img = Image.fromarray(img_array)
|
||||||
|
path = images_dir / f"camera_{serial_number}_frame_{frame_index:06d}.png"
|
||||||
|
path.parent.mkdir(parents=True, exist_ok=True)
|
||||||
|
img.save(str(path), quality=100)
|
||||||
|
logging.info(f"Saved image: {path}")
|
||||||
|
except Exception as e:
|
||||||
|
logging.error(f"Failed to save image for camera {serial_number} frame {frame_index}: {e}")
|
||||||
|
|
||||||
|
|
||||||
|
def save_images_from_cameras(
|
||||||
|
images_dir: Path,
|
||||||
|
serial_numbers: list[int] | None = None,
|
||||||
|
fps=None,
|
||||||
|
width=None,
|
||||||
|
height=None,
|
||||||
|
record_time_s=2,
|
||||||
|
mock=False,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Initializes all the cameras and saves images to the directory. Useful to visually identify the camera
|
||||||
|
associated to a given serial number.
|
||||||
|
"""
|
||||||
|
if serial_numbers is None or len(serial_numbers) == 0:
|
||||||
|
camera_infos = find_cameras(mock=mock)
|
||||||
|
serial_numbers = [cam["serial_number"] for cam in camera_infos]
|
||||||
|
|
||||||
|
if mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
print("Connecting cameras")
|
||||||
|
cameras = []
|
||||||
|
for cam_sn in serial_numbers:
|
||||||
|
print(f"{cam_sn=}")
|
||||||
|
camera = IntelRealSenseCamera(cam_sn, fps=fps, width=width, height=height, mock=mock)
|
||||||
|
camera.connect()
|
||||||
|
print(
|
||||||
|
f"IntelRealSenseCamera({camera.serial_number}, fps={camera.fps}, width={camera.width}, height={camera.height}, color_mode={camera.color_mode})"
|
||||||
|
)
|
||||||
|
cameras.append(camera)
|
||||||
|
|
||||||
|
images_dir = Path(images_dir)
|
||||||
|
if images_dir.exists():
|
||||||
|
shutil.rmtree(
|
||||||
|
images_dir,
|
||||||
|
)
|
||||||
|
images_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
print(f"Saving images to {images_dir}")
|
||||||
|
frame_index = 0
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
try:
|
||||||
|
with concurrent.futures.ThreadPoolExecutor(max_workers=1) as executor:
|
||||||
|
while True:
|
||||||
|
now = time.perf_counter()
|
||||||
|
|
||||||
|
for camera in cameras:
|
||||||
|
# If we use async_read when fps is None, the loop will go full speed, and we will end up
|
||||||
|
# saving the same images from the cameras multiple times until the RAM/disk is full.
|
||||||
|
image = camera.read() if fps is None else camera.async_read()
|
||||||
|
if image is None:
|
||||||
|
print("No Frame")
|
||||||
|
|
||||||
|
bgr_converted_image = cv2.cvtColor(image, cv2.COLOR_RGB2BGR)
|
||||||
|
|
||||||
|
executor.submit(
|
||||||
|
save_image,
|
||||||
|
bgr_converted_image,
|
||||||
|
camera.serial_number,
|
||||||
|
frame_index,
|
||||||
|
images_dir,
|
||||||
|
)
|
||||||
|
|
||||||
|
if fps is not None:
|
||||||
|
dt_s = time.perf_counter() - now
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
if time.perf_counter() - start_time > record_time_s:
|
||||||
|
break
|
||||||
|
|
||||||
|
print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
|
||||||
|
|
||||||
|
frame_index += 1
|
||||||
|
finally:
|
||||||
|
print(f"Images have been saved to {images_dir}")
|
||||||
|
for camera in cameras:
|
||||||
|
camera.disconnect()
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class IntelRealSenseCameraConfig:
|
||||||
|
"""
|
||||||
|
Example of tested options for Intel Real Sense D405:
|
||||||
|
|
||||||
|
```python
|
||||||
|
IntelRealSenseCameraConfig(30, 640, 480)
|
||||||
|
IntelRealSenseCameraConfig(60, 640, 480)
|
||||||
|
IntelRealSenseCameraConfig(90, 640, 480)
|
||||||
|
IntelRealSenseCameraConfig(30, 1280, 720)
|
||||||
|
IntelRealSenseCameraConfig(30, 640, 480, use_depth=True)
|
||||||
|
IntelRealSenseCameraConfig(30, 640, 480, rotation=90)
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
fps: int | None = None
|
||||||
|
width: int | None = None
|
||||||
|
height: int | None = None
|
||||||
|
color_mode: str = "rgb"
|
||||||
|
channels: int | None = None
|
||||||
|
use_depth: bool = False
|
||||||
|
force_hardware_reset: bool = True
|
||||||
|
rotation: int | None = None
|
||||||
|
mock: bool = False
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
if self.color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"`color_mode` is expected to be 'rgb' or 'bgr', but {self.color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.channels = 3
|
||||||
|
|
||||||
|
at_least_one_is_not_none = self.fps is not None or self.width is not None or self.height is not None
|
||||||
|
at_least_one_is_none = self.fps is None or self.width is None or self.height is None
|
||||||
|
if at_least_one_is_not_none and at_least_one_is_none:
|
||||||
|
raise ValueError(
|
||||||
|
"For `fps`, `width` and `height`, either all of them need to be set, or none of them, "
|
||||||
|
f"but {self.fps=}, {self.width=}, {self.height=} were provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation not in [-90, None, 90, 180]:
|
||||||
|
raise ValueError(f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})")
|
||||||
|
|
||||||
|
|
||||||
|
class IntelRealSenseCamera:
|
||||||
|
"""
|
||||||
|
The IntelRealSenseCamera class is similar to OpenCVCamera class but adds additional features for Intel Real Sense cameras:
|
||||||
|
- is instantiated with the serial number of the camera - won't randomly change as it can be the case of OpenCVCamera for Linux,
|
||||||
|
- can also be instantiated with the camera's name — if it's unique — using IntelRealSenseCamera.init_from_name(),
|
||||||
|
- depth map can be returned.
|
||||||
|
|
||||||
|
To find the camera indices of your cameras, you can run our utility script that will save a few frames for each camera:
|
||||||
|
```bash
|
||||||
|
python lerobot/common/robot_devices/cameras/intelrealsense.py --images-dir outputs/images_from_intelrealsense_cameras
|
||||||
|
```
|
||||||
|
|
||||||
|
When an IntelRealSenseCamera is instantiated, if no specific config is provided, the default fps, width, height and color_mode
|
||||||
|
of the given camera will be used.
|
||||||
|
|
||||||
|
Example of usage:
|
||||||
|
```python
|
||||||
|
# Instantiate with its serial number
|
||||||
|
camera = IntelRealSenseCamera(128422271347)
|
||||||
|
# Or by its name if it's unique
|
||||||
|
camera = IntelRealSenseCamera.init_from_name("Intel RealSense D405")
|
||||||
|
camera.connect()
|
||||||
|
color_image = camera.read()
|
||||||
|
# when done using the camera, consider disconnecting
|
||||||
|
camera.disconnect()
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of changing default fps, width, height and color_mode:
|
||||||
|
```python
|
||||||
|
camera = IntelRealSenseCamera(serial_number, fps=30, width=1280, height=720)
|
||||||
|
camera = connect() # applies the settings, might error out if these settings are not compatible with the camera
|
||||||
|
|
||||||
|
camera = IntelRealSenseCamera(serial_number, fps=90, width=640, height=480)
|
||||||
|
camera = connect()
|
||||||
|
|
||||||
|
camera = IntelRealSenseCamera(serial_number, fps=90, width=640, height=480, color_mode="bgr")
|
||||||
|
camera = connect()
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of returning depth:
|
||||||
|
```python
|
||||||
|
camera = IntelRealSenseCamera(serial_number, use_depth=True)
|
||||||
|
camera.connect()
|
||||||
|
color_image, depth_map = camera.read()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
serial_number: int,
|
||||||
|
config: IntelRealSenseCameraConfig | None = None,
|
||||||
|
**kwargs,
|
||||||
|
):
|
||||||
|
if config is None:
|
||||||
|
config = IntelRealSenseCameraConfig()
|
||||||
|
|
||||||
|
# Overwrite the config arguments using kwargs
|
||||||
|
config = replace(config, **kwargs)
|
||||||
|
|
||||||
|
self.serial_number = serial_number
|
||||||
|
self.fps = config.fps
|
||||||
|
self.width = config.width
|
||||||
|
self.height = config.height
|
||||||
|
self.channels = config.channels
|
||||||
|
self.color_mode = config.color_mode
|
||||||
|
self.use_depth = config.use_depth
|
||||||
|
self.force_hardware_reset = config.force_hardware_reset
|
||||||
|
self.mock = config.mock
|
||||||
|
|
||||||
|
self.camera = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.thread = None
|
||||||
|
self.stop_event = None
|
||||||
|
self.color_image = None
|
||||||
|
self.depth_map = None
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
# TODO(alibets): Do we keep original width/height or do we define them after rotation?
|
||||||
|
self.rotation = None
|
||||||
|
if config.rotation == -90:
|
||||||
|
self.rotation = cv2.ROTATE_90_COUNTERCLOCKWISE
|
||||||
|
elif config.rotation == 90:
|
||||||
|
self.rotation = cv2.ROTATE_90_CLOCKWISE
|
||||||
|
elif config.rotation == 180:
|
||||||
|
self.rotation = cv2.ROTATE_180
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def init_from_name(cls, name: str, config: IntelRealSenseCameraConfig | None = None, **kwargs):
|
||||||
|
camera_infos = find_cameras()
|
||||||
|
camera_names = [cam["name"] for cam in camera_infos]
|
||||||
|
this_name_count = Counter(camera_names)[name]
|
||||||
|
if this_name_count > 1:
|
||||||
|
# TODO(aliberts): Test this with multiple identical cameras (Aloha)
|
||||||
|
raise ValueError(
|
||||||
|
f"Multiple {name} cameras have been detected. Please use their serial number to instantiate them."
|
||||||
|
)
|
||||||
|
|
||||||
|
name_to_serial_dict = {cam["name"]: cam["serial_number"] for cam in camera_infos}
|
||||||
|
cam_sn = name_to_serial_dict[name]
|
||||||
|
|
||||||
|
if config is None:
|
||||||
|
config = IntelRealSenseCameraConfig()
|
||||||
|
|
||||||
|
# Overwrite the config arguments using kwargs
|
||||||
|
config = replace(config, **kwargs)
|
||||||
|
|
||||||
|
return cls(serial_number=cam_sn, config=config, **kwargs)
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise RobotDeviceAlreadyConnectedError(
|
||||||
|
f"IntelRealSenseCamera({self.serial_number}) is already connected."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_pyrealsense2 as rs
|
||||||
|
else:
|
||||||
|
import pyrealsense2 as rs
|
||||||
|
|
||||||
|
config = rs.config()
|
||||||
|
config.enable_device(str(self.serial_number))
|
||||||
|
|
||||||
|
if self.fps and self.width and self.height:
|
||||||
|
# TODO(rcadene): can we set rgb8 directly?
|
||||||
|
config.enable_stream(rs.stream.color, self.width, self.height, rs.format.rgb8, self.fps)
|
||||||
|
else:
|
||||||
|
config.enable_stream(rs.stream.color)
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
if self.fps and self.width and self.height:
|
||||||
|
config.enable_stream(rs.stream.depth, self.width, self.height, rs.format.z16, self.fps)
|
||||||
|
else:
|
||||||
|
config.enable_stream(rs.stream.depth)
|
||||||
|
|
||||||
|
self.camera = rs.pipeline()
|
||||||
|
try:
|
||||||
|
profile = self.camera.start(config)
|
||||||
|
is_camera_open = True
|
||||||
|
except RuntimeError:
|
||||||
|
is_camera_open = False
|
||||||
|
traceback.print_exc()
|
||||||
|
|
||||||
|
# If the camera doesn't work, display the camera indices corresponding to
|
||||||
|
# valid cameras.
|
||||||
|
if not is_camera_open:
|
||||||
|
# Verify that the provided `serial_number` is valid before printing the traceback
|
||||||
|
camera_infos = find_cameras()
|
||||||
|
serial_numbers = [cam["serial_number"] for cam in camera_infos]
|
||||||
|
if self.serial_number not in serial_numbers:
|
||||||
|
raise ValueError(
|
||||||
|
f"`serial_number` is expected to be one of these available cameras {serial_numbers}, but {self.serial_number} is provided instead. "
|
||||||
|
"To find the serial number you should use, run `python lerobot/common/robot_devices/cameras/intelrealsense.py`."
|
||||||
|
)
|
||||||
|
|
||||||
|
raise OSError(f"Can't access IntelRealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
color_stream = profile.get_stream(rs.stream.color)
|
||||||
|
color_profile = color_stream.as_video_stream_profile()
|
||||||
|
actual_fps = color_profile.fps()
|
||||||
|
actual_width = color_profile.width()
|
||||||
|
actual_height = color_profile.height()
|
||||||
|
|
||||||
|
# Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
|
||||||
|
if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
|
||||||
|
# Using `OSError` since it's a broad that encompasses issues related to device communication
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.fps=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_fps}."
|
||||||
|
)
|
||||||
|
if self.width is not None and self.width != actual_width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.width=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_width}."
|
||||||
|
)
|
||||||
|
if self.height is not None and self.height != actual_height:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.height=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_height}."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.fps = round(actual_fps)
|
||||||
|
self.width = round(actual_width)
|
||||||
|
self.height = round(actual_height)
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def read(self, temporary_color: str | None = None) -> np.ndarray | tuple[np.ndarray, np.ndarray]:
|
||||||
|
"""Read a frame from the camera returned in the format height x width x channels (e.g. 480 x 640 x 3)
|
||||||
|
of type `np.uint8`, contrarily to the pytorch format which is float channel first.
|
||||||
|
|
||||||
|
When `use_depth=True`, returns a tuple `(color_image, depth_map)` with a depth map in the format
|
||||||
|
height x width (e.g. 480 x 640) of type np.uint16.
|
||||||
|
|
||||||
|
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
||||||
|
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
||||||
|
"""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
frame = self.camera.wait_for_frames(timeout_ms=5000)
|
||||||
|
|
||||||
|
color_frame = frame.get_color_frame()
|
||||||
|
|
||||||
|
if not color_frame:
|
||||||
|
raise OSError(f"Can't capture color image from IntelRealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
color_image = np.asanyarray(color_frame.get_data())
|
||||||
|
|
||||||
|
requested_color_mode = self.color_mode if temporary_color is None else temporary_color
|
||||||
|
if requested_color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
# IntelRealSense uses RGB format as default (red, green, blue).
|
||||||
|
if requested_color_mode == "bgr":
|
||||||
|
color_image = cv2.cvtColor(color_image, cv2.COLOR_RGB2BGR)
|
||||||
|
|
||||||
|
h, w, _ = color_image.shape
|
||||||
|
if h != self.height or w != self.width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
color_image = cv2.rotate(color_image, self.rotation)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the image
|
||||||
|
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the image was received
|
||||||
|
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
depth_frame = frame.get_depth_frame()
|
||||||
|
if not depth_frame:
|
||||||
|
raise OSError(f"Can't capture depth image from IntelRealSenseCamera({self.serial_number}).")
|
||||||
|
|
||||||
|
depth_map = np.asanyarray(depth_frame.get_data())
|
||||||
|
|
||||||
|
h, w = depth_map.shape
|
||||||
|
if h != self.height or w != self.width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't capture depth map with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
depth_map = cv2.rotate(depth_map, self.rotation)
|
||||||
|
|
||||||
|
return color_image, depth_map
|
||||||
|
else:
|
||||||
|
return color_image
|
||||||
|
|
||||||
|
def read_loop(self):
|
||||||
|
while not self.stop_event.is_set():
|
||||||
|
if self.use_depth:
|
||||||
|
self.color_image, self.depth_map = self.read()
|
||||||
|
else:
|
||||||
|
self.color_image = self.read()
|
||||||
|
|
||||||
|
def async_read(self):
|
||||||
|
"""Access the latest color image"""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.thread is None:
|
||||||
|
self.stop_event = threading.Event()
|
||||||
|
self.thread = Thread(target=self.read_loop, args=())
|
||||||
|
self.thread.daemon = True
|
||||||
|
self.thread.start()
|
||||||
|
|
||||||
|
num_tries = 0
|
||||||
|
while self.color_image is None:
|
||||||
|
# TODO(rcadene, aliberts): intelrealsense has diverged compared to opencv over here
|
||||||
|
num_tries += 1
|
||||||
|
time.sleep(1 / self.fps)
|
||||||
|
if num_tries > self.fps and (self.thread.ident is None or not self.thread.is_alive()):
|
||||||
|
raise Exception(
|
||||||
|
"The thread responsible for `self.async_read()` took too much time to start. There might be an issue. Verify that `self.thread.start()` has been called."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.use_depth:
|
||||||
|
return self.color_image, self.depth_map
|
||||||
|
else:
|
||||||
|
return self.color_image
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"IntelRealSenseCamera({self.serial_number}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.thread is not None and self.thread.is_alive():
|
||||||
|
# wait for the thread to finish
|
||||||
|
self.stop_event.set()
|
||||||
|
self.thread.join()
|
||||||
|
self.thread = None
|
||||||
|
self.stop_event = None
|
||||||
|
|
||||||
|
self.camera.stop()
|
||||||
|
self.camera = None
|
||||||
|
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser(
|
||||||
|
description="Save a few frames using `IntelRealSenseCamera` for all cameras connected to the computer, or a selected subset."
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--serial-numbers",
|
||||||
|
type=int,
|
||||||
|
nargs="*",
|
||||||
|
default=None,
|
||||||
|
help="List of serial numbers used to instantiate the `IntelRealSenseCamera`. If not provided, find and use all available camera indices.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--fps",
|
||||||
|
type=int,
|
||||||
|
default=30,
|
||||||
|
help="Set the number of frames recorded per seconds for all cameras. If not provided, use the default fps of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--width",
|
||||||
|
type=str,
|
||||||
|
default=640,
|
||||||
|
help="Set the width for all cameras. If not provided, use the default width of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--height",
|
||||||
|
type=str,
|
||||||
|
default=480,
|
||||||
|
help="Set the height for all cameras. If not provided, use the default height of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--images-dir",
|
||||||
|
type=Path,
|
||||||
|
default="outputs/images_from_intelrealsense_cameras",
|
||||||
|
help="Set directory to save a few frames for each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--record-time-s",
|
||||||
|
type=float,
|
||||||
|
default=2.0,
|
||||||
|
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
save_images_from_cameras(**vars(args))
|
||||||
520
lerobot/common/robot_devices/cameras/opencv.py
Normal file
520
lerobot/common/robot_devices/cameras/opencv.py
Normal file
@@ -0,0 +1,520 @@
|
|||||||
|
"""
|
||||||
|
This file contains utilities for recording frames from cameras. For more info look at `OpenCVCamera` docstring.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import argparse
|
||||||
|
import concurrent.futures
|
||||||
|
import math
|
||||||
|
import platform
|
||||||
|
import shutil
|
||||||
|
import threading
|
||||||
|
import time
|
||||||
|
from dataclasses import dataclass, replace
|
||||||
|
from pathlib import Path
|
||||||
|
from threading import Thread
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
from PIL import Image
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.utils import (
|
||||||
|
RobotDeviceAlreadyConnectedError,
|
||||||
|
RobotDeviceNotConnectedError,
|
||||||
|
busy_wait,
|
||||||
|
)
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
# The maximum opencv device index depends on your operating system. For instance,
|
||||||
|
# if you have 3 cameras, they should be associated to index 0, 1, and 2. This is the case
|
||||||
|
# on MacOS. However, on Ubuntu, the indices are different like 6, 16, 23.
|
||||||
|
# When you change the USB port or reboot the computer, the operating system might
|
||||||
|
# treat the same cameras as new devices. Thus we select a higher bound to search indices.
|
||||||
|
MAX_OPENCV_INDEX = 60
|
||||||
|
|
||||||
|
|
||||||
|
def find_cameras(raise_when_empty=False, max_index_search_range=MAX_OPENCV_INDEX, mock=False) -> list[dict]:
|
||||||
|
cameras = []
|
||||||
|
if platform.system() == "Linux":
|
||||||
|
print("Linux detected. Finding available camera indices through scanning '/dev/video*' ports")
|
||||||
|
possible_ports = [str(port) for port in Path("/dev").glob("video*")]
|
||||||
|
ports = _find_cameras(possible_ports, mock=mock)
|
||||||
|
for port in ports:
|
||||||
|
cameras.append(
|
||||||
|
{
|
||||||
|
"port": port,
|
||||||
|
"index": int(port.removeprefix("/dev/video")),
|
||||||
|
}
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
print(
|
||||||
|
"Mac or Windows detected. Finding available camera indices through "
|
||||||
|
f"scanning all indices from 0 to {MAX_OPENCV_INDEX}"
|
||||||
|
)
|
||||||
|
possible_indices = range(max_index_search_range)
|
||||||
|
indices = _find_cameras(possible_indices, mock=mock)
|
||||||
|
for index in indices:
|
||||||
|
cameras.append(
|
||||||
|
{
|
||||||
|
"port": None,
|
||||||
|
"index": index,
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
return cameras
|
||||||
|
|
||||||
|
|
||||||
|
def _find_cameras(
|
||||||
|
possible_camera_ids: list[int | str], raise_when_empty=False, mock=False
|
||||||
|
) -> list[int | str]:
|
||||||
|
if mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
camera_ids = []
|
||||||
|
for camera_idx in possible_camera_ids:
|
||||||
|
camera = cv2.VideoCapture(camera_idx)
|
||||||
|
is_open = camera.isOpened()
|
||||||
|
camera.release()
|
||||||
|
|
||||||
|
if is_open:
|
||||||
|
print(f"Camera found at index {camera_idx}")
|
||||||
|
camera_ids.append(camera_idx)
|
||||||
|
|
||||||
|
if raise_when_empty and len(camera_ids) == 0:
|
||||||
|
raise OSError(
|
||||||
|
"Not a single camera was detected. Try re-plugging, or re-installing `opencv2`, "
|
||||||
|
"or your camera driver, or make sure your camera is compatible with opencv2."
|
||||||
|
)
|
||||||
|
|
||||||
|
return camera_ids
|
||||||
|
|
||||||
|
|
||||||
|
def is_valid_unix_path(path: str) -> bool:
|
||||||
|
"""Note: if 'path' points to a symlink, this will return True only if the target exists"""
|
||||||
|
p = Path(path)
|
||||||
|
return p.is_absolute() and p.exists()
|
||||||
|
|
||||||
|
|
||||||
|
def get_camera_index_from_unix_port(port: Path) -> int:
|
||||||
|
return int(str(port.resolve()).removeprefix("/dev/video"))
|
||||||
|
|
||||||
|
|
||||||
|
def save_image(img_array, camera_index, frame_index, images_dir):
|
||||||
|
img = Image.fromarray(img_array)
|
||||||
|
path = images_dir / f"camera_{camera_index:02d}_frame_{frame_index:06d}.png"
|
||||||
|
path.parent.mkdir(parents=True, exist_ok=True)
|
||||||
|
img.save(str(path), quality=100)
|
||||||
|
|
||||||
|
|
||||||
|
def save_images_from_cameras(
|
||||||
|
images_dir: Path,
|
||||||
|
camera_ids: list | None = None,
|
||||||
|
fps=None,
|
||||||
|
width=None,
|
||||||
|
height=None,
|
||||||
|
record_time_s=2,
|
||||||
|
mock=False,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Initializes all the cameras and saves images to the directory. Useful to visually identify the camera
|
||||||
|
associated to a given camera index.
|
||||||
|
"""
|
||||||
|
if camera_ids is None or len(camera_ids) == 0:
|
||||||
|
camera_infos = find_cameras(mock=mock)
|
||||||
|
camera_ids = [cam["index"] for cam in camera_infos]
|
||||||
|
|
||||||
|
print("Connecting cameras")
|
||||||
|
cameras = []
|
||||||
|
for cam_idx in camera_ids:
|
||||||
|
camera = OpenCVCamera(cam_idx, fps=fps, width=width, height=height, mock=mock)
|
||||||
|
camera.connect()
|
||||||
|
print(
|
||||||
|
f"OpenCVCamera({camera.camera_index}, fps={camera.fps}, width={camera.width}, "
|
||||||
|
f"height={camera.height}, color_mode={camera.color_mode})"
|
||||||
|
)
|
||||||
|
cameras.append(camera)
|
||||||
|
|
||||||
|
images_dir = Path(images_dir)
|
||||||
|
if images_dir.exists():
|
||||||
|
shutil.rmtree(
|
||||||
|
images_dir,
|
||||||
|
)
|
||||||
|
images_dir.mkdir(parents=True, exist_ok=True)
|
||||||
|
|
||||||
|
print(f"Saving images to {images_dir}")
|
||||||
|
frame_index = 0
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
with concurrent.futures.ThreadPoolExecutor(max_workers=1) as executor:
|
||||||
|
while True:
|
||||||
|
now = time.perf_counter()
|
||||||
|
|
||||||
|
for camera in cameras:
|
||||||
|
# If we use async_read when fps is None, the loop will go full speed, and we will endup
|
||||||
|
# saving the same images from the cameras multiple times until the RAM/disk is full.
|
||||||
|
image = camera.read() if fps is None else camera.async_read()
|
||||||
|
|
||||||
|
executor.submit(
|
||||||
|
save_image,
|
||||||
|
image,
|
||||||
|
camera.camera_index,
|
||||||
|
frame_index,
|
||||||
|
images_dir,
|
||||||
|
)
|
||||||
|
|
||||||
|
if fps is not None:
|
||||||
|
dt_s = time.perf_counter() - now
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
|
||||||
|
|
||||||
|
if time.perf_counter() - start_time > record_time_s:
|
||||||
|
break
|
||||||
|
|
||||||
|
frame_index += 1
|
||||||
|
|
||||||
|
print(f"Images have been saved to {images_dir}")
|
||||||
|
|
||||||
|
|
||||||
|
@dataclass
|
||||||
|
class OpenCVCameraConfig:
|
||||||
|
"""
|
||||||
|
Example of tested options for Intel Real Sense D405:
|
||||||
|
|
||||||
|
```python
|
||||||
|
OpenCVCameraConfig(30, 640, 480)
|
||||||
|
OpenCVCameraConfig(60, 640, 480)
|
||||||
|
OpenCVCameraConfig(90, 640, 480)
|
||||||
|
OpenCVCameraConfig(30, 1280, 720)
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
fps: int | None = None
|
||||||
|
width: int | None = None
|
||||||
|
height: int | None = None
|
||||||
|
color_mode: str = "rgb"
|
||||||
|
channels: int | None = None
|
||||||
|
rotation: int | None = None
|
||||||
|
mock: bool = False
|
||||||
|
|
||||||
|
def __post_init__(self):
|
||||||
|
if self.color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"`color_mode` is expected to be 'rgb' or 'bgr', but {self.color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.channels = 3
|
||||||
|
|
||||||
|
if self.rotation not in [-90, None, 90, 180]:
|
||||||
|
raise ValueError(f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})")
|
||||||
|
|
||||||
|
|
||||||
|
class OpenCVCamera:
|
||||||
|
"""
|
||||||
|
The OpenCVCamera class allows to efficiently record images from cameras. It relies on opencv2 to communicate
|
||||||
|
with the cameras. Most cameras are compatible. For more info, see the [Video I/O with OpenCV Overview](https://docs.opencv.org/4.x/d0/da7/videoio_overview.html).
|
||||||
|
|
||||||
|
An OpenCVCamera instance requires a camera index (e.g. `OpenCVCamera(camera_index=0)`). When you only have one camera
|
||||||
|
like a webcam of a laptop, the camera index is expected to be 0, but it might also be very different, and the camera index
|
||||||
|
might change if you reboot your computer or re-plug your camera. This behavior depends on your operation system.
|
||||||
|
|
||||||
|
To find the camera indices of your cameras, you can run our utility script that will be save a few frames for each camera:
|
||||||
|
```bash
|
||||||
|
python lerobot/common/robot_devices/cameras/opencv.py --images-dir outputs/images_from_opencv_cameras
|
||||||
|
```
|
||||||
|
|
||||||
|
When an OpenCVCamera is instantiated, if no specific config is provided, the default fps, width, height and color_mode
|
||||||
|
of the given camera will be used.
|
||||||
|
|
||||||
|
Example of usage:
|
||||||
|
```python
|
||||||
|
camera = OpenCVCamera(camera_index=0)
|
||||||
|
camera.connect()
|
||||||
|
color_image = camera.read()
|
||||||
|
# when done using the camera, consider disconnecting
|
||||||
|
camera.disconnect()
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of changing default fps, width, height and color_mode:
|
||||||
|
```python
|
||||||
|
camera = OpenCVCamera(0, fps=30, width=1280, height=720)
|
||||||
|
camera = connect() # applies the settings, might error out if these settings are not compatible with the camera
|
||||||
|
|
||||||
|
camera = OpenCVCamera(0, fps=90, width=640, height=480)
|
||||||
|
camera = connect()
|
||||||
|
|
||||||
|
camera = OpenCVCamera(0, fps=90, width=640, height=480, color_mode="bgr")
|
||||||
|
camera = connect()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, camera_index: int | str, config: OpenCVCameraConfig | None = None, **kwargs):
|
||||||
|
if config is None:
|
||||||
|
config = OpenCVCameraConfig()
|
||||||
|
|
||||||
|
# Overwrite config arguments using kwargs
|
||||||
|
config = replace(config, **kwargs)
|
||||||
|
|
||||||
|
self.camera_index = camera_index
|
||||||
|
self.port = None
|
||||||
|
|
||||||
|
# Linux uses ports for connecting to cameras
|
||||||
|
if platform.system() == "Linux":
|
||||||
|
if isinstance(self.camera_index, int):
|
||||||
|
self.port = Path(f"/dev/video{self.camera_index}")
|
||||||
|
elif isinstance(self.camera_index, str) and is_valid_unix_path(self.camera_index):
|
||||||
|
self.port = Path(self.camera_index)
|
||||||
|
# Retrieve the camera index from a potentially symlinked path
|
||||||
|
self.camera_index = get_camera_index_from_unix_port(self.port)
|
||||||
|
else:
|
||||||
|
raise ValueError(f"Please check the provided camera_index: {camera_index}")
|
||||||
|
|
||||||
|
self.fps = config.fps
|
||||||
|
self.width = config.width
|
||||||
|
self.height = config.height
|
||||||
|
self.channels = config.channels
|
||||||
|
self.color_mode = config.color_mode
|
||||||
|
self.mock = config.mock
|
||||||
|
|
||||||
|
self.camera = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.thread = None
|
||||||
|
self.stop_event = None
|
||||||
|
self.color_image = None
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
# TODO(aliberts): Do we keep original width/height or do we define them after rotation?
|
||||||
|
self.rotation = None
|
||||||
|
if config.rotation == -90:
|
||||||
|
self.rotation = cv2.ROTATE_90_COUNTERCLOCKWISE
|
||||||
|
elif config.rotation == 90:
|
||||||
|
self.rotation = cv2.ROTATE_90_CLOCKWISE
|
||||||
|
elif config.rotation == 180:
|
||||||
|
self.rotation = cv2.ROTATE_180
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise RobotDeviceAlreadyConnectedError(f"OpenCVCamera({self.camera_index}) is already connected.")
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
# Use 1 thread to avoid blocking the main thread. Especially useful during data collection
|
||||||
|
# when other threads are used to save the images.
|
||||||
|
cv2.setNumThreads(1)
|
||||||
|
|
||||||
|
camera_idx = f"/dev/video{self.camera_index}" if platform.system() == "Linux" else self.camera_index
|
||||||
|
# First create a temporary camera trying to access `camera_index`,
|
||||||
|
# and verify it is a valid camera by calling `isOpened`.
|
||||||
|
tmp_camera = cv2.VideoCapture(camera_idx)
|
||||||
|
is_camera_open = tmp_camera.isOpened()
|
||||||
|
# Release camera to make it accessible for `find_camera_indices`
|
||||||
|
tmp_camera.release()
|
||||||
|
del tmp_camera
|
||||||
|
|
||||||
|
# If the camera doesn't work, display the camera indices corresponding to
|
||||||
|
# valid cameras.
|
||||||
|
if not is_camera_open:
|
||||||
|
# Verify that the provided `camera_index` is valid before printing the traceback
|
||||||
|
cameras_info = find_cameras()
|
||||||
|
available_cam_ids = [cam["index"] for cam in cameras_info]
|
||||||
|
if self.camera_index not in available_cam_ids:
|
||||||
|
raise ValueError(
|
||||||
|
f"`camera_index` is expected to be one of these available cameras {available_cam_ids}, but {self.camera_index} is provided instead. "
|
||||||
|
"To find the camera index you should use, run `python lerobot/common/robot_devices/cameras/opencv.py`."
|
||||||
|
)
|
||||||
|
|
||||||
|
raise OSError(f"Can't access OpenCVCamera({camera_idx}).")
|
||||||
|
|
||||||
|
# Secondly, create the camera that will be used downstream.
|
||||||
|
# Note: For some unknown reason, calling `isOpened` blocks the camera which then
|
||||||
|
# needs to be re-created.
|
||||||
|
self.camera = cv2.VideoCapture(camera_idx)
|
||||||
|
|
||||||
|
if self.fps is not None:
|
||||||
|
self.camera.set(cv2.CAP_PROP_FPS, self.fps)
|
||||||
|
if self.width is not None:
|
||||||
|
self.camera.set(cv2.CAP_PROP_FRAME_WIDTH, self.width)
|
||||||
|
if self.height is not None:
|
||||||
|
self.camera.set(cv2.CAP_PROP_FRAME_HEIGHT, self.height)
|
||||||
|
|
||||||
|
actual_fps = self.camera.get(cv2.CAP_PROP_FPS)
|
||||||
|
actual_width = self.camera.get(cv2.CAP_PROP_FRAME_WIDTH)
|
||||||
|
actual_height = self.camera.get(cv2.CAP_PROP_FRAME_HEIGHT)
|
||||||
|
|
||||||
|
# Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
|
||||||
|
if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
|
||||||
|
# Using `OSError` since it's a broad that encompasses issues related to device communication
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.fps=} for OpenCVCamera({self.camera_index}). Actual value is {actual_fps}."
|
||||||
|
)
|
||||||
|
if self.width is not None and not math.isclose(self.width, actual_width, rel_tol=1e-3):
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.width=} for OpenCVCamera({self.camera_index}). Actual value is {actual_width}."
|
||||||
|
)
|
||||||
|
if self.height is not None and not math.isclose(self.height, actual_height, rel_tol=1e-3):
|
||||||
|
raise OSError(
|
||||||
|
f"Can't set {self.height=} for OpenCVCamera({self.camera_index}). Actual value is {actual_height}."
|
||||||
|
)
|
||||||
|
|
||||||
|
self.fps = round(actual_fps)
|
||||||
|
self.width = round(actual_width)
|
||||||
|
self.height = round(actual_height)
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def read(self, temporary_color_mode: str | None = None) -> np.ndarray:
|
||||||
|
"""Read a frame from the camera returned in the format (height, width, channels)
|
||||||
|
(e.g. 480 x 640 x 3), contrarily to the pytorch format which is channel first.
|
||||||
|
|
||||||
|
Note: Reading a frame is done every `camera.fps` times per second, and it is blocking.
|
||||||
|
If you are reading data from other sensors, we advise to use `camera.async_read()` which is non blocking version of `camera.read()`.
|
||||||
|
"""
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
ret, color_image = self.camera.read()
|
||||||
|
|
||||||
|
if not ret:
|
||||||
|
raise OSError(f"Can't capture color image from camera {self.camera_index}.")
|
||||||
|
|
||||||
|
requested_color_mode = self.color_mode if temporary_color_mode is None else temporary_color_mode
|
||||||
|
|
||||||
|
if requested_color_mode not in ["rgb", "bgr"]:
|
||||||
|
raise ValueError(
|
||||||
|
f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
# OpenCV uses BGR format as default (blue, green, red) for all operations, including displaying images.
|
||||||
|
# However, Deep Learning framework such as LeRobot uses RGB format as default to train neural networks,
|
||||||
|
# so we convert the image color from BGR to RGB.
|
||||||
|
if requested_color_mode == "rgb":
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_cv2 as cv2
|
||||||
|
else:
|
||||||
|
import cv2
|
||||||
|
|
||||||
|
color_image = cv2.cvtColor(color_image, cv2.COLOR_BGR2RGB)
|
||||||
|
|
||||||
|
h, w, _ = color_image.shape
|
||||||
|
if h != self.height or w != self.width:
|
||||||
|
raise OSError(
|
||||||
|
f"Can't capture color image with expected height and width ({self.height} x {self.width}). ({h} x {w}) returned instead."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.rotation is not None:
|
||||||
|
color_image = cv2.rotate(color_image, self.rotation)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the image
|
||||||
|
self.logs["delta_timestamp_s"] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the image was received
|
||||||
|
self.logs["timestamp_utc"] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
self.color_image = color_image
|
||||||
|
|
||||||
|
return color_image
|
||||||
|
|
||||||
|
def read_loop(self):
|
||||||
|
while not self.stop_event.is_set():
|
||||||
|
try:
|
||||||
|
self.color_image = self.read()
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error reading in thread: {e}")
|
||||||
|
|
||||||
|
def async_read(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.thread is None:
|
||||||
|
self.stop_event = threading.Event()
|
||||||
|
self.thread = Thread(target=self.read_loop, args=())
|
||||||
|
self.thread.daemon = True
|
||||||
|
self.thread.start()
|
||||||
|
|
||||||
|
num_tries = 0
|
||||||
|
while True:
|
||||||
|
if self.color_image is not None:
|
||||||
|
return self.color_image
|
||||||
|
|
||||||
|
time.sleep(1 / self.fps)
|
||||||
|
num_tries += 1
|
||||||
|
if num_tries > self.fps * 2:
|
||||||
|
raise TimeoutError("Timed out waiting for async_read() to start.")
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"OpenCVCamera({self.camera_index}) is not connected. Try running `camera.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.thread is not None:
|
||||||
|
self.stop_event.set()
|
||||||
|
self.thread.join() # wait for the thread to finish
|
||||||
|
self.thread = None
|
||||||
|
self.stop_event = None
|
||||||
|
|
||||||
|
self.camera.release()
|
||||||
|
self.camera = None
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == "__main__":
|
||||||
|
parser = argparse.ArgumentParser(
|
||||||
|
description="Save a few frames using `OpenCVCamera` for all cameras connected to the computer, or a selected subset."
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--camera-ids",
|
||||||
|
type=int,
|
||||||
|
nargs="*",
|
||||||
|
default=None,
|
||||||
|
help="List of camera indices used to instantiate the `OpenCVCamera`. If not provided, find and use all available camera indices.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--fps",
|
||||||
|
type=int,
|
||||||
|
default=None,
|
||||||
|
help="Set the number of frames recorded per seconds for all cameras. If not provided, use the default fps of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--width",
|
||||||
|
type=str,
|
||||||
|
default=None,
|
||||||
|
help="Set the width for all cameras. If not provided, use the default width of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--height",
|
||||||
|
type=str,
|
||||||
|
default=None,
|
||||||
|
help="Set the height for all cameras. If not provided, use the default height of each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--images-dir",
|
||||||
|
type=Path,
|
||||||
|
default="outputs/images_from_opencv_cameras",
|
||||||
|
help="Set directory to save a few frames for each camera.",
|
||||||
|
)
|
||||||
|
parser.add_argument(
|
||||||
|
"--record-time-s",
|
||||||
|
type=float,
|
||||||
|
default=4.0,
|
||||||
|
help="Set the number of seconds used to record the frames. By default, 2 seconds.",
|
||||||
|
)
|
||||||
|
args = parser.parse_args()
|
||||||
|
save_images_from_cameras(**vars(args))
|
||||||
11
lerobot/common/robot_devices/cameras/utils.py
Normal file
11
lerobot/common/robot_devices/cameras/utils.py
Normal file
@@ -0,0 +1,11 @@
|
|||||||
|
from typing import Protocol
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
|
||||||
|
|
||||||
|
# Defines a camera type
|
||||||
|
class Camera(Protocol):
|
||||||
|
def connect(self): ...
|
||||||
|
def read(self, temporary_color: str | None = None) -> np.ndarray: ...
|
||||||
|
def async_read(self) -> np.ndarray: ...
|
||||||
|
def disconnect(self): ...
|
||||||
382
lerobot/common/robot_devices/control_utils.py
Normal file
382
lerobot/common/robot_devices/control_utils.py
Normal file
@@ -0,0 +1,382 @@
|
|||||||
|
########################################################################################
|
||||||
|
# Utilities
|
||||||
|
########################################################################################
|
||||||
|
|
||||||
|
|
||||||
|
import logging
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from contextlib import nullcontext
|
||||||
|
from copy import copy
|
||||||
|
from functools import cache
|
||||||
|
|
||||||
|
import cv2
|
||||||
|
import torch
|
||||||
|
import tqdm
|
||||||
|
from deepdiff import DeepDiff
|
||||||
|
from termcolor import colored
|
||||||
|
|
||||||
|
from lerobot.common.datasets.image_writer import safe_stop_image_writer
|
||||||
|
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||||
|
from lerobot.common.datasets.utils import get_features_from_robot
|
||||||
|
from lerobot.common.policies.factory import make_policy
|
||||||
|
from lerobot.common.robot_devices.robots.utils import Robot
|
||||||
|
from lerobot.common.robot_devices.utils import busy_wait
|
||||||
|
from lerobot.common.utils.utils import get_safe_torch_device, init_hydra_config, set_global_seed
|
||||||
|
from lerobot.scripts.eval import get_pretrained_policy_path
|
||||||
|
|
||||||
|
|
||||||
|
def log_control_info(robot: Robot, dt_s, episode_index=None, frame_index=None, fps=None):
|
||||||
|
log_items = []
|
||||||
|
if episode_index is not None:
|
||||||
|
log_items.append(f"ep:{episode_index}")
|
||||||
|
if frame_index is not None:
|
||||||
|
log_items.append(f"frame:{frame_index}")
|
||||||
|
|
||||||
|
def log_dt(shortname, dt_val_s):
|
||||||
|
nonlocal log_items, fps
|
||||||
|
info_str = f"{shortname}:{dt_val_s * 1000:5.2f} ({1/ dt_val_s:3.1f}hz)"
|
||||||
|
if fps is not None:
|
||||||
|
actual_fps = 1 / dt_val_s
|
||||||
|
if actual_fps < fps - 1:
|
||||||
|
info_str = colored(info_str, "yellow")
|
||||||
|
log_items.append(info_str)
|
||||||
|
|
||||||
|
# total step time displayed in milliseconds and its frequency
|
||||||
|
log_dt("dt", dt_s)
|
||||||
|
|
||||||
|
# TODO(aliberts): move robot-specific logs logic in robot.print_logs()
|
||||||
|
if not robot.robot_type.startswith("stretch"):
|
||||||
|
for name in robot.leader_arms:
|
||||||
|
key = f"read_leader_{name}_pos_dt_s"
|
||||||
|
if key in robot.logs:
|
||||||
|
log_dt("dtRlead", robot.logs[key])
|
||||||
|
|
||||||
|
for name in robot.follower_arms:
|
||||||
|
key = f"write_follower_{name}_goal_pos_dt_s"
|
||||||
|
if key in robot.logs:
|
||||||
|
log_dt("dtWfoll", robot.logs[key])
|
||||||
|
|
||||||
|
key = f"read_follower_{name}_pos_dt_s"
|
||||||
|
if key in robot.logs:
|
||||||
|
log_dt("dtRfoll", robot.logs[key])
|
||||||
|
|
||||||
|
for name in robot.cameras:
|
||||||
|
key = f"read_camera_{name}_dt_s"
|
||||||
|
if key in robot.logs:
|
||||||
|
log_dt(f"dtR{name}", robot.logs[key])
|
||||||
|
|
||||||
|
info_str = " ".join(log_items)
|
||||||
|
logging.info(info_str)
|
||||||
|
|
||||||
|
|
||||||
|
@cache
|
||||||
|
def is_headless():
|
||||||
|
"""Detects if python is running without a monitor."""
|
||||||
|
try:
|
||||||
|
import pynput # noqa
|
||||||
|
|
||||||
|
return False
|
||||||
|
except Exception:
|
||||||
|
print(
|
||||||
|
"Error trying to import pynput. Switching to headless mode. "
|
||||||
|
"As a result, the video stream from the cameras won't be shown, "
|
||||||
|
"and you won't be able to change the control flow with keyboards. "
|
||||||
|
"For more info, see traceback below.\n"
|
||||||
|
)
|
||||||
|
traceback.print_exc()
|
||||||
|
print()
|
||||||
|
return True
|
||||||
|
|
||||||
|
|
||||||
|
def has_method(_object: object, method_name: str):
|
||||||
|
return hasattr(_object, method_name) and callable(getattr(_object, method_name))
|
||||||
|
|
||||||
|
|
||||||
|
def predict_action(observation, policy, device, use_amp):
|
||||||
|
observation = copy(observation)
|
||||||
|
with (
|
||||||
|
torch.inference_mode(),
|
||||||
|
torch.autocast(device_type=device.type) if device.type == "cuda" and use_amp else nullcontext(),
|
||||||
|
):
|
||||||
|
# Convert to pytorch format: channel first and float32 in [0,1] with batch dimension
|
||||||
|
for name in observation:
|
||||||
|
if "image" in name:
|
||||||
|
observation[name] = observation[name].type(torch.float32) / 255
|
||||||
|
observation[name] = observation[name].permute(2, 0, 1).contiguous()
|
||||||
|
observation[name] = observation[name].unsqueeze(0)
|
||||||
|
observation[name] = observation[name].to(device)
|
||||||
|
|
||||||
|
# Compute the next action with the policy
|
||||||
|
# based on the current observation
|
||||||
|
action = policy.select_action(observation)
|
||||||
|
|
||||||
|
# Remove batch dimension
|
||||||
|
action = action.squeeze(0)
|
||||||
|
|
||||||
|
# Move to cpu, if not already the case
|
||||||
|
action = action.to("cpu")
|
||||||
|
|
||||||
|
return action
|
||||||
|
|
||||||
|
|
||||||
|
def init_keyboard_listener(assign_rewards=False):
|
||||||
|
"""
|
||||||
|
Initializes a keyboard listener to enable early termination of an episode
|
||||||
|
or environment reset by pressing the right arrow key ('->'). This may require
|
||||||
|
sudo permissions to allow the terminal to monitor keyboard events.
|
||||||
|
|
||||||
|
Args:
|
||||||
|
assign_rewards (bool): If True, allows annotating the collected trajectory
|
||||||
|
with a binary reward at the end of the episode to indicate success.
|
||||||
|
"""
|
||||||
|
events = {}
|
||||||
|
events["exit_early"] = False
|
||||||
|
events["rerecord_episode"] = False
|
||||||
|
events["stop_recording"] = False
|
||||||
|
if assign_rewards:
|
||||||
|
events["next.reward"] = 0
|
||||||
|
|
||||||
|
if is_headless():
|
||||||
|
logging.warning(
|
||||||
|
"Headless environment detected. On-screen cameras display and keyboard inputs will not be available."
|
||||||
|
)
|
||||||
|
listener = None
|
||||||
|
return listener, events
|
||||||
|
|
||||||
|
# Only import pynput if not in a headless environment
|
||||||
|
from pynput import keyboard
|
||||||
|
|
||||||
|
def on_press(key):
|
||||||
|
try:
|
||||||
|
if key == keyboard.Key.right:
|
||||||
|
print("Right arrow key pressed. Exiting loop...")
|
||||||
|
events["exit_early"] = True
|
||||||
|
elif key == keyboard.Key.left:
|
||||||
|
print("Left arrow key pressed. Exiting loop and rerecord the last episode...")
|
||||||
|
events["rerecord_episode"] = True
|
||||||
|
events["exit_early"] = True
|
||||||
|
elif key == keyboard.Key.esc:
|
||||||
|
print("Escape key pressed. Stopping data recording...")
|
||||||
|
events["stop_recording"] = True
|
||||||
|
events["exit_early"] = True
|
||||||
|
elif assign_rewards and key == keyboard.Key.space:
|
||||||
|
events["next.reward"] = 1 if events["next.reward"] == 0 else 0
|
||||||
|
print(
|
||||||
|
"Space key pressed. Assigning new reward to the subsequent frames. New reward:",
|
||||||
|
events["next.reward"],
|
||||||
|
)
|
||||||
|
|
||||||
|
except Exception as e:
|
||||||
|
print(f"Error handling key press: {e}")
|
||||||
|
|
||||||
|
listener = keyboard.Listener(on_press=on_press)
|
||||||
|
listener.start()
|
||||||
|
|
||||||
|
return listener, events
|
||||||
|
|
||||||
|
|
||||||
|
def init_policy(pretrained_policy_name_or_path, policy_overrides):
|
||||||
|
"""Instantiate the policy and load fps, device and use_amp from config yaml"""
|
||||||
|
pretrained_policy_path = get_pretrained_policy_path(pretrained_policy_name_or_path)
|
||||||
|
hydra_cfg = init_hydra_config(pretrained_policy_path / "config.yaml", policy_overrides)
|
||||||
|
policy = make_policy(hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=pretrained_policy_path)
|
||||||
|
|
||||||
|
# Check device is available
|
||||||
|
device = get_safe_torch_device(hydra_cfg.device, log=True)
|
||||||
|
use_amp = hydra_cfg.use_amp
|
||||||
|
policy_fps = hydra_cfg.env.fps
|
||||||
|
|
||||||
|
policy.eval()
|
||||||
|
policy.to(device)
|
||||||
|
|
||||||
|
torch.backends.cudnn.benchmark = True
|
||||||
|
torch.backends.cuda.matmul.allow_tf32 = True
|
||||||
|
set_global_seed(hydra_cfg.seed)
|
||||||
|
return policy, policy_fps, device, use_amp
|
||||||
|
|
||||||
|
|
||||||
|
def warmup_record(
|
||||||
|
robot,
|
||||||
|
events,
|
||||||
|
enable_teleoperation,
|
||||||
|
warmup_time_s,
|
||||||
|
display_cameras,
|
||||||
|
fps,
|
||||||
|
):
|
||||||
|
control_loop(
|
||||||
|
robot=robot,
|
||||||
|
control_time_s=warmup_time_s,
|
||||||
|
display_cameras=display_cameras,
|
||||||
|
events=events,
|
||||||
|
fps=fps,
|
||||||
|
teleoperate=enable_teleoperation,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def record_episode(
|
||||||
|
robot,
|
||||||
|
dataset,
|
||||||
|
events,
|
||||||
|
episode_time_s,
|
||||||
|
display_cameras,
|
||||||
|
policy,
|
||||||
|
device,
|
||||||
|
use_amp,
|
||||||
|
fps,
|
||||||
|
):
|
||||||
|
control_loop(
|
||||||
|
robot=robot,
|
||||||
|
control_time_s=episode_time_s,
|
||||||
|
display_cameras=display_cameras,
|
||||||
|
dataset=dataset,
|
||||||
|
events=events,
|
||||||
|
policy=policy,
|
||||||
|
device=device,
|
||||||
|
use_amp=use_amp,
|
||||||
|
fps=fps,
|
||||||
|
teleoperate=policy is None,
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
@safe_stop_image_writer
|
||||||
|
def control_loop(
|
||||||
|
robot,
|
||||||
|
control_time_s=None,
|
||||||
|
teleoperate=False,
|
||||||
|
display_cameras=False,
|
||||||
|
dataset: LeRobotDataset | None = None,
|
||||||
|
events=None,
|
||||||
|
policy=None,
|
||||||
|
device=None,
|
||||||
|
use_amp=None,
|
||||||
|
fps=None,
|
||||||
|
):
|
||||||
|
# TODO(rcadene): Add option to record logs
|
||||||
|
if not robot.is_connected:
|
||||||
|
robot.connect()
|
||||||
|
|
||||||
|
if events is None:
|
||||||
|
events = {"exit_early": False}
|
||||||
|
|
||||||
|
if control_time_s is None:
|
||||||
|
control_time_s = float("inf")
|
||||||
|
|
||||||
|
if teleoperate and policy is not None:
|
||||||
|
raise ValueError("When `teleoperate` is True, `policy` should be None.")
|
||||||
|
|
||||||
|
if dataset is not None and fps is not None and dataset.fps != fps:
|
||||||
|
raise ValueError(f"The dataset fps should be equal to requested fps ({dataset['fps']} != {fps}).")
|
||||||
|
|
||||||
|
timestamp = 0
|
||||||
|
start_episode_t = time.perf_counter()
|
||||||
|
while timestamp < control_time_s:
|
||||||
|
start_loop_t = time.perf_counter()
|
||||||
|
|
||||||
|
if teleoperate:
|
||||||
|
observation, action = robot.teleop_step(record_data=True)
|
||||||
|
else:
|
||||||
|
observation = robot.capture_observation()
|
||||||
|
|
||||||
|
if policy is not None:
|
||||||
|
pred_action = predict_action(observation, policy, device, use_amp)
|
||||||
|
# Action can eventually be clipped using `max_relative_target`,
|
||||||
|
# so action actually sent is saved in the dataset.
|
||||||
|
action = robot.send_action(pred_action)
|
||||||
|
action = {"action": action}
|
||||||
|
|
||||||
|
if dataset is not None:
|
||||||
|
frame = {**observation, **action}
|
||||||
|
if "next.reward" in events:
|
||||||
|
frame["next.reward"] = events["next.reward"]
|
||||||
|
dataset.add_frame(frame)
|
||||||
|
|
||||||
|
if display_cameras and not is_headless():
|
||||||
|
image_keys = [key for key in observation if "image" in key]
|
||||||
|
for key in image_keys:
|
||||||
|
cv2.imshow(key, cv2.cvtColor(observation[key].numpy(), cv2.COLOR_RGB2BGR))
|
||||||
|
cv2.waitKey(1)
|
||||||
|
|
||||||
|
if fps is not None:
|
||||||
|
dt_s = time.perf_counter() - start_loop_t
|
||||||
|
busy_wait(1 / fps - dt_s)
|
||||||
|
|
||||||
|
dt_s = time.perf_counter() - start_loop_t
|
||||||
|
log_control_info(robot, dt_s, fps=fps)
|
||||||
|
|
||||||
|
timestamp = time.perf_counter() - start_episode_t
|
||||||
|
if events["exit_early"]:
|
||||||
|
events["exit_early"] = False
|
||||||
|
break
|
||||||
|
|
||||||
|
|
||||||
|
def reset_environment(robot, events, reset_time_s):
|
||||||
|
# TODO(rcadene): refactor warmup_record and reset_environment
|
||||||
|
# TODO(alibets): allow for teleop during reset
|
||||||
|
if has_method(robot, "teleop_safety_stop"):
|
||||||
|
robot.teleop_safety_stop()
|
||||||
|
|
||||||
|
timestamp = 0
|
||||||
|
start_vencod_t = time.perf_counter()
|
||||||
|
if "next.reward" in events:
|
||||||
|
events["next.reward"] = 0
|
||||||
|
|
||||||
|
# Wait if necessary
|
||||||
|
with tqdm.tqdm(total=reset_time_s, desc="Waiting") as pbar:
|
||||||
|
while timestamp < reset_time_s:
|
||||||
|
time.sleep(1)
|
||||||
|
timestamp = time.perf_counter() - start_vencod_t
|
||||||
|
pbar.update(1)
|
||||||
|
if events["exit_early"]:
|
||||||
|
events["exit_early"] = False
|
||||||
|
break
|
||||||
|
|
||||||
|
|
||||||
|
def stop_recording(robot, listener, display_cameras):
|
||||||
|
robot.disconnect()
|
||||||
|
|
||||||
|
if not is_headless():
|
||||||
|
if listener is not None:
|
||||||
|
listener.stop()
|
||||||
|
|
||||||
|
if display_cameras:
|
||||||
|
cv2.destroyAllWindows()
|
||||||
|
|
||||||
|
|
||||||
|
def sanity_check_dataset_name(repo_id, policy):
|
||||||
|
_, dataset_name = repo_id.split("/")
|
||||||
|
# either repo_id doesnt start with "eval_" and there is no policy
|
||||||
|
# or repo_id starts with "eval_" and there is a policy
|
||||||
|
|
||||||
|
# Check if dataset_name starts with "eval_" but policy is missing
|
||||||
|
if dataset_name.startswith("eval_") and policy is None:
|
||||||
|
raise ValueError(
|
||||||
|
f"Your dataset name begins with 'eval_' ({dataset_name}), but no policy is provided."
|
||||||
|
)
|
||||||
|
|
||||||
|
# Check if dataset_name does not start with "eval_" but policy is provided
|
||||||
|
if not dataset_name.startswith("eval_") and policy is not None:
|
||||||
|
raise ValueError(
|
||||||
|
f"Your dataset name does not begin with 'eval_' ({dataset_name}), but a policy is provided ({policy})."
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def sanity_check_dataset_robot_compatibility(
|
||||||
|
dataset: LeRobotDataset, robot: Robot, fps: int, use_videos: bool
|
||||||
|
) -> None:
|
||||||
|
fields = [
|
||||||
|
("robot_type", dataset.meta.robot_type, robot.robot_type),
|
||||||
|
("fps", dataset.fps, fps),
|
||||||
|
("features", dataset.features, get_features_from_robot(robot, use_videos)),
|
||||||
|
]
|
||||||
|
|
||||||
|
mismatches = []
|
||||||
|
for field, dataset_value, present_value in fields:
|
||||||
|
diff = DeepDiff(dataset_value, present_value, exclude_regex_paths=[r".*\['info'\]$"])
|
||||||
|
if diff:
|
||||||
|
mismatches.append(f"{field}: expected {present_value}, got {dataset_value}")
|
||||||
|
|
||||||
|
if mismatches:
|
||||||
|
raise ValueError(
|
||||||
|
"Dataset metadata compatibility check failed with mismatches:\n" + "\n".join(mismatches)
|
||||||
|
)
|
||||||
867
lerobot/common/robot_devices/motors/dynamixel.py
Normal file
867
lerobot/common/robot_devices/motors/dynamixel.py
Normal file
@@ -0,0 +1,867 @@
|
|||||||
|
import enum
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from copy import deepcopy
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import tqdm
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
PROTOCOL_VERSION = 2.0
|
||||||
|
BAUDRATE = 1_000_000
|
||||||
|
TIMEOUT_MS = 1000
|
||||||
|
|
||||||
|
MAX_ID_RANGE = 252
|
||||||
|
|
||||||
|
# The following bounds define the lower and upper joints range (after calibration).
|
||||||
|
# For joints in degree (i.e. revolute joints), their nominal range is [-180, 180] degrees
|
||||||
|
# which corresponds to a half rotation on the left and half rotation on the right.
|
||||||
|
# Some joints might require higher range, so we allow up to [-270, 270] degrees until
|
||||||
|
# an error is raised.
|
||||||
|
LOWER_BOUND_DEGREE = -270
|
||||||
|
UPPER_BOUND_DEGREE = 270
|
||||||
|
# For joints in percentage (i.e. joints that move linearly like the prismatic joint of a gripper),
|
||||||
|
# their nominal range is [0, 100] %. For instance, for Aloha gripper, 0% is fully
|
||||||
|
# closed, and 100% is fully open. To account for slight calibration issue, we allow up to
|
||||||
|
# [-10, 110] until an error is raised.
|
||||||
|
LOWER_BOUND_LINEAR = -10
|
||||||
|
UPPER_BOUND_LINEAR = 110
|
||||||
|
|
||||||
|
HALF_TURN_DEGREE = 180
|
||||||
|
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xl330-m077
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xl330-m288
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xl430-w250
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xm430-w350
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xm540-w270
|
||||||
|
# https://emanual.robotis.com/docs/en/dxl/x/xc430-w150
|
||||||
|
|
||||||
|
# data_name: (address, size_byte)
|
||||||
|
X_SERIES_CONTROL_TABLE = {
|
||||||
|
"Model_Number": (0, 2),
|
||||||
|
"Model_Information": (2, 4),
|
||||||
|
"Firmware_Version": (6, 1),
|
||||||
|
"ID": (7, 1),
|
||||||
|
"Baud_Rate": (8, 1),
|
||||||
|
"Return_Delay_Time": (9, 1),
|
||||||
|
"Drive_Mode": (10, 1),
|
||||||
|
"Operating_Mode": (11, 1),
|
||||||
|
"Secondary_ID": (12, 1),
|
||||||
|
"Protocol_Type": (13, 1),
|
||||||
|
"Homing_Offset": (20, 4),
|
||||||
|
"Moving_Threshold": (24, 4),
|
||||||
|
"Temperature_Limit": (31, 1),
|
||||||
|
"Max_Voltage_Limit": (32, 2),
|
||||||
|
"Min_Voltage_Limit": (34, 2),
|
||||||
|
"PWM_Limit": (36, 2),
|
||||||
|
"Current_Limit": (38, 2),
|
||||||
|
"Acceleration_Limit": (40, 4),
|
||||||
|
"Velocity_Limit": (44, 4),
|
||||||
|
"Max_Position_Limit": (48, 4),
|
||||||
|
"Min_Position_Limit": (52, 4),
|
||||||
|
"Shutdown": (63, 1),
|
||||||
|
"Torque_Enable": (64, 1),
|
||||||
|
"LED": (65, 1),
|
||||||
|
"Status_Return_Level": (68, 1),
|
||||||
|
"Registered_Instruction": (69, 1),
|
||||||
|
"Hardware_Error_Status": (70, 1),
|
||||||
|
"Velocity_I_Gain": (76, 2),
|
||||||
|
"Velocity_P_Gain": (78, 2),
|
||||||
|
"Position_D_Gain": (80, 2),
|
||||||
|
"Position_I_Gain": (82, 2),
|
||||||
|
"Position_P_Gain": (84, 2),
|
||||||
|
"Feedforward_2nd_Gain": (88, 2),
|
||||||
|
"Feedforward_1st_Gain": (90, 2),
|
||||||
|
"Bus_Watchdog": (98, 1),
|
||||||
|
"Goal_PWM": (100, 2),
|
||||||
|
"Goal_Current": (102, 2),
|
||||||
|
"Goal_Velocity": (104, 4),
|
||||||
|
"Profile_Acceleration": (108, 4),
|
||||||
|
"Profile_Velocity": (112, 4),
|
||||||
|
"Goal_Position": (116, 4),
|
||||||
|
"Realtime_Tick": (120, 2),
|
||||||
|
"Moving": (122, 1),
|
||||||
|
"Moving_Status": (123, 1),
|
||||||
|
"Present_PWM": (124, 2),
|
||||||
|
"Present_Current": (126, 2),
|
||||||
|
"Present_Velocity": (128, 4),
|
||||||
|
"Present_Position": (132, 4),
|
||||||
|
"Velocity_Trajectory": (136, 4),
|
||||||
|
"Position_Trajectory": (140, 4),
|
||||||
|
"Present_Input_Voltage": (144, 2),
|
||||||
|
"Present_Temperature": (146, 1),
|
||||||
|
}
|
||||||
|
|
||||||
|
X_SERIES_BAUDRATE_TABLE = {
|
||||||
|
0: 9_600,
|
||||||
|
1: 57_600,
|
||||||
|
2: 115_200,
|
||||||
|
3: 1_000_000,
|
||||||
|
4: 2_000_000,
|
||||||
|
5: 3_000_000,
|
||||||
|
6: 4_000_000,
|
||||||
|
}
|
||||||
|
|
||||||
|
CALIBRATION_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
CONVERT_UINT32_TO_INT32_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
|
||||||
|
MODEL_CONTROL_TABLE = {
|
||||||
|
"x_series": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xl330-m077": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xl330-m288": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xl430-w250": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xm430-w350": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xm540-w270": X_SERIES_CONTROL_TABLE,
|
||||||
|
"xc430-w150": X_SERIES_CONTROL_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_RESOLUTION = {
|
||||||
|
"x_series": 4096,
|
||||||
|
"xl330-m077": 4096,
|
||||||
|
"xl330-m288": 4096,
|
||||||
|
"xl430-w250": 4096,
|
||||||
|
"xm430-w350": 4096,
|
||||||
|
"xm540-w270": 4096,
|
||||||
|
"xc430-w150": 4096,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_BAUDRATE_TABLE = {
|
||||||
|
"x_series": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xl330-m077": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xl330-m288": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xl430-w250": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xm430-w350": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xm540-w270": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
"xc430-w150": X_SERIES_BAUDRATE_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
NUM_READ_RETRY = 10
|
||||||
|
NUM_WRITE_RETRY = 10
|
||||||
|
|
||||||
|
|
||||||
|
def convert_degrees_to_steps(degrees: float | np.ndarray, models: str | list[str]) -> np.ndarray:
|
||||||
|
"""This function converts the degree range to the step range for indicating motors rotation.
|
||||||
|
It assumes a motor achieves a full rotation by going from -180 degree position to +180.
|
||||||
|
The motor resolution (e.g. 4096) corresponds to the number of steps needed to achieve a full rotation.
|
||||||
|
"""
|
||||||
|
resolutions = [MODEL_RESOLUTION[model] for model in models]
|
||||||
|
steps = degrees / 180 * np.array(resolutions) / 2
|
||||||
|
steps = steps.astype(int)
|
||||||
|
return steps
|
||||||
|
|
||||||
|
|
||||||
|
def convert_to_bytes(value, bytes, mock=False):
|
||||||
|
if mock:
|
||||||
|
return value
|
||||||
|
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
# Note: No need to convert back into unsigned int, since this byte preprocessing
|
||||||
|
# already handles it for us.
|
||||||
|
if bytes == 1:
|
||||||
|
data = [
|
||||||
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 2:
|
||||||
|
data = [
|
||||||
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
dxl.DXL_HIBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 4:
|
||||||
|
data = [
|
||||||
|
dxl.DXL_LOBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
dxl.DXL_HIBYTE(dxl.DXL_LOWORD(value)),
|
||||||
|
dxl.DXL_LOBYTE(dxl.DXL_HIWORD(value)),
|
||||||
|
dxl.DXL_HIBYTE(dxl.DXL_HIWORD(value)),
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"Value of the number of bytes to be sent is expected to be in [1, 2, 4], but "
|
||||||
|
f"{bytes} is provided instead."
|
||||||
|
)
|
||||||
|
return data
|
||||||
|
|
||||||
|
|
||||||
|
def get_group_sync_key(data_name, motor_names):
|
||||||
|
group_key = f"{data_name}_" + "_".join(motor_names)
|
||||||
|
return group_key
|
||||||
|
|
||||||
|
|
||||||
|
def get_result_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
rslt_name = f"{fn_name}_{group_key}"
|
||||||
|
return rslt_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_queue_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
queue_name = f"{fn_name}_{group_key}"
|
||||||
|
return queue_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_log_name(var_name, fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
log_name = f"{var_name}_{fn_name}_{group_key}"
|
||||||
|
return log_name
|
||||||
|
|
||||||
|
|
||||||
|
def assert_same_address(model_ctrl_table, motor_models, data_name):
|
||||||
|
all_addr = []
|
||||||
|
all_bytes = []
|
||||||
|
for model in motor_models:
|
||||||
|
addr, bytes = model_ctrl_table[model][data_name]
|
||||||
|
all_addr.append(addr)
|
||||||
|
all_bytes.append(bytes)
|
||||||
|
|
||||||
|
if len(set(all_addr)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different address for `data_name`='{data_name}' ({list(zip(motor_models, all_addr, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
if len(set(all_bytes)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different bytes representation for `data_name`='{data_name}' ({list(zip(motor_models, all_bytes, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
class TorqueMode(enum.Enum):
|
||||||
|
ENABLED = 1
|
||||||
|
DISABLED = 0
|
||||||
|
|
||||||
|
|
||||||
|
class DriveMode(enum.Enum):
|
||||||
|
NON_INVERTED = 0
|
||||||
|
INVERTED = 1
|
||||||
|
|
||||||
|
|
||||||
|
class CalibrationMode(enum.Enum):
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
DEGREE = 0
|
||||||
|
# Joints with linear motions (like gripper of Aloha) are experessed in nominal range of [0, 100]
|
||||||
|
LINEAR = 1
|
||||||
|
|
||||||
|
|
||||||
|
class JointOutOfRangeError(Exception):
|
||||||
|
def __init__(self, message="Joint is out of range"):
|
||||||
|
self.message = message
|
||||||
|
super().__init__(self.message)
|
||||||
|
|
||||||
|
|
||||||
|
class DynamixelMotorsBus:
|
||||||
|
# TODO(rcadene): Add a script to find the motor indices without DynamixelWizzard2
|
||||||
|
"""
|
||||||
|
The DynamixelMotorsBus class allows to efficiently read and write to the attached motors. It relies on
|
||||||
|
the python dynamixel sdk to communicate with the motors. For more info, see the [Dynamixel SDK Documentation](https://emanual.robotis.com/docs/en/software/dynamixel/dynamixel_sdk/sample_code/python_read_write_protocol_2_0/#python-read-write-protocol-20).
|
||||||
|
|
||||||
|
A DynamixelMotorsBus instance requires a port (e.g. `DynamixelMotorsBus(port="/dev/tty.usbmodem575E0031751"`)).
|
||||||
|
To find the port, you can run our utility script:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
>>> Finding all available ports for the MotorBus.
|
||||||
|
>>> ['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
>>> Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
|
||||||
|
>>> The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751.
|
||||||
|
>>> Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of usage for 1 motor connected to the bus:
|
||||||
|
```python
|
||||||
|
motor_name = "gripper"
|
||||||
|
motor_index = 6
|
||||||
|
motor_model = "xl330-m288"
|
||||||
|
|
||||||
|
motors_bus = DynamixelMotorsBus(
|
||||||
|
port="/dev/tty.usbmodem575E0031751",
|
||||||
|
motors={motor_name: (motor_index, motor_model)},
|
||||||
|
)
|
||||||
|
motors_bus.connect()
|
||||||
|
|
||||||
|
position = motors_bus.read("Present_Position")
|
||||||
|
|
||||||
|
# move from a few motor steps as an example
|
||||||
|
few_steps = 30
|
||||||
|
motors_bus.write("Goal_Position", position + few_steps)
|
||||||
|
|
||||||
|
# when done, consider disconnecting
|
||||||
|
motors_bus.disconnect()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
port: str,
|
||||||
|
motors: dict[str, tuple[int, str]],
|
||||||
|
extra_model_control_table: dict[str, list[tuple]] | None = None,
|
||||||
|
extra_model_resolution: dict[str, int] | None = None,
|
||||||
|
mock=False,
|
||||||
|
):
|
||||||
|
self.port = port
|
||||||
|
self.motors = motors
|
||||||
|
self.mock = mock
|
||||||
|
|
||||||
|
self.model_ctrl_table = deepcopy(MODEL_CONTROL_TABLE)
|
||||||
|
if extra_model_control_table:
|
||||||
|
self.model_ctrl_table.update(extra_model_control_table)
|
||||||
|
|
||||||
|
self.model_resolution = deepcopy(MODEL_RESOLUTION)
|
||||||
|
if extra_model_resolution:
|
||||||
|
self.model_resolution.update(extra_model_resolution)
|
||||||
|
|
||||||
|
self.port_handler = None
|
||||||
|
self.packet_handler = None
|
||||||
|
self.calibration = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise RobotDeviceAlreadyConnectedError(
|
||||||
|
f"DynamixelMotorsBus({self.port}) is already connected. Do not call `motors_bus.connect()` twice."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
self.port_handler = dxl.PortHandler(self.port)
|
||||||
|
self.packet_handler = dxl.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
try:
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
except Exception:
|
||||||
|
traceback.print_exc()
|
||||||
|
print(
|
||||||
|
"\nTry running `python lerobot/scripts/find_motors_bus_port.py` to make sure you are using the correct port.\n"
|
||||||
|
)
|
||||||
|
raise
|
||||||
|
|
||||||
|
# Allow to read and write
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
self.port_handler.setPacketTimeoutMillis(TIMEOUT_MS)
|
||||||
|
|
||||||
|
def reconnect(self):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
self.port_handler = dxl.PortHandler(self.port)
|
||||||
|
self.packet_handler = dxl.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def are_motors_configured(self):
|
||||||
|
# Only check the motor indices and not baudrate, since if the motor baudrates are incorrect,
|
||||||
|
# a ConnectionError will be raised anyway.
|
||||||
|
try:
|
||||||
|
return (self.motor_indices == self.read("ID")).all()
|
||||||
|
except ConnectionError as e:
|
||||||
|
print(e)
|
||||||
|
return False
|
||||||
|
|
||||||
|
def find_motor_indices(self, possible_ids=None, num_retry=2):
|
||||||
|
if possible_ids is None:
|
||||||
|
possible_ids = range(MAX_ID_RANGE)
|
||||||
|
|
||||||
|
indices = []
|
||||||
|
for idx in tqdm.tqdm(possible_ids):
|
||||||
|
try:
|
||||||
|
present_idx = self.read_with_motor_ids(self.motor_models, [idx], "ID", num_retry=num_retry)[0]
|
||||||
|
except ConnectionError:
|
||||||
|
continue
|
||||||
|
|
||||||
|
if idx != present_idx:
|
||||||
|
# sanity check
|
||||||
|
raise OSError(
|
||||||
|
"Motor index used to communicate through the bus is not the same as the one present in the motor memory. The motor memory might be damaged."
|
||||||
|
)
|
||||||
|
indices.append(idx)
|
||||||
|
|
||||||
|
return indices
|
||||||
|
|
||||||
|
def set_bus_baudrate(self, baudrate):
|
||||||
|
present_bus_baudrate = self.port_handler.getBaudRate()
|
||||||
|
if present_bus_baudrate != baudrate:
|
||||||
|
print(f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}.")
|
||||||
|
self.port_handler.setBaudRate(baudrate)
|
||||||
|
|
||||||
|
if self.port_handler.getBaudRate() != baudrate:
|
||||||
|
raise OSError("Failed to write bus baud rate.")
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_names(self) -> list[str]:
|
||||||
|
return list(self.motors.keys())
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_models(self) -> list[str]:
|
||||||
|
return [model for _, model in self.motors.values()]
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_indices(self) -> list[int]:
|
||||||
|
return [idx for idx, _ in self.motors.values()]
|
||||||
|
|
||||||
|
def set_calibration(self, calibration: dict[str, list]):
|
||||||
|
self.calibration = calibration
|
||||||
|
|
||||||
|
def apply_calibration_autocorrect(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function applies the calibration, automatically detects out of range errors for motors values and attempts to correct.
|
||||||
|
|
||||||
|
For more info, see docstring of `apply_calibration` and `autocorrect_calibration`.
|
||||||
|
"""
|
||||||
|
try:
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
except JointOutOfRangeError as e:
|
||||||
|
print(e)
|
||||||
|
self.autocorrect_calibration(values, motor_names)
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
|
||||||
|
a "zero position" at 0 degree.
|
||||||
|
|
||||||
|
Note: We say "nominal degree range" since the motors can take values outside this range. For instance, 190 degrees, if the motor
|
||||||
|
rotate more than a half a turn from the zero position. However, most motors can't rotate more than 180 degrees and will stay in this range.
|
||||||
|
|
||||||
|
Joints values are original in [0, 2**32[ (unsigned int32). Each motor are expected to complete a full rotation
|
||||||
|
when given a goal position that is + or - their resolution. For instance, dynamixel xl330-m077 have a resolution of 4096, and
|
||||||
|
at any position in their original range, let's say the position 56734, they complete a full rotation clockwise by moving to 60830,
|
||||||
|
or anticlockwise by moving to 52638. The position in the original range is arbitrary and might change a lot between each motor.
|
||||||
|
To harmonize between motors of the same model, different robots, or even models of different brands, we propose to work
|
||||||
|
in the centered nominal degree range ]-180, 180[.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Update direction of rotation of the motor to match between leader and follower.
|
||||||
|
# In fact, the motor of the leader for a given joint can be assembled in an
|
||||||
|
# opposite direction in term of rotation than the motor of the follower on the same joint.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from range [-2**31, 2**31] to
|
||||||
|
# nominal range [-resolution//2, resolution//2] (e.g. [-2048, 2048])
|
||||||
|
values[i] += homing_offset
|
||||||
|
|
||||||
|
# Convert from range [-resolution//2, resolution//2] to
|
||||||
|
# universal float32 centered degree range [-180, 180]
|
||||||
|
# (e.g. 2048 / (4096 // 2) * 180 = 180)
|
||||||
|
values[i] = values[i] / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_DEGREE) or (values[i] > UPPER_BOUND_DEGREE):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [-{HALF_TURN_DEGREE}, {HALF_TURN_DEGREE}] degrees (a full rotation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_DEGREE}, {UPPER_BOUND_DEGREE}] degrees to account for joints that can rotate a bit more, "
|
||||||
|
f"but present value is {values[i]} degree. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial 360 degrees jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Rescale the present position to a nominal range [0, 100] %,
|
||||||
|
# useful for joints with linear motions like Aloha gripper
|
||||||
|
values[i] = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_LINEAR) or (values[i] > UPPER_BOUND_LINEAR):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [0, 100] % (a full linear translation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_LINEAR}, {UPPER_BOUND_LINEAR}] % to account for some imprecision during calibration, "
|
||||||
|
f"but present value is {values[i]} %. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def autocorrect_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function automatically detects issues with values of motors after calibration, and correct for these issues.
|
||||||
|
|
||||||
|
Some motors might have values outside of expected maximum bounds after calibration.
|
||||||
|
For instance, for a joint in degree, its value can be outside [-270, 270] degrees, which is totally unexpected given
|
||||||
|
a nominal range of [-180, 180] degrees, which represents half a turn to the left or right starting from zero position.
|
||||||
|
|
||||||
|
Known issues:
|
||||||
|
#1: Motor value randomly shifts of a full turn, caused by hardware/connection errors.
|
||||||
|
#2: Motor internal homing offset is shifted by a full turn, caused by using default calibration (e.g Aloha).
|
||||||
|
#3: motor internal homing offset is shifted by less or more than a full turn, caused by using default calibration
|
||||||
|
or by human error during manual calibration.
|
||||||
|
|
||||||
|
Issues #1 and #2 can be solved by shifting the calibration homing offset by a full turn.
|
||||||
|
Issue #3 will be visually detected by user and potentially captured by the safety feature `max_relative_target`,
|
||||||
|
that will slow down the motor, raise an error asking to recalibrate. Manual recalibrating will solve the issue.
|
||||||
|
|
||||||
|
Note: A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Update direction of rotation of the motor to match between leader and follower.
|
||||||
|
# In fact, the motor of the leader for a given joint can be assembled in an
|
||||||
|
# opposite direction in term of rotation than the motor of the follower on the same joint.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from initial range to range [-180, 180] degrees
|
||||||
|
calib_val = (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
in_range = (calib_val > LOWER_BOUND_DEGREE) and (calib_val < UPPER_BOUND_DEGREE)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [-180, 180] degrees
|
||||||
|
# values[i] = (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
# - HALF_TURN_DEGREE <= (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE <= HALF_TURN_DEGREE
|
||||||
|
# (- (resolution // 2) - values[i] - homing_offset) / resolution <= factor <= ((resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
low_factor = (-(resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
upp_factor = ((resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from initial range to range [0, 100] in %
|
||||||
|
calib_val = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
in_range = (calib_val > LOWER_BOUND_LINEAR) and (calib_val < UPPER_BOUND_LINEAR)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [0, 100] %
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos + resolution * factor - start_pos - resolution * factor) * 100
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100
|
||||||
|
# 0 <= (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100 <= 100
|
||||||
|
# (start_pos - values[i]) / resolution <= factor <= (end_pos - values[i]) / resolution
|
||||||
|
low_factor = (start_pos - values[i]) / resolution
|
||||||
|
upp_factor = (end_pos - values[i]) / resolution
|
||||||
|
|
||||||
|
if not in_range:
|
||||||
|
# Get first integer between the two bounds
|
||||||
|
if low_factor < upp_factor:
|
||||||
|
factor = math.ceil(low_factor)
|
||||||
|
|
||||||
|
if factor > upp_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
else:
|
||||||
|
factor = math.ceil(upp_factor)
|
||||||
|
|
||||||
|
if factor > low_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
in_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
in_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
|
||||||
|
logging.warning(
|
||||||
|
f"Auto-correct calibration of motor '{name}' by shifting value by {abs(factor)} full turns, "
|
||||||
|
f"from '{out_of_range_str}' to '{in_range_str}'."
|
||||||
|
)
|
||||||
|
|
||||||
|
# A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
self.calibration["homing_offset"][calib_idx] += resolution * factor
|
||||||
|
|
||||||
|
def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Inverse of `apply_calibration`."""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Convert from nominal 0-centered degree range [-180, 180] to
|
||||||
|
# 0-centered resolution range (e.g. [-2048, 2048] for resolution=4096)
|
||||||
|
values[i] = values[i] / HALF_TURN_DEGREE * (resolution // 2)
|
||||||
|
|
||||||
|
# Substract the homing offsets to come back to actual motor range of values
|
||||||
|
# which can be arbitrary.
|
||||||
|
values[i] -= homing_offset
|
||||||
|
|
||||||
|
# Remove drive mode, which is the rotation direction of the motor, to come back to
|
||||||
|
# actual motor rotation direction which can be arbitrary.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from nominal lnear range of [0, 100] % to
|
||||||
|
# actual motor range of values which can be arbitrary.
|
||||||
|
values[i] = values[i] / 100 * (end_pos - start_pos) + start_pos
|
||||||
|
|
||||||
|
values = np.round(values).astype(np.int32)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
return_list = True
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
return_list = False
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, self.motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = dxl.GroupSyncRead(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx in motor_ids:
|
||||||
|
group.addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txRxPacket()
|
||||||
|
if comm == dxl.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = group.getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
if return_list:
|
||||||
|
return values
|
||||||
|
else:
|
||||||
|
return values[0]
|
||||||
|
|
||||||
|
def read(self, data_name, motor_names: str | list[str] | None = None):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"DynamixelMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
if data_name not in self.group_readers:
|
||||||
|
# create new group reader
|
||||||
|
self.group_readers[group_key] = dxl.GroupSyncRead(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
for idx in motor_ids:
|
||||||
|
self.group_readers[group_key].addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(NUM_READ_RETRY):
|
||||||
|
comm = self.group_readers[group_key].txRxPacket()
|
||||||
|
if comm == dxl.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = self.group_readers[group_key].getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
# Convert to signed int to use range [-2048, 2048] for our motor positions.
|
||||||
|
if data_name in CONVERT_UINT32_TO_INT32_REQUIRED:
|
||||||
|
values = values.astype(np.int32)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.apply_calibration_autocorrect(values, motor_names)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the data from the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the data was received
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "read", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
if not isinstance(values, list):
|
||||||
|
values = [values]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = dxl.GroupSyncWrite(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
group.addParam(idx, data)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txPacket()
|
||||||
|
if comm == dxl.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
def write(self, data_name, values: int | float | np.ndarray, motor_names: str | list[str] | None = None):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"DynamixelMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_dynamixel_sdk as dxl
|
||||||
|
else:
|
||||||
|
import dynamixel_sdk as dxl
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
if isinstance(values, (int, float, np.integer)):
|
||||||
|
values = [int(values)] * len(motor_names)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.revert_calibration(values, motor_names)
|
||||||
|
|
||||||
|
values = values.tolist()
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
init_group = data_name not in self.group_readers
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key] = dxl.GroupSyncWrite(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key].addParam(idx, data)
|
||||||
|
else:
|
||||||
|
self.group_writers[group_key].changeParam(idx, data)
|
||||||
|
|
||||||
|
comm = self.group_writers[group_key].txPacket()
|
||||||
|
if comm != dxl.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
# log the number of seconds it took to write the data to the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "write", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# TODO(rcadene): should we log the time before sending the write command?
|
||||||
|
# log the utc time when the write has been completed
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "write", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"DynamixelMotorsBus({self.port}) is not connected. Try running `motors_bus.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.port_handler is not None:
|
||||||
|
self.port_handler.closePort()
|
||||||
|
self.port_handler = None
|
||||||
|
|
||||||
|
self.packet_handler = None
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
887
lerobot/common/robot_devices/motors/feetech.py
Normal file
887
lerobot/common/robot_devices/motors/feetech.py
Normal file
@@ -0,0 +1,887 @@
|
|||||||
|
import enum
|
||||||
|
import logging
|
||||||
|
import math
|
||||||
|
import time
|
||||||
|
import traceback
|
||||||
|
from copy import deepcopy
|
||||||
|
|
||||||
|
import numpy as np
|
||||||
|
import tqdm
|
||||||
|
|
||||||
|
from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
|
||||||
|
from lerobot.common.utils.utils import capture_timestamp_utc
|
||||||
|
|
||||||
|
PROTOCOL_VERSION = 0
|
||||||
|
BAUDRATE = 1_000_000
|
||||||
|
TIMEOUT_MS = 1000
|
||||||
|
|
||||||
|
MAX_ID_RANGE = 252
|
||||||
|
|
||||||
|
# The following bounds define the lower and upper joints range (after calibration).
|
||||||
|
# For joints in degree (i.e. revolute joints), their nominal range is [-180, 180] degrees
|
||||||
|
# which corresponds to a half rotation on the left and half rotation on the right.
|
||||||
|
# Some joints might require higher range, so we allow up to [-270, 270] degrees until
|
||||||
|
# an error is raised.
|
||||||
|
LOWER_BOUND_DEGREE = -270
|
||||||
|
UPPER_BOUND_DEGREE = 270
|
||||||
|
# For joints in percentage (i.e. joints that move linearly like the prismatic joint of a gripper),
|
||||||
|
# their nominal range is [0, 100] %. For instance, for Aloha gripper, 0% is fully
|
||||||
|
# closed, and 100% is fully open. To account for slight calibration issue, we allow up to
|
||||||
|
# [-10, 110] until an error is raised.
|
||||||
|
LOWER_BOUND_LINEAR = -10
|
||||||
|
UPPER_BOUND_LINEAR = 110
|
||||||
|
|
||||||
|
HALF_TURN_DEGREE = 180
|
||||||
|
|
||||||
|
|
||||||
|
# See this link for STS3215 Memory Table:
|
||||||
|
# https://docs.google.com/spreadsheets/d/1GVs7W1VS1PqdhA1nW-abeyAHhTUxKUdR/edit?usp=sharing&ouid=116566590112741600240&rtpof=true&sd=true
|
||||||
|
# data_name: (address, size_byte)
|
||||||
|
SCS_SERIES_CONTROL_TABLE = {
|
||||||
|
"Model": (3, 2),
|
||||||
|
"ID": (5, 1),
|
||||||
|
"Baud_Rate": (6, 1),
|
||||||
|
"Return_Delay": (7, 1),
|
||||||
|
"Response_Status_Level": (8, 1),
|
||||||
|
"Min_Angle_Limit": (9, 2),
|
||||||
|
"Max_Angle_Limit": (11, 2),
|
||||||
|
"Max_Temperature_Limit": (13, 1),
|
||||||
|
"Max_Voltage_Limit": (14, 1),
|
||||||
|
"Min_Voltage_Limit": (15, 1),
|
||||||
|
"Max_Torque_Limit": (16, 2),
|
||||||
|
"Phase": (18, 1),
|
||||||
|
"Unloading_Condition": (19, 1),
|
||||||
|
"LED_Alarm_Condition": (20, 1),
|
||||||
|
"P_Coefficient": (21, 1),
|
||||||
|
"D_Coefficient": (22, 1),
|
||||||
|
"I_Coefficient": (23, 1),
|
||||||
|
"Minimum_Startup_Force": (24, 2),
|
||||||
|
"CW_Dead_Zone": (26, 1),
|
||||||
|
"CCW_Dead_Zone": (27, 1),
|
||||||
|
"Protection_Current": (28, 2),
|
||||||
|
"Angular_Resolution": (30, 1),
|
||||||
|
"Offset": (31, 2),
|
||||||
|
"Mode": (33, 1),
|
||||||
|
"Protective_Torque": (34, 1),
|
||||||
|
"Protection_Time": (35, 1),
|
||||||
|
"Overload_Torque": (36, 1),
|
||||||
|
"Speed_closed_loop_P_proportional_coefficient": (37, 1),
|
||||||
|
"Over_Current_Protection_Time": (38, 1),
|
||||||
|
"Velocity_closed_loop_I_integral_coefficient": (39, 1),
|
||||||
|
"Torque_Enable": (40, 1),
|
||||||
|
"Acceleration": (41, 1),
|
||||||
|
"Goal_Position": (42, 2),
|
||||||
|
"Goal_Time": (44, 2),
|
||||||
|
"Goal_Speed": (46, 2),
|
||||||
|
"Torque_Limit": (48, 2),
|
||||||
|
"Lock": (55, 1),
|
||||||
|
"Present_Position": (56, 2),
|
||||||
|
"Present_Speed": (58, 2),
|
||||||
|
"Present_Load": (60, 2),
|
||||||
|
"Present_Voltage": (62, 1),
|
||||||
|
"Present_Temperature": (63, 1),
|
||||||
|
"Status": (65, 1),
|
||||||
|
"Moving": (66, 1),
|
||||||
|
"Present_Current": (69, 2),
|
||||||
|
# Not in the Memory Table
|
||||||
|
"Maximum_Acceleration": (85, 2),
|
||||||
|
}
|
||||||
|
|
||||||
|
SCS_SERIES_BAUDRATE_TABLE = {
|
||||||
|
0: 1_000_000,
|
||||||
|
1: 500_000,
|
||||||
|
2: 250_000,
|
||||||
|
3: 128_000,
|
||||||
|
4: 115_200,
|
||||||
|
5: 57_600,
|
||||||
|
6: 38_400,
|
||||||
|
7: 19_200,
|
||||||
|
}
|
||||||
|
|
||||||
|
CALIBRATION_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
CONVERT_UINT32_TO_INT32_REQUIRED = ["Goal_Position", "Present_Position"]
|
||||||
|
|
||||||
|
|
||||||
|
MODEL_CONTROL_TABLE = {
|
||||||
|
"scs_series": SCS_SERIES_CONTROL_TABLE,
|
||||||
|
"sts3215": SCS_SERIES_CONTROL_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_RESOLUTION = {
|
||||||
|
"scs_series": 4096,
|
||||||
|
"sts3215": 4096,
|
||||||
|
}
|
||||||
|
|
||||||
|
MODEL_BAUDRATE_TABLE = {
|
||||||
|
"scs_series": SCS_SERIES_BAUDRATE_TABLE,
|
||||||
|
"sts3215": SCS_SERIES_BAUDRATE_TABLE,
|
||||||
|
}
|
||||||
|
|
||||||
|
# High number of retries is needed for feetech compared to dynamixel motors.
|
||||||
|
NUM_READ_RETRY = 20
|
||||||
|
NUM_WRITE_RETRY = 20
|
||||||
|
|
||||||
|
|
||||||
|
def convert_degrees_to_steps(degrees: float | np.ndarray, models: str | list[str]) -> np.ndarray:
|
||||||
|
"""This function converts the degree range to the step range for indicating motors rotation.
|
||||||
|
It assumes a motor achieves a full rotation by going from -180 degree position to +180.
|
||||||
|
The motor resolution (e.g. 4096) corresponds to the number of steps needed to achieve a full rotation.
|
||||||
|
"""
|
||||||
|
resolutions = [MODEL_RESOLUTION[model] for model in models]
|
||||||
|
steps = degrees / 180 * np.array(resolutions) / 2
|
||||||
|
steps = steps.astype(int)
|
||||||
|
return steps
|
||||||
|
|
||||||
|
|
||||||
|
def convert_to_bytes(value, bytes, mock=False):
|
||||||
|
if mock:
|
||||||
|
return value
|
||||||
|
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
# Note: No need to convert back into unsigned int, since this byte preprocessing
|
||||||
|
# already handles it for us.
|
||||||
|
if bytes == 1:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 2:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
]
|
||||||
|
elif bytes == 4:
|
||||||
|
data = [
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_LOWORD(value)),
|
||||||
|
scs.SCS_LOBYTE(scs.SCS_HIWORD(value)),
|
||||||
|
scs.SCS_HIBYTE(scs.SCS_HIWORD(value)),
|
||||||
|
]
|
||||||
|
else:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"Value of the number of bytes to be sent is expected to be in [1, 2, 4], but "
|
||||||
|
f"{bytes} is provided instead."
|
||||||
|
)
|
||||||
|
return data
|
||||||
|
|
||||||
|
|
||||||
|
def get_group_sync_key(data_name, motor_names):
|
||||||
|
group_key = f"{data_name}_" + "_".join(motor_names)
|
||||||
|
return group_key
|
||||||
|
|
||||||
|
|
||||||
|
def get_result_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
rslt_name = f"{fn_name}_{group_key}"
|
||||||
|
return rslt_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_queue_name(fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
queue_name = f"{fn_name}_{group_key}"
|
||||||
|
return queue_name
|
||||||
|
|
||||||
|
|
||||||
|
def get_log_name(var_name, fn_name, data_name, motor_names):
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
log_name = f"{var_name}_{fn_name}_{group_key}"
|
||||||
|
return log_name
|
||||||
|
|
||||||
|
|
||||||
|
def assert_same_address(model_ctrl_table, motor_models, data_name):
|
||||||
|
all_addr = []
|
||||||
|
all_bytes = []
|
||||||
|
for model in motor_models:
|
||||||
|
addr, bytes = model_ctrl_table[model][data_name]
|
||||||
|
all_addr.append(addr)
|
||||||
|
all_bytes.append(bytes)
|
||||||
|
|
||||||
|
if len(set(all_addr)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different address for `data_name`='{data_name}' ({list(zip(motor_models, all_addr, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
if len(set(all_bytes)) != 1:
|
||||||
|
raise NotImplementedError(
|
||||||
|
f"At least two motor models use a different bytes representation for `data_name`='{data_name}' ({list(zip(motor_models, all_bytes, strict=False))}). Contact a LeRobot maintainer."
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
class TorqueMode(enum.Enum):
|
||||||
|
ENABLED = 1
|
||||||
|
DISABLED = 0
|
||||||
|
|
||||||
|
|
||||||
|
class DriveMode(enum.Enum):
|
||||||
|
NON_INVERTED = 0
|
||||||
|
INVERTED = 1
|
||||||
|
|
||||||
|
|
||||||
|
class CalibrationMode(enum.Enum):
|
||||||
|
# Joints with rotational motions are expressed in degrees in nominal range of [-180, 180]
|
||||||
|
DEGREE = 0
|
||||||
|
# Joints with linear motions (like gripper of Aloha) are experessed in nominal range of [0, 100]
|
||||||
|
LINEAR = 1
|
||||||
|
|
||||||
|
|
||||||
|
class JointOutOfRangeError(Exception):
|
||||||
|
def __init__(self, message="Joint is out of range"):
|
||||||
|
self.message = message
|
||||||
|
super().__init__(self.message)
|
||||||
|
|
||||||
|
|
||||||
|
class FeetechMotorsBus:
|
||||||
|
"""
|
||||||
|
The FeetechMotorsBus class allows to efficiently read and write to the attached motors. It relies on
|
||||||
|
the python feetech sdk to communicate with the motors. For more info, see the [feetech SDK Documentation](https://emanual.robotis.com/docs/en/software/feetech/feetech_sdk/sample_code/python_read_write_protocol_2_0/#python-read-write-protocol-20).
|
||||||
|
|
||||||
|
A FeetechMotorsBus instance requires a port (e.g. `FeetechMotorsBus(port="/dev/tty.usbmodem575E0031751"`)).
|
||||||
|
To find the port, you can run our utility script:
|
||||||
|
```bash
|
||||||
|
python lerobot/scripts/find_motors_bus_port.py
|
||||||
|
>>> Finding all available ports for the MotorsBus.
|
||||||
|
>>> ['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
|
||||||
|
>>> Remove the usb cable from your FeetechMotorsBus and press Enter when done.
|
||||||
|
>>> The port of this FeetechMotorsBus is /dev/tty.usbmodem575E0031751.
|
||||||
|
>>> Reconnect the usb cable.
|
||||||
|
```
|
||||||
|
|
||||||
|
Example of usage for 1 motor connected to the bus:
|
||||||
|
```python
|
||||||
|
motor_name = "gripper"
|
||||||
|
motor_index = 6
|
||||||
|
motor_model = "sts3215"
|
||||||
|
|
||||||
|
motors_bus = FeetechMotorsBus(
|
||||||
|
port="/dev/tty.usbmodem575E0031751",
|
||||||
|
motors={motor_name: (motor_index, motor_model)},
|
||||||
|
)
|
||||||
|
motors_bus.connect()
|
||||||
|
|
||||||
|
position = motors_bus.read("Present_Position")
|
||||||
|
|
||||||
|
# move from a few motor steps as an example
|
||||||
|
few_steps = 30
|
||||||
|
motors_bus.write("Goal_Position", position + few_steps)
|
||||||
|
|
||||||
|
# when done, consider disconnecting
|
||||||
|
motors_bus.disconnect()
|
||||||
|
```
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(
|
||||||
|
self,
|
||||||
|
port: str,
|
||||||
|
motors: dict[str, tuple[int, str]],
|
||||||
|
extra_model_control_table: dict[str, list[tuple]] | None = None,
|
||||||
|
extra_model_resolution: dict[str, int] | None = None,
|
||||||
|
mock=False,
|
||||||
|
):
|
||||||
|
self.port = port
|
||||||
|
self.motors = motors
|
||||||
|
self.mock = mock
|
||||||
|
|
||||||
|
self.model_ctrl_table = deepcopy(MODEL_CONTROL_TABLE)
|
||||||
|
if extra_model_control_table:
|
||||||
|
self.model_ctrl_table.update(extra_model_control_table)
|
||||||
|
|
||||||
|
self.model_resolution = deepcopy(MODEL_RESOLUTION)
|
||||||
|
if extra_model_resolution:
|
||||||
|
self.model_resolution.update(extra_model_resolution)
|
||||||
|
|
||||||
|
self.port_handler = None
|
||||||
|
self.packet_handler = None
|
||||||
|
self.calibration = None
|
||||||
|
self.is_connected = False
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.logs = {}
|
||||||
|
|
||||||
|
self.track_positions = {}
|
||||||
|
|
||||||
|
def connect(self):
|
||||||
|
if self.is_connected:
|
||||||
|
raise RobotDeviceAlreadyConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is already connected. Do not call `motors_bus.connect()` twice."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
self.port_handler = scs.PortHandler(self.port)
|
||||||
|
self.packet_handler = scs.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
try:
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
except Exception:
|
||||||
|
traceback.print_exc()
|
||||||
|
print(
|
||||||
|
"\nTry running `python lerobot/scripts/find_motors_bus_port.py` to make sure you are using the correct port.\n"
|
||||||
|
)
|
||||||
|
raise
|
||||||
|
|
||||||
|
# Allow to read and write
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
self.port_handler.setPacketTimeoutMillis(TIMEOUT_MS)
|
||||||
|
|
||||||
|
def reconnect(self):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
self.port_handler = scs.PortHandler(self.port)
|
||||||
|
self.packet_handler = scs.PacketHandler(PROTOCOL_VERSION)
|
||||||
|
|
||||||
|
if not self.port_handler.openPort():
|
||||||
|
raise OSError(f"Failed to open port '{self.port}'.")
|
||||||
|
|
||||||
|
self.is_connected = True
|
||||||
|
|
||||||
|
def are_motors_configured(self):
|
||||||
|
# Only check the motor indices and not baudrate, since if the motor baudrates are incorrect,
|
||||||
|
# a ConnectionError will be raised anyway.
|
||||||
|
try:
|
||||||
|
return (self.motor_indices == self.read("ID")).all()
|
||||||
|
except ConnectionError as e:
|
||||||
|
print(e)
|
||||||
|
return False
|
||||||
|
|
||||||
|
def find_motor_indices(self, possible_ids=None, num_retry=2):
|
||||||
|
if possible_ids is None:
|
||||||
|
possible_ids = range(MAX_ID_RANGE)
|
||||||
|
|
||||||
|
indices = []
|
||||||
|
for idx in tqdm.tqdm(possible_ids):
|
||||||
|
try:
|
||||||
|
present_idx = self.read_with_motor_ids(self.motor_models, [idx], "ID", num_retry=num_retry)[0]
|
||||||
|
except ConnectionError:
|
||||||
|
continue
|
||||||
|
|
||||||
|
if idx != present_idx:
|
||||||
|
# sanity check
|
||||||
|
raise OSError(
|
||||||
|
"Motor index used to communicate through the bus is not the same as the one present in the motor memory. The motor memory might be damaged."
|
||||||
|
)
|
||||||
|
indices.append(idx)
|
||||||
|
|
||||||
|
return indices
|
||||||
|
|
||||||
|
def set_bus_baudrate(self, baudrate):
|
||||||
|
present_bus_baudrate = self.port_handler.getBaudRate()
|
||||||
|
if present_bus_baudrate != baudrate:
|
||||||
|
print(f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}.")
|
||||||
|
self.port_handler.setBaudRate(baudrate)
|
||||||
|
|
||||||
|
if self.port_handler.getBaudRate() != baudrate:
|
||||||
|
raise OSError("Failed to write bus baud rate.")
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_names(self) -> list[str]:
|
||||||
|
return list(self.motors.keys())
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_models(self) -> list[str]:
|
||||||
|
return [model for _, model in self.motors.values()]
|
||||||
|
|
||||||
|
@property
|
||||||
|
def motor_indices(self) -> list[int]:
|
||||||
|
return [idx for idx, _ in self.motors.values()]
|
||||||
|
|
||||||
|
def set_calibration(self, calibration: dict[str, list]):
|
||||||
|
self.calibration = calibration
|
||||||
|
|
||||||
|
def apply_calibration_autocorrect(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function apply the calibration, automatically detects out of range errors for motors values and attempt to correct.
|
||||||
|
|
||||||
|
For more info, see docstring of `apply_calibration` and `autocorrect_calibration`.
|
||||||
|
"""
|
||||||
|
try:
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
except JointOutOfRangeError as e:
|
||||||
|
print(e)
|
||||||
|
self.autocorrect_calibration(values, motor_names)
|
||||||
|
values = self.apply_calibration(values, motor_names)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
|
||||||
|
a "zero position" at 0 degree.
|
||||||
|
|
||||||
|
Note: We say "nominal degree range" since the motors can take values outside this range. For instance, 190 degrees, if the motor
|
||||||
|
rotate more than a half a turn from the zero position. However, most motors can't rotate more than 180 degrees and will stay in this range.
|
||||||
|
|
||||||
|
Joints values are original in [0, 2**32[ (unsigned int32). Each motor are expected to complete a full rotation
|
||||||
|
when given a goal position that is + or - their resolution. For instance, feetech xl330-m077 have a resolution of 4096, and
|
||||||
|
at any position in their original range, let's say the position 56734, they complete a full rotation clockwise by moving to 60830,
|
||||||
|
or anticlockwise by moving to 52638. The position in the original range is arbitrary and might change a lot between each motor.
|
||||||
|
To harmonize between motors of the same model, different robots, or even models of different brands, we propose to work
|
||||||
|
in the centered nominal degree range ]-180, 180[.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Update direction of rotation of the motor to match between leader and follower.
|
||||||
|
# In fact, the motor of the leader for a given joint can be assembled in an
|
||||||
|
# opposite direction in term of rotation than the motor of the follower on the same joint.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from range [-2**31, 2**31[ to
|
||||||
|
# nominal range ]-resolution, resolution[ (e.g. ]-2048, 2048[)
|
||||||
|
values[i] += homing_offset
|
||||||
|
|
||||||
|
# Convert from range ]-resolution, resolution[ to
|
||||||
|
# universal float32 centered degree range ]-180, 180[
|
||||||
|
values[i] = values[i] / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_DEGREE) or (values[i] > UPPER_BOUND_DEGREE):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [-{HALF_TURN_DEGREE}, {HALF_TURN_DEGREE}] degrees (a full rotation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_DEGREE}, {UPPER_BOUND_DEGREE}] degrees to account for joints that can rotate a bit more, "
|
||||||
|
f"but present value is {values[i]} degree. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial 360 degrees jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Rescale the present position to a nominal range [0, 100] %,
|
||||||
|
# useful for joints with linear motions like Aloha gripper
|
||||||
|
values[i] = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
|
||||||
|
if (values[i] < LOWER_BOUND_LINEAR) or (values[i] > UPPER_BOUND_LINEAR):
|
||||||
|
raise JointOutOfRangeError(
|
||||||
|
f"Wrong motor position range detected for {name}. "
|
||||||
|
f"Expected to be in nominal range of [0, 100] % (a full linear translation), "
|
||||||
|
f"with a maximum range of [{LOWER_BOUND_LINEAR}, {UPPER_BOUND_LINEAR}] % to account for some imprecision during calibration, "
|
||||||
|
f"but present value is {values[i]} %. "
|
||||||
|
"This might be due to a cable connection issue creating an artificial jump in motor values. "
|
||||||
|
"You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
|
||||||
|
)
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def autocorrect_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""This function automatically detects issues with values of motors after calibration, and correct for these issues.
|
||||||
|
|
||||||
|
Some motors might have values outside of expected maximum bounds after calibration.
|
||||||
|
For instance, for a joint in degree, its value can be outside [-270, 270] degrees, which is totally unexpected given
|
||||||
|
a nominal range of [-180, 180] degrees, which represents half a turn to the left or right starting from zero position.
|
||||||
|
|
||||||
|
Known issues:
|
||||||
|
#1: Motor value randomly shifts of a full turn, caused by hardware/connection errors.
|
||||||
|
#2: Motor internal homing offset is shifted of a full turn, caused by using default calibration (e.g Aloha).
|
||||||
|
#3: motor internal homing offset is shifted of less or more than a full turn, caused by using default calibration
|
||||||
|
or by human error during manual calibration.
|
||||||
|
|
||||||
|
Issues #1 and #2 can be solved by shifting the calibration homing offset by a full turn.
|
||||||
|
Issue #3 will be visually detected by user and potentially captured by the safety feature `max_relative_target`,
|
||||||
|
that will slow down the motor, raise an error asking to recalibrate. Manual recalibrating will solve the issue.
|
||||||
|
|
||||||
|
Note: A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
"""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
# Convert from unsigned int32 original range [0, 2**32] to signed float32 range
|
||||||
|
values = values.astype(np.float32)
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
# Convert from initial range to range [-180, 180] degrees
|
||||||
|
calib_val = (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
in_range = (calib_val > LOWER_BOUND_DEGREE) and (calib_val < UPPER_BOUND_DEGREE)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [-180, 180] degrees
|
||||||
|
# values[i] = (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE
|
||||||
|
# - HALF_TURN_DEGREE <= (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE <= HALF_TURN_DEGREE
|
||||||
|
# (- HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset) / resolution <= factor <= (HALF_TURN_DEGREE / 180 * (resolution // 2) - values[i] - homing_offset) / resolution
|
||||||
|
low_factor = (
|
||||||
|
-HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset
|
||||||
|
) / resolution
|
||||||
|
upp_factor = (
|
||||||
|
HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset
|
||||||
|
) / resolution
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from initial range to range [0, 100] in %
|
||||||
|
calib_val = (values[i] - start_pos) / (end_pos - start_pos) * 100
|
||||||
|
in_range = (calib_val > LOWER_BOUND_LINEAR) and (calib_val < UPPER_BOUND_LINEAR)
|
||||||
|
|
||||||
|
# Solve this inequality to find the factor to shift the range into [0, 100] %
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos + resolution * factor - start_pos - resolution * factor) * 100
|
||||||
|
# values[i] = (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100
|
||||||
|
# 0 <= (values[i] - start_pos + resolution * factor) / (end_pos - start_pos) * 100 <= 100
|
||||||
|
# (start_pos - values[i]) / resolution <= factor <= (end_pos - values[i]) / resolution
|
||||||
|
low_factor = (start_pos - values[i]) / resolution
|
||||||
|
upp_factor = (end_pos - values[i]) / resolution
|
||||||
|
|
||||||
|
if not in_range:
|
||||||
|
# Get first integer between the two bounds
|
||||||
|
if low_factor < upp_factor:
|
||||||
|
factor = math.ceil(low_factor)
|
||||||
|
|
||||||
|
if factor > upp_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
else:
|
||||||
|
factor = math.ceil(upp_factor)
|
||||||
|
|
||||||
|
if factor > low_factor:
|
||||||
|
raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
in_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
out_of_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
in_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
|
||||||
|
|
||||||
|
logging.warning(
|
||||||
|
f"Auto-correct calibration of motor '{name}' by shifting value by {abs(factor)} full turns, "
|
||||||
|
f"from '{out_of_range_str}' to '{in_range_str}'."
|
||||||
|
)
|
||||||
|
|
||||||
|
# A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
|
||||||
|
self.calibration["homing_offset"][calib_idx] += resolution * factor
|
||||||
|
|
||||||
|
def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
|
||||||
|
"""Inverse of `apply_calibration`."""
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
calib_idx = self.calibration["motor_names"].index(name)
|
||||||
|
calib_mode = self.calibration["calib_mode"][calib_idx]
|
||||||
|
|
||||||
|
if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
|
||||||
|
drive_mode = self.calibration["drive_mode"][calib_idx]
|
||||||
|
homing_offset = self.calibration["homing_offset"][calib_idx]
|
||||||
|
_, model = self.motors[name]
|
||||||
|
resolution = self.model_resolution[model]
|
||||||
|
|
||||||
|
# Convert from nominal 0-centered degree range [-180, 180] to
|
||||||
|
# 0-centered resolution range (e.g. [-2048, 2048] for resolution=4096)
|
||||||
|
values[i] = values[i] / HALF_TURN_DEGREE * (resolution // 2)
|
||||||
|
|
||||||
|
# Substract the homing offsets to come back to actual motor range of values
|
||||||
|
# which can be arbitrary.
|
||||||
|
values[i] -= homing_offset
|
||||||
|
|
||||||
|
# Remove drive mode, which is the rotation direction of the motor, to come back to
|
||||||
|
# actual motor rotation direction which can be arbitrary.
|
||||||
|
if drive_mode:
|
||||||
|
values[i] *= -1
|
||||||
|
|
||||||
|
elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
|
||||||
|
start_pos = self.calibration["start_pos"][calib_idx]
|
||||||
|
end_pos = self.calibration["end_pos"][calib_idx]
|
||||||
|
|
||||||
|
# Convert from nominal lnear range of [0, 100] % to
|
||||||
|
# actual motor range of values which can be arbitrary.
|
||||||
|
values[i] = values[i] / 100 * (end_pos - start_pos) + start_pos
|
||||||
|
|
||||||
|
values = np.round(values).astype(np.int32)
|
||||||
|
return values
|
||||||
|
|
||||||
|
def avoid_rotation_reset(self, values, motor_names, data_name):
|
||||||
|
if data_name not in self.track_positions:
|
||||||
|
self.track_positions[data_name] = {
|
||||||
|
"prev": [None] * len(self.motor_names),
|
||||||
|
# Assume False at initialization
|
||||||
|
"below_zero": [False] * len(self.motor_names),
|
||||||
|
"above_max": [False] * len(self.motor_names),
|
||||||
|
}
|
||||||
|
|
||||||
|
track = self.track_positions[data_name]
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
for i, name in enumerate(motor_names):
|
||||||
|
idx = self.motor_names.index(name)
|
||||||
|
|
||||||
|
if track["prev"][idx] is None:
|
||||||
|
track["prev"][idx] = values[i]
|
||||||
|
continue
|
||||||
|
|
||||||
|
# Detect a full rotation occured
|
||||||
|
if abs(track["prev"][idx] - values[i]) > 2048:
|
||||||
|
# Position went below 0 and got reset to 4095
|
||||||
|
if track["prev"][idx] < values[i]:
|
||||||
|
# So we set negative value by adding a full rotation
|
||||||
|
values[i] -= 4096
|
||||||
|
|
||||||
|
# Position went above 4095 and got reset to 0
|
||||||
|
elif track["prev"][idx] > values[i]:
|
||||||
|
# So we add a full rotation
|
||||||
|
values[i] += 4096
|
||||||
|
|
||||||
|
track["prev"][idx] = values[i]
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
return_list = True
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
return_list = False
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, self.motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = scs.GroupSyncRead(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx in motor_ids:
|
||||||
|
group.addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txRxPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = group.getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
if return_list:
|
||||||
|
return values
|
||||||
|
else:
|
||||||
|
return values[0]
|
||||||
|
|
||||||
|
def read(self, data_name, motor_names: str | list[str] | None = None):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
if data_name not in self.group_readers:
|
||||||
|
# create new group reader
|
||||||
|
self.group_readers[group_key] = scs.GroupSyncRead(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
for idx in motor_ids:
|
||||||
|
self.group_readers[group_key].addParam(idx)
|
||||||
|
|
||||||
|
for _ in range(NUM_READ_RETRY):
|
||||||
|
comm = self.group_readers[group_key].txRxPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Read failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
values = []
|
||||||
|
for idx in motor_ids:
|
||||||
|
value = self.group_readers[group_key].getData(idx, addr, bytes)
|
||||||
|
values.append(value)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
# Convert to signed int to use range [-2048, 2048] for our motor positions.
|
||||||
|
if data_name in CONVERT_UINT32_TO_INT32_REQUIRED:
|
||||||
|
values = values.astype(np.int32)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED:
|
||||||
|
values = self.avoid_rotation_reset(values, motor_names, data_name)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.apply_calibration_autocorrect(values, motor_names)
|
||||||
|
|
||||||
|
# log the number of seconds it took to read the data from the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# log the utc time at which the data was received
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "read", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
return values
|
||||||
|
|
||||||
|
def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if not isinstance(motor_ids, list):
|
||||||
|
motor_ids = [motor_ids]
|
||||||
|
if not isinstance(values, list):
|
||||||
|
values = [values]
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, motor_models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[motor_models[0]][data_name]
|
||||||
|
group = scs.GroupSyncWrite(self.port_handler, self.packet_handler, addr, bytes)
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
group.addParam(idx, data)
|
||||||
|
|
||||||
|
for _ in range(num_retry):
|
||||||
|
comm = group.txPacket()
|
||||||
|
if comm == scs.COMM_SUCCESS:
|
||||||
|
break
|
||||||
|
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port_handler.port_name} for indices {motor_ids}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
def write(self, data_name, values: int | float | np.ndarray, motor_names: str | list[str] | None = None):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
|
||||||
|
)
|
||||||
|
|
||||||
|
start_time = time.perf_counter()
|
||||||
|
|
||||||
|
if self.mock:
|
||||||
|
import tests.mock_scservo_sdk as scs
|
||||||
|
else:
|
||||||
|
import scservo_sdk as scs
|
||||||
|
|
||||||
|
if motor_names is None:
|
||||||
|
motor_names = self.motor_names
|
||||||
|
|
||||||
|
if isinstance(motor_names, str):
|
||||||
|
motor_names = [motor_names]
|
||||||
|
|
||||||
|
if isinstance(values, (int, float, np.integer)):
|
||||||
|
values = [int(values)] * len(motor_names)
|
||||||
|
|
||||||
|
values = np.array(values)
|
||||||
|
|
||||||
|
motor_ids = []
|
||||||
|
models = []
|
||||||
|
for name in motor_names:
|
||||||
|
motor_idx, model = self.motors[name]
|
||||||
|
motor_ids.append(motor_idx)
|
||||||
|
models.append(model)
|
||||||
|
|
||||||
|
if data_name in CALIBRATION_REQUIRED and self.calibration is not None:
|
||||||
|
values = self.revert_calibration(values, motor_names)
|
||||||
|
|
||||||
|
values = values.tolist()
|
||||||
|
|
||||||
|
assert_same_address(self.model_ctrl_table, models, data_name)
|
||||||
|
addr, bytes = self.model_ctrl_table[model][data_name]
|
||||||
|
group_key = get_group_sync_key(data_name, motor_names)
|
||||||
|
|
||||||
|
init_group = data_name not in self.group_readers
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key] = scs.GroupSyncWrite(
|
||||||
|
self.port_handler, self.packet_handler, addr, bytes
|
||||||
|
)
|
||||||
|
|
||||||
|
for idx, value in zip(motor_ids, values, strict=True):
|
||||||
|
data = convert_to_bytes(value, bytes, self.mock)
|
||||||
|
if init_group:
|
||||||
|
self.group_writers[group_key].addParam(idx, data)
|
||||||
|
else:
|
||||||
|
self.group_writers[group_key].changeParam(idx, data)
|
||||||
|
|
||||||
|
comm = self.group_writers[group_key].txPacket()
|
||||||
|
if comm != scs.COMM_SUCCESS:
|
||||||
|
raise ConnectionError(
|
||||||
|
f"Write failed due to communication error on port {self.port} for group_key {group_key}: "
|
||||||
|
f"{self.packet_handler.getTxRxResult(comm)}"
|
||||||
|
)
|
||||||
|
|
||||||
|
# log the number of seconds it took to write the data to the motors
|
||||||
|
delta_ts_name = get_log_name("delta_timestamp_s", "write", data_name, motor_names)
|
||||||
|
self.logs[delta_ts_name] = time.perf_counter() - start_time
|
||||||
|
|
||||||
|
# TODO(rcadene): should we log the time before sending the write command?
|
||||||
|
# log the utc time when the write has been completed
|
||||||
|
ts_utc_name = get_log_name("timestamp_utc", "write", data_name, motor_names)
|
||||||
|
self.logs[ts_utc_name] = capture_timestamp_utc()
|
||||||
|
|
||||||
|
def disconnect(self):
|
||||||
|
if not self.is_connected:
|
||||||
|
raise RobotDeviceNotConnectedError(
|
||||||
|
f"FeetechMotorsBus({self.port}) is not connected. Try running `motors_bus.connect()` first."
|
||||||
|
)
|
||||||
|
|
||||||
|
if self.port_handler is not None:
|
||||||
|
self.port_handler.closePort()
|
||||||
|
self.port_handler = None
|
||||||
|
|
||||||
|
self.packet_handler = None
|
||||||
|
self.group_readers = {}
|
||||||
|
self.group_writers = {}
|
||||||
|
self.is_connected = False
|
||||||
|
|
||||||
|
def __del__(self):
|
||||||
|
if getattr(self, "is_connected", False):
|
||||||
|
self.disconnect()
|
||||||
10
lerobot/common/robot_devices/motors/utils.py
Normal file
10
lerobot/common/robot_devices/motors/utils.py
Normal file
@@ -0,0 +1,10 @@
|
|||||||
|
from typing import Protocol
|
||||||
|
|
||||||
|
|
||||||
|
class MotorsBus(Protocol):
|
||||||
|
def motor_names(self): ...
|
||||||
|
def set_calibration(self): ...
|
||||||
|
def apply_calibration(self): ...
|
||||||
|
def revert_calibration(self): ...
|
||||||
|
def read(self): ...
|
||||||
|
def write(self): ...
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user