Update tensor device assignment in ReplayBuffer class

- Changed the device assignment for tensors in the ReplayBuffer class from `device` to `storage_device` for consistency and improved resource management.

.github/PULL_REQUEST_TEMPLATE.md

@@ -21,7 +21,7 @@ Provide a simple way for the reviewer to try out your changes.
 
 Examples:
 ```bash
-DATA_DIR=tests/data pytest -sx tests/test_stuff.py::test_something
+pytest -sx tests/test_stuff.py::test_something
 ```
 ```bash
 python lerobot/scripts/train.py --some.option=true

.github/workflows/nightly-tests.yml

@@ -7,10 +7,8 @@ on:
   schedule:
     - cron: "0 2 * * *"
 
-env:
-  DATA_DIR: tests/data
+# env:
   # SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
-
 jobs:
   run_all_tests_cpu:
     name: CPU
@@ -30,13 +28,9 @@ jobs:
         working-directory: /lerobot
     steps:
       - name: Tests
-        env:
-          DATA_DIR: tests/data
         run: pytest -v --cov=./lerobot --disable-warnings tests
 
       - name: Tests end-to-end
-        env:
-          DATA_DIR: tests/data
         run: make test-end-to-end
 
 

.github/workflows/quality.yml

@@ -50,7 +50,7 @@ jobs:
         uses: actions/checkout@v3
 
       - name: Install poetry
-        run: pipx install poetry
+        run: pipx install "poetry<2.0.0"
 
       - name: Poetry check
         run: poetry check
@@ -64,7 +64,7 @@ jobs:
         uses: actions/checkout@v3
 
       - name: Install poetry
-        run: pipx install poetry
+        run: pipx install "poetry<2.0.0"
 
       - name: Install poetry-relax
         run: poetry self add poetry-relax

.github/workflows/test.yml

@@ -29,7 +29,6 @@ jobs:
     name: Pytest
     runs-on: ubuntu-latest
     env:
-      DATA_DIR: tests/data
       MUJOCO_GL: egl
     steps:
       - uses: actions/checkout@v4
@@ -70,7 +69,6 @@ jobs:
     name: Pytest (minimal install)
     runs-on: ubuntu-latest
     env:
-      DATA_DIR: tests/data
       MUJOCO_GL: egl
     steps:
       - uses: actions/checkout@v4
@@ -104,39 +102,38 @@ jobs:
             && rm -rf tests/outputs outputs
 
   # TODO(aliberts, rcadene): redesign after v2 migration / removing hydra
-  end-to-end:
-    name: End-to-end
-    runs-on: ubuntu-latest
-    env:
-      DATA_DIR: tests/data
-      MUJOCO_GL: egl
-    steps:
-      - uses: actions/checkout@v4
-        with:
-          lfs: true  # Ensure LFS files are pulled
+  # end-to-end:
+  #   name: End-to-end
+  #   runs-on: ubuntu-latest
+  #   env:
+  #     MUJOCO_GL: egl
+  #   steps:
+  #     - uses: actions/checkout@v4
+  #       with:
+  #         lfs: true  # Ensure LFS files are pulled
 
-      - name: Install apt dependencies
-      # portaudio19-dev is needed to install pyaudio
-        run: |
-          sudo apt-get update && \
-          sudo apt-get install -y libegl1-mesa-dev portaudio19-dev
+  #     - name: Install apt dependencies
+  #     # portaudio19-dev is needed to install pyaudio
+  #       run: |
+  #         sudo apt-get update && \
+  #         sudo apt-get install -y libegl1-mesa-dev portaudio19-dev
 
-      - name: Install poetry
-        run: |
-          pipx install poetry && poetry config virtualenvs.in-project true
-          echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
+  #     - name: Install poetry
+  #       run: |
+  #         pipx install poetry && poetry config virtualenvs.in-project true
+  #         echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
 
-      - name: Set up Python 3.10
-        uses: actions/setup-python@v5
-        with:
-          python-version: "3.10"
-          cache: "poetry"
+  #     - name: Set up Python 3.10
+  #       uses: actions/setup-python@v5
+  #       with:
+  #         python-version: "3.10"
+  #         cache: "poetry"
 
-      - name: Install poetry dependencies
-        run: |
-          poetry install --all-extras
+  #     - name: Install poetry dependencies
+  #       run: |
+  #         poetry install --all-extras
 
-      - name: Test end-to-end
-        run: |
-          make test-end-to-end \
-            && rm -rf outputs
+  #     - name: Test end-to-end
+  #       run: |
+  #         make test-end-to-end \
+  #           && rm -rf outputs

.pre-commit-config.yaml

@@ -3,7 +3,7 @@ default_language_version:
     python: python3.10
 repos:
   - repo: https://github.com/pre-commit/pre-commit-hooks
-    rev: v4.6.0
+    rev: v5.0.0
     hooks:
       - id: check-added-large-files
       - id: debug-statements
@@ -14,11 +14,12 @@ repos:
       - id: end-of-file-fixer
       - id: trailing-whitespace
   - repo: https://github.com/asottile/pyupgrade
-    rev: v3.16.0
+    rev: v3.19.0
     hooks:
     -   id: pyupgrade
+        exclude: '^(.*_pb2_grpc\.py|.*_pb2\.py$)'
   - repo: https://github.com/astral-sh/ruff-pre-commit
-    rev: v0.5.2
+    rev: v0.8.2
     hooks:
       - id: ruff
         args: [--fix]
@@ -32,6 +33,6 @@ repos:
           - "--check"
           - "--no-update"
   - repo: https://github.com/gitleaks/gitleaks
-    rev: v8.18.4
+    rev: v8.21.2
     hooks:
       - id: gitleaks

CONTRIBUTING.md

@@ -267,7 +267,7 @@ We use `pytest` in order to run the tests. From the root of the
 repository, here's how to run tests with `pytest` for the library:
 
 ```bash
-DATA_DIR="tests/data" python -m pytest -sv ./tests
+python -m pytest -sv ./tests
 ```
 
 

README.md

@@ -68,7 +68,7 @@
 
 ### Acknowledgment
 
-- Thanks to Tony Zaho, Zipeng Fu and colleagues for open sourcing ACT policy, ALOHA environments and datasets. Ours are adapted from [ALOHA](https://tonyzhaozh.github.io/aloha) and [Mobile ALOHA](https://mobile-aloha.github.io).
+- Thanks to Tony Zhao, Zipeng Fu and colleagues for open sourcing ACT policy, ALOHA environments and datasets. Ours are adapted from [ALOHA](https://tonyzhaozh.github.io/aloha) and [Mobile ALOHA](https://mobile-aloha.github.io).
 - Thanks to Cheng Chi, Zhenjia Xu and colleagues for open sourcing Diffusion policy, Pusht environment and datasets, as well as UMI datasets. Ours are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu) and [UMI Gripper](https://umi-gripper.github.io).
 - Thanks to Nicklas Hansen, Yunhai Feng and colleagues for open sourcing TDMPC policy, Simxarm environments and datasets. Ours are adapted from [TDMPC](https://github.com/nicklashansen/tdmpc) and [FOWM](https://www.yunhaifeng.com/FOWM).
 - Thanks to Antonio Loquercio and Ashish Kumar for their early support.
@@ -153,10 +153,12 @@ python lerobot/scripts/visualize_dataset.py \
     --episode-index 0
 ```
 
-or from a dataset in a local folder with the root `DATA_DIR` environment variable (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
+or from a dataset in a local folder with the `root` option and the `--local-files-only` (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
 ```bash
-DATA_DIR='./my_local_data_dir' python lerobot/scripts/visualize_dataset.py \
+python lerobot/scripts/visualize_dataset.py \
     --repo-id lerobot/pusht \
+    --root ./my_local_data_dir \
+    --local-files-only 1 \
     --episode-index 0
 ```
 
@@ -208,12 +210,10 @@ dataset attributes:
 
 A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
 - hf_dataset stored using Hugging Face datasets library serialization to parquet
-- videos are stored in mp4 format to save space or png files
-- episode_data_index saved using `safetensor` tensor serialization format
-- stats saved using `safetensor` tensor serialization format
-- info are saved using JSON
+- videos are stored in mp4 format to save space
+- metadata are stored in plain json/jsonl files
 
-Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can set the `DATA_DIR` environment variable to your root dataset folder as illustrated in the above section on dataset visualization.
+Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can use the `local_files_only` argument and specify its location with the `root` argument if it's not in the default `~/.cache/huggingface/lerobot` location.
 
 ### Evaluate a pretrained policy
 

benchmarks/video/README.md

@@ -21,7 +21,7 @@ How to decode videos?
 
 ## Variables
 **Image content & size**
-We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an appartment, or in a factory, or outdoor, or with lots of moving objects in the scene, etc. Similarly, loading times might not vary linearly with the image size (resolution).
+We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an apartment, or in a factory, or outdoor, or with lots of moving objects in the scene, etc. Similarly, loading times might not vary linearly with the image size (resolution).
 For these reasons, we run this benchmark on four representative datasets:
 - `lerobot/pusht_image`: (96 x 96 pixels) simulation with simple geometric shapes, fixed camera.
 - `aliberts/aloha_mobile_shrimp_image`: (480 x 640 pixels) real-world indoor, moving camera.
@@ -63,7 +63,7 @@ This of course is affected by the `-g` parameter during encoding, which specifie
 
 Note that this differs significantly from a typical use case like watching a movie, in which every frame is loaded sequentially from the beginning to the end and it's acceptable to have big values for `-g`.
 
-Additionally, because some policies might request single timestamps that are a few frames appart, we also have the following scenario:
+Additionally, because some policies might request single timestamps that are a few frames apart, we also have the following scenario:
 - `2_frames_4_space`: 2 frames with 4 consecutive frames of spacing in between (e.g `[t, t + 5 / fps]`),
 
 However, due to how video decoding is implemented with `pyav`, we don't have access to an accurate seek so in practice this scenario is essentially the same as `6_frames` since all 6 frames between `t` and `t + 5 / fps` will be decoded.
@@ -85,8 +85,8 @@ However, due to how video decoding is implemented with `pyav`, we don't have acc
 **Average Structural Similarity Index Measure (higher is better)**
 `avg_ssim` evaluates the perceived quality of images by comparing luminance, contrast, and structure. SSIM values range from -1 to 1, where 1 indicates perfect similarity.
 
-One aspect that can't be measured here with those metrics is the compatibility of the encoding accross platforms, in particular on web browser, for visualization purposes.
-h264, h265 and AV1 are all commonly used codecs and should not be pose an issue. However, the chroma subsampling (`pix_fmt`) format might affect compatibility:
+One aspect that can't be measured here with those metrics is the compatibility of the encoding across platforms, in particular on web browser, for visualization purposes.
+h264, h265 and AV1 are all commonly used codecs and should not pose an issue. However, the chroma subsampling (`pix_fmt`) format might affect compatibility:
 - `yuv420p` is more widely supported across various platforms, including web browsers.
 - `yuv444p` offers higher color fidelity but might not be supported as broadly.
 
@@ -116,7 +116,7 @@ Additional encoding parameters exist that are not included in this benchmark. In
 - `-preset` which allows for selecting encoding presets. This represents a collection of options that will provide a certain encoding speed to compression ratio. By leaving this parameter unspecified, it is considered to be `medium` for libx264 and libx265 and `8` for libsvtav1.
 - `-tune` which allows to optimize the encoding for certains aspects (e.g. film quality, fast decoding, etc.).
 
-See the documentation mentioned above for more detailled info on these settings and for a more comprehensive list of other parameters.
+See the documentation mentioned above for more detailed info on these settings and for a more comprehensive list of other parameters.
 
 Similarly on the decoding side, other decoders exist but are not implemented in our current benchmark. To name a few:
 - `torchaudio`

benchmarks/video/run_video_benchmark.py

@@ -32,7 +32,11 @@ import numpy as np
 import pandas as pd
 import PIL
 import torch
-from skimage.metrics import mean_squared_error, peak_signal_noise_ratio, structural_similarity
+from skimage.metrics import (
+    mean_squared_error,
+    peak_signal_noise_ratio,
+    structural_similarity,
+)
 from tqdm import tqdm
 
 from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
@@ -81,7 +85,9 @@ def get_directory_size(directory: Path) -> int:
     return total_size
 
 
-def load_original_frames(imgs_dir: Path, timestamps: list[float], fps: int) -> torch.Tensor:
+def load_original_frames(
+    imgs_dir: Path, timestamps: list[float], fps: int
+) -> torch.Tensor:
     frames = []
     for ts in timestamps:
         idx = int(ts * fps)
@@ -94,7 +100,11 @@ def load_original_frames(imgs_dir: Path, timestamps: list[float], fps: int) -> t
 
 
 def save_decoded_frames(
-    imgs_dir: Path, save_dir: Path, frames: torch.Tensor, timestamps: list[float], fps: int
+    imgs_dir: Path,
+    save_dir: Path,
+    frames: torch.Tensor,
+    timestamps: list[float],
+    fps: int,
 ) -> None:
     if save_dir.exists() and len(list(save_dir.glob("frame_*.png"))) == len(timestamps):
         return
@@ -104,7 +114,10 @@ def save_decoded_frames(
         idx = int(ts * fps)
         frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
         PIL.Image.fromarray(frame_hwc).save(save_dir / f"frame_{idx:06d}_decoded.png")
-        shutil.copyfile(imgs_dir / f"frame_{idx:06d}.png", save_dir / f"frame_{idx:06d}_original.png")
+        shutil.copyfile(
+            imgs_dir / f"frame_{idx:06d}.png",
+            save_dir / f"frame_{idx:06d}_original.png",
+        )
 
 
 def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
@@ -116,11 +129,17 @@ def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
     hf_dataset = dataset.hf_dataset.with_format(None)
 
     # We only save images from the first camera
-    img_keys = [key for key in hf_dataset.features if key.startswith("observation.image")]
+    img_keys = [
+        key for key in hf_dataset.features if key.startswith("observation.image")
+    ]
     imgs_dataset = hf_dataset.select_columns(img_keys[0])
 
     for i, item in enumerate(
-        tqdm(imgs_dataset, desc=f"saving {dataset.repo_id} first episode images", leave=False)
+        tqdm(
+            imgs_dataset,
+            desc=f"saving {dataset.repo_id} first episode images",
+            leave=False,
+        )
     ):
         img = item[img_keys[0]]
         img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
@@ -129,7 +148,9 @@ def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
             break
 
 
-def sample_timestamps(timestamps_mode: str, ep_num_images: int, fps: int) -> list[float]:
+def sample_timestamps(
+    timestamps_mode: str, ep_num_images: int, fps: int
+) -> list[float]:
     # Start at 5 to allow for 2_frames_4_space and 6_frames
     idx = random.randint(5, ep_num_images - 1)
     match timestamps_mode:
@@ -154,7 +175,9 @@ def decode_video_frames(
     backend: str,
 ) -> torch.Tensor:
     if backend in ["pyav", "video_reader"]:
-        return decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
+        return decode_video_frames_torchvision(
+            video_path, timestamps, tolerance_s, backend
+        )
     else:
         raise NotImplementedError(backend)
 
@@ -181,7 +204,9 @@ def benchmark_decoding(
         }
 
         with time_benchmark:
-            frames = decode_video_frames(video_path, timestamps=timestamps, tolerance_s=5e-1, backend=backend)
+            frames = decode_video_frames(
+                video_path, timestamps=timestamps, tolerance_s=5e-1, backend=backend
+            )
         result["load_time_video_ms"] = time_benchmark.result_ms / num_frames
 
         with time_benchmark:
@@ -190,12 +215,18 @@ def benchmark_decoding(
 
         frames_np, original_frames_np = frames.numpy(), original_frames.numpy()
         for i in range(num_frames):
-            result["mse_values"].append(mean_squared_error(original_frames_np[i], frames_np[i]))
+            result["mse_values"].append(
+                mean_squared_error(original_frames_np[i], frames_np[i])
+            )
             result["psnr_values"].append(
-                peak_signal_noise_ratio(original_frames_np[i], frames_np[i], data_range=1.0)
+                peak_signal_noise_ratio(
+                    original_frames_np[i], frames_np[i], data_range=1.0
+                )
             )
             result["ssim_values"].append(
-                structural_similarity(original_frames_np[i], frames_np[i], data_range=1.0, channel_axis=0)
+                structural_similarity(
+                    original_frames_np[i], frames_np[i], data_range=1.0, channel_axis=0
+                )
             )
 
         if save_frames and sample == 0:
@@ -215,7 +246,9 @@ def benchmark_decoding(
     # As these samples are independent, we run them in parallel threads to speed up the benchmark.
     with ThreadPoolExecutor(max_workers=num_workers) as executor:
         futures = [executor.submit(process_sample, i) for i in range(num_samples)]
-        for future in tqdm(as_completed(futures), total=num_samples, desc="samples", leave=False):
+        for future in tqdm(
+            as_completed(futures), total=num_samples, desc="samples", leave=False
+        ):
             result = future.result()
             load_times_video_ms.append(result["load_time_video_ms"])
             load_times_images_ms.append(result["load_time_images_ms"])
@@ -275,9 +308,13 @@ def benchmark_encoding_decoding(
     random.seed(seed)
     benchmark_table = []
     for timestamps_mode in tqdm(
-        decoding_cfg["timestamps_modes"], desc="decodings (timestamps_modes)", leave=False
+        decoding_cfg["timestamps_modes"],
+        desc="decodings (timestamps_modes)",
+        leave=False,
     ):
-        for backend in tqdm(decoding_cfg["backends"], desc="decodings (backends)", leave=False):
+        for backend in tqdm(
+            decoding_cfg["backends"], desc="decodings (backends)", leave=False
+        ):
             benchmark_row = benchmark_decoding(
                 imgs_dir,
                 video_path,
@@ -355,14 +392,23 @@ def main(
                 imgs_dir = output_dir / "images" / dataset.repo_id.replace("/", "_")
                 # We only use the first episode
                 save_first_episode(imgs_dir, dataset)
-                for key, values in tqdm(encoding_benchmarks.items(), desc="encodings (g, crf)", leave=False):
+                for key, values in tqdm(
+                    encoding_benchmarks.items(), desc="encodings (g, crf)", leave=False
+                ):
                     for value in tqdm(values, desc=f"encodings ({key})", leave=False):
                         encoding_cfg = BASE_ENCODING.copy()
                         encoding_cfg["vcodec"] = video_codec
                         encoding_cfg["pix_fmt"] = pixel_format
                         encoding_cfg[key] = value
-                        args_path = Path("_".join(str(value) for value in encoding_cfg.values()))
-                        video_path = output_dir / "videos" / args_path / f"{repo_id.replace('/', '_')}.mp4"
+                        args_path = Path(
+                            "_".join(str(value) for value in encoding_cfg.values())
+                        )
+                        video_path = (
+                            output_dir
+                            / "videos"
+                            / args_path
+                            / f"{repo_id.replace('/', '_')}.mp4"
+                        )
                         benchmark_table += benchmark_encoding_decoding(
                             dataset,
                             video_path,
@@ -388,7 +434,9 @@ def main(
     # Concatenate all results
     df_list = [pd.read_csv(csv_path) for csv_path in file_paths]
     concatenated_df = pd.concat(df_list, ignore_index=True)
-    concatenated_path = output_dir / f"{now:%Y-%m-%d}_{now:%H-%M-%S}_all_{num_samples}-samples.csv"
+    concatenated_path = (
+        output_dir / f"{now:%Y-%m-%d}_{now:%H-%M-%S}_all_{num_samples}-samples.csv"
+    )
     concatenated_df.to_csv(concatenated_path, header=True, index=False)
 
 

checkport.py

@@ -0,0 +1,18 @@
+import socket
+
+
+def check_port(host, port):
+    s = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+    try:
+        s.connect((host, port))
+        print(f"Connection successful to {host}:{port}!")
+    except Exception as e:
+        print(f"Connection failed to {host}:{port}: {e}")
+    finally:
+        s.close()
+
+
+if __name__ == "__main__":
+    host = "127.0.0.1"  # or "localhost"
+    port = 51350
+    check_port(host, port)

docker/lerobot-gpu-mani-skill/Dockerfile

@@ -0,0 +1,11 @@
+FROM huggingface/lerobot-gpu:latest
+
+RUN apt-get update && apt-get install -y --no-install-recommends \
+    libvulkan1 vulkan-tools \
+    && apt-get clean && rm -rf /var/lib/apt/lists/*
+
+RUN pip install --upgrade --no-cache-dir pip
+RUN pip install --no-cache-dir ".[mani-skill]"
+
+# Set EGL as the rendering backend for MuJoCo
+ENV MUJOCO_GL="egl"

examples/10_use_so100.md

@@ -1,25 +1,31 @@
-This tutorial explains how to use [SO-100](https://github.com/TheRobotStudio/SO-ARM100) with LeRobot.
+# Using the [SO-100](https://github.com/TheRobotStudio/SO-ARM100) with LeRobot
 
-## Source the parts
+
+## A. Source the parts
 
 Follow this [README](https://github.com/TheRobotStudio/SO-ARM100). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
 
 **Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
 
-## Install LeRobot
+## B. Install LeRobot
 
 On your computer:
 
 1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
 ```bash
 mkdir -p ~/miniconda3
+# Linux:
 wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
+# Mac M-series:
+# curl https://repo.anaconda.com/miniconda/Miniconda3-latest-MacOSX-arm64.sh -o ~/miniconda3/miniconda.sh
+# Mac Intel:
+# curl https://repo.anaconda.com/miniconda/Miniconda3-latest-MacOSX-x86_64.sh -o ~/miniconda3/miniconda.sh
 bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
 rm ~/miniconda3/miniconda.sh
 ~/miniconda3/bin/conda init bash
 ```
 
-2. Restart shell or `source ~/.bashrc`
+2. Restart shell or `source ~/.bashrc` (*Mac*: `source ~/.bash_profile`) or `source ~/.zshrc` if you're using zshell
 
 3. Create and activate a fresh conda environment for lerobot
 ```bash
@@ -36,23 +42,30 @@ git clone https://github.com/huggingface/lerobot.git ~/lerobot
 cd ~/lerobot && pip install -e ".[feetech]"
 ```
 
-For Linux only (not Mac), install extra dependencies for recording datasets:
+*For Linux only (not Mac)*: install extra dependencies for recording datasets:
 ```bash
 conda install -y -c conda-forge ffmpeg
 pip uninstall -y opencv-python
 conda install -y -c conda-forge "opencv>=4.10.0"
 ```
 
-## Configure the motors
+## C. Configure the motors
 
-Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the use of our scripts below.
+### 1. Find the USB ports associated to each arm
 
-**Find USB ports associated to your arms**
-To find the correct ports for each arm, run the utility script twice:
+Designate one bus servo adapter and 6 motors for your leader arm, and similarly the other bus servo adapter and 6 motors for the follower arm.
+
+#### a. Run the script to find ports
+
+Follow Step 1 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I), which illustrates the use of our scripts below.
+
+To find the port for each bus servo adapter, run the utility script:
 ```bash
 python lerobot/scripts/find_motors_bus_port.py
 ```
 
+#### b. Example outputs
+
 Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
 ```
 Finding all available ports for the MotorBus.
@@ -64,7 +77,6 @@ Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
 The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
 Reconnect the usb cable.
 ```
-
 Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
 ```
 Finding all available ports for the MotorBus.
@@ -77,13 +89,20 @@ The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
 Reconnect the usb cable.
 ```
 
-Troubleshooting: On Linux, you might need to give access to the USB ports by running:
+#### c. Troubleshooting
+On Linux, you might need to give access to the USB ports by running:
 ```bash
 sudo chmod 666 /dev/ttyACM0
 sudo chmod 666 /dev/ttyACM1
 ```
 
-**Configure your motors**
+#### d. Update YAML file
+
+Now that you have the ports, modify the *port* sections in `so100.yaml`
+
+### 2. Configure the motors
+
+#### a. Set IDs for all 12 motors
 Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
 ```bash
 python lerobot/scripts/configure_motor.py \
@@ -94,7 +113,7 @@ python lerobot/scripts/configure_motor.py \
   --ID 1
 ```
 
-Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).
+*Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).*
 
 Then unplug your motor and plug the second motor and set its ID to 2.
 ```bash
@@ -108,23 +127,25 @@ python lerobot/scripts/configure_motor.py \
 
 Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
 
-**Remove the gears of the 6 leader motors**
-Follow step 2 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
 
-**Add motor horn to the motors**
-Follow step 3 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). For SO-100, you need to align the holes on the motor horn to the motor spline to be approximately 1:30, 4:30, 7:30 and 10:30.
+#### b. Remove the gears of the 6 leader motors
+
+Follow step 2 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=248). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
+
+#### c. Add motor horn to all 12 motors
+Follow step 3 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=569). For SO-100, you need to align the holes on the motor horn to the motor spline to be approximately 1:30, 4:30, 7:30 and 10:30.
 Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
 
-## Assemble the arms
+## D. Assemble the arms
 
-Follow step 4 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
+Follow step 4 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=610). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
 
-## Calibrate
+## E. Calibrate
 
 Next, you'll need to calibrate your SO-100 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one SO-100 robot to work on another.
 
-**Manual calibration of follower arm**
-/!\ Contrarily to step 6 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the auto calibration, we will actually do manual calibration of follower for now.
+#### a. Manual calibration of follower arm
+/!\ Contrarily to step 6 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=724) which illustrates the auto calibration, we will actually do manual calibration of follower for now.
 
 You will need to move the follower arm to these positions sequentially:
 
@@ -139,8 +160,8 @@ python lerobot/scripts/control_robot.py calibrate \
     --robot-overrides '~cameras' --arms main_follower
 ```
 
-**Manual calibration of leader arm**
-Follow step 6 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
+#### b. Manual calibration of leader arm
+Follow step 6 of the [assembly video](https://youtu.be/FioA2oeFZ5I?t=724) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
 
 | 1. Zero position | 2. Rotated position | 3. Rest position |
 |---|---|---|
@@ -153,7 +174,7 @@ python lerobot/scripts/control_robot.py calibrate \
     --robot-overrides '~cameras' --arms main_leader
 ```
 
-## Teleoperate
+## F. Teleoperate
 
 **Simple teleop**
 Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
@@ -165,14 +186,14 @@ python lerobot/scripts/control_robot.py teleoperate \
 ```
 
 
-**Teleop with displaying cameras**
+#### a. Teleop with displaying cameras
 Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
 ```bash
 python lerobot/scripts/control_robot.py teleoperate \
     --robot-path lerobot/configs/robot/so100.yaml
 ```
 
-## Record a dataset
+## G. Record a dataset
 
 Once you're familiar with teleoperation, you can record your first dataset with SO-100.
 
@@ -192,7 +213,6 @@ Record 2 episodes and upload your dataset to the hub:
 python lerobot/scripts/control_robot.py record \
     --robot-path lerobot/configs/robot/so100.yaml \
     --fps 30 \
-    --root data \
     --repo-id ${HF_USER}/so100_test \
     --tags so100 tutorial \
     --warmup-time-s 5 \
@@ -202,7 +222,7 @@ python lerobot/scripts/control_robot.py record \
     --push-to-hub 1
 ```
 
-## Visualize a dataset
+## H. Visualize a dataset
 
 If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
 ```bash
@@ -212,27 +232,25 @@ echo ${HF_USER}/so100_test
 If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
 ```bash
 python lerobot/scripts/visualize_dataset_html.py \
-  --root data \
   --repo-id ${HF_USER}/so100_test
 ```
 
-## Replay an episode
+## I. Replay an episode
 
 Now try to replay the first episode on your robot:
 ```bash
-DATA_DIR=data python lerobot/scripts/control_robot.py replay \
+python lerobot/scripts/control_robot.py replay \
     --robot-path lerobot/configs/robot/so100.yaml \
     --fps 30 \
-    --root data \
     --repo-id ${HF_USER}/so100_test \
     --episode 0
 ```
 
-## Train a policy
+## J. Train a policy
 
 To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
 ```bash
-DATA_DIR=data python lerobot/scripts/train.py \
+python lerobot/scripts/train.py \
   dataset_repo_id=${HF_USER}/so100_test \
   policy=act_so100_real \
   env=so100_real \
@@ -248,18 +266,16 @@ Let's explain it:
 3. We provided an environment as argument with `env=so100_real`. This loads configurations from [`lerobot/configs/env/so100_real.yaml`](../lerobot/configs/env/so100_real.yaml).
 4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
 5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
-6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
 
 Training should take several hours. You will find checkpoints in `outputs/train/act_so100_test/checkpoints`.
 
-## Evaluate your policy
+## K. Evaluate your policy
 
 You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
 ```bash
 python lerobot/scripts/control_robot.py record \
   --robot-path lerobot/configs/robot/so100.yaml \
   --fps 30 \
-  --root data \
   --repo-id ${HF_USER}/eval_act_so100_test \
   --tags so100 tutorial eval \
   --warmup-time-s 5 \
@@ -273,7 +289,7 @@ As you can see, it's almost the same command as previously used to record your t
 1. There is an additional `-p` argument which indicates the path to your policy checkpoint with  (e.g. `-p outputs/train/eval_so100_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_so100_test`).
 2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_so100_test`).
 
-## More
+## L. More Information
 
 Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
 

examples/11_use_moss.md

@@ -192,7 +192,6 @@ Record 2 episodes and upload your dataset to the hub:
 python lerobot/scripts/control_robot.py record \
     --robot-path lerobot/configs/robot/moss.yaml \
     --fps 30 \
-    --root data \
     --repo-id ${HF_USER}/moss_test \
     --tags moss tutorial \
     --warmup-time-s 5 \
@@ -212,7 +211,6 @@ echo ${HF_USER}/moss_test
 If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
 ```bash
 python lerobot/scripts/visualize_dataset_html.py \
-  --root data \
   --repo-id ${HF_USER}/moss_test
 ```
 
@@ -220,10 +218,9 @@ python lerobot/scripts/visualize_dataset_html.py \
 
 Now try to replay the first episode on your robot:
 ```bash
-DATA_DIR=data python lerobot/scripts/control_robot.py replay \
+python lerobot/scripts/control_robot.py replay \
     --robot-path lerobot/configs/robot/moss.yaml \
     --fps 30 \
-    --root data \
     --repo-id ${HF_USER}/moss_test \
     --episode 0
 ```
@@ -232,7 +229,7 @@ DATA_DIR=data python lerobot/scripts/control_robot.py replay \
 
 To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
 ```bash
-DATA_DIR=data python lerobot/scripts/train.py \
+python lerobot/scripts/train.py \
   dataset_repo_id=${HF_USER}/moss_test \
   policy=act_moss_real \
   env=moss_real \
@@ -248,7 +245,6 @@ Let's explain it:
 3. We provided an environment as argument with `env=moss_real`. This loads configurations from [`lerobot/configs/env/moss_real.yaml`](../lerobot/configs/env/moss_real.yaml).
 4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
 5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
-6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
 
 Training should take several hours. You will find checkpoints in `outputs/train/act_moss_test/checkpoints`.
 
@@ -259,7 +255,6 @@ You can use the `record` function from [`lerobot/scripts/control_robot.py`](../l
 python lerobot/scripts/control_robot.py record \
   --robot-path lerobot/configs/robot/moss.yaml \
   --fps 30 \
-  --root data \
   --repo-id ${HF_USER}/eval_act_moss_test \
   --tags moss tutorial eval \
   --warmup-time-s 5 \

examples/12_train_hilserl_classifier.md

@@ -0,0 +1,94 @@
+# Training a HIL-SERL Reward Classifier with LeRobot
+
+This tutorial provides step-by-step instructions for training a reward classifier using LeRobot.
+
+---
+
+## Training Script Overview
+
+LeRobot includes a ready-to-use training script located at [`lerobot/scripts/train_hilserl_classifier.py`](../../lerobot/scripts/train_hilserl_classifier.py). Here's an outline of its workflow:
+
+1. **Configuration Loading**
+   The script uses Hydra to load a configuration file for subsequent steps. (Details on Hydra follow below.)
+
+2. **Dataset Initialization**
+   It loads a `LeRobotDataset` containing images and rewards. To optimize performance, a weighted random sampler is used to balance class sampling.
+
+3. **Classifier Initialization**
+   A lightweight classification head is built on top of a frozen, pretrained image encoder from HuggingFace. The classifier outputs either:
+   - A single probability (binary classification), or
+   - Logits (multi-class classification).
+
+4. **Training Loop Execution**
+   The script performs:
+   - Forward and backward passes,
+   - Optimization steps,
+   - Periodic logging, evaluation, and checkpoint saving.
+
+---
+
+## Configuring with Hydra
+
+For detailed information about Hydra usage, refer to [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md). However, note that training the reward classifier differs slightly and requires a separate configuration file.
+
+### Config File Setup
+
+The default `default.yaml` cannot launch the reward classifier training directly. Instead, you need a configuration file like [`lerobot/configs/policy/hilserl_classifier.yaml`](../../lerobot/configs/policy/hilserl_classifier.yaml), with the following adjustment:
+
+Replace the `dataset_repo_id` field with the identifier for your dataset, which contains images and sparse rewards:
+
+```yaml
+# Example: lerobot/configs/policy/reward_classifier.yaml
+dataset_repo_id: "my_dataset_repo_id"
+## Typical logs and metrics
+```
+When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
+
+After that, you will see training log like this one:
+
+```
+[2024-11-29 18:26:36,999][root][INFO] -
+Epoch 5/5
+Training:  82%|██████████████████████████████████████████████████████████████████████████████▋                 | 91/111 [00:50<00:09,  2.04it/s, loss=0.2999, acc=69.99%]
+```
+
+or evaluation log like:
+
+```
+Validation: 100%|████████████████████████████████████████████████████████████████████████████████████████████████████████████████████████| 28/28 [00:20<00:00,  1.37it/s]
+```
+
+### Metrics Tracking with Weights & Biases (WandB)
+
+If `wandb.enable` is set to `true`, the training and evaluation logs will also be saved in WandB. This allows you to track key metrics in real-time, including:
+
+- **Training Metrics**:
+  - `train/accuracy`
+  - `train/loss`
+  - `train/dataloading_s`
+- **Evaluation Metrics**:
+  - `eval/accuracy`
+  - `eval/loss`
+  - `eval/eval_s`
+
+#### Additional Features
+
+You can also log sample predictions during evaluation. Each logged sample will include:
+
+- The **input image**.
+- The **predicted label**.
+- The **true label**.
+- The **classifier's "confidence" (logits/probability)**.
+
+These logs can be useful for diagnosing and debugging performance issues.
+
+
+#### Generate protobuf files
+
+```bash
+python -m grpc_tools.protoc \
+    -I lerobot/scripts/server \
+    --python_out=lerobot/scripts/server \
+    --grpc_python_out=lerobot/scripts/server \
+    lerobot/scripts/server/hilserl.proto
+```

examples/1_load_lerobot_dataset.py

@@ -18,7 +18,10 @@ import torch
 from huggingface_hub import HfApi
 
 import lerobot
-from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
+from lerobot.common.datasets.lerobot_dataset import (
+    LeRobotDataset,
+    LeRobotDatasetMetadata,
+)
 
 # We ported a number of existing datasets ourselves, use this to see the list:
 print("List of available datasets:")
@@ -26,7 +29,10 @@ pprint(lerobot.available_datasets)
 
 # You can also browse through the datasets created/ported by the community on the hub using the hub api:
 hub_api = HfApi()
-repo_ids = [info.id for info in hub_api.list_datasets(task_categories="robotics", tags=["LeRobot"])]
+repo_ids = [
+    info.id
+    for info in hub_api.list_datasets(task_categories="robotics", tags=["LeRobot"])
+]
 pprint(repo_ids)
 
 # Or simply explore them in your web browser directly at:
@@ -41,7 +47,9 @@ ds_meta = LeRobotDatasetMetadata(repo_id)
 # structure of the dataset without downloading the actual data yet (only metadata files — which are
 # lightweight).
 print(f"Total number of episodes: {ds_meta.total_episodes}")
-print(f"Average number of frames per episode: {ds_meta.total_frames / ds_meta.total_episodes:.3f}")
+print(
+    f"Average number of frames per episode: {ds_meta.total_frames / ds_meta.total_episodes:.3f}"
+)
 print(f"Frames per second used during data collection: {ds_meta.fps}")
 print(f"Robot type: {ds_meta.robot_type}")
 print(f"keys to access images from cameras: {ds_meta.camera_keys=}\n")

examples/2_evaluate_pretrained_policy.py

@@ -32,7 +32,9 @@ if torch.cuda.is_available():
     print("GPU is available. Device set to:", device)
 else:
     device = torch.device("cpu")
-    print(f"GPU is not available. Device set to: {device}. Inference will be slower than on GPU.")
+    print(
+        f"GPU is not available. Device set to: {device}. Inference will be slower than on GPU."
+    )
     # Decrease the number of reverse-diffusion steps (trades off a bit of quality for 10x speed)
     policy.diffusion.num_inference_steps = 10
 

examples/3_train_policy.py

@@ -31,7 +31,24 @@ delta_timestamps = {
     # Load the previous action (-0.1), the next action to be executed (0.0),
     # and 14 future actions with a 0.1 seconds spacing. All these actions will be
     # used to supervise the policy.
-    "action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
+    "action": [
+        -0.1,
+        0.0,
+        0.1,
+        0.2,
+        0.3,
+        0.4,
+        0.5,
+        0.6,
+        0.7,
+        0.8,
+        0.9,
+        1.0,
+        1.1,
+        1.2,
+        1.3,
+        1.4,
+    ],
 }
 dataset = LeRobotDataset("lerobot/pusht", delta_timestamps=delta_timestamps)
 

examples/6_add_image_transforms.py

@@ -10,10 +10,10 @@ from torchvision.transforms import ToPILImage, v2
 
 from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
 
-dataset_repo_id = "lerobot/aloha_static_tape"
+dataset_repo_id = "lerobot/aloha_static_screw_driver"
 
 # Create a LeRobotDataset with no transformations
-dataset = LeRobotDataset(dataset_repo_id)
+dataset = LeRobotDataset(dataset_repo_id, episodes=[0])
 # This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
 
 # Get the index of the first observation in the first episode
@@ -28,15 +28,20 @@ transforms = v2.Compose(
     [
         v2.ColorJitter(brightness=(0.5, 1.5)),
         v2.ColorJitter(contrast=(0.5, 1.5)),
+        v2.ColorJitter(hue=(-0.1, 0.1)),
         v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
     ]
 )
 
 # Create another LeRobotDataset with the defined transformations
-transformed_dataset = LeRobotDataset(dataset_repo_id, image_transforms=transforms)
+transformed_dataset = LeRobotDataset(
+    dataset_repo_id, episodes=[0], image_transforms=transforms
+)
 
 # Get a frame from the transformed dataset
-transformed_frame = transformed_dataset[first_idx][transformed_dataset.meta.camera_keys[0]]
+transformed_frame = transformed_dataset[first_idx][
+    transformed_dataset.meta.camera_keys[0]
+]
 
 # Create a directory to store output images
 output_dir = Path("outputs/image_transforms")

examples/7_get_started_with_real_robot.md

@@ -29,7 +29,7 @@ For a visual walkthrough of the assembly process, you can refer to [this video t
 
 ## 2. Configure motors, calibrate arms, teleoperate your Koch v1.1
 
-First, install the additional dependencies required for robots built with dynamixel motors like Koch v1.1 by running one of the following commands.
+First, install the additional dependencies required for robots built with dynamixel motors like Koch v1.1 by running one of the following commands (make sure gcc is installed).
 
 Using `pip`:
 ```bash
@@ -778,7 +778,6 @@ Now run this to record 2 episodes:
 python lerobot/scripts/control_robot.py record \
   --robot-path lerobot/configs/robot/koch.yaml \
   --fps 30 \
-  --root data \
   --repo-id ${HF_USER}/koch_test \
   --tags tutorial \
   --warmup-time-s 5 \
@@ -787,7 +786,7 @@ python lerobot/scripts/control_robot.py record \
   --num-episodes 2
 ```
 
-This will write your dataset locally to `{root}/{repo-id}` (e.g. `data/cadene/koch_test`) and push it on the hub at `https://huggingface.co/datasets/{HF_USER}/{repo-id}`. Your dataset will be automatically tagged with `LeRobot` for the community to find it easily, and you can also add custom tags (in this case `tutorial` for example).
+This will write your dataset locally to `~/.cache/huggingface/lerobot/{repo-id}` (e.g. `data/cadene/koch_test`) and push it on the hub at `https://huggingface.co/datasets/{HF_USER}/{repo-id}`. Your dataset will be automatically tagged with `LeRobot` for the community to find it easily, and you can also add custom tags (in this case `tutorial` for example).
 
 You can look for other LeRobot datasets on the hub by searching for `LeRobot` tags: https://huggingface.co/datasets?other=LeRobot
 
@@ -840,7 +839,6 @@ In the coming months, we plan to release a foundational model for robotics. We a
 You can visualize your dataset by running:
 ```bash
 python lerobot/scripts/visualize_dataset_html.py \
-  --root data \
   --repo-id ${HF_USER}/koch_test
 ```
 
@@ -858,7 +856,6 @@ To replay the first episode of the dataset you just recorded, run the following
 python lerobot/scripts/control_robot.py replay \
   --robot-path lerobot/configs/robot/koch.yaml \
   --fps 30 \
-  --root data \
   --repo-id ${HF_USER}/koch_test \
   --episode 0
 ```
@@ -871,7 +868,7 @@ Your robot should replicate movements similar to those you recorded. For example
 
 To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
 ```bash
-DATA_DIR=data python lerobot/scripts/train.py \
+python lerobot/scripts/train.py \
   dataset_repo_id=${HF_USER}/koch_test \
   policy=act_koch_real \
   env=koch_real \
@@ -918,7 +915,6 @@ env:
 It should match your dataset (e.g. `fps: 30`) and your robot (e.g. `state_dim: 6` and `action_dim: 6`). We are still working on simplifying this in future versions of `lerobot`.
 4. We provided `device=cuda` since we are training on a Nvidia GPU, but you could use `device=mps` to train on Apple silicon.
 5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
-6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
 
 For more information on the `train` script see the previous tutorial: [`examples/4_train_policy_with_script.md`](../examples/4_train_policy_with_script.md)
 
@@ -991,7 +987,6 @@ To this end, you can use the `record` function from [`lerobot/scripts/control_ro
 python lerobot/scripts/control_robot.py record \
   --robot-path lerobot/configs/robot/koch.yaml \
   --fps 30 \
-  --root data \
   --repo-id ${HF_USER}/eval_koch_test \
   --tags tutorial eval \
   --warmup-time-s 5 \
@@ -1010,7 +1005,6 @@ As you can see, it's almost the same command as previously used to record your t
 You can then visualize your evaluation dataset by running the same command as before but with the new inference dataset as argument:
 ```bash
 python lerobot/scripts/visualize_dataset.py \
-  --root data \
   --repo-id ${HF_USER}/eval_koch_test
 ```
 

examples/8_use_stretch.md

@@ -128,7 +128,6 @@ Record one episode:
 python lerobot/scripts/control_robot.py record \
     --robot-path lerobot/configs/robot/stretch.yaml \
     --fps 20 \
-    --root data \
     --repo-id ${HF_USER}/stretch_test \
     --tags stretch tutorial \
     --warmup-time-s 3 \
@@ -146,7 +145,6 @@ Now try to replay this episode (make sure the robot's initial position is the sa
 python lerobot/scripts/control_robot.py replay \
     --robot-path lerobot/configs/robot/stretch.yaml \
     --fps 20 \
-    --root data \
     --repo-id ${HF_USER}/stretch_test \
     --episode 0
 ```

examples/9_use_aloha.md

@@ -56,7 +56,7 @@ python lerobot/scripts/control_robot.py teleoperate \
     --robot-overrides max_relative_target=5
 ```
 
-By adding `--robot-overrides max_relative_target=5`, we override the default value for `max_relative_target` defined in `lerobot/configs/robot/aloha.yaml`. It is expected to be `5` to limit the magnitude of the movement for more safety, but the teloperation won't be smooth. When you feel confident, you can disable this limit by adding `--robot-overrides max_relative_target=null` to the command line:
+By adding `--robot-overrides max_relative_target=5`, we override the default value for `max_relative_target` defined in `lerobot/configs/robot/aloha.yaml`. It is expected to be `5` to limit the magnitude of the movement for more safety, but the teleoperation won't be smooth. When you feel confident, you can disable this limit by adding `--robot-overrides max_relative_target=null` to the command line:
 ```bash
 python lerobot/scripts/control_robot.py teleoperate \
     --robot-path lerobot/configs/robot/aloha.yaml \
@@ -84,7 +84,6 @@ python lerobot/scripts/control_robot.py record \
     --robot-path lerobot/configs/robot/aloha.yaml \
     --robot-overrides max_relative_target=null \
     --fps 30 \
-    --root data \
     --repo-id ${HF_USER}/aloha_test \
     --tags aloha tutorial \
     --warmup-time-s 5 \
@@ -104,7 +103,6 @@ echo ${HF_USER}/aloha_test
 If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
 ```bash
 python lerobot/scripts/visualize_dataset_html.py \
-  --root data \
   --repo-id ${HF_USER}/aloha_test
 ```
 
@@ -119,7 +117,6 @@ python lerobot/scripts/control_robot.py replay \
     --robot-path lerobot/configs/robot/aloha.yaml \
     --robot-overrides max_relative_target=null \
     --fps 30 \
-    --root data \
     --repo-id ${HF_USER}/aloha_test \
     --episode 0
 ```
@@ -128,7 +125,7 @@ python lerobot/scripts/control_robot.py replay \
 
 To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
 ```bash
-DATA_DIR=data python lerobot/scripts/train.py \
+python lerobot/scripts/train.py \
   dataset_repo_id=${HF_USER}/aloha_test \
   policy=act_aloha_real \
   env=aloha_real \
@@ -144,7 +141,6 @@ Let's explain it:
 3. We provided an environment as argument with `env=aloha_real`. This loads configurations from [`lerobot/configs/env/aloha_real.yaml`](../lerobot/configs/env/aloha_real.yaml). Note: this yaml defines 18 dimensions for the `state_dim` and `action_dim`, corresponding to 18 motors, not 14 motors as used in previous Aloha work. This is because, we include the `shoulder_shadow` and `elbow_shadow` motors for simplicity.
 4. We provided `device=cuda` since we are training on a Nvidia GPU.
 5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
-6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
 
 Training should take several hours. You will find checkpoints in `outputs/train/act_aloha_test/checkpoints`.
 
@@ -156,7 +152,6 @@ python lerobot/scripts/control_robot.py record \
   --robot-path lerobot/configs/robot/aloha.yaml \
   --robot-overrides max_relative_target=null \
   --fps 30 \
-  --root data \
   --repo-id ${HF_USER}/eval_act_aloha_test \
   --tags aloha tutorial eval \
   --warmup-time-s 5 \

examples/advanced/2_calculate_validation_loss.py

@@ -14,7 +14,10 @@ from pathlib import Path
 import torch
 from huggingface_hub import snapshot_download
 
-from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, LeRobotDatasetMetadata
+from lerobot.common.datasets.lerobot_dataset import (
+    LeRobotDataset,
+    LeRobotDatasetMetadata,
+)
 from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
 
 device = torch.device("cuda")
@@ -37,7 +40,24 @@ delta_timestamps = {
     # Load the previous action (-0.1), the next action to be executed (0.0),
     # and 14 future actions with a 0.1 seconds spacing. All these actions will be
     # used to calculate the loss.
-    "action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
+    "action": [
+        -0.1,
+        0.0,
+        0.1,
+        0.2,
+        0.3,
+        0.4,
+        0.5,
+        0.6,
+        0.7,
+        0.8,
+        0.9,
+        1.0,
+        1.1,
+        1.2,
+        1.3,
+        1.4,
+    ],
 }
 
 # Load the last 10% of episodes of the dataset as a validation set.
@@ -53,8 +73,12 @@ print(f"Number of episodes in full dataset: {total_episodes}")
 print(f"Number of episodes in training dataset (90% subset): {len(train_episodes)}")
 print(f"Number of episodes in validation dataset (10% subset): {len(val_episodes)}")
 # - Load train an val datasets
-train_dataset = LeRobotDataset("lerobot/pusht", episodes=train_episodes, delta_timestamps=delta_timestamps)
-val_dataset = LeRobotDataset("lerobot/pusht", episodes=val_episodes, delta_timestamps=delta_timestamps)
+train_dataset = LeRobotDataset(
+    "lerobot/pusht", episodes=train_episodes, delta_timestamps=delta_timestamps
+)
+val_dataset = LeRobotDataset(
+    "lerobot/pusht", episodes=val_episodes, delta_timestamps=delta_timestamps
+)
 print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
 print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
 

examples/port_datasets/pusht_zarr.py

@@ -63,13 +63,15 @@ def build_features(mode: str) -> dict:
     return features
 
 
-def load_raw_dataset(zarr_path: Path, load_images: bool = True):
+def load_raw_dataset(zarr_path: Path):
     try:
         from lerobot.common.datasets.push_dataset_to_hub._diffusion_policy_replay_buffer import (
             ReplayBuffer as DiffusionPolicyReplayBuffer,
         )
     except ModuleNotFoundError as e:
-        print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
+        print(
+            "`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`"
+        )
         raise e
 
     zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
@@ -81,7 +83,9 @@ def calculate_coverage(zarr_data):
         import pymunk
         from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
     except ModuleNotFoundError as e:
-        print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
+        print(
+            "`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`"
+        )
         raise e
 
     block_pos = zarr_data["state"][:, 2:4]
@@ -111,7 +115,9 @@ def calculate_coverage(zarr_data):
         ]
         space.add(*walls)
 
-        block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
+        block_body, block_shapes = PushTEnv.add_tee(
+            space, block_pos[i].tolist(), block_angle[i].item()
+        )
         goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
         block_geom = pymunk_to_shapely(block_body, block_body.shapes)
         intersection_area = goal_geom.intersection(block_geom).area

lerobot/__init__.py

@@ -182,7 +182,11 @@ available_real_world_datasets = [
 ]
 
 available_datasets = sorted(
-    set(itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets))
+    set(
+        itertools.chain(
+            *available_datasets_per_env.values(), available_real_world_datasets
+        )
+    )
 )
 
 # lists all available policies from `lerobot/common/policies`
@@ -224,9 +228,13 @@ available_policies_per_env = {
     "dora_aloha_real": ["act_aloha_real"],
 }
 
-env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
+env_task_pairs = [
+    (env, task) for env, tasks in available_tasks_per_env.items() for task in tasks
+]
 env_dataset_pairs = [
-    (env, dataset) for env, datasets in available_datasets_per_env.items() for dataset in datasets
+    (env, dataset)
+    for env, datasets in available_datasets_per_env.items()
+    for dataset in datasets
 ]
 env_dataset_policy_triplets = [
     (env, dataset, policy)

lerobot/common/datasets/compute_stats.py

@@ -45,12 +45,20 @@ def get_stats_einops_patterns(dataset, num_workers=0):
         if key in dataset.meta.camera_keys:
             # sanity check that images are channel first
             _, c, h, w = batch[key].shape
-            assert c < h and c < w, f"expect channel first images, but instead {batch[key].shape}"
+            assert (
+                c < h and c < w
+            ), f"expect channel first images, but instead {batch[key].shape}"
 
             # sanity check that images are float32 in range [0,1]
-            assert batch[key].dtype == torch.float32, f"expect torch.float32, but instead {batch[key].dtype=}"
-            assert batch[key].max() <= 1, f"expect pixels lower than 1, but instead {batch[key].max()=}"
-            assert batch[key].min() >= 0, f"expect pixels greater than 1, but instead {batch[key].min()=}"
+            assert (
+                batch[key].dtype == torch.float32
+            ), f"expect torch.float32, but instead {batch[key].dtype=}"
+            assert (
+                batch[key].max() <= 1
+            ), f"expect pixels lower than 1, but instead {batch[key].max()=}"
+            assert (
+                batch[key].min() >= 0
+            ), f"expect pixels greater than 1, but instead {batch[key].min()=}"
 
             stats_patterns[key] = "b c h w -> c 1 1"
         elif batch[key].ndim == 2:
@@ -98,7 +106,11 @@ def compute_stats(dataset, batch_size=8, num_workers=8, max_num_samples=None):
     running_item_count = 0  # for online mean computation
     dataloader = create_seeded_dataloader(dataset, batch_size, seed=1337)
     for i, batch in enumerate(
-        tqdm.tqdm(dataloader, total=ceil(max_num_samples / batch_size), desc="Compute mean, min, max")
+        tqdm.tqdm(
+            dataloader,
+            total=ceil(max_num_samples / batch_size),
+            desc="Compute mean, min, max",
+        )
     ):
         this_batch_size = len(batch["index"])
         running_item_count += this_batch_size
@@ -113,9 +125,16 @@ def compute_stats(dataset, batch_size=8, num_workers=8, max_num_samples=None):
             # and x is the current batch mean. Some rearrangement is then required to avoid risking
             # numerical overflow. Another hint: Nₙ₋₁ = Nₙ - Bₙ. Rearrangement yields
             # x̄ₙ = x̄ₙ₋₁ + Bₙ * (xₙ - x̄ₙ₋₁) / Nₙ
-            mean[key] = mean[key] + this_batch_size * (batch_mean - mean[key]) / running_item_count
-            max[key] = torch.maximum(max[key], einops.reduce(batch[key], pattern, "max"))
-            min[key] = torch.minimum(min[key], einops.reduce(batch[key], pattern, "min"))
+            mean[key] = (
+                mean[key]
+                + this_batch_size * (batch_mean - mean[key]) / running_item_count
+            )
+            max[key] = torch.maximum(
+                max[key], einops.reduce(batch[key], pattern, "max")
+            )
+            min[key] = torch.minimum(
+                min[key], einops.reduce(batch[key], pattern, "min")
+            )
 
         if i == ceil(max_num_samples / batch_size) - 1:
             break
@@ -124,7 +143,9 @@ def compute_stats(dataset, batch_size=8, num_workers=8, max_num_samples=None):
     running_item_count = 0  # for online std computation
     dataloader = create_seeded_dataloader(dataset, batch_size, seed=1337)
     for i, batch in enumerate(
-        tqdm.tqdm(dataloader, total=ceil(max_num_samples / batch_size), desc="Compute std")
+        tqdm.tqdm(
+            dataloader, total=ceil(max_num_samples / batch_size), desc="Compute std"
+        )
     ):
         this_batch_size = len(batch["index"])
         running_item_count += this_batch_size
@@ -138,7 +159,9 @@ def compute_stats(dataset, batch_size=8, num_workers=8, max_num_samples=None):
             # Numerically stable update step for mean computation (where the mean is over squared
             # residuals).See notes in the mean computation loop above.
             batch_std = einops.reduce((batch[key] - mean[key]) ** 2, pattern, "mean")
-            std[key] = std[key] + this_batch_size * (batch_std - std[key]) / running_item_count
+            std[key] = (
+                std[key] + this_batch_size * (batch_std - std[key]) / running_item_count
+            )
 
         if i == ceil(max_num_samples / batch_size) - 1:
             break
@@ -177,13 +200,19 @@ def aggregate_stats(ls_datasets) -> dict[str, torch.Tensor]:
             # compute `max(dataset_0["max"], dataset_1["max"], ...)`
             stats[data_key][stat_key] = einops.reduce(
                 torch.stack(
-                    [ds.meta.stats[data_key][stat_key] for ds in ls_datasets if data_key in ds.meta.stats],
+                    [
+                        ds.meta.stats[data_key][stat_key]
+                        for ds in ls_datasets
+                        if data_key in ds.meta.stats
+                    ],
                     dim=0,
                 ),
                 "n ... -> ...",
                 stat_key,
             )
-        total_samples = sum(d.num_frames for d in ls_datasets if data_key in d.meta.stats)
+        total_samples = sum(
+            d.num_frames for d in ls_datasets if data_key in d.meta.stats
+        )
         # Compute the "sum" statistic by multiplying each mean by the number of samples in the respective
         # dataset, then divide by total_samples to get the overall "mean".
         # NOTE: the brackets around (d.num_frames / total_samples) are needed tor minimize the risk of

lerobot/common/datasets/factory.py

@@ -74,7 +74,25 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
 
     image_transforms = None
     if cfg.training.image_transforms.enable:
-        cfg_tf = cfg.training.image_transforms
+        default_tf = OmegaConf.create(
+            {
+                "brightness": {"weight": 0.0, "min_max": None},
+                "contrast": {"weight": 0.0, "min_max": None},
+                "saturation": {"weight": 0.0, "min_max": None},
+                "hue": {"weight": 0.0, "min_max": None},
+                "sharpness": {"weight": 0.0, "min_max": None},
+                "max_num_transforms": None,
+                "random_order": False,
+                "image_size": None,
+                "interpolation": None,
+                "image_mean": None,
+                "image_std": None,
+            }
+        )
+        cfg_tf = OmegaConf.merge(
+            OmegaConf.create(default_tf), cfg.training.image_transforms
+        )
+
         image_transforms = get_image_transforms(
             brightness_weight=cfg_tf.brightness.weight,
             brightness_min_max=cfg_tf.brightness.min_max,
@@ -88,6 +106,12 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
             sharpness_min_max=cfg_tf.sharpness.min_max,
             max_num_transforms=cfg_tf.max_num_transforms,
             random_order=cfg_tf.random_order,
+            image_size=(cfg_tf.image_size.height, cfg_tf.image_size.width)
+            if cfg_tf.image_size
+            else None,
+            interpolation=cfg_tf.interpolation,
+            image_mean=cfg_tf.image_mean,
+            image_std=cfg_tf.image_std,
         )
 
     if isinstance(cfg.dataset_repo_id, str):
@@ -111,6 +135,8 @@ def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotData
             for stats_type, listconfig in stats_dict.items():
                 # example of stats_type: min, max, mean, std
                 stats = OmegaConf.to_container(listconfig, resolve=True)
-                dataset.meta.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
+                dataset.meta.stats[key][stats_type] = torch.tensor(
+                    stats, dtype=torch.float32
+                )
 
     return dataset

lerobot/common/datasets/image_writer.py

@@ -28,7 +28,7 @@ def safe_stop_image_writer(func):
         try:
             return func(*args, **kwargs)
         except Exception as e:
-            dataset = kwargs.get("dataset", None)
+            dataset = kwargs.get("dataset")
             image_writer = getattr(dataset, "image_writer", None) if dataset else None
             if image_writer is not None:
                 print("Waiting for image writer to terminate...")
@@ -109,7 +109,9 @@ class AsyncImageWriter:
         self._stopped = False
 
         if num_threads <= 0 and num_processes <= 0:
-            raise ValueError("Number of threads and processes must be greater than zero.")
+            raise ValueError(
+                "Number of threads and processes must be greater than zero."
+            )
 
         if self.num_processes == 0:
             # Use threading
@@ -123,12 +125,16 @@ class AsyncImageWriter:
             # Use multiprocessing
             self.queue = multiprocessing.JoinableQueue()
             for _ in range(self.num_processes):
-                p = multiprocessing.Process(target=worker_process, args=(self.queue, self.num_threads))
+                p = multiprocessing.Process(
+                    target=worker_process, args=(self.queue, self.num_threads)
+                )
                 p.daemon = True
                 p.start()
                 self.processes.append(p)
 
-    def save_image(self, image: torch.Tensor | np.ndarray | PIL.Image.Image, fpath: Path):
+    def save_image(
+        self, image: torch.Tensor | np.ndarray | PIL.Image.Image, fpath: Path
+    ):
         if isinstance(image, torch.Tensor):
             # Convert tensor to numpy array to minimize main process time
             image = image.cpu().numpy()

lerobot/common/datasets/lerobot_dataset.py

@@ -68,7 +68,9 @@ from lerobot.common.robot_devices.robots.utils import Robot
 
 # For maintainers, see lerobot/common/datasets/push_dataset_to_hub/CODEBASE_VERSION.md
 CODEBASE_VERSION = "v2.0"
-LEROBOT_HOME = Path(os.getenv("LEROBOT_HOME", "~/.cache/huggingface/lerobot")).expanduser()
+LEROBOT_HOME = Path(
+    os.getenv("LEROBOT_HOME", "~/.cache/huggingface/lerobot")
+).expanduser()
 
 
 class LeRobotDatasetMetadata:
@@ -84,7 +86,8 @@ class LeRobotDatasetMetadata:
 
         # Load metadata
         (self.root / "meta").mkdir(exist_ok=True, parents=True)
-        self.pull_from_repo(allow_patterns="meta/")
+        if not self.local_files_only:
+            self.pull_from_repo(allow_patterns="meta/")
         self.info = load_info(self.root)
         self.stats = load_stats(self.root)
         self.tasks = load_tasks(self.root)
@@ -107,7 +110,11 @@ class LeRobotDatasetMetadata:
 
     @cached_property
     def _hub_version(self) -> str | None:
-        return None if self.local_files_only else get_hub_safe_version(self.repo_id, CODEBASE_VERSION)
+        return (
+            None
+            if self.local_files_only
+            else get_hub_safe_version(self.repo_id, CODEBASE_VERSION)
+        )
 
     @property
     def _version(self) -> str:
@@ -121,7 +128,9 @@ class LeRobotDatasetMetadata:
 
     def get_video_file_path(self, ep_index: int, vid_key: str) -> Path:
         ep_chunk = self.get_episode_chunk(ep_index)
-        fpath = self.video_path.format(episode_chunk=ep_chunk, video_key=vid_key, episode_index=ep_index)
+        fpath = self.video_path.format(
+            episode_chunk=ep_chunk, video_key=vid_key, episode_index=ep_index
+        )
         return Path(fpath)
 
     def get_episode_chunk(self, ep_index: int) -> int:
@@ -165,7 +174,11 @@ class LeRobotDatasetMetadata:
     @property
     def camera_keys(self) -> list[str]:
         """Keys to access visual modalities (regardless of their storage method)."""
-        return [key for key, ft in self.features.items() if ft["dtype"] in ["video", "image"]]
+        return [
+            key
+            for key, ft in self.features.items()
+            if ft["dtype"] in ["video", "image"]
+        ]
 
     @property
     def names(self) -> dict[str, list | dict]:
@@ -214,7 +227,9 @@ class LeRobotDatasetMetadata:
         task_index = self.task_to_task_index.get(task, None)
         return task_index if task_index is not None else self.total_tasks
 
-    def save_episode(self, episode_index: int, episode_length: int, task: str, task_index: int) -> None:
+    def save_episode(
+        self, episode_index: int, episode_length: int, task: str, task_index: int
+    ) -> None:
         self.info["total_episodes"] += 1
         self.info["total_frames"] += episode_length
 
@@ -256,7 +271,9 @@ class LeRobotDatasetMetadata:
         """
         for key in self.video_keys:
             if not self.features[key].get("info", None):
-                video_path = self.root / self.get_video_file_path(ep_index=0, vid_key=key)
+                video_path = self.root / self.get_video_file_path(
+                    ep_index=0, vid_key=key
+                )
                 self.info["features"][key]["info"] = get_video_info(video_path)
 
         write_json(self.info, self.root / INFO_PATH)
@@ -291,14 +308,14 @@ class LeRobotDatasetMetadata:
         obj.root.mkdir(parents=True, exist_ok=False)
 
         if robot is not None:
-            features = get_features_from_robot(robot, use_videos)
+            features = {**(features or {}), **get_features_from_robot(robot)}
             robot_type = robot.robot_type
             if not all(cam.fps == fps for cam in robot.cameras.values()):
                 logging.warning(
                     f"Some cameras in your {robot.robot_type} robot don't have an fps matching the fps of your dataset."
                     "In this case, frames from lower fps cameras will be repeated to fill in the blanks."
                 )
-        elif robot_type is None or features is None:
+        elif features is None:
             raise ValueError(
                 "Dataset features must either come from a Robot or explicitly passed upon creation."
             )
@@ -307,7 +324,9 @@ class LeRobotDatasetMetadata:
             features = {**features, **DEFAULT_FEATURES}
 
         obj.tasks, obj.stats, obj.episodes = {}, {}, []
-        obj.info = create_empty_dataset_info(CODEBASE_VERSION, fps, robot_type, features, use_videos)
+        obj.info = create_empty_dataset_info(
+            CODEBASE_VERSION, fps, robot_type, features, use_videos
+        )
         if len(obj.video_keys) > 0 and not use_videos:
             raise ValueError()
         write_json(obj.info, obj.root / INFO_PATH)
@@ -443,7 +462,9 @@ class LeRobotDataset(torch.utils.data.Dataset):
         self.root.mkdir(exist_ok=True, parents=True)
 
         # Load metadata
-        self.meta = LeRobotDatasetMetadata(self.repo_id, self.root, self.local_files_only)
+        self.meta = LeRobotDatasetMetadata(
+            self.repo_id, self.root, self.local_files_only
+        )
 
         # Check version
         check_version_compatibility(self.repo_id, self.meta._version, CODEBASE_VERSION)
@@ -451,10 +472,14 @@ class LeRobotDataset(torch.utils.data.Dataset):
         # Load actual data
         self.download_episodes(download_videos)
         self.hf_dataset = self.load_hf_dataset()
-        self.episode_data_index = get_episode_data_index(self.meta.episodes, self.episodes)
+        self.episode_data_index = get_episode_data_index(
+            self.meta.episodes, self.episodes
+        )
 
         # Check timestamps
-        check_timestamps_sync(self.hf_dataset, self.episode_data_index, self.fps, self.tolerance_s)
+        check_timestamps_sync(
+            self.hf_dataset, self.episode_data_index, self.fps, self.tolerance_s
+        )
 
         # Setup delta_indices
         if self.delta_timestamps is not None:
@@ -500,7 +525,9 @@ class LeRobotDataset(torch.utils.data.Dataset):
             tags=tags, dataset_info=self.meta.info, license=license, **card_kwargs
         )
         card.push_to_hub(repo_id=self.repo_id, repo_type="dataset")
-        create_branch(repo_id=self.repo_id, branch=CODEBASE_VERSION, repo_type="dataset")
+        create_branch(
+            repo_id=self.repo_id, branch=CODEBASE_VERSION, repo_type="dataset"
+        )
 
     def pull_from_repo(
         self,
@@ -528,7 +555,9 @@ class LeRobotDataset(torch.utils.data.Dataset):
         files = None
         ignore_patterns = None if download_videos else "videos/"
         if self.episodes is not None:
-            files = [str(self.meta.get_data_file_path(ep_idx)) for ep_idx in self.episodes]
+            files = [
+                str(self.meta.get_data_file_path(ep_idx)) for ep_idx in self.episodes
+            ]
             if len(self.meta.video_keys) > 0 and download_videos:
                 video_files = [
                     str(self.meta.get_video_file_path(ep_idx, vid_key))
@@ -537,7 +566,8 @@ class LeRobotDataset(torch.utils.data.Dataset):
                 ]
                 files += video_files
 
-        self.pull_from_repo(allow_patterns=files, ignore_patterns=ignore_patterns)
+        if not self.local_files_only:
+            self.pull_from_repo(allow_patterns=files, ignore_patterns=ignore_patterns)
 
     def load_hf_dataset(self) -> datasets.Dataset:
         """hf_dataset contains all the observations, states, actions, rewards, etc."""
@@ -545,7 +575,10 @@ class LeRobotDataset(torch.utils.data.Dataset):
             path = str(self.root / "data")
             hf_dataset = load_dataset("parquet", data_dir=path, split="train")
         else:
-            files = [str(self.root / self.meta.get_data_file_path(ep_idx)) for ep_idx in self.episodes]
+            files = [
+                str(self.root / self.meta.get_data_file_path(ep_idx))
+                for ep_idx in self.episodes
+            ]
             hf_dataset = load_dataset("parquet", data_files=files, split="train")
 
         # TODO(aliberts): hf_dataset.set_format("torch")
@@ -561,12 +594,20 @@ class LeRobotDataset(torch.utils.data.Dataset):
     @property
     def num_frames(self) -> int:
         """Number of frames in selected episodes."""
-        return len(self.hf_dataset) if self.hf_dataset is not None else self.meta.total_frames
+        return (
+            len(self.hf_dataset)
+            if self.hf_dataset is not None
+            else self.meta.total_frames
+        )
 
     @property
     def num_episodes(self) -> int:
         """Number of episodes selected."""
-        return len(self.episodes) if self.episodes is not None else self.meta.total_episodes
+        return (
+            len(self.episodes)
+            if self.episodes is not None
+            else self.meta.total_episodes
+        )
 
     @property
     def features(self) -> dict[str, dict]:
@@ -580,16 +621,24 @@ class LeRobotDataset(torch.utils.data.Dataset):
         else:
             return get_hf_features_from_features(self.features)
 
-    def _get_query_indices(self, idx: int, ep_idx: int) -> tuple[dict[str, list[int | bool]]]:
+    def _get_query_indices(
+        self, idx: int, ep_idx: int
+    ) -> tuple[dict[str, list[int | bool]]]:
         ep_start = self.episode_data_index["from"][ep_idx]
         ep_end = self.episode_data_index["to"][ep_idx]
         query_indices = {
-            key: [max(ep_start.item(), min(ep_end.item() - 1, idx + delta)) for delta in delta_idx]
+            key: [
+                max(ep_start.item(), min(ep_end.item() - 1, idx + delta))
+                for delta in delta_idx
+            ]
             for key, delta_idx in self.delta_indices.items()
         }
         padding = {  # Pad values outside of current episode range
             f"{key}_is_pad": torch.BoolTensor(
-                [(idx + delta < ep_start.item()) | (idx + delta >= ep_end.item()) for delta in delta_idx]
+                [
+                    (idx + delta < ep_start.item()) | (idx + delta >= ep_end.item())
+                    for delta in delta_idx
+                ]
             )
             for key, delta_idx in self.delta_indices.items()
         }
@@ -617,7 +666,9 @@ class LeRobotDataset(torch.utils.data.Dataset):
             if key not in self.meta.video_keys
         }
 
-    def _query_videos(self, query_timestamps: dict[str, list[float]], ep_idx: int) -> dict:
+    def _query_videos(
+        self, query_timestamps: dict[str, list[float]], ep_idx: int
+    ) -> dict:
         """Note: When using data workers (e.g. DataLoader with num_workers>0), do not call this function
         in the main process (e.g. by using a second Dataloader with num_workers=0). It will result in a
         Segmentation Fault. This probably happens because a memory reference to the video loader is created in
@@ -647,7 +698,9 @@ class LeRobotDataset(torch.utils.data.Dataset):
 
         query_indices = None
         if self.delta_indices is not None:
-            current_ep_idx = self.episodes.index(ep_idx) if self.episodes is not None else ep_idx
+            current_ep_idx = (
+                self.episodes.index(ep_idx) if self.episodes is not None else ep_idx
+            )
             query_indices, padding = self._get_query_indices(idx, current_ep_idx)
             query_result = self._query_hf_dataset(query_indices)
             item = {**item, **padding}
@@ -679,19 +732,28 @@ class LeRobotDataset(torch.utils.data.Dataset):
         )
 
     def create_episode_buffer(self, episode_index: int | None = None) -> dict:
-        current_ep_idx = self.meta.total_episodes if episode_index is None else episode_index
+        current_ep_idx = (
+            self.meta.total_episodes if episode_index is None else episode_index
+        )
         return {
             "size": 0,
-            **{key: current_ep_idx if key == "episode_index" else [] for key in self.features},
+            **{
+                key: current_ep_idx if key == "episode_index" else []
+                for key in self.features
+            },
         }
 
-    def _get_image_file_path(self, episode_index: int, image_key: str, frame_index: int) -> Path:
+    def _get_image_file_path(
+        self, episode_index: int, image_key: str, frame_index: int
+    ) -> Path:
         fpath = DEFAULT_IMAGE_PATH.format(
             image_key=image_key, episode_index=episode_index, frame_index=frame_index
         )
         return self.root / fpath
 
-    def _save_image(self, image: torch.Tensor | np.ndarray | PIL.Image.Image, fpath: Path) -> None:
+    def _save_image(
+        self, image: torch.Tensor | np.ndarray | PIL.Image.Image, fpath: Path
+    ) -> None:
         if self.image_writer is None:
             if isinstance(image, torch.Tensor):
                 image = image.cpu().numpy()
@@ -712,7 +774,9 @@ class LeRobotDataset(torch.utils.data.Dataset):
             self.episode_buffer = self.create_episode_buffer()
 
         frame_index = self.episode_buffer["size"]
-        timestamp = frame.pop("timestamp") if "timestamp" in frame else frame_index / self.fps
+        timestamp = (
+            frame.pop("timestamp") if "timestamp" in frame else frame_index / self.fps
+        )
         self.episode_buffer["frame_index"].append(frame_index)
         self.episode_buffer["timestamp"].append(timestamp)
 
@@ -721,11 +785,17 @@ class LeRobotDataset(torch.utils.data.Dataset):
                 raise ValueError(key)
 
             if self.features[key]["dtype"] not in ["image", "video"]:
-                item = frame[key].numpy() if isinstance(frame[key], torch.Tensor) else frame[key]
+                item = (
+                    frame[key].numpy()
+                    if isinstance(frame[key], torch.Tensor)
+                    else frame[key]
+                )
                 self.episode_buffer[key].append(item)
             elif self.features[key]["dtype"] in ["image", "video"]:
                 img_path = self._get_image_file_path(
-                    episode_index=self.episode_buffer["episode_index"], image_key=key, frame_index=frame_index
+                    episode_index=self.episode_buffer["episode_index"],
+                    image_key=key,
+                    frame_index=frame_index,
                 )
                 if frame_index == 0:
                     img_path.parent.mkdir(parents=True, exist_ok=True)
@@ -734,7 +804,9 @@ class LeRobotDataset(torch.utils.data.Dataset):
 
         self.episode_buffer["size"] += 1
 
-    def save_episode(self, task: str, encode_videos: bool = True, episode_data: dict | None = None) -> None:
+    def save_episode(
+        self, task: str, encode_videos: bool = True, episode_data: dict | None = None
+    ) -> None:
         """
         This will save to disk the current episode in self.episode_buffer. Note that since it affects files on
         disk, it sets self.consolidated to False to ensure proper consolidation later on before uploading to
@@ -801,7 +873,9 @@ class LeRobotDataset(torch.utils.data.Dataset):
 
     def _save_episode_table(self, episode_buffer: dict, episode_index: int) -> None:
         episode_dict = {key: episode_buffer[key] for key in self.hf_features}
-        ep_dataset = datasets.Dataset.from_dict(episode_dict, features=self.hf_features, split="train")
+        ep_dataset = datasets.Dataset.from_dict(
+            episode_dict, features=self.hf_features, split="train"
+        )
         ep_data_path = self.root / self.meta.get_data_file_path(ep_index=episode_index)
         ep_data_path.parent.mkdir(parents=True, exist_ok=True)
         write_parquet(ep_dataset, ep_data_path)
@@ -873,10 +947,16 @@ class LeRobotDataset(torch.utils.data.Dataset):
 
         return video_paths
 
-    def consolidate(self, run_compute_stats: bool = True, keep_image_files: bool = False) -> None:
+    def consolidate(
+        self, run_compute_stats: bool = True, keep_image_files: bool = False
+    ) -> None:
         self.hf_dataset = self.load_hf_dataset()
-        self.episode_data_index = get_episode_data_index(self.meta.episodes, self.episodes)
-        check_timestamps_sync(self.hf_dataset, self.episode_data_index, self.fps, self.tolerance_s)
+        self.episode_data_index = get_episode_data_index(
+            self.meta.episodes, self.episodes
+        )
+        check_timestamps_sync(
+            self.hf_dataset, self.episode_data_index, self.fps, self.tolerance_s
+        )
 
         if len(self.meta.video_keys) > 0:
             self.encode_videos()
@@ -981,7 +1061,9 @@ class MultiLeRobotDataset(torch.utils.data.Dataset):
         super().__init__()
         self.repo_ids = repo_ids
         self.root = Path(root) if root else LEROBOT_HOME
-        self.tolerances_s = tolerances_s if tolerances_s else {repo_id: 1e-4 for repo_id in repo_ids}
+        self.tolerances_s = (
+            tolerances_s if tolerances_s else {repo_id: 1e-4 for repo_id in repo_ids}
+        )
         # Construct the underlying datasets passing everything but `transform` and `delta_timestamps` which
         # are handled by this class.
         self._datasets = [
@@ -1058,7 +1140,13 @@ class MultiLeRobotDataset(torch.utils.data.Dataset):
     def features(self) -> datasets.Features:
         features = {}
         for dataset in self._datasets:
-            features.update({k: v for k, v in dataset.hf_features.items() if k not in self.disabled_features})
+            features.update(
+                {
+                    k: v
+                    for k, v in dataset.hf_features.items()
+                    if k not in self.disabled_features
+                }
+            )
         return features
 
     @property
@@ -1119,7 +1207,9 @@ class MultiLeRobotDataset(torch.utils.data.Dataset):
                 continue
             break
         else:
-            raise AssertionError("We expect the loop to break out as long as the index is within bounds.")
+            raise AssertionError(
+                "We expect the loop to break out as long as the index is within bounds."
+            )
         item = self._datasets[dataset_idx][idx - start_idx]
         item["dataset_index"] = torch.tensor(dataset_idx)
         for data_key in self.disabled_features:

lerobot/common/datasets/online_buffer.py

@@ -131,7 +131,9 @@ class OnlineBuffer(torch.utils.data.Dataset):
         else:
             self._delta_timestamps = None
 
-    def _make_data_spec(self, data_spec: dict[str, Any], buffer_capacity: int) -> dict[str, dict[str, Any]]:
+    def _make_data_spec(
+        self, data_spec: dict[str, Any], buffer_capacity: int
+    ) -> dict[str, dict[str, Any]]:
         """Makes the data spec for np.memmap."""
         if any(k.startswith("_") for k in data_spec):
             raise ValueError(
@@ -154,14 +156,32 @@ class OnlineBuffer(torch.utils.data.Dataset):
             OnlineBuffer.NEXT_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": ()},
             # Since the memmap is initialized with all-zeros, this keeps track of which indices are occupied
             # with real data rather than the dummy initialization.
-            OnlineBuffer.OCCUPANCY_MASK_KEY: {"dtype": np.dtype("?"), "shape": (buffer_capacity,)},
-            OnlineBuffer.INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
-            OnlineBuffer.FRAME_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
-            OnlineBuffer.EPISODE_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
-            OnlineBuffer.TIMESTAMP_KEY: {"dtype": np.dtype("float64"), "shape": (buffer_capacity,)},
+            OnlineBuffer.OCCUPANCY_MASK_KEY: {
+                "dtype": np.dtype("?"),
+                "shape": (buffer_capacity,),
+            },
+            OnlineBuffer.INDEX_KEY: {
+                "dtype": np.dtype("int64"),
+                "shape": (buffer_capacity,),
+            },
+            OnlineBuffer.FRAME_INDEX_KEY: {
+                "dtype": np.dtype("int64"),
+                "shape": (buffer_capacity,),
+            },
+            OnlineBuffer.EPISODE_INDEX_KEY: {
+                "dtype": np.dtype("int64"),
+                "shape": (buffer_capacity,),
+            },
+            OnlineBuffer.TIMESTAMP_KEY: {
+                "dtype": np.dtype("float64"),
+                "shape": (buffer_capacity,),
+            },
         }
         for k, v in data_spec.items():
-            complete_data_spec[k] = {"dtype": v["dtype"], "shape": (buffer_capacity, *v["shape"])}
+            complete_data_spec[k] = {
+                "dtype": v["dtype"],
+                "shape": (buffer_capacity, *v["shape"]),
+            }
         return complete_data_spec
 
     def add_data(self, data: dict[str, np.ndarray]):
@@ -188,7 +208,9 @@ class OnlineBuffer(torch.utils.data.Dataset):
 
         # Shift the incoming indices if necessary.
         if self.num_frames > 0:
-            last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][next_index - 1]
+            last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][
+                next_index - 1
+            ]
             last_data_index = self._data[OnlineBuffer.INDEX_KEY][next_index - 1]
             data[OnlineBuffer.EPISODE_INDEX_KEY] += last_episode_index + 1
             data[OnlineBuffer.INDEX_KEY] += last_data_index + 1
@@ -223,7 +245,11 @@ class OnlineBuffer(torch.utils.data.Dataset):
     @property
     def num_episodes(self) -> int:
         return len(
-            np.unique(self._data[OnlineBuffer.EPISODE_INDEX_KEY][self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]])
+            np.unique(
+                self._data[OnlineBuffer.EPISODE_INDEX_KEY][
+                    self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]
+                ]
+            )
         )
 
     @property
@@ -261,7 +287,9 @@ class OnlineBuffer(torch.utils.data.Dataset):
                 self._data[OnlineBuffer.OCCUPANCY_MASK_KEY],
             )
         )[0]
-        episode_timestamps = self._data[OnlineBuffer.TIMESTAMP_KEY][episode_data_indices]
+        episode_timestamps = self._data[OnlineBuffer.TIMESTAMP_KEY][
+            episode_data_indices
+        ]
 
         for data_key in self.delta_timestamps:
             # Note: The logic in this loop is copied from `load_previous_and_future_frames`.
@@ -278,7 +306,8 @@ class OnlineBuffer(torch.utils.data.Dataset):
 
             # Check violated query timestamps are all outside the episode range.
             assert (
-                (query_ts[is_pad] < episode_timestamps[0]) | (episode_timestamps[-1] < query_ts[is_pad])
+                (query_ts[is_pad] < episode_timestamps[0])
+                | (episode_timestamps[-1] < query_ts[is_pad])
             ).all(), (
                 f"One or several timestamps unexpectedly violate the tolerance ({min_} > {self.tolerance_s=}"
                 ") inside the episode range."
@@ -293,7 +322,9 @@ class OnlineBuffer(torch.utils.data.Dataset):
 
     def get_data_by_key(self, key: str) -> torch.Tensor:
         """Returns all data for a given data key as a Tensor."""
-        return torch.from_numpy(self._data[key][self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]])
+        return torch.from_numpy(
+            self._data[key][self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]]
+        )
 
 
 def compute_sampler_weights(
@@ -324,13 +355,19 @@ def compute_sampler_weights(
         - Options `drop_first_n_frames` and `episode_indices_to_use` can be added easily. They were not
           included here to avoid adding complexity.
     """
-    if len(offline_dataset) == 0 and (online_dataset is None or len(online_dataset) == 0):
-        raise ValueError("At least one of `offline_dataset` or `online_dataset` should be contain data.")
+    if len(offline_dataset) == 0 and (
+        online_dataset is None or len(online_dataset) == 0
+    ):
+        raise ValueError(
+            "At least one of `offline_dataset` or `online_dataset` should be contain data."
+        )
     if (online_dataset is None) ^ (online_sampling_ratio is None):
         raise ValueError(
             "`online_dataset` and `online_sampling_ratio` must be provided together or not at all."
         )
-    offline_sampling_ratio = 0 if online_sampling_ratio is None else 1 - online_sampling_ratio
+    offline_sampling_ratio = (
+        0 if online_sampling_ratio is None else 1 - online_sampling_ratio
+    )
 
     weights = []
 

lerobot/common/datasets/push_dataset_to_hub/_diffusion_policy_replay_buffer.py

@@ -37,10 +37,16 @@ def check_chunks_compatible(chunks: tuple, shape: tuple):
         assert c > 0
 
 
-def rechunk_recompress_array(group, name, chunks=None, chunk_length=None, compressor=None, tmp_key="_temp"):
+def rechunk_recompress_array(
+    group, name, chunks=None, chunk_length=None, compressor=None, tmp_key="_temp"
+):
     old_arr = group[name]
     if chunks is None:
-        chunks = (chunk_length,) + old_arr.chunks[1:] if chunk_length is not None else old_arr.chunks
+        chunks = (
+            (chunk_length,) + old_arr.chunks[1:]
+            if chunk_length is not None
+            else old_arr.chunks
+        )
     check_chunks_compatible(chunks, old_arr.shape)
 
     if compressor is None:
@@ -82,13 +88,18 @@ def get_optimal_chunks(shape, dtype, target_chunk_bytes=2e6, max_chunk_length=No
     for i in range(len(shape) - 1):
         this_chunk_bytes = itemsize * np.prod(rshape[:i])
         next_chunk_bytes = itemsize * np.prod(rshape[: i + 1])
-        if this_chunk_bytes <= target_chunk_bytes and next_chunk_bytes > target_chunk_bytes:
+        if (
+            this_chunk_bytes <= target_chunk_bytes
+            and next_chunk_bytes > target_chunk_bytes
+        ):
             split_idx = i
 
     rchunks = rshape[:split_idx]
     item_chunk_bytes = itemsize * np.prod(rshape[:split_idx])
     this_max_chunk_length = rshape[split_idx]
-    next_chunk_length = min(this_max_chunk_length, math.ceil(target_chunk_bytes / item_chunk_bytes))
+    next_chunk_length = min(
+        this_max_chunk_length, math.ceil(target_chunk_bytes / item_chunk_bytes)
+    )
     rchunks.append(next_chunk_length)
     len_diff = len(shape) - len(rchunks)
     rchunks.extend([1] * len_diff)
@@ -124,7 +135,13 @@ class ReplayBuffer:
         root.require_group("data", overwrite=False)
         meta = root.require_group("meta", overwrite=False)
         if "episode_ends" not in meta:
-            meta.zeros("episode_ends", shape=(0,), dtype=np.int64, compressor=None, overwrite=False)
+            meta.zeros(
+                "episode_ends",
+                shape=(0,),
+                dtype=np.int64,
+                compressor=None,
+                overwrite=False,
+            )
         return cls(root=root)
 
     @classmethod
@@ -193,7 +210,11 @@ class ReplayBuffer:
             root = zarr.group(store=store)
             # copy without recompression
             n_copied, n_skipped, n_bytes_copied = zarr.copy_store(
-                source=src_store, dest=store, source_path="/meta", dest_path="/meta", if_exists=if_exists
+                source=src_store,
+                dest=store,
+                source_path="/meta",
+                dest_path="/meta",
+                if_exists=if_exists,
             )
             data_group = root.create_group("data", overwrite=True)
             if keys is None:
@@ -201,7 +222,9 @@ class ReplayBuffer:
             for key in keys:
                 value = src_root["data"][key]
                 cks = cls._resolve_array_chunks(chunks=chunks, key=key, array=value)
-                cpr = cls._resolve_array_compressor(compressors=compressors, key=key, array=value)
+                cpr = cls._resolve_array_compressor(
+                    compressors=compressors, key=key, array=value
+                )
                 if cks == value.chunks and cpr == value.compressor:
                     # copy without recompression
                     this_path = "/data/" + key
@@ -286,13 +309,17 @@ class ReplayBuffer:
             meta_group = root.create_group("meta", overwrite=True)
             # save meta, no chunking
             for key, value in self.root["meta"].items():
-                _ = meta_group.array(name=key, data=value, shape=value.shape, chunks=value.shape)
+                _ = meta_group.array(
+                    name=key, data=value, shape=value.shape, chunks=value.shape
+                )
 
         # save data, chunk
         data_group = root.create_group("data", overwrite=True)
         for key, value in self.root["data"].items():
             cks = self._resolve_array_chunks(chunks=chunks, key=key, array=value)
-            cpr = self._resolve_array_compressor(compressors=compressors, key=key, array=value)
+            cpr = self._resolve_array_compressor(
+                compressors=compressors, key=key, array=value
+            )
             if isinstance(value, zarr.Array):
                 if cks == value.chunks and cpr == value.compressor:
                     # copy without recompression
@@ -339,13 +366,19 @@ class ReplayBuffer:
     @staticmethod
     def resolve_compressor(compressor="default"):
         if compressor == "default":
-            compressor = numcodecs.Blosc(cname="lz4", clevel=5, shuffle=numcodecs.Blosc.NOSHUFFLE)
+            compressor = numcodecs.Blosc(
+                cname="lz4", clevel=5, shuffle=numcodecs.Blosc.NOSHUFFLE
+            )
         elif compressor == "disk":
-            compressor = numcodecs.Blosc("zstd", clevel=5, shuffle=numcodecs.Blosc.BITSHUFFLE)
+            compressor = numcodecs.Blosc(
+                "zstd", clevel=5, shuffle=numcodecs.Blosc.BITSHUFFLE
+            )
         return compressor
 
     @classmethod
-    def _resolve_array_compressor(cls, compressors: dict | str | numcodecs.abc.Codec, key, array):
+    def _resolve_array_compressor(
+        cls, compressors: dict | str | numcodecs.abc.Codec, key, array
+    ):
         # allows compressor to be explicitly set to None
         cpr = "nil"
         if isinstance(compressors, dict):
@@ -404,7 +437,11 @@ class ReplayBuffer:
         if self.backend == "zarr":
             for key, value in np_data.items():
                 _ = meta_group.array(
-                    name=key, data=value, shape=value.shape, chunks=value.shape, overwrite=True
+                    name=key,
+                    data=value,
+                    shape=value.shape,
+                    chunks=value.shape,
+                    overwrite=True,
                 )
         else:
             meta_group.update(np_data)
@@ -514,10 +551,18 @@ class ReplayBuffer:
             # create array
             if key not in self.data:
                 if is_zarr:
-                    cks = self._resolve_array_chunks(chunks=chunks, key=key, array=value)
-                    cpr = self._resolve_array_compressor(compressors=compressors, key=key, array=value)
+                    cks = self._resolve_array_chunks(
+                        chunks=chunks, key=key, array=value
+                    )
+                    cpr = self._resolve_array_compressor(
+                        compressors=compressors, key=key, array=value
+                    )
                     arr = self.data.zeros(
-                        name=key, shape=new_shape, chunks=cks, dtype=value.dtype, compressor=cpr
+                        name=key,
+                        shape=new_shape,
+                        chunks=cks,
+                        dtype=value.dtype,
+                        compressor=cpr,
                     )
                 else:
                     # copy data to prevent modify
@@ -544,7 +589,9 @@ class ReplayBuffer:
 
         # rechunk
         if is_zarr and episode_ends.chunks[0] < episode_ends.shape[0]:
-            rechunk_recompress_array(self.meta, "episode_ends", chunk_length=int(episode_ends.shape[0] * 1.5))
+            rechunk_recompress_array(
+                self.meta, "episode_ends", chunk_length=int(episode_ends.shape[0] * 1.5)
+            )
 
     def drop_episode(self):
         is_zarr = self.backend == "zarr"

lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py

@@ -38,7 +38,9 @@ import argparse
 from pathlib import Path
 
 from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
-from lerobot.common.datasets.push_dataset_to_hub._download_raw import AVAILABLE_RAW_REPO_IDS
+from lerobot.common.datasets.push_dataset_to_hub._download_raw import (
+    AVAILABLE_RAW_REPO_IDS,
+)
 from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
 from lerobot.scripts.push_dataset_to_hub import push_dataset_to_hub
 
@@ -73,7 +75,9 @@ def encode_datasets(
         check_repo_id(raw_repo_id)
         dataset_repo_id_push = get_push_repo_id_from_raw(raw_repo_id, push_repo)
         dataset_raw_dir = raw_dir / raw_repo_id
-        dataset_dir = local_dir / dataset_repo_id_push if local_dir is not None else None
+        dataset_dir = (
+            local_dir / dataset_repo_id_push if local_dir is not None else None
+        )
         encoding = {
             "vcodec": vcodec,
             "pix_fmt": pix_fmt,

lerobot/common/datasets/push_dataset_to_hub/_umi_imagecodecs_numcodecs.py

@@ -133,7 +133,9 @@ class Jpeg2k(Codec):
         )
 
     def decode(self, buf, out=None):
-        return imagecodecs.jpeg2k_decode(buf, verbose=self.verbose, numthreads=self.numthreads, out=out)
+        return imagecodecs.jpeg2k_decode(
+            buf, verbose=self.verbose, numthreads=self.numthreads, out=out
+        )
 
 
 class JpegXl(Codec):

lerobot/common/datasets/push_dataset_to_hub/aloha_hdf5_format.py

@@ -44,7 +44,9 @@ from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
 def get_cameras(hdf5_data):
     # ignore depth channel, not currently handled
     # TODO(rcadene): add depth
-    rgb_cameras = [key for key in hdf5_data["/observations/images"].keys() if "depth" not in key]  # noqa: SIM118
+    rgb_cameras = [
+        key for key in hdf5_data["/observations/images"].keys() if "depth" not in key
+    ]  # noqa: SIM118
     return rgb_cameras
 
 
@@ -73,7 +75,9 @@ def check_format(raw_dir) -> bool:
                 else:
                     assert data[f"/observations/images/{camera}"].ndim == 4
                     b, h, w, c = data[f"/observations/images/{camera}"].shape
-                    assert c < h and c < w, f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
+                    assert (
+                        c < h and c < w
+                    ), f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
 
 
 def load_from_raw(
@@ -134,14 +138,17 @@ def load_from_raw(
                     # encode images to a mp4 video
                     fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
                     video_path = videos_dir / fname
-                    encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+                    encode_video_frames(
+                        tmp_imgs_dir, video_path, fps, **(encoding or {})
+                    )
 
                     # clean temporary images directory
                     shutil.rmtree(tmp_imgs_dir)
 
                     # store the reference to the video frame
                     ep_dict[img_key] = [
-                        {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                        {"path": f"videos/{fname}", "timestamp": i / fps}
+                        for i in range(num_frames)
                     ]
                 else:
                     ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
@@ -181,15 +188,18 @@ def to_hf_dataset(data_dict, video) -> Dataset:
             features[key] = Image()
 
     features["observation.state"] = Sequence(
-        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+        length=data_dict["observation.state"].shape[1],
+        feature=Value(dtype="float32", id=None),
     )
     if "observation.velocity" in data_dict:
         features["observation.velocity"] = Sequence(
-            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
+            length=data_dict["observation.velocity"].shape[1],
+            feature=Value(dtype="float32", id=None),
         )
     if "observation.effort" in data_dict:
         features["observation.effort"] = Sequence(
-            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
+            length=data_dict["observation.effort"].shape[1],
+            feature=Value(dtype="float32", id=None),
         )
     features["action"] = Sequence(
         length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)

lerobot/common/datasets/push_dataset_to_hub/dora_parquet_format.py

@@ -26,7 +26,9 @@ import torch
 from datasets import Dataset, Features, Image, Sequence, Value
 
 from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
-from lerobot.common.datasets.push_dataset_to_hub.utils import calculate_episode_data_index
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    calculate_episode_data_index,
+)
 from lerobot.common.datasets.utils import (
     hf_transform_to_torch,
 )
@@ -42,11 +44,19 @@ def check_format(raw_dir) -> bool:
     return True
 
 
-def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episodes: list[int] | None = None):
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+):
     # Load data stream that will be used as reference for the timestamps synchronization
     reference_files = list(raw_dir.glob("observation.images.cam_*.parquet"))
     if len(reference_files) == 0:
-        raise ValueError(f"Missing reference files for camera, starting with  in '{raw_dir}'")
+        raise ValueError(
+            f"Missing reference files for camera, starting with  in '{raw_dir}'"
+        )
     # select first camera in alphanumeric order
     reference_key = sorted(reference_files)[0].stem
     reference_df = pd.read_parquet(raw_dir / f"{reference_key}.parquet")
@@ -107,7 +117,9 @@ def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episod
 
     df["timestamp"] = df["timestamp_utc"].map(lambda x: x.timestamp())
     # each episode starts with timestamp 0 to match the ones from the video
-    df["timestamp"] = df.groupby("episode_index")["timestamp"].transform(lambda x: x - x.iloc[0])
+    df["timestamp"] = df.groupby("episode_index")["timestamp"].transform(
+        lambda x: x - x.iloc[0]
+    )
 
     del df["timestamp_utc"]
 
@@ -120,7 +132,9 @@ def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episod
     ep_ids = [ep_idx for ep_idx, _ in df.groupby("episode_index")]
     expected_ep_ids = list(range(df["episode_index"].max() + 1))
     if ep_ids != expected_ep_ids:
-        raise ValueError(f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}")
+        raise ValueError(
+            f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}"
+        )
 
     # Create symlink to raw videos directory (that needs to be absolute not relative)
     videos_dir.parent.mkdir(parents=True, exist_ok=True)
@@ -152,7 +166,9 @@ def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episod
             data_dict[key] = torch.from_numpy(df[key].values)
         # is vector
         elif df[key].iloc[0].shape[0] > 1:
-            data_dict[key] = torch.stack([torch.from_numpy(x.copy()) for x in df[key].values])
+            data_dict[key] = torch.stack(
+                [torch.from_numpy(x.copy()) for x in df[key].values]
+            )
         else:
             raise ValueError(key)
 
@@ -170,15 +186,18 @@ def to_hf_dataset(data_dict, video) -> Dataset:
             features[key] = Image()
 
     features["observation.state"] = Sequence(
-        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+        length=data_dict["observation.state"].shape[1],
+        feature=Value(dtype="float32", id=None),
     )
     if "observation.velocity" in data_dict:
         features["observation.velocity"] = Sequence(
-            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
+            length=data_dict["observation.velocity"].shape[1],
+            feature=Value(dtype="float32", id=None),
         )
     if "observation.effort" in data_dict:
         features["observation.effort"] = Sequence(
-            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
+            length=data_dict["observation.effort"].shape[1],
+            feature=Value(dtype="float32", id=None),
         )
     features["action"] = Sequence(
         length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)

lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml

@@ -1,639 +0,0 @@
-OPENX_DATASET_CONFIGS:
-  fractal20220817_data:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - base_pose_tool_reached
-      - gripper_closed
-    fps: 3
-
-  kuka:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - clip_function_input/base_pose_tool_reached
-      - gripper_closed
-    fps: 10
-
-  bridge_openx:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - EEF_state
-      - gripper_state
-    fps: 5
-
-  taco_play:
-    image_obs_keys:
-      - rgb_static
-      - rgb_gripper
-    depth_obs_keys:
-      - depth_static
-      - depth_gripper
-    state_obs_keys:
-      - state_eef
-      - state_gripper
-    fps: 15
-
-  jaco_play:
-    image_obs_keys:
-      - image
-      - image_wrist
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state_eef
-      - state_gripper
-    fps: 10
-
-  berkeley_cable_routing:
-    image_obs_keys:
-      - image
-      - top_image
-      - wrist45_image
-      - wrist225_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - robot_state
-    fps: 10
-
-  roboturk:
-    image_obs_keys:
-      - front_rgb
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - null
-    fps: 10
-
-  nyu_door_opening_surprising_effectiveness:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - null
-    fps: 3
-
-  viola:
-    image_obs_keys:
-      - agentview_rgb
-      - eye_in_hand_rgb
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - joint_states
-      - gripper_states
-    fps: 20
-
-  berkeley_autolab_ur5:
-    image_obs_keys:
-      - image
-      - hand_image
-    depth_obs_keys:
-      - image_with_depth
-    state_obs_keys:
-      - state
-    fps: 5
-
-  toto:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 30
-
-  language_table:
-    image_obs_keys:
-      - rgb
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - effector_translation
-    fps: 10
-
-  columbia_cairlab_pusht_real:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - robot_state
-    fps: 10
-
-  stanford_kuka_multimodal_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - depth_image
-    state_obs_keys:
-      - ee_position
-      - ee_orientation
-    fps: 20
-
-  nyu_rot_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 3
-
-  io_ai_tech:
-    image_obs_keys:
-      - image
-      - image_fisheye
-      - image_left_side
-      - image_right_side
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 3
-
-  stanford_hydra_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 10
-
-  austin_buds_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 20
-
-  nyu_franka_play_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - image_additional_view
-    depth_obs_keys:
-      - depth
-      - depth_additional_view
-    state_obs_keys:
-      - eef_state
-    fps: 3
-
-  maniskill_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - depth
-      - wrist_depth
-    state_obs_keys:
-      - tcp_pose
-      - gripper_state
-    fps: 20
-
-  furniture_bench_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 10
-
-  cmu_franka_exploration_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - highres_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - null
-    fps: 10
-
-  ucsd_kitchen_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - joint_state
-    fps: 2
-
-  ucsd_pick_and_place_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 3
-
-  spoc:
-    image_obs_keys:
-      - image
-      - image_manipulation
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - null
-    fps: 3
-
-  austin_sailor_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 20
-
-  austin_sirius_dataset_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 20
-
-  bc_z:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - present/xyz
-      - present/axis_angle
-      - present/sensed_close
-    fps: 10
-
-  utokyo_pr2_opening_fridge_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 10
-
-  utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 10
-
-  utokyo_xarm_pick_and_place_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - image2
-      - hand_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - end_effector_pose
-    fps: 10
-
-  utokyo_xarm_bimanual_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - pose_r
-    fps: 10
-
-  robo_net:
-    image_obs_keys:
-      - image
-      - image1
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 1
-
-  robo_set:
-    image_obs_keys:
-      - image_left
-      - image_right
-      - image_wrist
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-      - state_velocity
-    fps: 5
-
-  berkeley_mvp_converted_externally_to_rlds:
-    image_obs_keys:
-      - hand_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - gripper
-      - pose
-      - joint_pos
-    fps: 5
-
-  berkeley_rpt_converted_externally_to_rlds:
-    image_obs_keys:
-      - hand_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - joint_pos
-      - gripper
-    fps: 30
-
-  kaist_nonprehensile_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 10
-
-  stanford_mask_vit_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-
-  tokyo_u_lsmo_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 10
-
-  dlr_sara_pour_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 10
-
-  dlr_sara_grid_clamp_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 10
-
-  dlr_edan_shared_control_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 5
-
-  asu_table_top_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 12.5
-
-  stanford_robocook_converted_externally_to_rlds:
-    image_obs_keys:
-      - image_1
-      - image_2
-    depth_obs_keys:
-      - depth_1
-      - depth_2
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 5
-
-  imperialcollege_sawyer_wrist_cam:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 10
-
-  iamlab_cmu_pickup_insert_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - joint_state
-      - gripper_state
-    fps: 20
-
-  uiuc_d3field:
-    image_obs_keys:
-      - image_1
-      - image_2
-    depth_obs_keys:
-      - depth_1
-      - depth_2
-    state_obs_keys:
-      - null
-    fps: 1
-
-  utaustin_mutex:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 20
-
-  berkeley_fanuc_manipulation:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - joint_state
-      - gripper_state
-    fps: 10
-
-  cmu_playing_with_food:
-    image_obs_keys:
-      - image
-      - finger_vision_1
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 10
-
-  cmu_play_fusion:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 5
-
-  cmu_stretch:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - eef_state
-      - gripper_state
-    fps: 10
-
-  berkeley_gnm_recon:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-      - position
-      - yaw
-    fps: 3
-
-  berkeley_gnm_cory_hall:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-      - position
-      - yaw
-    fps: 5
-
-  berkeley_gnm_sac_son:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-      - position
-      - yaw
-    fps: 10
-
-  droid:
-    image_obs_keys:
-      - exterior_image_1_left
-      - exterior_image_2_left
-      - wrist_image_left
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - proprio
-    fps: 15
-
-  droid_100:
-    image_obs_keys:
-      - exterior_image_1_left
-      - exterior_image_2_left
-      - wrist_image_left
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - proprio
-    fps: 15
-
-  fmb:
-    image_obs_keys:
-      - image_side_1
-      - image_side_2
-      - image_wrist_1
-      - image_wrist_2
-    depth_obs_keys:
-      - image_side_1_depth
-      - image_side_2_depth
-      - image_wrist_1_depth
-      - image_wrist_2_depth
-    state_obs_keys:
-      - proprio
-    fps: 10
-
-  dobbe:
-    image_obs_keys:
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - proprio
-    fps: 3.75
-
-  usc_cloth_sim_converted_externally_to_rlds:
-    image_obs_keys:
-      - image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - null
-    fps: 10
-
-  plex_robosuite:
-    image_obs_keys:
-      - image
-      - wrist_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 20
-
-  conq_hose_manipulation:
-    image_obs_keys:
-      - frontleft_fisheye_image
-      - frontright_fisheye_image
-      - hand_color_image
-    depth_obs_keys:
-      - null
-    state_obs_keys:
-      - state
-    fps: 30

lerobot/common/datasets/push_dataset_to_hub/openx/data_utils.py

@@ -1,106 +0,0 @@
-#!/usr/bin/env python
-
-# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the Licens    e.
-# You may obtain a copy of the License at
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-"""
-NOTE(YL): Adapted from:
-    Octo: https://github.com/octo-models/octo/blob/main/octo/data/utils/data_utils.py
-
-data_utils.py
-
-Additional utils for data processing.
-"""
-
-from typing import Any, Dict, List
-
-import tensorflow as tf
-
-
-def binarize_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
-    """
-    Converts gripper actions from continuous to binary values (0 and 1).
-
-    We exploit that fact that most of the time, the gripper is fully open (near 1.0) or fully closed (near 0.0). As it
-    transitions between the two, it sometimes passes through a few intermediate values. We relabel those intermediate
-    values based on the state that is reached _after_ those intermediate values.
-
-    In the edge case that the trajectory ends with an intermediate value, we give up on binarizing and relabel that
-    chunk of intermediate values as the last action in the trajectory.
-
-    The `scan_fn` implements the following logic:
-        new_actions = np.empty_like(actions)
-        carry = actions[-1]
-        for i in reversed(range(actions.shape[0])):
-            if in_between_mask[i]:
-                carry = carry
-            else:
-                carry = float(open_mask[i])
-            new_actions[i] = carry
-    """
-    open_mask, closed_mask = actions > 0.95, actions < 0.05
-    in_between_mask = tf.logical_not(tf.logical_or(open_mask, closed_mask))
-    is_open_float = tf.cast(open_mask, tf.float32)
-
-    def scan_fn(carry, i):
-        return tf.cond(in_between_mask[i], lambda: tf.cast(carry, tf.float32), lambda: is_open_float[i])
-
-    return tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), actions[-1], reverse=True)
-
-
-def invert_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
-    return 1 - actions
-
-
-def rel2abs_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
-    """
-    Converts relative gripper actions (+1 for closing, -1 for opening) to absolute actions (0 = closed; 1 = open).
-
-    Assumes that the first relative gripper is not redundant (i.e. close when already closed)!
-    """
-    # Note =>> -1 for closing, 1 for opening, 0 for no change
-    opening_mask, closing_mask = actions < -0.1, actions > 0.1
-    thresholded_actions = tf.where(opening_mask, 1, tf.where(closing_mask, -1, 0))
-
-    def scan_fn(carry, i):
-        return tf.cond(thresholded_actions[i] == 0, lambda: carry, lambda: thresholded_actions[i])
-
-    # If no relative grasp, assumes open for whole trajectory
-    start = -1 * thresholded_actions[tf.argmax(thresholded_actions != 0, axis=0)]
-    start = tf.cond(start == 0, lambda: 1, lambda: start)
-
-    # Note =>> -1 for closed, 1 for open
-    new_actions = tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), start)
-    new_actions = tf.cast(new_actions, tf.float32) / 2 + 0.5
-
-    return new_actions
-
-
-# === Bridge-V2 =>> Dataset-Specific Transform ===
-def relabel_bridge_actions(traj: Dict[str, Any]) -> Dict[str, Any]:
-    """Relabels actions to use reached proprioceptive state; discards last timestep (no-action)."""
-    movement_actions = traj["observation"]["state"][1:, :6] - traj["observation"]["state"][:-1, :6]
-    traj_truncated = tf.nest.map_structure(lambda x: x[:-1], traj)
-    traj_truncated["action"] = tf.concat([movement_actions, traj["action"][:-1, -1:]], axis=1)
-
-    return traj_truncated
-
-
-# === RLDS Dataset Initialization Utilities ===
-def pprint_data_mixture(dataset_kwargs_list: List[Dict[str, Any]], dataset_weights: List[int]) -> None:
-    print("\n######################################################################################")
-    print(f"# Loading the following {len(dataset_kwargs_list)} datasets (incl. sampling weight):{'': >24} #")
-    for dataset_kwargs, weight in zip(dataset_kwargs_list, dataset_weights, strict=False):
-        pad = 80 - len(dataset_kwargs["name"])
-        print(f"# {dataset_kwargs['name']}: {weight:=>{pad}f} #")
-    print("######################################################################################\n")

lerobot/common/datasets/push_dataset_to_hub/openx/droid_utils.py

@@ -1,200 +0,0 @@
-#!/usr/bin/env python
-
-# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-"""
-NOTE(YL): Adapted from:
-    OpenVLA: https://github.com/openvla/openvla
-
-Episode transforms for DROID dataset.
-"""
-
-from typing import Any, Dict
-
-import tensorflow as tf
-import tensorflow_graphics.geometry.transformation as tfg
-
-
-def rmat_to_euler(rot_mat):
-    return tfg.euler.from_rotation_matrix(rot_mat)
-
-
-def euler_to_rmat(euler):
-    return tfg.rotation_matrix_3d.from_euler(euler)
-
-
-def invert_rmat(rot_mat):
-    return tfg.rotation_matrix_3d.inverse(rot_mat)
-
-
-def rotmat_to_rot6d(mat):
-    """
-    Converts rotation matrix to R6 rotation representation (first two rows in rotation matrix).
-    Args:
-        mat: rotation matrix
-
-    Returns: 6d vector (first two rows of rotation matrix)
-
-    """
-    r6 = mat[..., :2, :]
-    r6_0, r6_1 = r6[..., 0, :], r6[..., 1, :]
-    r6_flat = tf.concat([r6_0, r6_1], axis=-1)
-    return r6_flat
-
-
-def velocity_act_to_wrist_frame(velocity, wrist_in_robot_frame):
-    """
-    Translates velocity actions (translation + rotation) from base frame of the robot to wrist frame.
-    Args:
-        velocity: 6d velocity action (3 x translation, 3 x rotation)
-        wrist_in_robot_frame: 6d pose of the end-effector in robot base frame
-
-    Returns: 9d velocity action in robot wrist frame (3 x translation, 6 x rotation as R6)
-
-    """
-    r_frame = euler_to_rmat(wrist_in_robot_frame[:, 3:6])
-    r_frame_inv = invert_rmat(r_frame)
-
-    # world to wrist: dT_pi = R^-1 dT_rbt
-    vel_t = (r_frame_inv @ velocity[:, :3][..., None])[..., 0]
-
-    # world to wrist: dR_pi = R^-1 dR_rbt R
-    dr_ = euler_to_rmat(velocity[:, 3:6])
-    dr_ = r_frame_inv @ (dr_ @ r_frame)
-    dr_r6 = rotmat_to_rot6d(dr_)
-    return tf.concat([vel_t, dr_r6], axis=-1)
-
-
-def rand_swap_exterior_images(img1, img2):
-    """
-    Randomly swaps the two exterior images (for training with single exterior input).
-    """
-    return tf.cond(tf.random.uniform(shape=[]) > 0.5, lambda: (img1, img2), lambda: (img2, img1))
-
-
-def droid_baseact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    """
-    DROID dataset transformation for actions expressed in *base* frame of the robot.
-    """
-    dt = trajectory["action_dict"]["cartesian_velocity"][:, :3]
-    dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6]
-
-    trajectory["action"] = tf.concat(
-        (
-            dt,
-            dr_,
-            1 - trajectory["action_dict"]["gripper_position"],
-        ),
-        axis=-1,
-    )
-    trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = (
-        rand_swap_exterior_images(
-            trajectory["observation"]["exterior_image_1_left"],
-            trajectory["observation"]["exterior_image_2_left"],
-        )
-    )
-    trajectory["observation"]["proprio"] = tf.concat(
-        (
-            trajectory["observation"]["cartesian_position"],
-            trajectory["observation"]["gripper_position"],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def droid_wristact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    """
-    DROID dataset transformation for actions expressed in *wrist* frame of the robot.
-    """
-    wrist_act = velocity_act_to_wrist_frame(
-        trajectory["action_dict"]["cartesian_velocity"], trajectory["observation"]["cartesian_position"]
-    )
-    trajectory["action"] = tf.concat(
-        (
-            wrist_act,
-            trajectory["action_dict"]["gripper_position"],
-        ),
-        axis=-1,
-    )
-    trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = (
-        rand_swap_exterior_images(
-            trajectory["observation"]["exterior_image_1_left"],
-            trajectory["observation"]["exterior_image_2_left"],
-        )
-    )
-    trajectory["observation"]["proprio"] = tf.concat(
-        (
-            trajectory["observation"]["cartesian_position"],
-            trajectory["observation"]["gripper_position"],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def droid_finetuning_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    """
-    DROID dataset transformation for actions expressed in *base* frame of the robot.
-    """
-    dt = trajectory["action_dict"]["cartesian_velocity"][:, :3]
-    dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6]
-    trajectory["action"] = tf.concat(
-        (
-            dt,
-            dr_,
-            1 - trajectory["action_dict"]["gripper_position"],
-        ),
-        axis=-1,
-    )
-    trajectory["observation"]["proprio"] = tf.concat(
-        (
-            trajectory["observation"]["cartesian_position"],
-            trajectory["observation"]["gripper_position"],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def zero_action_filter(traj: Dict) -> bool:
-    """
-    Filters transitions whose actions are all-0 (only relative actions, no gripper action).
-    Note: this filter is applied *after* action normalization, so need to compare to "normalized 0".
-    """
-    droid_q01 = tf.convert_to_tensor(
-        [
-            -0.7776297926902771,
-            -0.5803514122962952,
-            -0.5795090794563293,
-            -0.6464047729969025,
-            -0.7041108310222626,
-            -0.8895104378461838,
-        ]
-    )
-    droid_q99 = tf.convert_to_tensor(
-        [
-            0.7597932070493698,
-            0.5726242214441299,
-            0.7351000607013702,
-            0.6705610305070877,
-            0.6464948207139969,
-            0.8897542208433151,
-        ]
-    )
-    droid_norm_0_act = (
-        2 * (tf.zeros_like(traj["action"][:, :6]) - droid_q01) / (droid_q99 - droid_q01 + 1e-8) - 1
-    )
-
-    return tf.reduce_any(tf.math.abs(traj["action"][:, :6] - droid_norm_0_act) > 1e-5)

lerobot/common/datasets/push_dataset_to_hub/openx/transforms.py

@@ -1,859 +0,0 @@
-#!/usr/bin/env python
-
-# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-"""
-NOTE(YL): Adapted from:
-    OpenVLA: https://github.com/openvla/openvla
-    Octo: https://github.com/octo-models/octo
-
-transforms.py
-
-Defines a registry of per-dataset standardization transforms for each dataset in Open-X Embodiment.
-
-Transforms adopt the following structure:
-    Input: Dictionary of *batched* features (i.e., has leading time dimension)
-    Output: Dictionary `step` =>> {
-        "observation": {
-            <image_keys, depth_image_keys>
-            State (in chosen state representation)
-        },
-        "action": Action (in chosen action representation),
-        "language_instruction": str
-    }
-"""
-
-from typing import Any, Dict
-
-import tensorflow as tf
-
-from lerobot.common.datasets.push_dataset_to_hub.openx.data_utils import (
-    binarize_gripper_actions,
-    invert_gripper_actions,
-    rel2abs_gripper_actions,
-    relabel_bridge_actions,
-)
-
-
-def droid_baseact_transform_fn():
-    from lerobot.common.datasets.push_dataset_to_hub.openx.droid_utils import droid_baseact_transform
-
-    return droid_baseact_transform
-
-
-def bridge_openx_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    """
-    Applies to version of Bridge V2 in Open X-Embodiment mixture.
-
-    Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it!
-    """
-    for key in trajectory:
-        if key == "traj_metadata":
-            continue
-        elif key in ["observation", "action"]:
-            for key2 in trajectory[key]:
-                trajectory[key][key2] = trajectory[key][key2][1:]
-        else:
-            trajectory[key] = trajectory[key][1:]
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32),
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    trajectory = relabel_bridge_actions(trajectory)
-    trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    return trajectory
-
-
-def bridge_orig_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    """
-    Applies to original version of Bridge V2 from the official project website.
-
-    Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it!
-    """
-    for key in trajectory:
-        if key == "traj_metadata":
-            continue
-        elif key == "observation":
-            for key2 in trajectory[key]:
-                trajectory[key][key2] = trajectory[key][key2][1:]
-        else:
-            trajectory[key] = trajectory[key][1:]
-
-    trajectory["action"] = tf.concat(
-        [
-            trajectory["action"][:, :6],
-            binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
-        ],
-        axis=1,
-    )
-    trajectory = relabel_bridge_actions(trajectory)
-    trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    return trajectory
-
-
-def ppgm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = tf.concat(
-        [
-            trajectory["action"][:, :6],
-            binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
-        ],
-        axis=1,
-    )
-    trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"][:, -1:]
-    return trajectory
-
-
-def rt1_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # make gripper action absolute action, +1 = open, 0 = close
-    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
-    gripper_action = rel2abs_gripper_actions(gripper_action)
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            gripper_action[:, None],
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def kuka_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # make gripper action absolute action, +1 = open, 0 = close
-    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
-    gripper_action = rel2abs_gripper_actions(gripper_action)
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            gripper_action[:, None],
-        ),
-        axis=-1,
-    )
-    # decode compressed state
-    eef_value = tf.io.decode_compressed(
-        trajectory["observation"]["clip_function_input/base_pose_tool_reached"],
-        compression_type="ZLIB",
-    )
-    eef_value = tf.io.decode_raw(eef_value, tf.float32)
-    trajectory["observation"]["clip_function_input/base_pose_tool_reached"] = tf.reshape(eef_value, (-1, 7))
-    gripper_value = tf.io.decode_compressed(
-        trajectory["observation"]["gripper_closed"], compression_type="ZLIB"
-    )
-    gripper_value = tf.io.decode_raw(gripper_value, tf.float32)
-    trajectory["observation"]["gripper_closed"] = tf.reshape(gripper_value, (-1, 1))
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def taco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["state_eef"] = trajectory["observation"]["robot_obs"][:, :6]
-    trajectory["observation"]["state_gripper"] = trajectory["observation"]["robot_obs"][:, 7:8]
-    trajectory["action"] = trajectory["action"]["rel_actions_world"]
-
-    # invert gripper action + clip, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :6],
-            tf.clip_by_value(trajectory["action"][:, -1:], 0, 1),
-        ),
-        axis=-1,
-    )
-
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def jaco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["state_eef"] = trajectory["observation"]["end_effector_cartesian_pos"][:, :6]
-    trajectory["observation"]["state_gripper"] = trajectory["observation"]["end_effector_cartesian_pos"][
-        :, -1:
-    ]
-
-    # make gripper action absolute action, +1 = open, 0 = close
-    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
-    gripper_action = rel2abs_gripper_actions(gripper_action)
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            tf.zeros_like(trajectory["action"]["world_vector"]),
-            gripper_action[:, None],
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def berkeley_cable_routing_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            tf.zeros_like(trajectory["action"]["world_vector"][:, :1]),
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def roboturk_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # invert absolute gripper action, +1 = open, 0 = close
-    gripper_action = invert_gripper_actions(
-        tf.clip_by_value(trajectory["action"]["gripper_closedness_action"], 0, 1)
-    )
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            gripper_action,
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    trajectory["language_embedding"] = trajectory["observation"]["natural_language_embedding"]
-    return trajectory
-
-
-def nyu_door_opening_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # make gripper action absolute action, +1 = open, 0 = close
-    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
-    gripper_action = rel2abs_gripper_actions(gripper_action)
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            gripper_action[:, None],
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def viola_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # make gripper action, +1 = open, 0 = close
-    gripper_action = trajectory["action"]["gripper_closedness_action"][:, None]
-    gripper_action = tf.clip_by_value(gripper_action, 0, 1)
-    gripper_action = invert_gripper_actions(gripper_action)
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            gripper_action,
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def berkeley_autolab_ur5_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["state"] = trajectory["observation"]["robot_state"][:, 6:14]
-
-    # make gripper action absolute action, +1 = open, 0 = close
-    gripper_action = trajectory["action"]["gripper_closedness_action"]
-    gripper_action = rel2abs_gripper_actions(gripper_action)
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            gripper_action[:, None],
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def toto_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32),
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def language_table_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # default to "open" gripper
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"],
-            tf.zeros_like(trajectory["action"]),
-            tf.zeros_like(trajectory["action"]),
-            tf.ones_like(trajectory["action"][:, :1]),
-        ),
-        axis=-1,
-    )
-
-    # decode language instruction
-    instruction_bytes = trajectory["observation"]["instruction"]
-    instruction_encoded = tf.strings.unicode_encode(instruction_bytes, output_encoding="UTF-8")
-    # Remove trailing padding --> convert RaggedTensor to regular Tensor.
-    trajectory["language_instruction"] = tf.strings.split(instruction_encoded, "\x00")[:, :1].to_tensor()[
-        :, 0
-    ]
-    return trajectory
-
-
-def pusht_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["world_vector"],
-            trajectory["action"]["rotation_delta"],
-            trajectory["action"]["gripper_closedness_action"][:, None],
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def stanford_kuka_multimodal_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["depth_image"] = trajectory["observation"]["depth_image"][..., 0]
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :3],
-            tf.zeros_like(trajectory["action"][:, :3]),
-            trajectory["action"][:, -1:],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def nyu_rot_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][..., :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., -1:]
-    trajectory["action"] = trajectory["action"][..., :7]
-    return trajectory
-
-
-def stanford_hydra_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # invert gripper action, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :6],
-            invert_gripper_actions(trajectory["action"][:, -1:]),
-        ),
-        axis=-1,
-    )
-
-    trajectory["observation"]["eef_state"] = tf.concat(
-        (
-            trajectory["observation"]["state"][:, :3],
-            trajectory["observation"]["state"][:, 7:10],
-        ),
-        axis=-1,
-    )
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -3:-2]
-    return trajectory
-
-
-def austin_buds_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # invert gripper action + clip, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :6],
-            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
-        ),
-        axis=-1,
-    )
-
-    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8]
-    return trajectory
-
-
-def nyu_franka_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["depth"] = tf.cast(trajectory["observation"]["depth"][..., 0], tf.float32)
-    trajectory["observation"]["depth_additional_view"] = tf.cast(
-        trajectory["observation"]["depth_additional_view"][..., 0], tf.float32
-    )
-    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, -6:]
-
-    # clip gripper action, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, -8:-2],
-            tf.clip_by_value(trajectory["action"][:, -2:-1], 0, 1),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def maniskill_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., 7:8]
-    return trajectory
-
-
-def furniture_bench_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    import tensorflow_graphics.geometry.transformation as tft
-
-    trajectory["observation"]["state"] = tf.concat(
-        (
-            trajectory["observation"]["state"][:, :7],
-            trajectory["observation"]["state"][:, -1:],
-        ),
-        axis=-1,
-    )
-
-    # invert gripper action + clip, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :3],
-            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
-            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def cmu_franka_exploration_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = trajectory["action"][..., :-1]
-    return trajectory
-
-
-def ucsd_kitchen_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7]
-    trajectory["action"] = trajectory["action"][..., :-1]
-    return trajectory
-
-
-def ucsd_pick_place_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :3],
-            tf.zeros_like(trajectory["action"][:, :3]),
-            trajectory["action"][:, -1:],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def austin_sailor_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # invert gripper action + clip, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :6],
-            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def austin_sirius_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # invert gripper action + clip, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :6],
-            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def bc_z_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"]["future/xyz_residual"][:, :3],
-            trajectory["action"]["future/axis_angle_residual"][:, :3],
-            invert_gripper_actions(tf.cast(trajectory["action"]["future/target_close"][:, :1], tf.float32)),
-        ),
-        axis=-1,
-    )
-    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
-    return trajectory
-
-
-def tokyo_pr2_opening_fridge_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    trajectory["action"] = trajectory["action"][..., :-1]
-    return trajectory
-
-
-def tokyo_pr2_tabletop_manipulation_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    trajectory["action"] = trajectory["action"][..., :-1]
-    return trajectory
-
-
-def utokyo_xarm_bimanual_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = trajectory["action"][..., -7:]
-    return trajectory
-
-
-def robo_net_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = tf.concat(
-        (
-            trajectory["observation"]["state"][:, :4],
-            tf.zeros_like(trajectory["observation"]["state"][:, :2]),
-        ),
-        axis=-1,
-    )
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :4],
-            tf.zeros_like(trajectory["action"][:, :2]),
-            trajectory["action"][:, -1:],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def berkeley_mvp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    """
-    trajectory["observation"]["state"] = tf.concat((
-        tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32),
-                        trajectory["observation"]["pose"],
-                        trajectory["observation"]["joint_pos"],),
-                        axis=-1,)
-    """
-    trajectory["observation"]["gripper"] = tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32)
-    return trajectory
-
-
-def berkeley_rpt_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["gripper"] = tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32)
-    return trajectory
-
-
-def kaist_nonprehensible_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, -7:]
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :6],
-            tf.zeros_like(trajectory["action"][:, :1]),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def stanford_mask_vit_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = tf.concat(
-        (
-            trajectory["observation"]["end_effector_pose"][:, :4],
-            tf.zeros_like(trajectory["observation"]["end_effector_pose"][:, :2]),
-        ),
-        axis=-1,
-    )
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["end_effector_pose"][:, -1:]
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :4],
-            tf.zeros_like(trajectory["action"][:, :2]),
-            trajectory["action"][:, -1:],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def tokyo_lsmo_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    return trajectory
-
-
-def dlr_sara_grid_clamp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :6]
-    return trajectory
-
-
-def dlr_edan_shared_control_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # invert gripper action, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :6],
-            invert_gripper_actions(trajectory["action"][:, -1:]),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def asu_table_top_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = trajectory["ground_truth_states"]["EE"]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    return trajectory
-
-
-def robocook_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    return trajectory
-
-
-def imperial_wristcam_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = trajectory["action"][..., :-1]
-    return trajectory
-
-
-def iamlab_pick_insert_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    import tensorflow_graphics.geometry.transformation as tft
-
-    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 7:8]
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :3],
-            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
-            trajectory["action"][:, 7:8],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def uiuc_d3field_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"],
-            tf.zeros_like(trajectory["action"]),
-            tf.zeros_like(trajectory["action"][:, :1]),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def utaustin_mutex_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8]
-
-    # invert gripper action + clip, +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :6],
-            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def berkeley_fanuc_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :6]
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 6:7]
-
-    # dataset does not store gripper actions, so use gripper state info, invert so +1 = open, 0 = close
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"],
-            invert_gripper_actions(trajectory["observation"]["gripper_state"]),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def cmu_playing_with_food_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    import tensorflow_graphics.geometry.transformation as tft
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :3],
-            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
-            trajectory["action"][:, -1:],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def playfusion_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :3],
-            trajectory["action"][:, -4:],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def cmu_stretch_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["eef_state"] = tf.concat(
-        (
-            trajectory["observation"]["state"][:, :3],
-            tf.zeros_like(trajectory["observation"]["state"][:, :3]),
-        ),
-        axis=-1,
-    )
-    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
-    trajectory["action"] = trajectory["action"][..., :-1]
-    return trajectory
-
-
-def gnm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    trajectory["observation"]["state"] = tf.concat(
-        (
-            trajectory["observation"]["position"],
-            tf.zeros_like(trajectory["observation"]["state"][:, :3]),
-            trajectory["observation"]["yaw"],
-        ),
-        axis=-1,
-    )
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"],
-            tf.zeros_like(trajectory["action"]),
-            tf.zeros_like(trajectory["action"]),
-            tf.zeros_like(trajectory["action"][:, :1]),
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def fmb_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # every input feature is batched, ie has leading batch dimension
-    trajectory["observation"]["proprio"] = tf.concat(
-        (
-            trajectory["observation"]["eef_pose"],
-            trajectory["observation"]["state_gripper_pose"][..., None],
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def dobbe_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # every input feature is batched, ie has leading batch dimension
-    trajectory["observation"]["proprio"] = trajectory["observation"]["state"]
-    return trajectory
-
-
-def robo_set_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    # gripper action is in -1...1 --> clip to 0...1, flip
-    gripper_action = trajectory["action"][:, -1:]
-    gripper_action = invert_gripper_actions(tf.clip_by_value(gripper_action, 0, 1))
-
-    trajectory["action"] = tf.concat(
-        (
-            trajectory["action"][:, :7],
-            gripper_action,
-        ),
-        axis=-1,
-    )
-    return trajectory
-
-
-def identity_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
-    return trajectory
-
-
-# === Registry ===
-OPENX_STANDARDIZATION_TRANSFORMS = {
-    "bridge_openx": bridge_openx_dataset_transform,
-    "bridge_orig": bridge_orig_dataset_transform,
-    "bridge_dataset": bridge_orig_dataset_transform,
-    "ppgm": ppgm_dataset_transform,
-    "ppgm_static": ppgm_dataset_transform,
-    "ppgm_wrist": ppgm_dataset_transform,
-    "fractal20220817_data": rt1_dataset_transform,
-    "kuka": kuka_dataset_transform,
-    "taco_play": taco_play_dataset_transform,
-    "jaco_play": jaco_play_dataset_transform,
-    "berkeley_cable_routing": berkeley_cable_routing_dataset_transform,
-    "roboturk": roboturk_dataset_transform,
-    "nyu_door_opening_surprising_effectiveness": nyu_door_opening_dataset_transform,
-    "viola": viola_dataset_transform,
-    "berkeley_autolab_ur5": berkeley_autolab_ur5_dataset_transform,
-    "toto": toto_dataset_transform,
-    "language_table": language_table_dataset_transform,
-    "columbia_cairlab_pusht_real": pusht_dataset_transform,
-    "stanford_kuka_multimodal_dataset_converted_externally_to_rlds": stanford_kuka_multimodal_dataset_transform,
-    "nyu_rot_dataset_converted_externally_to_rlds": nyu_rot_dataset_transform,
-    "stanford_hydra_dataset_converted_externally_to_rlds": stanford_hydra_dataset_transform,
-    "austin_buds_dataset_converted_externally_to_rlds": austin_buds_dataset_transform,
-    "nyu_franka_play_dataset_converted_externally_to_rlds": nyu_franka_play_dataset_transform,
-    "maniskill_dataset_converted_externally_to_rlds": maniskill_dataset_transform,
-    "furniture_bench_dataset_converted_externally_to_rlds": furniture_bench_dataset_transform,
-    "cmu_franka_exploration_dataset_converted_externally_to_rlds": cmu_franka_exploration_dataset_transform,
-    "ucsd_kitchen_dataset_converted_externally_to_rlds": ucsd_kitchen_dataset_transform,
-    "ucsd_pick_and_place_dataset_converted_externally_to_rlds": ucsd_pick_place_dataset_transform,
-    "austin_sailor_dataset_converted_externally_to_rlds": austin_sailor_dataset_transform,
-    "austin_sirius_dataset_converted_externally_to_rlds": austin_sirius_dataset_transform,
-    "bc_z": bc_z_dataset_transform,
-    "utokyo_pr2_opening_fridge_converted_externally_to_rlds": tokyo_pr2_opening_fridge_dataset_transform,
-    "utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds": tokyo_pr2_tabletop_manipulation_dataset_transform,
-    "utokyo_xarm_pick_and_place_converted_externally_to_rlds": identity_transform,
-    "utokyo_xarm_bimanual_converted_externally_to_rlds": utokyo_xarm_bimanual_dataset_transform,
-    "robo_net": robo_net_dataset_transform,
-    "berkeley_mvp_converted_externally_to_rlds": berkeley_mvp_dataset_transform,
-    "berkeley_rpt_converted_externally_to_rlds": berkeley_rpt_dataset_transform,
-    "kaist_nonprehensile_converted_externally_to_rlds": kaist_nonprehensible_dataset_transform,
-    "stanford_mask_vit_converted_externally_to_rlds": stanford_mask_vit_dataset_transform,
-    "tokyo_u_lsmo_converted_externally_to_rlds": tokyo_lsmo_dataset_transform,
-    "dlr_sara_pour_converted_externally_to_rlds": identity_transform,
-    "dlr_sara_grid_clamp_converted_externally_to_rlds": dlr_sara_grid_clamp_dataset_transform,
-    "dlr_edan_shared_control_converted_externally_to_rlds": dlr_edan_shared_control_dataset_transform,
-    "asu_table_top_converted_externally_to_rlds": asu_table_top_dataset_transform,
-    "stanford_robocook_converted_externally_to_rlds": robocook_dataset_transform,
-    "imperialcollege_sawyer_wrist_cam": imperial_wristcam_dataset_transform,
-    "iamlab_cmu_pickup_insert_converted_externally_to_rlds": iamlab_pick_insert_dataset_transform,
-    "uiuc_d3field": uiuc_d3field_dataset_transform,
-    "utaustin_mutex": utaustin_mutex_dataset_transform,
-    "berkeley_fanuc_manipulation": berkeley_fanuc_dataset_transform,
-    "cmu_playing_with_food": cmu_playing_with_food_dataset_transform,
-    "cmu_play_fusion": playfusion_dataset_transform,
-    "cmu_stretch": cmu_stretch_dataset_transform,
-    "berkeley_gnm_recon": gnm_dataset_transform,
-    "berkeley_gnm_cory_hall": gnm_dataset_transform,
-    "berkeley_gnm_sac_son": gnm_dataset_transform,
-    "droid": droid_baseact_transform_fn(),
-    "droid_100": droid_baseact_transform_fn(),  # first 100 episodes of droid
-    "fmb": fmb_transform,
-    "dobbe": dobbe_dataset_transform,
-    "robo_set": robo_set_dataset_transform,
-    "usc_cloth_sim_converted_externally_to_rlds": identity_transform,
-    "plex_robosuite": identity_transform,
-    "conq_hose_manipulation": identity_transform,
-    "io_ai_tech": identity_transform,
-    "spoc": identity_transform,
-}

lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py

@@ -14,13 +14,16 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 """
+For all datasets in the RLDS format.
 For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets.
 
+NOTE: You need to install tensorflow and tensorflow_datsets before running this script.
+
 Example:
     python lerobot/scripts/push_dataset_to_hub.py \
-        --raw-dir /hdd/tensorflow_datasets/bridge_dataset/1.0.0/ \
-        --repo-id youliangtan/sampled_bridge_data_v2 \
-        --raw-format openx_rlds.bridge_orig \
+        --raw-dir /path/to/data/bridge_dataset/1.0.0/ \
+        --repo-id your_hub/sampled_bridge_data_v2 \
+        --raw-format rlds \
         --episodes 3 4 5 8 9
 
 Exact dataset fps defined in openx/config.py, obtained from:
@@ -35,12 +38,10 @@ import tensorflow as tf
 import tensorflow_datasets as tfds
 import torch
 import tqdm
-import yaml
 from datasets import Dataset, Features, Image, Sequence, Value
 from PIL import Image as PILImage
 
 from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
-from lerobot.common.datasets.push_dataset_to_hub.openx.transforms import OPENX_STANDARDIZATION_TRANSFORMS
 from lerobot.common.datasets.push_dataset_to_hub.utils import (
     calculate_episode_data_index,
     concatenate_episodes,
@@ -52,11 +53,6 @@ from lerobot.common.datasets.utils import (
 )
 from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
 
-with open("lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml") as f:
-    _openx_list = yaml.safe_load(f)
-
-OPENX_DATASET_CONFIGS = _openx_list["OPENX_DATASET_CONFIGS"]
-
 np.set_printoptions(precision=2)
 
 
@@ -108,7 +104,6 @@ def load_from_raw(
     video: bool,
     episodes: list[int] | None = None,
     encoding: dict | None = None,
-    openx_dataset_name: str | None = None,
 ):
     """
     Args:
@@ -136,18 +131,23 @@ def load_from_raw(
     # we will apply the standardization transform if the dataset_name is provided
     # if the dataset name is not provided and the goal is to convert any rlds formatted dataset
     # search for 'image' keys in the observations
-    if openx_dataset_name is not None:
-        print(" - applying standardization transform for dataset: ", openx_dataset_name)
-        assert openx_dataset_name in OPENX_STANDARDIZATION_TRANSFORMS
-        transform_fn = OPENX_STANDARDIZATION_TRANSFORMS[openx_dataset_name]
-        dataset = dataset.map(transform_fn)
+    image_keys = []
+    state_keys = []
+    observation_info = dataset_info.features["steps"]["observation"]
+    for key in observation_info:
+        # check whether the key is for an image or a vector observation
+        if len(observation_info[key].shape) == 3:
+            # only adding uint8 images discards depth images
+            if observation_info[key].dtype == tf.uint8:
+                image_keys.append(key)
+        else:
+            state_keys.append(key)
 
-        image_keys = OPENX_DATASET_CONFIGS[openx_dataset_name]["image_obs_keys"]
-    else:
-        obs_keys = dataset_info.features["steps"]["observation"].keys()
-        image_keys = [key for key in obs_keys if "image" in key]
-
-    lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None
+    lang_key = (
+        "language_instruction"
+        if "language_instruction" in dataset.element_spec
+        else None
+    )
 
     print(" - image_keys: ", image_keys)
     print(" - lang_key: ", lang_key)
@@ -193,50 +193,33 @@ def load_from_raw(
 
         num_frames = episode["action"].shape[0]
 
-        ###########################################################
-        # Handle the episodic data
-
-        # last step of demonstration is considered done
-        done = torch.zeros(num_frames, dtype=torch.bool)
-        done[-1] = True
         ep_dict = {}
-        langs = []  # TODO: might be located in "observation"
+        for key in state_keys:
+            ep_dict[f"observation.{key}"] = tf_to_torch(episode["observation"][key])
 
-        image_array_dict = {key: [] for key in image_keys}
-
-        # We will create the state observation tensor by stacking the state
-        # obs keys defined in the openx/configs.py
-        if openx_dataset_name is not None:
-            state_obs_keys = OPENX_DATASET_CONFIGS[openx_dataset_name]["state_obs_keys"]
-            # stack the state observations, if is None, pad with zeros
-            states = []
-            for key in state_obs_keys:
-                if key in episode["observation"]:
-                    states.append(tf_to_torch(episode["observation"][key]))
-                else:
-                    states.append(torch.zeros(num_frames, 1))  # pad with zeros
-            states = torch.cat(states, dim=1)
-            # assert states.shape == (num_frames, 8), f"states shape: {states.shape}"
-        else:
-            states = tf_to_torch(episode["observation"]["state"])
-
-        actions = tf_to_torch(episode["action"])
-        rewards = tf_to_torch(episode["reward"]).float()
+        ep_dict["action"] = tf_to_torch(episode["action"])
+        ep_dict["next.reward"] = tf_to_torch(episode["reward"]).float()
+        ep_dict["next.done"] = tf_to_torch(episode["is_last"])
+        ep_dict["is_terminal"] = tf_to_torch(episode["is_terminal"])
+        ep_dict["is_first"] = tf_to_torch(episode["is_first"])
+        ep_dict["discount"] = tf_to_torch(episode["discount"])
 
         # If lang_key is present, convert the entire tensor at once
         if lang_key is not None:
-            langs = [str(x) for x in episode[lang_key]]
+            ep_dict["language_instruction"] = [
+                x.numpy().decode("utf-8") for x in episode[lang_key]
+            ]
+
+        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
+        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+
+        image_array_dict = {key: [] for key in image_keys}
 
         for im_key in image_keys:
             imgs = episode["observation"][im_key]
             image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
 
-        # simple assertions
-        for item in [states, actions, rewards, done]:
-            assert len(item) == num_frames
-
-        ###########################################################
-
         # loop through all cameras
         for im_key in image_keys:
             img_key = f"observation.images.{im_key}"
@@ -257,22 +240,12 @@ def load_from_raw(
 
                 # store the reference to the video frame
                 ep_dict[img_key] = [
-                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                    {"path": f"videos/{fname}", "timestamp": i / fps}
+                    for i in range(num_frames)
                 ]
             else:
                 ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
 
-        if lang_key is not None:
-            ep_dict["language_instruction"] = langs
-
-        ep_dict["observation.state"] = states
-        ep_dict["action"] = actions
-        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
-        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
-        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
-        ep_dict["next.reward"] = rewards
-        ep_dict["next.done"] = done
-
         path_ep_dict = tmp_ep_dicts_dir.joinpath(
             "ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt"
         )
@@ -290,30 +263,30 @@ def load_from_raw(
 def to_hf_dataset(data_dict, video) -> Dataset:
     features = {}
 
-    keys = [key for key in data_dict if "observation.images." in key]
-    for key in keys:
-        if video:
-            features[key] = VideoFrame()
-        else:
-            features[key] = Image()
+    for key in data_dict:
+        # check if vector state obs
+        if key.startswith("observation.") and "observation.images." not in key:
+            features[key] = Sequence(
+                length=data_dict[key].shape[1], feature=Value(dtype="float32", id=None)
+            )
+        # check if image obs
+        elif "observation.images." in key:
+            if video:
+                features[key] = VideoFrame()
+            else:
+                features[key] = Image()
 
-    features["observation.state"] = Sequence(
-        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
-    )
-    if "observation.velocity" in data_dict:
-        features["observation.velocity"] = Sequence(
-            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
-        )
-    if "observation.effort" in data_dict:
-        features["observation.effort"] = Sequence(
-            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
-        )
     if "language_instruction" in data_dict:
         features["language_instruction"] = Value(dtype="string", id=None)
 
     features["action"] = Sequence(
         length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
     )
+
+    features["is_terminal"] = Value(dtype="bool", id=None)
+    features["is_first"] = Value(dtype="bool", id=None)
+    features["discount"] = Value(dtype="float32", id=None)
+
     features["episode_index"] = Value(dtype="int64", id=None)
     features["frame_index"] = Value(dtype="int64", id=None)
     features["timestamp"] = Value(dtype="float32", id=None)
@@ -333,19 +306,8 @@ def from_raw_to_lerobot_format(
     video: bool = True,
     episodes: list[int] | None = None,
     encoding: dict | None = None,
-    openx_dataset_name: str | None = None,
 ):
-    """This is a test impl for rlds conversion"""
-    if openx_dataset_name is None:
-        # set a default rlds frame rate if the dataset is not from openx
-        fps = 30
-    elif "fps" not in OPENX_DATASET_CONFIGS[openx_dataset_name]:
-        raise ValueError(
-            "fps for this dataset is not specified in openx/configs.py yet," "means it is not yet tested"
-        )
-    fps = OPENX_DATASET_CONFIGS[openx_dataset_name]["fps"]
-
-    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding, openx_dataset_name)
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
     hf_dataset = to_hf_dataset(data_dict, video)
     episode_data_index = calculate_episode_data_index(hf_dataset)
     info = {

lerobot/common/datasets/push_dataset_to_hub/pusht_zarr_format.py

@@ -56,7 +56,9 @@ def check_format(raw_dir):
 
     required_datasets.remove("meta/episode_ends")
 
-    assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
+    assert all(
+        nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets
+    )
 
 
 def load_from_raw(
@@ -76,7 +78,9 @@ def load_from_raw(
             ReplayBuffer as DiffusionPolicyReplayBuffer,
         )
     except ModuleNotFoundError as e:
-        print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
+        print(
+            "`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`"
+        )
         raise e
     # as define in gmy-pusht env: https://github.com/huggingface/gym-pusht/blob/e0684ff988d223808c0a9dcfaba9dc4991791370/gym_pusht/envs/pusht.py#L174
     success_threshold = 0.95  # 95% coverage,
@@ -150,7 +154,9 @@ def load_from_raw(
             ]
             space.add(*walls)
 
-            block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
+            block_body, block_shapes = PushTEnv.add_tee(
+                space, block_pos[i].tolist(), block_angle[i].item()
+            )
             goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
             block_geom = pymunk_to_shapely(block_body, block_body.shapes)
             intersection_area = goal_geom.intersection(block_geom).area
@@ -159,7 +165,9 @@ def load_from_raw(
             reward[i] = np.clip(coverage / success_threshold, 0, 1)
             success[i] = coverage > success_threshold
             if keypoints_instead_of_image:
-                keypoints[i] = torch.from_numpy(PushTEnv.get_keypoints(block_shapes).flatten())
+                keypoints[i] = torch.from_numpy(
+                    PushTEnv.get_keypoints(block_shapes).flatten()
+                )
 
         # last step of demonstration is considered done
         done[-1] = True
@@ -184,7 +192,8 @@ def load_from_raw(
 
                 # store the reference to the video frame
                 ep_dict[img_key] = [
-                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                    {"path": f"videos/{fname}", "timestamp": i / fps}
+                    for i in range(num_frames)
                 ]
             else:
                 ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
@@ -193,7 +202,9 @@ def load_from_raw(
         if keypoints_instead_of_image:
             ep_dict["observation.environment_state"] = keypoints
         ep_dict["action"] = actions[from_idx:to_idx]
-        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+        ep_dict["episode_index"] = torch.tensor(
+            [ep_idx] * num_frames, dtype=torch.int64
+        )
         ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
         ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
         # ep_dict["next.observation.image"] = image[1:],
@@ -220,7 +231,8 @@ def to_hf_dataset(data_dict, video, keypoints_instead_of_image: bool = False):
             features["observation.image"] = Image()
 
     features["observation.state"] = Sequence(
-        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+        length=data_dict["observation.state"].shape[1],
+        feature=Value(dtype="float32", id=None),
     )
     if keypoints_instead_of_image:
         features["observation.environment_state"] = Sequence(
@@ -261,7 +273,9 @@ def from_raw_to_lerobot_format(
     if fps is None:
         fps = 10
 
-    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, keypoints_instead_of_image, encoding)
+    data_dict = load_from_raw(
+        raw_dir, videos_dir, fps, video, episodes, keypoints_instead_of_image, encoding
+    )
     hf_dataset = to_hf_dataset(data_dict, video, keypoints_instead_of_image)
     episode_data_index = calculate_episode_data_index(hf_dataset)
     info = {

lerobot/common/datasets/push_dataset_to_hub/umi_zarr_format.py

@@ -26,7 +26,9 @@ from datasets import Dataset, Features, Image, Sequence, Value
 from PIL import Image as PILImage
 
 from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
-from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
+from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import (
+    register_codecs,
+)
 from lerobot.common.datasets.push_dataset_to_hub.utils import (
     calculate_episode_data_index,
     concatenate_episodes,
@@ -61,7 +63,9 @@ def check_format(raw_dir) -> bool:
     nb_frames = zarr_data["data/camera0_rgb"].shape[0]
 
     required_datasets.remove("meta/episode_ends")
-    assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
+    assert all(
+        nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets
+    )
 
 
 def load_from_raw(
@@ -79,7 +83,9 @@ def load_from_raw(
     end_pose = torch.from_numpy(zarr_data["data/robot0_demo_end_pose"][:])
     start_pos = torch.from_numpy(zarr_data["data/robot0_demo_start_pose"][:])
     eff_pos = torch.from_numpy(zarr_data["data/robot0_eef_pos"][:])
-    eff_rot_axis_angle = torch.from_numpy(zarr_data["data/robot0_eef_rot_axis_angle"][:])
+    eff_rot_axis_angle = torch.from_numpy(
+        zarr_data["data/robot0_eef_rot_axis_angle"][:]
+    )
     gripper_width = torch.from_numpy(zarr_data["data/robot0_gripper_width"][:])
 
     states_pos = torch.cat([eff_pos, eff_rot_axis_angle], dim=1)
@@ -129,24 +135,31 @@ def load_from_raw(
                     save_images_concurrently(imgs_array, tmp_imgs_dir)
 
                     # encode images to a mp4 video
-                    encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+                    encode_video_frames(
+                        tmp_imgs_dir, video_path, fps, **(encoding or {})
+                    )
 
                     # clean temporary images directory
                     shutil.rmtree(tmp_imgs_dir)
 
                 # store the reference to the video frame
                 ep_dict[img_key] = [
-                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                    {"path": f"videos/{fname}", "timestamp": i / fps}
+                    for i in range(num_frames)
                 ]
             else:
                 ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
 
             ep_dict["observation.state"] = state
-            ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+            ep_dict["episode_index"] = torch.tensor(
+                [ep_idx] * num_frames, dtype=torch.int64
+            )
             ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
             ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
             ep_dict["episode_data_index_from"] = torch.tensor([from_idx] * num_frames)
-            ep_dict["episode_data_index_to"] = torch.tensor([from_idx + num_frames] * num_frames)
+            ep_dict["episode_data_index_to"] = torch.tensor(
+                [from_idx + num_frames] * num_frames
+            )
             ep_dict["end_pose"] = end_pose[from_idx:to_idx]
             ep_dict["start_pos"] = start_pos[from_idx:to_idx]
             ep_dict["gripper_width"] = gripper_width[from_idx:to_idx]
@@ -172,7 +185,8 @@ def to_hf_dataset(data_dict, video):
         features["observation.image"] = Image()
 
     features["observation.state"] = Sequence(
-        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+        length=data_dict["observation.state"].shape[1],
+        feature=Value(dtype="float32", id=None),
     )
     features["episode_index"] = Value(dtype="int64", id=None)
     features["frame_index"] = Value(dtype="int64", id=None)
@@ -192,7 +206,8 @@ def to_hf_dataset(data_dict, video):
         length=data_dict["start_pos"].shape[1], feature=Value(dtype="float32", id=None)
     )
     features["gripper_width"] = Sequence(
-        length=data_dict["gripper_width"].shape[1], feature=Value(dtype="float32", id=None)
+        length=data_dict["gripper_width"].shape[1],
+        feature=Value(dtype="float32", id=None),
     )
 
     hf_dataset = Dataset.from_dict(data_dict, features=Features(features))

lerobot/common/datasets/push_dataset_to_hub/utils.py

@@ -45,7 +45,9 @@ def concatenate_episodes(ep_dicts):
     return data_dict
 
 
-def save_images_concurrently(imgs_array: numpy.array, out_dir: Path, max_workers: int = 4):
+def save_images_concurrently(
+    imgs_array: numpy.array, out_dir: Path, max_workers: int = 4
+):
     out_dir = Path(out_dir)
     out_dir.mkdir(parents=True, exist_ok=True)
 
@@ -55,7 +57,10 @@ def save_images_concurrently(imgs_array: numpy.array, out_dir: Path, max_workers
 
     num_images = len(imgs_array)
     with ThreadPoolExecutor(max_workers=max_workers) as executor:
-        [executor.submit(save_image, imgs_array[i], i, out_dir) for i in range(num_images)]
+        [
+            executor.submit(save_image, imgs_array[i], i, out_dir)
+            for i in range(num_images)
+        ]
 
 
 def get_default_encoding() -> dict:
@@ -64,7 +69,8 @@ def get_default_encoding() -> dict:
     return {
         k: v.default
         for k, v in signature.parameters.items()
-        if v.default is not inspect.Parameter.empty and k in ["vcodec", "pix_fmt", "g", "crf"]
+        if v.default is not inspect.Parameter.empty
+        and k in ["vcodec", "pix_fmt", "g", "crf"]
     }
 
 
@@ -77,7 +83,9 @@ def check_repo_id(repo_id: str) -> None:
 
 
 # TODO(aliberts): remove
-def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torch.Tensor]:
+def calculate_episode_data_index(
+    hf_dataset: datasets.Dataset,
+) -> Dict[str, torch.Tensor]:
     """
     Calculate episode data index for the provided HuggingFace Dataset. Relies on episode_index column of hf_dataset.
 

lerobot/common/datasets/push_dataset_to_hub/xarm_pkl_format.py

@@ -40,7 +40,10 @@ from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
 
 def check_format(raw_dir):
     keys = {"actions", "rewards", "dones"}
-    nested_keys = {"observations": {"rgb", "state"}, "next_observations": {"rgb", "state"}}
+    nested_keys = {
+        "observations": {"rgb", "state"},
+        "next_observations": {"rgb", "state"},
+    }
 
     xarm_files = list(raw_dir.glob("*.pkl"))
     assert len(xarm_files) > 0
@@ -53,11 +56,17 @@ def check_format(raw_dir):
 
     # Check for consistent lengths in nested keys
     expected_len = len(dataset_dict["actions"])
-    assert all(len(dataset_dict[key]) == expected_len for key in keys if key in dataset_dict)
+    assert all(
+        len(dataset_dict[key]) == expected_len for key in keys if key in dataset_dict
+    )
 
     for key, subkeys in nested_keys.items():
         nested_dict = dataset_dict.get(key, {})
-        assert all(len(nested_dict[subkey]) == expected_len for subkey in subkeys if subkey in nested_dict)
+        assert all(
+            len(nested_dict[subkey]) == expected_len
+            for subkey in subkeys
+            if subkey in nested_dict
+        )
 
 
 def load_from_raw(
@@ -122,13 +131,18 @@ def load_from_raw(
             shutil.rmtree(tmp_imgs_dir)
 
             # store the reference to the video frame
-            ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
+            ep_dict[img_key] = [
+                {"path": f"videos/{fname}", "timestamp": i / fps}
+                for i in range(num_frames)
+            ]
         else:
             ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
 
         ep_dict["observation.state"] = state
         ep_dict["action"] = action
-        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+        ep_dict["episode_index"] = torch.tensor(
+            [ep_idx] * num_frames, dtype=torch.int64
+        )
         ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
         ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
         # ep_dict["next.observation.image"] = next_image
@@ -153,7 +167,8 @@ def to_hf_dataset(data_dict, video):
         features["observation.image"] = Image()
 
     features["observation.state"] = Sequence(
-        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+        length=data_dict["observation.state"].shape[1],
+        feature=Value(dtype="float32", id=None),
     )
     features["action"] = Sequence(
         length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)

lerobot/common/datasets/sampler.py

@@ -43,7 +43,10 @@ class EpisodeAwareSampler:
         ):
             if episode_indices_to_use is None or episode_idx in episode_indices_to_use:
                 indices.extend(
-                    range(start_index.item() + drop_n_first_frames, end_index.item() - drop_n_last_frames)
+                    range(
+                        start_index.item() + drop_n_first_frames,
+                        end_index.item() - drop_n_last_frames,
+                    )
                 )
 
         self.indices = indices

lerobot/common/datasets/transforms.py

@@ -57,7 +57,9 @@ class RandomSubsetApply(Transform):
         elif not isinstance(n_subset, int):
             raise TypeError("n_subset should be an int or None")
         elif not (1 <= n_subset <= len(transforms)):
-            raise ValueError(f"n_subset should be in the interval [1, {len(transforms)}]")
+            raise ValueError(
+                f"n_subset should be in the interval [1, {len(transforms)}]"
+            )
 
         self.transforms = transforms
         total = sum(p)
@@ -116,16 +118,22 @@ class SharpnessJitter(Transform):
     def _check_input(self, sharpness):
         if isinstance(sharpness, (int, float)):
             if sharpness < 0:
-                raise ValueError("If sharpness is a single number, it must be non negative.")
+                raise ValueError(
+                    "If sharpness is a single number, it must be non negative."
+                )
             sharpness = [1.0 - sharpness, 1.0 + sharpness]
             sharpness[0] = max(sharpness[0], 0.0)
         elif isinstance(sharpness, collections.abc.Sequence) and len(sharpness) == 2:
             sharpness = [float(v) for v in sharpness]
         else:
-            raise TypeError(f"{sharpness=} should be a single number or a sequence with length 2.")
+            raise TypeError(
+                f"{sharpness=} should be a single number or a sequence with length 2."
+            )
 
         if not 0.0 <= sharpness[0] <= sharpness[1]:
-            raise ValueError(f"sharpnesss values should be between (0., inf), but got {sharpness}.")
+            raise ValueError(
+                f"sharpnesss values should be between (0., inf), but got {sharpness}."
+            )
 
         return float(sharpness[0]), float(sharpness[1])
 
@@ -134,7 +142,9 @@ class SharpnessJitter(Transform):
 
     def _transform(self, inpt: Any, params: Dict[str, Any]) -> Any:
         sharpness_factor = self._generate_value(self.sharpness[0], self.sharpness[1])
-        return self._call_kernel(F.adjust_sharpness, inpt, sharpness_factor=sharpness_factor)
+        return self._call_kernel(
+            F.adjust_sharpness, inpt, sharpness_factor=sharpness_factor
+        )
 
 
 def get_image_transforms(
@@ -150,6 +160,10 @@ def get_image_transforms(
     sharpness_min_max: tuple[float, float] | None = None,
     max_num_transforms: int | None = None,
     random_order: bool = False,
+    interpolation: str | None = None,
+    image_size: tuple[int, int] | None = None,
+    image_mean: list[float] | None = None,
+    image_std: list[float] | None = None,
 ):
     def check_value(name, weight, min_max):
         if min_max is not None:
@@ -170,6 +184,22 @@ def get_image_transforms(
 
     weights = []
     transforms = []
+    if image_size is not None:
+        interpolations = [interpolation.value for interpolation in v2.InterpolationMode]
+        if interpolation is None:
+            # Use BICUBIC as default interpolation
+            interpolation_mode = v2.InterpolationMode.BICUBIC
+        elif interpolation in interpolations:
+            interpolation_mode = v2.InterpolationMode(interpolation)
+        else:
+            raise ValueError("The interpolation passed is not supported")
+        # Weight for resizing is always 1
+        weights.append(1.0)
+        transforms.append(
+            v2.Resize(
+                size=(image_size[0], image_size[1]), interpolation=interpolation_mode
+            )
+        )
     if brightness_min_max is not None and brightness_weight > 0.0:
         weights.append(brightness_weight)
         transforms.append(v2.ColorJitter(brightness=brightness_min_max))
@@ -185,6 +215,15 @@ def get_image_transforms(
     if sharpness_min_max is not None and sharpness_weight > 0.0:
         weights.append(sharpness_weight)
         transforms.append(SharpnessJitter(sharpness=sharpness_min_max))
+    if image_mean is not None and image_std is not None:
+        # Weight for normalization is always 1
+        weights.append(1.0)
+        transforms.append(
+            v2.Normalize(
+                mean=image_mean,
+                std=image_std,
+            )
+        )
 
     n_subset = len(transforms)
     if max_num_transforms is not None:
@@ -194,4 +233,6 @@ def get_image_transforms(
         return v2.Identity()
     else:
         # TODO(rcadene, aliberts): add v2.ToDtype float16?
-        return RandomSubsetApply(transforms, p=weights, n_subset=n_subset, random_order=random_order)
+        return RandomSubsetApply(
+            transforms, p=weights, n_subset=n_subset, random_order=random_order
+        )

lerobot/common/datasets/utils.py

@@ -13,12 +13,15 @@
 # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
 # See the License for the specific language governing permissions and
 # limitations under the License.
+import importlib.resources
 import json
 import logging
 import textwrap
+from collections.abc import Iterator
 from itertools import accumulate
 from pathlib import Path
 from pprint import pformat
+from types import SimpleNamespace
 from typing import Any
 
 import datasets
@@ -40,9 +43,15 @@ EPISODES_PATH = "meta/episodes.jsonl"
 STATS_PATH = "meta/stats.json"
 TASKS_PATH = "meta/tasks.jsonl"
 
-DEFAULT_VIDEO_PATH = "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4"
-DEFAULT_PARQUET_PATH = "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet"
-DEFAULT_IMAGE_PATH = "images/{image_key}/episode_{episode_index:06d}/frame_{frame_index:06d}.png"
+DEFAULT_VIDEO_PATH = (
+    "videos/chunk-{episode_chunk:03d}/{video_key}/episode_{episode_index:06d}.mp4"
+)
+DEFAULT_PARQUET_PATH = (
+    "data/chunk-{episode_chunk:03d}/episode_{episode_index:06d}.parquet"
+)
+DEFAULT_IMAGE_PATH = (
+    "images/{image_key}/episode_{episode_index:06d}/frame_{frame_index:06d}.png"
+)
 
 DATASET_CARD_TEMPLATE = """
 ---
@@ -96,7 +105,9 @@ def unflatten_dict(d: dict, sep: str = "/") -> dict:
 
 
 def serialize_dict(stats: dict[str, torch.Tensor | np.ndarray | dict]) -> dict:
-    serialized_dict = {key: value.tolist() for key, value in flatten_dict(stats).items()}
+    serialized_dict = {
+        key: value.tolist() for key, value in flatten_dict(stats).items()
+    }
     return unflatten_dict(serialized_dict)
 
 
@@ -154,14 +165,19 @@ def load_stats(local_dir: Path) -> dict:
 
 def load_tasks(local_dir: Path) -> dict:
     tasks = load_jsonlines(local_dir / TASKS_PATH)
-    return {item["task_index"]: item["task"] for item in sorted(tasks, key=lambda x: x["task_index"])}
+    return {
+        item["task_index"]: item["task"]
+        for item in sorted(tasks, key=lambda x: x["task_index"])
+    }
 
 
 def load_episodes(local_dir: Path) -> dict:
     return load_jsonlines(local_dir / EPISODES_PATH)
 
 
-def load_image_as_numpy(fpath: str | Path, dtype="float32", channel_first: bool = True) -> np.ndarray:
+def load_image_as_numpy(
+    fpath: str | Path, dtype="float32", channel_first: bool = True
+) -> np.ndarray:
     img = PILImage.open(fpath).convert("RGB")
     img_array = np.array(img, dtype=dtype)
     if channel_first:  # (H, W, C) -> (C, H, W)
@@ -219,7 +235,10 @@ class BackwardCompatibilityError(Exception):
 
 
 def check_version_compatibility(
-    repo_id: str, version_to_check: str, current_version: str, enforce_breaking_major: bool = True
+    repo_id: str,
+    version_to_check: str,
+    current_version: str,
+    enforce_breaking_major: bool = True,
 ) -> None:
     current_major, _ = _get_major_minor(current_version)
     major_to_check, _ = _get_major_minor(version_to_check)
@@ -272,6 +291,7 @@ def get_hf_features_from_features(features: dict) -> datasets.Features:
             hf_features[key] = datasets.Sequence(
                 length=ft["shape"][0], feature=datasets.Value(dtype=ft["dtype"])
             )
+            # TODO: (alibers, azouitine) Add support for ft["shap"] == 0 as Value
 
     return datasets.Features(hf_features)
 
@@ -313,7 +333,9 @@ def create_empty_dataset_info(
 def get_episode_data_index(
     episode_dicts: list[dict], episodes: list[int] | None = None
 ) -> dict[str, torch.Tensor]:
-    episode_lengths = {ep_idx: ep_dict["length"] for ep_idx, ep_dict in enumerate(episode_dicts)}
+    episode_lengths = {
+        ep_idx: ep_dict["length"] for ep_idx, ep_dict in enumerate(episode_dicts)
+    }
     if episodes is not None:
         episode_lengths = {ep_idx: episode_lengths[ep_idx] for ep_idx in episodes}
 
@@ -334,7 +356,9 @@ def calculate_total_episode(
     return total_episodes
 
 
-def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> dict[str, torch.Tensor]:
+def calculate_episode_data_index(
+    hf_dataset: datasets.Dataset,
+) -> dict[str, torch.Tensor]:
     episode_lengths = []
     table = hf_dataset.data.table
     total_episodes = calculate_total_episode(hf_dataset)
@@ -376,7 +400,9 @@ def check_timestamps_sync(
         # Track original indices before masking
         original_indices = torch.arange(len(diffs))
         filtered_indices = original_indices[mask]
-        outside_tolerance_filtered_indices = torch.nonzero(~filtered_within_tolerance)  # .squeeze()
+        outside_tolerance_filtered_indices = torch.nonzero(
+            ~filtered_within_tolerance
+        )  # .squeeze()
         outside_tolerance_indices = filtered_indices[outside_tolerance_filtered_indices]
         episode_indices = torch.stack(hf_dataset["episode_index"])
 
@@ -401,7 +427,10 @@ def check_timestamps_sync(
 
 
 def check_delta_timestamps(
-    delta_timestamps: dict[str, list[float]], fps: int, tolerance_s: float, raise_value_error: bool = True
+    delta_timestamps: dict[str, list[float]],
+    fps: int,
+    tolerance_s: float,
+    raise_value_error: bool = True,
 ) -> bool:
     """This will check if all the values in delta_timestamps are multiples of 1/fps +/- tolerance.
     This is to ensure that these delta_timestamps added to any timestamp from a dataset will themselves be
@@ -409,10 +438,14 @@ def check_delta_timestamps(
     """
     outside_tolerance = {}
     for key, delta_ts in delta_timestamps.items():
-        within_tolerance = [abs(ts * fps - round(ts * fps)) / fps <= tolerance_s for ts in delta_ts]
+        within_tolerance = [
+            abs(ts * fps - round(ts * fps)) / fps <= tolerance_s for ts in delta_ts
+        ]
         if not all(within_tolerance):
             outside_tolerance[key] = [
-                ts for ts, is_within in zip(delta_ts, within_tolerance, strict=True) if not is_within
+                ts
+                for ts, is_within in zip(delta_ts, within_tolerance, strict=True)
+                if not is_within
             ]
 
     if len(outside_tolerance) > 0:
@@ -430,7 +463,9 @@ def check_delta_timestamps(
     return True
 
 
-def get_delta_indices(delta_timestamps: dict[str, list[float]], fps: int) -> dict[str, list[int]]:
+def get_delta_indices(
+    delta_timestamps: dict[str, list[float]], fps: int
+) -> dict[str, list[int]]:
     delta_indices = {}
     for key, delta_ts in delta_timestamps.items():
         delta_indices[key] = (torch.tensor(delta_ts) * fps).long().tolist()
@@ -476,6 +511,7 @@ def create_lerobot_dataset_card(
     Note: If specified, license must be one of https://huggingface.co/docs/hub/repositories-licenses.
     """
     card_tags = ["LeRobot"]
+
     if tags:
         card_tags += tags
     if dataset_info:
@@ -493,8 +529,68 @@ def create_lerobot_dataset_card(
             }
         ],
     )
+
+    card_template = (
+        importlib.resources.files("lerobot.common.datasets") / "card_template.md"
+    ).read_text()
+
     return DatasetCard.from_template(
         card_data=card_data,
-        template_path="./lerobot/common/datasets/card_template.md",
+        template_str=card_template,
         **kwargs,
     )
+
+
+class IterableNamespace(SimpleNamespace):
+    """
+    A namespace object that supports both dictionary-like iteration and dot notation access.
+    Automatically converts nested dictionaries into IterableNamespaces.
+
+    This class extends SimpleNamespace to provide:
+    - Dictionary-style iteration over keys
+    - Access to items via both dot notation (obj.key) and brackets (obj["key"])
+    - Dictionary-like methods: items(), keys(), values()
+    - Recursive conversion of nested dictionaries
+
+    Args:
+        dictionary: Optional dictionary to initialize the namespace
+        **kwargs: Additional keyword arguments passed to SimpleNamespace
+
+    Examples:
+        >>> data = {"name": "Alice", "details": {"age": 25}}
+        >>> ns = IterableNamespace(data)
+        >>> ns.name
+        'Alice'
+        >>> ns.details.age
+        25
+        >>> list(ns.keys())
+        ['name', 'details']
+        >>> for key, value in ns.items():
+        ...     print(f"{key}: {value}")
+        name: Alice
+        details: IterableNamespace(age=25)
+    """
+
+    def __init__(self, dictionary: dict[str, Any] = None, **kwargs):
+        super().__init__(**kwargs)
+        if dictionary is not None:
+            for key, value in dictionary.items():
+                if isinstance(value, dict):
+                    setattr(self, key, IterableNamespace(value))
+                else:
+                    setattr(self, key, value)
+
+    def __iter__(self) -> Iterator[str]:
+        return iter(vars(self))
+
+    def __getitem__(self, key: str) -> Any:
+        return vars(self)[key]
+
+    def items(self):
+        return vars(self).items()
+
+    def values(self):
+        return vars(self).values()
+
+    def keys(self):
+        return vars(self).keys()

lerobot/common/datasets/v2/batch_convert_dataset_v1_to_v2.py

@@ -26,7 +26,10 @@ from pathlib import Path
 from textwrap import dedent
 
 from lerobot import available_datasets
-from lerobot.common.datasets.v2.convert_dataset_v1_to_v2 import convert_dataset, parse_robot_config
+from lerobot.common.datasets.v2.convert_dataset_v1_to_v2 import (
+    convert_dataset,
+    parse_robot_config,
+)
 
 LOCAL_DIR = Path("data/")
 
@@ -117,7 +120,10 @@ DATASETS = {
         "single_task": "Place the battery into the slot of the remote controller.",
         **ALOHA_STATIC_INFO,
     },
-    "aloha_static_candy": {"single_task": "Pick up the candy and unwrap it.", **ALOHA_STATIC_INFO},
+    "aloha_static_candy": {
+        "single_task": "Pick up the candy and unwrap it.",
+        **ALOHA_STATIC_INFO,
+    },
     "aloha_static_coffee": {
         "single_task": "Place the coffee capsule inside the capsule container, then place the cup onto the center of the cup tray, then push the 'Hot Water' and 'Travel Mug' buttons.",
         **ALOHA_STATIC_INFO,
@@ -159,20 +165,29 @@ DATASETS = {
         **ALOHA_STATIC_INFO,
     },
     "aloha_static_vinh_cup": {
-        "single_task": "Pick up the platic cup with the right arm, then pop its lid open with the left arm.",
+        "single_task": "Pick up the plastic cup with the right arm, then pop its lid open with the left arm.",
         **ALOHA_STATIC_INFO,
     },
     "aloha_static_vinh_cup_left": {
-        "single_task": "Pick up the platic cup with the left arm, then pop its lid open with the right arm.",
+        "single_task": "Pick up the plastic cup with the left arm, then pop its lid open with the right arm.",
+        **ALOHA_STATIC_INFO,
+    },
+    "aloha_static_ziploc_slide": {
+        "single_task": "Slide open the ziploc bag.",
+        **ALOHA_STATIC_INFO,
+    },
+    "aloha_sim_insertion_scripted": {
+        "single_task": "Insert the peg into the socket.",
         **ALOHA_STATIC_INFO,
     },
-    "aloha_static_ziploc_slide": {"single_task": "Slide open the ziploc bag.", **ALOHA_STATIC_INFO},
-    "aloha_sim_insertion_scripted": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
     "aloha_sim_insertion_scripted_image": {
         "single_task": "Insert the peg into the socket.",
         **ALOHA_STATIC_INFO,
     },
-    "aloha_sim_insertion_human": {"single_task": "Insert the peg into the socket.", **ALOHA_STATIC_INFO},
+    "aloha_sim_insertion_human": {
+        "single_task": "Insert the peg into the socket.",
+        **ALOHA_STATIC_INFO,
+    },
     "aloha_sim_insertion_human_image": {
         "single_task": "Insert the peg into the socket.",
         **ALOHA_STATIC_INFO,
@@ -193,10 +208,19 @@ DATASETS = {
         "single_task": "Pick up the cube with the right arm and transfer it to the left arm.",
         **ALOHA_STATIC_INFO,
     },
-    "pusht": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
-    "pusht_image": {"single_task": "Push the T-shaped block onto the T-shaped target.", **PUSHT_INFO},
+    "pusht": {
+        "single_task": "Push the T-shaped block onto the T-shaped target.",
+        **PUSHT_INFO,
+    },
+    "pusht_image": {
+        "single_task": "Push the T-shaped block onto the T-shaped target.",
+        **PUSHT_INFO,
+    },
     "unitreeh1_fold_clothes": {"single_task": "Fold the sweatshirt.", **UNITREEH_INFO},
-    "unitreeh1_rearrange_objects": {"single_task": "Put the object into the bin.", **UNITREEH_INFO},
+    "unitreeh1_rearrange_objects": {
+        "single_task": "Put the object into the bin.",
+        **UNITREEH_INFO,
+    },
     "unitreeh1_two_robot_greeting": {
         "single_task": "Greet the other robot with a high five.",
         **UNITREEH_INFO,
@@ -206,13 +230,31 @@ DATASETS = {
         **UNITREEH_INFO,
     },
     "xarm_lift_medium": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
-    "xarm_lift_medium_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
-    "xarm_lift_medium_replay": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
-    "xarm_lift_medium_replay_image": {"single_task": "Pick up the cube and lift it.", **XARM_INFO},
+    "xarm_lift_medium_image": {
+        "single_task": "Pick up the cube and lift it.",
+        **XARM_INFO,
+    },
+    "xarm_lift_medium_replay": {
+        "single_task": "Pick up the cube and lift it.",
+        **XARM_INFO,
+    },
+    "xarm_lift_medium_replay_image": {
+        "single_task": "Pick up the cube and lift it.",
+        **XARM_INFO,
+    },
     "xarm_push_medium": {"single_task": "Push the cube onto the target.", **XARM_INFO},
-    "xarm_push_medium_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
-    "xarm_push_medium_replay": {"single_task": "Push the cube onto the target.", **XARM_INFO},
-    "xarm_push_medium_replay_image": {"single_task": "Push the cube onto the target.", **XARM_INFO},
+    "xarm_push_medium_image": {
+        "single_task": "Push the cube onto the target.",
+        **XARM_INFO,
+    },
+    "xarm_push_medium_replay": {
+        "single_task": "Push the cube onto the target.",
+        **XARM_INFO,
+    },
+    "xarm_push_medium_replay_image": {
+        "single_task": "Push the cube onto the target.",
+        **XARM_INFO,
+    },
     "umi_cup_in_the_wild": {
         "single_task": "Put the cup on the plate.",
         "license": "apache-2.0",

lerobot/common/datasets/v2/convert_dataset_v1_to_v2.py

@@ -152,7 +152,9 @@ V1_INFO_PATH = "meta_data/info.json"
 V1_STATS_PATH = "meta_data/stats.safetensors"
 
 
-def parse_robot_config(config_path: Path, config_overrides: list[str] | None = None) -> tuple[str, dict]:
+def parse_robot_config(
+    config_path: Path, config_overrides: list[str] | None = None
+) -> tuple[str, dict]:
     robot_cfg = init_hydra_config(config_path, config_overrides)
     if robot_cfg["robot_type"] in ["aloha", "koch"]:
         state_names = [
@@ -203,7 +205,9 @@ def convert_stats_to_json(v1_dir: Path, v2_dir: Path) -> None:
         torch.testing.assert_close(stats_json[key], stats[key])
 
 
-def get_features_from_hf_dataset(dataset: Dataset, robot_config: dict | None = None) -> dict[str, list]:
+def get_features_from_hf_dataset(
+    dataset: Dataset, robot_config: dict | None = None
+) -> dict[str, list]:
     features = {}
     for key, ft in dataset.features.items():
         if isinstance(ft, datasets.Value):
@@ -215,7 +219,9 @@ def get_features_from_hf_dataset(dataset: Dataset, robot_config: dict | None = N
             dtype = ft.feature.dtype
             shape = (ft.length,)
             motor_names = (
-                robot_config["names"][key] if robot_config else [f"motor_{i}" for i in range(ft.length)]
+                robot_config["names"][key]
+                if robot_config
+                else [f"motor_{i}" for i in range(ft.length)]
             )
             assert len(motor_names) == shape[0]
             names = {"motors": motor_names}
@@ -239,11 +245,15 @@ def get_features_from_hf_dataset(dataset: Dataset, robot_config: dict | None = N
     return features
 
 
-def add_task_index_by_episodes(dataset: Dataset, tasks_by_episodes: dict) -> tuple[Dataset, list[str]]:
+def add_task_index_by_episodes(
+    dataset: Dataset, tasks_by_episodes: dict
+) -> tuple[Dataset, list[str]]:
     df = dataset.to_pandas()
     tasks = list(set(tasks_by_episodes.values()))
     tasks_to_task_index = {task: task_idx for task_idx, task in enumerate(tasks)}
-    episodes_to_task_index = {ep_idx: tasks_to_task_index[task] for ep_idx, task in tasks_by_episodes.items()}
+    episodes_to_task_index = {
+        ep_idx: tasks_to_task_index[task] for ep_idx, task in tasks_by_episodes.items()
+    }
     df["task_index"] = df["episode_index"].map(episodes_to_task_index).astype(int)
 
     features = dataset.features
@@ -260,10 +270,19 @@ def add_task_index_from_tasks_col(
     # HACK: This is to clean some of the instructions in our version of Open X datasets
     prefix_to_clean = "tf.Tensor(b'"
     suffix_to_clean = "', shape=(), dtype=string)"
-    df[tasks_col] = df[tasks_col].str.removeprefix(prefix_to_clean).str.removesuffix(suffix_to_clean)
+    df[tasks_col] = (
+        df[tasks_col]
+        .str.removeprefix(prefix_to_clean)
+        .str.removesuffix(suffix_to_clean)
+    )
 
     # Create task_index col
-    tasks_by_episode = df.groupby("episode_index")[tasks_col].unique().apply(lambda x: x.tolist()).to_dict()
+    tasks_by_episode = (
+        df.groupby("episode_index")[tasks_col]
+        .unique()
+        .apply(lambda x: x.tolist())
+        .to_dict()
+    )
     tasks = df[tasks_col].unique().tolist()
     tasks_to_task_index = {task: idx for idx, task in enumerate(tasks)}
     df["task_index"] = df[tasks_col].map(tasks_to_task_index).astype(int)
@@ -288,7 +307,9 @@ def split_parquet_by_episodes(
     for ep_chunk in range(total_chunks):
         ep_chunk_start = DEFAULT_CHUNK_SIZE * ep_chunk
         ep_chunk_end = min(DEFAULT_CHUNK_SIZE * (ep_chunk + 1), total_episodes)
-        chunk_dir = "/".join(DEFAULT_PARQUET_PATH.split("/")[:-1]).format(episode_chunk=ep_chunk)
+        chunk_dir = "/".join(DEFAULT_PARQUET_PATH.split("/")[:-1]).format(
+            episode_chunk=ep_chunk
+        )
         (output_dir / chunk_dir).mkdir(parents=True, exist_ok=True)
         for ep_idx in range(ep_chunk_start, ep_chunk_end):
             ep_table = table.filter(pc.equal(table["episode_index"], ep_idx))
@@ -320,7 +341,9 @@ def move_videos(
     videos_moved = False
     video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*.mp4")]
     if len(video_files) == 0:
-        video_files = [str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*/*/*.mp4")]
+        video_files = [
+            str(f.relative_to(work_dir)) for f in work_dir.glob("videos*/*/*/*.mp4")
+        ]
         videos_moved = True  # Videos have already been moved
 
     assert len(video_files) == total_episodes * len(video_keys)
@@ -351,7 +374,9 @@ def move_videos(
                 target_path = DEFAULT_VIDEO_PATH.format(
                     episode_chunk=ep_chunk, video_key=vid_key, episode_index=ep_idx
                 )
-                video_file = V1_VIDEO_FILE.format(video_key=vid_key, episode_index=ep_idx)
+                video_file = V1_VIDEO_FILE.format(
+                    video_key=vid_key, episode_index=ep_idx
+                )
                 if len(video_dirs) == 1:
                     video_path = video_dirs[0] / video_file
                 else:
@@ -368,7 +393,9 @@ def move_videos(
     subprocess.run(["git", "push"], cwd=work_dir, check=True)
 
 
-def fix_lfs_video_files_tracking(work_dir: Path, lfs_untracked_videos: list[str]) -> None:
+def fix_lfs_video_files_tracking(
+    work_dir: Path, lfs_untracked_videos: list[str]
+) -> None:
     """
     HACK: This function fixes the tracking by git lfs which was not properly set on some repos. In that case,
     there's no other option than to download the actual files and reupload them with lfs tracking.
@@ -376,7 +403,12 @@ def fix_lfs_video_files_tracking(work_dir: Path, lfs_untracked_videos: list[str]
     for i in range(0, len(lfs_untracked_videos), 100):
         files = lfs_untracked_videos[i : i + 100]
         try:
-            subprocess.run(["git", "rm", "--cached", *files], cwd=work_dir, capture_output=True, check=True)
+            subprocess.run(
+                ["git", "rm", "--cached", *files],
+                cwd=work_dir,
+                capture_output=True,
+                check=True,
+            )
         except subprocess.CalledProcessError as e:
             print("git rm --cached ERROR:")
             print(e.stderr)
@@ -387,10 +419,14 @@ def fix_lfs_video_files_tracking(work_dir: Path, lfs_untracked_videos: list[str]
     subprocess.run(["git", "push"], cwd=work_dir, check=True)
 
 
-def fix_gitattributes(work_dir: Path, current_gittatributes: Path, clean_gittatributes: Path) -> None:
+def fix_gitattributes(
+    work_dir: Path, current_gittatributes: Path, clean_gittatributes: Path
+) -> None:
     shutil.copyfile(clean_gittatributes, current_gittatributes)
     subprocess.run(["git", "add", ".gitattributes"], cwd=work_dir, check=True)
-    subprocess.run(["git", "commit", "-m", "Fix .gitattributes"], cwd=work_dir, check=True)
+    subprocess.run(
+        ["git", "commit", "-m", "Fix .gitattributes"], cwd=work_dir, check=True
+    )
     subprocess.run(["git", "push"], cwd=work_dir, check=True)
 
 
@@ -399,7 +435,17 @@ def _lfs_clone(repo_id: str, work_dir: Path, branch: str) -> None:
     repo_url = f"https://huggingface.co/datasets/{repo_id}"
     env = {"GIT_LFS_SKIP_SMUDGE": "1"}  # Prevent downloading LFS files
     subprocess.run(
-        ["git", "clone", "--branch", branch, "--single-branch", "--depth", "1", repo_url, str(work_dir)],
+        [
+            "git",
+            "clone",
+            "--branch",
+            branch,
+            "--single-branch",
+            "--depth",
+            "1",
+            repo_url,
+            str(work_dir),
+        ],
         check=True,
         env=env,
     )
@@ -407,13 +453,19 @@ def _lfs_clone(repo_id: str, work_dir: Path, branch: str) -> None:
 
 def _get_lfs_untracked_videos(work_dir: Path, video_files: list[str]) -> list[str]:
     lfs_tracked_files = subprocess.run(
-        ["git", "lfs", "ls-files", "-n"], cwd=work_dir, capture_output=True, text=True, check=True
+        ["git", "lfs", "ls-files", "-n"],
+        cwd=work_dir,
+        capture_output=True,
+        text=True,
+        check=True,
     )
     lfs_tracked_files = set(lfs_tracked_files.stdout.splitlines())
     return [f for f in video_files if f not in lfs_tracked_files]
 
 
-def get_videos_info(repo_id: str, local_dir: Path, video_keys: list[str], branch: str) -> dict:
+def get_videos_info(
+    repo_id: str, local_dir: Path, video_keys: list[str], branch: str
+) -> dict:
     # Assumes first episode
     video_files = [
         DEFAULT_VIDEO_PATH.format(episode_chunk=0, video_key=vid_key, episode_index=0)
@@ -421,7 +473,11 @@ def get_videos_info(repo_id: str, local_dir: Path, video_keys: list[str], branch
     ]
     hub_api = HfApi()
     hub_api.snapshot_download(
-        repo_id=repo_id, repo_type="dataset", local_dir=local_dir, revision=branch, allow_patterns=video_files
+        repo_id=repo_id,
+        repo_type="dataset",
+        local_dir=local_dir,
+        revision=branch,
+        allow_patterns=video_files,
     )
     videos_info_dict = {}
     for vid_key, vid_path in zip(video_keys, video_files, strict=True):
@@ -448,7 +504,11 @@ def convert_dataset(
 
     hub_api = HfApi()
     hub_api.snapshot_download(
-        repo_id=repo_id, repo_type="dataset", revision=v1, local_dir=v1x_dir, ignore_patterns="videos*/"
+        repo_id=repo_id,
+        repo_type="dataset",
+        revision=v1,
+        local_dir=v1x_dir,
+        ignore_patterns="videos*/",
     )
     branch = "main"
     if test_branch:
@@ -480,19 +540,31 @@ def convert_dataset(
     if single_task:
         tasks_by_episodes = {ep_idx: single_task for ep_idx in episode_indices}
         dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
-        tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
+        tasks_by_episodes = {
+            ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()
+        }
     elif tasks_path:
         tasks_by_episodes = load_json(tasks_path)
-        tasks_by_episodes = {int(ep_idx): task for ep_idx, task in tasks_by_episodes.items()}
+        tasks_by_episodes = {
+            int(ep_idx): task for ep_idx, task in tasks_by_episodes.items()
+        }
         dataset, tasks = add_task_index_by_episodes(dataset, tasks_by_episodes)
-        tasks_by_episodes = {ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()}
+        tasks_by_episodes = {
+            ep_idx: [task] for ep_idx, task in tasks_by_episodes.items()
+        }
     elif tasks_col:
-        dataset, tasks, tasks_by_episodes = add_task_index_from_tasks_col(dataset, tasks_col)
+        dataset, tasks, tasks_by_episodes = add_task_index_from_tasks_col(
+            dataset, tasks_col
+        )
     else:
         raise ValueError
 
-    assert set(tasks) == {task for ep_tasks in tasks_by_episodes.values() for task in ep_tasks}
-    tasks = [{"task_index": task_idx, "task": task} for task_idx, task in enumerate(tasks)]
+    assert set(tasks) == {
+        task for ep_tasks in tasks_by_episodes.values() for task in ep_tasks
+    }
+    tasks = [
+        {"task_index": task_idx, "task": task} for task_idx, task in enumerate(tasks)
+    ]
     write_jsonlines(tasks, v20_dir / TASKS_PATH)
     features["task_index"] = {
         "dtype": "int64",
@@ -506,14 +578,25 @@ def convert_dataset(
         dataset = dataset.remove_columns(video_keys)
         clean_gitattr = Path(
             hub_api.hf_hub_download(
-                repo_id=GITATTRIBUTES_REF, repo_type="dataset", local_dir=local_dir, filename=".gitattributes"
+                repo_id=GITATTRIBUTES_REF,
+                repo_type="dataset",
+                local_dir=local_dir,
+                filename=".gitattributes",
             )
         ).absolute()
         with tempfile.TemporaryDirectory() as tmp_video_dir:
             move_videos(
-                repo_id, video_keys, total_episodes, total_chunks, Path(tmp_video_dir), clean_gitattr, branch
+                repo_id,
+                video_keys,
+                total_episodes,
+                total_chunks,
+                Path(tmp_video_dir),
+                clean_gitattr,
+                branch,
             )
-        videos_info = get_videos_info(repo_id, v1x_dir, video_keys=video_keys, branch=branch)
+        videos_info = get_videos_info(
+            repo_id, v1x_dir, video_keys=video_keys, branch=branch
+        )
         for key in video_keys:
             features[key]["shape"] = (
                 videos_info[key].pop("video.height"),
@@ -521,15 +604,22 @@ def convert_dataset(
                 videos_info[key].pop("video.channels"),
             )
             features[key]["video_info"] = videos_info[key]
-            assert math.isclose(videos_info[key]["video.fps"], metadata_v1["fps"], rel_tol=1e-3)
+            assert math.isclose(
+                videos_info[key]["video.fps"], metadata_v1["fps"], rel_tol=1e-3
+            )
             if "encoding" in metadata_v1:
-                assert videos_info[key]["video.pix_fmt"] == metadata_v1["encoding"]["pix_fmt"]
+                assert (
+                    videos_info[key]["video.pix_fmt"]
+                    == metadata_v1["encoding"]["pix_fmt"]
+                )
     else:
         assert metadata_v1.get("video", 0) == 0
         videos_info = None
 
     # Split data into 1 parquet file by episode
-    episode_lengths = split_parquet_by_episodes(dataset, total_episodes, total_chunks, v20_dir)
+    episode_lengths = split_parquet_by_episodes(
+        dataset, total_episodes, total_chunks, v20_dir
+    )
 
     if robot_config is not None:
         robot_type = robot_config["robot_type"]
@@ -540,7 +630,11 @@ def convert_dataset(
 
     # Episodes
     episodes = [
-        {"episode_index": ep_idx, "tasks": tasks_by_episodes[ep_idx], "length": episode_lengths[ep_idx]}
+        {
+            "episode_index": ep_idx,
+            "tasks": tasks_by_episodes[ep_idx],
+            "length": episode_lengths[ep_idx],
+        }
         for ep_idx in episode_indices
     ]
     write_jsonlines(episodes, v20_dir / EPISODES_PATH)
@@ -563,16 +657,27 @@ def convert_dataset(
     }
     write_json(metadata_v2_0, v20_dir / INFO_PATH)
     convert_stats_to_json(v1x_dir, v20_dir)
-    card = create_lerobot_dataset_card(tags=repo_tags, dataset_info=metadata_v2_0, **card_kwargs)
+    card = create_lerobot_dataset_card(
+        tags=repo_tags, dataset_info=metadata_v2_0, **card_kwargs
+    )
 
     with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
-        hub_api.delete_folder(repo_id=repo_id, path_in_repo="data", repo_type="dataset", revision=branch)
+        hub_api.delete_folder(
+            repo_id=repo_id, path_in_repo="data", repo_type="dataset", revision=branch
+        )
 
     with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
-        hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta_data", repo_type="dataset", revision=branch)
+        hub_api.delete_folder(
+            repo_id=repo_id,
+            path_in_repo="meta_data",
+            repo_type="dataset",
+            revision=branch,
+        )
 
     with contextlib.suppress(EntryNotFoundError, HfHubHTTPError):
-        hub_api.delete_folder(repo_id=repo_id, path_in_repo="meta", repo_type="dataset", revision=branch)
+        hub_api.delete_folder(
+            repo_id=repo_id, path_in_repo="meta", repo_type="dataset", revision=branch
+        )
 
     hub_api.upload_folder(
         repo_id=repo_id,
@@ -655,7 +760,11 @@ def main():
     if not args.local_dir:
         args.local_dir = Path("/tmp/lerobot_dataset_v2")
 
-    robot_config = parse_robot_config(args.robot_config, args.robot_overrides) if args.robot_config else None
+    robot_config = (
+        parse_robot_config(args.robot_config, args.robot_overrides)
+        if args.robot_config
+        else None
+    )
     del args.robot_config, args.robot_overrides
 
     convert_dataset(**vars(args), robot_config=robot_config)

lerobot/common/datasets/video_utils.py

@@ -227,7 +227,9 @@ def get_audio_info(video_path: Path | str) -> dict:
         "json",
         str(video_path),
     ]
-    result = subprocess.run(ffprobe_audio_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True)
+    result = subprocess.run(
+        ffprobe_audio_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True
+    )
     if result.returncode != 0:
         raise RuntimeError(f"Error running ffprobe: {result.stderr}")
 
@@ -241,7 +243,9 @@ def get_audio_info(video_path: Path | str) -> dict:
         "has_audio": True,
         "audio.channels": audio_stream_info.get("channels", None),
         "audio.codec": audio_stream_info.get("codec_name", None),
-        "audio.bit_rate": int(audio_stream_info["bit_rate"]) if audio_stream_info.get("bit_rate") else None,
+        "audio.bit_rate": int(audio_stream_info["bit_rate"])
+        if audio_stream_info.get("bit_rate")
+        else None,
         "audio.sample_rate": int(audio_stream_info["sample_rate"])
         if audio_stream_info.get("sample_rate")
         else None,
@@ -263,7 +267,9 @@ def get_video_info(video_path: Path | str) -> dict:
         "json",
         str(video_path),
     ]
-    result = subprocess.run(ffprobe_video_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True)
+    result = subprocess.run(
+        ffprobe_video_cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, text=True
+    )
     if result.returncode != 0:
         raise RuntimeError(f"Error running ffprobe: {result.stderr}")
 

lerobot/common/envs/factory.py

@@ -14,9 +14,13 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 import importlib
+from collections import deque
 
 import gymnasium as gym
+import numpy as np
+import torch
 from omegaconf import DictConfig
+# from mani_skill.utils import common
 
 
 def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv | None:
@@ -30,6 +34,12 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
     if cfg.env.name == "real_world":
         return
 
+    if "maniskill" in cfg.env.name:
+        env = make_maniskill_env(
+            cfg, n_envs if n_envs is not None else cfg.eval.batch_size
+        )
+        return env
+
     package_name = f"gym_{cfg.env.name}"
 
     try:
@@ -47,7 +57,11 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
         gym_kwgs["max_episode_steps"] = cfg.env.episode_length
 
     # batched version of the env that returns an observation of shape (b, c)
-    env_cls = gym.vector.AsyncVectorEnv if cfg.eval.use_async_envs else gym.vector.SyncVectorEnv
+    env_cls = (
+        gym.vector.AsyncVectorEnv
+        if cfg.eval.use_async_envs
+        else gym.vector.SyncVectorEnv
+    )
     env = env_cls(
         [
             lambda: gym.make(gym_handle, disable_env_checker=True, **gym_kwgs)
@@ -56,3 +70,99 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
     )
 
     return env
+
+
+def make_maniskill_env(
+    cfg: DictConfig, n_envs: int | None = None
+) -> gym.vector.VectorEnv | None:
+    """Make ManiSkill3 gym environment"""
+    from mani_skill.vector.wrappers.gymnasium import ManiSkillVectorEnv
+
+    env = gym.make(
+        cfg.env.task,
+        obs_mode=cfg.env.obs,
+        control_mode=cfg.env.control_mode,
+        render_mode=cfg.env.render_mode,
+        sensor_configs=dict(width=cfg.env.image_size, height=cfg.env.image_size),
+        num_envs=n_envs,
+    )
+    # cfg.env_cfg.control_mode = cfg.eval_env_cfg.control_mode = env.control_mode
+    env = ManiSkillVectorEnv(env, ignore_terminations=True)
+    # state should have the size of 25
+    # env = ConvertToLeRobotEnv(env, n_envs)
+    # env = PixelWrapper(cfg, env, n_envs)
+    env._max_episode_steps = env.max_episode_steps = (
+        50  # gym_utils.find_max_episode_steps_value(env)
+    )
+    env.unwrapped.metadata["render_fps"] = 20
+
+    return env
+
+
+class PixelWrapper(gym.Wrapper):
+    """
+    Wrapper for pixel observations. Works with Maniskill vectorized environments
+    """
+
+    def __init__(self, cfg, env, num_envs, num_frames=3):
+        super().__init__(env)
+        self.cfg = cfg
+        self.env = env
+        self.observation_space = gym.spaces.Box(
+            low=0,
+            high=255,
+            shape=(num_envs, num_frames * 3, cfg.env.render_size, cfg.env.render_size),
+            dtype=np.uint8,
+        )
+        self._frames = deque([], maxlen=num_frames)
+        self._render_size = cfg.env.render_size
+
+    def _get_obs(self, obs):
+        frame = obs["sensor_data"]["base_camera"]["rgb"].cpu().permute(0, 3, 1, 2)
+        self._frames.append(frame)
+        return {
+            "pixels": torch.from_numpy(np.concatenate(self._frames, axis=1)).to(
+                self.env.device
+            )
+        }
+
+    def reset(self, seed):
+        obs, info = self.env.reset()  # (seed=seed)
+        for _ in range(self._frames.maxlen):
+            obs_frames = self._get_obs(obs)
+        return obs_frames, info
+
+    def step(self, action):
+        obs, reward, terminated, truncated, info = self.env.step(action)
+        return self._get_obs(obs), reward, terminated, truncated, info
+
+
+# TODO: Remove this
+class ConvertToLeRobotEnv(gym.Wrapper):
+    def __init__(self, env, num_envs):
+        super().__init__(env)
+
+    def reset(self, seed=None, options=None):
+        obs, info = self.env.reset(seed=seed, options={})
+        return self._get_obs(obs), info
+
+    def step(self, action):
+        obs, reward, terminated, truncated, info = self.env.step(action)
+        return self._get_obs(obs), reward, terminated, truncated, info
+
+    def _get_obs(self, observation):
+        sensor_data = observation.pop("sensor_data")
+        del observation["sensor_param"]
+        images = []
+        for cam_data in sensor_data.values():
+            images.append(cam_data["rgb"])
+
+        images = torch.concat(images, axis=-1)
+        # flatten the rest of the data which should just be state data
+        observation = common.flatten_state_dict(
+            observation, use_torch=True, device=self.base_env.device
+        )
+        ret = dict()
+        ret["state"] = observation
+        ret["pixels"] = images
+        return ret

lerobot/common/envs/utils.py

@@ -28,28 +28,32 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
     """
     # map to expected inputs for the policy
     return_observations = {}
-    if "pixels" in observations:
-        if isinstance(observations["pixels"], dict):
-            imgs = {f"observation.images.{key}": img for key, img in observations["pixels"].items()}
-        else:
-            imgs = {"observation.image": observations["pixels"]}
+    # TODO: You have to merge all tensors from agent key and extra key
+    # You don't keep sensor param key in the observation
+    # And you keep sensor data rgb
+    for key, img in observations.items():
+        if "images" not in key:
+            continue
 
-        for imgkey, img in imgs.items():
-            img = torch.from_numpy(img)
+        if img.ndim == 3:
+            img = img.unsqueeze(0)
+        # sanity check that images are channel last
+        _, h, w, c = img.shape
+        assert (
+            c < h and c < w
+        ), f"expect channel last images, but instead got {img.shape=}"
 
-            # sanity check that images are channel last
-            _, h, w, c = img.shape
-            assert c < h and c < w, f"expect channel last images, but instead got {img.shape=}"
+        # sanity check that images are uint8
+        assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
 
-            # sanity check that images are uint8
-            assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
+        # convert to channel first of type float32 in range [0,1]
+        img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
+        img = img.type(torch.float32)
+        img /= 255
 
-            # convert to channel first of type float32 in range [0,1]
-            img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
-            img = img.type(torch.float32)
-            img /= 255
-
-            return_observations[imgkey] = img
+        return_observations[key] = img
+        # obs state agent qpos and qvel
+        # image
 
     if "environment_state" in observations:
         return_observations["observation.environment_state"] = torch.from_numpy(
@@ -58,5 +62,43 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
 
     # TODO(rcadene): enable pixels only baseline with `obs_type="pixels"` in environment by removing
     # requirement for "agent_pos"
-    return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
+    # return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
+    return_observations["observation.state"] = observations["observation.state"].float()
+    return return_observations
+
+
+def preprocess_maniskill_observation(
+    observations: dict[str, np.ndarray],
+) -> dict[str, Tensor]:
+    """Convert environment observation to LeRobot format observation.
+    Args:
+        observation: Dictionary of observation batches from a Gym vector environment.
+    Returns:
+        Dictionary of observation batches with keys renamed to LeRobot format and values as tensors.
+    """
+    # map to expected inputs for the policy
+    return_observations = {}
+    # TODO: You have to merge all tensors from agent key and extra key
+    # You don't keep sensor param key in the observation
+    # And you keep sensor data rgb
+    q_pos = observations["agent"]["qpos"]
+    q_vel = observations["agent"]["qvel"]
+    tcp_pos = observations["extra"]["tcp_pose"]
+    img = observations["sensor_data"]["base_camera"]["rgb"]
+
+    _, h, w, c = img.shape
+    assert c < h and c < w, f"expect channel last images, but instead got {img.shape=}"
+
+    # sanity check that images are uint8
+    assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
+
+    # convert to channel first of type float32 in range [0,1]
+    img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
+    img = img.type(torch.float32)
+    img /= 255
+
+    state = torch.cat([q_pos, q_vel, tcp_pos], dim=-1)
+
+    return_observations["observation.image"] = img
+    return_observations["observation.state"] = state
     return return_observations

lerobot/common/logger.py

@@ -25,6 +25,7 @@ from glob import glob
 from pathlib import Path
 
 import torch
+import wandb
 from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE
 from omegaconf import DictConfig, OmegaConf
 from termcolor import colored
@@ -83,7 +84,9 @@ class Logger:
     pretrained_model_dir_name = "pretrained_model"
     training_state_file_name = "training_state.pth"
 
-    def __init__(self, cfg: DictConfig, log_dir: str, wandb_job_name: str | None = None):
+    def __init__(
+        self, cfg: DictConfig, log_dir: str, wandb_job_name: str | None = None
+    ):
         """
         Args:
             log_dir: The directory to save all logs and training outputs to.
@@ -103,12 +106,12 @@ class Logger:
         enable_wandb = cfg.get("wandb", {}).get("enable", False)
         run_offline = not enable_wandb or not project
         if run_offline:
-            logging.info(colored("Logs will be saved locally.", "yellow", attrs=["bold"]))
+            logging.info(
+                colored("Logs will be saved locally.", "yellow", attrs=["bold"])
+            )
             self._wandb = None
         else:
             os.environ["WANDB_SILENT"] = "true"
-            import wandb
-
             wandb_run_id = None
             if cfg.resume:
                 wandb_run_id = get_wandb_run_id_from_filesystem(self.checkpoints_dir)
@@ -128,8 +131,12 @@ class Logger:
                 job_type="train_eval",
                 resume="must" if cfg.resume else None,
             )
+            # Handle custom step key for rl asynchronous training.
+            self._wandb_custom_step_key: set[str] | None = None
             print(colored("Logs will be synced with wandb.", "blue", attrs=["bold"]))
-            logging.info(f"Track this run --> {colored(wandb.run.get_url(), 'yellow', attrs=['bold'])}")
+            logging.info(
+                f"Track this run --> {colored(wandb.run.get_url(), 'yellow', attrs=['bold'])}"
+            )
             self._wandb = wandb
 
     @classmethod
@@ -150,7 +157,9 @@ class Logger:
         """
         return cls.get_last_checkpoint_dir(log_dir) / cls.pretrained_model_dir_name
 
-    def save_model(self, save_dir: Path, policy: Policy, wandb_artifact_name: str | None = None):
+    def save_model(
+        self, save_dir: Path, policy: Policy, wandb_artifact_name: str | None = None
+    ):
         """Save the weights of the Policy model using PyTorchModelHubMixin.
 
         The weights are saved in a folder called "pretrained_model" under the checkpoint directory.
@@ -173,18 +182,32 @@ class Logger:
         self,
         save_dir: Path,
         train_step: int,
-        optimizer: Optimizer,
+        optimizer: Optimizer | dict,
         scheduler: LRScheduler | None,
+        interaction_step: int | None = None,
     ):
         """Checkpoint the global training_step, optimizer state, scheduler state, and random state.
 
         All of these are saved as "training_state.pth" under the checkpoint directory.
         """
+        # In Sac, for example, we have a dictionary of torch.optim.Optimizer
+        if type(optimizer) is dict:
+            optimizer_state_dict = {}
+            for k in optimizer:
+                optimizer_state_dict[k] = optimizer[k].state_dict()
+        else:
+            optimizer_state_dict = optimizer.state_dict()
+
         training_state = {
             "step": train_step,
-            "optimizer": optimizer.state_dict(),
+            "optimizer": optimizer_state_dict,
             **get_global_random_state(),
         }
+        # Interaction step is related to the distributed training code
+        # In that setup, we have two kinds of steps, the online step of the env and the optimization step
+        # We need to save both in order to resume the optimization properly and not break the logs dependant on the interaction step
+        if interaction_step is not None:
+            training_state["interaction_step"] = interaction_step
         if scheduler is not None:
             training_state["scheduler"] = scheduler.state_dict()
         torch.save(training_state, save_dir / self.training_state_file_name)
@@ -196,6 +219,7 @@ class Logger:
         optimizer: Optimizer,
         scheduler: LRScheduler | None,
         identifier: str,
+        interaction_step: int | None = None,
     ):
         """Checkpoint the model weights and the training state."""
         checkpoint_dir = self.checkpoints_dir / str(identifier)
@@ -205,18 +229,34 @@ class Logger:
             else f"{self._group.replace(':', '_').replace('/', '_')}-{self._cfg.seed}-{identifier}"
         )
         self.save_model(
-            checkpoint_dir / self.pretrained_model_dir_name, policy, wandb_artifact_name=wandb_artifact_name
+            checkpoint_dir / self.pretrained_model_dir_name,
+            policy,
+            wandb_artifact_name=wandb_artifact_name,
+        )
+        self.save_training_state(
+            checkpoint_dir, train_step, optimizer, scheduler, interaction_step
         )
-        self.save_training_state(checkpoint_dir, train_step, optimizer, scheduler)
         os.symlink(checkpoint_dir.absolute(), self.last_checkpoint_dir)
 
-    def load_last_training_state(self, optimizer: Optimizer, scheduler: LRScheduler | None) -> int:
+    def load_last_training_state(
+        self, optimizer: Optimizer | dict, scheduler: LRScheduler | None
+    ) -> int:
         """
         Given the last checkpoint in the logging directory, load the optimizer state, scheduler state, and
         random state, and return the global training step.
         """
-        training_state = torch.load(self.last_checkpoint_dir / self.training_state_file_name)
-        optimizer.load_state_dict(training_state["optimizer"])
+        training_state = torch.load(
+            self.last_checkpoint_dir / self.training_state_file_name
+        )
+        # For the case where the optimizer is a dictionary of optimizers (e.g., sac)
+        if type(training_state["optimizer"]) is dict:
+            assert set(training_state["optimizer"].keys()) == set(
+                optimizer.keys()
+            ), "Optimizer dictionaries do not have the same keys during resume!"
+            for k, v in training_state["optimizer"].items():
+                optimizer[k].load_state_dict(v)
+        else:
+            optimizer.load_state_dict(training_state["optimizer"])
         if scheduler is not None:
             scheduler.load_state_dict(training_state["scheduler"])
         elif "scheduler" in training_state:
@@ -224,20 +264,63 @@ class Logger:
                 "The checkpoint contains a scheduler state_dict, but no LRScheduler was provided."
             )
         # Small hack to get the expected keys: use `get_global_random_state`.
-        set_global_random_state({k: training_state[k] for k in get_global_random_state()})
+        set_global_random_state(
+            {k: training_state[k] for k in get_global_random_state()}
+        )
         return training_state["step"]
 
-    def log_dict(self, d, step, mode="train"):
+    def log_dict(
+        self,
+        d,
+        step: int | None = None,
+        mode="train",
+        custom_step_key: str | None = None,
+    ):
+        """Log a dictionary of metrics to WandB."""
         assert mode in {"train", "eval"}
         # TODO(alexander-soare): Add local text log.
+        if step is None and custom_step_key is None:
+            raise ValueError("Either step or custom_step_key must be provided.")
+
         if self._wandb is not None:
+            # NOTE: This is not simple. Wandb step is it must always monotonically increase and it
+            # increases with each wandb.log call, but in the case of asynchronous RL for example,
+            # multiple time steps is possible for example, the interaction step with the environment,
+            # the training step, the evaluation step, etc. So we need to define a custom step key
+            # to log the correct step for each metric.
+            if custom_step_key is not None:
+                if self._wandb_custom_step_key is None:
+                    self._wandb_custom_step_key = set()
+                new_custom_key = f"{mode}/{custom_step_key}"
+                if new_custom_key not in self._wandb_custom_step_key:
+                    self._wandb_custom_step_key.add(new_custom_key)
+                    self._wandb.define_metric(new_custom_key, hidden=True)
+
             for k, v in d.items():
-                if not isinstance(v, (int, float, str)):
+                if not isinstance(v, (int, float, str, wandb.Table)):
                     logging.warning(
                         f'WandB logging of key "{k}" was ignored as its type is not handled by this wrapper.'
                     )
                     continue
-                self._wandb.log({f"{mode}/{k}": v}, step=step)
+
+                # Do not log the custom step key itself.
+                if (
+                    self._wandb_custom_step_key is not None
+                    and k in self._wandb_custom_step_key
+                ):
+                    continue
+
+                if custom_step_key is not None:
+                    value_custom_step = d[custom_step_key]
+                    self._wandb.log(
+                        {
+                            f"{mode}/{k}": v,
+                            f"{mode}/{custom_step_key}": value_custom_step,
+                        }
+                    )
+                    continue
+
+                self._wandb.log(data={f"{mode}/{k}": v}, step=step)
 
     def log_video(self, video_path: str, step: int, mode: str = "train"):
         assert mode in {"train", "eval"}

lerobot/common/policies/act/configuration_act.py

@@ -168,4 +168,6 @@ class ACTConfig:
             not any(k.startswith("observation.image") for k in self.input_shapes)
             and "observation.environment_state" not in self.input_shapes
         ):
-            raise ValueError("You must provide at least one image or the environment state among the inputs.")
+            raise ValueError(
+                "You must provide at least one image or the environment state among the inputs."
+            )

lerobot/common/policies/act/modeling_act.py

@@ -81,10 +81,14 @@ class ACTPolicy(
 
         self.model = ACT(config)
 
-        self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
+        self.expected_image_keys = [
+            k for k in config.input_shapes if k.startswith("observation.image")
+        ]
 
         if config.temporal_ensemble_coeff is not None:
-            self.temporal_ensembler = ACTTemporalEnsembler(config.temporal_ensemble_coeff, config.chunk_size)
+            self.temporal_ensembler = ACTTemporalEnsembler(
+                config.temporal_ensemble_coeff, config.chunk_size
+            )
 
         self.reset()
 
@@ -107,8 +111,12 @@ class ACTPolicy(
 
         batch = self.normalize_inputs(batch)
         if len(self.expected_image_keys) > 0:
-            batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
-            batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
+            batch = dict(
+                batch
+            )  # shallow copy so that adding a key doesn't modify the original
+            batch["observation.images"] = torch.stack(
+                [batch[k] for k in self.expected_image_keys], dim=-4
+            )
 
         # If we are doing temporal ensembling, do online updates where we keep track of the number of actions
         # we are ensembling over.
@@ -135,13 +143,18 @@ class ACTPolicy(
         """Run the batch through the model and compute the loss for training or validation."""
         batch = self.normalize_inputs(batch)
         if len(self.expected_image_keys) > 0:
-            batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
-            batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
+            batch = dict(
+                batch
+            )  # shallow copy so that adding a key doesn't modify the original
+            batch["observation.images"] = torch.stack(
+                [batch[k] for k in self.expected_image_keys], dim=-4
+            )
         batch = self.normalize_targets(batch)
         actions_hat, (mu_hat, log_sigma_x2_hat) = self.model(batch)
 
         l1_loss = (
-            F.l1_loss(batch["action"], actions_hat, reduction="none") * ~batch["action_is_pad"].unsqueeze(-1)
+            F.l1_loss(batch["action"], actions_hat, reduction="none")
+            * ~batch["action_is_pad"].unsqueeze(-1)
         ).mean()
 
         loss_dict = {"l1_loss": l1_loss.item()}
@@ -151,7 +164,12 @@ class ACTPolicy(
             # KL-divergence per batch element, then take the mean over the batch.
             # (See App. B of https://arxiv.org/abs/1312.6114 for more details).
             mean_kld = (
-                (-0.5 * (1 + log_sigma_x2_hat - mu_hat.pow(2) - (log_sigma_x2_hat).exp())).sum(-1).mean()
+                (
+                    -0.5
+                    * (1 + log_sigma_x2_hat - mu_hat.pow(2) - (log_sigma_x2_hat).exp())
+                )
+                .sum(-1)
+                .mean()
             )
             loss_dict["kld_loss"] = mean_kld.item()
             loss_dict["loss"] = l1_loss + mean_kld * self.config.kl_weight
@@ -205,7 +223,9 @@ class ACTTemporalEnsembler:
         ```
         """
         self.chunk_size = chunk_size
-        self.ensemble_weights = torch.exp(-temporal_ensemble_coeff * torch.arange(chunk_size))
+        self.ensemble_weights = torch.exp(
+            -temporal_ensemble_coeff * torch.arange(chunk_size)
+        )
         self.ensemble_weights_cumsum = torch.cumsum(self.ensemble_weights, dim=0)
         self.reset()
 
@@ -221,7 +241,9 @@ class ACTTemporalEnsembler:
         time steps, and pop/return the next batch of actions in the sequence.
         """
         self.ensemble_weights = self.ensemble_weights.to(device=actions.device)
-        self.ensemble_weights_cumsum = self.ensemble_weights_cumsum.to(device=actions.device)
+        self.ensemble_weights_cumsum = self.ensemble_weights_cumsum.to(
+            device=actions.device
+        )
         if self.ensembled_actions is None:
             # Initializes `self._ensembled_action` to the sequence of actions predicted during the first
             # time step of the episode.
@@ -229,19 +251,34 @@ class ACTTemporalEnsembler:
             # Note: The last dimension is unsqueeze to make sure we can broadcast properly for tensor
             # operations later.
             self.ensembled_actions_count = torch.ones(
-                (self.chunk_size, 1), dtype=torch.long, device=self.ensembled_actions.device
+                (self.chunk_size, 1),
+                dtype=torch.long,
+                device=self.ensembled_actions.device,
             )
         else:
             # self.ensembled_actions will have shape (batch_size, chunk_size - 1, action_dim). Compute
             # the online update for those entries.
-            self.ensembled_actions *= self.ensemble_weights_cumsum[self.ensembled_actions_count - 1]
-            self.ensembled_actions += actions[:, :-1] * self.ensemble_weights[self.ensembled_actions_count]
-            self.ensembled_actions /= self.ensemble_weights_cumsum[self.ensembled_actions_count]
-            self.ensembled_actions_count = torch.clamp(self.ensembled_actions_count + 1, max=self.chunk_size)
+            self.ensembled_actions *= self.ensemble_weights_cumsum[
+                self.ensembled_actions_count - 1
+            ]
+            self.ensembled_actions += (
+                actions[:, :-1] * self.ensemble_weights[self.ensembled_actions_count]
+            )
+            self.ensembled_actions /= self.ensemble_weights_cumsum[
+                self.ensembled_actions_count
+            ]
+            self.ensembled_actions_count = torch.clamp(
+                self.ensembled_actions_count + 1, max=self.chunk_size
+            )
             # The last action, which has no prior online average, needs to get concatenated onto the end.
-            self.ensembled_actions = torch.cat([self.ensembled_actions, actions[:, -1:]], dim=1)
+            self.ensembled_actions = torch.cat(
+                [self.ensembled_actions, actions[:, -1:]], dim=1
+            )
             self.ensembled_actions_count = torch.cat(
-                [self.ensembled_actions_count, torch.ones_like(self.ensembled_actions_count[-1:])]
+                [
+                    self.ensembled_actions_count,
+                    torch.ones_like(self.ensembled_actions_count[-1:]),
+                ]
             )
         # "Consume" the first action.
         action, self.ensembled_actions, self.ensembled_actions_count = (
@@ -293,7 +330,9 @@ class ACT(nn.Module):
         # BERT style VAE encoder with input tokens [cls, robot_state, *action_sequence].
         # The cls token forms parameters of the latent's distribution (like this [*means, *log_variances]).
         self.use_robot_state = "observation.state" in config.input_shapes
-        self.use_images = any(k.startswith("observation.image") for k in config.input_shapes)
+        self.use_images = any(
+            k.startswith("observation.image") for k in config.input_shapes
+        )
         self.use_env_state = "observation.environment_state" in config.input_shapes
         if self.config.use_vae:
             self.vae_encoder = ACTEncoder(config, is_vae_encoder=True)
@@ -308,7 +347,9 @@ class ACT(nn.Module):
                 config.output_shapes["action"][0], config.dim_model
             )
             # Projection layer from the VAE encoder's output to the latent distribution's parameter space.
-            self.vae_encoder_latent_output_proj = nn.Linear(config.dim_model, config.latent_dim * 2)
+            self.vae_encoder_latent_output_proj = nn.Linear(
+                config.dim_model, config.latent_dim * 2
+            )
             # Fixed sinusoidal positional embedding for the input to the VAE encoder. Unsqueeze for batch
             # dimension.
             num_input_token_encoder = 1 + config.chunk_size
@@ -316,20 +357,28 @@ class ACT(nn.Module):
                 num_input_token_encoder += 1
             self.register_buffer(
                 "vae_encoder_pos_enc",
-                create_sinusoidal_pos_embedding(num_input_token_encoder, config.dim_model).unsqueeze(0),
+                create_sinusoidal_pos_embedding(
+                    num_input_token_encoder, config.dim_model
+                ).unsqueeze(0),
             )
 
         # Backbone for image feature extraction.
         if self.use_images:
             backbone_model = getattr(torchvision.models, config.vision_backbone)(
-                replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
+                replace_stride_with_dilation=[
+                    False,
+                    False,
+                    config.replace_final_stride_with_dilation,
+                ],
                 weights=config.pretrained_backbone_weights,
                 norm_layer=FrozenBatchNorm2d,
             )
             # Note: The assumption here is that we are using a ResNet model (and hence layer4 is the final
             # feature map).
             # Note: The forward method of this returns a dict: {"feature_map": output}.
-            self.backbone = IntermediateLayerGetter(backbone_model, return_layers={"layer4": "feature_map"})
+            self.backbone = IntermediateLayerGetter(
+                backbone_model, return_layers={"layer4": "feature_map"}
+            )
 
         # Transformer (acts as VAE decoder when training with the variational objective).
         self.encoder = ACTEncoder(config)
@@ -343,7 +392,8 @@ class ACT(nn.Module):
             )
         if self.use_env_state:
             self.encoder_env_state_input_proj = nn.Linear(
-                config.input_shapes["observation.environment_state"][0], config.dim_model
+                config.input_shapes["observation.environment_state"][0],
+                config.dim_model,
             )
         self.encoder_latent_input_proj = nn.Linear(config.latent_dim, config.dim_model)
         if self.use_images:
@@ -358,14 +408,18 @@ class ACT(nn.Module):
             n_1d_tokens += 1
         self.encoder_1d_feature_pos_embed = nn.Embedding(n_1d_tokens, config.dim_model)
         if self.use_images:
-            self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(config.dim_model // 2)
+            self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(
+                config.dim_model // 2
+            )
 
         # Transformer decoder.
         # Learnable positional embedding for the transformer's decoder (in the style of DETR object queries).
         self.decoder_pos_embed = nn.Embedding(config.chunk_size, config.dim_model)
 
         # Final action regression head on the output of the transformer's decoder.
-        self.action_head = nn.Linear(config.dim_model, config.output_shapes["action"][0])
+        self.action_head = nn.Linear(
+            config.dim_model, config.output_shapes["action"][0]
+        )
 
         self._reset_parameters()
 
@@ -375,7 +429,9 @@ class ACT(nn.Module):
             if p.dim() > 1:
                 nn.init.xavier_uniform_(p)
 
-    def forward(self, batch: dict[str, Tensor]) -> tuple[Tensor, tuple[Tensor, Tensor] | tuple[None, None]]:
+    def forward(
+        self, batch: dict[str, Tensor]
+    ) -> tuple[Tensor, tuple[Tensor, Tensor] | tuple[None, None]]:
         """A forward pass through the Action Chunking Transformer (with optional VAE encoder).
 
         `batch` should have the following structure:
@@ -412,12 +468,20 @@ class ACT(nn.Module):
                 self.vae_encoder_cls_embed.weight, "1 d -> b 1 d", b=batch_size
             )  # (B, 1, D)
             if self.use_robot_state:
-                robot_state_embed = self.vae_encoder_robot_state_input_proj(batch["observation.state"])
+                robot_state_embed = self.vae_encoder_robot_state_input_proj(
+                    batch["observation.state"]
+                )
                 robot_state_embed = robot_state_embed.unsqueeze(1)  # (B, 1, D)
-            action_embed = self.vae_encoder_action_input_proj(batch["action"])  # (B, S, D)
+            action_embed = self.vae_encoder_action_input_proj(
+                batch["action"]
+            )  # (B, S, D)
 
             if self.use_robot_state:
-                vae_encoder_input = [cls_embed, robot_state_embed, action_embed]  # (B, S+2, D)
+                vae_encoder_input = [
+                    cls_embed,
+                    robot_state_embed,
+                    action_embed,
+                ]  # (B, S+2, D)
             else:
                 vae_encoder_input = [cls_embed, action_embed]
             vae_encoder_input = torch.cat(vae_encoder_input, axis=1)
@@ -455,20 +519,26 @@ class ACT(nn.Module):
             # When not using the VAE encoder, we set the latent to be all zeros.
             mu = log_sigma_x2 = None
             # TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use buffer
-            latent_sample = torch.zeros([batch_size, self.config.latent_dim], dtype=torch.float32).to(
-                batch["observation.state"].device
-            )
+            latent_sample = torch.zeros(
+                [batch_size, self.config.latent_dim], dtype=torch.float32
+            ).to(batch["observation.state"].device)
 
         # Prepare transformer encoder inputs.
         encoder_in_tokens = [self.encoder_latent_input_proj(latent_sample)]
-        encoder_in_pos_embed = list(self.encoder_1d_feature_pos_embed.weight.unsqueeze(1))
+        encoder_in_pos_embed = list(
+            self.encoder_1d_feature_pos_embed.weight.unsqueeze(1)
+        )
         # Robot state token.
         if self.use_robot_state:
-            encoder_in_tokens.append(self.encoder_robot_state_input_proj(batch["observation.state"]))
+            encoder_in_tokens.append(
+                self.encoder_robot_state_input_proj(batch["observation.state"])
+            )
         # Environment state token.
         if self.use_env_state:
             encoder_in_tokens.append(
-                self.encoder_env_state_input_proj(batch["observation.environment_state"])
+                self.encoder_env_state_input_proj(
+                    batch["observation.environment_state"]
+                )
             )
 
         # Camera observation features and positional embeddings.
@@ -477,19 +547,29 @@ class ACT(nn.Module):
             all_cam_pos_embeds = []
 
             for cam_index in range(batch["observation.images"].shape[-4]):
-                cam_features = self.backbone(batch["observation.images"][:, cam_index])["feature_map"]
+                cam_features = self.backbone(batch["observation.images"][:, cam_index])[
+                    "feature_map"
+                ]
                 # TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use
                 # buffer
-                cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(dtype=cam_features.dtype)
-                cam_features = self.encoder_img_feat_input_proj(cam_features)  # (B, C, h, w)
+                cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(
+                    dtype=cam_features.dtype
+                )
+                cam_features = self.encoder_img_feat_input_proj(
+                    cam_features
+                )  # (B, C, h, w)
                 all_cam_features.append(cam_features)
                 all_cam_pos_embeds.append(cam_pos_embed)
             # Concatenate camera observation feature maps and positional embeddings along the width dimension,
             # and move to (sequence, batch, dim).
             all_cam_features = torch.cat(all_cam_features, axis=-1)
-            encoder_in_tokens.extend(einops.rearrange(all_cam_features, "b c h w -> (h w) b c"))
+            encoder_in_tokens.extend(
+                einops.rearrange(all_cam_features, "b c h w -> (h w) b c")
+            )
             all_cam_pos_embeds = torch.cat(all_cam_pos_embeds, axis=-1)
-            encoder_in_pos_embed.extend(einops.rearrange(all_cam_pos_embeds, "b c h w -> (h w) b c"))
+            encoder_in_pos_embed.extend(
+                einops.rearrange(all_cam_pos_embeds, "b c h w -> (h w) b c")
+            )
 
         # Stack all tokens along the sequence dimension.
         encoder_in_tokens = torch.stack(encoder_in_tokens, axis=0)
@@ -524,12 +604,21 @@ class ACTEncoder(nn.Module):
     def __init__(self, config: ACTConfig, is_vae_encoder: bool = False):
         super().__init__()
         self.is_vae_encoder = is_vae_encoder
-        num_layers = config.n_vae_encoder_layers if self.is_vae_encoder else config.n_encoder_layers
-        self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(num_layers)])
+        num_layers = (
+            config.n_vae_encoder_layers
+            if self.is_vae_encoder
+            else config.n_encoder_layers
+        )
+        self.layers = nn.ModuleList(
+            [ACTEncoderLayer(config) for _ in range(num_layers)]
+        )
         self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
 
     def forward(
-        self, x: Tensor, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None
+        self,
+        x: Tensor,
+        pos_embed: Tensor | None = None,
+        key_padding_mask: Tensor | None = None,
     ) -> Tensor:
         for layer in self.layers:
             x = layer(x, pos_embed=pos_embed, key_padding_mask=key_padding_mask)
@@ -540,7 +629,9 @@ class ACTEncoder(nn.Module):
 class ACTEncoderLayer(nn.Module):
     def __init__(self, config: ACTConfig):
         super().__init__()
-        self.self_attn = nn.MultiheadAttention(config.dim_model, config.n_heads, dropout=config.dropout)
+        self.self_attn = nn.MultiheadAttention(
+            config.dim_model, config.n_heads, dropout=config.dropout
+        )
 
         # Feed forward layers.
         self.linear1 = nn.Linear(config.dim_model, config.dim_feedforward)
@@ -555,7 +646,9 @@ class ACTEncoderLayer(nn.Module):
         self.activation = get_activation_fn(config.feedforward_activation)
         self.pre_norm = config.pre_norm
 
-    def forward(self, x, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None) -> Tensor:
+    def forward(
+        self, x, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None
+    ) -> Tensor:
         skip = x
         if self.pre_norm:
             x = self.norm1(x)
@@ -580,7 +673,9 @@ class ACTDecoder(nn.Module):
     def __init__(self, config: ACTConfig):
         """Convenience module for running multiple decoder layers followed by normalization."""
         super().__init__()
-        self.layers = nn.ModuleList([ACTDecoderLayer(config) for _ in range(config.n_decoder_layers)])
+        self.layers = nn.ModuleList(
+            [ACTDecoderLayer(config) for _ in range(config.n_decoder_layers)]
+        )
         self.norm = nn.LayerNorm(config.dim_model)
 
     def forward(
@@ -592,7 +687,10 @@ class ACTDecoder(nn.Module):
     ) -> Tensor:
         for layer in self.layers:
             x = layer(
-                x, encoder_out, decoder_pos_embed=decoder_pos_embed, encoder_pos_embed=encoder_pos_embed
+                x,
+                encoder_out,
+                decoder_pos_embed=decoder_pos_embed,
+                encoder_pos_embed=encoder_pos_embed,
             )
         if self.norm is not None:
             x = self.norm(x)
@@ -602,8 +700,12 @@ class ACTDecoder(nn.Module):
 class ACTDecoderLayer(nn.Module):
     def __init__(self, config: ACTConfig):
         super().__init__()
-        self.self_attn = nn.MultiheadAttention(config.dim_model, config.n_heads, dropout=config.dropout)
-        self.multihead_attn = nn.MultiheadAttention(config.dim_model, config.n_heads, dropout=config.dropout)
+        self.self_attn = nn.MultiheadAttention(
+            config.dim_model, config.n_heads, dropout=config.dropout
+        )
+        self.multihead_attn = nn.MultiheadAttention(
+            config.dim_model, config.n_heads, dropout=config.dropout
+        )
 
         # Feed forward layers.
         self.linear1 = nn.Linear(config.dim_model, config.dim_feedforward)
@@ -644,7 +746,9 @@ class ACTDecoderLayer(nn.Module):
         if self.pre_norm:
             x = self.norm1(x)
         q = k = self.maybe_add_pos_embed(x, decoder_pos_embed)
-        x = self.self_attn(q, k, value=x)[0]  # select just the output, not the attention weights
+        x = self.self_attn(q, k, value=x)[
+            0
+        ]  # select just the output, not the attention weights
         x = skip + self.dropout1(x)
         if self.pre_norm:
             skip = x
@@ -681,9 +785,14 @@ def create_sinusoidal_pos_embedding(num_positions: int, dimension: int) -> Tenso
     """
 
     def get_position_angle_vec(position):
-        return [position / np.power(10000, 2 * (hid_j // 2) / dimension) for hid_j in range(dimension)]
+        return [
+            position / np.power(10000, 2 * (hid_j // 2) / dimension)
+            for hid_j in range(dimension)
+        ]
 
-    sinusoid_table = np.array([get_position_angle_vec(pos_i) for pos_i in range(num_positions)])
+    sinusoid_table = np.array(
+        [get_position_angle_vec(pos_i) for pos_i in range(num_positions)]
+    )
     sinusoid_table[:, 0::2] = np.sin(sinusoid_table[:, 0::2])  # dim 2i
     sinusoid_table[:, 1::2] = np.cos(sinusoid_table[:, 1::2])  # dim 2i+1
     return torch.from_numpy(sinusoid_table).float()
@@ -728,7 +837,9 @@ class ACTSinusoidalPositionEmbedding2d(nn.Module):
         x_range = x_range / (x_range[:, :, -1:] + self._eps) * self._two_pi
 
         inverse_frequency = self._temperature ** (
-            2 * (torch.arange(self.dimension, dtype=torch.float32, device=x.device) // 2) / self.dimension
+            2
+            * (torch.arange(self.dimension, dtype=torch.float32, device=x.device) // 2)
+            / self.dimension
         )
 
         x_range = x_range.unsqueeze(-1) / inverse_frequency  # (1, H, W, 1)
@@ -736,9 +847,15 @@ class ACTSinusoidalPositionEmbedding2d(nn.Module):
 
         # Note: this stack then flatten operation results in interleaved sine and cosine terms.
         # pos_embed_x and pos_embed_y are (1, H, W, C // 2).
-        pos_embed_x = torch.stack((x_range[..., 0::2].sin(), x_range[..., 1::2].cos()), dim=-1).flatten(3)
-        pos_embed_y = torch.stack((y_range[..., 0::2].sin(), y_range[..., 1::2].cos()), dim=-1).flatten(3)
-        pos_embed = torch.cat((pos_embed_y, pos_embed_x), dim=3).permute(0, 3, 1, 2)  # (1, C, H, W)
+        pos_embed_x = torch.stack(
+            (x_range[..., 0::2].sin(), x_range[..., 1::2].cos()), dim=-1
+        ).flatten(3)
+        pos_embed_y = torch.stack(
+            (y_range[..., 0::2].sin(), y_range[..., 1::2].cos()), dim=-1
+        ).flatten(3)
+        pos_embed = torch.cat((pos_embed_y, pos_embed_x), dim=3).permute(
+            0, 3, 1, 2
+        )  # (1, C, H, W)
 
         return pos_embed
 

lerobot/common/policies/diffusion/configuration_diffusion.py

@@ -121,7 +121,9 @@ class DiffusionConfig:
             "observation.state": "min_max",
         }
     )
-    output_normalization_modes: dict[str, str] = field(default_factory=lambda: {"action": "min_max"})
+    output_normalization_modes: dict[str, str] = field(
+        default_factory=lambda: {"action": "min_max"}
+    )
 
     # Architecture / modeling.
     # Vision backbone.
@@ -163,8 +165,13 @@ class DiffusionConfig:
 
         image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
 
-        if len(image_keys) == 0 and "observation.environment_state" not in self.input_shapes:
-            raise ValueError("You must provide at least one image or the environment state among the inputs.")
+        if (
+            len(image_keys) == 0
+            and "observation.environment_state" not in self.input_shapes
+        ):
+            raise ValueError(
+                "You must provide at least one image or the environment state among the inputs."
+            )
 
         if len(image_keys) > 0:
             if self.crop_shape is not None:

lerobot/common/policies/diffusion/modeling_diffusion.py

@@ -88,7 +88,9 @@ class DiffusionPolicy(
 
         self.diffusion = DiffusionModel(config)
 
-        self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
+        self.expected_image_keys = [
+            k for k in config.input_shapes if k.startswith("observation.image")
+        ]
         self.use_env_state = "observation.environment_state" in config.input_shapes
 
         self.reset()
@@ -102,7 +104,9 @@ class DiffusionPolicy(
         if len(self.expected_image_keys) > 0:
             self._queues["observation.images"] = deque(maxlen=self.config.n_obs_steps)
         if self.use_env_state:
-            self._queues["observation.environment_state"] = deque(maxlen=self.config.n_obs_steps)
+            self._queues["observation.environment_state"] = deque(
+                maxlen=self.config.n_obs_steps
+            )
 
     @torch.no_grad
     def select_action(self, batch: dict[str, Tensor]) -> Tensor:
@@ -128,14 +132,22 @@ class DiffusionPolicy(
         """
         batch = self.normalize_inputs(batch)
         if len(self.expected_image_keys) > 0:
-            batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
-            batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
+            batch = dict(
+                batch
+            )  # shallow copy so that adding a key doesn't modify the original
+            batch["observation.images"] = torch.stack(
+                [batch[k] for k in self.expected_image_keys], dim=-4
+            )
         # Note: It's important that this happens after stacking the images into a single key.
         self._queues = populate_queues(self._queues, batch)
 
         if len(self._queues["action"]) == 0:
             # stack n latest observations from the queue
-            batch = {k: torch.stack(list(self._queues[k]), dim=1) for k in batch if k in self._queues}
+            batch = {
+                k: torch.stack(list(self._queues[k]), dim=1)
+                for k in batch
+                if k in self._queues
+            }
             actions = self.diffusion.generate_actions(batch)
 
             # TODO(rcadene): make above methods return output dictionary?
@@ -150,8 +162,12 @@ class DiffusionPolicy(
         """Run the batch through the model and compute the loss for training or validation."""
         batch = self.normalize_inputs(batch)
         if len(self.expected_image_keys) > 0:
-            batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
-            batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
+            batch = dict(
+                batch
+            )  # shallow copy so that adding a key doesn't modify the original
+            batch["observation.images"] = torch.stack(
+                [batch[k] for k in self.expected_image_keys], dim=-4
+            )
         batch = self.normalize_targets(batch)
         loss = self.diffusion.compute_loss(batch)
         return {"loss": loss}
@@ -177,7 +193,9 @@ class DiffusionModel(nn.Module):
 
         # Build observation encoders (depending on which observations are provided).
         global_cond_dim = config.input_shapes["observation.state"][0]
-        num_images = len([k for k in config.input_shapes if k.startswith("observation.image")])
+        num_images = len(
+            [k for k in config.input_shapes if k.startswith("observation.image")]
+        )
         self._use_images = False
         self._use_env_state = False
         if num_images > 0:
@@ -193,7 +211,9 @@ class DiffusionModel(nn.Module):
             self._use_env_state = True
             global_cond_dim += config.input_shapes["observation.environment_state"][0]
 
-        self.unet = DiffusionConditionalUnet1d(config, global_cond_dim=global_cond_dim * config.n_obs_steps)
+        self.unet = DiffusionConditionalUnet1d(
+            config, global_cond_dim=global_cond_dim * config.n_obs_steps
+        )
 
         self.noise_scheduler = _make_noise_scheduler(
             config.noise_scheduler_type,
@@ -213,14 +233,21 @@ class DiffusionModel(nn.Module):
 
     # ========= inference  ============
     def conditional_sample(
-        self, batch_size: int, global_cond: Tensor | None = None, generator: torch.Generator | None = None
+        self,
+        batch_size: int,
+        global_cond: Tensor | None = None,
+        generator: torch.Generator | None = None,
     ) -> Tensor:
         device = get_device_from_parameters(self)
         dtype = get_dtype_from_parameters(self)
 
         # Sample prior.
         sample = torch.randn(
-            size=(batch_size, self.config.horizon, self.config.output_shapes["action"][0]),
+            size=(
+                batch_size,
+                self.config.horizon,
+                self.config.output_shapes["action"][0],
+            ),
             dtype=dtype,
             device=device,
             generator=generator,
@@ -236,7 +263,9 @@ class DiffusionModel(nn.Module):
                 global_cond=global_cond,
             )
             # Compute previous image: x_t -> x_t-1
-            sample = self.noise_scheduler.step(model_output, t, sample, generator=generator).prev_sample
+            sample = self.noise_scheduler.step(
+                model_output, t, sample, generator=generator
+            ).prev_sample
 
         return sample
 
@@ -248,27 +277,39 @@ class DiffusionModel(nn.Module):
         if self._use_images:
             if self.config.use_separate_rgb_encoder_per_camera:
                 # Combine batch and sequence dims while rearranging to make the camera index dimension first.
-                images_per_camera = einops.rearrange(batch["observation.images"], "b s n ... -> n (b s) ...")
+                images_per_camera = einops.rearrange(
+                    batch["observation.images"], "b s n ... -> n (b s) ..."
+                )
                 img_features_list = torch.cat(
                     [
                         encoder(images)
-                        for encoder, images in zip(self.rgb_encoder, images_per_camera, strict=True)
+                        for encoder, images in zip(
+                            self.rgb_encoder, images_per_camera, strict=True
+                        )
                     ]
                 )
                 # Separate batch and sequence dims back out. The camera index dim gets absorbed into the
                 # feature dim (effectively concatenating the camera features).
                 img_features = einops.rearrange(
-                    img_features_list, "(n b s) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
+                    img_features_list,
+                    "(n b s) ... -> b s (n ...)",
+                    b=batch_size,
+                    s=n_obs_steps,
                 )
             else:
                 # Combine batch, sequence, and "which camera" dims before passing to shared encoder.
                 img_features = self.rgb_encoder(
-                    einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
+                    einops.rearrange(
+                        batch["observation.images"], "b s n ... -> (b s n) ..."
+                    )
                 )
                 # Separate batch dim and sequence dim back out. The camera index dim gets absorbed into the
                 # feature dim (effectively concatenating the camera features).
                 img_features = einops.rearrange(
-                    img_features, "(b s n) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
+                    img_features,
+                    "(b s n) ... -> b s (n ...)",
+                    b=batch_size,
+                    s=n_obs_steps,
                 )
             global_cond_feats.append(img_features)
 
@@ -354,7 +395,9 @@ class DiffusionModel(nn.Module):
         elif self.config.prediction_type == "sample":
             target = batch["action"]
         else:
-            raise ValueError(f"Unsupported prediction type {self.config.prediction_type}")
+            raise ValueError(
+                f"Unsupported prediction type {self.config.prediction_type}"
+            )
 
         loss = F.mse_loss(pred, target, reduction="none")
 
@@ -414,7 +457,9 @@ class SpatialSoftmax(nn.Module):
 
         # we could use torch.linspace directly but that seems to behave slightly differently than numpy
         # and causes a small degradation in pc_success of pre-trained models.
-        pos_x, pos_y = np.meshgrid(np.linspace(-1.0, 1.0, self._in_w), np.linspace(-1.0, 1.0, self._in_h))
+        pos_x, pos_y = np.meshgrid(
+            np.linspace(-1.0, 1.0, self._in_w), np.linspace(-1.0, 1.0, self._in_h)
+        )
         pos_x = torch.from_numpy(pos_x.reshape(self._in_h * self._in_w, 1)).float()
         pos_y = torch.from_numpy(pos_y.reshape(self._in_h * self._in_w, 1)).float()
         # register as buffer so it's moved to the correct device.
@@ -456,7 +501,9 @@ class DiffusionRgbEncoder(nn.Module):
             # Always use center crop for eval
             self.center_crop = torchvision.transforms.CenterCrop(config.crop_shape)
             if config.crop_is_random:
-                self.maybe_random_crop = torchvision.transforms.RandomCrop(config.crop_shape)
+                self.maybe_random_crop = torchvision.transforms.RandomCrop(
+                    config.crop_shape
+                )
             else:
                 self.maybe_random_crop = self.center_crop
         else:
@@ -477,7 +524,9 @@ class DiffusionRgbEncoder(nn.Module):
             self.backbone = _replace_submodules(
                 root_module=self.backbone,
                 predicate=lambda x: isinstance(x, nn.BatchNorm2d),
-                func=lambda x: nn.GroupNorm(num_groups=x.num_features // 16, num_channels=x.num_features),
+                func=lambda x: nn.GroupNorm(
+                    num_groups=x.num_features // 16, num_channels=x.num_features
+                ),
             )
 
         # Set up pooling and final layers.
@@ -485,17 +534,25 @@ class DiffusionRgbEncoder(nn.Module):
         # The dummy input should take the number of image channels from `config.input_shapes` and it should
         # use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
         # height and width from `config.input_shapes`.
-        image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
+        image_keys = [
+            k for k in config.input_shapes if k.startswith("observation.image")
+        ]
         # Note: we have a check in the config class to make sure all images have the same shape.
         image_key = image_keys[0]
         dummy_input_h_w = (
-            config.crop_shape if config.crop_shape is not None else config.input_shapes[image_key][1:]
+            config.crop_shape
+            if config.crop_shape is not None
+            else config.input_shapes[image_key][1:]
+        )
+        dummy_input = torch.zeros(
+            size=(1, config.input_shapes[image_key][0], *dummy_input_h_w)
         )
-        dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *dummy_input_h_w))
         with torch.inference_mode():
             dummy_feature_map = self.backbone(dummy_input)
         feature_map_shape = tuple(dummy_feature_map.shape[1:])
-        self.pool = SpatialSoftmax(feature_map_shape, num_kp=config.spatial_softmax_num_keypoints)
+        self.pool = SpatialSoftmax(
+            feature_map_shape, num_kp=config.spatial_softmax_num_keypoints
+        )
         self.feature_dim = config.spatial_softmax_num_keypoints * 2
         self.out = nn.Linear(config.spatial_softmax_num_keypoints * 2, self.feature_dim)
         self.relu = nn.ReLU()
@@ -522,7 +579,9 @@ class DiffusionRgbEncoder(nn.Module):
 
 
 def _replace_submodules(
-    root_module: nn.Module, predicate: Callable[[nn.Module], bool], func: Callable[[nn.Module], nn.Module]
+    root_module: nn.Module,
+    predicate: Callable[[nn.Module], bool],
+    func: Callable[[nn.Module], nn.Module],
 ) -> nn.Module:
     """
     Args:
@@ -535,7 +594,11 @@ def _replace_submodules(
     if predicate(root_module):
         return func(root_module)
 
-    replace_list = [k.split(".") for k, m in root_module.named_modules(remove_duplicate=True) if predicate(m)]
+    replace_list = [
+        k.split(".")
+        for k, m in root_module.named_modules(remove_duplicate=True)
+        if predicate(m)
+    ]
     for *parents, k in replace_list:
         parent_module = root_module
         if len(parents) > 0:
@@ -550,7 +613,9 @@ def _replace_submodules(
         else:
             setattr(parent_module, k, tgt_module)
     # verify that all BN are replaced
-    assert not any(predicate(m) for _, m in root_module.named_modules(remove_duplicate=True))
+    assert not any(
+        predicate(m) for _, m in root_module.named_modules(remove_duplicate=True)
+    )
     return root_module
 
 
@@ -578,7 +643,9 @@ class DiffusionConv1dBlock(nn.Module):
         super().__init__()
 
         self.block = nn.Sequential(
-            nn.Conv1d(inp_channels, out_channels, kernel_size, padding=kernel_size // 2),
+            nn.Conv1d(
+                inp_channels, out_channels, kernel_size, padding=kernel_size // 2
+            ),
             nn.GroupNorm(n_groups, out_channels),
             nn.Mish(),
         )
@@ -601,9 +668,13 @@ class DiffusionConditionalUnet1d(nn.Module):
         # Encoder for the diffusion timestep.
         self.diffusion_step_encoder = nn.Sequential(
             DiffusionSinusoidalPosEmb(config.diffusion_step_embed_dim),
-            nn.Linear(config.diffusion_step_embed_dim, config.diffusion_step_embed_dim * 4),
+            nn.Linear(
+                config.diffusion_step_embed_dim, config.diffusion_step_embed_dim * 4
+            ),
             nn.Mish(),
-            nn.Linear(config.diffusion_step_embed_dim * 4, config.diffusion_step_embed_dim),
+            nn.Linear(
+                config.diffusion_step_embed_dim * 4, config.diffusion_step_embed_dim
+            ),
         )
 
         # The FiLM conditioning dimension.
@@ -628,10 +699,16 @@ class DiffusionConditionalUnet1d(nn.Module):
             self.down_modules.append(
                 nn.ModuleList(
                     [
-                        DiffusionConditionalResidualBlock1d(dim_in, dim_out, **common_res_block_kwargs),
-                        DiffusionConditionalResidualBlock1d(dim_out, dim_out, **common_res_block_kwargs),
+                        DiffusionConditionalResidualBlock1d(
+                            dim_in, dim_out, **common_res_block_kwargs
+                        ),
+                        DiffusionConditionalResidualBlock1d(
+                            dim_out, dim_out, **common_res_block_kwargs
+                        ),
                         # Downsample as long as it is not the last block.
-                        nn.Conv1d(dim_out, dim_out, 3, 2, 1) if not is_last else nn.Identity(),
+                        nn.Conv1d(dim_out, dim_out, 3, 2, 1)
+                        if not is_last
+                        else nn.Identity(),
                     ]
                 )
             )
@@ -640,10 +717,14 @@ class DiffusionConditionalUnet1d(nn.Module):
         self.mid_modules = nn.ModuleList(
             [
                 DiffusionConditionalResidualBlock1d(
-                    config.down_dims[-1], config.down_dims[-1], **common_res_block_kwargs
+                    config.down_dims[-1],
+                    config.down_dims[-1],
+                    **common_res_block_kwargs,
                 ),
                 DiffusionConditionalResidualBlock1d(
-                    config.down_dims[-1], config.down_dims[-1], **common_res_block_kwargs
+                    config.down_dims[-1],
+                    config.down_dims[-1],
+                    **common_res_block_kwargs,
                 ),
             ]
         )
@@ -656,16 +737,24 @@ class DiffusionConditionalUnet1d(nn.Module):
                 nn.ModuleList(
                     [
                         # dim_in * 2, because it takes the encoder's skip connection as well
-                        DiffusionConditionalResidualBlock1d(dim_in * 2, dim_out, **common_res_block_kwargs),
-                        DiffusionConditionalResidualBlock1d(dim_out, dim_out, **common_res_block_kwargs),
+                        DiffusionConditionalResidualBlock1d(
+                            dim_in * 2, dim_out, **common_res_block_kwargs
+                        ),
+                        DiffusionConditionalResidualBlock1d(
+                            dim_out, dim_out, **common_res_block_kwargs
+                        ),
                         # Upsample as long as it is not the last block.
-                        nn.ConvTranspose1d(dim_out, dim_out, 4, 2, 1) if not is_last else nn.Identity(),
+                        nn.ConvTranspose1d(dim_out, dim_out, 4, 2, 1)
+                        if not is_last
+                        else nn.Identity(),
                     ]
                 )
             )
 
         self.final_conv = nn.Sequential(
-            DiffusionConv1dBlock(config.down_dims[0], config.down_dims[0], kernel_size=config.kernel_size),
+            DiffusionConv1dBlock(
+                config.down_dims[0], config.down_dims[0], kernel_size=config.kernel_size
+            ),
             nn.Conv1d(config.down_dims[0], config.output_shapes["action"][0], 1),
         )
 
@@ -733,17 +822,23 @@ class DiffusionConditionalResidualBlock1d(nn.Module):
         self.use_film_scale_modulation = use_film_scale_modulation
         self.out_channels = out_channels
 
-        self.conv1 = DiffusionConv1dBlock(in_channels, out_channels, kernel_size, n_groups=n_groups)
+        self.conv1 = DiffusionConv1dBlock(
+            in_channels, out_channels, kernel_size, n_groups=n_groups
+        )
 
         # FiLM modulation (https://arxiv.org/abs/1709.07871) outputs per-channel bias and (maybe) scale.
         cond_channels = out_channels * 2 if use_film_scale_modulation else out_channels
         self.cond_encoder = nn.Sequential(nn.Mish(), nn.Linear(cond_dim, cond_channels))
 
-        self.conv2 = DiffusionConv1dBlock(out_channels, out_channels, kernel_size, n_groups=n_groups)
+        self.conv2 = DiffusionConv1dBlock(
+            out_channels, out_channels, kernel_size, n_groups=n_groups
+        )
 
         # A final convolution for dimension matching the residual (if needed).
         self.residual_conv = (
-            nn.Conv1d(in_channels, out_channels, 1) if in_channels != out_channels else nn.Identity()
+            nn.Conv1d(in_channels, out_channels, 1)
+            if in_channels != out_channels
+            else nn.Identity()
         )
 
     def forward(self, x: Tensor, cond: Tensor) -> Tensor:

lerobot/common/policies/factory.py

@@ -52,7 +52,9 @@ def get_policy_and_config_classes(name: str) -> tuple[Policy, object]:
 
         return TDMPCPolicy, TDMPCConfig
     elif name == "diffusion":
-        from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
+        from lerobot.common.policies.diffusion.configuration_diffusion import (
+            DiffusionConfig,
+        )
         from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
 
         return DiffusionPolicy, DiffusionConfig
@@ -66,12 +68,21 @@ def get_policy_and_config_classes(name: str) -> tuple[Policy, object]:
         from lerobot.common.policies.vqbet.modeling_vqbet import VQBeTPolicy
 
         return VQBeTPolicy, VQBeTConfig
+    elif name == "sac":
+        from lerobot.common.policies.sac.configuration_sac import SACConfig
+        from lerobot.common.policies.sac.modeling_sac import SACPolicy
+
+        return SACPolicy, SACConfig
     else:
         raise NotImplementedError(f"Policy with name {name} is not implemented.")
 
 
 def make_policy(
-    hydra_cfg: DictConfig, pretrained_policy_name_or_path: str | None = None, dataset_stats=None
+    hydra_cfg: DictConfig,
+    pretrained_policy_name_or_path: str | None = None,
+    dataset_stats=None,
+    *args,
+    **kwargs,
 ) -> Policy:
     """Make an instance of a policy class.
 
@@ -85,17 +96,19 @@ def make_policy(
             be provided when initializing a new policy, and must not be provided when loading a pretrained
             policy. Therefore, this argument is mutually exclusive with `pretrained_policy_name_or_path`.
     """
-    if not (pretrained_policy_name_or_path is None) ^ (dataset_stats is None):
-        raise ValueError(
-            "Exactly one of `pretrained_policy_name_or_path` and `dataset_stats` must be provided."
-        )
+    # if not (pretrained_policy_name_or_path is None) ^ (dataset_stats is None):
+    #     raise ValueError(
+    #         "Exactly one of `pretrained_policy_name_or_path` and `dataset_stats` must be provided."
+    #     )
 
     policy_cls, policy_cfg_class = get_policy_and_config_classes(hydra_cfg.policy.name)
 
     policy_cfg = _policy_cfg_from_hydra_cfg(policy_cfg_class, hydra_cfg)
     if pretrained_policy_name_or_path is None:
         # Make a fresh policy.
-        policy = policy_cls(policy_cfg, dataset_stats)
+        # HACK: We pass *args and **kwargs to the policy constructor to allow for additional arguments
+        # for example device for the sac policy.
+        policy = policy_cls(config=policy_cfg, dataset_stats=dataset_stats)
     else:
         # Load a pretrained policy and override the config if needed (for example, if there are inference-time
         # hyperparameters that we want to vary).
@@ -104,7 +117,9 @@ def make_policy(
         # huggingface_hub should make it possible to avoid the hack:
         # https://github.com/huggingface/huggingface_hub/pull/2274.
         policy = policy_cls(policy_cfg)
-        policy.load_state_dict(policy_cls.from_pretrained(pretrained_policy_name_or_path).state_dict())
+        policy.load_state_dict(
+            policy_cls.from_pretrained(pretrained_policy_name_or_path).state_dict()
+        )
 
     policy.to(get_safe_torch_device(hydra_cfg.device))
 

lerobot/common/policies/hilserl/classifier/configuration_classifier.py

@@ -0,0 +1,35 @@
+import json
+import os
+from dataclasses import asdict, dataclass
+
+
+@dataclass
+class ClassifierConfig:
+    """Configuration for the Classifier model."""
+
+    num_classes: int = 2
+    hidden_dim: int = 256
+    dropout_rate: float = 0.1
+    model_name: str = "helper2424/resnet10"
+    device: str = "cpu"
+    model_type: str = "cnn"  # "transformer" or "cnn"
+    num_cameras: int = 2
+
+    def save_pretrained(self, save_dir):
+        """Save config to json file."""
+        os.makedirs(save_dir, exist_ok=True)
+
+        # Convert to dict and save as JSON
+        config_dict = asdict(self)
+        with open(os.path.join(save_dir, "config.json"), "w") as f:
+            json.dump(config_dict, f, indent=2)
+
+    @classmethod
+    def from_pretrained(cls, pretrained_model_name_or_path):
+        """Load config from json file."""
+        config_file = os.path.join(pretrained_model_name_or_path, "config.json")
+
+        with open(config_file) as f:
+            config_dict = json.load(f)
+
+        return cls(**config_dict)

lerobot/common/policies/hilserl/classifier/modeling_classifier.py

@@ -0,0 +1,173 @@
+import logging
+from typing import Optional
+
+import torch
+from huggingface_hub import PyTorchModelHubMixin
+from torch import Tensor, nn
+
+from .configuration_classifier import ClassifierConfig
+
+logging.basicConfig(
+    level=logging.INFO, format="%(asctime)s - %(name)s - %(levelname)s - %(message)s"
+)
+logger = logging.getLogger(__name__)
+
+
+class ClassifierOutput:
+    """Wrapper for classifier outputs with additional metadata."""
+
+    def __init__(
+        self,
+        logits: Tensor,
+        probabilities: Optional[Tensor] = None,
+        hidden_states: Optional[Tensor] = None,
+    ):
+        self.logits = logits
+        self.probabilities = probabilities
+        self.hidden_states = hidden_states
+
+    def __repr__(self):
+        return (
+            f"ClassifierOutput(logits={self.logits}, "
+            f"probabilities={self.probabilities}, "
+            f"hidden_states={self.hidden_states})"
+        )
+
+
+class Classifier(
+    nn.Module,
+    PyTorchModelHubMixin,
+    # Add Hub metadata
+    library_name="lerobot",
+    repo_url="https://github.com/huggingface/lerobot",
+    tags=["robotics", "vision-classifier"],
+):
+    """Image classifier built on top of a pre-trained encoder."""
+
+    # Add name attribute for factory
+    name = "classifier"
+
+    def __init__(self, config: ClassifierConfig):
+        from transformers import AutoModel
+
+        super().__init__()
+        self.config = config
+        # self.processor = AutoImageProcessor.from_pretrained(self.config.model_name, trust_remote_code=True)
+        encoder = AutoModel.from_pretrained(
+            self.config.model_name, trust_remote_code=True
+        )
+        # Extract vision model if we're given a multimodal model
+        if hasattr(encoder, "vision_model"):
+            logging.info("Multimodal model detected - using vision encoder only")
+            self.encoder = encoder.vision_model
+            self.vision_config = encoder.config.vision_config
+        else:
+            self.encoder = encoder
+            self.vision_config = getattr(encoder, "config", None)
+
+        # Model type from config
+        self.is_cnn = self.config.model_type == "cnn"
+
+        # For CNNs, initialize backbone
+        if self.is_cnn:
+            self._setup_cnn_backbone()
+
+        self._freeze_encoder()
+        self._build_classifier_head()
+
+    def _setup_cnn_backbone(self):
+        """Set up CNN encoder"""
+        if hasattr(self.encoder, "fc"):
+            self.feature_dim = self.encoder.fc.in_features
+            self.encoder = nn.Sequential(*list(self.encoder.children())[:-1])
+        elif hasattr(self.encoder.config, "hidden_sizes"):
+            self.feature_dim = self.encoder.config.hidden_sizes[
+                -1
+            ]  # Last channel dimension
+        else:
+            raise ValueError("Unsupported CNN architecture")
+
+        self.encoder = self.encoder.to(self.config.device)
+
+    def _freeze_encoder(self) -> None:
+        """Freeze the encoder parameters."""
+        for param in self.encoder.parameters():
+            param.requires_grad = False
+
+    def _build_classifier_head(self) -> None:
+        """Initialize the classifier head architecture."""
+        # Get input dimension based on model type
+        if self.is_cnn:
+            input_dim = self.feature_dim
+        else:  # Transformer models
+            if hasattr(self.encoder.config, "hidden_size"):
+                input_dim = self.encoder.config.hidden_size
+            else:
+                raise ValueError(
+                    "Unsupported transformer architecture since hidden_size is not found"
+                )
+
+        self.classifier_head = nn.Sequential(
+            nn.Linear(input_dim * self.config.num_cameras, self.config.hidden_dim),
+            nn.Dropout(self.config.dropout_rate),
+            nn.LayerNorm(self.config.hidden_dim),
+            nn.ReLU(),
+            nn.Linear(
+                self.config.hidden_dim,
+                1 if self.config.num_classes == 2 else self.config.num_classes,
+            ),
+        )
+        self.classifier_head = self.classifier_head.to(self.config.device)
+
+    def _get_encoder_output(self, x: torch.Tensor) -> torch.Tensor:
+        """Extract the appropriate output from the encoder."""
+        # Process images with the processor (handles resizing and normalization)
+        # processed = self.processor(
+        #     images=x,  # LeRobotDataset already provides proper tensor format
+        #     return_tensors="pt",
+        # )
+        # processed = processed["pixel_values"].to(x.device)
+        processed = x
+
+        with torch.no_grad():
+            if self.is_cnn:
+                # The HF ResNet applies pooling internally
+                outputs = self.encoder(processed)
+                # Get pooled output directly
+                features = outputs.pooler_output
+
+                if features.dim() > 2:
+                    features = features.squeeze(-1).squeeze(-1)
+                return features
+            else:  # Transformer models
+                outputs = self.encoder(processed)
+                if (
+                    hasattr(outputs, "pooler_output")
+                    and outputs.pooler_output is not None
+                ):
+                    return outputs.pooler_output
+                return outputs.last_hidden_state[:, 0, :]
+
+    def forward(self, xs: torch.Tensor) -> ClassifierOutput:
+        """Forward pass of the classifier."""
+        # For training, we expect input to be a tensor directly from LeRobotDataset
+        encoder_outputs = torch.hstack([self._get_encoder_output(x) for x in xs])
+        logits = self.classifier_head(encoder_outputs)
+
+        if self.config.num_classes == 2:
+            logits = logits.squeeze(-1)
+            probabilities = torch.sigmoid(logits)
+        else:
+            probabilities = torch.softmax(logits, dim=-1)
+
+        return ClassifierOutput(
+            logits=logits, probabilities=probabilities, hidden_states=encoder_outputs
+        )
+
+    def predict_reward(self, x, threshold=0.6):
+        if self.config.num_classes == 2:
+            probs = self.forward(x).probabilities
+            logging.debug(f"Predicted reward images: {probs}")
+            return (probs > threshold).float()
+        else:
+            return torch.argmax(self.forward(x).probabilities, dim=1)

lerobot/common/policies/hilserl/configuration_hilserl.py

@@ -1,6 +1,6 @@
 #!/usr/bin/env python
 
-# Copyright 2024 The HuggingFace Inc. team. 
+# Copyright 2024 The HuggingFace Inc. team.
 # All rights reserved.
 #
 # Licensed under the Apache License, Version 2.0 (the "License");
@@ -15,7 +15,7 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
-from dataclasses import dataclass, field
+from dataclasses import dataclass
 
 
 @dataclass

lerobot/common/policies/hilserl/modeling_hilserl.py

@@ -1,6 +1,6 @@
 #!/usr/bin/env python
 
-# Copyright 2024 The HuggingFace Inc. team. 
+# Copyright 2024 The HuggingFace Inc. team.
 # All rights reserved.
 #
 # Licensed under the Apache License, Version 2.0 (the "License");
@@ -15,11 +15,10 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 
-import torch
 import torch.nn as nn
-import torch.nn.functional as F  # noqa: N812
 from huggingface_hub import PyTorchModelHubMixin
 
+
 class HILSerlPolicy(
     nn.Module,
     PyTorchModelHubMixin,
@@ -27,4 +26,4 @@ class HILSerlPolicy(
     repo_url="https://github.com/huggingface/lerobot",
     tags=["robotics", "hilserl"],
 ):
-    pass
+    pass

lerobot/common/policies/normalize.py

@@ -130,7 +130,7 @@ class Normalize(nn.Module):
             setattr(self, "buffer_" + key.replace(".", "_"), buffer)
 
     # TODO(rcadene): should we remove torch.no_grad?
-    @torch.no_grad
+    # @torch.no_grad
     def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
         batch = dict(batch)  # shallow copy avoids mutating the input batch
         for key, mode in self.modes.items():
@@ -196,7 +196,7 @@ class Unnormalize(nn.Module):
             setattr(self, "buffer_" + key.replace(".", "_"), buffer)
 
     # TODO(rcadene): should we remove torch.no_grad?
-    @torch.no_grad
+    # @torch.no_grad
     def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
         batch = dict(batch)  # shallow copy avoids mutating the input batch
         for key, mode in self.modes.items():

lerobot/common/policies/sac/configuration_sac.py

@@ -1,6 +1,6 @@
 #!/usr/bin/env python
 
-# Copyright 2024 The HuggingFace Inc. team. 
+# Copyright 2024 The HuggingFace Inc. team.
 # All rights reserved.
 #
 # Licensed under the Apache License, Version 2.0 (the "License");
@@ -16,8 +16,93 @@
 # limitations under the License.
 
 from dataclasses import dataclass, field
+from typing import Any
 
 
 @dataclass
 class SACConfig:
-    discount = 0.99
+    input_shapes: dict[str, list[int]] = field(
+        default_factory=lambda: {
+            "observation.image": [3, 84, 84],
+            "observation.state": [4],
+        }
+    )
+    output_shapes: dict[str, list[int]] = field(
+        default_factory=lambda: {
+            "action": [2],
+        }
+    )
+    input_normalization_modes: dict[str, str] = field(
+        default_factory=lambda: {
+            "observation.image": "mean_std",
+            "observation.state": "min_max",
+            "observation.environment_state": "min_max",
+        }
+    )
+    input_normalization_params: dict[str, dict[str, list[float]]] = field(
+        default_factory=lambda: {
+            "observation.image": {
+                "mean": [[0.485, 0.456, 0.406]],
+                "std": [[0.229, 0.224, 0.225]],
+            },
+            "observation.state": {"min": [-1, -1, -1, -1], "max": [1, 1, 1, 1]},
+        }
+    )
+    output_normalization_modes: dict[str, str] = field(
+        default_factory=lambda: {"action": "min_max"}
+    )
+    output_normalization_params: dict[str, dict[str, list[float]]] = field(
+        default_factory=lambda: {
+            "action": {"min": [-1, -1], "max": [1, 1]},
+        }
+    )
+    # TODO: Move it outside of the config
+    actor_learner_config: dict[str, str | int] = field(
+        default_factory=lambda: {
+            "learner_host": "127.0.0.1",
+            "learner_port": 50051,
+        }
+    )
+    camera_number: int = 1
+
+    storage_device: str = "cpu"
+    # Add type annotations for these fields:
+    vision_encoder_name: str | None = field(default="helper2424/resnet10")
+    freeze_vision_encoder: bool = True
+    image_encoder_hidden_dim: int = 32
+    shared_encoder: bool = True
+    discount: float = 0.99
+    temperature_init: float = 1.0
+    num_critics: int = 2
+    num_subsample_critics: int | None = None
+    critic_lr: float = 3e-4
+    actor_lr: float = 3e-4
+    temperature_lr: float = 3e-4
+    critic_target_update_weight: float = 0.005
+    utd_ratio: int = 1  # If you want enable utd_ratio, you need to set it to >1
+    state_encoder_hidden_dim: int = 256
+    latent_dim: int = 256
+    target_entropy: float | None = None
+    use_backup_entropy: bool = True
+    grad_clip_norm: float = 40.0
+    critic_network_kwargs: dict[str, Any] = field(
+        default_factory=lambda: {
+            "hidden_dims": [256, 256],
+            "activate_final": True,
+            "final_activation": None,
+        }
+    )
+    actor_network_kwargs: dict[str, Any] = field(
+        default_factory=lambda: {
+            "hidden_dims": [256, 256],
+            "activate_final": True,
+        }
+    )
+    policy_kwargs: dict[str, Any] = field(
+        default_factory=lambda: {
+            "use_tanh_squash": True,
+            "log_std_min": -5,
+            "log_std_max": 2,
+            "init_final": 0.05,
+        }
+    )

lerobot/common/policies/tdmpc/configuration_tdmpc.py

@@ -191,6 +191,10 @@ class TDMPCConfig:
                     "If `n_action_steps > 1`, `n_action_repeats` must be left to its default value of 1."
                 )
             if not self.use_mpc:
-                raise ValueError("If `n_action_steps > 1`, `use_mpc` must be set to `True`.")
+                raise ValueError(
+                    "If `n_action_steps > 1`, `use_mpc` must be set to `True`."
+                )
             if self.n_action_steps > self.horizon:
-                raise ValueError("`n_action_steps` must be less than or equal to `horizon`.")
+                raise ValueError(
+                    "`n_action_steps` must be less than or equal to `horizon`."
+                )

lerobot/common/policies/tdmpc/modeling_tdmpc.py

@@ -68,7 +68,9 @@ class TDMPCPolicy(
     name = "tdmpc"
 
     def __init__(
-        self, config: TDMPCConfig | None = None, dataset_stats: dict[str, dict[str, Tensor]] | None = None
+        self,
+        config: TDMPCConfig | None = None,
+        dataset_stats: dict[str, dict[str, Tensor]] | None = None,
     ):
         """
         Args:
@@ -100,7 +102,9 @@ class TDMPCPolicy(
             config.output_shapes, config.output_normalization_modes, dataset_stats
         )
 
-        image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
+        image_keys = [
+            k for k in config.input_shapes if k.startswith("observation.image")
+        ]
         # Note: This check is covered in the post-init of the config but have a sanity check just in case.
         self._use_image = False
         self._use_env_state = False
@@ -120,7 +124,9 @@ class TDMPCPolicy(
         """
         self._queues = {
             "observation.state": deque(maxlen=1),
-            "action": deque(maxlen=max(self.config.n_action_steps, self.config.n_action_repeats)),
+            "action": deque(
+                maxlen=max(self.config.n_action_steps, self.config.n_action_repeats)
+            ),
         }
         if self._use_image:
             self._queues["observation.image"] = deque(maxlen=1)
@@ -135,7 +141,9 @@ class TDMPCPolicy(
         """Select a single action given environment observations."""
         batch = self.normalize_inputs(batch)
         if self._use_image:
-            batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
+            batch = dict(
+                batch
+            )  # shallow copy so that adding a key doesn't modify the original
             batch["observation.image"] = batch[self.input_image_key]
 
         self._queues = populate_queues(self._queues, batch)
@@ -209,13 +217,20 @@ class TDMPCPolicy(
 
         # In the CEM loop we will need this for a call to estimate_value with the gaussian sampled
         # trajectories.
-        z = einops.repeat(z, "b d -> n b d", n=self.config.n_gaussian_samples + self.config.n_pi_samples)
+        z = einops.repeat(
+            z,
+            "b d -> n b d",
+            n=self.config.n_gaussian_samples + self.config.n_pi_samples,
+        )
 
         # Model Predictive Path Integral (MPPI) with the cross-entropy method (CEM) as the optimization
         # algorithm.
         # The initial mean and standard deviation for the cross-entropy method (CEM).
         mean = torch.zeros(
-            self.config.horizon, batch_size, self.config.output_shapes["action"][0], device=device
+            self.config.horizon,
+            batch_size,
+            self.config.output_shapes["action"][0],
+            device=device,
         )
         # Maybe warm start CEM with the mean from the previous step.
         if self._prev_mean is not None:
@@ -231,35 +246,47 @@ class TDMPCPolicy(
                 self.config.output_shapes["action"][0],
                 device=std.device,
             )
-            gaussian_actions = torch.clamp(mean.unsqueeze(1) + std.unsqueeze(1) * std_normal_noise, -1, 1)
+            gaussian_actions = torch.clamp(
+                mean.unsqueeze(1) + std.unsqueeze(1) * std_normal_noise, -1, 1
+            )
 
             # Compute elite actions.
             actions = torch.cat([gaussian_actions, pi_actions], dim=1)
             value = self.estimate_value(z, actions).nan_to_num_(0)
-            elite_idxs = torch.topk(value, self.config.n_elites, dim=0).indices  # (n_elites, batch)
+            elite_idxs = torch.topk(
+                value, self.config.n_elites, dim=0
+            ).indices  # (n_elites, batch)
             elite_value = value.take_along_dim(elite_idxs, dim=0)  # (n_elites, batch)
             # (horizon, n_elites, batch, action_dim)
-            elite_actions = actions.take_along_dim(einops.rearrange(elite_idxs, "n b -> 1 n b 1"), dim=1)
+            elite_actions = actions.take_along_dim(
+                einops.rearrange(elite_idxs, "n b -> 1 n b 1"), dim=1
+            )
 
             # Update gaussian PDF parameters to be the (weighted) mean and standard deviation of the elites.
             max_value = elite_value.max(0, keepdim=True)[0]  # (1, batch)
             # The weighting is a softmax over trajectory values. Note that this is not the same as the usage
             # of Ω in eqn 4 of the TD-MPC paper. Instead it is the normalized version of it: s = Ω/ΣΩ. This
             # makes the equations: μ = Σ(s⋅Γ), σ = Σ(s⋅(Γ-μ)²).
-            score = torch.exp(self.config.elite_weighting_temperature * (elite_value - max_value))
+            score = torch.exp(
+                self.config.elite_weighting_temperature * (elite_value - max_value)
+            )
             score /= score.sum(axis=0, keepdim=True)
             # (horizon, batch, action_dim)
-            _mean = torch.sum(einops.rearrange(score, "n b -> n b 1") * elite_actions, dim=1)
+            _mean = torch.sum(
+                einops.rearrange(score, "n b -> n b 1") * elite_actions, dim=1
+            )
             _std = torch.sqrt(
                 torch.sum(
                     einops.rearrange(score, "n b -> n b 1")
-                    * (elite_actions - einops.rearrange(_mean, "h b d -> h 1 b d")) ** 2,
+                    * (elite_actions - einops.rearrange(_mean, "h b d -> h 1 b d"))
+                    ** 2,
                     dim=1,
                 )
             )
             # Update mean with an exponential moving average, and std with a direct replacement.
             mean = (
-                self.config.gaussian_mean_momentum * mean + (1 - self.config.gaussian_mean_momentum) * _mean
+                self.config.gaussian_mean_momentum * mean
+                + (1 - self.config.gaussian_mean_momentum) * _mean
             )
             std = _std.clamp_(self.config.min_std, self.config.max_std)
 
@@ -268,7 +295,9 @@ class TDMPCPolicy(
 
         # Randomly select one of the elite actions from the last iteration of MPPI/CEM using the softmax
         # scores from the last iteration.
-        actions = elite_actions[:, torch.multinomial(score.T, 1).squeeze(), torch.arange(batch_size)]
+        actions = elite_actions[
+            :, torch.multinomial(score.T, 1).squeeze(), torch.arange(batch_size)
+        ]
 
         return actions
 
@@ -291,7 +320,8 @@ class TDMPCPolicy(
             # of the FOWM paper.
             if self.config.uncertainty_regularizer_coeff > 0:
                 regularization = -(
-                    self.config.uncertainty_regularizer_coeff * self.model.Qs(z, actions[t]).std(0)
+                    self.config.uncertainty_regularizer_coeff
+                    * self.model.Qs(z, actions[t]).std(0)
                 )
             else:
                 regularization = 0
@@ -311,15 +341,22 @@ class TDMPCPolicy(
         if self.config.q_ensemble_size > 2:
             G += (
                 running_discount
-                * torch.min(terminal_values[torch.randint(0, self.config.q_ensemble_size, size=(2,))], dim=0)[
-                    0
-                ]
+                * torch.min(
+                    terminal_values[
+                        torch.randint(0, self.config.q_ensemble_size, size=(2,))
+                    ],
+                    dim=0,
+                )[0]
             )
         else:
             G += running_discount * torch.min(terminal_values, dim=0)[0]
         # Finally, also regularize the terminal value.
         if self.config.uncertainty_regularizer_coeff > 0:
-            G -= running_discount * self.config.uncertainty_regularizer_coeff * terminal_values.std(0)
+            G -= (
+                running_discount
+                * self.config.uncertainty_regularizer_coeff
+                * terminal_values.std(0)
+            )
         return G
 
     def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor | float]:
@@ -331,7 +368,9 @@ class TDMPCPolicy(
 
         batch = self.normalize_inputs(batch)
         if self._use_image:
-            batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
+            batch = dict(
+                batch
+            )  # shallow copy so that adding a key doesn't modify the original
             batch["observation.image"] = batch[self.input_image_key]
         batch = self.normalize_targets(batch)
 
@@ -349,7 +388,10 @@ class TDMPCPolicy(
         # Apply random image augmentations.
         if self._use_image and self.config.max_random_shift_ratio > 0:
             observations["observation.image"] = flatten_forward_unflatten(
-                partial(random_shifts_aug, max_random_shift_ratio=self.config.max_random_shift_ratio),
+                partial(
+                    random_shifts_aug,
+                    max_random_shift_ratio=self.config.max_random_shift_ratio,
+                ),
                 observations["observation.image"],
             )
 
@@ -367,14 +409,20 @@ class TDMPCPolicy(
         # Note this has shape `horizon+1` because there are `horizon` actions and a current `z`. Each action
         # gives us a next `z`.
         batch_size = batch["index"].shape[0]
-        z_preds = torch.empty(horizon + 1, batch_size, self.config.latent_dim, device=device)
+        z_preds = torch.empty(
+            horizon + 1, batch_size, self.config.latent_dim, device=device
+        )
         z_preds[0] = self.model.encode(current_observation)
         reward_preds = torch.empty_like(reward, device=device)
         for t in range(horizon):
-            z_preds[t + 1], reward_preds[t] = self.model.latent_dynamics_and_reward(z_preds[t], action[t])
+            z_preds[t + 1], reward_preds[t] = self.model.latent_dynamics_and_reward(
+                z_preds[t], action[t]
+            )
 
         # Compute Q and V value predictions based on the latent rollout.
-        q_preds_ensemble = self.model.Qs(z_preds[:-1], action)  # (ensemble, horizon, batch)
+        q_preds_ensemble = self.model.Qs(
+            z_preds[:-1], action
+        )  # (ensemble, horizon, batch)
         v_preds = self.model.V(z_preds[:-1])
         info.update({"Q": q_preds_ensemble.mean().item(), "V": v_preds.mean().item()})
 
@@ -388,10 +436,14 @@ class TDMPCPolicy(
             # actions (not actions estimated by π).
             # Note: Here we do not use self.model_target, but self.model. This is to follow the original code
             # and the FOWM paper.
-            q_targets = reward + self.config.discount * self.model.V(self.model.encode(next_observations))
+            q_targets = reward + self.config.discount * self.model.V(
+                self.model.encode(next_observations)
+            )
             # From eqn 3 of FOWM. These appear as Q(z, a). Here we call them v_targets to emphasize that we
             # are using them to compute loss for V.
-            v_targets = self.model_target.Qs(z_preds[:-1].detach(), action, return_min=True)
+            v_targets = self.model_target.Qs(
+                z_preds[:-1].detach(), action, return_min=True
+            )
 
         # Compute losses.
         # Exponentially decay the loss weight with respect to the timestep. Steps that are more distant in the
@@ -434,7 +486,9 @@ class TDMPCPolicy(
                 temporal_loss_coeffs
                 * F.mse_loss(
                     q_preds_ensemble,
-                    einops.repeat(q_targets, "t b -> e t b", e=q_preds_ensemble.shape[0]),
+                    einops.repeat(
+                        q_targets, "t b -> e t b", e=q_preds_ensemble.shape[0]
+                    ),
                     reduction="none",
                 ).sum(0)  # sum over ensemble
                 # `q_preds_ensemble` depends on the first observation and the actions.
@@ -472,12 +526,14 @@ class TDMPCPolicy(
         z_preds = z_preds.detach()
         # Use stopgrad for the advantage calculation.
         with torch.no_grad():
-            advantage = self.model_target.Qs(z_preds[:-1], action, return_min=True) - self.model.V(
-                z_preds[:-1]
-            )
+            advantage = self.model_target.Qs(
+                z_preds[:-1], action, return_min=True
+            ) - self.model.V(z_preds[:-1])
             info["advantage"] = advantage[0]
             # (t, b)
-            exp_advantage = torch.clamp(torch.exp(advantage * self.config.advantage_scaling), max=100.0)
+            exp_advantage = torch.clamp(
+                torch.exp(advantage * self.config.advantage_scaling), max=100.0
+            )
         action_preds = self.model.pi(z_preds[:-1])  # (t, b, a)
         # Calculate the MSE between the actions and the action predictions.
         # Note: FOWM's original code calculates the log probability (wrt to a unit standard deviation
@@ -532,7 +588,9 @@ class TDMPCPolicy(
         # Note a minor variation with respect to the original FOWM code. Here they do this based on an EMA
         # update frequency parameter which is set to 2 (every 2 steps an update is done). To simplify the code
         # we update every step and adjust the decay parameter `alpha` accordingly (0.99 -> 0.995)
-        update_ema_parameters(self.model_target, self.model, self.config.target_model_momentum)
+        update_ema_parameters(
+            self.model_target, self.model, self.config.target_model_momentum
+        )
 
 
 class TDMPCTOLD(nn.Module):
@@ -543,7 +601,9 @@ class TDMPCTOLD(nn.Module):
         self.config = config
         self._encoder = TDMPCObservationEncoder(config)
         self._dynamics = nn.Sequential(
-            nn.Linear(config.latent_dim + config.output_shapes["action"][0], config.mlp_dim),
+            nn.Linear(
+                config.latent_dim + config.output_shapes["action"][0], config.mlp_dim
+            ),
             nn.LayerNorm(config.mlp_dim),
             nn.Mish(),
             nn.Linear(config.mlp_dim, config.mlp_dim),
@@ -554,7 +614,9 @@ class TDMPCTOLD(nn.Module):
             nn.Sigmoid(),
         )
         self._reward = nn.Sequential(
-            nn.Linear(config.latent_dim + config.output_shapes["action"][0], config.mlp_dim),
+            nn.Linear(
+                config.latent_dim + config.output_shapes["action"][0], config.mlp_dim
+            ),
             nn.LayerNorm(config.mlp_dim),
             nn.Mish(),
             nn.Linear(config.mlp_dim, config.mlp_dim),
@@ -574,7 +636,10 @@ class TDMPCTOLD(nn.Module):
         self._Qs = nn.ModuleList(
             [
                 nn.Sequential(
-                    nn.Linear(config.latent_dim + config.output_shapes["action"][0], config.mlp_dim),
+                    nn.Linear(
+                        config.latent_dim + config.output_shapes["action"][0],
+                        config.mlp_dim,
+                    ),
                     nn.LayerNorm(config.mlp_dim),
                     nn.Tanh(),
                     nn.Linear(config.mlp_dim, config.mlp_dim),
@@ -619,7 +684,9 @@ class TDMPCTOLD(nn.Module):
                 m[-1], nn.Linear
             ), "Sanity check. The last linear layer needs 0 initialization on weights."
             nn.init.zeros_(m[-1].weight)
-            nn.init.zeros_(m[-1].bias)  # this has already been done, but keep this line here for good measure
+            nn.init.zeros_(
+                m[-1].bias
+            )  # this has already been done, but keep this line here for good measure
 
     def encode(self, obs: dict[str, Tensor]) -> Tensor:
         """Encodes an observation into its latent representation."""
@@ -717,14 +784,32 @@ class TDMPCObservationEncoder(nn.Module):
         if "observation.image" in config.input_shapes:
             self.image_enc_layers = nn.Sequential(
                 nn.Conv2d(
-                    config.input_shapes["observation.image"][0], config.image_encoder_hidden_dim, 7, stride=2
+                    config.input_shapes["observation.image"][0],
+                    config.image_encoder_hidden_dim,
+                    7,
+                    stride=2,
                 ),
                 nn.ReLU(),
-                nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 5, stride=2),
+                nn.Conv2d(
+                    config.image_encoder_hidden_dim,
+                    config.image_encoder_hidden_dim,
+                    5,
+                    stride=2,
+                ),
                 nn.ReLU(),
-                nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
+                nn.Conv2d(
+                    config.image_encoder_hidden_dim,
+                    config.image_encoder_hidden_dim,
+                    3,
+                    stride=2,
+                ),
                 nn.ReLU(),
-                nn.Conv2d(config.image_encoder_hidden_dim, config.image_encoder_hidden_dim, 3, stride=2),
+                nn.Conv2d(
+                    config.image_encoder_hidden_dim,
+                    config.image_encoder_hidden_dim,
+                    3,
+                    stride=2,
+                ),
                 nn.ReLU(),
             )
             dummy_batch = torch.zeros(1, *config.input_shapes["observation.image"])
@@ -740,7 +825,10 @@ class TDMPCObservationEncoder(nn.Module):
             )
         if "observation.state" in config.input_shapes:
             self.state_enc_layers = nn.Sequential(
-                nn.Linear(config.input_shapes["observation.state"][0], config.state_encoder_hidden_dim),
+                nn.Linear(
+                    config.input_shapes["observation.state"][0],
+                    config.state_encoder_hidden_dim,
+                ),
                 nn.ELU(),
                 nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
                 nn.LayerNorm(config.latent_dim),
@@ -749,7 +837,8 @@ class TDMPCObservationEncoder(nn.Module):
         if "observation.environment_state" in config.input_shapes:
             self.env_state_enc_layers = nn.Sequential(
                 nn.Linear(
-                    config.input_shapes["observation.environment_state"][0], config.state_encoder_hidden_dim
+                    config.input_shapes["observation.environment_state"][0],
+                    config.state_encoder_hidden_dim,
                 ),
                 nn.ELU(),
                 nn.Linear(config.state_encoder_hidden_dim, config.latent_dim),
@@ -766,9 +855,15 @@ class TDMPCObservationEncoder(nn.Module):
         feat = []
         # NOTE: Order of observations matters here.
         if "observation.image" in self.config.input_shapes:
-            feat.append(flatten_forward_unflatten(self.image_enc_layers, obs_dict["observation.image"]))
+            feat.append(
+                flatten_forward_unflatten(
+                    self.image_enc_layers, obs_dict["observation.image"]
+                )
+            )
         if "observation.environment_state" in self.config.input_shapes:
-            feat.append(self.env_state_enc_layers(obs_dict["observation.environment_state"]))
+            feat.append(
+                self.env_state_enc_layers(obs_dict["observation.environment_state"])
+            )
         if "observation.state" in self.config.input_shapes:
             feat.append(self.state_enc_layers(obs_dict["observation.state"]))
         return torch.stack(feat, dim=0).mean(0)
@@ -811,12 +906,17 @@ def update_ema_parameters(ema_net: nn.Module, net: nn.Module, alpha: float):
     """Update EMA parameters in place with ema_param <- alpha * ema_param + (1 - alpha) * param."""
     for ema_module, module in zip(ema_net.modules(), net.modules(), strict=True):
         for (n_p_ema, p_ema), (n_p, p) in zip(
-            ema_module.named_parameters(recurse=False), module.named_parameters(recurse=False), strict=True
+            ema_module.named_parameters(recurse=False),
+            module.named_parameters(recurse=False),
+            strict=True,
         ):
             assert n_p_ema == n_p, "Parameter names don't match for EMA model update"
             if isinstance(p, dict):
                 raise RuntimeError("Dict parameter not supported")
-            if isinstance(module, nn.modules.batchnorm._BatchNorm) or not p.requires_grad:
+            if (
+                isinstance(module, nn.modules.batchnorm._BatchNorm)
+                or not p.requires_grad
+            ):
                 # Copy BatchNorm parameters, and non-trainable parameters directly.
                 p_ema.copy_(p.to(dtype=p_ema.dtype).data)
             with torch.no_grad():
@@ -824,7 +924,9 @@ def update_ema_parameters(ema_net: nn.Module, net: nn.Module, alpha: float):
                 p_ema.add_(p.to(dtype=p_ema.dtype).data, alpha=1 - alpha)
 
 
-def flatten_forward_unflatten(fn: Callable[[Tensor], Tensor], image_tensor: Tensor) -> Tensor:
+def flatten_forward_unflatten(
+    fn: Callable[[Tensor], Tensor], image_tensor: Tensor
+) -> Tensor:
     """Helper to temporarily flatten extra dims at the start of the image tensor.
 
     Args:

lerobot/common/policies/vqbet/configuration_vqbet.py

@@ -109,7 +109,9 @@ class VQBeTConfig:
             "observation.state": "min_max",
         }
     )
-    output_normalization_modes: dict[str, str] = field(default_factory=lambda: {"action": "min_max"})
+    output_normalization_modes: dict[str, str] = field(
+        default_factory=lambda: {"action": "min_max"}
+    )
 
     # Architecture / modeling.
     # Vision backbone.

lerobot/common/policies/vqbet/modeling_vqbet.py

@@ -79,7 +79,9 @@ class VQBeTPolicy(
 
         self.vqbet = VQBeTModel(config)
 
-        self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
+        self.expected_image_keys = [
+            k for k in config.input_shapes if k.startswith("observation.image")
+        ]
 
         self.reset()
 
@@ -104,8 +106,12 @@ class VQBeTPolicy(
         """
 
         batch = self.normalize_inputs(batch)
-        batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
-        batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
+        batch = dict(
+            batch
+        )  # shallow copy so that adding a key doesn't modify the original
+        batch["observation.images"] = torch.stack(
+            [batch[k] for k in self.expected_image_keys], dim=-4
+        )
         # Note: It's important that this happens after stacking the images into a single key.
         self._queues = populate_queues(self._queues, batch)
 
@@ -116,8 +122,14 @@ class VQBeTPolicy(
             )
 
         if len(self._queues["action"]) == 0:
-            batch = {k: torch.stack(list(self._queues[k]), dim=1) for k in batch if k in self._queues}
-            actions = self.vqbet(batch, rollout=True)[:, : self.config.action_chunk_size]
+            batch = {
+                k: torch.stack(list(self._queues[k]), dim=1)
+                for k in batch
+                if k in self._queues
+            }
+            actions = self.vqbet(batch, rollout=True)[
+                :, : self.config.action_chunk_size
+            ]
 
             # the dimension of returned action is (batch_size, action_chunk_size, action_dim)
             actions = self.unnormalize_outputs({"action": actions})["action"]
@@ -130,8 +142,12 @@ class VQBeTPolicy(
     def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
         """Run the batch through the model and compute the loss for training or validation."""
         batch = self.normalize_inputs(batch)
-        batch = dict(batch)  # shallow copy so that adding a key doesn't modify the original
-        batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
+        batch = dict(
+            batch
+        )  # shallow copy so that adding a key doesn't modify the original
+        batch["observation.images"] = torch.stack(
+            [batch[k] for k in self.expected_image_keys], dim=-4
+        )
         batch = self.normalize_targets(batch)
         # VQ-BeT discretizes action using VQ-VAE before training BeT (please refer to section 3.2 in the VQ-BeT paper https://arxiv.org/pdf/2403.03181)
         if not self.vqbet.action_head.vqvae_model.discretized.item():
@@ -139,7 +155,9 @@ class VQBeTPolicy(
             # n_different_codes: how many of the total possible VQ codes are being used in single batch (how many of them have at least one encoder embedding as a nearest neighbor). This can be at most `vqvae_n_embed * number of layers of RVQ (=2)`.
             # n_different_combinations: how many different code combinations are being used out of all possible combinations in single batch. This can be at most `vqvae_n_embed ^ number of layers of RVQ (=2)` (hint consider the RVQ as a decision tree).
             loss, n_different_codes, n_different_combinations, recon_l1_error = (
-                self.vqbet.action_head.discretize(self.config.n_vqvae_training_steps, batch["action"])
+                self.vqbet.action_head.discretize(
+                    self.config.n_vqvae_training_steps, batch["action"]
+                )
             )
             return {
                 "loss": loss,
@@ -196,7 +214,9 @@ class SpatialSoftmax(nn.Module):
 
         # we could use torch.linspace directly but that seems to behave slightly differently than numpy
         # and causes a small degradation in pc_success of pre-trained models.
-        pos_x, pos_y = np.meshgrid(np.linspace(-1.0, 1.0, self._in_w), np.linspace(-1.0, 1.0, self._in_h))
+        pos_x, pos_y = np.meshgrid(
+            np.linspace(-1.0, 1.0, self._in_w), np.linspace(-1.0, 1.0, self._in_h)
+        )
         pos_x = torch.from_numpy(pos_x.reshape(self._in_h * self._in_w, 1)).float()
         pos_y = torch.from_numpy(pos_y.reshape(self._in_h * self._in_w, 1)).float()
         # register as buffer so it's moved to the correct device.
@@ -288,14 +308,17 @@ class VQBeTModel(nn.Module):
         self.config = config
 
         self.rgb_encoder = VQBeTRgbEncoder(config)
-        self.num_images = len([k for k in config.input_shapes if k.startswith("observation.image")])
+        self.num_images = len(
+            [k for k in config.input_shapes if k.startswith("observation.image")]
+        )
         # This action query token is used as a prompt for querying action chunks. Please refer to "A_Q" in the image above.
         # Note: During the forward pass, this token is repeated as many times as needed. The authors also experimented with initializing the necessary number of tokens independently and observed inferior results.
         self.action_token = nn.Parameter(torch.randn(1, 1, self.config.gpt_input_dim))
 
         # To input state and observation features into GPT layers, we first project the features to fit the shape of input size of GPT.
         self.state_projector = MLP(
-            config.input_shapes["observation.state"][0], hidden_channels=[self.config.gpt_input_dim]
+            config.input_shapes["observation.state"][0],
+            hidden_channels=[self.config.gpt_input_dim],
         )
         self.rgb_feature_projector = MLP(
             self.rgb_encoder.feature_dim, hidden_channels=[self.config.gpt_input_dim]
@@ -310,7 +333,12 @@ class VQBeTModel(nn.Module):
         num_tokens = self.config.n_action_pred_token + self.config.n_obs_steps - 1
         self.register_buffer(
             "select_target_actions_indices",
-            torch.row_stack([torch.arange(i, i + self.config.action_chunk_size) for i in range(num_tokens)]),
+            torch.row_stack(
+                [
+                    torch.arange(i, i + self.config.action_chunk_size)
+                    for i in range(num_tokens)
+                ]
+            ),
         )
 
     def forward(self, batch: dict[str, Tensor], rollout: bool) -> Tensor:
@@ -325,7 +353,11 @@ class VQBeTModel(nn.Module):
         )
         # Separate batch and sequence dims.
         img_features = einops.rearrange(
-            img_features, "(b s n) ... -> b s n ...", b=batch_size, s=n_obs_steps, n=self.num_images
+            img_features,
+            "(b s n) ... -> b s n ...",
+            b=batch_size,
+            s=n_obs_steps,
+            n=self.num_images,
         )
 
         # Arrange prior and current observation step tokens as shown in the class docstring.
@@ -337,13 +369,19 @@ class VQBeTModel(nn.Module):
         input_tokens.append(
             self.state_projector(batch["observation.state"])
         )  # (batch, obs_step, projection dims)
-        input_tokens.append(einops.repeat(self.action_token, "1 1 d -> b n d", b=batch_size, n=n_obs_steps))
+        input_tokens.append(
+            einops.repeat(
+                self.action_token, "1 1 d -> b n d", b=batch_size, n=n_obs_steps
+            )
+        )
         # Interleave tokens by stacking and rearranging.
         input_tokens = torch.stack(input_tokens, dim=2)
         input_tokens = einops.rearrange(input_tokens, "b n t d -> b (n t) d")
 
         len_additional_action_token = self.config.n_action_pred_token - 1
-        future_action_tokens = self.action_token.repeat(batch_size, len_additional_action_token, 1)
+        future_action_tokens = self.action_token.repeat(
+            batch_size, len_additional_action_token, 1
+        )
 
         # add additional action query tokens for predicting future action chunks
         input_tokens = torch.cat([input_tokens, future_action_tokens], dim=1)
@@ -352,9 +390,9 @@ class VQBeTModel(nn.Module):
         features = self.policy(input_tokens)
         # len(self.config.input_shapes) is the number of different observation modes.
         # this line gets the index of action prompt tokens.
-        historical_act_pred_index = np.arange(0, n_obs_steps) * (len(self.config.input_shapes) + 1) + len(
-            self.config.input_shapes
-        )
+        historical_act_pred_index = np.arange(0, n_obs_steps) * (
+            len(self.config.input_shapes) + 1
+        ) + len(self.config.input_shapes)
 
         # only extract the output tokens at the position of action query:
         # Behavior Transformer (BeT), and VQ-BeT are both sequence-to-sequence prediction models,
@@ -362,7 +400,11 @@ class VQBeTModel(nn.Module):
         # Thus, it predicts a historical action sequence, in addition to current and future actions (predicting future actions : optional).
         if len_additional_action_token > 0:
             features = torch.cat(
-                [features[:, historical_act_pred_index], features[:, -len_additional_action_token:]], dim=1
+                [
+                    features[:, historical_act_pred_index],
+                    features[:, -len_additional_action_token:],
+                ],
+                dim=1,
             )
         else:
             features = features[:, historical_act_pred_index]
@@ -370,13 +412,15 @@ class VQBeTModel(nn.Module):
         action_head_output = self.action_head(features)
         # if rollout, VQ-BeT don't calculate loss
         if rollout:
-            return action_head_output["predicted_action"][:, n_obs_steps - 1, :].reshape(
-                batch_size, self.config.action_chunk_size, -1
-            )
+            return action_head_output["predicted_action"][
+                :, n_obs_steps - 1, :
+            ].reshape(batch_size, self.config.action_chunk_size, -1)
         # else, it calculate overall loss (bin prediction loss, and offset loss)
         else:
             output = batch["action"][:, self.select_target_actions_indices]
-            loss = self.action_head.loss_fn(action_head_output, output, reduction="mean")
+            loss = self.action_head.loss_fn(
+                action_head_output, output, reduction="mean"
+            )
             return action_head_output, loss
 
 
@@ -411,7 +455,9 @@ class VQBeTHead(nn.Module):
         else:
             self.map_to_cbet_preds_bin = MLP(
                 in_channels=config.gpt_output_dim,
-                hidden_channels=[self.vqvae_model.vqvae_num_layers * self.config.vqvae_n_embed],
+                hidden_channels=[
+                    self.vqvae_model.vqvae_num_layers * self.config.vqvae_n_embed
+                ],
             )
         self.map_to_cbet_preds_offset = MLP(
             in_channels=config.gpt_output_dim,
@@ -438,7 +484,10 @@ class VQBeTHead(nn.Module):
 
         loss, metric = self.vqvae_model.vqvae_forward(actions)
         n_different_codes = sum(
-            [len(torch.unique(metric[2][:, i])) for i in range(self.vqvae_model.vqvae_num_layers)]
+            [
+                len(torch.unique(metric[2][:, i]))
+                for i in range(self.vqvae_model.vqvae_num_layers)
+            ]
         )
         n_different_combinations = len(torch.unique(metric[2], dim=0))
         recon_l1_error = metric[0].detach().cpu().item()
@@ -485,7 +534,13 @@ class VQBeTHead(nn.Module):
 
             cbet_secondary_logits = self.map_to_cbet_preds_secondary_bin(
                 torch.cat(
-                    (x, F.one_hot(sampled_primary_centers, num_classes=self.config.vqvae_n_embed)),
+                    (
+                        x,
+                        F.one_hot(
+                            sampled_primary_centers,
+                            num_classes=self.config.vqvae_n_embed,
+                        ),
+                    ),
                     axis=1,
                 )
             )
@@ -493,19 +548,29 @@ class VQBeTHead(nn.Module):
                 cbet_secondary_logits / self.config.bet_softmax_temperature, dim=-1
             )
             sampled_secondary_centers = einops.rearrange(
-                torch.multinomial(cbet_secondary_probs.view(-1, choices), num_samples=1),
+                torch.multinomial(
+                    cbet_secondary_probs.view(-1, choices), num_samples=1
+                ),
                 "(NT) 1 -> NT",
                 NT=NT,
             )
-            sampled_centers = torch.stack((sampled_primary_centers, sampled_secondary_centers), axis=1)
-            cbet_logits = torch.stack([cbet_primary_logits, cbet_secondary_logits], dim=1)
+            sampled_centers = torch.stack(
+                (sampled_primary_centers, sampled_secondary_centers), axis=1
+            )
+            cbet_logits = torch.stack(
+                [cbet_primary_logits, cbet_secondary_logits], dim=1
+            )
         # if self.config.sequentially_select is False, bin prediction head samples primary and secondary code at once.
         else:
             cbet_logits = self.map_to_cbet_preds_bin(x)
             cbet_logits = einops.rearrange(
-                cbet_logits, "(NT) (G C) -> (NT) G C", G=self.vqvae_model.vqvae_num_layers
+                cbet_logits,
+                "(NT) (G C) -> (NT) G C",
+                G=self.vqvae_model.vqvae_num_layers,
+            )
+            cbet_probs = torch.softmax(
+                cbet_logits / self.config.bet_softmax_temperature, dim=-1
             )
-            cbet_probs = torch.softmax(cbet_logits / self.config.bet_softmax_temperature, dim=-1)
             NT, G, choices = cbet_probs.shape
             sampled_centers = einops.rearrange(
                 torch.multinomial(cbet_probs.view(-1, choices), num_samples=1),
@@ -525,9 +590,17 @@ class VQBeTHead(nn.Module):
         sampled_offsets = sampled_offsets.sum(dim=1)
         with torch.no_grad():
             # Get the centroids (= vectors corresponding to the codes) of each layer to pass it through RVQ decoder
-            return_decoder_input = self.vqvae_model.get_embeddings_from_code(sampled_centers).clone().detach()
+            return_decoder_input = (
+                self.vqvae_model.get_embeddings_from_code(sampled_centers)
+                .clone()
+                .detach()
+            )
             # pass the centroids through decoder to get actions.
-            decoded_action = self.vqvae_model.get_action_from_latent(return_decoder_input).clone().detach()
+            decoded_action = (
+                self.vqvae_model.get_action_from_latent(return_decoder_input)
+                .clone()
+                .detach()
+            )
         # reshaped extracted offset to match with decoded centroids
         sampled_offsets = einops.rearrange(
             sampled_offsets, "NT (W A) -> NT W A", W=self.config.action_chunk_size
@@ -576,7 +649,9 @@ class VQBeTHead(nn.Module):
         # Figure out the loss for the actions.
         # First, we need to find the closest cluster center for each ground truth action.
         with torch.no_grad():
-            state_vq, action_bins = self.vqvae_model.get_code(action_seq)  # action_bins: NT, G
+            state_vq, action_bins = self.vqvae_model.get_code(
+                action_seq
+            )  # action_bins: NT, G
 
         # Now we can compute the loss.
 
@@ -599,8 +674,12 @@ class VQBeTHead(nn.Module):
             + cbet_loss2 * self.config.secondary_code_loss_weight
         )
 
-        equal_primary_code_rate = torch.sum((action_bins[:, 0] == sampled_centers[:, 0]).int()) / (NT)
-        equal_secondary_code_rate = torch.sum((action_bins[:, 1] == sampled_centers[:, 1]).int()) / (NT)
+        equal_primary_code_rate = torch.sum(
+            (action_bins[:, 0] == sampled_centers[:, 0]).int()
+        ) / (NT)
+        equal_secondary_code_rate = torch.sum(
+            (action_bins[:, 1] == sampled_centers[:, 1]).int()
+        ) / (NT)
 
         action_mse_error = torch.mean((action_seq - predicted_action) ** 2)
         vq_action_error = torch.mean(torch.abs(action_seq - decoded_action))
@@ -614,7 +693,9 @@ class VQBeTHead(nn.Module):
             "classification_loss": cbet_loss.detach().cpu().item(),
             "offset_loss": offset_loss.detach().cpu().item(),
             "equal_primary_code_rate": equal_primary_code_rate.detach().cpu().item(),
-            "equal_secondary_code_rate": equal_secondary_code_rate.detach().cpu().item(),
+            "equal_secondary_code_rate": equal_secondary_code_rate.detach()
+            .cpu()
+            .item(),
             "vq_action_error": vq_action_error.detach().cpu().item(),
             "offset_action_error": offset_action_error.detach().cpu().item(),
             "action_error_max": action_error_max.detach().cpu().item(),
@@ -643,11 +724,17 @@ class VQBeTOptimizer(torch.optim.Adam):
         if cfg.policy.sequentially_select:
             decay_params = (
                 decay_params
-                + list(policy.vqbet.action_head.map_to_cbet_preds_primary_bin.parameters())
-                + list(policy.vqbet.action_head.map_to_cbet_preds_secondary_bin.parameters())
+                + list(
+                    policy.vqbet.action_head.map_to_cbet_preds_primary_bin.parameters()
+                )
+                + list(
+                    policy.vqbet.action_head.map_to_cbet_preds_secondary_bin.parameters()
+                )
             )
         else:
-            decay_params = decay_params + list(policy.vqbet.action_head.map_to_cbet_preds_bin.parameters())
+            decay_params = decay_params + list(
+                policy.vqbet.action_head.map_to_cbet_preds_bin.parameters()
+            )
 
         optim_groups = [
             {
@@ -693,7 +780,11 @@ class VQBeTScheduler(nn.Module):
                 progress = float(current_step - num_warmup_steps) / float(
                     max(1, num_training_steps - num_warmup_steps)
                 )
-                return max(0.0, 0.5 * (1.0 + math.cos(math.pi * float(num_cycles) * 2.0 * progress)))
+                return max(
+                    0.0,
+                    0.5
+                    * (1.0 + math.cos(math.pi * float(num_cycles) * 2.0 * progress)),
+                )
 
         self.lr_scheduler = LambdaLR(optimizer, lr_lambda, -1)
 
@@ -717,7 +808,9 @@ class VQBeTRgbEncoder(nn.Module):
             # Always use center crop for eval
             self.center_crop = torchvision.transforms.CenterCrop(config.crop_shape)
             if config.crop_is_random:
-                self.maybe_random_crop = torchvision.transforms.RandomCrop(config.crop_shape)
+                self.maybe_random_crop = torchvision.transforms.RandomCrop(
+                    config.crop_shape
+                )
             else:
                 self.maybe_random_crop = self.center_crop
         else:
@@ -738,7 +831,9 @@ class VQBeTRgbEncoder(nn.Module):
             self.backbone = _replace_submodules(
                 root_module=self.backbone,
                 predicate=lambda x: isinstance(x, nn.BatchNorm2d),
-                func=lambda x: nn.GroupNorm(num_groups=x.num_features // 16, num_channels=x.num_features),
+                func=lambda x: nn.GroupNorm(
+                    num_groups=x.num_features // 16, num_channels=x.num_features
+                ),
             )
 
         # Set up pooling and final layers.
@@ -746,17 +841,25 @@ class VQBeTRgbEncoder(nn.Module):
         # The dummy input should take the number of image channels from `config.input_shapes` and it should
         # use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
         # height and width from `config.input_shapes`.
-        image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
+        image_keys = [
+            k for k in config.input_shapes if k.startswith("observation.image")
+        ]
         assert len(image_keys) == 1
         image_key = image_keys[0]
         dummy_input_h_w = (
-            config.crop_shape if config.crop_shape is not None else config.input_shapes[image_key][1:]
+            config.crop_shape
+            if config.crop_shape is not None
+            else config.input_shapes[image_key][1:]
+        )
+        dummy_input = torch.zeros(
+            size=(1, config.input_shapes[image_key][0], *dummy_input_h_w)
         )
-        dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *dummy_input_h_w))
         with torch.inference_mode():
             dummy_feature_map = self.backbone(dummy_input)
         feature_map_shape = tuple(dummy_feature_map.shape[1:])
-        self.pool = SpatialSoftmax(feature_map_shape, num_kp=config.spatial_softmax_num_keypoints)
+        self.pool = SpatialSoftmax(
+            feature_map_shape, num_kp=config.spatial_softmax_num_keypoints
+        )
         self.feature_dim = config.spatial_softmax_num_keypoints * 2
         self.out = nn.Linear(config.spatial_softmax_num_keypoints * 2, self.feature_dim)
         self.relu = nn.ReLU()
@@ -783,7 +886,9 @@ class VQBeTRgbEncoder(nn.Module):
 
 
 def _replace_submodules(
-    root_module: nn.Module, predicate: Callable[[nn.Module], bool], func: Callable[[nn.Module], nn.Module]
+    root_module: nn.Module,
+    predicate: Callable[[nn.Module], bool],
+    func: Callable[[nn.Module], nn.Module],
 ) -> nn.Module:
     """
     Args:
@@ -796,7 +901,11 @@ def _replace_submodules(
     if predicate(root_module):
         return func(root_module)
 
-    replace_list = [k.split(".") for k, m in root_module.named_modules(remove_duplicate=True) if predicate(m)]
+    replace_list = [
+        k.split(".")
+        for k, m in root_module.named_modules(remove_duplicate=True)
+        if predicate(m)
+    ]
     for *parents, k in replace_list:
         parent_module = root_module
         if len(parents) > 0:
@@ -811,7 +920,9 @@ def _replace_submodules(
         else:
             setattr(parent_module, k, tgt_module)
     # verify that all BN are replaced
-    assert not any(predicate(m) for _, m in root_module.named_modules(remove_duplicate=True))
+    assert not any(
+        predicate(m) for _, m in root_module.named_modules(remove_duplicate=True)
+    )
     return root_module
 
 
@@ -844,7 +955,8 @@ class VqVae(nn.Module):
         )
 
         self.encoder = MLP(
-            in_channels=self.config.output_shapes["action"][0] * self.config.action_chunk_size,
+            in_channels=self.config.output_shapes["action"][0]
+            * self.config.action_chunk_size,
             hidden_channels=[
                 config.vqvae_enc_hidden_dim,
                 config.vqvae_enc_hidden_dim,
@@ -872,9 +984,13 @@ class VqVae(nn.Module):
         # given latent vector, this function outputs the decoded action.
         output = self.decoder(latent)
         if self.config.action_chunk_size == 1:
-            return einops.rearrange(output, "N (T A) -> N T A", A=self.config.output_shapes["action"][0])
+            return einops.rearrange(
+                output, "N (T A) -> N T A", A=self.config.output_shapes["action"][0]
+            )
         else:
-            return einops.rearrange(output, "N (T A) -> N T A", A=self.config.output_shapes["action"][0])
+            return einops.rearrange(
+                output, "N (T A) -> N T A", A=self.config.output_shapes["action"][0]
+            )
 
     def get_code(self, state):
         # in phase 2 of VQ-BeT training, we need a `ground truth labels of action data` to calculate the Focal loss for code prediction head. (please refer to section 3.3 in the paper https://arxiv.org/pdf/2403.03181)

lerobot/common/policies/vqbet/vqbet_utils.py

@@ -123,9 +123,15 @@ class CausalSelfAttention(nn.Module):
 
         # calculate query, key, values for all heads in batch and move head forward to be the batch dim
         q, k, v = self.c_attn(x).split(self.gpt_hidden_dim, dim=2)
-        k = k.view(B, T, self.gpt_n_head, C // self.gpt_n_head).transpose(1, 2)  # (B, nh, T, hs)
-        q = q.view(B, T, self.gpt_n_head, C // self.gpt_n_head).transpose(1, 2)  # (B, nh, T, hs)
-        v = v.view(B, T, self.gpt_n_head, C // self.gpt_n_head).transpose(1, 2)  # (B, nh, T, hs)
+        k = k.view(B, T, self.gpt_n_head, C // self.gpt_n_head).transpose(
+            1, 2
+        )  # (B, nh, T, hs)
+        q = q.view(B, T, self.gpt_n_head, C // self.gpt_n_head).transpose(
+            1, 2
+        )  # (B, nh, T, hs)
+        v = v.view(B, T, self.gpt_n_head, C // self.gpt_n_head).transpose(
+            1, 2
+        )  # (B, nh, T, hs)
 
         # causal self-attention; Self-attend: (B, nh, T, hs) x (B, nh, hs, T) -> (B, nh, T, T)
         att = (q @ k.transpose(-2, -1)) * (1.0 / math.sqrt(k.size(-1)))
@@ -133,7 +139,9 @@ class CausalSelfAttention(nn.Module):
         att = F.softmax(att, dim=-1)
         att = self.attn_dropout(att)
         y = att @ v  # (B, nh, T, T) x (B, nh, T, hs) -> (B, nh, T, hs)
-        y = y.transpose(1, 2).contiguous().view(B, T, C)  # re-assemble all head outputs side by side
+        y = (
+            y.transpose(1, 2).contiguous().view(B, T, C)
+        )  # re-assemble all head outputs side by side
 
         # output projection
         y = self.resid_dropout(self.c_proj(y))
@@ -189,12 +197,16 @@ class GPT(nn.Module):
                 "ln_f": nn.LayerNorm(config.gpt_hidden_dim),
             }
         )
-        self.lm_head = nn.Linear(config.gpt_hidden_dim, config.gpt_output_dim, bias=False)
+        self.lm_head = nn.Linear(
+            config.gpt_hidden_dim, config.gpt_output_dim, bias=False
+        )
         # init all weights, and apply a special scaled init to the residual projections, per GPT-2 paper
         self.apply(self._init_weights)
         for pn, p in self.named_parameters():
             if pn.endswith("c_proj.weight"):
-                torch.nn.init.normal_(p, mean=0.0, std=0.02 / math.sqrt(2 * config.gpt_n_layer))
+                torch.nn.init.normal_(
+                    p, mean=0.0, std=0.02 / math.sqrt(2 * config.gpt_n_layer)
+                )
 
         # report number of parameters
         n_params = sum(p.numel() for p in self.parameters())
@@ -208,11 +220,17 @@ class GPT(nn.Module):
         ), f"Cannot forward sequence of length {t}, block size is only {self.config.gpt_block_size}"
 
         # positional encodings that are added to the input embeddings
-        pos = torch.arange(0, t, dtype=torch.long, device=device).unsqueeze(0)  # shape (1, t)
+        pos = torch.arange(0, t, dtype=torch.long, device=device).unsqueeze(
+            0
+        )  # shape (1, t)
 
         # forward the GPT model itself
-        tok_emb = self.transformer.wte(input)  # token embeddings of shape (b, t, gpt_hidden_dim)
-        pos_emb = self.transformer.wpe(pos)  # position embeddings of shape (1, t, gpt_hidden_dim)
+        tok_emb = self.transformer.wte(
+            input
+        )  # token embeddings of shape (b, t, gpt_hidden_dim)
+        pos_emb = self.transformer.wpe(
+            pos
+        )  # position embeddings of shape (1, t, gpt_hidden_dim)
         x = self.transformer.drop(tok_emb + pos_emb)
         for block in self.transformer.h:
             x = block(x)
@@ -237,7 +255,9 @@ class GPT(nn.Module):
         # but want to use a smaller block size for some smaller, simpler model
         assert gpt_block_size <= self.config.gpt_block_size
         self.config.gpt_block_size = gpt_block_size
-        self.transformer.wpe.weight = nn.Parameter(self.transformer.wpe.weight[:gpt_block_size])
+        self.transformer.wpe.weight = nn.Parameter(
+            self.transformer.wpe.weight[:gpt_block_size]
+        )
         for block in self.transformer.h:
             block.attn.bias = block.attn.bias[:, :, :gpt_block_size, :gpt_block_size]
 
@@ -270,7 +290,9 @@ class GPT(nn.Module):
         param_dict = dict(self.named_parameters())
         inter_params = decay & no_decay
         union_params = decay | no_decay
-        assert len(inter_params) == 0, "parameters {} made it into both decay/no_decay sets!".format(
+        assert (
+            len(inter_params) == 0
+        ), "parameters {} made it into both decay/no_decay sets!".format(
             str(inter_params)
         )
         assert (
@@ -368,8 +390,12 @@ class ResidualVQ(nn.Module):
         codebook_input_dim = codebook_dim * heads
 
         requires_projection = codebook_input_dim != dim
-        self.project_in = nn.Linear(dim, codebook_input_dim) if requires_projection else nn.Identity()
-        self.project_out = nn.Linear(codebook_input_dim, dim) if requires_projection else nn.Identity()
+        self.project_in = (
+            nn.Linear(dim, codebook_input_dim) if requires_projection else nn.Identity()
+        )
+        self.project_out = (
+            nn.Linear(codebook_input_dim, dim) if requires_projection else nn.Identity()
+        )
 
         self.num_quantizers = num_quantizers
 
@@ -377,7 +403,10 @@ class ResidualVQ(nn.Module):
         self.layers = nn.ModuleList(
             [
                 VectorQuantize(
-                    dim=codebook_dim, codebook_dim=codebook_dim, accept_image_fmap=accept_image_fmap, **kwargs
+                    dim=codebook_dim,
+                    codebook_dim=codebook_dim,
+                    accept_image_fmap=accept_image_fmap,
+                    **kwargs,
                 )
                 for _ in range(num_quantizers)
             ]
@@ -448,7 +477,9 @@ class ResidualVQ(nn.Module):
 
         return all_codes
 
-    def forward(self, x, indices=None, return_all_codes=False, sample_codebook_temp=None):
+    def forward(
+        self, x, indices=None, return_all_codes=False, sample_codebook_temp=None
+    ):
         """
         For given input tensor x, this function will return the quantized output, the indices of the quantized output, and the loss.
         First, the input tensor x is projected to the codebook dimension. Then, the input tensor x is passed through Nq layers of VectorQuantize.
@@ -477,13 +508,17 @@ class ResidualVQ(nn.Module):
             ), "some of the residual vq indices were dropped out. please use indices derived when the module is in eval mode to derive cross entropy loss"
             ce_losses = []
 
-        should_quantize_dropout = self.training and self.quantize_dropout and not return_loss
+        should_quantize_dropout = (
+            self.training and self.quantize_dropout and not return_loss
+        )
 
         # sample a layer index at which to dropout further residual quantization
         # also prepare null indices and loss
 
         if should_quantize_dropout:
-            rand_quantize_dropout_index = randrange(self.quantize_dropout_cutoff_index, num_quant)
+            rand_quantize_dropout_index = randrange(
+                self.quantize_dropout_cutoff_index, num_quant
+            )
 
             if quant_dropout_multiple_of != 1:
                 rand_quantize_dropout_index = (
@@ -492,14 +527,23 @@ class ResidualVQ(nn.Module):
                     - 1
                 )
 
-            null_indices_shape = (x.shape[0], *x.shape[-2:]) if self.accept_image_fmap else tuple(x.shape[:2])
-            null_indices = torch.full(null_indices_shape, -1.0, device=device, dtype=torch.long)
+            null_indices_shape = (
+                (x.shape[0], *x.shape[-2:])
+                if self.accept_image_fmap
+                else tuple(x.shape[:2])
+            )
+            null_indices = torch.full(
+                null_indices_shape, -1.0, device=device, dtype=torch.long
+            )
             null_loss = torch.full((1,), 0.0, device=device, dtype=x.dtype)
 
         # go through the layers
 
         for quantizer_index, layer in enumerate(self.layers):
-            if should_quantize_dropout and quantizer_index > rand_quantize_dropout_index:
+            if (
+                should_quantize_dropout
+                and quantizer_index > rand_quantize_dropout_index
+            ):
                 all_indices.append(null_indices)
                 all_losses.append(null_loss)
                 continue
@@ -539,7 +583,9 @@ class ResidualVQ(nn.Module):
 
         # stack all losses and indices
 
-        all_losses, all_indices = map(partial(torch.stack, dim=-1), (all_losses, all_indices))
+        all_losses, all_indices = map(
+            partial(torch.stack, dim=-1), (all_losses, all_indices)
+        )
 
         ret = (quantized_out, all_indices, all_losses)
 
@@ -599,8 +645,12 @@ class VectorQuantize(nn.Module):
         codebook_input_dim = codebook_dim * heads
 
         requires_projection = codebook_input_dim != dim
-        self.project_in = nn.Linear(dim, codebook_input_dim) if requires_projection else nn.Identity()
-        self.project_out = nn.Linear(codebook_input_dim, dim) if requires_projection else nn.Identity()
+        self.project_in = (
+            nn.Linear(dim, codebook_input_dim) if requires_projection else nn.Identity()
+        )
+        self.project_out = (
+            nn.Linear(codebook_input_dim, dim) if requires_projection else nn.Identity()
+        )
 
         self.eps = eps
         self.commitment_weight = commitment_weight
@@ -614,10 +664,14 @@ class VectorQuantize(nn.Module):
         self.orthogonal_reg_active_codes_only = orthogonal_reg_active_codes_only
         self.orthogonal_reg_max_codes = orthogonal_reg_max_codes
 
-        assert not (ema_update and learnable_codebook), "learnable codebook not compatible with EMA update"
+        assert not (
+            ema_update and learnable_codebook
+        ), "learnable codebook not compatible with EMA update"
 
         assert 0 <= sync_update_v <= 1.0
-        assert not (sync_update_v > 0.0 and not learnable_codebook), "learnable codebook must be turned on"
+        assert not (
+            sync_update_v > 0.0 and not learnable_codebook
+        ), "learnable codebook must be turned on"
 
         self.sync_update_v = sync_update_v
 
@@ -629,7 +683,9 @@ class VectorQuantize(nn.Module):
         )
 
         if sync_codebook is None:
-            sync_codebook = distributed.is_initialized() and distributed.get_world_size() > 1
+            sync_codebook = (
+                distributed.is_initialized() and distributed.get_world_size() > 1
+            )
 
         codebook_kwargs = {
             "dim": codebook_dim,
@@ -794,11 +850,17 @@ class VectorQuantize(nn.Module):
 
             # quantize again
 
-            quantize, embed_ind, distances = self._codebook(x, **codebook_forward_kwargs)
+            quantize, embed_ind, distances = self._codebook(
+                x, **codebook_forward_kwargs
+            )
 
         if self.training:
             # determine code to use for commitment loss
-            maybe_detach = torch.detach if not self.learnable_codebook or freeze_codebook else identity
+            maybe_detach = (
+                torch.detach
+                if not self.learnable_codebook or freeze_codebook
+                else identity
+            )
 
             commit_quantize = maybe_detach(quantize)
 
@@ -808,7 +870,9 @@ class VectorQuantize(nn.Module):
 
             if self.sync_update_v > 0.0:
                 # (21) in https://minyoungg.github.io/vqtorch/assets/draft_050523.pdf
-                quantize = quantize + self.sync_update_v * (quantize - quantize.detach())
+                quantize = quantize + self.sync_update_v * (
+                    quantize - quantize.detach()
+                )
 
         # function for calculating cross entropy loss to distance matrix
         # used for (1) naturalspeech2 training residual vq latents to be close to the correct codes and (2) cross-entropy based commitment loss
@@ -841,7 +905,9 @@ class VectorQuantize(nn.Module):
                 embed_ind = rearrange(embed_ind, "1 (b h) n -> b n h", h=heads)
 
         if self.accept_image_fmap:
-            embed_ind = rearrange(embed_ind, "b (h w) ... -> b h w ...", h=height, w=width)
+            embed_ind = rearrange(
+                embed_ind, "b (h w) ... -> b h w ...", h=height, w=width
+            )
 
         if only_one:
             embed_ind = rearrange(embed_ind, "b 1 -> b")
@@ -895,8 +961,12 @@ class VectorQuantize(nn.Module):
 
                 num_codes = codebook.shape[-2]
 
-                if (self.orthogonal_reg_max_codes is not None) and num_codes > self.orthogonal_reg_max_codes:
-                    rand_ids = torch.randperm(num_codes, device=device)[: self.orthogonal_reg_max_codes]
+                if (
+                    self.orthogonal_reg_max_codes is not None
+                ) and num_codes > self.orthogonal_reg_max_codes:
+                    rand_ids = torch.randperm(num_codes, device=device)[
+                        : self.orthogonal_reg_max_codes
+                    ]
                     codebook = codebook[:, rand_ids]
 
                 orthogonal_reg_loss = orthogonal_loss_fn(codebook)
@@ -928,7 +998,9 @@ class VectorQuantize(nn.Module):
         # if masking, only return quantized for where mask has True
 
         if mask is not None:
-            quantize = torch.where(rearrange(mask, "... -> ... 1"), quantize, orig_input)
+            quantize = torch.where(
+                rearrange(mask, "... -> ... 1"), quantize, orig_input
+            )
 
         return quantize, embed_ind, loss
 
@@ -1038,7 +1110,9 @@ def sample_vectors(samples, num):
 
 
 def batched_sample_vectors(samples, num):
-    return torch.stack([sample_vectors(sample, num) for sample in samples.unbind(dim=0)], dim=0)
+    return torch.stack(
+        [sample_vectors(sample, num) for sample in samples.unbind(dim=0)], dim=0
+    )
 
 
 def pad_shape(shape, size, dim=0):
@@ -1089,7 +1163,9 @@ def sample_vectors_distributed(local_samples, num):
     all_num_samples = all_gather_sizes(local_samples, dim=0)
 
     if rank == 0:
-        samples_per_rank = sample_multinomial(num, all_num_samples / all_num_samples.sum())
+        samples_per_rank = sample_multinomial(
+            num, all_num_samples / all_num_samples.sum()
+        )
     else:
         samples_per_rank = torch.empty_like(all_num_samples)
 
@@ -1202,7 +1278,9 @@ class EuclideanCodebook(nn.Module):
         self.eps = eps
         self.threshold_ema_dead_code = threshold_ema_dead_code
         self.reset_cluster_size = (
-            reset_cluster_size if (reset_cluster_size is not None) else threshold_ema_dead_code
+            reset_cluster_size
+            if (reset_cluster_size is not None)
+            else threshold_ema_dead_code
         )
 
         assert callable(gumbel_sample)
@@ -1213,8 +1291,14 @@ class EuclideanCodebook(nn.Module):
             use_ddp and num_codebooks > 1 and kmeans_init
         ), "kmeans init is not compatible with multiple codebooks in distributed environment for now"
 
-        self.sample_fn = sample_vectors_distributed if use_ddp and sync_kmeans else batched_sample_vectors
-        self.kmeans_all_reduce_fn = distributed.all_reduce if use_ddp and sync_kmeans else noop
+        self.sample_fn = (
+            sample_vectors_distributed
+            if use_ddp and sync_kmeans
+            else batched_sample_vectors
+        )
+        self.kmeans_all_reduce_fn = (
+            distributed.all_reduce if use_ddp and sync_kmeans else noop
+        )
         self.all_reduce_fn = distributed.all_reduce if use_ddp else noop
 
         self.register_buffer("initted", torch.Tensor([not kmeans_init]))
@@ -1353,7 +1437,9 @@ class EuclideanCodebook(nn.Module):
         distributed.all_reduce(variance_numer)
         batch_variance = variance_numer / num_vectors
 
-        self.update_with_decay("batch_variance", batch_variance, self.affine_param_batch_decay)
+        self.update_with_decay(
+            "batch_variance", batch_variance, self.affine_param_batch_decay
+        )
 
     def replace(self, batch_samples, batch_mask):
         for ind, (samples, mask) in enumerate(
@@ -1362,7 +1448,9 @@ class EuclideanCodebook(nn.Module):
             if not torch.any(mask):
                 continue
 
-            sampled = self.sample_fn(rearrange(samples, "... -> 1 ..."), mask.sum().item())
+            sampled = self.sample_fn(
+                rearrange(samples, "... -> 1 ..."), mask.sum().item()
+            )
             sampled = rearrange(sampled, "1 ... -> ...")
 
             self.embed.data[ind][mask] = sampled
@@ -1386,7 +1474,9 @@ class EuclideanCodebook(nn.Module):
     def forward(self, x, sample_codebook_temp=None, mask=None, freeze_codebook=False):
         needs_codebook_dim = x.ndim < 4
         sample_codebook_temp = (
-            sample_codebook_temp if (sample_codebook_temp is not None) else self.sample_codebook_temp
+            sample_codebook_temp
+            if (sample_codebook_temp is not None)
+            else self.sample_codebook_temp
         )
 
         x = x.float()
@@ -1414,7 +1504,9 @@ class EuclideanCodebook(nn.Module):
         if self.affine_param:
             codebook_std = self.codebook_variance.clamp(min=1e-5).sqrt()
             batch_std = self.batch_variance.clamp(min=1e-5).sqrt()
-            embed = (embed - self.codebook_mean) * (batch_std / codebook_std) + self.batch_mean
+            embed = (embed - self.codebook_mean) * (
+                batch_std / codebook_std
+            ) + self.batch_mean
 
         dist = -cdist(flatten, embed)
 
@@ -1432,7 +1524,9 @@ class EuclideanCodebook(nn.Module):
 
         if self.training and self.ema_update and not freeze_codebook:
             if self.affine_param:
-                flatten = (flatten - self.batch_mean) * (codebook_std / batch_std) + self.codebook_mean
+                flatten = (flatten - self.batch_mean) * (
+                    codebook_std / batch_std
+                ) + self.codebook_mean
 
             if mask is not None:
                 embed_onehot[~mask] = 0.0
@@ -1455,7 +1549,9 @@ class EuclideanCodebook(nn.Module):
             self.expire_codes_(x)
 
         if needs_codebook_dim:
-            quantize, embed_ind = tuple(rearrange(t, "1 ... -> ...") for t in (quantize, embed_ind))
+            quantize, embed_ind = tuple(
+                rearrange(t, "1 ... -> ...") for t in (quantize, embed_ind)
+            )
 
         dist = unpack_one(dist, ps, "h * d")
 

lerobot/common/robot_devices/cameras/intelrealsense.py

@@ -65,7 +65,9 @@ def save_image(img_array, serial_number, frame_index, images_dir):
         img.save(str(path), quality=100)
         logging.info(f"Saved image: {path}")
     except Exception as e:
-        logging.error(f"Failed to save image for camera {serial_number} frame {frame_index}: {e}")
+        logging.error(
+            f"Failed to save image for camera {serial_number} frame {frame_index}: {e}"
+        )
 
 
 def save_images_from_cameras(
@@ -94,7 +96,9 @@ def save_images_from_cameras(
     cameras = []
     for cam_sn in serial_numbers:
         print(f"{cam_sn=}")
-        camera = IntelRealSenseCamera(cam_sn, fps=fps, width=width, height=height, mock=mock)
+        camera = IntelRealSenseCamera(
+            cam_sn, fps=fps, width=width, height=height, mock=mock
+        )
         camera.connect()
         print(
             f"IntelRealSenseCamera({camera.serial_number}, fps={camera.fps}, width={camera.width}, height={camera.height}, color_mode={camera.color_mode})"
@@ -140,7 +144,9 @@ def save_images_from_cameras(
                 if time.perf_counter() - start_time > record_time_s:
                     break
 
-                print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
+                print(
+                    f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}"
+                )
 
                 frame_index += 1
     finally:
@@ -182,8 +188,12 @@ class IntelRealSenseCameraConfig:
 
         self.channels = 3
 
-        at_least_one_is_not_none = self.fps is not None or self.width is not None or self.height is not None
-        at_least_one_is_none = self.fps is None or self.width is None or self.height is None
+        at_least_one_is_not_none = (
+            self.fps is not None or self.width is not None or self.height is not None
+        )
+        at_least_one_is_none = (
+            self.fps is None or self.width is None or self.height is None
+        )
         if at_least_one_is_not_none and at_least_one_is_none:
             raise ValueError(
                 "For `fps`, `width` and `height`, either all of them need to be set, or none of them, "
@@ -191,7 +201,9 @@ class IntelRealSenseCameraConfig:
             )
 
         if self.rotation not in [-90, None, 90, 180]:
-            raise ValueError(f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})")
+            raise ValueError(
+                f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})"
+            )
 
 
 class IntelRealSenseCamera:
@@ -286,7 +298,9 @@ class IntelRealSenseCamera:
             self.rotation = cv2.ROTATE_180
 
     @classmethod
-    def init_from_name(cls, name: str, config: IntelRealSenseCameraConfig | None = None, **kwargs):
+    def init_from_name(
+        cls, name: str, config: IntelRealSenseCameraConfig | None = None, **kwargs
+    ):
         camera_infos = find_cameras()
         camera_names = [cam["name"] for cam in camera_infos]
         this_name_count = Counter(camera_names)[name]
@@ -296,7 +310,9 @@ class IntelRealSenseCamera:
                 f"Multiple {name} cameras have been detected. Please use their serial number to instantiate them."
             )
 
-        name_to_serial_dict = {cam["name"]: cam["serial_number"] for cam in camera_infos}
+        name_to_serial_dict = {
+            cam["name"]: cam["serial_number"] for cam in camera_infos
+        }
         cam_sn = name_to_serial_dict[name]
 
         if config is None:
@@ -323,13 +339,17 @@ class IntelRealSenseCamera:
 
         if self.fps and self.width and self.height:
             # TODO(rcadene): can we set rgb8 directly?
-            config.enable_stream(rs.stream.color, self.width, self.height, rs.format.rgb8, self.fps)
+            config.enable_stream(
+                rs.stream.color, self.width, self.height, rs.format.rgb8, self.fps
+            )
         else:
             config.enable_stream(rs.stream.color)
 
         if self.use_depth:
             if self.fps and self.width and self.height:
-                config.enable_stream(rs.stream.depth, self.width, self.height, rs.format.z16, self.fps)
+                config.enable_stream(
+                    rs.stream.depth, self.width, self.height, rs.format.z16, self.fps
+                )
             else:
                 config.enable_stream(rs.stream.depth)
 
@@ -362,7 +382,9 @@ class IntelRealSenseCamera:
         actual_height = color_profile.height()
 
         # Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
-        if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
+        if self.fps is not None and not math.isclose(
+            self.fps, actual_fps, rel_tol=1e-3
+        ):
             # Using `OSError` since it's a broad that encompasses issues related to device communication
             raise OSError(
                 f"Can't set {self.fps=} for IntelRealSenseCamera({self.serial_number}). Actual value is {actual_fps}."
@@ -382,7 +404,9 @@ class IntelRealSenseCamera:
 
         self.is_connected = True
 
-    def read(self, temporary_color: str | None = None) -> np.ndarray | tuple[np.ndarray, np.ndarray]:
+    def read(
+        self, temporary_color: str | None = None
+    ) -> np.ndarray | tuple[np.ndarray, np.ndarray]:
         """Read a frame from the camera returned in the format height x width x channels (e.g. 480 x 640 x 3)
         of type `np.uint8`, contrarily to the pytorch format which is float channel first.
 
@@ -409,11 +433,15 @@ class IntelRealSenseCamera:
         color_frame = frame.get_color_frame()
 
         if not color_frame:
-            raise OSError(f"Can't capture color image from IntelRealSenseCamera({self.serial_number}).")
+            raise OSError(
+                f"Can't capture color image from IntelRealSenseCamera({self.serial_number})."
+            )
 
         color_image = np.asanyarray(color_frame.get_data())
 
-        requested_color_mode = self.color_mode if temporary_color is None else temporary_color
+        requested_color_mode = (
+            self.color_mode if temporary_color is None else temporary_color
+        )
         if requested_color_mode not in ["rgb", "bgr"]:
             raise ValueError(
                 f"Expected color values are 'rgb' or 'bgr', but {requested_color_mode} is provided."
@@ -441,7 +469,9 @@ class IntelRealSenseCamera:
         if self.use_depth:
             depth_frame = frame.get_depth_frame()
             if not depth_frame:
-                raise OSError(f"Can't capture depth image from IntelRealSenseCamera({self.serial_number}).")
+                raise OSError(
+                    f"Can't capture depth image from IntelRealSenseCamera({self.serial_number})."
+                )
 
             depth_map = np.asanyarray(depth_frame.get_data())
 
@@ -483,7 +513,9 @@ class IntelRealSenseCamera:
             # TODO(rcadene, aliberts): intelrealsense has diverged compared to opencv over here
             num_tries += 1
             time.sleep(1 / self.fps)
-            if num_tries > self.fps and (self.thread.ident is None or not self.thread.is_alive()):
+            if num_tries > self.fps and (
+                self.thread.ident is None or not self.thread.is_alive()
+            ):
                 raise Exception(
                     "The thread responsible for `self.async_read()` took too much time to start. There might be an issue. Verify that `self.thread.start()` has been called."
                 )

lerobot/common/robot_devices/cameras/opencv.py

@@ -31,10 +31,14 @@ from lerobot.common.utils.utils import capture_timestamp_utc
 MAX_OPENCV_INDEX = 60
 
 
-def find_cameras(raise_when_empty=False, max_index_search_range=MAX_OPENCV_INDEX, mock=False) -> list[dict]:
+def find_cameras(
+    raise_when_empty=False, max_index_search_range=MAX_OPENCV_INDEX, mock=False
+) -> list[dict]:
     cameras = []
     if platform.system() == "Linux":
-        print("Linux detected. Finding available camera indices through scanning '/dev/video*' ports")
+        print(
+            "Linux detected. Finding available camera indices through scanning '/dev/video*' ports"
+        )
         possible_ports = [str(port) for port in Path("/dev").glob("video*")]
         ports = _find_cameras(possible_ports, mock=mock)
         for port in ports:
@@ -165,7 +169,9 @@ def save_images_from_cameras(
                 dt_s = time.perf_counter() - now
                 busy_wait(1 / fps - dt_s)
 
-            print(f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}")
+            print(
+                f"Frame: {frame_index:04d}\tLatency (ms): {(time.perf_counter() - now) * 1000:.2f}"
+            )
 
             if time.perf_counter() - start_time > record_time_s:
                 break
@@ -205,7 +211,9 @@ class OpenCVCameraConfig:
         self.channels = 3
 
         if self.rotation not in [-90, None, 90, 180]:
-            raise ValueError(f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})")
+            raise ValueError(
+                f"`rotation` must be in [-90, None, 90, 180] (got {self.rotation})"
+            )
 
 
 class OpenCVCamera:
@@ -247,7 +255,12 @@ class OpenCVCamera:
     ```
     """
 
-    def __init__(self, camera_index: int | str, config: OpenCVCameraConfig | None = None, **kwargs):
+    def __init__(
+        self,
+        camera_index: int | str,
+        config: OpenCVCameraConfig | None = None,
+        **kwargs,
+    ):
         if config is None:
             config = OpenCVCameraConfig()
 
@@ -261,12 +274,16 @@ class OpenCVCamera:
         if platform.system() == "Linux":
             if isinstance(self.camera_index, int):
                 self.port = Path(f"/dev/video{self.camera_index}")
-            elif isinstance(self.camera_index, str) and is_valid_unix_path(self.camera_index):
+            elif isinstance(self.camera_index, str) and is_valid_unix_path(
+                self.camera_index
+            ):
                 self.port = Path(self.camera_index)
                 # Retrieve the camera index from a potentially symlinked path
                 self.camera_index = get_camera_index_from_unix_port(self.port)
             else:
-                raise ValueError(f"Please check the provided camera_index: {camera_index}")
+                raise ValueError(
+                    f"Please check the provided camera_index: {camera_index}"
+                )
 
         self.fps = config.fps
         self.width = config.width
@@ -298,7 +315,9 @@ class OpenCVCamera:
 
     def connect(self):
         if self.is_connected:
-            raise RobotDeviceAlreadyConnectedError(f"OpenCVCamera({self.camera_index}) is already connected.")
+            raise RobotDeviceAlreadyConnectedError(
+                f"OpenCVCamera({self.camera_index}) is already connected."
+            )
 
         if self.mock:
             import tests.mock_cv2 as cv2
@@ -309,7 +328,11 @@ class OpenCVCamera:
             # when other threads are used to save the images.
             cv2.setNumThreads(1)
 
-        camera_idx = f"/dev/video{self.camera_index}" if platform.system() == "Linux" else self.camera_index
+        camera_idx = (
+            f"/dev/video{self.camera_index}"
+            if platform.system() == "Linux"
+            else self.camera_index
+        )
         # First create a temporary camera trying to access `camera_index`,
         # and verify it is a valid camera by calling `isOpened`.
         tmp_camera = cv2.VideoCapture(camera_idx)
@@ -349,16 +372,22 @@ class OpenCVCamera:
         actual_height = self.camera.get(cv2.CAP_PROP_FRAME_HEIGHT)
 
         # Using `math.isclose` since actual fps can be a float (e.g. 29.9 instead of 30)
-        if self.fps is not None and not math.isclose(self.fps, actual_fps, rel_tol=1e-3):
+        if self.fps is not None and not math.isclose(
+            self.fps, actual_fps, rel_tol=1e-3
+        ):
             # Using `OSError` since it's a broad that encompasses issues related to device communication
             raise OSError(
                 f"Can't set {self.fps=} for OpenCVCamera({self.camera_index}). Actual value is {actual_fps}."
             )
-        if self.width is not None and not math.isclose(self.width, actual_width, rel_tol=1e-3):
+        if self.width is not None and not math.isclose(
+            self.width, actual_width, rel_tol=1e-3
+        ):
             raise OSError(
                 f"Can't set {self.width=} for OpenCVCamera({self.camera_index}). Actual value is {actual_width}."
             )
-        if self.height is not None and not math.isclose(self.height, actual_height, rel_tol=1e-3):
+        if self.height is not None and not math.isclose(
+            self.height, actual_height, rel_tol=1e-3
+        ):
             raise OSError(
                 f"Can't set {self.height=} for OpenCVCamera({self.camera_index}). Actual value is {actual_height}."
             )
@@ -388,7 +417,9 @@ class OpenCVCamera:
         if not ret:
             raise OSError(f"Can't capture color image from camera {self.camera_index}.")
 
-        requested_color_mode = self.color_mode if temporary_color_mode is None else temporary_color_mode
+        requested_color_mode = (
+            self.color_mode if temporary_color_mode is None else temporary_color_mode
+        )
 
         if requested_color_mode not in ["rgb", "bgr"]:
             raise ValueError(

lerobot/common/robot_devices/control_utils.py

@@ -11,6 +11,7 @@ from copy import copy
 from functools import cache
 
 import cv2
+import numpy as np
 import torch
 import tqdm
 from deepdiff import DeepDiff
@@ -22,11 +23,17 @@ from lerobot.common.datasets.utils import get_features_from_robot
 from lerobot.common.policies.factory import make_policy
 from lerobot.common.robot_devices.robots.utils import Robot
 from lerobot.common.robot_devices.utils import busy_wait
-from lerobot.common.utils.utils import get_safe_torch_device, init_hydra_config, set_global_seed
+from lerobot.common.utils.utils import (
+    get_safe_torch_device,
+    init_hydra_config,
+    set_global_seed,
+)
 from lerobot.scripts.eval import get_pretrained_policy_path
 
 
-def log_control_info(robot: Robot, dt_s, episode_index=None, frame_index=None, fps=None):
+def log_control_info(
+    robot: Robot, dt_s, episode_index=None, frame_index=None, fps=None
+):
     log_items = []
     if episode_index is not None:
         log_items.append(f"ep:{episode_index}")
@@ -35,7 +42,7 @@ def log_control_info(robot: Robot, dt_s, episode_index=None, frame_index=None, f
 
     def log_dt(shortname, dt_val_s):
         nonlocal log_items, fps
-        info_str = f"{shortname}:{dt_val_s * 1000:5.2f} ({1/ dt_val_s:3.1f}hz)"
+        info_str = f"{shortname}:{dt_val_s * 1000:5.2f} ({1 / dt_val_s:3.1f}hz)"
         if fps is not None:
             actual_fps = 1 / dt_val_s
             if actual_fps < fps - 1:
@@ -97,7 +104,9 @@ def predict_action(observation, policy, device, use_amp):
     observation = copy(observation)
     with (
         torch.inference_mode(),
-        torch.autocast(device_type=device.type) if device.type == "cuda" and use_amp else nullcontext(),
+        torch.autocast(device_type=device.type)
+        if device.type == "cuda" and use_amp
+        else nullcontext(),
     ):
         # Convert to pytorch format: channel first and float32 in [0,1] with batch dimension
         for name in observation:
@@ -120,14 +129,22 @@ def predict_action(observation, policy, device, use_amp):
     return action
 
 
-def init_keyboard_listener():
-    # Allow to exit early while recording an episode or resetting the environment,
-    # by tapping the right arrow key '->'. This might require a sudo permission
-    # to allow your terminal to monitor keyboard events.
+def init_keyboard_listener(assign_rewards=False):
+    """
+    Initializes a keyboard listener to enable early termination of an episode
+    or environment reset by pressing the right arrow key ('->'). This may require
+    sudo permissions to allow the terminal to monitor keyboard events.
+
+    Args:
+        assign_rewards (bool): If True, allows annotating the collected trajectory
+        with a binary reward at the end of the episode to indicate success.
+    """
     events = {}
     events["exit_early"] = False
     events["rerecord_episode"] = False
     events["stop_recording"] = False
+    if assign_rewards:
+        events["next.reward"] = 0
 
     if is_headless():
         logging.warning(
@@ -145,13 +162,22 @@ def init_keyboard_listener():
                 print("Right arrow key pressed. Exiting loop...")
                 events["exit_early"] = True
             elif key == keyboard.Key.left:
-                print("Left arrow key pressed. Exiting loop and rerecord the last episode...")
+                print(
+                    "Left arrow key pressed. Exiting loop and rerecord the last episode..."
+                )
                 events["rerecord_episode"] = True
                 events["exit_early"] = True
             elif key == keyboard.Key.esc:
                 print("Escape key pressed. Stopping data recording...")
                 events["stop_recording"] = True
                 events["exit_early"] = True
+            elif assign_rewards and key == keyboard.Key.space:
+                events["next.reward"] = 1 if events["next.reward"] == 0 else 0
+                print(
+                    "Space key pressed. Assigning new reward to the subsequent frames. New reward:",
+                    events["next.reward"],
+                )
+
         except Exception as e:
             print(f"Error handling key press: {e}")
 
@@ -164,8 +190,12 @@ def init_keyboard_listener():
 def init_policy(pretrained_policy_name_or_path, policy_overrides):
     """Instantiate the policy and load fps, device and use_amp from config yaml"""
     pretrained_policy_path = get_pretrained_policy_path(pretrained_policy_name_or_path)
-    hydra_cfg = init_hydra_config(pretrained_policy_path / "config.yaml", policy_overrides)
-    policy = make_policy(hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=pretrained_policy_path)
+    hydra_cfg = init_hydra_config(
+        pretrained_policy_path / "config.yaml", policy_overrides
+    )
+    policy = make_policy(
+        hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=pretrained_policy_path
+    )
 
     # Check device is available
     device = get_safe_torch_device(hydra_cfg.device, log=True)
@@ -184,7 +214,7 @@ def init_policy(pretrained_policy_name_or_path, policy_overrides):
 def warmup_record(
     robot,
     events,
-    enable_teloperation,
+    enable_teleoperation,
     warmup_time_s,
     display_cameras,
     fps,
@@ -195,7 +225,7 @@ def warmup_record(
         display_cameras=display_cameras,
         events=events,
         fps=fps,
-        teleoperate=enable_teloperation,
+        teleoperate=enable_teleoperation,
     )
 
 
@@ -209,6 +239,7 @@ def record_episode(
     device,
     use_amp,
     fps,
+    record_delta_actions,
 ):
     control_loop(
         robot=robot,
@@ -220,6 +251,7 @@ def record_episode(
         device=device,
         use_amp=use_amp,
         fps=fps,
+        record_delta_actions=record_delta_actions,
         teleoperate=policy is None,
     )
 
@@ -236,6 +268,7 @@ def control_loop(
     device=None,
     use_amp=None,
     fps=None,
+    record_delta_actions=False,
 ):
     # TODO(rcadene): Add option to record logs
     if not robot.is_connected:
@@ -251,15 +284,21 @@ def control_loop(
         raise ValueError("When `teleoperate` is True, `policy` should be None.")
 
     if dataset is not None and fps is not None and dataset.fps != fps:
-        raise ValueError(f"The dataset fps should be equal to requested fps ({dataset['fps']} != {fps}).")
+        raise ValueError(
+            f"The dataset fps should be equal to requested fps ({dataset['fps']} != {fps})."
+        )
 
     timestamp = 0
     start_episode_t = time.perf_counter()
     while timestamp < control_time_s:
         start_loop_t = time.perf_counter()
 
+        current_joint_positions = robot.follower_arms["main"].read("Present_Position")
+
         if teleoperate:
             observation, action = robot.teleop_step(record_data=True)
+            if record_delta_actions:
+                action["action"] = action["action"] - current_joint_positions
         else:
             observation = robot.capture_observation()
 
@@ -272,12 +311,22 @@ def control_loop(
 
         if dataset is not None:
             frame = {**observation, **action}
+            if "next.reward" in events:
+                frame["next.reward"] = events["next.reward"]
+                frame["next.done"] = (events["next.reward"] == 1) or (
+                    events["exit_early"]
+                )
             dataset.add_frame(frame)
 
+            # if frame["next.done"]:
+            # break
+
         if display_cameras and not is_headless():
             image_keys = [key for key in observation if "image" in key]
             for key in image_keys:
-                cv2.imshow(key, cv2.cvtColor(observation[key].numpy(), cv2.COLOR_RGB2BGR))
+                cv2.imshow(
+                    key, cv2.cvtColor(observation[key].numpy(), cv2.COLOR_RGB2BGR)
+                )
             cv2.waitKey(1)
 
         if fps is not None:
@@ -301,6 +350,8 @@ def reset_environment(robot, events, reset_time_s):
 
     timestamp = 0
     start_vencod_t = time.perf_counter()
+    if "next.reward" in events:
+        events["next.reward"] = 0
 
     # Wait if necessary
     with tqdm.tqdm(total=reset_time_s, desc="Waiting") as pbar:
@@ -313,6 +364,16 @@ def reset_environment(robot, events, reset_time_s):
                 break
 
 
+def reset_follower_position(robot: Robot, target_position):
+    current_position = robot.follower_arms["main"].read("Present_Position")
+    trajectory = torch.from_numpy(
+        np.linspace(current_position, target_position, 50)
+    )  # NOTE: 30 is just an aribtrary number
+    for pose in trajectory:
+        robot.send_action(pose)
+        busy_wait(0.015)
+
+
 def stop_recording(robot, listener, display_cameras):
     robot.disconnect()
 
@@ -343,21 +404,32 @@ def sanity_check_dataset_name(repo_id, policy):
 
 
 def sanity_check_dataset_robot_compatibility(
-    dataset: LeRobotDataset, robot: Robot, fps: int, use_videos: bool
+    dataset: LeRobotDataset,
+    robot: Robot,
+    fps: int,
+    use_videos: bool,
+    extra_features: dict = None,
 ) -> None:
+    features_from_robot = get_features_from_robot(robot, use_videos)
+    if extra_features is not None:
+        features_from_robot.update(extra_features)
+
     fields = [
         ("robot_type", dataset.meta.robot_type, robot.robot_type),
         ("fps", dataset.fps, fps),
-        ("features", dataset.features, get_features_from_robot(robot, use_videos)),
+        ("features", dataset.features, features_from_robot),
     ]
 
     mismatches = []
     for field, dataset_value, present_value in fields:
-        diff = DeepDiff(dataset_value, present_value)
+        diff = DeepDiff(
+            dataset_value, present_value, exclude_regex_paths=[r".*\['info'\]$"]
+        )
         if diff:
             mismatches.append(f"{field}: expected {present_value}, got {dataset_value}")
 
     if mismatches:
         raise ValueError(
-            "Dataset metadata compatibility check failed with mismatches:\n" + "\n".join(mismatches)
+            "Dataset metadata compatibility check failed with mismatches:\n"
+            + "\n".join(mismatches)
         )

lerobot/common/robot_devices/motors/dynamixel.py

@@ -8,7 +8,10 @@ from copy import deepcopy
 import numpy as np
 import tqdm
 
-from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
+from lerobot.common.robot_devices.utils import (
+    RobotDeviceAlreadyConnectedError,
+    RobotDeviceNotConnectedError,
+)
 from lerobot.common.utils.utils import capture_timestamp_utc
 
 PROTOCOL_VERSION = 2.0
@@ -143,7 +146,9 @@ NUM_READ_RETRY = 10
 NUM_WRITE_RETRY = 10
 
 
-def convert_degrees_to_steps(degrees: float | np.ndarray, models: str | list[str]) -> np.ndarray:
+def convert_degrees_to_steps(
+    degrees: float | np.ndarray, models: str | list[str]
+) -> np.ndarray:
     """This function converts the degree range to the step range for indicating motors rotation.
     It assumes a motor achieves a full rotation by going from -180 degree position to +180.
     The motor resolution (e.g. 4096) corresponds to the number of steps needed to achieve a full rotation.
@@ -378,7 +383,9 @@ class DynamixelMotorsBus:
         indices = []
         for idx in tqdm.tqdm(possible_ids):
             try:
-                present_idx = self.read_with_motor_ids(self.motor_models, [idx], "ID", num_retry=num_retry)[0]
+                present_idx = self.read_with_motor_ids(
+                    self.motor_models, [idx], "ID", num_retry=num_retry
+                )[0]
             except ConnectionError:
                 continue
 
@@ -394,7 +401,9 @@ class DynamixelMotorsBus:
     def set_bus_baudrate(self, baudrate):
         present_bus_baudrate = self.port_handler.getBaudRate()
         if present_bus_baudrate != baudrate:
-            print(f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}.")
+            print(
+                f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}."
+            )
             self.port_handler.setBaudRate(baudrate)
 
             if self.port_handler.getBaudRate() != baudrate:
@@ -415,7 +424,9 @@ class DynamixelMotorsBus:
     def set_calibration(self, calibration: dict[str, list]):
         self.calibration = calibration
 
-    def apply_calibration_autocorrect(self, values: np.ndarray | list, motor_names: list[str] | None):
+    def apply_calibration_autocorrect(
+        self, values: np.ndarray | list, motor_names: list[str] | None
+    ):
         """This function applies the calibration, automatically detects out of range errors for motors values and attempts to correct.
 
         For more info, see docstring of `apply_calibration` and `autocorrect_calibration`.
@@ -428,7 +439,9 @@ class DynamixelMotorsBus:
             values = self.apply_calibration(values, motor_names)
         return values
 
-    def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+    def apply_calibration(
+        self, values: np.ndarray | list, motor_names: list[str] | None
+    ):
         """Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
         a "zero position" at 0 degree.
 
@@ -503,7 +516,9 @@ class DynamixelMotorsBus:
 
         return values
 
-    def autocorrect_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+    def autocorrect_calibration(
+        self, values: np.ndarray | list, motor_names: list[str] | None
+    ):
         """This function automatically detects issues with values of motors after calibration, and correct for these issues.
 
         Some motors might have values outside of expected maximum bounds after calibration.
@@ -545,15 +560,23 @@ class DynamixelMotorsBus:
                     values[i] *= -1
 
                 # Convert from initial range to range [-180, 180] degrees
-                calib_val = (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
-                in_range = (calib_val > LOWER_BOUND_DEGREE) and (calib_val < UPPER_BOUND_DEGREE)
+                calib_val = (
+                    (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
+                )
+                in_range = (calib_val > LOWER_BOUND_DEGREE) and (
+                    calib_val < UPPER_BOUND_DEGREE
+                )
 
                 # Solve this inequality to find the factor to shift the range into [-180, 180] degrees
                 # values[i] = (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE
                 # - HALF_TURN_DEGREE <= (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE <= HALF_TURN_DEGREE
                 # (- (resolution // 2) - values[i] - homing_offset) / resolution <= factor <= ((resolution // 2) - values[i] - homing_offset) / resolution
-                low_factor = (-(resolution // 2) - values[i] - homing_offset) / resolution
-                upp_factor = ((resolution // 2) - values[i] - homing_offset) / resolution
+                low_factor = (
+                    -(resolution // 2) - values[i] - homing_offset
+                ) / resolution
+                upp_factor = (
+                    (resolution // 2) - values[i] - homing_offset
+                ) / resolution
 
             elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
                 start_pos = self.calibration["start_pos"][calib_idx]
@@ -561,7 +584,9 @@ class DynamixelMotorsBus:
 
                 # Convert from initial range to range [0, 100] in %
                 calib_val = (values[i] - start_pos) / (end_pos - start_pos) * 100
-                in_range = (calib_val > LOWER_BOUND_LINEAR) and (calib_val < UPPER_BOUND_LINEAR)
+                in_range = (calib_val > LOWER_BOUND_LINEAR) and (
+                    calib_val < UPPER_BOUND_LINEAR
+                )
 
                 # Solve this inequality to find the factor to shift the range into [0, 100] %
                 # values[i] = (values[i] - start_pos + resolution * factor) / (end_pos + resolution * factor - start_pos - resolution * factor) * 100
@@ -577,19 +602,27 @@ class DynamixelMotorsBus:
                     factor = math.ceil(low_factor)
 
                     if factor > upp_factor:
-                        raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
+                        raise ValueError(
+                            f"No integer found between bounds [{low_factor=}, {upp_factor=}]"
+                        )
                 else:
                     factor = math.ceil(upp_factor)
 
                     if factor > low_factor:
-                        raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
+                        raise ValueError(
+                            f"No integer found between bounds [{low_factor=}, {upp_factor=}]"
+                        )
 
                 if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
                     out_of_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
                     in_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
                 elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
-                    out_of_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
-                    in_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
+                    out_of_range_str = (
+                        f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
+                    )
+                    in_range_str = (
+                        f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
+                    )
 
                 logging.warning(
                     f"Auto-correct calibration of motor '{name}' by shifting value by {abs(factor)} full turns, "
@@ -599,7 +632,9 @@ class DynamixelMotorsBus:
                 # A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
                 self.calibration["homing_offset"][calib_idx] += resolution * factor
 
-    def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+    def revert_calibration(
+        self, values: np.ndarray | list, motor_names: list[str] | None
+    ):
         """Inverse of `apply_calibration`."""
         if motor_names is None:
             motor_names = self.motor_names
@@ -638,7 +673,9 @@ class DynamixelMotorsBus:
         values = np.round(values).astype(np.int32)
         return values
 
-    def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
+    def read_with_motor_ids(
+        self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY
+    ):
         if self.mock:
             import tests.mock_dynamixel_sdk as dxl
         else:
@@ -740,7 +777,9 @@ class DynamixelMotorsBus:
             values = self.apply_calibration_autocorrect(values, motor_names)
 
         # log the number of seconds it took to read the data from the motors
-        delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
+        delta_ts_name = get_log_name(
+            "delta_timestamp_s", "read", data_name, motor_names
+        )
         self.logs[delta_ts_name] = time.perf_counter() - start_time
 
         # log the utc time at which the data was received
@@ -749,7 +788,9 @@ class DynamixelMotorsBus:
 
         return values
 
-    def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
+    def write_with_motor_ids(
+        self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY
+    ):
         if self.mock:
             import tests.mock_dynamixel_sdk as dxl
         else:
@@ -778,7 +819,12 @@ class DynamixelMotorsBus:
                 f"{self.packet_handler.getTxRxResult(comm)}"
             )
 
-    def write(self, data_name, values: int | float | np.ndarray, motor_names: str | list[str] | None = None):
+    def write(
+        self,
+        data_name,
+        values: int | float | np.ndarray,
+        motor_names: str | list[str] | None = None,
+    ):
         if not self.is_connected:
             raise RobotDeviceNotConnectedError(
                 f"DynamixelMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
@@ -839,7 +885,9 @@ class DynamixelMotorsBus:
             )
 
         # log the number of seconds it took to write the data to the motors
-        delta_ts_name = get_log_name("delta_timestamp_s", "write", data_name, motor_names)
+        delta_ts_name = get_log_name(
+            "delta_timestamp_s", "write", data_name, motor_names
+        )
         self.logs[delta_ts_name] = time.perf_counter() - start_time
 
         # TODO(rcadene): should we log the time before sending the write command?

lerobot/common/robot_devices/motors/feetech.py

@@ -8,7 +8,10 @@ from copy import deepcopy
 import numpy as np
 import tqdm
 
-from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
+from lerobot.common.robot_devices.utils import (
+    RobotDeviceAlreadyConnectedError,
+    RobotDeviceNotConnectedError,
+)
 from lerobot.common.utils.utils import capture_timestamp_utc
 
 PROTOCOL_VERSION = 0
@@ -122,7 +125,9 @@ NUM_READ_RETRY = 20
 NUM_WRITE_RETRY = 20
 
 
-def convert_degrees_to_steps(degrees: float | np.ndarray, models: str | list[str]) -> np.ndarray:
+def convert_degrees_to_steps(
+    degrees: float | np.ndarray, models: str | list[str]
+) -> np.ndarray:
     """This function converts the degree range to the step range for indicating motors rotation.
     It assumes a motor achieves a full rotation by going from -180 degree position to +180.
     The motor resolution (e.g. 4096) corresponds to the number of steps needed to achieve a full rotation.
@@ -358,7 +363,9 @@ class FeetechMotorsBus:
         indices = []
         for idx in tqdm.tqdm(possible_ids):
             try:
-                present_idx = self.read_with_motor_ids(self.motor_models, [idx], "ID", num_retry=num_retry)[0]
+                present_idx = self.read_with_motor_ids(
+                    self.motor_models, [idx], "ID", num_retry=num_retry
+                )[0]
             except ConnectionError:
                 continue
 
@@ -374,7 +381,9 @@ class FeetechMotorsBus:
     def set_bus_baudrate(self, baudrate):
         present_bus_baudrate = self.port_handler.getBaudRate()
         if present_bus_baudrate != baudrate:
-            print(f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}.")
+            print(
+                f"Setting bus baud rate to {baudrate}. Previously {present_bus_baudrate}."
+            )
             self.port_handler.setBaudRate(baudrate)
 
             if self.port_handler.getBaudRate() != baudrate:
@@ -395,7 +404,9 @@ class FeetechMotorsBus:
     def set_calibration(self, calibration: dict[str, list]):
         self.calibration = calibration
 
-    def apply_calibration_autocorrect(self, values: np.ndarray | list, motor_names: list[str] | None):
+    def apply_calibration_autocorrect(
+        self, values: np.ndarray | list, motor_names: list[str] | None
+    ):
         """This function apply the calibration, automatically detects out of range errors for motors values and attempt to correct.
 
         For more info, see docstring of `apply_calibration` and `autocorrect_calibration`.
@@ -408,7 +419,9 @@ class FeetechMotorsBus:
             values = self.apply_calibration(values, motor_names)
         return values
 
-    def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+    def apply_calibration(
+        self, values: np.ndarray | list, motor_names: list[str] | None
+    ):
         """Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
         a "zero position" at 0 degree.
 
@@ -482,7 +495,9 @@ class FeetechMotorsBus:
 
         return values
 
-    def autocorrect_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+    def autocorrect_calibration(
+        self, values: np.ndarray | list, motor_names: list[str] | None
+    ):
         """This function automatically detects issues with values of motors after calibration, and correct for these issues.
 
         Some motors might have values outside of expected maximum bounds after calibration.
@@ -521,18 +536,26 @@ class FeetechMotorsBus:
                     values[i] *= -1
 
                 # Convert from initial range to range [-180, 180] degrees
-                calib_val = (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
-                in_range = (calib_val > LOWER_BOUND_DEGREE) and (calib_val < UPPER_BOUND_DEGREE)
+                calib_val = (
+                    (values[i] + homing_offset) / (resolution // 2) * HALF_TURN_DEGREE
+                )
+                in_range = (calib_val > LOWER_BOUND_DEGREE) and (
+                    calib_val < UPPER_BOUND_DEGREE
+                )
 
                 # Solve this inequality to find the factor to shift the range into [-180, 180] degrees
                 # values[i] = (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE
                 # - HALF_TURN_DEGREE <= (values[i] + homing_offset + resolution * factor) / (resolution // 2) * HALF_TURN_DEGREE <= HALF_TURN_DEGREE
                 # (- HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset) / resolution <= factor <= (HALF_TURN_DEGREE / 180 * (resolution // 2) - values[i] - homing_offset) / resolution
                 low_factor = (
-                    -HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset
+                    -HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2)
+                    - values[i]
+                    - homing_offset
                 ) / resolution
                 upp_factor = (
-                    HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2) - values[i] - homing_offset
+                    HALF_TURN_DEGREE / HALF_TURN_DEGREE * (resolution // 2)
+                    - values[i]
+                    - homing_offset
                 ) / resolution
 
             elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
@@ -541,7 +564,9 @@ class FeetechMotorsBus:
 
                 # Convert from initial range to range [0, 100] in %
                 calib_val = (values[i] - start_pos) / (end_pos - start_pos) * 100
-                in_range = (calib_val > LOWER_BOUND_LINEAR) and (calib_val < UPPER_BOUND_LINEAR)
+                in_range = (calib_val > LOWER_BOUND_LINEAR) and (
+                    calib_val < UPPER_BOUND_LINEAR
+                )
 
                 # Solve this inequality to find the factor to shift the range into [0, 100] %
                 # values[i] = (values[i] - start_pos + resolution * factor) / (end_pos + resolution * factor - start_pos - resolution * factor) * 100
@@ -557,19 +582,27 @@ class FeetechMotorsBus:
                     factor = math.ceil(low_factor)
 
                     if factor > upp_factor:
-                        raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
+                        raise ValueError(
+                            f"No integer found between bounds [{low_factor=}, {upp_factor=}]"
+                        )
                 else:
                     factor = math.ceil(upp_factor)
 
                     if factor > low_factor:
-                        raise ValueError(f"No integer found between bounds [{low_factor=}, {upp_factor=}]")
+                        raise ValueError(
+                            f"No integer found between bounds [{low_factor=}, {upp_factor=}]"
+                        )
 
                 if CalibrationMode[calib_mode] == CalibrationMode.DEGREE:
                     out_of_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
                     in_range_str = f"{LOWER_BOUND_DEGREE} < {calib_val} < {UPPER_BOUND_DEGREE} degrees"
                 elif CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
-                    out_of_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
-                    in_range_str = f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
+                    out_of_range_str = (
+                        f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
+                    )
+                    in_range_str = (
+                        f"{LOWER_BOUND_LINEAR} < {calib_val} < {UPPER_BOUND_LINEAR} %"
+                    )
 
                 logging.warning(
                     f"Auto-correct calibration of motor '{name}' by shifting value by {abs(factor)} full turns, "
@@ -579,7 +612,9 @@ class FeetechMotorsBus:
                 # A full turn corresponds to 360 degrees but also to 4096 steps for a motor resolution of 4096.
                 self.calibration["homing_offset"][calib_idx] += resolution * factor
 
-    def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+    def revert_calibration(
+        self, values: np.ndarray | list, motor_names: list[str] | None
+    ):
         """Inverse of `apply_calibration`."""
         if motor_names is None:
             motor_names = self.motor_names
@@ -655,7 +690,9 @@ class FeetechMotorsBus:
 
         return values
 
-    def read_with_motor_ids(self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY):
+    def read_with_motor_ids(
+        self, motor_models, motor_ids, data_name, num_retry=NUM_READ_RETRY
+    ):
         if self.mock:
             import tests.mock_scservo_sdk as scs
         else:
@@ -760,7 +797,9 @@ class FeetechMotorsBus:
             values = self.apply_calibration_autocorrect(values, motor_names)
 
         # log the number of seconds it took to read the data from the motors
-        delta_ts_name = get_log_name("delta_timestamp_s", "read", data_name, motor_names)
+        delta_ts_name = get_log_name(
+            "delta_timestamp_s", "read", data_name, motor_names
+        )
         self.logs[delta_ts_name] = time.perf_counter() - start_time
 
         # log the utc time at which the data was received
@@ -769,7 +808,9 @@ class FeetechMotorsBus:
 
         return values
 
-    def write_with_motor_ids(self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY):
+    def write_with_motor_ids(
+        self, motor_models, motor_ids, data_name, values, num_retry=NUM_WRITE_RETRY
+    ):
         if self.mock:
             import tests.mock_scservo_sdk as scs
         else:
@@ -798,7 +839,12 @@ class FeetechMotorsBus:
                 f"{self.packet_handler.getTxRxResult(comm)}"
             )
 
-    def write(self, data_name, values: int | float | np.ndarray, motor_names: str | list[str] | None = None):
+    def write(
+        self,
+        data_name,
+        values: int | float | np.ndarray,
+        motor_names: str | list[str] | None = None,
+    ):
         if not self.is_connected:
             raise RobotDeviceNotConnectedError(
                 f"FeetechMotorsBus({self.port}) is not connected. You need to run `motors_bus.connect()`."
@@ -859,7 +905,9 @@ class FeetechMotorsBus:
             )
 
         # log the number of seconds it took to write the data to the motors
-        delta_ts_name = get_log_name("delta_timestamp_s", "write", data_name, motor_names)
+        delta_ts_name = get_log_name(
+            "delta_timestamp_s", "write", data_name, motor_names
+        )
         self.logs[delta_ts_name] = time.perf_counter() - start_time
 
         # TODO(rcadene): should we log the time before sending the write command?

lerobot/common/robot_devices/robots/dynamixel_calibration.py

@@ -10,9 +10,7 @@ from lerobot.common.robot_devices.motors.dynamixel import (
 )
 from lerobot.common.robot_devices.motors.utils import MotorsBus
 
-URL_TEMPLATE = (
-    "https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
-)
+URL_TEMPLATE = "https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
 
 # The following positions are provided in nominal degree range ]-180, +180[
 # For more info on these constants, see comments in the code where they get used.
@@ -23,7 +21,9 @@ ROTATED_POSITION_DEGREE = 90
 def assert_drive_mode(drive_mode):
     # `drive_mode` is in [0,1] with 0 means original rotation direction for the motor, and 1 means inverted.
     if not np.all(np.isin(drive_mode, [0, 1])):
-        raise ValueError(f"`drive_mode` contains values other than 0 or 1: ({drive_mode})")
+        raise ValueError(
+            f"`drive_mode` contains values other than 0 or 1: ({drive_mode})"
+        )
 
 
 def apply_drive_mode(position, drive_mode):
@@ -64,12 +64,16 @@ def run_arm_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type
     ```
     """
     if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
-        raise ValueError("To run calibration, the torque must be disabled on all motors.")
+        raise ValueError(
+            "To run calibration, the torque must be disabled on all motors."
+        )
 
     print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
 
     print("\nMove arm to zero position")
-    print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="zero"))
+    print(
+        "See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="zero")
+    )
     input("Press Enter to continue...")
 
     # We arbitrarily chose our zero target position to be a straight horizontal position with gripper upwards and closed.
@@ -90,10 +94,15 @@ def run_arm_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type
     # corresponds to opening the gripper. When the rotation direction is ambiguous, we arbitrarely rotate clockwise from the point of view
     # of the previous motor in the kinetic chain.
     print("\nMove arm to rotated target position")
-    print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rotated"))
+    print(
+        "See: "
+        + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rotated")
+    )
     input("Press Enter to continue...")
 
-    rotated_target_pos = convert_degrees_to_steps(ROTATED_POSITION_DEGREE, arm.motor_models)
+    rotated_target_pos = convert_degrees_to_steps(
+        ROTATED_POSITION_DEGREE, arm.motor_models
+    )
 
     # Find drive mode by rotating each motor by a quarter of a turn.
     # Drive mode indicates if the motor rotation direction should be inverted (=1) or not (=0).
@@ -102,11 +111,15 @@ def run_arm_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type
 
     # Re-compute homing offset to take into account drive mode
     rotated_drived_pos = apply_drive_mode(rotated_pos, drive_mode)
-    rotated_nearest_pos = compute_nearest_rounded_position(rotated_drived_pos, arm.motor_models)
+    rotated_nearest_pos = compute_nearest_rounded_position(
+        rotated_drived_pos, arm.motor_models
+    )
     homing_offset = rotated_target_pos - rotated_nearest_pos
 
     print("\nMove arm to rest position")
-    print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rest"))
+    print(
+        "See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rest")
+    )
     input("Press Enter to continue...")
     print()
 

lerobot/common/robot_devices/robots/feetech_calibration.py

@@ -12,9 +12,7 @@ from lerobot.common.robot_devices.motors.feetech import (
 )
 from lerobot.common.robot_devices.motors.utils import MotorsBus
 
-URL_TEMPLATE = (
-    "https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
-)
+URL_TEMPLATE = "https://raw.githubusercontent.com/huggingface/lerobot/main/media/{robot}/{arm}_{position}.webp"
 
 # The following positions are provided in nominal degree range ]-180, +180[
 # For more info on these constants, see comments in the code where they get used.
@@ -25,7 +23,9 @@ ROTATED_POSITION_DEGREE = 90
 def assert_drive_mode(drive_mode):
     # `drive_mode` is in [0,1] with 0 means original rotation direction for the motor, and 1 means inverted.
     if not np.all(np.isin(drive_mode, [0, 1])):
-        raise ValueError(f"`drive_mode` contains values other than 0 or 1: ({drive_mode})")
+        raise ValueError(
+            f"`drive_mode` contains values other than 0 or 1: ({drive_mode})"
+        )
 
 
 def apply_drive_mode(position, drive_mode):
@@ -126,7 +126,9 @@ def apply_offset(calib, offset):
     return calib
 
 
-def run_arm_auto_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
+def run_arm_auto_calibration(
+    arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str
+):
     if robot_type == "so100":
         return run_arm_auto_calibration_so100(arm, robot_type, arm_name, arm_type)
     elif robot_type == "moss":
@@ -135,18 +137,27 @@ def run_arm_auto_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm
         raise ValueError(robot_type)
 
 
-def run_arm_auto_calibration_so100(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
+def run_arm_auto_calibration_so100(
+    arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str
+):
     """All the offsets and magic numbers are hand tuned, and are unique to SO-100 follower arms"""
     if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
-        raise ValueError("To run calibration, the torque must be disabled on all motors.")
+        raise ValueError(
+            "To run calibration, the torque must be disabled on all motors."
+        )
 
     if not (robot_type == "so100" and arm_type == "follower"):
-        raise NotImplementedError("Auto calibration only supports the follower of so100 arms for now.")
+        raise NotImplementedError(
+            "Auto calibration only supports the follower of so100 arms for now."
+        )
 
     print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
 
     print("\nMove arm to initial position")
-    print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="initial"))
+    print(
+        "See: "
+        + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="initial")
+    )
     input("Press Enter to continue...")
 
     # Lower the acceleration of the motors (in [0,254])
@@ -193,11 +204,16 @@ def run_arm_auto_calibration_so100(arm: MotorsBus, robot_type: str, arm_name: st
 
     print("Calibrate elbow_flex")
     calib["elbow_flex"] = move_to_calibrate(
-        arm, "elbow_flex", positive_first=False, in_between_move_hook=in_between_move_hook
+        arm,
+        "elbow_flex",
+        positive_first=False,
+        in_between_move_hook=in_between_move_hook,
     )
     calib["elbow_flex"] = apply_offset(calib["elbow_flex"], offset=80 - 1024)
 
-    arm.write("Goal_Position", calib["elbow_flex"]["zero_pos"] + 1024 + 512, "elbow_flex")
+    arm.write(
+        "Goal_Position", calib["elbow_flex"]["zero_pos"] + 1024 + 512, "elbow_flex"
+    )
     time.sleep(1)
 
     def in_between_move_hook():
@@ -225,18 +241,30 @@ def run_arm_auto_calibration_so100(arm: MotorsBus, robot_type: str, arm_name: st
         }
         arm.write("Goal_Position", list(positions.values()), list(positions.keys()))
 
-    arm.write("Goal_Position", round(calib["shoulder_lift"]["zero_pos"] - 1600), "shoulder_lift")
+    arm.write(
+        "Goal_Position",
+        round(calib["shoulder_lift"]["zero_pos"] - 1600),
+        "shoulder_lift",
+    )
     time.sleep(2)
-    arm.write("Goal_Position", round(calib["elbow_flex"]["zero_pos"] + 1700), "elbow_flex")
+    arm.write(
+        "Goal_Position", round(calib["elbow_flex"]["zero_pos"] + 1700), "elbow_flex"
+    )
     time.sleep(2)
-    arm.write("Goal_Position", round(calib["wrist_flex"]["zero_pos"] + 800), "wrist_flex")
+    arm.write(
+        "Goal_Position", round(calib["wrist_flex"]["zero_pos"] + 800), "wrist_flex"
+    )
     time.sleep(2)
     arm.write("Goal_Position", round(calib["gripper"]["end_pos"]), "gripper")
     time.sleep(2)
 
     print("Calibrate wrist_roll")
     calib["wrist_roll"] = move_to_calibrate(
-        arm, "wrist_roll", invert_drive_mode=True, positive_first=False, while_move_hook=while_move_hook
+        arm,
+        "wrist_roll",
+        invert_drive_mode=True,
+        positive_first=False,
+        while_move_hook=while_move_hook,
     )
 
     arm.write("Goal_Position", calib["wrist_roll"]["zero_pos"], "wrist_roll")
@@ -246,7 +274,9 @@ def run_arm_auto_calibration_so100(arm: MotorsBus, robot_type: str, arm_name: st
     arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"], "wrist_flex")
     time.sleep(1)
     arm.write("Goal_Position", calib["elbow_flex"]["zero_pos"] + 2048, "elbow_flex")
-    arm.write("Goal_Position", calib["shoulder_lift"]["zero_pos"] - 2048, "shoulder_lift")
+    arm.write(
+        "Goal_Position", calib["shoulder_lift"]["zero_pos"] - 2048, "shoulder_lift"
+    )
     time.sleep(1)
     arm.write("Goal_Position", calib["shoulder_pan"]["zero_pos"], "shoulder_pan")
     time.sleep(1)
@@ -275,18 +305,27 @@ def run_arm_auto_calibration_so100(arm: MotorsBus, robot_type: str, arm_name: st
     return calib_dict
 
 
-def run_arm_auto_calibration_moss(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
+def run_arm_auto_calibration_moss(
+    arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str
+):
     """All the offsets and magic numbers are hand tuned, and are unique to SO-100 follower arms"""
     if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
-        raise ValueError("To run calibration, the torque must be disabled on all motors.")
+        raise ValueError(
+            "To run calibration, the torque must be disabled on all motors."
+        )
 
     if not (robot_type == "moss" and arm_type == "follower"):
-        raise NotImplementedError("Auto calibration only supports the follower of moss arms for now.")
+        raise NotImplementedError(
+            "Auto calibration only supports the follower of moss arms for now."
+        )
 
     print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
 
     print("\nMove arm to initial position")
-    print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="initial"))
+    print(
+        "See: "
+        + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="initial")
+    )
     input("Press Enter to continue...")
 
     # Lower the acceleration of the motors (in [0,254])
@@ -370,8 +409,12 @@ def run_arm_auto_calibration_moss(arm: MotorsBus, robot_type: str, arm_name: str
 
     arm.write("Goal_Position", calib["wrist_flex"]["zero_pos"] - 1024, "wrist_flex")
     time.sleep(1)
-    arm.write("Goal_Position", calib["shoulder_lift"]["zero_pos"] + 2048, "shoulder_lift")
-    arm.write("Goal_Position", calib["elbow_flex"]["zero_pos"] - 1024 - 400, "elbow_flex")
+    arm.write(
+        "Goal_Position", calib["shoulder_lift"]["zero_pos"] + 2048, "shoulder_lift"
+    )
+    arm.write(
+        "Goal_Position", calib["elbow_flex"]["zero_pos"] - 1024 - 400, "elbow_flex"
+    )
     time.sleep(2)
 
     calib_modes = []
@@ -398,7 +441,9 @@ def run_arm_auto_calibration_moss(arm: MotorsBus, robot_type: str, arm_name: str
     return calib_dict
 
 
-def run_arm_manual_calibration(arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str):
+def run_arm_manual_calibration(
+    arm: MotorsBus, robot_type: str, arm_name: str, arm_type: str
+):
     """This function ensures that a neural network trained on data collected on a given robot
     can work on another robot. For instance before calibration, setting a same goal position
     for each motor of two different robots will get two very different positions. But after calibration,
@@ -421,12 +466,16 @@ def run_arm_manual_calibration(arm: MotorsBus, robot_type: str, arm_name: str, a
     ```
     """
     if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
-        raise ValueError("To run calibration, the torque must be disabled on all motors.")
+        raise ValueError(
+            "To run calibration, the torque must be disabled on all motors."
+        )
 
     print(f"\nRunning calibration of {robot_type} {arm_name} {arm_type}...")
 
     print("\nMove arm to zero position")
-    print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="zero"))
+    print(
+        "See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="zero")
+    )
     input("Press Enter to continue...")
 
     # We arbitrarily chose our zero target position to be a straight horizontal position with gripper upwards and closed.
@@ -446,10 +495,15 @@ def run_arm_manual_calibration(arm: MotorsBus, robot_type: str, arm_name: str, a
     # corresponds to opening the gripper. When the rotation direction is ambiguous, we arbitrarely rotate clockwise from the point of view
     # of the previous motor in the kinetic chain.
     print("\nMove arm to rotated target position")
-    print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rotated"))
+    print(
+        "See: "
+        + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rotated")
+    )
     input("Press Enter to continue...")
 
-    rotated_target_pos = convert_degrees_to_steps(ROTATED_POSITION_DEGREE, arm.motor_models)
+    rotated_target_pos = convert_degrees_to_steps(
+        ROTATED_POSITION_DEGREE, arm.motor_models
+    )
 
     # Find drive mode by rotating each motor by a quarter of a turn.
     # Drive mode indicates if the motor rotation direction should be inverted (=1) or not (=0).
@@ -461,7 +515,9 @@ def run_arm_manual_calibration(arm: MotorsBus, robot_type: str, arm_name: str, a
     homing_offset = rotated_target_pos - rotated_drived_pos
 
     print("\nMove arm to rest position")
-    print("See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rest"))
+    print(
+        "See: " + URL_TEMPLATE.format(robot=robot_type, arm=arm_type, position="rest")
+    )
     input("Press Enter to continue...")
     print()
 

lerobot/common/robot_devices/robots/manipulator.py

@@ -18,11 +18,16 @@ import torch
 from lerobot.common.robot_devices.cameras.utils import Camera
 from lerobot.common.robot_devices.motors.utils import MotorsBus
 from lerobot.common.robot_devices.robots.utils import get_arm_id
-from lerobot.common.robot_devices.utils import RobotDeviceAlreadyConnectedError, RobotDeviceNotConnectedError
+from lerobot.common.robot_devices.utils import (
+    RobotDeviceAlreadyConnectedError,
+    RobotDeviceNotConnectedError,
+)
 
 
 def ensure_safe_goal_position(
-    goal_pos: torch.Tensor, present_pos: torch.Tensor, max_relative_target: float | list[float]
+    goal_pos: torch.Tensor,
+    present_pos: torch.Tensor,
+    max_relative_target: float | list[float],
 ):
     # Cap relative action target magnitude for safety.
     diff = goal_pos - present_pos
@@ -32,7 +37,7 @@ def ensure_safe_goal_position(
     safe_goal_pos = present_pos + safe_diff
 
     if not torch.allclose(goal_pos, safe_goal_pos):
-        logging.warning(
+        logging.debug(
             "Relative goal position magnitude had to be clamped to be safe.\n"
             f"  requested relative goal position target: {diff}\n"
             f"    clamped relative goal position target: {safe_diff}"
@@ -67,8 +72,14 @@ class ManipulatorRobotConfig:
     # gripper is not put in torque mode.
     gripper_open_degree: float | None = None
 
+    joint_position_relative_bounds: dict[np.ndarray] | None = None
+
     def __setattr__(self, prop: str, val):
-        if prop == "max_relative_target" and val is not None and isinstance(val, Sequence):
+        if (
+            prop == "max_relative_target"
+            and val is not None
+            and isinstance(val, Sequence)
+        ):
             for name in self.follower_arms:
                 if len(self.follower_arms[name].motors) != len(val):
                     raise ValueError(
@@ -78,11 +89,16 @@ class ManipulatorRobotConfig:
                         "Note: This feature does not yet work with robots where different follower arms have "
                         "different numbers of motors."
                     )
+        if prop == "joint_position_relative_bounds" and val is not None:
+            for key in val:
+                val[key] = torch.tensor(val[key])
         super().__setattr__(prop, val)
 
     def __post_init__(self):
         if self.robot_type not in ["koch", "koch_bimanual", "aloha", "so100", "moss"]:
-            raise ValueError(f"Provided robot type ({self.robot_type}) is not supported.")
+            raise ValueError(
+                f"Provided robot type ({self.robot_type}) is not supported."
+            )
 
 
 class ManipulatorRobot:
@@ -336,7 +352,9 @@ class ManipulatorRobot:
             # to squeeze the gripper and have it spring back to an open position on its own.
             for name in self.leader_arms:
                 self.leader_arms[name].write("Torque_Enable", 1, "gripper")
-                self.leader_arms[name].write("Goal_Position", self.config.gripper_open_degree, "gripper")
+                self.leader_arms[name].write(
+                    "Goal_Position", self.config.gripper_open_degree, "gripper"
+                )
 
         # Check both arms can be read
         for name in self.follower_arms:
@@ -368,18 +386,26 @@ class ManipulatorRobot:
                 print(f"Missing calibration file '{arm_calib_path}'")
 
                 if self.robot_type in ["koch", "koch_bimanual", "aloha"]:
-                    from lerobot.common.robot_devices.robots.dynamixel_calibration import run_arm_calibration
+                    from lerobot.common.robot_devices.robots.dynamixel_calibration import (
+                        run_arm_calibration,
+                    )
 
-                    calibration = run_arm_calibration(arm, self.robot_type, name, arm_type)
+                    calibration = run_arm_calibration(
+                        arm, self.robot_type, name, arm_type
+                    )
 
                 elif self.robot_type in ["so100", "moss"]:
                     from lerobot.common.robot_devices.robots.feetech_calibration import (
                         run_arm_manual_calibration,
                     )
 
-                    calibration = run_arm_manual_calibration(arm, self.robot_type, name, arm_type)
+                    calibration = run_arm_manual_calibration(
+                        arm, self.robot_type, name, arm_type
+                    )
 
-                print(f"Calibration is done! Saving calibration file '{arm_calib_path}'")
+                print(
+                    f"Calibration is done! Saving calibration file '{arm_calib_path}'"
+                )
                 arm_calib_path.parent.mkdir(parents=True, exist_ok=True)
                 with open(arm_calib_path, "w") as f:
                     json.dump(calibration, f)
@@ -398,13 +424,17 @@ class ManipulatorRobot:
             from lerobot.common.robot_devices.motors.dynamixel import TorqueMode
 
             if (arm.read("Torque_Enable") != TorqueMode.DISABLED.value).any():
-                raise ValueError("To run set robot preset, the torque must be disabled on all motors.")
+                raise ValueError(
+                    "To run set robot preset, the torque must be disabled on all motors."
+                )
 
             # Use 'extended position mode' for all motors except gripper, because in joint mode the servos can't
             # rotate more than 360 degrees (from 0 to 4095) And some mistake can happen while assembling the arm,
             # you could end up with a servo with a position 0 or 4095 at a crucial point See [
             # https://emanual.robotis.com/docs/en/dxl/x/x_series/#operating-mode11]
-            all_motors_except_gripper = [name for name in arm.motor_names if name != "gripper"]
+            all_motors_except_gripper = [
+                name for name in arm.motor_names if name != "gripper"
+            ]
             if len(all_motors_except_gripper) > 0:
                 # 4 corresponds to Extended Position on Koch motors
                 arm.write("Operating_Mode", 4, all_motors_except_gripper)
@@ -433,7 +463,9 @@ class ManipulatorRobot:
                 # Enable torque on the gripper of the leader arms, and move it to 45 degrees,
                 # so that we can use it as a trigger to close the gripper of the follower arms.
                 self.leader_arms[name].write("Torque_Enable", 1, "gripper")
-                self.leader_arms[name].write("Goal_Position", self.config.gripper_open_degree, "gripper")
+                self.leader_arms[name].write(
+                    "Goal_Position", self.config.gripper_open_degree, "gripper"
+                )
 
     def set_aloha_robot_preset(self):
         def set_shadow_(arm):
@@ -463,11 +495,15 @@ class ManipulatorRobot:
             # you could end up with a servo with a position 0 or 4095 at a crucial point See [
             # https://emanual.robotis.com/docs/en/dxl/x/x_series/#operating-mode11]
             all_motors_except_gripper = [
-                name for name in self.follower_arms[name].motor_names if name != "gripper"
+                name
+                for name in self.follower_arms[name].motor_names
+                if name != "gripper"
             ]
             if len(all_motors_except_gripper) > 0:
                 # 4 corresponds to Extended Position on Aloha motors
-                self.follower_arms[name].write("Operating_Mode", 4, all_motors_except_gripper)
+                self.follower_arms[name].write(
+                    "Operating_Mode", 4, all_motors_except_gripper
+                )
 
             # Use 'position control current based' for follower gripper to be limited by the limit of the current.
             # It can grasp an object without forcing too much even tho,
@@ -515,7 +551,9 @@ class ManipulatorRobot:
             before_lread_t = time.perf_counter()
             leader_pos[name] = self.leader_arms[name].read("Present_Position")
             leader_pos[name] = torch.from_numpy(leader_pos[name])
-            self.logs[f"read_leader_{name}_pos_dt_s"] = time.perf_counter() - before_lread_t
+            self.logs[f"read_leader_{name}_pos_dt_s"] = (
+                time.perf_counter() - before_lread_t
+            )
 
         # Send goal position to the follower
         follower_goal_pos = {}
@@ -523,19 +561,31 @@ class ManipulatorRobot:
             before_fwrite_t = time.perf_counter()
             goal_pos = leader_pos[name]
 
+            # If specified, clip the goal positions within predefined bounds specified in the config of the robot
+            if self.config.joint_position_relative_bounds is not None:
+                goal_pos = torch.clamp(
+                    goal_pos,
+                    self.config.joint_position_relative_bounds["min"],
+                    self.config.joint_position_relative_bounds["max"],
+                )
+
             # Cap goal position when too far away from present position.
             # Slower fps expected due to reading from the follower.
             if self.config.max_relative_target is not None:
                 present_pos = self.follower_arms[name].read("Present_Position")
                 present_pos = torch.from_numpy(present_pos)
-                goal_pos = ensure_safe_goal_position(goal_pos, present_pos, self.config.max_relative_target)
+                goal_pos = ensure_safe_goal_position(
+                    goal_pos, present_pos, self.config.max_relative_target
+                )
 
             # Used when record_data=True
             follower_goal_pos[name] = goal_pos
 
             goal_pos = goal_pos.numpy().astype(np.int32)
             self.follower_arms[name].write("Goal_Position", goal_pos)
-            self.logs[f"write_follower_{name}_goal_pos_dt_s"] = time.perf_counter() - before_fwrite_t
+            self.logs[f"write_follower_{name}_goal_pos_dt_s"] = (
+                time.perf_counter() - before_fwrite_t
+            )
 
         # Early exit when recording data is not requested
         if not record_data:
@@ -548,7 +598,9 @@ class ManipulatorRobot:
             before_fread_t = time.perf_counter()
             follower_pos[name] = self.follower_arms[name].read("Present_Position")
             follower_pos[name] = torch.from_numpy(follower_pos[name])
-            self.logs[f"read_follower_{name}_pos_dt_s"] = time.perf_counter() - before_fread_t
+            self.logs[f"read_follower_{name}_pos_dt_s"] = (
+                time.perf_counter() - before_fread_t
+            )
 
         # Create state by concatenating follower current position
         state = []
@@ -570,8 +622,12 @@ class ManipulatorRobot:
             before_camread_t = time.perf_counter()
             images[name] = self.cameras[name].async_read()
             images[name] = torch.from_numpy(images[name])
-            self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
-            self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
+            self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs[
+                "delta_timestamp_s"
+            ]
+            self.logs[f"async_read_camera_{name}_dt_s"] = (
+                time.perf_counter() - before_camread_t
+            )
 
         # Populate output dictionnaries
         obs_dict, action_dict = {}, {}
@@ -595,7 +651,9 @@ class ManipulatorRobot:
             before_fread_t = time.perf_counter()
             follower_pos[name] = self.follower_arms[name].read("Present_Position")
             follower_pos[name] = torch.from_numpy(follower_pos[name])
-            self.logs[f"read_follower_{name}_pos_dt_s"] = time.perf_counter() - before_fread_t
+            self.logs[f"read_follower_{name}_pos_dt_s"] = (
+                time.perf_counter() - before_fread_t
+            )
 
         # Create state by concatenating follower current position
         state = []
@@ -610,8 +668,12 @@ class ManipulatorRobot:
             before_camread_t = time.perf_counter()
             images[name] = self.cameras[name].async_read()
             images[name] = torch.from_numpy(images[name])
-            self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
-            self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
+            self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs[
+                "delta_timestamp_s"
+            ]
+            self.logs[f"async_read_camera_{name}_dt_s"] = (
+                time.perf_counter() - before_camread_t
+            )
 
         # Populate output dictionnaries and format to pytorch
         obs_dict = {}
@@ -644,18 +706,29 @@ class ManipulatorRobot:
             goal_pos = action[from_idx:to_idx]
             from_idx = to_idx
 
+            # If specified, clip the goal positions within predefined bounds specified in the config of the robot
+            if self.config.joint_position_relative_bounds is not None:
+                goal_pos = torch.clamp(
+                    goal_pos,
+                    self.config.joint_position_relative_bounds["min"],
+                    self.config.joint_position_relative_bounds["max"],
+                )
+
             # Cap goal position when too far away from present position.
             # Slower fps expected due to reading from the follower.
             if self.config.max_relative_target is not None:
                 present_pos = self.follower_arms[name].read("Present_Position")
                 present_pos = torch.from_numpy(present_pos)
-                goal_pos = ensure_safe_goal_position(goal_pos, present_pos, self.config.max_relative_target)
+                goal_pos = ensure_safe_goal_position(
+                    goal_pos, present_pos, self.config.max_relative_target
+                )
 
             # Save tensor to concat and return
             action_sent.append(goal_pos)
 
             # Send goal position to each follower
             goal_pos = goal_pos.numpy().astype(np.int32)
+
             self.follower_arms[name].write("Goal_Position", goal_pos)
 
         return torch.cat(action_sent)

lerobot/common/robot_devices/robots/stretch.py

@@ -60,7 +60,9 @@ class StretchRobot(StretchAPI):
     def connect(self) -> None:
         self.is_connected = self.startup()
         if not self.is_connected:
-            print("Another process is already using Stretch. Try running 'stretch_free_robot_process.py'")
+            print(
+                "Another process is already using Stretch. Try running 'stretch_free_robot_process.py'"
+            )
             raise ConnectionError()
 
         for name in self.cameras:
@@ -68,7 +70,9 @@ class StretchRobot(StretchAPI):
             self.is_connected = self.is_connected and self.cameras[name].is_connected
 
         if not self.is_connected:
-            print("Could not connect to the cameras, check that all cameras are plugged-in.")
+            print(
+                "Could not connect to the cameras, check that all cameras are plugged-in."
+            )
             raise ConnectionError()
 
         self.run_calibration()
@@ -113,8 +117,12 @@ class StretchRobot(StretchAPI):
             before_camread_t = time.perf_counter()
             images[name] = self.cameras[name].async_read()
             images[name] = torch.from_numpy(images[name])
-            self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
-            self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
+            self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs[
+                "delta_timestamp_s"
+            ]
+            self.logs[f"async_read_camera_{name}_dt_s"] = (
+                time.perf_counter() - before_camread_t
+            )
 
         # Populate output dictionnaries
         obs_dict, action_dict = {}, {}
@@ -158,8 +166,12 @@ class StretchRobot(StretchAPI):
             before_camread_t = time.perf_counter()
             images[name] = self.cameras[name].async_read()
             images[name] = torch.from_numpy(images[name])
-            self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs["delta_timestamp_s"]
-            self.logs[f"async_read_camera_{name}_dt_s"] = time.perf_counter() - before_camread_t
+            self.logs[f"read_camera_{name}_dt_s"] = self.cameras[name].logs[
+                "delta_timestamp_s"
+            ]
+            self.logs[f"async_read_camera_{name}_dt_s"] = (
+                time.perf_counter() - before_camread_t
+            )
 
         # Populate output dictionnaries
         obs_dict = {}

lerobot/common/robot_devices/utils.py

@@ -34,7 +34,8 @@ class RobotDeviceNotConnectedError(Exception):
     """Exception raised when the robot device is not connected."""
 
     def __init__(
-        self, message="This robot device is not connected. Try calling `robot_device.connect()` first."
+        self,
+        message="This robot device is not connected. Try calling `robot_device.connect()` first.",
     ):
         self.message = message
         super().__init__(self.message)

lerobot/common/utils/import_utils.py

@@ -17,7 +17,9 @@ import importlib
 import logging
 
 
-def is_package_available(pkg_name: str, return_version: bool = False) -> tuple[bool, str] | bool:
+def is_package_available(
+    pkg_name: str, return_version: bool = False
+) -> tuple[bool, str] | bool:
     """Copied from https://github.com/huggingface/transformers/blob/main/src/transformers/utils/import_utils.py
     Check if the package spec exists and grab its version to avoid importing a local directory.
     **Note:** this doesn't work for all packages.

lerobot/common/utils/io_utils.py

@@ -22,6 +22,8 @@ def write_video(video_path, stacked_frames, fps):
     # Filter out DeprecationWarnings raised from pkg_resources
     with warnings.catch_warnings():
         warnings.filterwarnings(
-            "ignore", "pkg_resources is deprecated as an API", category=DeprecationWarning
+            "ignore",
+            "pkg_resources is deprecated as an API",
+            category=DeprecationWarning,
         )
         imageio.mimsave(video_path, stacked_frames, fps=fps)

lerobot/common/utils/utils.py

@@ -18,6 +18,7 @@ import os
 import os.path as osp
 import platform
 import random
+import time
 from contextlib import contextmanager
 from datetime import datetime, timezone
 from pathlib import Path
@@ -115,11 +116,11 @@ def seeded_context(seed: int) -> Generator[None, None, None]:
     set_global_random_state(random_state_dict)
 
 
-def init_logging():
+def init_logging(log_file=None):
     def custom_format(record):
         dt = datetime.now().strftime("%Y-%m-%d %H:%M:%S")
         fnameline = f"{record.pathname}:{record.lineno}"
-        message = f"{record.levelname} {dt} {fnameline[-15:]:>15} {record.msg}"
+        message = f"{record.levelname} [PID: {os.getpid()}] {dt} {fnameline[-15:]:>15} {record.msg}"
         return message
 
     logging.basicConfig(level=logging.INFO)
@@ -133,6 +134,12 @@ def init_logging():
     console_handler.setFormatter(formatter)
     logging.getLogger().addHandler(console_handler)
 
+    if log_file is not None:
+        # File handler
+        file_handler = logging.FileHandler(log_file)
+        file_handler.setFormatter(formatter)
+        logging.getLogger().addHandler(file_handler)
+
 
 def format_big_number(num, precision=0):
     suffixes = ["", "K", "M", "B", "T", "Q"]
@@ -155,11 +162,16 @@ def _relative_path_between(path1: Path, path2: Path) -> Path:
     except ValueError:  # most likely because path1 is not a subpath of path2
         common_parts = Path(osp.commonpath([path1, path2])).parts
         return Path(
-            "/".join([".."] * (len(path2.parts) - len(common_parts)) + list(path1.parts[len(common_parts) :]))
+            "/".join(
+                [".."] * (len(path2.parts) - len(common_parts))
+                + list(path1.parts[len(common_parts) :])
+            )
         )
 
 
-def init_hydra_config(config_path: str, overrides: list[str] | None = None) -> DictConfig:
+def init_hydra_config(
+    config_path: str, overrides: list[str] | None = None
+) -> DictConfig:
     """Initialize a Hydra config given only the path to the relevant config file.
 
     For config resolution, it is assumed that the config file's parent is the Hydra config dir.
@@ -168,7 +180,11 @@ def init_hydra_config(config_path: str, overrides: list[str] | None = None) -> D
     hydra.core.global_hydra.GlobalHydra.instance().clear()
     # Hydra needs a path relative to this file.
     hydra.initialize(
-        str(_relative_path_between(Path(config_path).absolute().parent, Path(__file__).absolute().parent)),
+        str(
+            _relative_path_between(
+                Path(config_path).absolute().parent, Path(__file__).absolute().parent
+            )
+        ),
         version_base="1.2",
     )
     cfg = hydra.compose(Path(config_path).stem, overrides)
@@ -182,10 +198,26 @@ def print_cuda_memory_usage():
     gc.collect()
     # Also clear the cache if you want to fully release the memory
     torch.cuda.empty_cache()
-    print("Current GPU Memory Allocated: {:.2f} MB".format(torch.cuda.memory_allocated(0) / 1024**2))
-    print("Maximum GPU Memory Allocated: {:.2f} MB".format(torch.cuda.max_memory_allocated(0) / 1024**2))
-    print("Current GPU Memory Reserved: {:.2f} MB".format(torch.cuda.memory_reserved(0) / 1024**2))
-    print("Maximum GPU Memory Reserved: {:.2f} MB".format(torch.cuda.max_memory_reserved(0) / 1024**2))
+    print(
+        "Current GPU Memory Allocated: {:.2f} MB".format(
+            torch.cuda.memory_allocated(0) / 1024**2
+        )
+    )
+    print(
+        "Maximum GPU Memory Allocated: {:.2f} MB".format(
+            torch.cuda.max_memory_allocated(0) / 1024**2
+        )
+    )
+    print(
+        "Current GPU Memory Reserved: {:.2f} MB".format(
+            torch.cuda.memory_reserved(0) / 1024**2
+        )
+    )
+    print(
+        "Maximum GPU Memory Reserved: {:.2f} MB".format(
+            torch.cuda.max_memory_reserved(0) / 1024**2
+        )
+    )
 
 
 def capture_timestamp_utc():
@@ -217,3 +249,33 @@ def log_say(text, play_sounds, blocking=False):
 
     if play_sounds:
         say(text, blocking)
+
+
+class TimerManager:
+    def __init__(
+        self,
+        elapsed_time_list: list[float] | None = None,
+        label="Elapsed time",
+        log=True,
+    ):
+        self.label = label
+        self.elapsed_time_list = elapsed_time_list
+        self.log = log
+        self.elapsed = 0.0
+
+    def __enter__(self):
+        self.start = time.perf_counter()
+        return self
+
+    def __exit__(self, exc_type, exc_value, traceback):
+        self.elapsed: float = time.perf_counter() - self.start
+
+        if self.elapsed_time_list is not None:
+            self.elapsed_time_list.append(self.elapsed)
+
+        if self.log:
+            print(f"{self.label}: {self.elapsed:.6f} seconds")
+
+    @property
+    def elapsed_seconds(self):
+        return self.elapsed

lerobot/configs/default.yaml

@@ -2,6 +2,7 @@ defaults:
   - _self_
   - env: pusht
   - policy: diffusion
+  - robot: so100
 
 hydra:
   run:

lerobot/configs/env/maniskill_example.yaml

@@ -0,0 +1,30 @@
+# @package _global_
+
+fps: 400
+
+env:
+  name: maniskill/pushcube
+  task:  PushCube-v1
+  image_size: 64
+  control_mode: pd_ee_delta_pose
+  state_dim: 25
+  action_dim: 7
+  fps: ${fps}
+  obs: rgb
+  render_mode: rgb_array
+  render_size: 64
+  device: cuda
+
+  reward_classifier:
+    pretrained_path: null
+    config_path: null
+
+  wrapper:
+    joint_masking_action_space: null
+    delta_action: null
+
+  video_record:
+    enabled: false
+    record_dir: maniskill_videos
+    trajectory_name: trajectory
+    fps: ${fps}

lerobot/configs/env/so100_real.yaml

@@ -1,10 +1,50 @@
 # @package _global_
 
-fps: 30
+fps: 10
 
 env:
   name: real_world
   task: null
-  state_dim: 6
-  action_dim: 6
+  state_dim: 15
+  action_dim: 3
   fps: ${fps}
+  device: mps
+
+  wrapper:
+    crop_params_dict:
+      observation.images.front: [171, 207, 116, 251]
+      observation.images.side: [232, 200, 142, 204]
+    resize_size: [128, 128]
+    control_time_s: 10
+    reset_follower_pos: false
+    use_relative_joint_positions: true
+    reset_time_s: 5
+    display_cameras: false
+    delta_action: null #0.3
+    joint_masking_action_space: null #[1, 1, 1, 1, 0, 0] # disable wrist and gripper
+    add_joint_velocity_to_observation: true
+    add_ee_pose_to_observation: true
+
+    # If null then the teleoperation will be used to reset the robot
+    # Bounds for pushcube_gamepad_lerobot15 dataset and experiments
+    # fixed_reset_joint_positions: [-19.86, 103.19, 117.33, 42.7, 13.89, 0.297]
+    # ee_action_space_params: # If null then ee_action_space is not used
+    #   bounds:
+    #     max: [0.291, 0.147, 0.074]
+    #     min: [0.139, -0.143, 0.03]
+
+    # Bounds for insertcube_gamepad dataset and experiments
+    fixed_reset_joint_positions: [20.0,  90.,   90.,   75.,  -0.7910156, -0.5673759]
+    ee_action_space_params:
+      bounds:
+        max: [0.25295413, 0.07498981, 0.06862044]
+        min: [0.2010096,  -0.12, 0.0433196]
+
+      use_gamepad: true
+      x_step_size: 0.03
+      y_step_size: 0.03
+      z_step_size: 0.03
+
+  reward_classifier:
+    pretrained_path: null # outputs/classifier/13-02-random-sample-resnet10-frozen/checkpoints/best/pretrained_model
+    config_path: null # lerobot/configs/policy/hilserl_classifier.yaml

lerobot/configs/policy/hilserl_classifier.yaml

@@ -0,0 +1,61 @@
+# @package _global_
+
+defaults:
+  - _self_
+
+hydra:
+  run:
+    # Set `dir` to where you would like to save all of the run outputs. If you run another training session
+    # with the same value for `dir` its contents will be overwritten unless you set `resume` to true.
+    dir: outputs/train_hilserl_classifier/${now:%Y-%m-%d}/${now:%H-%M-%S}_${env.name}_${hydra.job.name}
+  job:
+    name: default
+
+seed: 13
+dataset_repo_id: aractingi/push_cube_square_light_reward_cropped_resized
+# aractingi/push_cube_square_reward_1_cropped_resized
+dataset_root: data/aractingi/push_cube_square_light_reward_cropped_resized
+local_files_only: true
+train_split_proportion: 0.8
+
+# Required by logger
+env:
+  name: "classifier"
+  task: "binary_classification"
+
+
+training:
+  num_epochs: 6
+  batch_size: 16
+  learning_rate: 1e-4
+  num_workers: 4
+  grad_clip_norm: 10
+  use_amp: true
+  log_freq: 1
+  eval_freq: 1  # How often to run validation (in epochs)
+  save_freq: 1  # How often to save checkpoints (in epochs)
+  save_checkpoint: true
+  image_keys: ["observation.images.front", "observation.images.side"]
+  label_key: "next.reward"
+  profile_inference_time: false
+  profile_inference_time_iters: 20
+
+eval:
+  batch_size: 16
+  num_samples_to_log: 30  # Number of validation samples to log in the table
+
+policy:
+  name: "hilserl/classifier"
+  model_name: "helper2424/resnet10" # "facebook/convnext-base-224
+  model_type: "cnn"
+  num_cameras: 2 # Has to be len(training.image_keys)
+
+wandb:
+  enable: false
+  project: "classifier-training"
+  job_name: "classifier_training_0"
+  disable_artifact: false
+
+device: "mps"
+resume: false
+output_dir: "outputs/classifier/old_trainer_resnet10_frozen"

lerobot/configs/policy/sac_maniskill.yaml

@@ -0,0 +1,118 @@
+# @package _global_
+
+# Train with:
+#
+# python lerobot/scripts/train.py \
+#   +dataset=lerobot/pusht_keypoints
+#   env=pusht \
+#   env.gym.obs_type=environment_state_agent_pos \
+
+seed: 1
+# dataset_repo_id: "AdilZtn/Maniskill-Pushcube-demonstration-medium"
+dataset_repo_id: null
+
+training:
+  # Offline training dataloader
+  num_workers: 4
+
+  batch_size: 512
+  grad_clip_norm: 40.0
+  lr: 3e-4
+
+
+  storage_device: "cuda"
+
+  eval_freq: 2500
+  log_freq: 10
+  save_freq: 1000000
+
+  online_steps: 1000000
+  online_rollout_n_episodes: 10
+  online_rollout_batch_size: 10
+  online_steps_between_rollouts: 1000
+  online_sampling_ratio: 1.0
+  online_env_seed: 10000
+  online_buffer_capacity: 200000
+  offline_buffer_capacity: 100000
+  online_buffer_seed_size: 0
+  online_step_before_learning: 500
+  do_online_rollout_async: false
+  policy_update_freq: 1
+
+policy:
+  name: sac
+
+  pretrained_model_path:
+
+  # Input / output structure.
+  n_action_repeats: 1
+  horizon: 1
+  n_action_steps: 1
+
+  shared_encoder: true
+  # vision_encoder_name: "helper2424/resnet10"
+  vision_encoder_name: null
+  # freeze_vision_encoder: true
+  freeze_vision_encoder: false
+  input_shapes:
+    # # TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
+    observation.state: ["${env.state_dim}"]
+    observation.image: [3, 64, 64]
+  output_shapes:
+    action: [7]
+
+  camera_number: 1
+
+  # Normalization / Unnormalization
+  # input_normalization_modes: null
+  input_normalization_modes:
+    observation.state: min_max
+    observation.image: mean_std
+  # input_normalization_params: null
+  input_normalization_params:
+    observation.state:
+      min: [-1.9361e+00, -7.7640e-01, -7.7094e-01, -2.9709e+00, -8.5656e-01,
+          1.0764e+00, -1.2680e+00,  0.0000e+00,  0.0000e+00, -9.3448e+00,
+         -3.3828e+00, -3.8420e+00, -5.2553e+00, -3.4154e+00, -6.5082e+00,
+         -6.0500e+00, -8.7193e+00, -8.2337e+00, -3.4650e-01, -4.9441e-01,
+          8.3516e-03, -3.1114e-01, -9.9700e-01, -2.3471e-01, -2.7137e-01]
+      max: [ 0.8644,  1.4306,  1.8520, -0.7578,  0.9508,  3.4901,  1.9381,  0.0400,
+          0.0400,  5.0885,  4.7156,  7.9393,  7.9100,  2.9796,  5.7720,  4.7163,
+          7.8145,  9.7415,  0.2422,  0.4505,  0.6306,  0.2622,  1.0000,  0.5135,
+          0.4001]
+
+    observation.image:
+      mean: [0.485, 0.456, 0.406]
+      std: [0.229, 0.224, 0.225]
+
+  output_normalization_modes:
+    action: min_max
+  output_normalization_params:
+    action:
+      min: [-0.03, -0.03, -0.03, -0.03, -0.03, -0.03, -0.03]
+      max: [0.03, 0.03, 0.03, 0.03, 0.03, 0.03, 0.03]
+  output_normalization_shapes:
+    action: [7]
+
+  # Architecture / modeling.
+  # Neural networks.
+  image_encoder_hidden_dim: 32
+  # discount: 0.99
+  discount: 0.80
+  temperature_init: 1.0
+  num_critics: 2 #10
+  num_subsample_critics: null
+  critic_lr: 3e-4
+  actor_lr: 3e-4
+  temperature_lr: 3e-4
+  # critic_target_update_weight: 0.005
+  critic_target_update_weight: 0.01
+  utd_ratio: 2 # 10
+
+actor_learner_config:
+  learner_host: "127.0.0.1"
+  learner_port: 50051
+  policy_parameters_push_frequency: 4
+  concurrency:
+    actor: 'threads'
+    learner: 'threads'

lerobot/configs/policy/sac_pusht_keypoints.yaml

@@ -0,0 +1,89 @@
+# @package _global_
+
+# Train with:
+#
+# python lerobot/scripts/train.py \
+#   env=pusht \
+#   +dataset=lerobot/pusht_keypoints
+
+seed: 1
+dataset_repo_id: lerobot/pusht_keypoints
+
+training:
+  offline_steps: 0
+
+  # Offline training dataloader
+  num_workers: 4
+
+  batch_size: 128
+  grad_clip_norm: 10.0
+  lr: 3e-4
+
+  eval_freq: 50000
+  log_freq: 500
+  save_freq: 50000
+
+  online_steps: 1000000
+  online_rollout_n_episodes: 10
+  online_rollout_batch_size: 10
+  online_steps_between_rollouts: 1000
+  online_sampling_ratio: 1.0
+  online_env_seed: 10000
+  online_buffer_capacity: 40000
+  online_buffer_seed_size: 0
+  do_online_rollout_async: false
+
+  delta_timestamps:
+    observation.environment_state: "[i / ${fps} for i in range(${policy.horizon} + 1)]"
+    observation.state: "[i / ${fps} for i in range(${policy.horizon} + 1)]"
+    action: "[i / ${fps} for i in range(${policy.horizon})]"
+    next.reward: "[i / ${fps} for i in range(${policy.horizon})]"
+
+policy:
+  name: sac
+
+  pretrained_model_path:
+
+  # Input / output structure.
+  n_action_repeats: 1
+  horizon: 5
+  n_action_steps: 5
+
+  input_shapes:
+    # TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
+    observation.environment_state: [16]
+    observation.state: ["${env.state_dim}"]
+  output_shapes:
+    action: ["${env.action_dim}"]
+
+  # Normalization / Unnormalization
+  input_normalization_modes:
+    observation.environment_state: min_max
+    observation.state: min_max
+  output_normalization_modes:
+    action: min_max
+
+  # Architecture / modeling.
+  # Neural networks.
+  # image_encoder_hidden_dim: 32
+  discount: 0.99
+  temperature_init: 1.0
+  num_critics: 2
+  num_subsample_critics: None
+  critic_lr: 3e-4
+  actor_lr: 3e-4
+  temperature_lr: 3e-4
+  critic_target_update_weight: 0.005
+  utd_ratio: 2
+
+
+  # # Loss coefficients.
+  # reward_coeff: 0.5
+  # expectile_weight: 0.9
+  # value_coeff: 0.1
+  # consistency_coeff: 20.0
+  # advantage_scaling: 3.0
+  # pi_coeff: 0.5
+  # temporal_decay_coeff: 0.5
+  # # Target model.
+  # target_model_momentum: 0.995

lerobot/configs/policy/sac_real.yaml

@@ -0,0 +1,120 @@
+# @package _global_
+
+# Train with:
+#
+# python lerobot/scripts/train.py \
+#   +dataset=lerobot/pusht_keypoints
+#   env=pusht \
+#   env.gym.obs_type=environment_state_agent_pos \
+
+seed: 1
+dataset_repo_id:  aractingi/insertcube_simple
+
+training:
+  # Offline training dataloader
+  num_workers: 4
+
+  # batch_size: 256
+  batch_size: 512
+  grad_clip_norm: 10.0
+  lr: 3e-4
+
+  eval_freq: 2500
+  log_freq: 1
+  save_freq: 2000000
+
+  online_steps: 1000000
+  online_rollout_n_episodes: 10
+  online_rollout_batch_size: 10
+  online_steps_between_rollouts: 1000
+  online_sampling_ratio: 1.0
+  online_env_seed: 10000
+  online_buffer_capacity: 10000
+  online_buffer_seed_size: 0
+  online_step_before_learning: 100 #5000
+  do_online_rollout_async: false
+  policy_update_freq: 1
+
+  # delta_timestamps:
+  #   observation.environment_state: "[i / ${fps} for i in range(${policy.horizon} + 1)]"
+  #   observation.state: "[i / ${fps} for i in range(${policy.horizon} + 1)]"
+  #   action: "[i / ${fps} for i in range(${policy.horizon})]"
+  #   next.reward: "[i / ${fps} for i in range(${policy.horizon})]"
+
+policy:
+  name: sac
+
+  pretrained_model_path:
+
+  # Input / output structure.
+  n_action_repeats: 1
+  horizon: 1
+  n_action_steps: 1
+
+  shared_encoder: true
+  vision_encoder_name: "helper2424/resnet10"
+  freeze_vision_encoder: true
+  input_shapes:
+    # # TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
+    observation.state: ["${env.state_dim}"]
+    observation.images.front: [3, 128, 128]
+    observation.images.side: [3, 128, 128]
+    # observation.image: [3, 128, 128]
+  output_shapes:
+    action: ["${env.action_dim}"]
+
+  # Normalization / Unnormalization
+  input_normalization_modes:
+    observation.images.front: mean_std
+    observation.images.side: mean_std
+    observation.state: min_max
+  input_normalization_params:
+    observation.images.front:
+      mean: [0.485, 0.456, 0.406]
+      std: [0.229, 0.224, 0.225]
+    observation.images.side:
+      mean: [0.485, 0.456, 0.406]
+      std: [0.229, 0.224, 0.225]
+    observation.state:
+      # 6- joint positions, 6- joint velocities, 3- ee position
+      max: [ 52.822266,  136.14258,   142.03125,   72.1582,     22.675781,   -0.5673759, 100., 100., 100., 100., 100., 100., 0.25295413, 0.07498981, 0.06862044]
+      min: [-2.6367188,  86.572266,   89.82422,    12.392578,    -26.015625,   -0.5673759, -100., -100., -100., -100., -100., -100., 0.2010096,  -0.12, 0.0433196]
+
+  output_normalization_modes:
+    action: min_max
+  output_normalization_params:
+    action:
+      min: [-0.03, -0.03, -0.01]
+      max: [0.03, 0.03, 0.03]
+
+  # Architecture / modeling.
+  # Neural networks.
+  image_encoder_hidden_dim: 32
+  # discount: 0.99
+  discount: 0.97
+  temperature_init: 1.0
+  num_critics: 2 #10
+  camera_number: 2
+  num_subsample_critics: null
+  critic_lr: 3e-4
+  actor_lr: 3e-4
+  temperature_lr: 3e-4
+  # critic_target_update_weight: 0.005
+  critic_target_update_weight: 0.01
+  utd_ratio: 2 # 10
+
+actor_learner_config:
+  learner_host: "127.0.0.1"
+  learner_port: 50051
+  policy_parameters_push_frequency: 15
+
+  # # Loss coefficients.
+  # reward_coeff: 0.5
+  # expectile_weight: 0.9
+  # value_coeff: 0.1
+  # consistency_coeff: 20.0
+  # advantage_scaling: 3.0
+  # pi_coeff: 0.5
+  # temporal_decay_coeff: 0.5
+  # # Target model.
+  # target_model_momentum: 0.995

lerobot/configs/robot/koch.yaml

@@ -10,7 +10,7 @@ max_relative_target: null
 leader_arms:
   main:
     _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
-    port: /dev/tty.usbmodem575E0031751
+    port: /dev/tty.usbmodem58760430441
     motors:
       # name: (index, model)
       shoulder_pan: [1, "xl330-m077"]
@@ -23,7 +23,7 @@ leader_arms:
 follower_arms:
   main:
     _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
-    port: /dev/tty.usbmodem575E0032081
+    port: /dev/tty.usbmodem585A0083391
     motors:
       # name: (index, model)
       shoulder_pan: [1, "xl430-w250"]

lerobot/configs/robot/so100.yaml

@@ -14,11 +14,18 @@ calibration_dir: .cache/calibration/so100
 # Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
 # the number of motors in your follower arms.
 max_relative_target: null
+joint_position_relative_bounds: null
+  # max: [100, 100, 100, 100, 100, 100]
+  # min: [-100, -100, -100, -100, -100, -100]
+  # max: [ 7.2158203e+01,  1.5398438e+02,  1.6075195e+02,  9.3251953e+01, 0., -1.4184397e-01]
+  # min: [-77.08008,     56.25,        60.55664,     19.511719,   0., -0.63829786]
+  # max: [ 35.06836 ,  103.18359 ,  127.61719 ,  75.58594 , 0., 0.]
+  # min: [ -8.876953 ,  63.808594 ,  90.49805 ,  49.48242 , 0., 0.]
 
 leader_arms:
   main:
     _target_: lerobot.common.robot_devices.motors.feetech.FeetechMotorsBus
-    port: /dev/tty.usbmodem585A0077581
+    port: /dev/tty.usbmodem58760433331
     motors:
       # name: (index, model)
       shoulder_pan: [1, "sts3215"]
@@ -31,7 +38,7 @@ leader_arms:
 follower_arms:
   main:
     _target_: lerobot.common.robot_devices.motors.feetech.FeetechMotorsBus
-    port: /dev/tty.usbmodem585A0080971
+    port: /dev/tty.usbmodem58760431631
     motors:
       # name: (index, model)
       shoulder_pan: [1, "sts3215"]
@@ -42,15 +49,15 @@ follower_arms:
       gripper: [6, "sts3215"]
 
 cameras:
-  laptop:
-    _target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
-    camera_index: 0
-    fps: 30
-    width: 640
-    height: 480
-  phone:
+  front:
     _target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
     camera_index: 1
     fps: 30
     width: 640
     height: 480
+  side:
+    _target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
+    camera_index: 0
+    fps: 30
+    width: 640
+    height: 480

lerobot/scripts/configure_motor.py

@@ -22,13 +22,17 @@ def configure_motor(port, brand, model, motor_idx_des, baudrate_des):
         from lerobot.common.robot_devices.motors.feetech import (
             SCS_SERIES_BAUDRATE_TABLE as SERIES_BAUDRATE_TABLE,
         )
-        from lerobot.common.robot_devices.motors.feetech import FeetechMotorsBus as MotorsBusClass
+        from lerobot.common.robot_devices.motors.feetech import (
+            FeetechMotorsBus as MotorsBusClass,
+        )
     elif brand == "dynamixel":
         from lerobot.common.robot_devices.motors.dynamixel import MODEL_BAUDRATE_TABLE
         from lerobot.common.robot_devices.motors.dynamixel import (
             X_SERIES_BAUDRATE_TABLE as SERIES_BAUDRATE_TABLE,
         )
-        from lerobot.common.robot_devices.motors.dynamixel import DynamixelMotorsBus as MotorsBusClass
+        from lerobot.common.robot_devices.motors.dynamixel import (
+            DynamixelMotorsBus as MotorsBusClass,
+        )
     else:
         raise ValueError(
             f"Currently we do not support this motor brand: {brand}. We currently support feetech and dynamixel motors."
@@ -46,7 +50,9 @@ def configure_motor(port, brand, model, motor_idx_des, baudrate_des):
     motor_model = model  # Use the motor model passed via argument
 
     # Initialize the MotorBus with the correct port and motor configurations
-    motor_bus = MotorsBusClass(port=port, motors={motor_name: (motor_index_arbitrary, motor_model)})
+    motor_bus = MotorsBusClass(
+        port=port, motors={motor_name: (motor_index_arbitrary, motor_model)}
+    )
 
     # Try to connect to the motor bus and handle any connection-specific errors
     try:
@@ -78,20 +84,26 @@ def configure_motor(port, brand, model, motor_idx_des, baudrate_des):
                 motor_index = present_ids[0]
 
         if motor_index == -1:
-            raise ValueError("No motors detected. Please ensure you have one motor connected.")
+            raise ValueError(
+                "No motors detected. Please ensure you have one motor connected."
+            )
 
         print(f"Motor index found at: {motor_index}")
 
         if brand == "feetech":
             # Allows ID and BAUDRATE to be written in memory
-            motor_bus.write_with_motor_ids(motor_bus.motor_models, motor_index, "Lock", 0)
+            motor_bus.write_with_motor_ids(
+                motor_bus.motor_models, motor_index, "Lock", 0
+            )
 
         if baudrate != baudrate_des:
             print(f"Setting its baudrate to {baudrate_des}")
             baudrate_idx = list(SERIES_BAUDRATE_TABLE.values()).index(baudrate_des)
 
             # The write can fail, so we allow retries
-            motor_bus.write_with_motor_ids(motor_bus.motor_models, motor_index, "Baud_Rate", baudrate_idx)
+            motor_bus.write_with_motor_ids(
+                motor_bus.motor_models, motor_index, "Baud_Rate", baudrate_idx
+            )
             time.sleep(0.5)
             motor_bus.set_bus_baudrate(baudrate_des)
             present_baudrate_idx = motor_bus.read_with_motor_ids(
@@ -103,9 +115,13 @@ def configure_motor(port, brand, model, motor_idx_des, baudrate_des):
 
         print(f"Setting its index to desired index {motor_idx_des}")
         motor_bus.write_with_motor_ids(motor_bus.motor_models, motor_index, "Lock", 0)
-        motor_bus.write_with_motor_ids(motor_bus.motor_models, motor_index, "ID", motor_idx_des)
+        motor_bus.write_with_motor_ids(
+            motor_bus.motor_models, motor_index, "ID", motor_idx_des
+        )
 
-        present_idx = motor_bus.read_with_motor_ids(motor_bus.motor_models, motor_idx_des, "ID", num_retry=2)
+        present_idx = motor_bus.read_with_motor_ids(
+            motor_bus.motor_models, motor_idx_des, "ID", num_retry=2
+        )
         if present_idx != motor_idx_des:
             raise OSError("Failed to write index.")
 
@@ -133,12 +149,29 @@ def configure_motor(port, brand, model, motor_idx_des, baudrate_des):
 
 if __name__ == "__main__":
     parser = argparse.ArgumentParser()
-    parser.add_argument("--port", type=str, required=True, help="Motors bus port (e.g. dynamixel,feetech)")
-    parser.add_argument("--brand", type=str, required=True, help="Motor brand (e.g. dynamixel,feetech)")
-    parser.add_argument("--model", type=str, required=True, help="Motor model (e.g. xl330-m077,sts3215)")
-    parser.add_argument("--ID", type=int, required=True, help="Desired ID of the current motor (e.g. 1,2,3)")
     parser.add_argument(
-        "--baudrate", type=int, default=1000000, help="Desired baudrate for the motor (default: 1000000)"
+        "--port",
+        type=str,
+        required=True,
+        help="Motors bus port (e.g. dynamixel,feetech)",
+    )
+    parser.add_argument(
+        "--brand", type=str, required=True, help="Motor brand (e.g. dynamixel,feetech)"
+    )
+    parser.add_argument(
+        "--model", type=str, required=True, help="Motor model (e.g. xl330-m077,sts3215)"
+    )
+    parser.add_argument(
+        "--ID",
+        type=int,
+        required=True,
+        help="Desired ID of the current motor (e.g. 1,2,3)",
+    )
+    parser.add_argument(
+        "--baudrate",
+        type=int,
+        default=1000000,
+        help="Desired baudrate for the motor (default: 1000000)",
     )
     args = parser.parse_args()
 

lerobot/scripts/control_robot.py

@@ -29,7 +29,6 @@ python lerobot/scripts/control_robot.py teleoperate \
 ```bash
 python lerobot/scripts/control_robot.py record \
     --fps 30 \
-    --root tmp/data \
     --repo-id $USER/koch_test \
     --num-episodes 1 \
     --run-compute-stats 0
@@ -38,7 +37,6 @@ python lerobot/scripts/control_robot.py record \
 - Visualize dataset:
 ```bash
 python lerobot/scripts/visualize_dataset.py \
-    --root tmp/data \
     --repo-id $USER/koch_test \
     --episode-index 0
 ```
@@ -47,7 +45,6 @@ python lerobot/scripts/visualize_dataset.py \
 ```bash
 python lerobot/scripts/control_robot.py replay \
     --fps 30 \
-    --root tmp/data \
     --repo-id $USER/koch_test \
     --episode 0
 ```
@@ -57,7 +54,6 @@ python lerobot/scripts/control_robot.py replay \
 ```bash
 python lerobot/scripts/control_robot.py record \
     --fps 30 \
-    --root data \
     --repo-id $USER/koch_pick_place_lego \
     --num-episodes 50 \
     --warmup-time-s 2 \
@@ -72,12 +68,12 @@ python lerobot/scripts/control_robot.py record \
 - Tap escape key 'esc' to stop the data recording.
 This might require a sudo permission to allow your terminal to monitor keyboard events.
 
-**NOTE**: You can resume/continue data recording by running the same data recording command twice.
-To avoid resuming by deleting the dataset, use `--force-override 1`.
+**NOTE**: You can resume/continue data recording by running the same data recording command and adding `--resume 1`.
+If the dataset you want to extend is not on the hub, you also need to add `--local-files-only 1`.
 
 - Train on this dataset with the ACT policy:
 ```bash
-DATA_DIR=data python lerobot/scripts/train.py \
+python lerobot/scripts/train.py \
     policy=act_koch_real \
     env=koch_real \
     dataset_repo_id=$USER/koch_pick_place_lego \
@@ -88,7 +84,6 @@ DATA_DIR=data python lerobot/scripts/train.py \
 ```bash
 python lerobot/scripts/control_robot.py record \
     --fps 30 \
-    --root data \
     --repo-id $USER/eval_act_koch_real \
     --num-episodes 10 \
     --warmup-time-s 2 \
@@ -114,6 +109,7 @@ from lerobot.common.robot_devices.control_utils import (
     log_control_info,
     record_episode,
     reset_environment,
+    reset_follower_position,
     sanity_check_dataset_name,
     sanity_check_dataset_robot_compatibility,
     stop_recording,
@@ -122,7 +118,12 @@ from lerobot.common.robot_devices.control_utils import (
 from lerobot.common.robot_devices.robots.factory import make_robot
 from lerobot.common.robot_devices.robots.utils import Robot
 from lerobot.common.robot_devices.utils import busy_wait, safe_disconnect
-from lerobot.common.utils.utils import init_hydra_config, init_logging, log_say, none_or_int
+from lerobot.common.utils.utils import (
+    init_hydra_config,
+    init_logging,
+    log_say,
+    none_or_int,
+)
 
 ########################################################################################
 # Control modes
@@ -177,7 +178,10 @@ def calibrate(robot: Robot, arms: list[str] | None):
 
 @safe_disconnect
 def teleoperate(
-    robot: Robot, fps: int | None = None, teleop_time_s: float | None = None, display_cameras: bool = False
+    robot: Robot,
+    fps: int | None = None,
+    teleop_time_s: float | None = None,
+    display_cameras: bool = False,
 ):
     control_loop(
         robot,
@@ -191,11 +195,12 @@ def teleoperate(
 @safe_disconnect
 def record(
     robot: Robot,
-    root: str,
+    root: Path,
     repo_id: str,
     single_task: str,
     pretrained_policy_name_or_path: str | None = None,
     policy_overrides: List[str] | None = None,
+    assign_rewards: bool = False,
     fps: int | None = None,
     warmup_time_s: int | float = 2,
     episode_time_s: int | float = 10,
@@ -204,10 +209,13 @@ def record(
     video: bool = True,
     run_compute_stats: bool = True,
     push_to_hub: bool = True,
+    tags: list[str] | None = None,
     num_image_writer_processes: int = 0,
     num_image_writer_threads_per_camera: int = 4,
     display_cameras: bool = True,
     play_sounds: bool = True,
+    reset_follower: bool = False,
+    record_delta_actions: bool = False,
     resume: bool = False,
     # TODO(rcadene, aliberts): remove local_files_only when refactor with dataset as argument
     local_files_only: bool = False,
@@ -218,6 +226,14 @@ def record(
     policy = None
     device = None
     use_amp = None
+    extra_features = (
+        {
+            "next.reward": {"dtype": "int64", "shape": (1,), "names": None},
+            "next.done": {"dtype": "bool", "shape": (1,), "names": None},
+        }
+        if assign_rewards
+        else None
+    )
 
     if single_task:
         task = single_task
@@ -226,11 +242,15 @@ def record(
 
     # Load pretrained policy
     if pretrained_policy_name_or_path is not None:
-        policy, policy_fps, device, use_amp = init_policy(pretrained_policy_name_or_path, policy_overrides)
+        policy, policy_fps, device, use_amp = init_policy(
+            pretrained_policy_name_or_path, policy_overrides
+        )
 
         if fps is None:
             fps = policy_fps
-            logging.warning(f"No fps provided, so using the fps from policy config ({policy_fps}).")
+            logging.warning(
+                f"No fps provided, so using the fps from policy config ({policy_fps})."
+            )
         elif fps != policy_fps:
             logging.warning(
                 f"There is a mismatch between the provided fps ({fps}) and the one from policy config ({policy_fps})."
@@ -246,7 +266,9 @@ def record(
             num_processes=num_image_writer_processes,
             num_threads=num_image_writer_threads_per_camera * len(robot.cameras),
         )
-        sanity_check_dataset_robot_compatibility(dataset, robot, fps, video)
+        sanity_check_dataset_robot_compatibility(
+            dataset, robot, fps, video, extra_features
+        )
     else:
         # Create empty dataset or load existing saved episodes
         sanity_check_dataset_name(repo_id, policy)
@@ -257,13 +279,17 @@ def record(
             robot=robot,
             use_videos=video,
             image_writer_processes=num_image_writer_processes,
-            image_writer_threads=num_image_writer_threads_per_camera * len(robot.cameras),
+            image_writer_threads=num_image_writer_threads_per_camera
+            * len(robot.cameras),
+            features=extra_features,
         )
 
     if not robot.is_connected:
         robot.connect()
+    listener, events = init_keyboard_listener(assign_rewards=assign_rewards)
 
-    listener, events = init_keyboard_listener()
+    if reset_follower:
+        initial_position = robot.follower_arms["main"].read("Present_Position")
 
     # Execute a few seconds without recording to:
     # 1. teleoperate the robot to move it in starting position if no policy provided,
@@ -271,7 +297,9 @@ def record(
     # 3. place the cameras windows on screen
     enable_teleoperation = policy is None
     log_say("Warmup record", play_sounds)
-    warmup_record(robot, events, enable_teleoperation, warmup_time_s, display_cameras, fps)
+    warmup_record(
+        robot, events, enable_teleoperation, warmup_time_s, display_cameras, fps
+    )
 
     if has_method(robot, "teleop_safety_stop"):
         robot.teleop_safety_stop()
@@ -297,6 +325,7 @@ def record(
             device=device,
             use_amp=use_amp,
             fps=fps,
+            record_delta_actions=record_delta_actions,
         )
 
         # Execute a few seconds without recording to give time to manually reset the environment
@@ -304,9 +333,11 @@ def record(
         # TODO(rcadene): add an option to enable teleoperation during reset
         # Skip reset for the last episode to be recorded
         if not events["stop_recording"] and (
-            (dataset.num_episodes < num_episodes - 1) or events["rerecord_episode"]
+            (recorded_episodes < num_episodes - 1) or events["rerecord_episode"]
         ):
             log_say("Reset the environment", play_sounds)
+            if reset_follower:
+                reset_follower_position(robot, initial_position)
             reset_environment(robot, events, reset_time_s)
 
         if events["rerecord_episode"]:
@@ -331,7 +362,7 @@ def record(
     dataset.consolidate(run_compute_stats)
 
     if push_to_hub:
-        dataset.push_to_hub()
+        dataset.push_to_hub(tags=tags)
 
     log_say("Exiting", play_sounds)
     return dataset
@@ -345,22 +376,27 @@ def replay(
     episode: int,
     fps: int | None = None,
     play_sounds: bool = True,
-    local_files_only: bool = True,
+    local_files_only: bool = False,
+    replay_delta_actions: bool = False,
 ):
     # TODO(rcadene, aliberts): refactor with control_loop, once `dataset` is an instance of LeRobotDataset
     # TODO(rcadene): Add option to record logs
 
-    dataset = LeRobotDataset(repo_id, root=root, episodes=[episode], local_files_only=local_files_only)
+    dataset = LeRobotDataset(
+        repo_id, root=root, episodes=[episode], local_files_only=local_files_only
+    )
     actions = dataset.hf_dataset.select_columns("action")
-
     if not robot.is_connected:
         robot.connect()
 
     log_say("Replaying episode", play_sounds, blocking=True)
     for idx in range(dataset.num_frames):
+        current_joint_positions = robot.follower_arms["main"].read("Present_Position")
         start_episode_t = time.perf_counter()
 
         action = actions[idx]["action"]
+        if replay_delta_actions:
+            action = action + current_joint_positions
         robot.send_action(action)
 
         dt_s = time.perf_counter() - start_episode_t
@@ -399,7 +435,10 @@ if __name__ == "__main__":
 
     parser_teleop = subparsers.add_parser("teleoperate", parents=[base_parser])
     parser_teleop.add_argument(
-        "--fps", type=none_or_int, default=None, help="Frames per second (set to None to disable)"
+        "--fps",
+        type=none_or_int,
+        default=None,
+        help="Frames per second (set to None to disable)",
     )
     parser_teleop.add_argument(
         "--display-cameras",
@@ -411,7 +450,10 @@ if __name__ == "__main__":
     parser_record = subparsers.add_parser("record", parents=[base_parser])
     task_args = parser_record.add_mutually_exclusive_group(required=True)
     parser_record.add_argument(
-        "--fps", type=none_or_int, default=None, help="Frames per second (set to None to disable)"
+        "--fps",
+        type=none_or_int,
+        default=None,
+        help="Frames per second (set to None to disable)",
     )
     task_args.add_argument(
         "--single-task",
@@ -427,8 +469,8 @@ if __name__ == "__main__":
     parser_record.add_argument(
         "--root",
         type=Path,
-        default="data",
-        help="Root directory where the dataset will be stored locally at '{root}/{repo_id}' (e.g. 'data/hf_username/dataset_name').",
+        default=None,
+        help="Root directory where the dataset will be stored (e.g. 'dataset/path').",
     )
     parser_record.add_argument(
         "--repo-id",
@@ -436,6 +478,12 @@ if __name__ == "__main__":
         default="lerobot/test",
         help="Dataset identifier. By convention it should match '{hf_username}/{dataset_name}' (e.g. `lerobot/test`).",
     )
+    parser_record.add_argument(
+        "--local-files-only",
+        type=int,
+        default=0,
+        help="Use local files only. By default, this script will try to fetch the dataset from the hub if it exists.",
+    )
     parser_record.add_argument(
         "--warmup-time-s",
         type=int,
@@ -454,7 +502,9 @@ if __name__ == "__main__":
         default=60,
         help="Number of seconds for resetting the environment after each episode.",
     )
-    parser_record.add_argument("--num-episodes", type=int, default=50, help="Number of episodes to record.")
+    parser_record.add_argument(
+        "--num-episodes", type=int, default=50, help="Number of episodes to record."
+    )
     parser_record.add_argument(
         "--run-compute-stats",
         type=int,
@@ -467,12 +517,12 @@ if __name__ == "__main__":
         default=1,
         help="Upload dataset to Hugging Face hub.",
     )
-    parser_record.add_argument(
-        "--tags",
-        type=str,
-        nargs="*",
-        help="Add tags to your dataset on the hub.",
-    )
+    # parser_record.add_argument(
+    #     "--tags",
+    #     type=str,
+    #     nargs="*",
+    #     help="Add tags to your dataset on the hub.",
+    # )
     parser_record.add_argument(
         "--num-image-writer-processes",
         type=int,
@@ -495,10 +545,10 @@ if __name__ == "__main__":
         ),
     )
     parser_record.add_argument(
-        "--force-override",
+        "--resume",
         type=int,
         default=0,
-        help="By default, data recording is resumed. When set to 1, delete the local directory and start data recording from scratch.",
+        help="Resume recording on an existing dataset.",
     )
     parser_record.add_argument(
         "-p",
@@ -515,16 +565,37 @@ if __name__ == "__main__":
         nargs="*",
         help="Any key=value arguments to override config values (use dots for.nested=overrides)",
     )
+    parser_record.add_argument(
+        "--assign-rewards",
+        type=int,
+        default=0,
+        help="Enables the assignation of rewards to frames (by default no assignation). When enabled, assign a 0 reward to frames until the space bar is pressed which assign a 1 reward. Press the space bar a second time to assign a 0 reward. The reward assigned is reset to 0 when the episode ends.",
+    )
+    parser_record.add_argument(
+        "--record-delta-actions",
+        type=int,
+        default=0,
+        help="Enables the recording of delta actions instead of absolute actions.",
+    )
+    parser_record.add_argument(
+        "--reset-follower",
+        type=int,
+        default=0,
+        help="Resets the follower to the initial position during while reseting the evironment, this is to avoid having the follower start at an awkward position in the next episode",
+    )
 
     parser_replay = subparsers.add_parser("replay", parents=[base_parser])
     parser_replay.add_argument(
-        "--fps", type=none_or_int, default=None, help="Frames per second (set to None to disable)"
+        "--fps",
+        type=none_or_int,
+        default=None,
+        help="Frames per second (set to None to disable)",
     )
     parser_replay.add_argument(
         "--root",
         type=Path,
-        default="data",
-        help="Root directory where the dataset will be stored locally at '{root}/{repo_id}' (e.g. 'data/hf_username/dataset_name').",
+        default=None,
+        help="Root directory where the dataset will be stored (e.g. 'dataset/path').",
     )
     parser_replay.add_argument(
         "--repo-id",
@@ -532,7 +603,21 @@ if __name__ == "__main__":
         default="lerobot/test",
         help="Dataset identifier. By convention it should match '{hf_username}/{dataset_name}' (e.g. `lerobot/test`).",
     )
-    parser_replay.add_argument("--episode", type=int, default=0, help="Index of the episode to replay.")
+    parser_replay.add_argument(
+        "--local-files-only",
+        type=int,
+        default=0,
+        help="Use local files only. By default, this script will try to fetch the dataset from the hub if it exists.",
+    )
+    parser_replay.add_argument(
+        "--replay-delta-actions",
+        type=int,
+        default=0,
+        help="Enables the replay of delta actions instead of absolute actions.",
+    )
+    parser_replay.add_argument(
+        "--episode", type=int, default=0, help="Index of the episode to replay."
+    )
 
     args = parser.parse_args()
 

lerobot/scripts/control_sim_robot.py

@@ -0,0 +1,607 @@
+"""
+Utilities to control a robot in simulation.
+
+Useful to record a dataset, replay a recorded episode and record an evaluation dataset.
+
+Examples of usage:
+
+
+- Unlimited teleoperation at a limited frequency of 30 Hz, to simulate data recording frequency.
+  You can modify this value depending on how fast your simulation can run:
+```bash
+python lerobot/scripts/control_robot.py teleoperate \
+    --fps 30 \
+    --robot-path lerobot/configs/robot/your_robot_config.yaml \
+    --sim-config lerobot/configs/env/your_sim_config.yaml
+```
+
+- Record one episode in order to test replay:
+```bash
+python lerobot/scripts/control_sim_robot.py record \
+    --robot-path lerobot/configs/robot/your_robot_config.yaml \
+    --sim-config lerobot/configs/env/your_sim_config.yaml \
+    --fps 30 \
+    --repo-id $USER/robot_sim_test \
+    --num-episodes 1 \
+    --run-compute-stats 0
+```
+
+Enable the --push-to-hub 1 to push the recorded dataset to the huggingface hub.
+
+- Visualize dataset:
+```bash
+python lerobot/scripts/visualize_dataset.py \
+    --repo-id $USER/robot_sim_test \
+    --episode-index 0
+```
+
+- Replay a sequence of test episodes:
+```bash
+python lerobot/scripts/control_sim_robot.py replay \
+    --robot-path lerobot/configs/robot/your_robot_config.yaml \
+    --sim-config lerobot/configs/env/your_sim_config.yaml \
+    --fps 30 \
+    --repo-id $USER/robot_sim_test \
+    --episode 0
+```
+Note: The seed is saved, therefore, during replay we can load the same environment state as the one during collection.
+
+- Record a full dataset in order to train a policy,
+30 seconds of recording for each episode, and 10 seconds to reset the environment in between episodes:
+```bash
+python lerobot/scripts/control_sim_robot.py record \
+    --robot-path lerobot/configs/robot/your_robot_config.yaml \
+    --sim-config lerobot/configs/env/your_sim_config.yaml \
+    --fps 30 \
+    --repo-id $USER/robot_sim_test \
+    --num-episodes 50 \
+    --episode-time-s 30 \
+```
+
+**NOTE**: You can use your keyboard to control data recording flow.
+- Tap right arrow key '->' to early exit while recording an episode and go to reseting the environment.
+- Tap right arrow key '->' to early exit while reseting the environment and got to recording the next episode.
+- Tap left arrow key '<-' to early exit and re-record the current episode.
+- Tap escape key 'esc' to stop the data recording.
+This might require a sudo permission to allow your terminal to monitor keyboard events.
+
+**NOTE**: You can resume/continue data recording by running the same data recording command twice.
+"""
+
+import argparse
+import importlib
+import logging
+import time
+from pathlib import Path
+
+import cv2
+import gymnasium as gym
+import numpy as np
+import torch
+
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
+from lerobot.common.robot_devices.control_utils import (
+    init_keyboard_listener,
+    init_policy,
+    is_headless,
+    log_control_info,
+    predict_action,
+    sanity_check_dataset_name,
+    sanity_check_dataset_robot_compatibility,
+    stop_recording,
+)
+from lerobot.common.robot_devices.robots.factory import make_robot
+from lerobot.common.robot_devices.robots.utils import Robot
+from lerobot.common.robot_devices.utils import busy_wait
+from lerobot.common.utils.utils import init_hydra_config, init_logging, log_say
+
+DEFAULT_FEATURES = {
+    "next.reward": {
+        "dtype": "float32",
+        "shape": (1,),
+        "names": None,
+    },
+    "next.success": {
+        "dtype": "bool",
+        "shape": (1,),
+        "names": None,
+    },
+    "seed": {
+        "dtype": "int64",
+        "shape": (1,),
+        "names": None,
+    },
+    "timestamp": {
+        "dtype": "float32",
+        "shape": (1,),
+        "names": None,
+    },
+}
+
+
+########################################################################################
+# Utilities
+########################################################################################
+def none_or_int(value):
+    if value == "None":
+        return None
+    return int(value)
+
+
+def init_sim_calibration(robot, cfg):
+    # Constants necessary for transforming the joint pos of the real robot to the sim
+    # depending on the robot discription used in that sim.
+    start_pos = np.array(robot.leader_arms.main.calibration["start_pos"])
+    axis_directions = np.array(cfg.get("axis_directions", [1]))
+    offsets = np.array(cfg.get("offsets", [0])) * np.pi
+
+    return {
+        "start_pos": start_pos,
+        "axis_directions": axis_directions,
+        "offsets": offsets,
+    }
+
+
+def real_positions_to_sim(real_positions, axis_directions, start_pos, offsets):
+    """Counts - starting position -> radians -> align axes -> offset"""
+    return axis_directions * (real_positions - start_pos) * 2.0 * np.pi / 4096 + offsets
+
+
+########################################################################################
+# Control modes
+########################################################################################
+
+
+def teleoperate(env, robot: Robot, process_action_fn, teleop_time_s=None):
+    env = env()
+    env.reset()
+    start_teleop_t = time.perf_counter()
+    while True:
+        leader_pos = robot.leader_arms.main.read("Present_Position")
+        action = process_action_fn(leader_pos)
+        env.step(np.expand_dims(action, 0))
+        if (
+            teleop_time_s is not None
+            and time.perf_counter() - start_teleop_t > teleop_time_s
+        ):
+            print("Teleoperation processes finished.")
+            break
+
+
+def record(
+    env,
+    robot: Robot,
+    process_action_from_leader,
+    root: Path,
+    repo_id: str,
+    task: str,
+    fps: int | None = None,
+    tags: list[str] | None = None,
+    pretrained_policy_name_or_path: str = None,
+    policy_overrides: bool | None = None,
+    episode_time_s: int = 30,
+    num_episodes: int = 50,
+    video: bool = True,
+    push_to_hub: bool = True,
+    num_image_writer_processes: int = 0,
+    num_image_writer_threads_per_camera: int = 4,
+    display_cameras: bool = False,
+    play_sounds: bool = True,
+    resume: bool = False,
+    local_files_only: bool = False,
+    run_compute_stats: bool = True,
+    assign_rewards: bool = False,
+) -> LeRobotDataset:
+    # Load pretrained policy
+
+    extra_features = (
+        {"next.reward": {"dtype": "int64", "shape": (1,), "names": None}}
+        if assign_rewards
+        else None
+    )
+
+    policy = None
+    if pretrained_policy_name_or_path is not None:
+        policy, policy_fps, device, use_amp = init_policy(
+            pretrained_policy_name_or_path, policy_overrides
+        )
+
+        if fps is None:
+            fps = policy_fps
+            logging.warning(
+                f"No fps provided, so using the fps from policy config ({policy_fps})."
+            )
+
+    if policy is None and process_action_from_leader is None:
+        raise ValueError(
+            "Either policy or process_action_fn has to be set to enable control in sim."
+        )
+
+    # initialize listener before sim env
+    listener, events = init_keyboard_listener(assign_rewards=assign_rewards)
+
+    # create sim env
+    env = env()
+
+    # Create empty dataset or load existing saved episodes
+    num_cameras = sum([1 if "image" in key else 0 for key in env.observation_space])
+
+    # get image keys
+    image_keys = [key for key in env.observation_space if "image" in key]
+    state_keys_dict = env_cfg.state_keys
+
+    if resume:
+        dataset = LeRobotDataset(
+            repo_id,
+            root=root,
+            local_files_only=local_files_only,
+        )
+        dataset.start_image_writer(
+            num_processes=num_image_writer_processes,
+            num_threads=num_image_writer_threads_per_camera * num_cameras,
+        )
+        sanity_check_dataset_robot_compatibility(dataset, robot, fps, video)
+    else:
+        features = DEFAULT_FEATURES
+        # add image keys to features
+        for key in image_keys:
+            shape = env.observation_space[key].shape
+            if not key.startswith("observation.image."):
+                key = "observation.image." + key
+            features[key] = {
+                "dtype": "video",
+                "names": ["channel", "height", "width"],
+                "shape": shape,
+            }
+
+        for key, obs_key in state_keys_dict.items():
+            features[key] = {
+                "dtype": "float32",
+                "names": None,
+                "shape": env.observation_space[obs_key].shape,
+            }
+
+        features["action"] = {
+            "dtype": "float32",
+            "shape": env.action_space.shape,
+            "names": None,
+        }
+        features = {**features, **extra_features}
+
+        # Create empty dataset or load existing saved episodes
+        sanity_check_dataset_name(repo_id, policy)
+        dataset = LeRobotDataset.create(
+            repo_id,
+            fps,
+            root=root,
+            features=features,
+            use_videos=video,
+            image_writer_processes=num_image_writer_processes,
+            image_writer_threads=num_image_writer_threads_per_camera * num_cameras,
+        )
+
+    recorded_episodes = 0
+    while True:
+        log_say(f"Recording episode {dataset.num_episodes}", play_sounds)
+
+        if events is None:
+            events = {"exit_early": False}
+
+        if episode_time_s is None:
+            episode_time_s = float("inf")
+
+        timestamp = 0
+        start_episode_t = time.perf_counter()
+
+        seed = np.random.randint(0, 1e5)
+        observation, info = env.reset(seed=seed)
+
+        while timestamp < episode_time_s:
+            start_loop_t = time.perf_counter()
+
+            if policy is not None:
+                action = predict_action(observation, policy, device, use_amp)
+            else:
+                leader_pos = robot.leader_arms.main.read("Present_Position")
+                action = process_action_from_leader(leader_pos)
+
+            observation, reward, terminated, _, info = env.step(action)
+
+            success = info.get("is_success", False)
+            env_timestamp = info.get("timestamp", dataset.episode_buffer["size"] / fps)
+
+            frame = {
+                "action": torch.from_numpy(action),
+                "next.reward": reward,
+                "next.success": success,
+                "seed": seed,
+                "timestamp": env_timestamp,
+            }
+
+            # Overwrite environment reward with manually assigned reward
+            if assign_rewards:
+                frame["next.reward"] = events["next.reward"]
+
+                # Should success always be false to match what we do in control_utils?
+                frame["next.success"] = False
+
+            for key in image_keys:
+                if not key.startswith("observation.image"):
+                    frame["observation.image." + key] = observation[key]
+                else:
+                    frame[key] = observation[key]
+
+            for key, obs_key in state_keys_dict.items():
+                frame[key] = torch.from_numpy(observation[obs_key])
+
+            dataset.add_frame(frame)
+
+            if display_cameras and not is_headless():
+                for key in image_keys:
+                    cv2.imshow(key, cv2.cvtColor(observation[key], cv2.COLOR_RGB2BGR))
+                cv2.waitKey(1)
+
+            if fps is not None:
+                dt_s = time.perf_counter() - start_loop_t
+                busy_wait(1 / fps - dt_s)
+
+            dt_s = time.perf_counter() - start_loop_t
+            log_control_info(robot, dt_s, fps=fps)
+
+            timestamp = time.perf_counter() - start_episode_t
+            if events["exit_early"] or terminated:
+                events["exit_early"] = False
+                break
+
+        if events["rerecord_episode"]:
+            log_say("Re-record episode", play_sounds)
+            events["rerecord_episode"] = False
+            events["exit_early"] = False
+            dataset.clear_episode_buffer()
+            continue
+
+        dataset.save_episode(task=task)
+        recorded_episodes += 1
+
+        if events["stop_recording"] or recorded_episodes >= num_episodes:
+            break
+        else:
+            logging.info(
+                "Waiting for a few seconds before starting next episode recording..."
+            )
+            busy_wait(3)
+
+    log_say("Stop recording", play_sounds, blocking=True)
+    stop_recording(robot, listener, display_cameras)
+
+    if run_compute_stats:
+        logging.info("Computing dataset statistics")
+    dataset.consolidate(run_compute_stats)
+
+    if push_to_hub:
+        dataset.push_to_hub(tags=tags)
+
+    log_say("Exiting", play_sounds)
+    return dataset
+
+
+def replay(
+    env,
+    root: Path,
+    repo_id: str,
+    episode: int,
+    fps: int | None = None,
+    local_files_only: bool = True,
+):
+    env = env()
+
+    local_dir = Path(root) / repo_id
+    if not local_dir.exists():
+        raise ValueError(local_dir)
+
+    dataset = LeRobotDataset(repo_id, root=root, local_files_only=local_files_only)
+    items = dataset.hf_dataset.select_columns("action")
+    seeds = dataset.hf_dataset.select_columns("seed")["seed"]
+
+    from_idx = dataset.episode_data_index["from"][episode].item()
+    to_idx = dataset.episode_data_index["to"][episode].item()
+    env.reset(seed=seeds[from_idx].item())
+    logging.info("Replaying episode")
+    log_say("Replaying episode", play_sounds=True)
+    for idx in range(from_idx, to_idx):
+        start_episode_t = time.perf_counter()
+        action = items[idx]["action"]
+        env.step(action.unsqueeze(0).numpy())
+        dt_s = time.perf_counter() - start_episode_t
+        busy_wait(1 / fps - dt_s)
+
+
+if __name__ == "__main__":
+    parser = argparse.ArgumentParser()
+    subparsers = parser.add_subparsers(dest="mode", required=True)
+
+    # Set common options for all the subparsers
+    base_parser = argparse.ArgumentParser(add_help=False)
+    base_parser.add_argument(
+        "--robot-path",
+        type=str,
+        default="lerobot/configs/robot/koch.yaml",
+        help="Path to robot yaml file used to instantiate the robot using `make_robot` factory function.",
+    )
+
+    base_parser.add_argument(
+        "--sim-config",
+        help="Path to a yaml config you want to use for initializing a sim environment based on gym ",
+    )
+
+    parser_record = subparsers.add_parser("teleoperate", parents=[base_parser])
+
+    parser_record = subparsers.add_parser("record", parents=[base_parser])
+    parser_record.add_argument(
+        "--fps",
+        type=none_or_int,
+        default=None,
+        help="Frames per second (set to None to disable)",
+    )
+    parser_record.add_argument(
+        "--root",
+        type=Path,
+        default=None,
+        help="Root directory where the dataset will be stored locally at '{root}/{repo_id}' (e.g. 'data/hf_username/dataset_name').",
+    )
+    parser_record.add_argument(
+        "--repo-id",
+        type=str,
+        default="lerobot/test",
+        help="Dataset identifier. By convention it should match '{hf_username}/{dataset_name}' (e.g. `lerobot/test`).",
+    )
+    parser_record.add_argument(
+        "--episode-time-s",
+        type=int,
+        default=60,
+        help="Number of seconds for data recording for each episode.",
+    )
+    parser_record.add_argument(
+        "--task",
+        type=str,
+        required=True,
+        help="A description of the task preformed during recording that can be used as a language instruction.",
+    )
+    parser_record.add_argument(
+        "--num-episodes", type=int, default=50, help="Number of episodes to record."
+    )
+    parser_record.add_argument(
+        "--run-compute-stats",
+        type=int,
+        default=1,
+        help="By default, run the computation of the data statistics at the end of data collection. Compute intensive and not required to just replay an episode.",
+    )
+    parser_record.add_argument(
+        "--push-to-hub",
+        type=int,
+        default=1,
+        help="Upload dataset to Hugging Face hub.",
+    )
+    parser_record.add_argument(
+        "--tags",
+        type=str,
+        nargs="*",
+        help="Add tags to your dataset on the hub.",
+    )
+    parser_record.add_argument(
+        "--num-image-writer-processes",
+        type=int,
+        default=0,
+        help=(
+            "Number of subprocesses handling the saving of frames as PNGs. Set to 0 to use threads only; "
+            "set to ≥1 to use subprocesses, each using threads to write images. The best number of processes "
+            "and threads depends on your system. We recommend 4 threads per camera with 0 processes. "
+            "If fps is unstable, adjust the thread count. If still unstable, try using 1 or more subprocesses."
+        ),
+    )
+    parser_record.add_argument(
+        "--num-image-writer-threads-per-camera",
+        type=int,
+        default=4,
+        help=(
+            "Number of threads writing the frames as png images on disk, per camera. "
+            "Too much threads might cause unstable teleoperation fps due to main thread being blocked. "
+            "Not enough threads might cause low camera fps."
+        ),
+    )
+    parser_record.add_argument(
+        "--display-cameras",
+        type=int,
+        default=0,
+        help="Visualize image observations with opencv.",
+    )
+    parser_record.add_argument(
+        "--resume",
+        type=int,
+        default=0,
+        help="Resume recording on an existing dataset.",
+    )
+    parser_record.add_argument(
+        "--assign-rewards",
+        type=int,
+        default=0,
+        help="Enables the assignation of rewards to frames (by default no assignation). When enabled, assign a 0 reward to frames until the space bar is pressed which assign a 1 reward. Press the space bar a second time to assign a 0 reward. The reward assigned is reset to 0 when the episode ends.",
+    )
+
+    parser_replay = subparsers.add_parser("replay", parents=[base_parser])
+    parser_replay.add_argument(
+        "--fps",
+        type=none_or_int,
+        default=None,
+        help="Frames per second (set to None to disable)",
+    )
+    parser_replay.add_argument(
+        "--root",
+        type=Path,
+        default=None,
+        help="Root directory where the dataset will be stored locally (e.g. 'data/hf_username/dataset_name'). By default, stored in cache folder.",
+    )
+    parser_replay.add_argument(
+        "--repo-id",
+        type=str,
+        default="lerobot/test",
+        help="Dataset identifier. By convention it should match '{hf_username}/{dataset_name}' (e.g. `lerobot/test`).",
+    )
+    parser_replay.add_argument(
+        "--episode", type=int, default=0, help="Index of the episodes to replay."
+    )
+
+    args = parser.parse_args()
+
+    init_logging()
+
+    control_mode = args.mode
+    robot_path = args.robot_path
+    env_config_path = args.sim_config
+    kwargs = vars(args)
+    del kwargs["mode"]
+    del kwargs["robot_path"]
+    del kwargs["sim_config"]
+
+    # make gym env
+    env_cfg = init_hydra_config(env_config_path)
+    importlib.import_module(f"gym_{env_cfg.env.name}")
+
+    def env_constructor():
+        return gym.make(env_cfg.env.handle, disable_env_checker=True, **env_cfg.env.gym)
+
+    robot = None
+    process_leader_actions_fn = None
+
+    if control_mode in ["teleoperate", "record"]:
+        # make robot
+        robot_overrides = ["~cameras", "~follower_arms"]
+        robot_cfg = init_hydra_config(robot_path, robot_overrides)
+        robot = make_robot(robot_cfg)
+        robot.connect()
+
+        calib_kwgs = init_sim_calibration(robot, env_cfg.calibration)
+
+        def process_leader_actions_fn(action):
+            return real_positions_to_sim(action, **calib_kwgs)
+
+        robot.leader_arms.main.calibration = None
+
+    if control_mode == "teleoperate":
+        teleoperate(env_constructor, robot, process_leader_actions_fn)
+
+    elif control_mode == "record":
+        record(env_constructor, robot, process_leader_actions_fn, **kwargs)
+
+    elif control_mode == "replay":
+        replay(env_constructor, **kwargs)
+
+    else:
+        raise ValueError(
+            f"Invalid control mode: '{control_mode}', only valid modes are teleoperate, record and replay."
+        )
+
+    if robot and robot.is_connected:
+        # Disconnect manually to avoid a "Core dump" during process
+        # termination due to camera threads not properly exiting.
+        robot.disconnect()

lerobot/scripts/display_sys_info.py

@@ -59,7 +59,11 @@ np_version = np.__version__ if HAS_NP else "N/A"
 
 torch_version = torch.__version__ if HAS_TORCH else "N/A"
 torch_cuda_available = torch.cuda.is_available() if HAS_TORCH else "N/A"
-cuda_version = torch._C._cuda_getCompiledVersion() if HAS_TORCH and torch.version.cuda is not None else "N/A"
+cuda_version = (
+    torch._C._cuda_getCompiledVersion()
+    if HAS_TORCH and torch.version.cuda is not None
+    else "N/A"
+)
 
 
 # TODO(aliberts): refactor into an actual command `lerobot env`
@@ -77,7 +81,9 @@ def display_sys_info() -> dict:
         "Using GPU in script?": "<fill in>",
         # "Using distributed or parallel set-up in script?": "<fill in>",
     }
-    print("\nCopy-and-paste the text below in your GitHub issue and FILL OUT the last point.\n")
+    print(
+        "\nCopy-and-paste the text below in your GitHub issue and FILL OUT the last point.\n"
+    )
     print(format_dict(info))
     return info
 

lerobot/scripts/eval.py

@@ -149,7 +149,9 @@ def rollout(
         if return_observations:
             all_observations.append(deepcopy(observation))
 
-        observation = {key: observation[key].to(device, non_blocking=True) for key in observation}
+        observation = {
+            key: observation[key].to(device, non_blocking=True) for key in observation
+        }
 
         with torch.inference_mode():
             action = policy.select_action(observation)
@@ -166,7 +168,10 @@ def rollout(
         # VectorEnv stores is_success in `info["final_info"][env_index]["is_success"]`. "final_info" isn't
         # available of none of the envs finished.
         if "final_info" in info:
-            successes = [info["is_success"] if info is not None else False for info in info["final_info"]]
+            successes = [
+                info["is_success"] if info is not None else False
+                for info in info["final_info"]
+            ]
         else:
             successes = [False] * env.num_envs
 
@@ -180,9 +185,13 @@ def rollout(
 
         step += 1
         running_success_rate = (
-            einops.reduce(torch.stack(all_successes, dim=1), "b n -> b", "any").numpy().mean()
+            einops.reduce(torch.stack(all_successes, dim=1), "b n -> b", "any")
+            .numpy()
+            .mean()
+        )
+        progbar.set_postfix(
+            {"running_success_rate": f"{running_success_rate.item() * 100:.1f}%"}
         )
-        progbar.set_postfix({"running_success_rate": f"{running_success_rate.item() * 100:.1f}%"})
         progbar.update()
 
     # Track the final observation.
@@ -200,7 +209,9 @@ def rollout(
     if return_observations:
         stacked_observations = {}
         for key in all_observations[0]:
-            stacked_observations[key] = torch.stack([obs[key] for obs in all_observations], dim=1)
+            stacked_observations[key] = torch.stack(
+                [obs[key] for obs in all_observations], dim=1
+            )
         ret["observation"] = stacked_observations
 
     return ret
@@ -255,7 +266,9 @@ def eval_policy(
             return
         n_to_render_now = min(max_episodes_rendered - n_episodes_rendered, env.num_envs)
         if isinstance(env, gym.vector.SyncVectorEnv):
-            ep_frames.append(np.stack([env.envs[i].render() for i in range(n_to_render_now)]))  # noqa: B023
+            ep_frames.append(
+                np.stack([env.envs[i].render() for i in range(n_to_render_now)])
+            )  # noqa: B023
         elif isinstance(env, gym.vector.AsyncVectorEnv):
             # Here we must render all frames and discard any we don't need.
             ep_frames.append(np.stack(env.call("render")[:n_to_render_now]))
@@ -267,7 +280,9 @@ def eval_policy(
         episode_data: dict | None = None
 
     # we dont want progress bar when we use slurm, since it clutters the logs
-    progbar = trange(n_batches, desc="Stepping through eval batches", disable=inside_slurm())
+    progbar = trange(
+        n_batches, desc="Stepping through eval batches", disable=inside_slurm()
+    )
     for batch_ix in progbar:
         # Cache frames for rendering videos. Each item will be (b, h, w, c), and the list indexes the rollout
         # step.
@@ -278,7 +293,8 @@ def eval_policy(
             seeds = None
         else:
             seeds = range(
-                start_seed + (batch_ix * env.num_envs), start_seed + ((batch_ix + 1) * env.num_envs)
+                start_seed + (batch_ix * env.num_envs),
+                start_seed + ((batch_ix + 1) * env.num_envs),
             )
         rollout_data = rollout(
             env,
@@ -296,13 +312,22 @@ def eval_policy(
 
         # Make a mask with shape (batch, n_steps) to mask out rollout data after the first done
         # (batch-element-wise). Note the `done_indices + 1` to make sure to keep the data from the done step.
-        mask = (torch.arange(n_steps) <= einops.repeat(done_indices + 1, "b -> b s", s=n_steps)).int()
+        mask = (
+            torch.arange(n_steps)
+            <= einops.repeat(done_indices + 1, "b -> b s", s=n_steps)
+        ).int()
         # Extend metrics.
-        batch_sum_rewards = einops.reduce((rollout_data["reward"] * mask), "b n -> b", "sum")
+        batch_sum_rewards = einops.reduce(
+            (rollout_data["reward"] * mask), "b n -> b", "sum"
+        )
         sum_rewards.extend(batch_sum_rewards.tolist())
-        batch_max_rewards = einops.reduce((rollout_data["reward"] * mask), "b n -> b", "max")
+        batch_max_rewards = einops.reduce(
+            (rollout_data["reward"] * mask), "b n -> b", "max"
+        )
         max_rewards.extend(batch_max_rewards.tolist())
-        batch_successes = einops.reduce((rollout_data["success"] * mask), "b n -> b", "any")
+        batch_successes = einops.reduce(
+            (rollout_data["success"] * mask), "b n -> b", "any"
+        )
         all_successes.extend(batch_successes.tolist())
         if seeds:
             all_seeds.extend(seeds)
@@ -315,17 +340,27 @@ def eval_policy(
                 rollout_data,
                 done_indices,
                 start_episode_index=batch_ix * env.num_envs,
-                start_data_index=(0 if episode_data is None else (episode_data["index"][-1].item() + 1)),
+                start_data_index=(
+                    0
+                    if episode_data is None
+                    else (episode_data["index"][-1].item() + 1)
+                ),
                 fps=env.unwrapped.metadata["render_fps"],
             )
             if episode_data is None:
                 episode_data = this_episode_data
             else:
                 # Some sanity checks to make sure we are correctly compiling the data.
-                assert episode_data["episode_index"][-1] + 1 == this_episode_data["episode_index"][0]
+                assert (
+                    episode_data["episode_index"][-1] + 1
+                    == this_episode_data["episode_index"][0]
+                )
                 assert episode_data["index"][-1] + 1 == this_episode_data["index"][0]
                 # Concatenate the episode data.
-                episode_data = {k: torch.cat([episode_data[k], this_episode_data[k]]) for k in episode_data}
+                episode_data = {
+                    k: torch.cat([episode_data[k], this_episode_data[k]])
+                    for k in episode_data
+                }
 
         # Maybe render video for visualization.
         if max_episodes_rendered > 0 and len(ep_frames) > 0:
@@ -343,7 +378,9 @@ def eval_policy(
                     target=write_video,
                     args=(
                         str(video_path),
-                        stacked_frames[: done_index + 1],  # + 1 to capture the last observation
+                        stacked_frames[
+                            : done_index + 1
+                        ],  # + 1 to capture the last observation
                         env.unwrapped.metadata["render_fps"],
                     ),
                 )
@@ -352,7 +389,9 @@ def eval_policy(
                 n_episodes_rendered += 1
 
         progbar.set_postfix(
-            {"running_success_rate": f"{np.mean(all_successes[:n_episodes]).item() * 100:.1f}%"}
+            {
+                "running_success_rate": f"{np.mean(all_successes[:n_episodes]).item() * 100:.1f}%"
+            }
         )
 
     # Wait till all video rendering threads are done.
@@ -398,7 +437,11 @@ def eval_policy(
 
 
 def _compile_episode_data(
-    rollout_data: dict, done_indices: Tensor, start_episode_index: int, start_data_index: int, fps: float
+    rollout_data: dict,
+    done_indices: Tensor,
+    start_episode_index: int,
+    start_data_index: int,
+    fps: float,
 ) -> dict:
     """Convenience function for `eval_policy(return_episode_data=True)`
 
@@ -416,12 +459,16 @@ def _compile_episode_data(
         # Here we do `num_frames - 1` as we don't want to include the last observation frame just yet.
         ep_dict = {
             "action": rollout_data["action"][ep_ix, : num_frames - 1],
-            "episode_index": torch.tensor([start_episode_index + ep_ix] * (num_frames - 1)),
+            "episode_index": torch.tensor(
+                [start_episode_index + ep_ix] * (num_frames - 1)
+            ),
             "frame_index": torch.arange(0, num_frames - 1, 1),
             "timestamp": torch.arange(0, num_frames - 1, 1) / fps,
             "next.done": rollout_data["done"][ep_ix, : num_frames - 1],
             "next.success": rollout_data["success"][ep_ix, : num_frames - 1],
-            "next.reward": rollout_data["reward"][ep_ix, : num_frames - 1].type(torch.float32),
+            "next.reward": rollout_data["reward"][ep_ix, : num_frames - 1].type(
+                torch.float32
+            ),
         }
 
         # For the last observation frame, all other keys will just be copy padded.
@@ -437,7 +484,9 @@ def _compile_episode_data(
     for key in ep_dicts[0]:
         data_dict[key] = torch.cat([x[key] for x in ep_dicts])
 
-    data_dict["index"] = torch.arange(start_data_index, start_data_index + total_frames, 1)
+    data_dict["index"] = torch.arange(
+        start_data_index, start_data_index + total_frames, 1
+    )
 
     return data_dict
 
@@ -450,7 +499,9 @@ def main(
 ):
     assert (pretrained_policy_path is None) ^ (hydra_cfg_path is None)
     if pretrained_policy_path is not None:
-        hydra_cfg = init_hydra_config(str(pretrained_policy_path / "config.yaml"), config_overrides)
+        hydra_cfg = init_hydra_config(
+            str(pretrained_policy_path / "config.yaml"), config_overrides
+        )
     else:
         hydra_cfg = init_hydra_config(hydra_cfg_path, config_overrides)
 
@@ -481,15 +532,23 @@ def main(
 
     logging.info("Making policy.")
     if hydra_cfg_path is None:
-        policy = make_policy(hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=str(pretrained_policy_path))
+        policy = make_policy(
+            hydra_cfg=hydra_cfg,
+            pretrained_policy_name_or_path=str(pretrained_policy_path),
+        )
     else:
         # Note: We need the dataset stats to pass to the policy's normalization modules.
-        policy = make_policy(hydra_cfg=hydra_cfg, dataset_stats=make_dataset(hydra_cfg).meta.stats)
+        policy = make_policy(
+            hydra_cfg=hydra_cfg, dataset_stats=make_dataset(hydra_cfg).meta.stats
+        )
 
     assert isinstance(policy, nn.Module)
     policy.eval()
 
-    with torch.no_grad(), torch.autocast(device_type=device.type) if hydra_cfg.use_amp else nullcontext():
+    with (
+        torch.no_grad(),
+        torch.autocast(device_type=device.type) if hydra_cfg.use_amp else nullcontext(),
+    ):
         info = eval_policy(
             env,
             policy,
@@ -511,16 +570,14 @@ def main(
 
 def get_pretrained_policy_path(pretrained_policy_name_or_path, revision=None):
     try:
-        pretrained_policy_path = Path(snapshot_download(pretrained_policy_name_or_path, revision=revision))
+        pretrained_policy_path = Path(
+            snapshot_download(pretrained_policy_name_or_path, revision=revision)
+        )
     except (HFValidationError, RepositoryNotFoundError) as e:
         if isinstance(e, HFValidationError):
-            error_message = (
-                "The provided pretrained_policy_name_or_path is not a valid Hugging Face Hub repo ID."
-            )
+            error_message = "The provided pretrained_policy_name_or_path is not a valid Hugging Face Hub repo ID."
         else:
-            error_message = (
-                "The provided pretrained_policy_name_or_path was not found on the Hugging Face Hub."
-            )
+            error_message = "The provided pretrained_policy_name_or_path was not found on the Hugging Face Hub."
 
         logging.warning(f"{error_message} Treating it as a local directory.")
         pretrained_policy_path = Path(pretrained_policy_name_or_path)
@@ -555,7 +612,9 @@ if __name__ == "__main__":
             "debugging). This argument is mutually exclusive with `--pretrained-policy-name-or-path` (`-p`)."
         ),
     )
-    parser.add_argument("--revision", help="Optionally provide the Hugging Face Hub revision ID.")
+    parser.add_argument(
+        "--revision", help="Optionally provide the Hugging Face Hub revision ID."
+    )
     parser.add_argument(
         "--out-dir",
         help=(
@@ -571,7 +630,11 @@ if __name__ == "__main__":
     args = parser.parse_args()
 
     if args.pretrained_policy_name_or_path is None:
-        main(hydra_cfg_path=args.config, out_dir=args.out_dir, config_overrides=args.overrides)
+        main(
+            hydra_cfg_path=args.config,
+            out_dir=args.out_dir,
+            config_overrides=args.overrides,
+        )
     else:
         pretrained_policy_path = get_pretrained_policy_path(
             args.pretrained_policy_name_or_path, revision=args.revision

lerobot/scripts/eval_on_robot.py

@@ -0,0 +1,426 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Evaluate a policy by running rollouts on the real robot and computing metrics.
+
+Usage examples: evaluate a checkpoint from the LeRobot training script for 10 episodes.
+
+```
+python lerobot/scripts/eval_on_robot.py \
+    -p outputs/train/model/checkpoints/005000/pretrained_model \
+    eval.n_episodes=10
+```
+
+Test reward classifier with teleoperation (you need to press space to take over)
+```
+python lerobot/scripts/eval_on_robot.py \
+    --robot-path lerobot/configs/robot/so100.yaml \
+    --reward-classifier-pretrained-path outputs/classifier/checkpoints/best/pretrained_model \
+    --reward-classifier-config-file lerobot/configs/policy/hilserl_classifier.yaml \
+    --display-cameras 1
+```
+
+**NOTE** (michel-aractingi): This script is incomplete and it is being prepared
+for running training on the real robot.
+"""
+
+import argparse
+import logging
+import time
+
+import cv2
+import numpy as np
+import torch
+from tqdm import trange
+
+from lerobot.common.policies.policy_protocol import Policy
+from lerobot.common.robot_devices.control_utils import (
+    busy_wait,
+    is_headless,
+    reset_follower_position,
+)
+from lerobot.common.robot_devices.robots.factory import Robot, make_robot
+from lerobot.common.utils.utils import (
+    init_hydra_config,
+    init_logging,
+    log_say,
+)
+
+
+def get_classifier(pretrained_path, config_path):
+    if pretrained_path is None or config_path is None:
+        return
+
+    from lerobot.common.policies.factory import _policy_cfg_from_hydra_cfg
+    from lerobot.common.policies.hilserl.classifier.configuration_classifier import (
+        ClassifierConfig,
+    )
+    from lerobot.common.policies.hilserl.classifier.modeling_classifier import (
+        Classifier,
+    )
+
+    cfg = init_hydra_config(config_path)
+
+    classifier_config = _policy_cfg_from_hydra_cfg(ClassifierConfig, cfg)
+    classifier_config.num_cameras = len(
+        cfg.training.image_keys
+    )  # TODO automate these paths
+    model = Classifier(classifier_config)
+    model.load_state_dict(Classifier.from_pretrained(pretrained_path).state_dict())
+    model = model.to("mps")
+    return model
+
+
+def rollout(
+    robot: Robot,
+    policy: Policy,
+    reward_classifier,
+    fps: int,
+    control_time_s: float = 20,
+    use_amp: bool = True,
+    display_cameras: bool = False,
+) -> dict:
+    """Run a batched policy rollout on the real robot.
+
+    The return dictionary contains:
+        "robot": A a dictionary of (batch, sequence + 1, *) tensors mapped to observation
+            keys. NOTE the that this has an extra sequence element relative to the other keys in the
+            dictionary. This is because an extra observation is included for after the environment is
+            terminated or truncated.
+        "action": A (batch, sequence, action_dim) tensor of actions applied based on the observations (not
+            including the last observations).
+        "reward": A (batch, sequence) tensor of rewards received for applying the actions.
+        "success": A (batch, sequence) tensor of success conditions (the only time this can be True is upon
+            environment termination/truncation).
+        "done": A (batch, sequence) tensor of **cumulative** done conditions. For any given batch element,
+            the first True is followed by True's all the way till the end. This can be used for masking
+            extraneous elements from the sequences above.
+
+    Args:
+        robot: The robot class that defines the interface with the real robot.
+        policy: The policy. Must be a PyTorch nn module.
+
+    Returns:
+        The dictionary described above.
+    """
+    # TODO (michel-aractingi): Infer the device from policy parameters when policy is added
+    # assert isinstance(policy, nn.Module), "Policy must be a PyTorch nn module."
+    # device = get_device_from_parameters(policy)
+
+    # define keyboard listener
+    listener, events = init_keyboard_listener()
+
+    # Reset the policy. TODO (michel-aractingi) add real policy evaluation once the code is ready.
+    # policy.reset()
+
+    # NOTE: sorting to make sure the key sequence is the same during training and testing.
+    observation = robot.capture_observation()
+    image_keys = [key for key in observation if "image" in key]
+    image_keys.sort()
+
+    all_actions = []
+    all_rewards = []
+    all_successes = []
+
+    start_episode_t = time.perf_counter()
+    init_pos = robot.follower_arms["main"].read("Present_Position")
+    timestamp = 0.0
+    while timestamp < control_time_s:
+        start_loop_t = time.perf_counter()
+
+        # Apply the next action.
+        while events["pause_policy"] and not events["human_intervention_step"]:
+            busy_wait(0.5)
+
+        if events["human_intervention_step"]:
+            # take over the robot's actions
+            observation, action = robot.teleop_step(record_data=True)
+            action = action["action"]  # teleop step returns torch tensors but in a dict
+        else:
+            # explore with policy
+            with torch.inference_mode():
+                # TODO (michel-aractingi) replace this part with policy (predict_action)
+                action = robot.follower_arms["main"].read("Present_Position")
+                action = torch.from_numpy(action)
+                robot.send_action(action)
+                # action = predict_action(observation, policy, device, use_amp)
+
+        observation = robot.capture_observation()
+        images = []
+        for key in image_keys:
+            if display_cameras:
+                cv2.imshow(
+                    key, cv2.cvtColor(observation[key].numpy(), cv2.COLOR_RGB2BGR)
+                )
+                cv2.waitKey(1)
+            images.append(observation[key].to("mps"))
+
+        reward = (
+            reward_classifier.predict_reward(images)
+            if reward_classifier is not None
+            else 0.0
+        )
+        all_rewards.append(reward)
+
+        # print("REWARD : ", reward)
+
+        all_actions.append(action)
+        all_successes.append(torch.tensor([False]))
+
+        dt_s = time.perf_counter() - start_loop_t
+        busy_wait(1 / fps - dt_s)
+        timestamp = time.perf_counter() - start_episode_t
+        if events["exit_early"]:
+            events["exit_early"] = False
+            events["human_intervention_step"] = False
+            events["pause_policy"] = False
+            break
+
+    reset_follower_position(robot, target_position=init_pos)
+
+    dones = torch.tensor([False] * len(all_actions))
+    dones[-1] = True
+    # Stack the sequence along the first dimension so that we have (batch, sequence, *) tensors.
+    ret = {
+        "action": torch.stack(all_actions, dim=1),
+        "next.reward": torch.stack(all_rewards, dim=1),
+        "next.success": torch.stack(all_successes, dim=1),
+        "done": dones,
+    }
+
+    listener.stop()
+
+    return ret
+
+
+def eval_policy(
+    robot: Robot,
+    policy: torch.nn.Module,
+    fps: float,
+    n_episodes: int,
+    control_time_s: int = 20,
+    use_amp: bool = True,
+    display_cameras: bool = False,
+    reward_classifier_pretrained_path: str | None = None,
+    reward_classifier_config_file: str | None = None,
+) -> dict:
+    """
+    Args:
+        env: The batch of environments.
+        policy: The policy.
+        n_episodes: The number of episodes to evaluate.
+    Returns:
+        Dictionary with metrics and data regarding the rollouts.
+    """
+    # TODO (michel-aractingi) comment this out for testing with a fixed policy
+    # assert isinstance(policy, Policy)
+    # policy.eval()
+
+    sum_rewards = []
+    max_rewards = []
+    successes = []
+    rollouts = []
+
+    start_eval = time.perf_counter()
+    progbar = trange(n_episodes, desc="Evaluating policy on real robot")
+    reward_classifier = get_classifier(
+        reward_classifier_pretrained_path, reward_classifier_config_file
+    )
+
+    for _ in progbar:
+        rollout_data = rollout(
+            robot,
+            policy,
+            reward_classifier,
+            fps,
+            control_time_s,
+            use_amp,
+            display_cameras,
+        )
+
+        rollouts.append(rollout_data)
+        sum_rewards.append(sum(rollout_data["next.reward"]))
+        max_rewards.append(max(rollout_data["next.reward"]))
+        successes.append(rollout_data["next.success"][-1])
+
+    info = {
+        "per_episode": [
+            {
+                "episode_ix": i,
+                "sum_reward": sum_reward,
+                "max_reward": max_reward,
+                "pc_success": success * 100,
+            }
+            for i, (sum_reward, max_reward, success) in enumerate(
+                zip(
+                    sum_rewards[:n_episodes],
+                    max_rewards[:n_episodes],
+                    successes[:n_episodes],
+                    strict=False,
+                )
+            )
+        ],
+        "aggregated": {
+            "avg_sum_reward": float(np.nanmean(torch.cat(sum_rewards[:n_episodes]))),
+            "avg_max_reward": float(np.nanmean(torch.cat(max_rewards[:n_episodes]))),
+            "pc_success": float(np.nanmean(torch.cat(successes[:n_episodes])) * 100),
+            "eval_s": time.time() - start_eval,
+            "eval_ep_s": (time.time() - start_eval) / n_episodes,
+        },
+    }
+
+    if robot.is_connected:
+        robot.disconnect()
+
+    return info
+
+
+def init_keyboard_listener():
+    # Allow to exit early while recording an episode or resetting the environment,
+    # by tapping the right arrow key '->'. This might require a sudo permission
+    # to allow your terminal to monitor keyboard events.
+    events = {}
+    events["exit_early"] = False
+    events["rerecord_episode"] = False
+    events["pause_policy"] = False
+    events["human_intervention_step"] = False
+
+    if is_headless():
+        logging.warning(
+            "Headless environment detected. On-screen cameras display and keyboard inputs will not be available."
+        )
+        listener = None
+        return listener, events
+
+    # Only import pynput if not in a headless environment
+    from pynput import keyboard
+
+    def on_press(key):
+        try:
+            if key == keyboard.Key.right:
+                print("Right arrow key pressed. Exiting loop...")
+                events["exit_early"] = True
+            elif key == keyboard.Key.left:
+                print(
+                    "Left arrow key pressed. Exiting loop and rerecord the last episode..."
+                )
+                events["rerecord_episode"] = True
+                events["exit_early"] = True
+            elif key == keyboard.Key.space:
+                # check if first space press then pause the policy for the user to get ready
+                # if second space press then the user is ready to start intervention
+                if not events["pause_policy"]:
+                    print(
+                        "Space key pressed. Human intervention required.\n"
+                        "Place the leader in similar pose to the follower and press space again."
+                    )
+                    events["pause_policy"] = True
+                    log_say(
+                        "Human intervention stage. Get ready to take over.",
+                        play_sounds=True,
+                    )
+                else:
+                    events["human_intervention_step"] = True
+                    print("Space key pressed. Human intervention starting.")
+                    log_say("Starting human intervention.", play_sounds=True)
+
+        except Exception as e:
+            print(f"Error handling key press: {e}")
+
+    listener = keyboard.Listener(on_press=on_press)
+    listener.start()
+
+    return listener, events
+
+
+if __name__ == "__main__":
+    init_logging()
+
+    parser = argparse.ArgumentParser(
+        description=__doc__, formatter_class=argparse.RawDescriptionHelpFormatter
+    )
+    group = parser.add_mutually_exclusive_group(required=True)
+    group.add_argument(
+        "--robot-path",
+        type=str,
+        default="lerobot/configs/robot/koch.yaml",
+        help="Path to robot yaml file used to instantiate the robot using `make_robot` factory function.",
+    )
+    group.add_argument(
+        "--robot-overrides",
+        type=str,
+        nargs="*",
+        help="Any key=value arguments to override config values (use dots for.nested=overrides)",
+    )
+    group.add_argument(
+        "-p",
+        "--pretrained-policy-name-or-path",
+        help=(
+            "Either the repo ID of a model hosted on the Hub or a path to a directory containing weights "
+            "saved using `Policy.save_pretrained`. If not provided, the policy is initialized from scratch "
+            "(useful for debugging). This argument is mutually exclusive with `--config`."
+        ),
+    )
+    group.add_argument(
+        "--config",
+        help=(
+            "Path to a yaml config you want to use for initializing a policy from scratch (useful for "
+            "debugging). This argument is mutually exclusive with `--pretrained-policy-name-or-path` (`-p`)."
+        ),
+    )
+    parser.add_argument(
+        "--revision", help="Optionally provide the Hugging Face Hub revision ID."
+    )
+    parser.add_argument(
+        "--out-dir",
+        help=(
+            "Where to save the evaluation outputs. If not provided, outputs are saved in "
+            "outputs/eval/{timestamp}_{env_name}_{policy_name}"
+        ),
+    )
+    parser.add_argument(
+        "--display-cameras",
+        help=("Whether to display the camera feed while the rollout is happening"),
+    )
+    parser.add_argument(
+        "--reward-classifier-pretrained-path",
+        type=str,
+        default=None,
+        help="Path to the pretrained classifier weights.",
+    )
+    parser.add_argument(
+        "--reward-classifier-config-file",
+        type=str,
+        default=None,
+        help="Path to a yaml config file that is necessary to build the reward classifier model.",
+    )
+
+    args = parser.parse_args()
+
+    robot_cfg = init_hydra_config(args.robot_path, args.robot_overrides)
+    robot = make_robot(robot_cfg)
+    if not robot.is_connected:
+        robot.connect()
+
+    eval_policy(
+        robot,
+        None,
+        fps=40,
+        n_episodes=2,
+        control_time_s=100,
+        display_cameras=args.display_cameras,
+        reward_classifier_config_file=args.reward_classifier_config_file,
+        reward_classifier_pretrained_path=args.reward_classifier_pretrained_path,
+    )

lerobot/scripts/find_motors_bus_port.py

@@ -32,9 +32,13 @@ def find_port():
         print(f"The port of this MotorsBus is '{port}'")
         print("Reconnect the USB cable.")
     elif len(ports_diff) == 0:
-        raise OSError(f"Could not detect the port. No difference was found ({ports_diff}).")
+        raise OSError(
+            f"Could not detect the port. No difference was found ({ports_diff})."
+        )
     else:
-        raise OSError(f"Could not detect the port. More than one port was found ({ports_diff}).")
+        raise OSError(
+            f"Could not detect the port. More than one port was found ({ports_diff})."
+        )
 
 
 if __name__ == "__main__":

lerobot/scripts/push_dataset_to_hub.py

@@ -56,24 +56,42 @@ from safetensors.torch import save_file
 from lerobot.common.datasets.compute_stats import compute_stats
 from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION, LeRobotDataset
 from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
-from lerobot.common.datasets.utils import create_branch, create_lerobot_dataset_card, flatten_dict
+from lerobot.common.datasets.utils import (
+    create_branch,
+    create_lerobot_dataset_card,
+    flatten_dict,
+)
 
 
 def get_from_raw_to_lerobot_format_fn(raw_format: str):
     if raw_format == "pusht_zarr":
-        from lerobot.common.datasets.push_dataset_to_hub.pusht_zarr_format import from_raw_to_lerobot_format
+        from lerobot.common.datasets.push_dataset_to_hub.pusht_zarr_format import (
+            from_raw_to_lerobot_format,
+        )
     elif raw_format == "umi_zarr":
-        from lerobot.common.datasets.push_dataset_to_hub.umi_zarr_format import from_raw_to_lerobot_format
+        from lerobot.common.datasets.push_dataset_to_hub.umi_zarr_format import (
+            from_raw_to_lerobot_format,
+        )
     elif raw_format == "aloha_hdf5":
-        from lerobot.common.datasets.push_dataset_to_hub.aloha_hdf5_format import from_raw_to_lerobot_format
-    elif "openx_rlds" in raw_format:
-        from lerobot.common.datasets.push_dataset_to_hub.openx_rlds_format import from_raw_to_lerobot_format
+        from lerobot.common.datasets.push_dataset_to_hub.aloha_hdf5_format import (
+            from_raw_to_lerobot_format,
+        )
+    elif raw_format in ["rlds", "openx"]:
+        from lerobot.common.datasets.push_dataset_to_hub.openx_rlds_format import (
+            from_raw_to_lerobot_format,
+        )
     elif raw_format == "dora_parquet":
-        from lerobot.common.datasets.push_dataset_to_hub.dora_parquet_format import from_raw_to_lerobot_format
+        from lerobot.common.datasets.push_dataset_to_hub.dora_parquet_format import (
+            from_raw_to_lerobot_format,
+        )
     elif raw_format == "xarm_pkl":
-        from lerobot.common.datasets.push_dataset_to_hub.xarm_pkl_format import from_raw_to_lerobot_format
+        from lerobot.common.datasets.push_dataset_to_hub.xarm_pkl_format import (
+            from_raw_to_lerobot_format,
+        )
     elif raw_format == "cam_png":
-        from lerobot.common.datasets.push_dataset_to_hub.cam_png_format import from_raw_to_lerobot_format
+        from lerobot.common.datasets.push_dataset_to_hub.cam_png_format import (
+            from_raw_to_lerobot_format,
+        )
     else:
         raise ValueError(
             f"The selected {raw_format} can't be found. Did you add it to `lerobot/scripts/push_dataset_to_hub.py::get_from_raw_to_lerobot_format_fn`?"
@@ -83,7 +101,10 @@ def get_from_raw_to_lerobot_format_fn(raw_format: str):
 
 
 def save_meta_data(
-    info: dict[str, Any], stats: dict, episode_data_index: dict[str, list], meta_data_dir: Path
+    info: dict[str, Any],
+    stats: dict,
+    episode_data_index: dict[str, list],
+    meta_data_dir: Path,
 ):
     meta_data_dir.mkdir(parents=True, exist_ok=True)
 
@@ -97,12 +118,16 @@ def save_meta_data(
     save_file(flatten_dict(stats), stats_path)
 
     # save episode_data_index
-    episode_data_index = {key: torch.tensor(episode_data_index[key]) for key in episode_data_index}
+    episode_data_index = {
+        key: torch.tensor(episode_data_index[key]) for key in episode_data_index
+    }
     ep_data_idx_path = meta_data_dir / "episode_data_index.safetensors"
     save_file(episode_data_index, ep_data_idx_path)
 
 
-def push_meta_data_to_hub(repo_id: str, meta_data_dir: str | Path, revision: str | None):
+def push_meta_data_to_hub(
+    repo_id: str, meta_data_dir: str | Path, revision: str | None
+):
     """Expect all meta data files to be all stored in a single "meta_data" directory.
     On the hugging face repositery, they will be uploaded in a "meta_data" directory at the root.
     """
@@ -187,7 +212,9 @@ def push_dataset_to_hub(
             if force_override:
                 shutil.rmtree(local_dir)
             elif not resume:
-                raise ValueError(f"`local_dir` already exists ({local_dir}). Use `--force-override 1`.")
+                raise ValueError(
+                    f"`local_dir` already exists ({local_dir}). Use `--force-override 1`."
+                )
 
         meta_data_dir = local_dir / "meta_data"
         videos_dir = local_dir / "videos"
@@ -204,24 +231,14 @@ def push_dataset_to_hub(
     # convert dataset from original raw format to LeRobot format
     from_raw_to_lerobot_format = get_from_raw_to_lerobot_format_fn(raw_format)
 
-    fmt_kwgs = {
-        "raw_dir": raw_dir,
-        "videos_dir": videos_dir,
-        "fps": fps,
-        "video": video,
-        "episodes": episodes,
-        "encoding": encoding,
-    }
-
-    if "openx_rlds." in raw_format:
-        # Support for official OXE dataset name inside `raw_format`.
-        # For instance, `raw_format="oxe_rlds"` uses the default formating (TODO what does that mean?),
-        # and `raw_format="oxe_rlds.bridge_orig"` uses the brdige_orig formating
-        _, openx_dataset_name = raw_format.split(".")
-        print(f"Converting dataset [{openx_dataset_name}] from 'openx_rlds' to LeRobot format.")
-        fmt_kwgs["openx_dataset_name"] = openx_dataset_name
-
-    hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(**fmt_kwgs)
+    hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(
+        raw_dir,
+        videos_dir,
+        fps,
+        video,
+        episodes,
+        encoding,
+    )
 
     lerobot_dataset = LeRobotDataset.from_preloaded(
         repo_id=repo_id,
@@ -233,7 +250,9 @@ def push_dataset_to_hub(
     stats = compute_stats(lerobot_dataset, batch_size, num_workers)
 
     if local_dir:
-        hf_dataset = hf_dataset.with_format(None)  # to remove transforms that cant be saved
+        hf_dataset = hf_dataset.with_format(
+            None
+        )  # to remove transforms that cant be saved
         hf_dataset.save_to_disk(str(local_dir / "train"))
 
     if push_to_hub or local_dir:
@@ -290,7 +309,7 @@ def main():
         "--raw-format",
         type=str,
         required=True,
-        help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`, `openx_rlds`).",
+        help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`, `rlds`, `openx`).",
     )
     parser.add_argument(
         "--repo-id",

lerobot/scripts/server/actor_server.py

@@ -0,0 +1,641 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+import logging
+from statistics import mean, quantiles
+from functools import lru_cache
+from lerobot.scripts.server.utils import setup_process_handlers
+
+# from lerobot.scripts.eval import eval_policy
+
+import grpc
+import hydra
+import torch
+from omegaconf import DictConfig
+from torch import nn
+import time
+
+# TODO: Remove the import of maniskill
+# from lerobot.common.envs.factory import make_maniskill_env
+# from lerobot.common.envs.utils import preprocess_maniskill_observation
+from lerobot.common.policies.factory import make_policy
+from lerobot.common.policies.sac.modeling_sac import SACPolicy
+from lerobot.common.robot_devices.robots.factory import make_robot
+from lerobot.common.robot_devices.robots.utils import Robot
+from lerobot.common.utils.utils import (
+    TimerManager,
+    get_safe_torch_device,
+    set_global_seed,
+)
+from lerobot.scripts.server import hilserl_pb2, hilserl_pb2_grpc
+from lerobot.scripts.server.buffer import (
+    Transition,
+    move_state_dict_to_device,
+    move_transition_to_device,
+    python_object_to_bytes,
+    transitions_to_bytes,
+    bytes_to_state_dict,
+)
+from lerobot.scripts.server.network_utils import (
+    receive_bytes_in_chunks,
+    send_bytes_in_chunks,
+)
+from lerobot.scripts.server.gym_manipulator import get_classifier, make_robot_env
+from lerobot.scripts.server import learner_service
+from lerobot.common.robot_devices.utils import busy_wait
+
+from torch.multiprocessing import Queue, Event
+from queue import Empty
+
+from lerobot.common.utils.utils import init_logging
+
+from lerobot.scripts.server.utils import get_last_item_from_queue
+
+ACTOR_SHUTDOWN_TIMEOUT = 30
+
+
+def receive_policy(
+    cfg: DictConfig,
+    parameters_queue: Queue,
+    shutdown_event: any,  # Event,
+    learner_client: hilserl_pb2_grpc.LearnerServiceStub | None = None,
+    grpc_channel: grpc.Channel | None = None,
+):
+    logging.info("[ACTOR] Start receiving parameters from the Learner")
+
+    if not use_threads(cfg):
+        # Setup process handlers to handle shutdown signal
+        # But use shutdown event from the main process
+        setup_process_handlers(False)
+
+    if grpc_channel is None or learner_client is None:
+        learner_client, grpc_channel = learner_service_client(
+            host=cfg.actor_learner_config.learner_host,
+            port=cfg.actor_learner_config.learner_port,
+        )
+
+    try:
+        iterator = learner_client.StreamParameters(hilserl_pb2.Empty())
+        receive_bytes_in_chunks(
+            iterator,
+            parameters_queue,
+            shutdown_event,
+            log_prefix="[ACTOR] parameters",
+        )
+    except grpc.RpcError as e:
+        logging.error(f"[ACTOR] gRPC error: {e}")
+
+    if not use_threads(cfg):
+        grpc_channel.close()
+    logging.info("[ACTOR] Received policy loop stopped")
+
+
+def transitions_stream(
+    shutdown_event: Event, transitions_queue: Queue
+) -> hilserl_pb2.Empty:
+    while not shutdown_event.is_set():
+        try:
+            message = transitions_queue.get(block=True, timeout=5)
+        except Empty:
+            logging.debug("[ACTOR] Transition queue is empty")
+            continue
+
+        yield from send_bytes_in_chunks(
+            message, hilserl_pb2.Transition, log_prefix="[ACTOR] Send transitions"
+        )
+
+    return hilserl_pb2.Empty()
+
+
+def interactions_stream(
+    shutdown_event: any,  # Event,
+    interactions_queue: Queue,
+) -> hilserl_pb2.Empty:
+    while not shutdown_event.is_set():
+        try:
+            message = interactions_queue.get(block=True, timeout=5)
+        except Empty:
+            logging.debug("[ACTOR] Interaction queue is empty")
+            continue
+
+        yield from send_bytes_in_chunks(
+            message,
+            hilserl_pb2.InteractionMessage,
+            log_prefix="[ACTOR] Send interactions",
+        )
+
+    return hilserl_pb2.Empty()
+
+
+def send_transitions(
+    cfg: DictConfig,
+    transitions_queue: Queue,
+    shutdown_event: any,  # Event,
+    learner_client: hilserl_pb2_grpc.LearnerServiceStub | None = None,
+    grpc_channel: grpc.Channel | None = None,
+) -> hilserl_pb2.Empty:
+    """
+    Sends transitions to the learner.
+
+    This function continuously retrieves messages from the queue and processes:
+
+    - **Transition Data:**
+        - A batch of transitions (observation, action, reward, next observation) is collected.
+        - Transitions are moved to the CPU and serialized using PyTorch.
+        - The serialized data is wrapped in a `hilserl_pb2.Transition` message and sent to the learner.
+    """
+
+    if not use_threads(cfg):
+        # Setup process handlers to handle shutdown signal
+        # But use shutdown event from the main process
+        setup_process_handlers(False)
+
+    if grpc_channel is None or learner_client is None:
+        learner_client, grpc_channel = learner_service_client(
+            host=cfg.actor_learner_config.learner_host,
+            port=cfg.actor_learner_config.learner_port,
+        )
+
+    try:
+        learner_client.SendTransitions(
+            transitions_stream(shutdown_event, transitions_queue)
+        )
+    except grpc.RpcError as e:
+        logging.error(f"[ACTOR] gRPC error: {e}")
+
+    logging.info("[ACTOR] Finished streaming transitions")
+
+    if not use_threads(cfg):
+        grpc_channel.close()
+    logging.info("[ACTOR] Transitions process stopped")
+
+
+def send_interactions(
+    cfg: DictConfig,
+    interactions_queue: Queue,
+    shutdown_event: any,  # Event,
+    learner_client: hilserl_pb2_grpc.LearnerServiceStub | None = None,
+    grpc_channel: grpc.Channel | None = None,
+) -> hilserl_pb2.Empty:
+    """
+    Sends interactions to the learner.
+
+    This function continuously retrieves messages from the queue and processes:
+
+    - **Interaction Messages:**
+        - Contains useful statistics about episodic rewards and policy timings.
+        - The message is serialized using `pickle` and sent to the learner.
+    """
+
+    if not use_threads(cfg):
+        # Setup process handlers to handle shutdown signal
+        # But use shutdown event from the main process
+        setup_process_handlers(False)
+
+    if grpc_channel is None or learner_client is None:
+        learner_client, grpc_channel = learner_service_client(
+            host=cfg.actor_learner_config.learner_host,
+            port=cfg.actor_learner_config.learner_port,
+        )
+
+    try:
+        learner_client.SendInteractions(
+            interactions_stream(shutdown_event, interactions_queue)
+        )
+    except grpc.RpcError as e:
+        logging.error(f"[ACTOR] gRPC error: {e}")
+
+    logging.info("[ACTOR] Finished streaming interactions")
+
+    if not use_threads(cfg):
+        grpc_channel.close()
+    logging.info("[ACTOR] Interactions process stopped")
+
+
+@lru_cache(maxsize=1)
+def learner_service_client(
+    host="127.0.0.1", port=50051
+) -> tuple[hilserl_pb2_grpc.LearnerServiceStub, grpc.Channel]:
+    import json
+
+    """
+    Returns a client for the learner service.
+
+    GRPC uses HTTP/2, which is a binary protocol and multiplexes requests over a single connection.
+    So we need to create only one client and reuse it.
+    """
+
+    service_config = {
+        "methodConfig": [
+            {
+                "name": [{}],  # Applies to ALL methods in ALL services
+                "retryPolicy": {
+                    "maxAttempts": 5,  # Max retries (total attempts = 5)
+                    "initialBackoff": "0.1s",  # First retry after 0.1s
+                    "maxBackoff": "2s",  # Max wait time between retries
+                    "backoffMultiplier": 2,  # Exponential backoff factor
+                    "retryableStatusCodes": [
+                        "UNAVAILABLE",
+                        "DEADLINE_EXCEEDED",
+                    ],  # Retries on network failures
+                },
+            }
+        ]
+    }
+
+    service_config_json = json.dumps(service_config)
+
+    channel = grpc.insecure_channel(
+        f"{host}:{port}",
+        options=[
+            ("grpc.max_receive_message_length", learner_service.MAX_MESSAGE_SIZE),
+            ("grpc.max_send_message_length", learner_service.MAX_MESSAGE_SIZE),
+            ("grpc.enable_retries", 1),
+            ("grpc.service_config", service_config_json),
+        ],
+    )
+    stub = hilserl_pb2_grpc.LearnerServiceStub(channel)
+    logging.info("[ACTOR] Learner service client created")
+    return stub, channel
+
+
+def update_policy_parameters(policy: SACPolicy, parameters_queue: Queue, device):
+    if not parameters_queue.empty():
+        logging.info("[ACTOR] Load new parameters from Learner.")
+        bytes_state_dict = get_last_item_from_queue(parameters_queue)
+        state_dict = bytes_to_state_dict(bytes_state_dict)
+        state_dict = move_state_dict_to_device(state_dict, device=device)
+        policy.load_state_dict(state_dict)
+
+
+def act_with_policy(
+    cfg: DictConfig,
+    robot: Robot,
+    reward_classifier: nn.Module,
+    shutdown_event: any,  # Event,
+    parameters_queue: Queue,
+    transitions_queue: Queue,
+    interactions_queue: Queue,
+):
+    """
+    Executes policy interaction within the environment.
+
+    This function rolls out the policy in the environment, collecting interaction data and pushing it to a queue for streaming to the learner.
+    Once an episode is completed, updated network parameters received from the learner are retrieved from a queue and loaded into the network.
+
+    Args:
+        cfg (DictConfig): Configuration settings for the interaction process.
+    """
+
+    logging.info("make_env online")
+
+    online_env = make_robot_env(
+        robot=robot, reward_classifier=reward_classifier, cfg=cfg
+    )
+
+    set_global_seed(cfg.seed)
+    device = get_safe_torch_device(cfg.device, log=True)
+
+    torch.backends.cudnn.benchmark = True
+    torch.backends.cuda.matmul.allow_tf32 = True
+
+    logging.info("make_policy")
+
+    ### Instantiate the policy in both the actor and learner processes
+    ### To avoid sending a SACPolicy object through the port, we create a policy intance
+    ### on both sides, the learner sends the updated parameters every n steps to update the actor's parameters
+    # TODO: At some point we should just need make sac policy
+    policy: SACPolicy = make_policy(
+        hydra_cfg=cfg,
+        # dataset_stats=offline_dataset.meta.stats if not cfg.resume else None,
+        # Hack: But if we do online training, we do not need dataset_stats
+        dataset_stats=None,
+        # TODO: Handle resume training
+        device=device,
+    )
+    policy = torch.compile(policy)
+    assert isinstance(policy, nn.Module)
+
+    obs, info = online_env.reset()
+
+    # NOTE: For the moment we will solely handle the case of a single environment
+    sum_reward_episode = 0
+    list_transition_to_send_to_learner = []
+    list_policy_time = []
+    episode_intervention = False
+    # Add counters for intervention rate calculation
+    episode_intervention_steps = 0
+    episode_total_steps = 0
+
+    for interaction_step in range(cfg.training.online_steps):
+        start_time = time.perf_counter()
+        if shutdown_event.is_set():
+            logging.info("[ACTOR] Shutting down act_with_policy")
+            return
+
+        if interaction_step >= cfg.training.online_step_before_learning:
+            # Time policy inference and check if it meets FPS requirement
+            with TimerManager(
+                elapsed_time_list=list_policy_time,
+                label="Policy inference time",
+                log=False,
+            ) as timer:  # noqa: F841
+                action = policy.select_action(batch=obs)
+            policy_fps = 1.0 / (list_policy_time[-1] + 1e-9)
+
+            log_policy_frequency_issue(
+                policy_fps=policy_fps, cfg=cfg, interaction_step=interaction_step
+            )
+
+            next_obs, reward, done, truncated, info = online_env.step(
+                action.squeeze(dim=0).cpu().numpy()
+            )
+        else:
+            # TODO (azouitine): Make a custom space for torch tensor
+            action = online_env.action_space.sample()
+            next_obs, reward, done, truncated, info = online_env.step(action)
+
+            # HACK: We have only one env but we want to batch it, it will be resolved with the torch box
+            action = (
+                torch.from_numpy(action[0])
+                .to(device, non_blocking=device.type == "cuda")
+                .unsqueeze(dim=0)
+            )
+
+        sum_reward_episode += float(reward)
+        # Increment total steps counter for intervention rate
+        episode_total_steps += 1
+
+        # NOTE: We overide the action if the intervention is True, because the action applied is the intervention action
+        if "is_intervention" in info and info["is_intervention"]:
+            # TODO: Check the shape
+            # NOTE: The action space for demonstration before hand is with the full action space
+            # but sometimes for example we want to deactivate the gripper
+            action = info["action_intervention"]
+            episode_intervention = True
+            # Increment intervention steps counter
+            episode_intervention_steps += 1
+
+        # Check for NaN values in observations
+        for key, tensor in obs.items():
+            if torch.isnan(tensor).any():
+                logging.error(
+                    f"[ACTOR] NaN values found in obs[{key}] at step {interaction_step}"
+                )
+
+        list_transition_to_send_to_learner.append(
+            Transition(
+                state=obs,
+                action=action,
+                reward=reward,
+                next_state=next_obs,
+                done=done,
+                truncated=truncated,  # TODO: (azouitine) Handle truncation properly
+                complementary_info=info,  # TODO Handle information for the transition, is_demonstraction: bool
+            )
+        )
+        # assign obs to the next obs and continue the rollout
+        obs = next_obs
+
+        # HACK: We have only one env but we want to batch it, it will be resolved with the torch box
+        # Because we are using a single environment we can index at zero
+        if done or truncated:
+            # TODO: Handle logging for episode information
+            logging.info(
+                f"[ACTOR] Global step {interaction_step}: Episode reward: {sum_reward_episode}"
+            )
+
+            update_policy_parameters(
+                policy=policy.actor, parameters_queue=parameters_queue, device=device
+            )
+
+            if len(list_transition_to_send_to_learner) > 0:
+                push_transitions_to_transport_queue(
+                    transitions=list_transition_to_send_to_learner,
+                    transitions_queue=transitions_queue,
+                )
+                list_transition_to_send_to_learner = []
+
+            stats = get_frequency_stats(list_policy_time)
+            list_policy_time.clear()
+
+            # Calculate intervention rate
+            intervention_rate = 0.0
+            if episode_total_steps > 0:
+                intervention_rate = episode_intervention_steps / episode_total_steps
+
+            # Send episodic reward to the learner
+            interactions_queue.put(
+                python_object_to_bytes(
+                    {
+                        "Episodic reward": sum_reward_episode,
+                        "Interaction step": interaction_step,
+                        "Episode intervention": int(episode_intervention),
+                        "Intervention rate": intervention_rate,
+                        **stats,
+                    }
+                )
+            )
+            sum_reward_episode = 0.0
+            episode_intervention = False
+            # Reset intervention counters
+            episode_intervention_steps = 0
+            episode_total_steps = 0
+            obs, info = online_env.reset()
+
+        if cfg.fps is not None:
+            dt_time = time.perf_counter() - start_time
+            busy_wait(1 / cfg.fps - dt_time)
+
+
+def push_transitions_to_transport_queue(transitions: list, transitions_queue):
+    """Send transitions to learner in smaller chunks to avoid network issues.
+
+    Args:
+        transitions: List of transitions to send
+        message_queue: Queue to send messages to learner
+        chunk_size: Size of each chunk to send
+    """
+    transition_to_send_to_learner = []
+    for transition in transitions:
+        tr = move_transition_to_device(transition=transition, device="cpu")
+        for key, value in tr["state"].items():
+            if torch.isnan(value).any():
+                logging.warning(f"Found NaN values in transition {key}")
+
+        transition_to_send_to_learner.append(tr)
+
+    transitions_queue.put(transitions_to_bytes(transition_to_send_to_learner))
+
+
+def get_frequency_stats(list_policy_time: list[float]) -> dict[str, float]:
+    stats = {}
+    list_policy_fps = [1.0 / t for t in list_policy_time]
+    if len(list_policy_fps) > 1:
+        policy_fps = mean(list_policy_fps)
+        quantiles_90 = quantiles(list_policy_fps, n=10)[-1]
+        logging.debug(f"[ACTOR] Average policy frame rate: {policy_fps}")
+        logging.debug(f"[ACTOR] Policy frame rate 90th percentile: {quantiles_90}")
+        stats = {
+            "Policy frequency [Hz]": policy_fps,
+            "Policy frequency 90th-p [Hz]": quantiles_90,
+        }
+    return stats
+
+
+def log_policy_frequency_issue(
+    policy_fps: float, cfg: DictConfig, interaction_step: int
+):
+    if policy_fps < cfg.fps:
+        logging.warning(
+            f"[ACTOR] Policy FPS {policy_fps:.1f} below required {cfg.fps} at step {interaction_step}"
+        )
+
+
+def establish_learner_connection(
+    stub,
+    shutdown_event: any,  # Event,
+    attempts=30,
+):
+    for _ in range(attempts):
+        if shutdown_event.is_set():
+            logging.info("[ACTOR] Shutting down establish_learner_connection")
+            return False
+
+        # Force a connection attempt and check state
+        try:
+            logging.info("[ACTOR] Send ready message to Learner")
+            if stub.Ready(hilserl_pb2.Empty()) == hilserl_pb2.Empty():
+                return True
+        except grpc.RpcError as e:
+            logging.error(f"[ACTOR] Waiting for Learner to be ready... {e}")
+            time.sleep(2)
+    return False
+
+
+def use_threads(cfg: DictConfig) -> bool:
+    return cfg.actor_learner_config.concurrency.actor == "threads"
+
+
+@hydra.main(version_base="1.2", config_name="default", config_path="../../configs")
+def actor_cli(cfg: dict):
+    if not use_threads(cfg):
+        import torch.multiprocessing as mp
+
+        mp.set_start_method("spawn")
+
+    init_logging(log_file="actor.log")
+    robot = make_robot(cfg=cfg.robot)
+
+    shutdown_event = setup_process_handlers(use_threads(cfg))
+
+    learner_client, grpc_channel = learner_service_client(
+        host=cfg.actor_learner_config.learner_host,
+        port=cfg.actor_learner_config.learner_port,
+    )
+
+    logging.info("[ACTOR] Establishing connection with Learner")
+    if not establish_learner_connection(learner_client, shutdown_event):
+        logging.error("[ACTOR] Failed to establish connection with Learner")
+        return
+
+    if not use_threads(cfg):
+        # If we use multithreading, we can reuse the channel
+        grpc_channel.close()
+        grpc_channel = None
+
+    logging.info("[ACTOR] Connection with Learner established")
+
+    parameters_queue = Queue()
+    transitions_queue = Queue()
+    interactions_queue = Queue()
+
+    concurrency_entity = None
+    if use_threads(cfg):
+        from threading import Thread
+
+        concurrency_entity = Thread
+    else:
+        from multiprocessing import Process
+
+        concurrency_entity = Process
+
+    receive_policy_process = concurrency_entity(
+        target=receive_policy,
+        args=(cfg, parameters_queue, shutdown_event, grpc_channel),
+        daemon=True,
+    )
+
+    transitions_process = concurrency_entity(
+        target=send_transitions,
+        args=(cfg, transitions_queue, shutdown_event, grpc_channel),
+        daemon=True,
+    )
+
+    interactions_process = concurrency_entity(
+        target=send_interactions,
+        args=(cfg, interactions_queue, shutdown_event, grpc_channel),
+        daemon=True,
+    )
+
+    transitions_process.start()
+    interactions_process.start()
+    receive_policy_process.start()
+
+    # HACK: FOR MANISKILL we do not have a reward classifier
+    # TODO: Remove this once we merge into main
+    reward_classifier = None
+    if (
+        cfg.env.reward_classifier.pretrained_path is not None
+        and cfg.env.reward_classifier.config_path is not None
+    ):
+        reward_classifier = get_classifier(
+            pretrained_path=cfg.env.reward_classifier.pretrained_path,
+            config_path=cfg.env.reward_classifier.config_path,
+        )
+
+    act_with_policy(
+        cfg,
+        robot,
+        reward_classifier,
+        shutdown_event,
+        parameters_queue,
+        transitions_queue,
+        interactions_queue,
+    )
+    logging.info("[ACTOR] Policy process joined")
+
+    logging.info("[ACTOR] Closing queues")
+    transitions_queue.close()
+    interactions_queue.close()
+    parameters_queue.close()
+
+    transitions_process.join()
+    logging.info("[ACTOR] Transitions process joined")
+    interactions_process.join()
+    logging.info("[ACTOR] Interactions process joined")
+    receive_policy_process.join()
+    logging.info("[ACTOR] Receive policy process joined")
+
+    logging.info("[ACTOR] join queues")
+    transitions_queue.cancel_join_thread()
+    interactions_queue.cancel_join_thread()
+    parameters_queue.cancel_join_thread()
+
+    logging.info("[ACTOR] queues closed")
+
+
+if __name__ == "__main__":
+    actor_cli()