Compare commits
61 Commits
thom-act
...
user/youli
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
9f751093bc | ||
|
|
1837b4c1ff | ||
|
|
3380665e3e | ||
|
|
471eab3d7e | ||
|
|
64425d5e00 | ||
|
|
e410e5d711 | ||
|
|
cc2f6e7404 | ||
|
|
a4d77b99f0 | ||
|
|
7bd5ab16d1 | ||
|
|
74362ac453 | ||
|
|
964f9e86d6 | ||
|
|
7a5fc76b9f | ||
|
|
85fec65b3e | ||
|
|
a644084f98 | ||
|
|
342f429f1c | ||
|
|
7d1542cae1 | ||
|
|
61e51c9fe4 | ||
|
|
3e4d7beb5d | ||
|
|
4ab4950da8 | ||
|
|
9aa4cdb976 | ||
|
|
2abef3bef9 | ||
|
|
48951662f2 | ||
|
|
56199fb76f | ||
|
|
11f1cb5dc9 | ||
|
|
b72d574891 | ||
|
|
15dd682714 | ||
|
|
e28fa2344c | ||
|
|
a92d79fff2 | ||
|
|
125bd93e29 | ||
|
|
c38f535c9f | ||
|
|
ff8f6aa6cd | ||
|
|
1cf050d412 | ||
|
|
54c9776bde | ||
|
|
a06598678c | ||
|
|
055a6f60c6 | ||
|
|
e54d6ea1eb | ||
|
|
1eb4bfe2e4 | ||
|
|
21f222fa1d | ||
|
|
33362dbd17 | ||
|
|
b0d954c6e1 | ||
|
|
bd3111f28b | ||
|
|
cf15cba5fc | ||
|
|
042e193995 | ||
|
|
d585c73f9f | ||
|
|
504d2aaf48 | ||
|
|
83f4f7f7e8 | ||
|
|
633115d861 | ||
|
|
57fb5fe8a6 | ||
|
|
0b51a335bc | ||
|
|
111cd58f8a | ||
|
|
265b0ec44d | ||
|
|
2c2e4e14ed | ||
|
|
13310681b1 | ||
|
|
3d625ae6d3 | ||
|
|
e3b9f1c19b | ||
|
|
7ec76ee235 | ||
|
|
3b86050ab0 | ||
|
|
6d39b73399 | ||
|
|
aca424a481 | ||
|
|
35c1ce7a66 | ||
|
|
e67da1d7a6 |
98
.github/workflows/build-docker-images.yml
vendored
98
.github/workflows/build-docker-images.yml
vendored
@@ -10,7 +10,6 @@ on:
|
||||
|
||||
env:
|
||||
PYTHON_VERSION: "3.10"
|
||||
# CI_SLACK_CHANNEL: ${{ secrets.CI_DOCKER_CHANNEL }}
|
||||
|
||||
jobs:
|
||||
latest-cpu:
|
||||
@@ -35,6 +34,8 @@ jobs:
|
||||
|
||||
- name: Check out code
|
||||
uses: actions/checkout@v4
|
||||
with:
|
||||
lfs: true
|
||||
|
||||
- name: Login to DockerHub
|
||||
uses: docker/login-action@v3
|
||||
@@ -51,34 +52,50 @@ jobs:
|
||||
tags: huggingface/lerobot-cpu
|
||||
build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
|
||||
|
||||
# - name: Post to a Slack channel
|
||||
# id: slack
|
||||
# #uses: slackapi/slack-github-action@v1.25.0
|
||||
# uses: slackapi/slack-github-action@6c661ce58804a1a20f6dc5fbee7f0381b469e001
|
||||
# with:
|
||||
# # Slack channel id, channel name, or user id to post message.
|
||||
# # See also: https://api.slack.com/methods/chat.postMessage#channels
|
||||
# channel-id: ${{ env.CI_SLACK_CHANNEL }}
|
||||
# # For posting a rich message using Block Kit
|
||||
# payload: |
|
||||
# {
|
||||
# "text": "lerobot-cpu Docker Image build result: ${{ job.status }}\n${{ github.event.pull_request.html_url || github.event.head_commit.url }}",
|
||||
# "blocks": [
|
||||
# {
|
||||
# "type": "section",
|
||||
# "text": {
|
||||
# "type": "mrkdwn",
|
||||
# "text": "lerobot-cpu Docker Image build result: ${{ job.status }}\n${{ github.event.pull_request.html_url || github.event.head_commit.url }}"
|
||||
# }
|
||||
# }
|
||||
# ]
|
||||
# }
|
||||
# env:
|
||||
# SLACK_BOT_TOKEN: ${{ secrets.SLACK_CIFEEDBACK_BOT_TOKEN }}
|
||||
|
||||
latest-cuda:
|
||||
name: GPU
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Cleanup disk
|
||||
run: |
|
||||
sudo df -h
|
||||
# sudo ls -l /usr/local/lib/
|
||||
# sudo ls -l /usr/share/
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo rm -rf /usr/local/lib/android
|
||||
sudo rm -rf /usr/share/dotnet
|
||||
sudo du -sh /usr/local/lib/
|
||||
sudo du -sh /usr/share/
|
||||
sudo df -h
|
||||
- name: Set up Docker Buildx
|
||||
uses: docker/setup-buildx-action@v3
|
||||
|
||||
- name: Check out code
|
||||
uses: actions/checkout@v4
|
||||
with:
|
||||
lfs: true
|
||||
|
||||
- name: Login to DockerHub
|
||||
uses: docker/login-action@v3
|
||||
with:
|
||||
username: ${{ secrets.DOCKERHUB_USERNAME }}
|
||||
password: ${{ secrets.DOCKERHUB_PASSWORD }}
|
||||
|
||||
- name: Build and Push GPU
|
||||
uses: docker/build-push-action@v5
|
||||
with:
|
||||
context: .
|
||||
file: ./docker/lerobot-gpu/Dockerfile
|
||||
push: true
|
||||
tags: huggingface/lerobot-gpu
|
||||
build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
|
||||
|
||||
|
||||
latest-cuda-dev:
|
||||
name: GPU Dev
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Cleanup disk
|
||||
run: |
|
||||
@@ -104,36 +121,11 @@ jobs:
|
||||
username: ${{ secrets.DOCKERHUB_USERNAME }}
|
||||
password: ${{ secrets.DOCKERHUB_PASSWORD }}
|
||||
|
||||
- name: Build and Push GPU
|
||||
- name: Build and Push GPU dev
|
||||
uses: docker/build-push-action@v5
|
||||
with:
|
||||
context: .
|
||||
file: ./docker/lerobot-gpu/Dockerfile
|
||||
file: ./docker/lerobot-gpu-dev/Dockerfile
|
||||
push: true
|
||||
tags: huggingface/lerobot-gpu
|
||||
tags: huggingface/lerobot-gpu:dev
|
||||
build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
|
||||
|
||||
# - name: Post to a Slack channel
|
||||
# id: slack
|
||||
# #uses: slackapi/slack-github-action@v1.25.0
|
||||
# uses: slackapi/slack-github-action@6c661ce58804a1a20f6dc5fbee7f0381b469e001
|
||||
# with:
|
||||
# # Slack channel id, channel name, or user id to post message.
|
||||
# # See also: https://api.slack.com/methods/chat.postMessage#channels
|
||||
# channel-id: ${{ env.CI_SLACK_CHANNEL }}
|
||||
# # For posting a rich message using Block Kit
|
||||
# payload: |
|
||||
# {
|
||||
# "text": "lerobot-gpu Docker Image build result: ${{ job.status }}\n${{ github.event.pull_request.html_url || github.event.head_commit.url }}",
|
||||
# "blocks": [
|
||||
# {
|
||||
# "type": "section",
|
||||
# "text": {
|
||||
# "type": "mrkdwn",
|
||||
# "text": "lerobot-gpu Docker Image build result: ${{ job.status }}\n${{ github.event.pull_request.html_url || github.event.head_commit.url }}"
|
||||
# }
|
||||
# }
|
||||
# ]
|
||||
# }
|
||||
# env:
|
||||
# SLACK_BOT_TOKEN: ${{ secrets.SLACK_CIFEEDBACK_BOT_TOKEN }}
|
||||
|
||||
2
.github/workflows/nightly-tests.yml
vendored
2
.github/workflows/nightly-tests.yml
vendored
@@ -70,6 +70,8 @@ jobs:
|
||||
# files: ./coverage.xml
|
||||
# verbose: true
|
||||
- name: Tests end-to-end
|
||||
env:
|
||||
DEVICE: cuda
|
||||
run: make test-end-to-end
|
||||
|
||||
# - name: Generate Report
|
||||
|
||||
11
.github/workflows/test.yml
vendored
11
.github/workflows/test.yml
vendored
@@ -10,6 +10,7 @@ on:
|
||||
- "examples/**"
|
||||
- ".github/**"
|
||||
- "poetry.lock"
|
||||
- "Makefile"
|
||||
push:
|
||||
branches:
|
||||
- main
|
||||
@@ -19,6 +20,7 @@ on:
|
||||
- "examples/**"
|
||||
- ".github/**"
|
||||
- "poetry.lock"
|
||||
- "Makefile"
|
||||
|
||||
jobs:
|
||||
pytest:
|
||||
@@ -32,8 +34,8 @@ jobs:
|
||||
with:
|
||||
lfs: true # Ensure LFS files are pulled
|
||||
|
||||
- name: Install EGL
|
||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
|
||||
- name: Install apt dependencies
|
||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev ffmpeg
|
||||
|
||||
- name: Install poetry
|
||||
run: |
|
||||
@@ -70,6 +72,9 @@ jobs:
|
||||
with:
|
||||
lfs: true # Ensure LFS files are pulled
|
||||
|
||||
- name: Install apt dependencies
|
||||
run: sudo apt-get update && sudo apt-get install -y ffmpeg
|
||||
|
||||
- name: Install poetry
|
||||
run: |
|
||||
pipx install poetry && poetry config virtualenvs.in-project true
|
||||
@@ -104,7 +109,7 @@ jobs:
|
||||
with:
|
||||
lfs: true # Ensure LFS files are pulled
|
||||
|
||||
- name: Install EGL
|
||||
- name: Install apt dependencies
|
||||
run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
|
||||
|
||||
- name: Install poetry
|
||||
|
||||
18
.github/workflows/trufflehog.yml
vendored
Normal file
18
.github/workflows/trufflehog.yml
vendored
Normal file
@@ -0,0 +1,18 @@
|
||||
on:
|
||||
push:
|
||||
|
||||
name: Secret Leaks
|
||||
|
||||
permissions:
|
||||
contents: read
|
||||
|
||||
jobs:
|
||||
trufflehog:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Checkout code
|
||||
uses: actions/checkout@v4
|
||||
with:
|
||||
fetch-depth: 0
|
||||
- name: Secret Scanning
|
||||
uses: trufflesecurity/trufflehog@main
|
||||
31
.gitignore
vendored
31
.gitignore
vendored
@@ -2,12 +2,17 @@
|
||||
logs
|
||||
tmp
|
||||
wandb
|
||||
|
||||
# Data
|
||||
data
|
||||
outputs
|
||||
.vscode
|
||||
rl
|
||||
|
||||
# Apple
|
||||
.DS_Store
|
||||
|
||||
# VS Code
|
||||
.vscode
|
||||
|
||||
# HPC
|
||||
nautilus/*.yaml
|
||||
*.key
|
||||
@@ -90,6 +95,7 @@ instance/
|
||||
docs/_build/
|
||||
|
||||
# PyBuilder
|
||||
.pybuilder/
|
||||
target/
|
||||
|
||||
# Jupyter Notebook
|
||||
@@ -102,13 +108,6 @@ ipython_config.py
|
||||
# pyenv
|
||||
.python-version
|
||||
|
||||
# pipenv
|
||||
# According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control.
|
||||
# However, in case of collaboration, if having platform-specific dependencies or dependencies
|
||||
# having no cross-platform support, pipenv may install dependencies that don't work, or not
|
||||
# install all needed dependencies.
|
||||
#Pipfile.lock
|
||||
|
||||
# PEP 582; used by e.g. github.com/David-OConnor/pyflow
|
||||
__pypackages__/
|
||||
|
||||
@@ -119,6 +118,14 @@ celerybeat.pid
|
||||
# SageMath parsed files
|
||||
*.sage.py
|
||||
|
||||
# Environments
|
||||
.env
|
||||
.venv
|
||||
venv/
|
||||
ENV/
|
||||
env.bak/
|
||||
venv.bak/
|
||||
|
||||
# Spyder project settings
|
||||
.spyderproject
|
||||
.spyproject
|
||||
@@ -136,3 +143,9 @@ dmypy.json
|
||||
|
||||
# Pyre type checker
|
||||
.pyre/
|
||||
|
||||
# pytype static type analyzer
|
||||
.pytype/
|
||||
|
||||
# Cython debug symbols
|
||||
cython_debug/
|
||||
|
||||
80
Makefile
80
Makefile
@@ -5,11 +5,12 @@ PYTHON_PATH := $(shell which python)
|
||||
# If Poetry is installed, redefine PYTHON_PATH to use the Poetry-managed Python
|
||||
POETRY_CHECK := $(shell command -v poetry)
|
||||
ifneq ($(POETRY_CHECK),)
|
||||
PYTHON_PATH := $(shell poetry run which python)
|
||||
PYTHON_PATH := $(shell poetry run which python)
|
||||
endif
|
||||
|
||||
export PATH := $(dir $(PYTHON_PATH)):$(PATH)
|
||||
|
||||
DEVICE ?= cpu
|
||||
|
||||
build-cpu:
|
||||
docker build -t lerobot:latest -f docker/lerobot-cpu/Dockerfile .
|
||||
@@ -18,15 +19,16 @@ build-gpu:
|
||||
docker build -t lerobot:latest -f docker/lerobot-gpu/Dockerfile .
|
||||
|
||||
test-end-to-end:
|
||||
${MAKE} test-act-ete-train
|
||||
${MAKE} test-act-ete-eval
|
||||
${MAKE} test-act-ete-train-amp
|
||||
${MAKE} test-act-ete-eval-amp
|
||||
${MAKE} test-diffusion-ete-train
|
||||
${MAKE} test-diffusion-ete-eval
|
||||
${MAKE} test-tdmpc-ete-train
|
||||
${MAKE} test-tdmpc-ete-eval
|
||||
${MAKE} test-default-ete-eval
|
||||
${MAKE} DEVICE=$(DEVICE) test-act-ete-train
|
||||
${MAKE} DEVICE=$(DEVICE) test-act-ete-eval
|
||||
${MAKE} DEVICE=$(DEVICE) test-act-ete-train-amp
|
||||
${MAKE} DEVICE=$(DEVICE) test-act-ete-eval-amp
|
||||
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-train
|
||||
${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-eval
|
||||
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train
|
||||
${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-eval
|
||||
${MAKE} DEVICE=$(DEVICE) test-default-ete-eval
|
||||
${MAKE} DEVICE=$(DEVICE) test-act-pusht-tutorial
|
||||
|
||||
test-act-ete-train:
|
||||
python lerobot/scripts/train.py \
|
||||
@@ -38,21 +40,22 @@ test-act-ete-train:
|
||||
training.online_steps=0 \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
device=cpu \
|
||||
training.save_model=true \
|
||||
device=$(DEVICE) \
|
||||
training.save_checkpoint=true \
|
||||
training.save_freq=2 \
|
||||
policy.n_action_steps=20 \
|
||||
policy.chunk_size=20 \
|
||||
training.batch_size=2 \
|
||||
training.image_transforms.enable=true \
|
||||
hydra.run.dir=tests/outputs/act/
|
||||
|
||||
test-act-ete-eval:
|
||||
python lerobot/scripts/eval.py \
|
||||
-p tests/outputs/act/checkpoints/000002 \
|
||||
-p tests/outputs/act/checkpoints/000002/pretrained_model \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
env.episode_length=8 \
|
||||
device=cpu \
|
||||
device=$(DEVICE) \
|
||||
|
||||
test-act-ete-train-amp:
|
||||
python lerobot/scripts/train.py \
|
||||
@@ -64,22 +67,23 @@ test-act-ete-train-amp:
|
||||
training.online_steps=0 \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
device=cpu \
|
||||
training.save_model=true \
|
||||
device=$(DEVICE) \
|
||||
training.save_checkpoint=true \
|
||||
training.save_freq=2 \
|
||||
policy.n_action_steps=20 \
|
||||
policy.chunk_size=20 \
|
||||
training.batch_size=2 \
|
||||
hydra.run.dir=tests/outputs/act/ \
|
||||
hydra.run.dir=tests/outputs/act_amp/ \
|
||||
training.image_transforms.enable=true \
|
||||
use_amp=true
|
||||
|
||||
test-act-ete-eval-amp:
|
||||
python lerobot/scripts/eval.py \
|
||||
-p tests/outputs/act/checkpoints/000002 \
|
||||
-p tests/outputs/act_amp/checkpoints/000002/pretrained_model \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
env.episode_length=8 \
|
||||
device=cpu \
|
||||
device=$(DEVICE) \
|
||||
use_amp=true
|
||||
|
||||
test-diffusion-ete-train:
|
||||
@@ -94,19 +98,20 @@ test-diffusion-ete-train:
|
||||
training.online_steps=0 \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
device=cpu \
|
||||
training.save_model=true \
|
||||
device=$(DEVICE) \
|
||||
training.save_checkpoint=true \
|
||||
training.save_freq=2 \
|
||||
training.batch_size=2 \
|
||||
training.image_transforms.enable=true \
|
||||
hydra.run.dir=tests/outputs/diffusion/
|
||||
|
||||
test-diffusion-ete-eval:
|
||||
python lerobot/scripts/eval.py \
|
||||
-p tests/outputs/diffusion/checkpoints/000002 \
|
||||
-p tests/outputs/diffusion/checkpoints/000002/pretrained_model \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
env.episode_length=8 \
|
||||
device=cpu \
|
||||
device=$(DEVICE) \
|
||||
|
||||
# TODO(alexander-soare): Restore online_steps to 2 when it is reinstated.
|
||||
test-tdmpc-ete-train:
|
||||
@@ -121,19 +126,20 @@ test-tdmpc-ete-train:
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
env.episode_length=2 \
|
||||
device=cpu \
|
||||
training.save_model=true \
|
||||
device=$(DEVICE) \
|
||||
training.save_checkpoint=true \
|
||||
training.save_freq=2 \
|
||||
training.batch_size=2 \
|
||||
training.image_transforms.enable=true \
|
||||
hydra.run.dir=tests/outputs/tdmpc/
|
||||
|
||||
test-tdmpc-ete-eval:
|
||||
python lerobot/scripts/eval.py \
|
||||
-p tests/outputs/tdmpc/checkpoints/000002 \
|
||||
-p tests/outputs/tdmpc/checkpoints/000002/pretrained_model \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
env.episode_length=8 \
|
||||
device=cpu \
|
||||
device=$(DEVICE) \
|
||||
|
||||
test-default-ete-eval:
|
||||
python lerobot/scripts/eval.py \
|
||||
@@ -141,4 +147,22 @@ test-default-ete-eval:
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
env.episode_length=8 \
|
||||
device=cpu \
|
||||
device=$(DEVICE) \
|
||||
|
||||
test-act-pusht-tutorial:
|
||||
cp examples/advanced/1_train_act_pusht/act_pusht.yaml lerobot/configs/policy/created_by_Makefile.yaml
|
||||
python lerobot/scripts/train.py \
|
||||
policy=created_by_Makefile.yaml \
|
||||
env=pusht \
|
||||
wandb.enable=False \
|
||||
training.offline_steps=2 \
|
||||
eval.n_episodes=1 \
|
||||
eval.batch_size=1 \
|
||||
env.episode_length=2 \
|
||||
device=$(DEVICE) \
|
||||
training.save_model=true \
|
||||
training.save_freq=2 \
|
||||
training.batch_size=2 \
|
||||
training.image_transforms.enable=true \
|
||||
hydra.run.dir=tests/outputs/act_pusht/
|
||||
rm lerobot/configs/policy/created_by_Makefile.yaml
|
||||
|
||||
153
README.md
153
README.md
@@ -58,6 +58,7 @@
|
||||
- Thanks to Cheng Chi, Zhenjia Xu and colleagues for open sourcing Diffusion policy, Pusht environment and datasets, as well as UMI datasets. Ours are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu) and [UMI Gripper](https://umi-gripper.github.io).
|
||||
- Thanks to Nicklas Hansen, Yunhai Feng and colleagues for open sourcing TDMPC policy, Simxarm environments and datasets. Ours are adapted from [TDMPC](https://github.com/nicklashansen/tdmpc) and [FOWM](https://www.yunhaifeng.com/FOWM).
|
||||
- Thanks to Antonio Loquercio and Ashish Kumar for their early support.
|
||||
- Thanks to [Seungjae (Jay) Lee](https://sjlee.cc/), [Mahi Shafiullah](https://mahis.life/) and colleagues for open sourcing [VQ-BeT](https://sjlee.cc/vq-bet/) policy and helping us adapt the codebase to our repository. The policy is adapted from [VQ-BeT repo](https://github.com/jayLEE0301/vq_bet_official).
|
||||
|
||||
|
||||
## Installation
|
||||
@@ -77,6 +78,10 @@ Install 🤗 LeRobot:
|
||||
pip install .
|
||||
```
|
||||
|
||||
> **NOTE:** Depending on your platform, If you encounter any build errors during this step
|
||||
you may need to install `cmake` and `build-essential` for building some of our dependencies.
|
||||
On linux: `sudo apt-get install cmake build-essential`
|
||||
|
||||
For simulations, 🤗 LeRobot comes with gymnasium environments that can be installed as extras:
|
||||
- [aloha](https://github.com/huggingface/gym-aloha)
|
||||
- [xarm](https://github.com/huggingface/gym-xarm)
|
||||
@@ -99,6 +104,7 @@ wandb login
|
||||
```
|
||||
.
|
||||
├── examples # contains demonstration examples, start here to learn about LeRobot
|
||||
| └── advanced # contains even more examples for those who have mastered the basics
|
||||
├── lerobot
|
||||
| ├── configs # contains hydra yaml files with all options that you can override in the command line
|
||||
| | ├── default.yaml # selected by default, it loads pusht environment and diffusion policy
|
||||
@@ -122,13 +128,21 @@ wandb login
|
||||
|
||||
Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically download data from the Hugging Face hub.
|
||||
|
||||
You can also locally visualize episodes from a dataset by executing our script from the command line:
|
||||
You can also locally visualize episodes from a dataset on the hub by executing our script from the command line:
|
||||
```bash
|
||||
python lerobot/scripts/visualize_dataset.py \
|
||||
--repo-id lerobot/pusht \
|
||||
--episode-index 0
|
||||
```
|
||||
|
||||
or from a dataset in a local folder with the root `DATA_DIR` environment variable (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
|
||||
```bash
|
||||
DATA_DIR='./my_local_data_dir' python lerobot/scripts/visualize_dataset.py \
|
||||
--repo-id lerobot/pusht \
|
||||
--episode-index 0
|
||||
```
|
||||
|
||||
|
||||
It will open `rerun.io` and display the camera streams, robot states and actions, like this:
|
||||
|
||||
https://github-production-user-asset-6210df.s3.amazonaws.com/4681518/328035972-fd46b787-b532-47e2-bb6f-fd536a55a7ed.mov?X-Amz-Algorithm=AWS4-HMAC-SHA256&X-Amz-Credential=AKIAVCODYLSA53PQK4ZA%2F20240505%2Fus-east-1%2Fs3%2Faws4_request&X-Amz-Date=20240505T172924Z&X-Amz-Expires=300&X-Amz-Signature=d680b26c532eeaf80740f08af3320d22ad0b8a4e4da1bcc4f33142c15b509eda&X-Amz-SignedHeaders=host&actor_id=24889239&key_id=0&repo_id=748713144
|
||||
@@ -136,6 +150,51 @@ https://github-production-user-asset-6210df.s3.amazonaws.com/4681518/328035972-f
|
||||
|
||||
Our script can also visualize datasets stored on a distant server. See `python lerobot/scripts/visualize_dataset.py --help` for more instructions.
|
||||
|
||||
### The `LeRobotDataset` format
|
||||
|
||||
A dataset in `LeRobotDataset` format is very simple to use. It can be loaded from a repository on the Hugging Face hub or a local folder simply with e.g. `dataset = LeRobotDataset("lerobot/aloha_static_coffee")` and can be indexed into like any Hugging Face and PyTorch dataset. For instance `dataset[0]` will retrieve a single temporal frame from the dataset containing observation(s) and an action as PyTorch tensors ready to be fed to a model.
|
||||
|
||||
A specificity of `LeRobotDataset` is that, rather than retrieving a single frame by its index, we can retrieve several frames based on their temporal relationship with the indexed frame, by setting `delta_timestamps` to a list of relative times with respect to the indexed frame. For example, with `delta_timestamps = {"observation.image": [-1, -0.5, -0.2, 0]}` one can retrieve, for a given index, 4 frames: 3 "previous" frames 1 second, 0.5 seconds, and 0.2 seconds before the indexed frame, and the indexed frame itself (corresponding to the 0 entry). See example [1_load_lerobot_dataset.py](examples/1_load_lerobot_dataset.py) for more details on `delta_timestamps`.
|
||||
|
||||
Under the hood, the `LeRobotDataset` format makes use of several ways to serialize data which can be useful to understand if you plan to work more closely with this format. We tried to make a flexible yet simple dataset format that would cover most type of features and specificities present in reinforcement learning and robotics, in simulation and in real-world, with a focus on cameras and robot states but easily extended to other types of sensory inputs as long as they can be represented by a tensor.
|
||||
|
||||
Here are the important details and internal structure organization of a typical `LeRobotDataset` instantiated with `dataset = LeRobotDataset("lerobot/aloha_static_coffee")`. The exact features will change from dataset to dataset but not the main aspects:
|
||||
|
||||
```
|
||||
dataset attributes:
|
||||
├ hf_dataset: a Hugging Face dataset (backed by Arrow/parquet). Typical features example:
|
||||
│ ├ observation.images.cam_high (VideoFrame):
|
||||
│ │ VideoFrame = {'path': path to a mp4 video, 'timestamp' (float32): timestamp in the video}
|
||||
│ ├ observation.state (list of float32): position of an arm joints (for instance)
|
||||
│ ... (more observations)
|
||||
│ ├ action (list of float32): goal position of an arm joints (for instance)
|
||||
│ ├ episode_index (int64): index of the episode for this sample
|
||||
│ ├ frame_index (int64): index of the frame for this sample in the episode ; starts at 0 for each episode
|
||||
│ ├ timestamp (float32): timestamp in the episode
|
||||
│ ├ next.done (bool): indicates the end of en episode ; True for the last frame in each episode
|
||||
│ └ index (int64): general index in the whole dataset
|
||||
├ episode_data_index: contains 2 tensors with the start and end indices of each episode
|
||||
│ ├ from (1D int64 tensor): first frame index for each episode — shape (num episodes,) starts with 0
|
||||
│ └ to: (1D int64 tensor): last frame index for each episode — shape (num episodes,)
|
||||
├ stats: a dictionary of statistics (max, mean, min, std) for each feature in the dataset, for instance
|
||||
│ ├ observation.images.cam_high: {'max': tensor with same number of dimensions (e.g. `(c, 1, 1)` for images, `(c,)` for states), etc.}
|
||||
│ ...
|
||||
├ info: a dictionary of metadata on the dataset
|
||||
│ ├ fps (float): frame per second the dataset is recorded/synchronized to
|
||||
│ └ video (bool): indicates if frames are encoded in mp4 video files to save space or stored as png files
|
||||
├ videos_dir (Path): where the mp4 videos or png images are stored/accessed
|
||||
└ camera_keys (list of string): the keys to access camera features in the item returned by the dataset (e.g. `["observation.images.cam_high", ...]`)
|
||||
```
|
||||
|
||||
A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
|
||||
- hf_dataset stored using Hugging Face datasets library serialization to parquet
|
||||
- videos are stored in mp4 format to save space or png files
|
||||
- episode_data_index saved using `safetensor` tensor serialization format
|
||||
- stats saved using `safetensor` tensor serialization format
|
||||
- info are saved using JSON
|
||||
|
||||
Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can set the `DATA_DIR` environment variable to your root dataset folder as illustrated in the above section on dataset visualization.
|
||||
|
||||
### Evaluate a pretrained policy
|
||||
|
||||
Check out [example 2](./examples/2_evaluate_pretrained_policy.py) that illustrates how to download a pretrained policy from Hugging Face hub, and run an evaluation on its corresponding environment.
|
||||
@@ -149,18 +208,19 @@ python lerobot/scripts/eval.py \
|
||||
```
|
||||
|
||||
Note: After training your own policy, you can re-evaluate the checkpoints with:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/eval.py \
|
||||
-p PATH/TO/TRAIN/OUTPUT/FOLDER
|
||||
python lerobot/scripts/eval.py -p {OUTPUT_DIR}/checkpoints/last/pretrained_model
|
||||
```
|
||||
|
||||
See `python lerobot/scripts/eval.py --help` for more instructions.
|
||||
|
||||
### Train your own policy
|
||||
|
||||
Check out [example 3](./examples/3_train_policy.py) that illustrates how to start training a model.
|
||||
Check out [example 3](./examples/3_train_policy.py) that illustrates how to train a model using our core library in python, and [example 4](./examples/4_train_policy_with_script.md) that shows how to use our training script from command line.
|
||||
|
||||
In general, you can use our training script to easily train any policy. Here is an example of training the ACT policy on trajectories collected by humans on the Aloha simulation environment for the insertion task:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py \
|
||||
policy=act \
|
||||
@@ -174,6 +234,19 @@ The experiment directory is automatically generated and will show up in yellow i
|
||||
hydra.run.dir=your/new/experiment/dir
|
||||
```
|
||||
|
||||
In the experiment directory there will be a folder called `checkpoints` which will have the following structure:
|
||||
|
||||
```bash
|
||||
checkpoints
|
||||
├── 000250 # checkpoint_dir for training step 250
|
||||
│ ├── pretrained_model # Hugging Face pretrained model dir
|
||||
│ │ ├── config.json # Hugging Face pretrained model config
|
||||
│ │ ├── config.yaml # consolidated Hydra config
|
||||
│ │ ├── model.safetensors # model weights
|
||||
│ │ └── README.md # Hugging Face model card
|
||||
│ └── training_state.pth # optimizer/scheduler/rng state and training step
|
||||
```
|
||||
|
||||
To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding:
|
||||
|
||||
```bash
|
||||
@@ -184,7 +257,19 @@ A link to the wandb logs for the run will also show up in yellow in your termina
|
||||
|
||||

|
||||
|
||||
Note: For efficiency, during training every checkpoint is evaluated on a low number of episodes. After training, you may want to re-evaluate your best checkpoints on more episodes or change the evaluation settings. See `python lerobot/scripts/eval.py --help` for more instructions.
|
||||
Note: For efficiency, during training every checkpoint is evaluated on a low number of episodes. You may use `eval.n_episodes=500` to evaluate on more episodes than the default. Or, after training, you may want to re-evaluate your best checkpoints on more episodes or change the evaluation settings. See `python lerobot/scripts/eval.py --help` for more instructions.
|
||||
|
||||
#### Reproduce state-of-the-art (SOTA)
|
||||
|
||||
We have organized our configuration files (found under [`lerobot/configs`](./lerobot/configs)) such that they reproduce SOTA results from a given model variant in their respective original works. Simply running:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py policy=diffusion env=pusht
|
||||
```
|
||||
|
||||
reproduces SOTA results for Diffusion Policy on the PushT task.
|
||||
|
||||
Pretrained policies, along with reproduction details, can be found under the "Models" section of https://huggingface.co/lerobot.
|
||||
|
||||
## Contribute
|
||||
|
||||
@@ -197,13 +282,13 @@ To add a dataset to the hub, you need to login using a write-access token, which
|
||||
huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
|
||||
```
|
||||
|
||||
Then move your dataset folder in `data` directory (e.g. `data/aloha_static_pingpong_test`), and push your dataset to the hub with:
|
||||
Then point to your raw dataset folder (e.g. `data/aloha_static_pingpong_test_raw`), and push your dataset to the hub with:
|
||||
```bash
|
||||
python lerobot/scripts/push_dataset_to_hub.py \
|
||||
--data-dir data \
|
||||
--dataset-id aloha_static_pingpong_test \
|
||||
--raw-format aloha_hdf5 \
|
||||
--community-id lerobot
|
||||
--raw-dir data/aloha_static_pingpong_test_raw \
|
||||
--out-dir data \
|
||||
--repo-id lerobot/aloha_static_pingpong_test \
|
||||
--raw-format aloha_hdf5
|
||||
```
|
||||
|
||||
See `python lerobot/scripts/push_dataset_to_hub.py --help` for more instructions.
|
||||
@@ -215,14 +300,14 @@ If your dataset format is not supported, implement your own in `lerobot/common/d
|
||||
|
||||
Once you have trained a policy you may upload it to the Hugging Face hub using a hub id that looks like `${hf_user}/${repo_name}` (e.g. [lerobot/diffusion_pusht](https://huggingface.co/lerobot/diffusion_pusht)).
|
||||
|
||||
You first need to find the checkpoint located inside your experiment directory (e.g. `outputs/train/2024-05-05/20-21-12_aloha_act_default/checkpoints/002500`). It should contain:
|
||||
You first need to find the checkpoint folder located inside your experiment directory (e.g. `outputs/train/2024-05-05/20-21-12_aloha_act_default/checkpoints/002500`). Within that there is a `pretrained_model` directory which should contain:
|
||||
- `config.json`: A serialized version of the policy configuration (following the policy's dataclass config).
|
||||
- `model.safetensors`: A set of `torch.nn.Module` parameters, saved in [Hugging Face Safetensors](https://huggingface.co/docs/safetensors/index) format.
|
||||
- `config.yaml`: A consolidated Hydra training configuration containing the policy, environment, and dataset configs. The policy configuration should match `config.json` exactly. The environment config is useful for anyone who wants to evaluate your policy. The dataset config just serves as a paper trail for reproducibility.
|
||||
|
||||
To upload these to the hub, run the following:
|
||||
```bash
|
||||
huggingface-cli upload ${hf_user}/${repo_name} path/to/checkpoint/dir
|
||||
huggingface-cli upload ${hf_user}/${repo_name} path/to/pretrained_model
|
||||
```
|
||||
|
||||
See [eval.py](https://github.com/huggingface/lerobot/blob/main/lerobot/scripts/eval.py) for an example of how other people may use your policy.
|
||||
@@ -255,7 +340,7 @@ with profile(
|
||||
## Citation
|
||||
|
||||
If you want, you can cite this work with:
|
||||
```
|
||||
```bibtex
|
||||
@misc{cadene2024lerobot,
|
||||
author = {Cadene, Remi and Alibert, Simon and Soare, Alexander and Gallouedec, Quentin and Zouitine, Adil and Wolf, Thomas},
|
||||
title = {LeRobot: State-of-the-art Machine Learning for Real-World Robotics in Pytorch},
|
||||
@@ -263,3 +348,45 @@ If you want, you can cite this work with:
|
||||
year = {2024}
|
||||
}
|
||||
```
|
||||
|
||||
Additionally, if you are using any of the particular policy architecture, pretrained models, or datasets, it is recommended to cite the original authors of the work as they appear below:
|
||||
|
||||
- [Diffusion Policy](https://diffusion-policy.cs.columbia.edu)
|
||||
```bibtex
|
||||
@article{chi2024diffusionpolicy,
|
||||
author = {Cheng Chi and Zhenjia Xu and Siyuan Feng and Eric Cousineau and Yilun Du and Benjamin Burchfiel and Russ Tedrake and Shuran Song},
|
||||
title ={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
|
||||
journal = {The International Journal of Robotics Research},
|
||||
year = {2024},
|
||||
}
|
||||
```
|
||||
- [ACT or ALOHA](https://tonyzhaozh.github.io/aloha)
|
||||
```bibtex
|
||||
@article{zhao2023learning,
|
||||
title={Learning fine-grained bimanual manipulation with low-cost hardware},
|
||||
author={Zhao, Tony Z and Kumar, Vikash and Levine, Sergey and Finn, Chelsea},
|
||||
journal={arXiv preprint arXiv:2304.13705},
|
||||
year={2023}
|
||||
}
|
||||
```
|
||||
|
||||
- [TDMPC](https://www.nicklashansen.com/td-mpc/)
|
||||
|
||||
```bibtex
|
||||
@inproceedings{Hansen2022tdmpc,
|
||||
title={Temporal Difference Learning for Model Predictive Control},
|
||||
author={Nicklas Hansen and Xiaolong Wang and Hao Su},
|
||||
booktitle={ICML},
|
||||
year={2022}
|
||||
}
|
||||
```
|
||||
|
||||
- [VQ-BeT](https://sjlee.cc/vq-bet/)
|
||||
```bibtex
|
||||
@article{lee2024behavior,
|
||||
title={Behavior generation with latent actions},
|
||||
author={Lee, Seungjae and Wang, Yibin and Etukuru, Haritheja and Kim, H Jin and Shafiullah, Nur Muhammad Mahi and Pinto, Lerrel},
|
||||
journal={arXiv preprint arXiv:2403.03181},
|
||||
year={2024}
|
||||
}
|
||||
```
|
||||
|
||||
271
benchmarks/video/README.md
Normal file
271
benchmarks/video/README.md
Normal file
@@ -0,0 +1,271 @@
|
||||
# Video benchmark
|
||||
|
||||
|
||||
## Questions
|
||||
What is the optimal trade-off between:
|
||||
- maximizing loading time with random access,
|
||||
- minimizing memory space on disk,
|
||||
- maximizing success rate of policies,
|
||||
- compatibility across devices/platforms for decoding videos (e.g. video players, web browsers).
|
||||
|
||||
How to encode videos?
|
||||
- Which video codec (`-vcodec`) to use? h264, h265, AV1?
|
||||
- What pixel format to use (`-pix_fmt`)? `yuv444p` or `yuv420p`?
|
||||
- How much compression (`-crf`)? No compression with `0`, intermediate compression with `25` or extreme with `50+`?
|
||||
- Which frequency to chose for key frames (`-g`)? A key frame every `10` frames?
|
||||
|
||||
How to decode videos?
|
||||
- Which `decoder`? `torchvision`, `torchaudio`, `ffmpegio`, `decord`, or `nvc`?
|
||||
- What scenarios to use for the requesting timestamps during benchmark? (`timestamps_mode`)
|
||||
|
||||
|
||||
## Variables
|
||||
**Image content & size**
|
||||
We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an appartment, or in a factory, or outdoor, or with lots of moving objects in the scene, etc. Similarly, loading times might not vary linearly with the image size (resolution).
|
||||
For these reasons, we run this benchmark on four representative datasets:
|
||||
- `lerobot/pusht_image`: (96 x 96 pixels) simulation with simple geometric shapes, fixed camera.
|
||||
- `aliberts/aloha_mobile_shrimp_image`: (480 x 640 pixels) real-world indoor, moving camera.
|
||||
- `aliberts/paris_street`: (720 x 1280 pixels) real-world outdoor, moving camera.
|
||||
- `aliberts/kitchen`: (1080 x 1920 pixels) real-world indoor, fixed camera.
|
||||
|
||||
Note: The datasets used for this benchmark need to be image datasets, not video datasets.
|
||||
|
||||
**Data augmentations**
|
||||
We might revisit this benchmark and find better settings if we train our policies with various data augmentations to make them more robust (e.g. robust to color changes, compression, etc.).
|
||||
|
||||
### Encoding parameters
|
||||
| parameter | values |
|
||||
|-------------|--------------------------------------------------------------|
|
||||
| **vcodec** | `libx264`, `libx265`, `libsvtav1` |
|
||||
| **pix_fmt** | `yuv444p`, `yuv420p` |
|
||||
| **g** | `1`, `2`, `3`, `4`, `5`, `6`, `10`, `15`, `20`, `40`, `None` |
|
||||
| **crf** | `0`, `5`, `10`, `15`, `20`, `25`, `30`, `40`, `50`, `None` |
|
||||
|
||||
Note that `crf` value might be interpreted differently by various video codecs. In other words, the same value used with one codec doesn't necessarily translate into the same compression level with another codec. In fact, the default value (`None`) isn't the same amongst the different video codecs. Importantly, it is also the case for many other ffmpeg arguments like `g` which specifies the frequency of the key frames.
|
||||
|
||||
For a comprehensive list and documentation of these parameters, see the ffmpeg documentation depending on the video codec used:
|
||||
- h264: https://trac.ffmpeg.org/wiki/Encode/H.264
|
||||
- h265: https://trac.ffmpeg.org/wiki/Encode/H.265
|
||||
- AV1: https://trac.ffmpeg.org/wiki/Encode/AV1
|
||||
|
||||
### Decoding parameters
|
||||
**Decoder**
|
||||
We tested two video decoding backends from torchvision:
|
||||
- `pyav` (default)
|
||||
- `video_reader` (requires to build torchvision from source)
|
||||
|
||||
**Requested timestamps**
|
||||
Given the way video decoding works, once a keyframe has been loaded, the decoding of subsequent frames is fast.
|
||||
This of course is affected by the `-g` parameter during encoding, which specifies the frequency of the keyframes. Given our typical use cases in robotics policies which might request a few timestamps in different random places, we want to replicate these use cases with the following scenarios:
|
||||
- `1_frame`: 1 frame,
|
||||
- `2_frames`: 2 consecutive frames (e.g. `[t, t + 1 / fps]`),
|
||||
- `6_frames`: 6 consecutive frames (e.g. `[t + i / fps for i in range(6)]`)
|
||||
|
||||
Note that this differs significantly from a typical use case like watching a movie, in which every frame is loaded sequentially from the beginning to the end and it's acceptable to have big values for `-g`.
|
||||
|
||||
Additionally, because some policies might request single timestamps that are a few frames appart, we also have the following scenario:
|
||||
- `2_frames_4_space`: 2 frames with 4 consecutive frames of spacing in between (e.g `[t, t + 5 / fps]`),
|
||||
|
||||
However, due to how video decoding is implemented with `pyav`, we don't have access to an accurate seek so in practice this scenario is essentially the same as `6_frames` since all 6 frames between `t` and `t + 5 / fps` will be decoded.
|
||||
|
||||
|
||||
## Metrics
|
||||
**Data compression ratio (lower is better)**
|
||||
`video_images_size_ratio` is the ratio of the memory space on disk taken by the encoded video over the memory space taken by the original images. For instance, `video_images_size_ratio=25%` means that the video takes 4 times less memory space on disk compared to the original images.
|
||||
|
||||
**Loading time ratio (lower is better)**
|
||||
`video_images_load_time_ratio` is the ratio of the time it takes to decode frames from the video at a given timestamps over the time it takes to load the exact same original images. Lower is better. For instance, `video_images_load_time_ratio=200%` means that decoding from video is 2 times slower than loading the original images.
|
||||
|
||||
**Average Mean Square Error (lower is better)**
|
||||
`avg_mse` is the average mean square error between each decoded frame and its corresponding original image over all requested timestamps, and also divided by the number of pixels in the image to be comparable when switching to different image sizes.
|
||||
|
||||
**Average Peak Signal to Noise Ratio (higher is better)**
|
||||
`avg_psnr` measures the ratio between the maximum possible power of a signal and the power of corrupting noise that affects the fidelity of its representation. Higher PSNR indicates better quality.
|
||||
|
||||
**Average Structural Similarity Index Measure (higher is better)**
|
||||
`avg_ssim` evaluates the perceived quality of images by comparing luminance, contrast, and structure. SSIM values range from -1 to 1, where 1 indicates perfect similarity.
|
||||
|
||||
One aspect that can't be measured here with those metrics is the compatibility of the encoding accross platforms, in particular on web browser, for visualization purposes.
|
||||
h264, h265 and AV1 are all commonly used codecs and should not be pose an issue. However, the chroma subsampling (`pix_fmt`) format might affect compatibility:
|
||||
- `yuv420p` is more widely supported across various platforms, including web browsers.
|
||||
- `yuv444p` offers higher color fidelity but might not be supported as broadly.
|
||||
|
||||
|
||||
<!-- **Loss of a pretrained policy (higher is better)** (not available)
|
||||
`loss_pretrained` is the result of evaluating with the selected encoding/decoding settings a policy pretrained on original images. It is easier to understand than `avg_l2_error`.
|
||||
|
||||
**Success rate after retraining (higher is better)** (not available)
|
||||
`success_rate` is the result of training and evaluating a policy with the selected encoding/decoding settings. It is the most difficult metric to get but also the very best. -->
|
||||
|
||||
|
||||
## How the benchmark works
|
||||
The benchmark evaluates both encoding and decoding of video frames on the first episode of each dataset.
|
||||
|
||||
**Encoding:** for each `vcodec` and `pix_fmt` pair, we use a default value for `g` and `crf` upon which we change a single value (either `g` or `crf`) to one of the specified values (we don't test every combination of those as this would be computationally too heavy).
|
||||
This gives a unique set of encoding parameters which is used to encode the episode.
|
||||
|
||||
**Decoding:** Then, for each of those unique encodings, we iterate through every combination of the decoding parameters `backend` and `timestamps_mode`. For each of them, we record the metrics of a number of samples (given by `--num-samples`). This is parallelized for efficiency and the number of processes can be controlled with `--num-workers`. Ideally, it's best to have a `--num-samples` that is divisible by `--num-workers`.
|
||||
|
||||
Intermediate results saved for each `vcodec` and `pix_fmt` combination in csv tables.
|
||||
These are then all concatenated to a single table ready for analysis.
|
||||
|
||||
## Caveats
|
||||
We tried to measure the most impactful parameters for both encoding and decoding. However, for computational reasons we can't test out every combination.
|
||||
|
||||
Additional encoding parameters exist that are not included in this benchmark. In particular:
|
||||
- `-preset` which allows for selecting encoding presets. This represents a collection of options that will provide a certain encoding speed to compression ratio. By leaving this parameter unspecified, it is considered to be `medium` for libx264 and libx265 and `8` for libsvtav1.
|
||||
- `-tune` which allows to optimize the encoding for certains aspects (e.g. film quality, fast decoding, etc.).
|
||||
|
||||
See the documentation mentioned above for more detailled info on these settings and for a more comprehensive list of other parameters.
|
||||
|
||||
Similarly on the decoding side, other decoders exist but are not implemented in our current benchmark. To name a few:
|
||||
- `torchaudio`
|
||||
- `ffmpegio`
|
||||
- `decord`
|
||||
- `nvc`
|
||||
|
||||
Note as well that since we are mostly interested in the performance at decoding time (also because encoding is done only once before uploading a dataset), we did not measure encoding times nor have any metrics regarding encoding.
|
||||
However, besides the necessity to build ffmpeg from source, encoding did not pose any issue and it didn't take a significant amount of time during this benchmark.
|
||||
|
||||
|
||||
## Install
|
||||
Building ffmpeg from source is required to include libx265 and libaom/libsvtav1 (av1) video codecs ([compilation guide](https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu)).
|
||||
|
||||
**Note:** While you still need to build torchvision with a conda-installed `ffmpeg<4.3` to use the `video_reader` decoder (as described in [#220](https://github.com/huggingface/lerobot/pull/220)), you also need another version which is custom-built with all the video codecs for encoding. For the script to then use that version, you can prepend the command above with `PATH="$HOME/bin:$PATH"`, which is where ffmpeg should be built.
|
||||
|
||||
|
||||
## Adding a video decoder
|
||||
Right now, we're only benchmarking the two video decoder available with torchvision: `pyav` and `video_reader`.
|
||||
You can easily add a new decoder to benchmark by adding it to this function in the script:
|
||||
```diff
|
||||
def decode_video_frames(
|
||||
video_path: str,
|
||||
timestamps: list[float],
|
||||
tolerance_s: float,
|
||||
backend: str,
|
||||
) -> torch.Tensor:
|
||||
if backend in ["pyav", "video_reader"]:
|
||||
return decode_video_frames_torchvision(
|
||||
video_path, timestamps, tolerance_s, backend
|
||||
)
|
||||
+ elif backend == ["your_decoder"]:
|
||||
+ return your_decoder_function(
|
||||
+ video_path, timestamps, tolerance_s, backend
|
||||
+ )
|
||||
else:
|
||||
raise NotImplementedError(backend)
|
||||
```
|
||||
|
||||
|
||||
## Example
|
||||
For a quick run, you can try these parameters:
|
||||
```bash
|
||||
python benchmark/video/run_video_benchmark.py \
|
||||
--output-dir outputs/video_benchmark \
|
||||
--repo-ids \
|
||||
lerobot/pusht_image \
|
||||
aliberts/aloha_mobile_shrimp_image \
|
||||
--vcodec libx264 libx265 \
|
||||
--pix-fmt yuv444p yuv420p \
|
||||
--g 2 20 None \
|
||||
--crf 10 40 None \
|
||||
--timestamps-modes 1_frame 2_frames \
|
||||
--backends pyav video_reader \
|
||||
--num-samples 5 \
|
||||
--num-workers 5 \
|
||||
--save-frames 0
|
||||
```
|
||||
|
||||
|
||||
## Results
|
||||
|
||||
### Reproduce
|
||||
We ran the benchmark with the following parameters:
|
||||
```bash
|
||||
# h264 and h265 encodings
|
||||
python benchmark/video/run_video_benchmark.py \
|
||||
--output-dir outputs/video_benchmark \
|
||||
--repo-ids \
|
||||
lerobot/pusht_image \
|
||||
aliberts/aloha_mobile_shrimp_image \
|
||||
aliberts/paris_street \
|
||||
aliberts/kitchen \
|
||||
--vcodec libx264 libx265 \
|
||||
--pix-fmt yuv444p yuv420p \
|
||||
--g 1 2 3 4 5 6 10 15 20 40 None \
|
||||
--crf 0 5 10 15 20 25 30 40 50 None \
|
||||
--timestamps-modes 1_frame 2_frames 6_frames \
|
||||
--backends pyav video_reader \
|
||||
--num-samples 50 \
|
||||
--num-workers 5 \
|
||||
--save-frames 1
|
||||
|
||||
# av1 encoding (only compatible with yuv420p and pyav decoder)
|
||||
python benchmark/video/run_video_benchmark.py \
|
||||
--output-dir outputs/video_benchmark \
|
||||
--repo-ids \
|
||||
lerobot/pusht_image \
|
||||
aliberts/aloha_mobile_shrimp_image \
|
||||
aliberts/paris_street \
|
||||
aliberts/kitchen \
|
||||
--vcodec libsvtav1 \
|
||||
--pix-fmt yuv420p \
|
||||
--g 1 2 3 4 5 6 10 15 20 40 None \
|
||||
--crf 0 5 10 15 20 25 30 40 50 None \
|
||||
--timestamps-modes 1_frame 2_frames 6_frames \
|
||||
--backends pyav \
|
||||
--num-samples 50 \
|
||||
--num-workers 5 \
|
||||
--save-frames 1
|
||||
```
|
||||
|
||||
The full results are available [here](https://docs.google.com/spreadsheets/d/1OYJB43Qu8fC26k_OyoMFgGBBKfQRCi4BIuYitQnq3sw/edit?usp=sharing)
|
||||
|
||||
|
||||
### Parameters selected for LeRobotDataset
|
||||
Considering these results, we chose what we think is the best set of encoding parameter:
|
||||
- vcodec: `libsvtav1`
|
||||
- pix-fmt: `yuv420p`
|
||||
- g: `2`
|
||||
- crf: `30`
|
||||
|
||||
Since we're using av1 encoding, we're choosing the `pyav` decoder as `video_reader` does not support it (and `pyav` doesn't require a custom build of `torchvision`).
|
||||
|
||||
### Summary
|
||||
|
||||
These tables show the results for `g=2` and `crf=30`, using `timestamps-modes=6_frames` and `backend=pyav`
|
||||
|
||||
| video_images_size_ratio | vcodec | pix_fmt | | | |
|
||||
|------------------------------------|------------|---------|-----------|-----------|-----------|
|
||||
| | libx264 | | libx265 | | libsvtav1 |
|
||||
| repo_id | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||
| lerobot/pusht_image | **16.97%** | 17.58% | 18.57% | 18.86% | 22.06% |
|
||||
| aliberts/aloha_mobile_shrimp_image | 2.14% | 2.11% | 1.38% | **1.37%** | 5.59% |
|
||||
| aliberts/paris_street | 2.12% | 2.13% | **1.54%** | **1.54%** | 4.43% |
|
||||
| aliberts/kitchen | 1.40% | 1.39% | **1.00%** | **1.00%** | 2.52% |
|
||||
|
||||
| video_images_load_time_ratio | vcodec | pix_fmt | | | |
|
||||
|------------------------------------|---------|---------|----------|---------|-----------|
|
||||
| | libx264 | | libx265 | | libsvtav1 |
|
||||
| repo_id | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||
| lerobot/pusht_image | 6.45 | 5.19 | **1.90** | 2.12 | 2.47 |
|
||||
| aliberts/aloha_mobile_shrimp_image | 11.80 | 7.92 | 0.71 | 0.85 | **0.48** |
|
||||
| aliberts/paris_street | 2.21 | 2.05 | 0.36 | 0.49 | **0.30** |
|
||||
| aliberts/kitchen | 1.46 | 1.46 | 0.28 | 0.51 | **0.26** |
|
||||
|
||||
| | | vcodec | pix_fmt | | | |
|
||||
|------------------------------------|----------|----------|--------------|----------|-----------|--------------|
|
||||
| | | libx264 | | libx265 | | libsvtav1 |
|
||||
| repo_id | metric | yuv420p | yuv444p | yuv420p | yuv444p | yuv420p |
|
||||
| lerobot/pusht_image | avg_mse | 2.90E-04 | **2.03E-04** | 3.13E-04 | 2.29E-04 | 2.19E-04 |
|
||||
| | avg_psnr | 35.44 | 37.07 | 35.49 | **37.30** | 37.20 |
|
||||
| | avg_ssim | 98.28% | **98.85%** | 98.31% | 98.84% | 98.72% |
|
||||
| aliberts/aloha_mobile_shrimp_image | avg_mse | 2.76E-04 | 2.59E-04 | 3.17E-04 | 3.06E-04 | **1.30E-04** |
|
||||
| | avg_psnr | 35.91 | 36.21 | 35.88 | 36.09 | **40.17** |
|
||||
| | avg_ssim | 95.19% | 95.18% | 95.00% | 95.05% | **97.73%** |
|
||||
| aliberts/paris_street | avg_mse | 6.89E-04 | 6.70E-04 | 4.03E-03 | 4.02E-03 | **3.09E-04** |
|
||||
| | avg_psnr | 33.48 | 33.68 | 32.05 | 32.15 | **35.40** |
|
||||
| | avg_ssim | 93.76% | 93.75% | 89.46% | 89.46% | **95.46%** |
|
||||
| aliberts/kitchen | avg_mse | 2.50E-04 | 2.24E-04 | 4.28E-04 | 4.18E-04 | **1.53E-04** |
|
||||
| | avg_psnr | 36.73 | 37.33 | 36.56 | 36.75 | **39.12** |
|
||||
| | avg_ssim | 95.47% | 95.58% | 95.52% | 95.53% | **96.82%** |
|
||||
90
benchmarks/video/capture_camera_feed.py
Normal file
90
benchmarks/video/capture_camera_feed.py
Normal file
@@ -0,0 +1,90 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""Capture video feed from a camera as raw images."""
|
||||
|
||||
import argparse
|
||||
import datetime as dt
|
||||
from pathlib import Path
|
||||
|
||||
import cv2
|
||||
|
||||
|
||||
def display_and_save_video_stream(output_dir: Path, fps: int, width: int, height: int):
|
||||
now = dt.datetime.now()
|
||||
capture_dir = output_dir / f"{now:%Y-%m-%d}" / f"{now:%H-%M-%S}"
|
||||
if not capture_dir.exists():
|
||||
capture_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
# Opens the default webcam
|
||||
cap = cv2.VideoCapture(0)
|
||||
if not cap.isOpened():
|
||||
print("Error: Could not open video stream.")
|
||||
return
|
||||
|
||||
cap.set(cv2.CAP_PROP_FPS, fps)
|
||||
cap.set(cv2.CAP_PROP_FRAME_WIDTH, width)
|
||||
cap.set(cv2.CAP_PROP_FRAME_HEIGHT, height)
|
||||
|
||||
frame_index = 0
|
||||
while True:
|
||||
ret, frame = cap.read()
|
||||
|
||||
if not ret:
|
||||
print("Error: Could not read frame.")
|
||||
break
|
||||
|
||||
cv2.imshow("Video Stream", frame)
|
||||
cv2.imwrite(str(capture_dir / f"frame_{frame_index:06d}.png"), frame)
|
||||
frame_index += 1
|
||||
|
||||
# Break the loop on 'q' key press
|
||||
if cv2.waitKey(1) & 0xFF == ord("q"):
|
||||
break
|
||||
|
||||
# Release the capture and destroy all windows
|
||||
cap.release()
|
||||
cv2.destroyAllWindows()
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
parser = argparse.ArgumentParser()
|
||||
|
||||
parser.add_argument(
|
||||
"--output-dir",
|
||||
type=Path,
|
||||
default=Path("outputs/cam_capture/"),
|
||||
help="Directory where the capture images are written. A subfolder named with the current date & time will be created inside it for each capture.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--fps",
|
||||
type=int,
|
||||
default=30,
|
||||
help="Frames Per Second of the capture.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--width",
|
||||
type=int,
|
||||
default=1280,
|
||||
help="Width of the captured images.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--height",
|
||||
type=int,
|
||||
default=720,
|
||||
help="Height of the captured images.",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
display_and_save_video_stream(**vars(args))
|
||||
490
benchmarks/video/run_video_benchmark.py
Normal file
490
benchmarks/video/run_video_benchmark.py
Normal file
@@ -0,0 +1,490 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""Assess the performance of video decoding in various configurations.
|
||||
|
||||
This script will benchmark different video encoding and decoding parameters.
|
||||
See the provided README.md or run `python benchmark/video/run_video_benchmark.py --help` for usage info.
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import datetime as dt
|
||||
import random
|
||||
import shutil
|
||||
from collections import OrderedDict
|
||||
from concurrent.futures import ThreadPoolExecutor, as_completed
|
||||
from pathlib import Path
|
||||
|
||||
import einops
|
||||
import numpy as np
|
||||
import pandas as pd
|
||||
import PIL
|
||||
import torch
|
||||
from skimage.metrics import mean_squared_error, peak_signal_noise_ratio, structural_similarity
|
||||
from tqdm import tqdm
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.video_utils import (
|
||||
decode_video_frames_torchvision,
|
||||
encode_video_frames,
|
||||
)
|
||||
from lerobot.common.utils.benchmark import TimeBenchmark
|
||||
|
||||
BASE_ENCODING = OrderedDict(
|
||||
[
|
||||
("vcodec", "libx264"),
|
||||
("pix_fmt", "yuv444p"),
|
||||
("g", 2),
|
||||
("crf", None),
|
||||
# TODO(aliberts): Add fastdecode
|
||||
# ("fastdecode", 0),
|
||||
]
|
||||
)
|
||||
|
||||
|
||||
# TODO(rcadene, aliberts): move to `utils.py` folder when we want to refactor
|
||||
def parse_int_or_none(value) -> int | None:
|
||||
if value.lower() == "none":
|
||||
return None
|
||||
try:
|
||||
return int(value)
|
||||
except ValueError as e:
|
||||
raise argparse.ArgumentTypeError(f"Invalid int or None: {value}") from e
|
||||
|
||||
|
||||
def check_datasets_formats(repo_ids: list) -> None:
|
||||
for repo_id in repo_ids:
|
||||
dataset = LeRobotDataset(repo_id)
|
||||
if dataset.video:
|
||||
raise ValueError(
|
||||
f"Use only image dataset for running this benchmark. Video dataset provided: {repo_id}"
|
||||
)
|
||||
|
||||
|
||||
def get_directory_size(directory: Path) -> int:
|
||||
total_size = 0
|
||||
for item in directory.rglob("*"):
|
||||
if item.is_file():
|
||||
total_size += item.stat().st_size
|
||||
return total_size
|
||||
|
||||
|
||||
def load_original_frames(imgs_dir: Path, timestamps: list[float], fps: int) -> torch.Tensor:
|
||||
frames = []
|
||||
for ts in timestamps:
|
||||
idx = int(ts * fps)
|
||||
frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
||||
frame = torch.from_numpy(np.array(frame))
|
||||
frame = frame.type(torch.float32) / 255
|
||||
frame = einops.rearrange(frame, "h w c -> c h w")
|
||||
frames.append(frame)
|
||||
return torch.stack(frames)
|
||||
|
||||
|
||||
def save_decoded_frames(
|
||||
imgs_dir: Path, save_dir: Path, frames: torch.Tensor, timestamps: list[float], fps: int
|
||||
) -> None:
|
||||
if save_dir.exists() and len(list(save_dir.glob("frame_*.png"))) == len(timestamps):
|
||||
return
|
||||
|
||||
save_dir.mkdir(parents=True, exist_ok=True)
|
||||
for i, ts in enumerate(timestamps):
|
||||
idx = int(ts * fps)
|
||||
frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
|
||||
PIL.Image.fromarray(frame_hwc).save(save_dir / f"frame_{idx:06d}_decoded.png")
|
||||
shutil.copyfile(imgs_dir / f"frame_{idx:06d}.png", save_dir / f"frame_{idx:06d}_original.png")
|
||||
|
||||
|
||||
def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
|
||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||
if imgs_dir.exists() and len(list(imgs_dir.glob("frame_*.png"))) == ep_num_images:
|
||||
return
|
||||
|
||||
imgs_dir.mkdir(parents=True, exist_ok=True)
|
||||
hf_dataset = dataset.hf_dataset.with_format(None)
|
||||
|
||||
# We only save images from the first camera
|
||||
img_keys = [key for key in hf_dataset.features if key.startswith("observation.image")]
|
||||
imgs_dataset = hf_dataset.select_columns(img_keys[0])
|
||||
|
||||
for i, item in enumerate(
|
||||
tqdm(imgs_dataset, desc=f"saving {dataset.repo_id} first episode images", leave=False)
|
||||
):
|
||||
img = item[img_keys[0]]
|
||||
img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
|
||||
|
||||
if i >= ep_num_images - 1:
|
||||
break
|
||||
|
||||
|
||||
def sample_timestamps(timestamps_mode: str, ep_num_images: int, fps: int) -> list[float]:
|
||||
# Start at 5 to allow for 2_frames_4_space and 6_frames
|
||||
idx = random.randint(5, ep_num_images - 1)
|
||||
match timestamps_mode:
|
||||
case "1_frame":
|
||||
frame_indexes = [idx]
|
||||
case "2_frames":
|
||||
frame_indexes = [idx - 1, idx]
|
||||
case "2_frames_4_space":
|
||||
frame_indexes = [idx - 5, idx]
|
||||
case "6_frames":
|
||||
frame_indexes = [idx - i for i in range(6)][::-1]
|
||||
case _:
|
||||
raise ValueError(timestamps_mode)
|
||||
|
||||
return [idx / fps for idx in frame_indexes]
|
||||
|
||||
|
||||
def decode_video_frames(
|
||||
video_path: str,
|
||||
timestamps: list[float],
|
||||
tolerance_s: float,
|
||||
backend: str,
|
||||
) -> torch.Tensor:
|
||||
if backend in ["pyav", "video_reader"]:
|
||||
return decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
|
||||
else:
|
||||
raise NotImplementedError(backend)
|
||||
|
||||
|
||||
def benchmark_decoding(
|
||||
imgs_dir: Path,
|
||||
video_path: Path,
|
||||
timestamps_mode: str,
|
||||
backend: str,
|
||||
ep_num_images: int,
|
||||
fps: int,
|
||||
num_samples: int = 50,
|
||||
num_workers: int = 4,
|
||||
save_frames: bool = False,
|
||||
) -> dict:
|
||||
def process_sample(sample: int):
|
||||
time_benchmark = TimeBenchmark()
|
||||
timestamps = sample_timestamps(timestamps_mode, ep_num_images, fps)
|
||||
num_frames = len(timestamps)
|
||||
result = {
|
||||
"psnr_values": [],
|
||||
"ssim_values": [],
|
||||
"mse_values": [],
|
||||
}
|
||||
|
||||
with time_benchmark:
|
||||
frames = decode_video_frames(video_path, timestamps=timestamps, tolerance_s=5e-1, backend=backend)
|
||||
result["load_time_video_ms"] = time_benchmark.result_ms / num_frames
|
||||
|
||||
with time_benchmark:
|
||||
original_frames = load_original_frames(imgs_dir, timestamps, fps)
|
||||
result["load_time_images_ms"] = time_benchmark.result_ms / num_frames
|
||||
|
||||
frames_np, original_frames_np = frames.numpy(), original_frames.numpy()
|
||||
for i in range(num_frames):
|
||||
result["mse_values"].append(mean_squared_error(original_frames_np[i], frames_np[i]))
|
||||
result["psnr_values"].append(
|
||||
peak_signal_noise_ratio(original_frames_np[i], frames_np[i], data_range=1.0)
|
||||
)
|
||||
result["ssim_values"].append(
|
||||
structural_similarity(original_frames_np[i], frames_np[i], data_range=1.0, channel_axis=0)
|
||||
)
|
||||
|
||||
if save_frames and sample == 0:
|
||||
save_dir = video_path.with_suffix("") / f"{timestamps_mode}_{backend}"
|
||||
save_decoded_frames(imgs_dir, save_dir, frames, timestamps, fps)
|
||||
|
||||
return result
|
||||
|
||||
load_times_video_ms = []
|
||||
load_times_images_ms = []
|
||||
mse_values = []
|
||||
psnr_values = []
|
||||
ssim_values = []
|
||||
|
||||
# A sample is a single set of decoded frames specified by timestamps_mode (e.g. a single frame, 2 frames, etc.).
|
||||
# For each sample, we record metrics (loading time and quality metrics) which are then averaged over all samples.
|
||||
# As these samples are independent, we run them in parallel threads to speed up the benchmark.
|
||||
with ThreadPoolExecutor(max_workers=num_workers) as executor:
|
||||
futures = [executor.submit(process_sample, i) for i in range(num_samples)]
|
||||
for future in tqdm(as_completed(futures), total=num_samples, desc="samples", leave=False):
|
||||
result = future.result()
|
||||
load_times_video_ms.append(result["load_time_video_ms"])
|
||||
load_times_images_ms.append(result["load_time_images_ms"])
|
||||
psnr_values.extend(result["psnr_values"])
|
||||
ssim_values.extend(result["ssim_values"])
|
||||
mse_values.extend(result["mse_values"])
|
||||
|
||||
avg_load_time_video_ms = float(np.array(load_times_video_ms).mean())
|
||||
avg_load_time_images_ms = float(np.array(load_times_images_ms).mean())
|
||||
video_images_load_time_ratio = avg_load_time_video_ms / avg_load_time_images_ms
|
||||
|
||||
return {
|
||||
"avg_load_time_video_ms": avg_load_time_video_ms,
|
||||
"avg_load_time_images_ms": avg_load_time_images_ms,
|
||||
"video_images_load_time_ratio": video_images_load_time_ratio,
|
||||
"avg_mse": float(np.mean(mse_values)),
|
||||
"avg_psnr": float(np.mean(psnr_values)),
|
||||
"avg_ssim": float(np.mean(ssim_values)),
|
||||
}
|
||||
|
||||
|
||||
def benchmark_encoding_decoding(
|
||||
dataset: LeRobotDataset,
|
||||
video_path: Path,
|
||||
imgs_dir: Path,
|
||||
encoding_cfg: dict,
|
||||
decoding_cfg: dict,
|
||||
num_samples: int,
|
||||
num_workers: int,
|
||||
save_frames: bool,
|
||||
overwrite: bool = False,
|
||||
seed: int = 1337,
|
||||
) -> list[dict]:
|
||||
fps = dataset.fps
|
||||
|
||||
if overwrite or not video_path.is_file():
|
||||
tqdm.write(f"encoding {video_path}")
|
||||
encode_video_frames(
|
||||
imgs_dir=imgs_dir,
|
||||
video_path=video_path,
|
||||
fps=fps,
|
||||
video_codec=encoding_cfg["vcodec"],
|
||||
pixel_format=encoding_cfg["pix_fmt"],
|
||||
group_of_pictures_size=encoding_cfg.get("g"),
|
||||
constant_rate_factor=encoding_cfg.get("crf"),
|
||||
# fast_decode=encoding_cfg.get("fastdecode"),
|
||||
overwrite=True,
|
||||
)
|
||||
|
||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||
width, height = tuple(dataset[0][dataset.camera_keys[0]].shape[-2:])
|
||||
num_pixels = width * height
|
||||
video_size_bytes = video_path.stat().st_size
|
||||
images_size_bytes = get_directory_size(imgs_dir)
|
||||
video_images_size_ratio = video_size_bytes / images_size_bytes
|
||||
|
||||
random.seed(seed)
|
||||
benchmark_table = []
|
||||
for timestamps_mode in tqdm(
|
||||
decoding_cfg["timestamps_modes"], desc="decodings (timestamps_modes)", leave=False
|
||||
):
|
||||
for backend in tqdm(decoding_cfg["backends"], desc="decodings (backends)", leave=False):
|
||||
benchmark_row = benchmark_decoding(
|
||||
imgs_dir,
|
||||
video_path,
|
||||
timestamps_mode,
|
||||
backend,
|
||||
ep_num_images,
|
||||
fps,
|
||||
num_samples,
|
||||
num_workers,
|
||||
save_frames,
|
||||
)
|
||||
benchmark_row.update(
|
||||
**{
|
||||
"repo_id": dataset.repo_id,
|
||||
"resolution": f"{width} x {height}",
|
||||
"num_pixels": num_pixels,
|
||||
"video_size_bytes": video_size_bytes,
|
||||
"images_size_bytes": images_size_bytes,
|
||||
"video_images_size_ratio": video_images_size_ratio,
|
||||
"timestamps_mode": timestamps_mode,
|
||||
"backend": backend,
|
||||
},
|
||||
**encoding_cfg,
|
||||
)
|
||||
benchmark_table.append(benchmark_row)
|
||||
|
||||
return benchmark_table
|
||||
|
||||
|
||||
def main(
|
||||
output_dir: Path,
|
||||
repo_ids: list[str],
|
||||
vcodec: list[str],
|
||||
pix_fmt: list[str],
|
||||
g: list[int],
|
||||
crf: list[int],
|
||||
# fastdecode: list[int],
|
||||
timestamps_modes: list[str],
|
||||
backends: list[str],
|
||||
num_samples: int,
|
||||
num_workers: int,
|
||||
save_frames: bool,
|
||||
):
|
||||
check_datasets_formats(repo_ids)
|
||||
encoding_benchmarks = {
|
||||
"g": g,
|
||||
"crf": crf,
|
||||
# "fastdecode": fastdecode,
|
||||
}
|
||||
decoding_benchmarks = {
|
||||
"timestamps_modes": timestamps_modes,
|
||||
"backends": backends,
|
||||
}
|
||||
headers = ["repo_id", "resolution", "num_pixels"]
|
||||
headers += list(BASE_ENCODING.keys())
|
||||
headers += [
|
||||
"timestamps_mode",
|
||||
"backend",
|
||||
"video_size_bytes",
|
||||
"images_size_bytes",
|
||||
"video_images_size_ratio",
|
||||
"avg_load_time_video_ms",
|
||||
"avg_load_time_images_ms",
|
||||
"video_images_load_time_ratio",
|
||||
"avg_mse",
|
||||
"avg_psnr",
|
||||
"avg_ssim",
|
||||
]
|
||||
file_paths = []
|
||||
for video_codec in tqdm(vcodec, desc="encodings (vcodec)"):
|
||||
for pixel_format in tqdm(pix_fmt, desc="encodings (pix_fmt)", leave=False):
|
||||
benchmark_table = []
|
||||
for repo_id in tqdm(repo_ids, desc="encodings (datasets)", leave=False):
|
||||
dataset = LeRobotDataset(repo_id)
|
||||
imgs_dir = output_dir / "images" / dataset.repo_id.replace("/", "_")
|
||||
# We only use the first episode
|
||||
save_first_episode(imgs_dir, dataset)
|
||||
for key, values in tqdm(encoding_benchmarks.items(), desc="encodings (g, crf)", leave=False):
|
||||
for value in tqdm(values, desc=f"encodings ({key})", leave=False):
|
||||
encoding_cfg = BASE_ENCODING.copy()
|
||||
encoding_cfg["vcodec"] = video_codec
|
||||
encoding_cfg["pix_fmt"] = pixel_format
|
||||
encoding_cfg[key] = value
|
||||
args_path = Path("_".join(str(value) for value in encoding_cfg.values()))
|
||||
video_path = output_dir / "videos" / args_path / f"{repo_id.replace('/', '_')}.mp4"
|
||||
benchmark_table += benchmark_encoding_decoding(
|
||||
dataset,
|
||||
video_path,
|
||||
imgs_dir,
|
||||
encoding_cfg,
|
||||
decoding_benchmarks,
|
||||
num_samples,
|
||||
num_workers,
|
||||
save_frames,
|
||||
)
|
||||
|
||||
# Save intermediate results
|
||||
benchmark_df = pd.DataFrame(benchmark_table, columns=headers)
|
||||
now = dt.datetime.now()
|
||||
csv_path = (
|
||||
output_dir
|
||||
/ f"{now:%Y-%m-%d}_{now:%H-%M-%S}_{video_codec}_{pixel_format}_{num_samples}-samples.csv"
|
||||
)
|
||||
benchmark_df.to_csv(csv_path, header=True, index=False)
|
||||
file_paths.append(csv_path)
|
||||
del benchmark_df
|
||||
|
||||
# Concatenate all results
|
||||
df_list = [pd.read_csv(csv_path) for csv_path in file_paths]
|
||||
concatenated_df = pd.concat(df_list, ignore_index=True)
|
||||
concatenated_path = output_dir / f"{now:%Y-%m-%d}_{now:%H-%M-%S}_all_{num_samples}-samples.csv"
|
||||
concatenated_df.to_csv(concatenated_path, header=True, index=False)
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
parser = argparse.ArgumentParser()
|
||||
parser.add_argument(
|
||||
"--output-dir",
|
||||
type=Path,
|
||||
default=Path("outputs/video_benchmark"),
|
||||
help="Directory where the video benchmark outputs are written.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--repo-ids",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=[
|
||||
"lerobot/pusht_image",
|
||||
"aliberts/aloha_mobile_shrimp_image",
|
||||
"aliberts/paris_street",
|
||||
"aliberts/kitchen",
|
||||
],
|
||||
help="Datasets repo-ids to test against. First episodes only are used. Must be images.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--vcodec",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=["libx264", "libx265", "libsvtav1"],
|
||||
help="Video codecs to be tested",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--pix-fmt",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=["yuv444p", "yuv420p"],
|
||||
help="Pixel formats (chroma subsampling) to be tested",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--g",
|
||||
type=parse_int_or_none,
|
||||
nargs="*",
|
||||
default=[1, 2, 3, 4, 5, 6, 10, 15, 20, 40, 100, None],
|
||||
help="Group of pictures sizes to be tested.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--crf",
|
||||
type=parse_int_or_none,
|
||||
nargs="*",
|
||||
default=[0, 5, 10, 15, 20, 25, 30, 40, 50, None],
|
||||
help="Constant rate factors to be tested.",
|
||||
)
|
||||
# parser.add_argument(
|
||||
# "--fastdecode",
|
||||
# type=int,
|
||||
# nargs="*",
|
||||
# default=[0, 1],
|
||||
# help="Use the fastdecode tuning option. 0 disables it. "
|
||||
# "For libx264 and libx265, only 1 is possible. "
|
||||
# "For libsvtav1, 1, 2 or 3 are possible values with a higher number meaning a faster decoding optimization",
|
||||
# )
|
||||
parser.add_argument(
|
||||
"--timestamps-modes",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=[
|
||||
"1_frame",
|
||||
"2_frames",
|
||||
"2_frames_4_space",
|
||||
"6_frames",
|
||||
],
|
||||
help="Timestamps scenarios to be tested.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--backends",
|
||||
type=str,
|
||||
nargs="*",
|
||||
default=["pyav", "video_reader"],
|
||||
help="Torchvision decoding backend to be tested.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--num-samples",
|
||||
type=int,
|
||||
default=50,
|
||||
help="Number of samples for each encoding x decoding config.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--num-workers",
|
||||
type=int,
|
||||
default=10,
|
||||
help="Number of processes for parallelized sample processing.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--save-frames",
|
||||
type=int,
|
||||
default=0,
|
||||
help="Whether to save decoded frames or not. Enter a non-zero number for true.",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
main(**vars(args))
|
||||
@@ -8,7 +8,7 @@ ARG DEBIAN_FRONTEND=noninteractive
|
||||
# Install apt dependencies
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
build-essential cmake \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||
|
||||
# Create virtual environment
|
||||
|
||||
68
docker/lerobot-gpu-dev/Dockerfile
Normal file
68
docker/lerobot-gpu-dev/Dockerfile
Normal file
@@ -0,0 +1,68 @@
|
||||
FROM nvidia/cuda:12.2.2-devel-ubuntu22.04
|
||||
|
||||
# Configure image
|
||||
ARG PYTHON_VERSION=3.10
|
||||
ARG DEBIAN_FRONTEND=noninteractive
|
||||
|
||||
# Install apt dependencies
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
build-essential cmake \
|
||||
git git-lfs openssh-client \
|
||||
nano vim less util-linux tree \
|
||||
htop atop nvtop \
|
||||
sed gawk grep curl wget zip unzip \
|
||||
tcpdump sysstat screen tmux \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
||||
python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
|
||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||
|
||||
# Install ffmpeg build dependencies. See:
|
||||
# https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu
|
||||
# TODO(aliberts): create image to build dependencies from source instead
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
autoconf automake yasm \
|
||||
libass-dev \
|
||||
libfreetype6-dev \
|
||||
libgnutls28-dev \
|
||||
libunistring-dev \
|
||||
libmp3lame-dev \
|
||||
libtool \
|
||||
libvorbis-dev \
|
||||
meson \
|
||||
ninja-build \
|
||||
pkg-config \
|
||||
texinfo \
|
||||
yasm \
|
||||
zlib1g-dev \
|
||||
nasm \
|
||||
libx264-dev \
|
||||
libx265-dev libnuma-dev \
|
||||
libvpx-dev \
|
||||
libfdk-aac-dev \
|
||||
libopus-dev \
|
||||
libsvtav1-dev libsvtav1enc-dev libsvtav1dec-dev \
|
||||
libdav1d-dev
|
||||
|
||||
|
||||
# Install gh cli tool
|
||||
RUN (type -p wget >/dev/null || (apt update && apt-get install wget -y)) \
|
||||
&& mkdir -p -m 755 /etc/apt/keyrings \
|
||||
&& wget -qO- https://cli.github.com/packages/githubcli-archive-keyring.gpg | tee /etc/apt/keyrings/githubcli-archive-keyring.gpg > /dev/null \
|
||||
&& chmod go+r /etc/apt/keyrings/githubcli-archive-keyring.gpg \
|
||||
&& echo "deb [arch=$(dpkg --print-architecture) signed-by=/etc/apt/keyrings/githubcli-archive-keyring.gpg] https://cli.github.com/packages stable main" | tee /etc/apt/sources.list.d/github-cli.list > /dev/null \
|
||||
&& apt update \
|
||||
&& apt install gh -y \
|
||||
&& apt clean && rm -rf /var/lib/apt/lists/*
|
||||
|
||||
# Setup `python`
|
||||
RUN ln -s /usr/bin/python3 /usr/bin/python
|
||||
|
||||
# Install poetry
|
||||
RUN curl -sSL https://install.python-poetry.org | python -
|
||||
ENV PATH="/root/.local/bin:$PATH"
|
||||
RUN echo 'if [ "$HOME" != "/root" ]; then ln -sf /root/.local/bin/poetry $HOME/.local/bin/poetry; fi' >> /root/.bashrc
|
||||
RUN poetry config virtualenvs.create false
|
||||
RUN poetry config virtualenvs.in-project true
|
||||
|
||||
# Set EGL as the rendering backend for MuJoCo
|
||||
ENV MUJOCO_GL="egl"
|
||||
@@ -4,18 +4,15 @@ FROM nvidia/cuda:12.4.1-base-ubuntu22.04
|
||||
ARG PYTHON_VERSION=3.10
|
||||
ARG DEBIAN_FRONTEND=noninteractive
|
||||
|
||||
|
||||
# Install apt dependencies
|
||||
RUN apt-get update && apt-get install -y --no-install-recommends \
|
||||
build-essential cmake \
|
||||
git git-lfs openssh-client \
|
||||
nano vim ffmpeg \
|
||||
htop atop nvtop \
|
||||
sed gawk grep curl wget \
|
||||
tcpdump sysstat screen \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
|
||||
libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
|
||||
python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
|
||||
&& apt-get clean && rm -rf /var/lib/apt/lists/*
|
||||
|
||||
|
||||
# Create virtual environment
|
||||
RUN ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python
|
||||
RUN python -m venv /opt/venv
|
||||
@@ -23,8 +20,7 @@ ENV PATH="/opt/venv/bin:$PATH"
|
||||
RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
|
||||
|
||||
# Install LeRobot
|
||||
RUN git lfs install
|
||||
RUN git clone https://github.com/huggingface/lerobot.git
|
||||
COPY . /lerobot
|
||||
WORKDIR /lerobot
|
||||
RUN pip install --upgrade --no-cache-dir pip
|
||||
RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht]"
|
||||
|
||||
183
examples/4_train_policy_with_script.md
Normal file
183
examples/4_train_policy_with_script.md
Normal file
@@ -0,0 +1,183 @@
|
||||
This tutorial will explain the training script, how to use it, and particularly the use of Hydra to configure everything needed for the training run.
|
||||
|
||||
## The training script
|
||||
|
||||
LeRobot offers a training script at [`lerobot/scripts/train.py`](../../lerobot/scripts/train.py). At a high level it does the following:
|
||||
|
||||
- Loads a Hydra configuration file for the following steps (more on Hydra in a moment).
|
||||
- Makes a simulation environment.
|
||||
- Makes a dataset corresponding to that simulation environment.
|
||||
- Makes a policy.
|
||||
- Runs a standard training loop with forward pass, backward pass, optimization step, and occasional logging, evaluation (of the policy on the environment), and checkpointing.
|
||||
|
||||
## Basics of how we use Hydra
|
||||
|
||||
Explaining the ins and outs of [Hydra](https://hydra.cc/docs/intro/) is beyond the scope of this document, but here we'll share the main points you need to know.
|
||||
|
||||
First, `lerobot/configs` has a directory structure like this:
|
||||
|
||||
```
|
||||
.
|
||||
├── default.yaml
|
||||
├── env
|
||||
│ ├── aloha.yaml
|
||||
│ ├── pusht.yaml
|
||||
│ └── xarm.yaml
|
||||
└── policy
|
||||
├── act.yaml
|
||||
├── diffusion.yaml
|
||||
└── tdmpc.yaml
|
||||
```
|
||||
|
||||
**_For brevity, in the rest of this document we'll drop the leading `lerobot/configs` path. So `default.yaml` really refers to `lerobot/configs/default.yaml`._**
|
||||
|
||||
When you run the training script with
|
||||
|
||||
```python
|
||||
python lerobot/scripts/train.py
|
||||
```
|
||||
|
||||
Hydra is set up to read `default.yaml` (via the `@hydra.main` decorator). If you take a look at the `@hydra.main`'s arguments you will see `config_path="../configs", config_name="default"`. At the top of `default.yaml`, is a `defaults` section which looks likes this:
|
||||
|
||||
```yaml
|
||||
defaults:
|
||||
- _self_
|
||||
- env: pusht
|
||||
- policy: diffusion
|
||||
```
|
||||
|
||||
This logic tells Hydra to incorporate configuration parameters from `env/pusht.yaml` and `policy/diffusion.yaml`. _Note: Be aware of the order as any configuration parameters with the same name will be overidden. Thus, `default.yaml` is overridden by `env/pusht.yaml` which is overidden by `policy/diffusion.yaml`_.
|
||||
|
||||
Then, `default.yaml` also contains common configuration parameters such as `device: cuda` or `use_amp: false` (for enabling fp16 training). Some other parameters are set to `???` which indicates that they are expected to be set in additional yaml files. For instance, `training.offline_steps: ???` in `default.yaml` is set to `200000` in `diffusion.yaml`.
|
||||
|
||||
Thanks to this `defaults` section in `default.yaml`, if you want to train Diffusion Policy with PushT, you really only need to run:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py
|
||||
```
|
||||
|
||||
However, you can be more explicit and launch the exact same Diffusion Policy training on PushT with:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py policy=diffusion env=pusht
|
||||
```
|
||||
|
||||
This way of overriding defaults via the CLI is especially useful when you want to change the policy and/or environment. For instance, you can train ACT on the default Aloha environment with:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py policy=act env=aloha
|
||||
```
|
||||
|
||||
There are two things to note here:
|
||||
- Config overrides are passed as `param_name=param_value`.
|
||||
- Here we have overridden the defaults section. `policy=act` tells Hydra to use `policy/act.yaml`, and `env=aloha` tells Hydra to use `env/aloha.yaml`.
|
||||
|
||||
_As an aside: we've set up all of our configurations so that they reproduce state-of-the-art results from papers in the literature._
|
||||
|
||||
## Overriding configuration parameters in the CLI
|
||||
|
||||
Now let's say that we want to train on a different task in the Aloha environment. If you look in `env/aloha.yaml` you will see something like:
|
||||
|
||||
```yaml
|
||||
# lerobot/configs/env/aloha.yaml
|
||||
env:
|
||||
task: AlohaInsertion-v0
|
||||
```
|
||||
|
||||
And if you look in `policy/act.yaml` you will see something like:
|
||||
|
||||
```yaml
|
||||
# lerobot/configs/policy/act.yaml
|
||||
dataset_repo_id: lerobot/aloha_sim_insertion_human
|
||||
```
|
||||
|
||||
But our Aloha environment actually supports a cube transfer task as well. To train for this task, you could manually modify the two yaml configuration files respectively.
|
||||
|
||||
First, we'd need to switch to using the cube transfer task for the ALOHA environment.
|
||||
|
||||
```diff
|
||||
# lerobot/configs/env/aloha.yaml
|
||||
env:
|
||||
- task: AlohaInsertion-v0
|
||||
+ task: AlohaTransferCube-v0
|
||||
```
|
||||
|
||||
Then, we'd also need to switch to using the cube transfer dataset.
|
||||
|
||||
```diff
|
||||
# lerobot/configs/policy/act.yaml
|
||||
-dataset_repo_id: lerobot/aloha_sim_insertion_human
|
||||
+dataset_repo_id: lerobot/aloha_sim_transfer_cube_human
|
||||
```
|
||||
|
||||
Then, you'd be able to run:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py policy=act env=aloha
|
||||
```
|
||||
|
||||
and you'd be training and evaluating on the cube transfer task.
|
||||
|
||||
An alternative approach to editing the yaml configuration files, would be to override the defaults via the command line:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py \
|
||||
policy=act \
|
||||
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||
env=aloha \
|
||||
env.task=AlohaTransferCube-v0
|
||||
```
|
||||
|
||||
There's something new here. Notice the `.` delimiter used to traverse the configuration hierarchy. _But be aware that the `defaults` section is an exception. As you saw above, we didn't need to write `defaults.policy=act` in the CLI. `policy=act` was enough._
|
||||
|
||||
Putting all that knowledge together, here's the command that was used to train https://huggingface.co/lerobot/act_aloha_sim_transfer_cube_human.
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py \
|
||||
hydra.run.dir=outputs/train/act_aloha_sim_transfer_cube_human \
|
||||
device=cuda
|
||||
env=aloha \
|
||||
env.task=AlohaTransferCube-v0 \
|
||||
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||
policy=act \
|
||||
training.eval_freq=10000 \
|
||||
training.log_freq=250 \
|
||||
training.offline_steps=100000 \
|
||||
training.save_model=true \
|
||||
training.save_freq=25000 \
|
||||
eval.n_episodes=50 \
|
||||
eval.batch_size=50 \
|
||||
wandb.enable=false \
|
||||
```
|
||||
|
||||
There's one new thing here: `hydra.run.dir=outputs/train/act_aloha_sim_transfer_cube_human`, which specifies where to save the training output.
|
||||
|
||||
## Using a configuration file not in `lerobot/configs`
|
||||
|
||||
Above we discusses the our training script is set up such that Hydra looks for `default.yaml` in `lerobot/configs`. But, if you have a configuration file elsewhere in your filesystem you may use:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py --config-dir PARENT/PATH --config-name FILE_NAME_WITHOUT_EXTENSION
|
||||
```
|
||||
|
||||
Note: here we use regular syntax for providing CLI arguments to a Python script, not Hydra's `param_name=param_value` syntax.
|
||||
|
||||
As a concrete example, this becomes particularly handy when you have a folder with training outputs, and would like to re-run the training. For example, say you previously ran the training script with one of the earlier commands and have `outputs/train/my_experiment/checkpoints/pretrained_model/config.yaml`. This `config.yaml` file will have the full set of configuration parameters within it. To run the training with the same configuration again, do:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py --config-dir outputs/train/my_experiment/checkpoints/last/pretrained_model --config-name config
|
||||
```
|
||||
|
||||
Note that you may still use the regular syntax for config parameter overrides (eg: by adding `training.offline_steps=200000`).
|
||||
|
||||
---
|
||||
|
||||
So far we've seen how to train Diffusion Policy for PushT and ACT for ALOHA. Now, what if we want to train ACT for PushT? Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py policy=act env=pusht dataset_repo_id=lerobot/pusht
|
||||
```
|
||||
|
||||
Please, head on over to our [advanced tutorial on adapting policy configuration to various environments](./advanced/train_act_pusht/train_act_pusht.md) to learn more.
|
||||
|
||||
Or in the meantime, happy coding! 🤗
|
||||
37
examples/5_resume_training.md
Normal file
37
examples/5_resume_training.md
Normal file
@@ -0,0 +1,37 @@
|
||||
This tutorial explains how to resume a training run that you've started with the training script. If you don't know how our training script and configuration system works, please read [4_train_policy_with_script.md](./4_train_policy_with_script.md) first.
|
||||
|
||||
## Basic training resumption
|
||||
|
||||
Let's consider the example of training ACT for one of the ALOHA tasks. Here's a command that can achieve that:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py \
|
||||
hydra.run.dir=outputs/train/run_resumption \
|
||||
policy=act \
|
||||
dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
|
||||
env=aloha \
|
||||
env.task=AlohaTransferCube-v0 \
|
||||
training.log_freq=25 \
|
||||
training.save_checkpoint=true \
|
||||
training.save_freq=100
|
||||
```
|
||||
|
||||
Here we're using the default dataset and environment for ACT, and we've taken care to set up the log frequency and checkpointing frequency to low numbers so we can test resumption. You should be able to see some logging and have a first checkpoint within 1 minute. Please interrupt the training after the first checkpoint.
|
||||
|
||||
To resume, all that we have to do is run the training script, providing the run directory, and the resume option:
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py \
|
||||
hydra.run.dir=outputs/train/run_resumption \
|
||||
resume=true
|
||||
```
|
||||
|
||||
You should see from the logging that your training picks up from where it left off.
|
||||
|
||||
Note that with `resume=true`, the configuration file from the last checkpoint in the training output directory is loaded. So it doesn't matter that we haven't provided all the other configuration parameters from our previous command (although there may be warnings to notify you that your command has a different configuration than than the checkpoint).
|
||||
|
||||
---
|
||||
|
||||
Now you should know how to resume your training run in case it gets interrupted or you want to extend a finished training run.
|
||||
|
||||
Happy coding! 🤗
|
||||
52
examples/6_add_image_transforms.py
Normal file
52
examples/6_add_image_transforms.py
Normal file
@@ -0,0 +1,52 @@
|
||||
"""
|
||||
This script demonstrates how to use torchvision's image transformation with LeRobotDataset for data
|
||||
augmentation purposes. The transformations are passed to the dataset as an argument upon creation, and
|
||||
transforms are applied to the observation images before they are returned in the dataset's __get_item__.
|
||||
"""
|
||||
|
||||
from pathlib import Path
|
||||
|
||||
from torchvision.transforms import ToPILImage, v2
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
|
||||
dataset_repo_id = "lerobot/aloha_static_tape"
|
||||
|
||||
# Create a LeRobotDataset with no transformations
|
||||
dataset = LeRobotDataset(dataset_repo_id)
|
||||
# This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
|
||||
|
||||
# Get the index of the first observation in the first episode
|
||||
first_idx = dataset.episode_data_index["from"][0].item()
|
||||
|
||||
# Get the frame corresponding to the first camera
|
||||
frame = dataset[first_idx][dataset.camera_keys[0]]
|
||||
|
||||
|
||||
# Define the transformations
|
||||
transforms = v2.Compose(
|
||||
[
|
||||
v2.ColorJitter(brightness=(0.5, 1.5)),
|
||||
v2.ColorJitter(contrast=(0.5, 1.5)),
|
||||
v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
|
||||
]
|
||||
)
|
||||
|
||||
# Create another LeRobotDataset with the defined transformations
|
||||
transformed_dataset = LeRobotDataset(dataset_repo_id, image_transforms=transforms)
|
||||
|
||||
# Get a frame from the transformed dataset
|
||||
transformed_frame = transformed_dataset[first_idx][transformed_dataset.camera_keys[0]]
|
||||
|
||||
# Create a directory to store output images
|
||||
output_dir = Path("outputs/image_transforms")
|
||||
output_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
# Save the original frame
|
||||
to_pil = ToPILImage()
|
||||
to_pil(frame).save(output_dir / "original_frame.png", quality=100)
|
||||
print(f"Original frame saved to {output_dir / 'original_frame.png'}.")
|
||||
|
||||
# Save the transformed frame
|
||||
to_pil(transformed_frame).save(output_dir / "transformed_frame.png", quality=100)
|
||||
print(f"Transformed frame saved to {output_dir / 'transformed_frame.png'}.")
|
||||
@@ -1,14 +1,23 @@
|
||||
# @package _global_
|
||||
|
||||
seed: 1000
|
||||
dataset_repo_id: lerobot/aloha_sim_insertion_human
|
||||
# Change the seed to match what PushT eval uses
|
||||
# (to avoid evaluating on seeds used for generating the training data).
|
||||
seed: 100000
|
||||
# Change the dataset repository to the PushT one.
|
||||
dataset_repo_id: lerobot/pusht
|
||||
|
||||
override_dataset_stats:
|
||||
observation.image:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
|
||||
training:
|
||||
offline_steps: 20000
|
||||
offline_steps: 80000
|
||||
online_steps: 0
|
||||
eval_freq: 100000
|
||||
save_freq: 200
|
||||
log_freq: 200
|
||||
eval_freq: 10000
|
||||
save_freq: 100000
|
||||
log_freq: 250
|
||||
save_model: true
|
||||
|
||||
batch_size: 8
|
||||
@@ -35,18 +44,19 @@ policy:
|
||||
n_action_steps: 100
|
||||
|
||||
input_shapes:
|
||||
# TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
|
||||
observation.images: [3, 480, 640]
|
||||
observation.image: [3, 96, 96]
|
||||
observation.state: ["${env.state_dim}"]
|
||||
output_shapes:
|
||||
action: ["${env.action_dim}"]
|
||||
|
||||
# Normalization / Unnormalization
|
||||
input_normalization_modes:
|
||||
observation.images.front: mean_std
|
||||
observation.state: mean_std
|
||||
observation.image: mean_std
|
||||
# Use min_max normalization just because it's more standard.
|
||||
observation.state: min_max
|
||||
output_normalization_modes:
|
||||
action: mean_std
|
||||
# Use min_max normalization just because it's more standard.
|
||||
action: min_max
|
||||
|
||||
# Architecture.
|
||||
# Vision backbone.
|
||||
@@ -60,7 +70,7 @@ policy:
|
||||
dim_feedforward: 3200
|
||||
feedforward_activation: relu
|
||||
n_encoder_layers: 4
|
||||
# Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
|
||||
# Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
|
||||
# that means only the first layer is used. Here we match the original implementation by setting this to 1.
|
||||
# See this issue https://github.com/tonyzhaozh/act/issues/25#issue-2258740521.
|
||||
n_decoder_layers: 1
|
||||
70
examples/advanced/1_train_act_pusht/train_act_pusht.md
Normal file
70
examples/advanced/1_train_act_pusht/train_act_pusht.md
Normal file
@@ -0,0 +1,70 @@
|
||||
In this tutorial we will learn how to adapt a policy configuration to be compatible with a new environment and dataset. As a concrete example, we will adapt the default configuration for ACT to be compatible with the PushT environment and dataset.
|
||||
|
||||
If you haven't already read our tutorial on the [training script and configuration tooling](../4_train_policy_with_script.md) please do so prior to tackling this tutorial.
|
||||
|
||||
Let's get started!
|
||||
|
||||
Suppose we want to train ACT for PushT. Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
|
||||
|
||||
```bash
|
||||
python lerobot/scripts/train.py policy=act env=pusht dataset_repo_id=lerobot/pusht
|
||||
```
|
||||
|
||||
We need to adapt the parameters of the ACT policy configuration to the PushT environment. The most important ones are the image keys.
|
||||
|
||||
ALOHA's datasets and environments typically use a variable number of cameras. In `lerobot/configs/policy/act.yaml` you may notice two relevant sections. Here we show you the minimal diff needed to adjust to PushT:
|
||||
|
||||
```diff
|
||||
override_dataset_stats:
|
||||
- observation.images.top:
|
||||
+ observation.image:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
|
||||
policy:
|
||||
input_shapes:
|
||||
- observation.images.top: [3, 480, 640]
|
||||
+ observation.image: [3, 96, 96]
|
||||
observation.state: ["${env.state_dim}"]
|
||||
output_shapes:
|
||||
action: ["${env.action_dim}"]
|
||||
|
||||
input_normalization_modes:
|
||||
- observation.images.top: mean_std
|
||||
+ observation.image: mean_std
|
||||
observation.state: min_max
|
||||
output_normalization_modes:
|
||||
action: min_max
|
||||
```
|
||||
|
||||
Here we've accounted for the following:
|
||||
- PushT uses "observation.image" for its image key.
|
||||
- PushT provides smaller images.
|
||||
|
||||
_Side note: technically we could override these via the CLI, but with many changes it gets a bit messy, and we also have a bit of a challenge in that we're using `.` in our observation keys which is treated by Hydra as a hierarchical separator_.
|
||||
|
||||
For your convenience, we provide [`act_pusht.yaml`](./act_pusht.yaml) in this directory. It contains the diff above, plus some other (optional) ones that are explained within. Please copy it into `lerobot/configs/policy` with:
|
||||
|
||||
```bash
|
||||
cp examples/advanced/1_train_act_pusht/act_pusht.yaml lerobot/configs/policy/act_pusht.yaml
|
||||
```
|
||||
|
||||
(remember from a [previous tutorial](../4_train_policy_with_script.md) that Hydra will look in the `lerobot/configs` directory). Now try running the following.
|
||||
|
||||
<!-- Note to contributor: are you changing this command? Note that it's tested in `Makefile`, so change it there too! -->
|
||||
```bash
|
||||
python lerobot/scripts/train.py policy=act_pusht env=pusht
|
||||
```
|
||||
|
||||
Notice that this is much the same as the command that failed at the start of the tutorial, only:
|
||||
- Now we are using `policy=act_pusht` to point to our new configuration file.
|
||||
- We can drop `dataset_repo_id=lerobot/pusht` as the change is incorporated in our new configuration file.
|
||||
|
||||
Hurrah! You're now training ACT for the PushT environment.
|
||||
|
||||
---
|
||||
|
||||
The bottom line of this tutorial is that when training policies for different environments and datasets you will need to understand what parts of the policy configuration are specific to those and make changes accordingly.
|
||||
|
||||
Happy coding! 🤗
|
||||
@@ -45,6 +45,9 @@ import itertools
|
||||
|
||||
from lerobot.__version__ import __version__ # noqa: F401
|
||||
|
||||
# TODO(rcadene): Improve policies and envs. As of now, an item in `available_policies`
|
||||
# refers to a yaml file AND a modeling name. Same for `available_envs` which refers to
|
||||
# a yaml file AND a environment name. The difference should be more obvious.
|
||||
available_tasks_per_env = {
|
||||
"aloha": [
|
||||
"AlohaInsertion-v0",
|
||||
@@ -52,6 +55,7 @@ available_tasks_per_env = {
|
||||
],
|
||||
"pusht": ["PushT-v0"],
|
||||
"xarm": ["XarmLift-v0"],
|
||||
"dora_aloha_real": ["DoraAloha-v0", "DoraKoch-v0", "DoraReachy2-v0"],
|
||||
}
|
||||
available_envs = list(available_tasks_per_env.keys())
|
||||
|
||||
@@ -66,6 +70,8 @@ available_datasets_per_env = {
|
||||
"lerobot/aloha_sim_transfer_cube_human_image",
|
||||
"lerobot/aloha_sim_transfer_cube_scripted_image",
|
||||
],
|
||||
# TODO(alexander-soare): Add "lerobot/pusht_keypoints". Right now we can't because this is too tightly
|
||||
# coupled with tests.
|
||||
"pusht": ["lerobot/pusht", "lerobot/pusht_image"],
|
||||
"xarm": [
|
||||
"lerobot/xarm_lift_medium",
|
||||
@@ -77,6 +83,23 @@ available_datasets_per_env = {
|
||||
"lerobot/xarm_push_medium_image",
|
||||
"lerobot/xarm_push_medium_replay_image",
|
||||
],
|
||||
"dora_aloha_real": [
|
||||
"lerobot/aloha_static_battery",
|
||||
"lerobot/aloha_static_candy",
|
||||
"lerobot/aloha_static_coffee",
|
||||
"lerobot/aloha_static_coffee_new",
|
||||
"lerobot/aloha_static_cups_open",
|
||||
"lerobot/aloha_static_fork_pick_up",
|
||||
"lerobot/aloha_static_pingpong_test",
|
||||
"lerobot/aloha_static_pro_pencil",
|
||||
"lerobot/aloha_static_screw_driver",
|
||||
"lerobot/aloha_static_tape",
|
||||
"lerobot/aloha_static_thread_velcro",
|
||||
"lerobot/aloha_static_towel",
|
||||
"lerobot/aloha_static_vinh_cup",
|
||||
"lerobot/aloha_static_vinh_cup_left",
|
||||
"lerobot/aloha_static_ziploc_slide",
|
||||
],
|
||||
}
|
||||
|
||||
available_real_world_datasets = [
|
||||
@@ -108,16 +131,20 @@ available_datasets = list(
|
||||
itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets)
|
||||
)
|
||||
|
||||
# lists all available policies from `lerobot/common/policies` by their class attribute: `name`.
|
||||
available_policies = [
|
||||
"act",
|
||||
"diffusion",
|
||||
"tdmpc",
|
||||
"vqbet",
|
||||
]
|
||||
|
||||
# keys and values refer to yaml files
|
||||
available_policies_per_env = {
|
||||
"aloha": ["act"],
|
||||
"pusht": ["diffusion"],
|
||||
"pusht": ["diffusion", "vqbet"],
|
||||
"xarm": ["tdmpc"],
|
||||
"dora_aloha_real": ["act_real"],
|
||||
}
|
||||
|
||||
env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
|
||||
|
||||
@@ -1,334 +0,0 @@
|
||||
# Video benchmark
|
||||
|
||||
|
||||
## Questions
|
||||
|
||||
What is the optimal trade-off between:
|
||||
- maximizing loading time with random access,
|
||||
- minimizing memory space on disk,
|
||||
- maximizing success rate of policies?
|
||||
|
||||
How to encode videos?
|
||||
- How much compression (`-crf`)? Low compression with `0`, normal compression with `20` or extreme with `56`?
|
||||
- What pixel format to use (`-pix_fmt`)? `yuv444p` or `yuv420p`?
|
||||
- How many key frames (`-g`)? A key frame every `10` frames?
|
||||
|
||||
How to decode videos?
|
||||
- Which `decoder`? `torchvision`, `torchaudio`, `ffmpegio`, `decord`, or `nvc`?
|
||||
|
||||
## Metrics
|
||||
|
||||
**Percentage of data compression (higher is better)**
|
||||
`compression_factor` is the ratio of the memory space on disk taken by the original images to encode, to the memory space taken by the encoded video. For instance, `compression_factor=4` means that the video takes 4 times less memory space on disk compared to the original images.
|
||||
|
||||
**Percentage of loading time (higher is better)**
|
||||
`load_time_factor` is the ratio of the time it takes to load original images at given timestamps, to the time it takes to decode the exact same frames from the video. Higher is better. For instance, `load_time_factor=0.5` means that decoding from video is 2 times slower than loading the original images.
|
||||
|
||||
**Average L2 error per pixel (lower is better)**
|
||||
`avg_per_pixel_l2_error` is the average L2 error between each decoded frame and its corresponding original image over all requested timestamps, and also divided by the number of pixels in the image to be comparable when switching to different image sizes.
|
||||
|
||||
**Loss of a pretrained policy (higher is better)** (not available)
|
||||
`loss_pretrained` is the result of evaluating with the selected encoding/decoding settings a policy pretrained on original images. It is easier to understand than `avg_l2_error`.
|
||||
|
||||
**Success rate after retraining (higher is better)** (not available)
|
||||
`success_rate` is the result of training and evaluating a policy with the selected encoding/decoding settings. It is the most difficult metric to get but also the very best.
|
||||
|
||||
|
||||
## Variables
|
||||
|
||||
**Image content**
|
||||
We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an appartment, or in a factory, or outdoor, etc. Hence, we run this benchmark on two datasets: `pusht` (simulation) and `umi` (real-world outdoor).
|
||||
|
||||
**Requested timestamps**
|
||||
In this benchmark, we focus on the loading time of random access, so we are not interested in sequentially loading all frames of a video like in a movie. However, the number of consecutive timestamps requested and their spacing can greatly affect the `load_time_factor`. In fact, it is expected to get faster loading time by decoding a large number of consecutive frames from a video, than to load the same data from individual images. To reflect our robotics use case, we consider a few settings:
|
||||
- `single_frame`: 1 frame,
|
||||
- `2_frames`: 2 consecutive frames (e.g. `[t, t + 1 / fps]`),
|
||||
- `2_frames_4_space`: 2 consecutive frames with 4 frames of spacing (e.g `[t, t + 4 / fps]`),
|
||||
|
||||
**Data augmentations**
|
||||
We might revisit this benchmark and find better settings if we train our policies with various data augmentations to make them more robust (e.g. robust to color changes, compression, etc.).
|
||||
|
||||
|
||||
## Results
|
||||
|
||||
**`decoder`**
|
||||
| repo_id | decoder | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | <span style="color: #32CD32;">torchvision</span> | 0.166 | 0.0000119 |
|
||||
| lerobot/pusht | ffmpegio | 0.009 | 0.0001182 |
|
||||
| lerobot/pusht | torchaudio | 0.138 | 0.0000359 |
|
||||
| lerobot/umi_cup_in_the_wild | <span style="color: #32CD32;">torchvision</span> | 0.174 | 0.0000174 |
|
||||
| lerobot/umi_cup_in_the_wild | ffmpegio | 0.010 | 0.0000735 |
|
||||
| lerobot/umi_cup_in_the_wild | torchaudio | 0.154 | 0.0000340 |
|
||||
|
||||
### `1_frame`
|
||||
|
||||
**`pix_fmt`**
|
||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | yuv420p | 3.788 | 0.224 | 0.0000760 |
|
||||
| lerobot/pusht | yuv444p | 3.646 | 0.185 | 0.0000443 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.388 | 0.0000469 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.329 | 0.0000397 |
|
||||
|
||||
**`g`**
|
||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 1 | 2.543 | 0.204 | 0.0000556 |
|
||||
| lerobot/pusht | 2 | 3.646 | 0.182 | 0.0000443 |
|
||||
| lerobot/pusht | 3 | 4.431 | 0.174 | 0.0000450 |
|
||||
| lerobot/pusht | 4 | 5.103 | 0.163 | 0.0000448 |
|
||||
| lerobot/pusht | 5 | 5.625 | 0.163 | 0.0000436 |
|
||||
| lerobot/pusht | 6 | 5.974 | 0.155 | 0.0000427 |
|
||||
| lerobot/pusht | 10 | 6.814 | 0.130 | 0.0000410 |
|
||||
| lerobot/pusht | 15 | 7.431 | 0.105 | 0.0000406 |
|
||||
| lerobot/pusht | 20 | 7.662 | 0.097 | 0.0000400 |
|
||||
| lerobot/pusht | 40 | 8.163 | 0.061 | 0.0000405 |
|
||||
| lerobot/pusht | 100 | 8.761 | 0.039 | 0.0000422 |
|
||||
| lerobot/pusht | None | 8.909 | 0.024 | 0.0000431 |
|
||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.444 | 0.0000601 |
|
||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.345 | 0.0000397 |
|
||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.282 | 0.0000416 |
|
||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.271 | 0.0000415 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.260 | 0.0000415 |
|
||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.249 | 0.0000415 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.195 | 0.0000399 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.169 | 0.0000394 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.140 | 0.0000390 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.096 | 0.0000384 |
|
||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.046 | 0.0000390 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.022 | 0.0000400 |
|
||||
|
||||
**`crf`**
|
||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 0 | 1.699 | 0.175 | 0.0000035 |
|
||||
| lerobot/pusht | 5 | 1.409 | 0.181 | 0.0000080 |
|
||||
| lerobot/pusht | 10 | 1.842 | 0.172 | 0.0000123 |
|
||||
| lerobot/pusht | 15 | 2.322 | 0.187 | 0.0000211 |
|
||||
| lerobot/pusht | 20 | 3.050 | 0.181 | 0.0000346 |
|
||||
| lerobot/pusht | None | 3.646 | 0.189 | 0.0000443 |
|
||||
| lerobot/pusht | 25 | 3.969 | 0.186 | 0.0000521 |
|
||||
| lerobot/pusht | 30 | 5.687 | 0.184 | 0.0000850 |
|
||||
| lerobot/pusht | 40 | 10.818 | 0.193 | 0.0001726 |
|
||||
| lerobot/pusht | 50 | 18.185 | 0.183 | 0.0002606 |
|
||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.165 | 0.0000056 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.171 | 0.0000111 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.212 | 0.0000153 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.261 | 0.0000218 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.312 | 0.0000317 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.339 | 0.0000397 |
|
||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.297 | 0.0000452 |
|
||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.406 | 0.0000629 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.468 | 0.0001184 |
|
||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.515 | 0.0001879 |
|
||||
|
||||
**best**
|
||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | 3.646 | 0.188 | 0.0000443 |
|
||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.339 | 0.0000397 |
|
||||
|
||||
### `2_frames`
|
||||
|
||||
**`pix_fmt`**
|
||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | yuv420p | 3.788 | 0.314 | 0.0000799 |
|
||||
| lerobot/pusht | yuv444p | 3.646 | 0.303 | 0.0000496 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.642 | 0.0000503 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.529 | 0.0000436 |
|
||||
|
||||
**`g`**
|
||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 1 | 2.543 | 0.308 | 0.0000599 |
|
||||
| lerobot/pusht | 2 | 3.646 | 0.279 | 0.0000496 |
|
||||
| lerobot/pusht | 3 | 4.431 | 0.259 | 0.0000498 |
|
||||
| lerobot/pusht | 4 | 5.103 | 0.243 | 0.0000501 |
|
||||
| lerobot/pusht | 5 | 5.625 | 0.235 | 0.0000492 |
|
||||
| lerobot/pusht | 6 | 5.974 | 0.230 | 0.0000481 |
|
||||
| lerobot/pusht | 10 | 6.814 | 0.194 | 0.0000468 |
|
||||
| lerobot/pusht | 15 | 7.431 | 0.152 | 0.0000460 |
|
||||
| lerobot/pusht | 20 | 7.662 | 0.151 | 0.0000455 |
|
||||
| lerobot/pusht | 40 | 8.163 | 0.095 | 0.0000454 |
|
||||
| lerobot/pusht | 100 | 8.761 | 0.062 | 0.0000472 |
|
||||
| lerobot/pusht | None | 8.909 | 0.037 | 0.0000479 |
|
||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.638 | 0.0000625 |
|
||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.537 | 0.0000436 |
|
||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.493 | 0.0000437 |
|
||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.458 | 0.0000446 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.438 | 0.0000445 |
|
||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.424 | 0.0000444 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.345 | 0.0000435 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.313 | 0.0000417 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.264 | 0.0000421 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.185 | 0.0000414 |
|
||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.090 | 0.0000420 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.042 | 0.0000424 |
|
||||
|
||||
**`crf`**
|
||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 0 | 1.699 | 0.302 | 0.0000097 |
|
||||
| lerobot/pusht | 5 | 1.409 | 0.287 | 0.0000142 |
|
||||
| lerobot/pusht | 10 | 1.842 | 0.283 | 0.0000184 |
|
||||
| lerobot/pusht | 15 | 2.322 | 0.305 | 0.0000268 |
|
||||
| lerobot/pusht | 20 | 3.050 | 0.285 | 0.0000402 |
|
||||
| lerobot/pusht | None | 3.646 | 0.285 | 0.0000496 |
|
||||
| lerobot/pusht | 25 | 3.969 | 0.293 | 0.0000572 |
|
||||
| lerobot/pusht | 30 | 5.687 | 0.293 | 0.0000893 |
|
||||
| lerobot/pusht | 40 | 10.818 | 0.319 | 0.0001762 |
|
||||
| lerobot/pusht | 50 | 18.185 | 0.304 | 0.0002626 |
|
||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.235 | 0.0000112 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.261 | 0.0000166 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.333 | 0.0000207 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.406 | 0.0000267 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.489 | 0.0000361 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.537 | 0.0000436 |
|
||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.578 | 0.0000487 |
|
||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.453 | 0.0000655 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.767 | 0.0001192 |
|
||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.816 | 0.0001881 |
|
||||
|
||||
**best**
|
||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | 3.646 | 0.283 | 0.0000496 |
|
||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.543 | 0.0000436 |
|
||||
|
||||
### `2_frames_4_space`
|
||||
|
||||
**`pix_fmt`**
|
||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | yuv420p | 3.788 | 0.257 | 0.0000855 |
|
||||
| lerobot/pusht | yuv444p | 3.646 | 0.261 | 0.0000556 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 0.493 | 0.0000476 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.371 | 0.0000404 |
|
||||
|
||||
**`g`**
|
||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 1 | 2.543 | 0.226 | 0.0000670 |
|
||||
| lerobot/pusht | 2 | 3.646 | 0.222 | 0.0000556 |
|
||||
| lerobot/pusht | 3 | 4.431 | 0.217 | 0.0000567 |
|
||||
| lerobot/pusht | 4 | 5.103 | 0.204 | 0.0000555 |
|
||||
| lerobot/pusht | 5 | 5.625 | 0.179 | 0.0000556 |
|
||||
| lerobot/pusht | 6 | 5.974 | 0.188 | 0.0000544 |
|
||||
| lerobot/pusht | 10 | 6.814 | 0.160 | 0.0000531 |
|
||||
| lerobot/pusht | 15 | 7.431 | 0.150 | 0.0000521 |
|
||||
| lerobot/pusht | 20 | 7.662 | 0.123 | 0.0000519 |
|
||||
| lerobot/pusht | 40 | 8.163 | 0.092 | 0.0000519 |
|
||||
| lerobot/pusht | 100 | 8.761 | 0.053 | 0.0000533 |
|
||||
| lerobot/pusht | None | 8.909 | 0.034 | 0.0000541 |
|
||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.409 | 0.0000607 |
|
||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.381 | 0.0000404 |
|
||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.355 | 0.0000418 |
|
||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.346 | 0.0000425 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.354 | 0.0000419 |
|
||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.336 | 0.0000419 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.314 | 0.0000402 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.269 | 0.0000397 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.246 | 0.0000395 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.171 | 0.0000390 |
|
||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.091 | 0.0000399 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.043 | 0.0000409 |
|
||||
|
||||
**`crf`**
|
||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 0 | 1.699 | 0.212 | 0.0000193 |
|
||||
| lerobot/pusht | 5 | 1.409 | 0.211 | 0.0000232 |
|
||||
| lerobot/pusht | 10 | 1.842 | 0.199 | 0.0000270 |
|
||||
| lerobot/pusht | 15 | 2.322 | 0.198 | 0.0000347 |
|
||||
| lerobot/pusht | 20 | 3.050 | 0.211 | 0.0000469 |
|
||||
| lerobot/pusht | None | 3.646 | 0.206 | 0.0000556 |
|
||||
| lerobot/pusht | 25 | 3.969 | 0.210 | 0.0000626 |
|
||||
| lerobot/pusht | 30 | 5.687 | 0.223 | 0.0000927 |
|
||||
| lerobot/pusht | 40 | 10.818 | 0.227 | 0.0001763 |
|
||||
| lerobot/pusht | 50 | 18.185 | 0.223 | 0.0002625 |
|
||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.147 | 0.0000071 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.182 | 0.0000125 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.222 | 0.0000166 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.270 | 0.0000229 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.325 | 0.0000326 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.362 | 0.0000404 |
|
||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.390 | 0.0000459 |
|
||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 0.437 | 0.0000633 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 0.499 | 0.0001186 |
|
||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 0.564 | 0.0001879 |
|
||||
|
||||
**best**
|
||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | 3.646 | 0.224 | 0.0000556 |
|
||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.368 | 0.0000404 |
|
||||
|
||||
### `6_frames`
|
||||
|
||||
**`pix_fmt`**
|
||||
| repo_id | pix_fmt | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | yuv420p | 3.788 | 0.660 | 0.0000839 |
|
||||
| lerobot/pusht | yuv444p | 3.646 | 0.546 | 0.0000542 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv420p | 14.391 | 1.225 | 0.0000497 |
|
||||
| lerobot/umi_cup_in_the_wild | yuv444p | 14.932 | 0.908 | 0.0000428 |
|
||||
|
||||
**`g`**
|
||||
| repo_id | g | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 1 | 2.543 | 0.552 | 0.0000646 |
|
||||
| lerobot/pusht | 2 | 3.646 | 0.534 | 0.0000542 |
|
||||
| lerobot/pusht | 3 | 4.431 | 0.563 | 0.0000546 |
|
||||
| lerobot/pusht | 4 | 5.103 | 0.537 | 0.0000545 |
|
||||
| lerobot/pusht | 5 | 5.625 | 0.477 | 0.0000532 |
|
||||
| lerobot/pusht | 6 | 5.974 | 0.515 | 0.0000530 |
|
||||
| lerobot/pusht | 10 | 6.814 | 0.410 | 0.0000512 |
|
||||
| lerobot/pusht | 15 | 7.431 | 0.405 | 0.0000503 |
|
||||
| lerobot/pusht | 20 | 7.662 | 0.345 | 0.0000500 |
|
||||
| lerobot/pusht | 40 | 8.163 | 0.247 | 0.0000496 |
|
||||
| lerobot/pusht | 100 | 8.761 | 0.147 | 0.0000510 |
|
||||
| lerobot/pusht | None | 8.909 | 0.100 | 0.0000519 |
|
||||
| lerobot/umi_cup_in_the_wild | 1 | 14.411 | 0.997 | 0.0000620 |
|
||||
| lerobot/umi_cup_in_the_wild | 2 | 14.932 | 0.911 | 0.0000428 |
|
||||
| lerobot/umi_cup_in_the_wild | 3 | 20.174 | 0.869 | 0.0000433 |
|
||||
| lerobot/umi_cup_in_the_wild | 4 | 24.889 | 0.874 | 0.0000438 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 28.825 | 0.864 | 0.0000439 |
|
||||
| lerobot/umi_cup_in_the_wild | 6 | 31.635 | 0.834 | 0.0000440 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 39.418 | 0.781 | 0.0000421 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 44.577 | 0.679 | 0.0000411 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 47.907 | 0.652 | 0.0000410 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 52.554 | 0.465 | 0.0000404 |
|
||||
| lerobot/umi_cup_in_the_wild | 100 | 58.241 | 0.245 | 0.0000413 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 60.530 | 0.116 | 0.0000417 |
|
||||
|
||||
**`crf`**
|
||||
| repo_id | crf | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- | --- |
|
||||
| lerobot/pusht | 0 | 1.699 | 0.534 | 0.0000163 |
|
||||
| lerobot/pusht | 5 | 1.409 | 0.524 | 0.0000205 |
|
||||
| lerobot/pusht | 10 | 1.842 | 0.510 | 0.0000245 |
|
||||
| lerobot/pusht | 15 | 2.322 | 0.512 | 0.0000324 |
|
||||
| lerobot/pusht | 20 | 3.050 | 0.508 | 0.0000452 |
|
||||
| lerobot/pusht | None | 3.646 | 0.518 | 0.0000542 |
|
||||
| lerobot/pusht | 25 | 3.969 | 0.534 | 0.0000616 |
|
||||
| lerobot/pusht | 30 | 5.687 | 0.530 | 0.0000927 |
|
||||
| lerobot/pusht | 40 | 10.818 | 0.552 | 0.0001777 |
|
||||
| lerobot/pusht | 50 | 18.185 | 0.564 | 0.0002644 |
|
||||
| lerobot/umi_cup_in_the_wild | 0 | 1.918 | 0.401 | 0.0000101 |
|
||||
| lerobot/umi_cup_in_the_wild | 5 | 3.207 | 0.499 | 0.0000156 |
|
||||
| lerobot/umi_cup_in_the_wild | 10 | 4.818 | 0.599 | 0.0000197 |
|
||||
| lerobot/umi_cup_in_the_wild | 15 | 7.329 | 0.704 | 0.0000258 |
|
||||
| lerobot/umi_cup_in_the_wild | 20 | 11.361 | 0.834 | 0.0000352 |
|
||||
| lerobot/umi_cup_in_the_wild | None | 14.932 | 0.925 | 0.0000428 |
|
||||
| lerobot/umi_cup_in_the_wild | 25 | 17.741 | 0.978 | 0.0000480 |
|
||||
| lerobot/umi_cup_in_the_wild | 30 | 27.983 | 1.088 | 0.0000648 |
|
||||
| lerobot/umi_cup_in_the_wild | 40 | 82.449 | 1.324 | 0.0001190 |
|
||||
| lerobot/umi_cup_in_the_wild | 50 | 186.145 | 1.436 | 0.0001880 |
|
||||
|
||||
**best**
|
||||
| repo_id | compression_factor | load_time_factor | avg_per_pixel_l2_error |
|
||||
| --- | --- | --- | --- |
|
||||
| lerobot/pusht | 3.646 | 0.546 | 0.0000542 |
|
||||
| lerobot/umi_cup_in_the_wild | 14.932 | 0.934 | 0.0000428 |
|
||||
@@ -1,372 +0,0 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import json
|
||||
import random
|
||||
import shutil
|
||||
import subprocess
|
||||
import time
|
||||
from pathlib import Path
|
||||
|
||||
import einops
|
||||
import numpy
|
||||
import PIL
|
||||
import torch
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.video_utils import (
|
||||
decode_video_frames_torchvision,
|
||||
)
|
||||
|
||||
|
||||
def get_directory_size(directory):
|
||||
total_size = 0
|
||||
# Iterate over all files and subdirectories recursively
|
||||
for item in directory.rglob("*"):
|
||||
if item.is_file():
|
||||
# Add the file size to the total
|
||||
total_size += item.stat().st_size
|
||||
return total_size
|
||||
|
||||
|
||||
def run_video_benchmark(
|
||||
output_dir,
|
||||
cfg,
|
||||
timestamps_mode,
|
||||
seed=1337,
|
||||
):
|
||||
output_dir = Path(output_dir)
|
||||
if output_dir.exists():
|
||||
shutil.rmtree(output_dir)
|
||||
output_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
repo_id = cfg["repo_id"]
|
||||
|
||||
# TODO(rcadene): rewrite with hardcoding of original images and episodes
|
||||
dataset = LeRobotDataset(repo_id)
|
||||
|
||||
# Get fps
|
||||
fps = dataset.fps
|
||||
|
||||
# we only load first episode
|
||||
ep_num_images = dataset.episode_data_index["to"][0].item()
|
||||
|
||||
# Save/Load image directory for the first episode
|
||||
imgs_dir = Path(f"tmp/data/images/{repo_id}/observation.image_episode_000000")
|
||||
if not imgs_dir.exists():
|
||||
imgs_dir.mkdir(parents=True, exist_ok=True)
|
||||
hf_dataset = dataset.hf_dataset.with_format(None)
|
||||
imgs_dataset = hf_dataset.select_columns("observation.image")
|
||||
|
||||
for i, item in enumerate(imgs_dataset):
|
||||
img = item["observation.image"]
|
||||
img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
|
||||
|
||||
if i >= ep_num_images - 1:
|
||||
break
|
||||
|
||||
sum_original_frames_size_bytes = get_directory_size(imgs_dir)
|
||||
|
||||
# Encode images into video
|
||||
video_path = output_dir / "episode_0.mp4"
|
||||
|
||||
g = cfg.get("g")
|
||||
crf = cfg.get("crf")
|
||||
pix_fmt = cfg["pix_fmt"]
|
||||
|
||||
cmd = f"ffmpeg -r {fps} "
|
||||
cmd += "-f image2 "
|
||||
cmd += "-loglevel error "
|
||||
cmd += f"-i {str(imgs_dir / 'frame_%06d.png')} "
|
||||
cmd += "-vcodec libx264 "
|
||||
if g is not None:
|
||||
cmd += f"-g {g} " # ensures at least 1 keyframe every 10 frames
|
||||
# cmd += "-keyint_min 10 " set a minimum of 10 frames between 2 key frames
|
||||
# cmd += "-sc_threshold 0 " disable scene change detection to lower the number of key frames
|
||||
if crf is not None:
|
||||
cmd += f"-crf {crf} "
|
||||
cmd += f"-pix_fmt {pix_fmt} "
|
||||
cmd += f"{str(video_path)}"
|
||||
subprocess.run(cmd.split(" "), check=True)
|
||||
|
||||
video_size_bytes = video_path.stat().st_size
|
||||
|
||||
# Set decoder
|
||||
|
||||
decoder = cfg["decoder"]
|
||||
decoder_kwgs = cfg["decoder_kwgs"]
|
||||
device = cfg["device"]
|
||||
|
||||
if decoder == "torchvision":
|
||||
decode_frames_fn = decode_video_frames_torchvision
|
||||
else:
|
||||
raise ValueError(decoder)
|
||||
|
||||
# Estimate average loading time
|
||||
|
||||
def load_original_frames(imgs_dir, timestamps):
|
||||
frames = []
|
||||
for ts in timestamps:
|
||||
idx = int(ts * fps)
|
||||
frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
||||
frame = torch.from_numpy(numpy.array(frame))
|
||||
frame = frame.type(torch.float32) / 255
|
||||
frame = einops.rearrange(frame, "h w c -> c h w")
|
||||
frames.append(frame)
|
||||
return frames
|
||||
|
||||
list_avg_load_time = []
|
||||
list_avg_load_time_from_images = []
|
||||
per_pixel_l2_errors = []
|
||||
|
||||
random.seed(seed)
|
||||
|
||||
for t in range(50):
|
||||
# test loading 2 frames that are 4 frames appart, which might be a common setting
|
||||
ts = random.randint(fps, ep_num_images - fps) / fps
|
||||
|
||||
if timestamps_mode == "1_frame":
|
||||
timestamps = [ts]
|
||||
elif timestamps_mode == "2_frames":
|
||||
timestamps = [ts - 1 / fps, ts]
|
||||
elif timestamps_mode == "2_frames_4_space":
|
||||
timestamps = [ts - 4 / fps, ts]
|
||||
elif timestamps_mode == "6_frames":
|
||||
timestamps = [ts - i / fps for i in range(6)][::-1]
|
||||
else:
|
||||
raise ValueError(timestamps_mode)
|
||||
|
||||
num_frames = len(timestamps)
|
||||
|
||||
start_time_s = time.monotonic()
|
||||
frames = decode_frames_fn(
|
||||
video_path, timestamps=timestamps, tolerance_s=1e-4, device=device, **decoder_kwgs
|
||||
)
|
||||
avg_load_time = (time.monotonic() - start_time_s) / num_frames
|
||||
list_avg_load_time.append(avg_load_time)
|
||||
|
||||
start_time_s = time.monotonic()
|
||||
original_frames = load_original_frames(imgs_dir, timestamps)
|
||||
avg_load_time_from_images = (time.monotonic() - start_time_s) / num_frames
|
||||
list_avg_load_time_from_images.append(avg_load_time_from_images)
|
||||
|
||||
# Estimate average L2 error between original frames and decoded frames
|
||||
for i, ts in enumerate(timestamps):
|
||||
# are_close = torch.allclose(frames[i], original_frames[i], atol=0.02)
|
||||
num_pixels = original_frames[i].numel()
|
||||
per_pixel_l2_error = torch.norm(frames[i] - original_frames[i], p=2).item() / num_pixels
|
||||
|
||||
# save decoded frames
|
||||
if t == 0:
|
||||
frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
|
||||
PIL.Image.fromarray(frame_hwc).save(output_dir / f"frame_{i:06d}.png")
|
||||
|
||||
# save original_frames
|
||||
idx = int(ts * fps)
|
||||
if t == 0:
|
||||
original_frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
|
||||
original_frame.save(output_dir / f"original_frame_{i:06d}.png")
|
||||
|
||||
per_pixel_l2_errors.append(per_pixel_l2_error)
|
||||
|
||||
avg_load_time = float(numpy.array(list_avg_load_time).mean())
|
||||
avg_load_time_from_images = float(numpy.array(list_avg_load_time_from_images).mean())
|
||||
avg_per_pixel_l2_error = float(numpy.array(per_pixel_l2_errors).mean())
|
||||
|
||||
# Save benchmark info
|
||||
|
||||
info = {
|
||||
"sum_original_frames_size_bytes": sum_original_frames_size_bytes,
|
||||
"video_size_bytes": video_size_bytes,
|
||||
"avg_load_time_from_images": avg_load_time_from_images,
|
||||
"avg_load_time": avg_load_time,
|
||||
"compression_factor": sum_original_frames_size_bytes / video_size_bytes,
|
||||
"load_time_factor": avg_load_time_from_images / avg_load_time,
|
||||
"avg_per_pixel_l2_error": avg_per_pixel_l2_error,
|
||||
}
|
||||
|
||||
with open(output_dir / "info.json", "w") as f:
|
||||
json.dump(info, f)
|
||||
|
||||
return info
|
||||
|
||||
|
||||
def display_markdown_table(headers, rows):
|
||||
for i, row in enumerate(rows):
|
||||
new_row = []
|
||||
for col in row:
|
||||
if col is None:
|
||||
new_col = "None"
|
||||
elif isinstance(col, float):
|
||||
new_col = f"{col:.3f}"
|
||||
if new_col == "0.000":
|
||||
new_col = f"{col:.7f}"
|
||||
elif isinstance(col, int):
|
||||
new_col = f"{col}"
|
||||
else:
|
||||
new_col = col
|
||||
new_row.append(new_col)
|
||||
rows[i] = new_row
|
||||
|
||||
header_line = "| " + " | ".join(headers) + " |"
|
||||
separator_line = "| " + " | ".join(["---" for _ in headers]) + " |"
|
||||
body_lines = ["| " + " | ".join(row) + " |" for row in rows]
|
||||
markdown_table = "\n".join([header_line, separator_line] + body_lines)
|
||||
print(markdown_table)
|
||||
print()
|
||||
|
||||
|
||||
def load_info(out_dir):
|
||||
with open(out_dir / "info.json") as f:
|
||||
info = json.load(f)
|
||||
return info
|
||||
|
||||
|
||||
def main():
|
||||
out_dir = Path("tmp/run_video_benchmark")
|
||||
dry_run = False
|
||||
repo_ids = ["lerobot/pusht", "lerobot/umi_cup_in_the_wild"]
|
||||
timestamps_modes = [
|
||||
"1_frame",
|
||||
"2_frames",
|
||||
"2_frames_4_space",
|
||||
"6_frames",
|
||||
]
|
||||
for timestamps_mode in timestamps_modes:
|
||||
bench_dir = out_dir / timestamps_mode
|
||||
|
||||
print(f"### `{timestamps_mode}`")
|
||||
print()
|
||||
|
||||
print("**`pix_fmt`**")
|
||||
headers = ["repo_id", "pix_fmt", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
||||
rows = []
|
||||
for repo_id in repo_ids:
|
||||
for pix_fmt in ["yuv420p", "yuv444p"]:
|
||||
cfg = {
|
||||
"repo_id": repo_id,
|
||||
# video encoding
|
||||
"g": 2,
|
||||
"crf": None,
|
||||
"pix_fmt": pix_fmt,
|
||||
# video decoding
|
||||
"device": "cpu",
|
||||
"decoder": "torchvision",
|
||||
"decoder_kwgs": {},
|
||||
}
|
||||
if not dry_run:
|
||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_{pix_fmt}", cfg, timestamps_mode)
|
||||
info = load_info(bench_dir / repo_id / f"torchvision_{pix_fmt}")
|
||||
rows.append(
|
||||
[
|
||||
repo_id,
|
||||
pix_fmt,
|
||||
info["compression_factor"],
|
||||
info["load_time_factor"],
|
||||
info["avg_per_pixel_l2_error"],
|
||||
]
|
||||
)
|
||||
display_markdown_table(headers, rows)
|
||||
|
||||
print("**`g`**")
|
||||
headers = ["repo_id", "g", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
||||
rows = []
|
||||
for repo_id in repo_ids:
|
||||
for g in [1, 2, 3, 4, 5, 6, 10, 15, 20, 40, 100, None]:
|
||||
cfg = {
|
||||
"repo_id": repo_id,
|
||||
# video encoding
|
||||
"g": g,
|
||||
"pix_fmt": "yuv444p",
|
||||
# video decoding
|
||||
"device": "cpu",
|
||||
"decoder": "torchvision",
|
||||
"decoder_kwgs": {},
|
||||
}
|
||||
if not dry_run:
|
||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_g_{g}", cfg, timestamps_mode)
|
||||
info = load_info(bench_dir / repo_id / f"torchvision_g_{g}")
|
||||
rows.append(
|
||||
[
|
||||
repo_id,
|
||||
g,
|
||||
info["compression_factor"],
|
||||
info["load_time_factor"],
|
||||
info["avg_per_pixel_l2_error"],
|
||||
]
|
||||
)
|
||||
display_markdown_table(headers, rows)
|
||||
|
||||
print("**`crf`**")
|
||||
headers = ["repo_id", "crf", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
||||
rows = []
|
||||
for repo_id in repo_ids:
|
||||
for crf in [0, 5, 10, 15, 20, None, 25, 30, 40, 50]:
|
||||
cfg = {
|
||||
"repo_id": repo_id,
|
||||
# video encoding
|
||||
"g": 2,
|
||||
"crf": crf,
|
||||
"pix_fmt": "yuv444p",
|
||||
# video decoding
|
||||
"device": "cpu",
|
||||
"decoder": "torchvision",
|
||||
"decoder_kwgs": {},
|
||||
}
|
||||
if not dry_run:
|
||||
run_video_benchmark(bench_dir / repo_id / f"torchvision_crf_{crf}", cfg, timestamps_mode)
|
||||
info = load_info(bench_dir / repo_id / f"torchvision_crf_{crf}")
|
||||
rows.append(
|
||||
[
|
||||
repo_id,
|
||||
crf,
|
||||
info["compression_factor"],
|
||||
info["load_time_factor"],
|
||||
info["avg_per_pixel_l2_error"],
|
||||
]
|
||||
)
|
||||
display_markdown_table(headers, rows)
|
||||
|
||||
print("**best**")
|
||||
headers = ["repo_id", "compression_factor", "load_time_factor", "avg_per_pixel_l2_error"]
|
||||
rows = []
|
||||
for repo_id in repo_ids:
|
||||
cfg = {
|
||||
"repo_id": repo_id,
|
||||
# video encoding
|
||||
"g": 2,
|
||||
"crf": None,
|
||||
"pix_fmt": "yuv444p",
|
||||
# video decoding
|
||||
"device": "cpu",
|
||||
"decoder": "torchvision",
|
||||
"decoder_kwgs": {},
|
||||
}
|
||||
if not dry_run:
|
||||
run_video_benchmark(bench_dir / repo_id / "torchvision_best", cfg, timestamps_mode)
|
||||
info = load_info(bench_dir / repo_id / "torchvision_best")
|
||||
rows.append(
|
||||
[
|
||||
repo_id,
|
||||
info["compression_factor"],
|
||||
info["load_time_factor"],
|
||||
info["avg_per_pixel_l2_error"],
|
||||
]
|
||||
)
|
||||
display_markdown_table(headers, rows)
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
main()
|
||||
@@ -16,17 +16,15 @@
|
||||
from copy import deepcopy
|
||||
from math import ceil
|
||||
|
||||
import datasets
|
||||
import einops
|
||||
import torch
|
||||
import tqdm
|
||||
from datasets import Image
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.video_utils import VideoFrame
|
||||
|
||||
|
||||
def get_stats_einops_patterns(dataset: LeRobotDataset | datasets.Dataset, num_workers=0):
|
||||
def get_stats_einops_patterns(dataset, num_workers=0):
|
||||
"""These einops patterns will be used to aggregate batches and compute statistics.
|
||||
|
||||
Note: We assume the images are in channel first format
|
||||
@@ -45,6 +43,10 @@ def get_stats_einops_patterns(dataset: LeRobotDataset | datasets.Dataset, num_wo
|
||||
# sanity check that tensors are not float64
|
||||
assert batch[key].dtype != torch.float64
|
||||
|
||||
# NOTE: skip language_instruction embedding in stats computation
|
||||
if key == "language_instruction":
|
||||
continue
|
||||
|
||||
if isinstance(feats_type, (VideoFrame, Image)):
|
||||
# sanity check that images are channel first
|
||||
_, c, h, w = batch[key].shape
|
||||
@@ -66,9 +68,8 @@ def get_stats_einops_patterns(dataset: LeRobotDataset | datasets.Dataset, num_wo
|
||||
return stats_patterns
|
||||
|
||||
|
||||
def compute_stats(
|
||||
dataset: LeRobotDataset | datasets.Dataset, batch_size=32, num_workers=16, max_num_samples=None
|
||||
):
|
||||
def compute_stats(dataset, batch_size=32, num_workers=16, max_num_samples=None):
|
||||
"""Compute mean/std and min/max statistics of all data keys in a LeRobotDataset."""
|
||||
if max_num_samples is None:
|
||||
max_num_samples = len(dataset)
|
||||
|
||||
@@ -159,3 +160,54 @@ def compute_stats(
|
||||
"min": min[key],
|
||||
}
|
||||
return stats
|
||||
|
||||
|
||||
def aggregate_stats(ls_datasets) -> dict[str, torch.Tensor]:
|
||||
"""Aggregate stats of multiple LeRobot datasets into one set of stats without recomputing from scratch.
|
||||
|
||||
The final stats will have the union of all data keys from each of the datasets.
|
||||
|
||||
The final stats will have the union of all data keys from each of the datasets. For instance:
|
||||
- new_max = max(max_dataset_0, max_dataset_1, ...)
|
||||
- new_min = min(min_dataset_0, min_dataset_1, ...)
|
||||
- new_mean = (mean of all data)
|
||||
- new_std = (std of all data)
|
||||
"""
|
||||
data_keys = set()
|
||||
for dataset in ls_datasets:
|
||||
data_keys.update(dataset.stats.keys())
|
||||
stats = {k: {} for k in data_keys}
|
||||
for data_key in data_keys:
|
||||
for stat_key in ["min", "max"]:
|
||||
# compute `max(dataset_0["max"], dataset_1["max"], ...)`
|
||||
stats[data_key][stat_key] = einops.reduce(
|
||||
torch.stack([d.stats[data_key][stat_key] for d in ls_datasets if data_key in d.stats], dim=0),
|
||||
"n ... -> ...",
|
||||
stat_key,
|
||||
)
|
||||
total_samples = sum(d.num_samples for d in ls_datasets if data_key in d.stats)
|
||||
# Compute the "sum" statistic by multiplying each mean by the number of samples in the respective
|
||||
# dataset, then divide by total_samples to get the overall "mean".
|
||||
# NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
|
||||
# numerical overflow!
|
||||
stats[data_key]["mean"] = sum(
|
||||
d.stats[data_key]["mean"] * (d.num_samples / total_samples)
|
||||
for d in ls_datasets
|
||||
if data_key in d.stats
|
||||
)
|
||||
# The derivation for standard deviation is a little more involved but is much in the same spirit as
|
||||
# the computation of the mean.
|
||||
# Given two sets of data where the statistics are known:
|
||||
# σ_combined = sqrt[ (n1 * (σ1^2 + d1^2) + n2 * (σ2^2 + d2^2)) / (n1 + n2) ]
|
||||
# where d1 = μ1 - μ_combined, d2 = μ2 - μ_combined
|
||||
# NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
|
||||
# numerical overflow!
|
||||
stats[data_key]["std"] = torch.sqrt(
|
||||
sum(
|
||||
(d.stats[data_key]["std"] ** 2 + (d.stats[data_key]["mean"] - stats[data_key]["mean"]) ** 2)
|
||||
* (d.num_samples / total_samples)
|
||||
for d in ls_datasets
|
||||
if data_key in d.stats
|
||||
)
|
||||
)
|
||||
return stats
|
||||
@@ -16,34 +16,96 @@
|
||||
import logging
|
||||
|
||||
import torch
|
||||
from omegaconf import OmegaConf
|
||||
from omegaconf import ListConfig, OmegaConf
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, MultiLeRobotDataset
|
||||
from lerobot.common.datasets.transforms import get_image_transforms
|
||||
|
||||
|
||||
def make_dataset(
|
||||
cfg,
|
||||
split="train",
|
||||
):
|
||||
if cfg.env.name not in cfg.dataset_repo_id:
|
||||
logging.warning(
|
||||
f"There might be a mismatch between your training dataset ({cfg.dataset_repo_id=}) and your "
|
||||
f"environment ({cfg.env.name=})."
|
||||
)
|
||||
def resolve_delta_timestamps(cfg):
|
||||
"""Resolves delta_timestamps config key (in-place) by using `eval`.
|
||||
|
||||
Doesn't do anything if delta_timestamps is not specified or has already been resolve (as evidenced by
|
||||
the data type of its values).
|
||||
"""
|
||||
delta_timestamps = cfg.training.get("delta_timestamps")
|
||||
if delta_timestamps is not None:
|
||||
for key in delta_timestamps:
|
||||
if isinstance(delta_timestamps[key], str):
|
||||
delta_timestamps[key] = eval(delta_timestamps[key])
|
||||
# TODO(rcadene, alexander-soare): remove `eval` to avoid exploit
|
||||
cfg.training.delta_timestamps[key] = eval(delta_timestamps[key])
|
||||
|
||||
# TODO(rcadene): add data augmentations
|
||||
|
||||
dataset = LeRobotDataset(
|
||||
cfg.dataset_repo_id,
|
||||
split=split,
|
||||
delta_timestamps=delta_timestamps,
|
||||
)
|
||||
def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotDataset:
|
||||
"""
|
||||
Args:
|
||||
cfg: A Hydra config as per the LeRobot config scheme.
|
||||
split: Select the data subset used to create an instance of LeRobotDataset.
|
||||
All datasets hosted on [lerobot](https://huggingface.co/lerobot) contain only one subset: "train".
|
||||
Thus, by default, `split="train"` selects all the available data. `split` aims to work like the
|
||||
slicer in the hugging face datasets:
|
||||
https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
|
||||
As of now, it only supports `split="train[:n]"` to load the first n frames of the dataset or
|
||||
`split="train[n:]"` to load the last n frames. For instance `split="train[:1000]"`.
|
||||
Returns:
|
||||
The LeRobotDataset.
|
||||
"""
|
||||
if not isinstance(cfg.dataset_repo_id, (str, ListConfig)):
|
||||
raise ValueError(
|
||||
"Expected cfg.dataset_repo_id to be either a single string to load one dataset or a list of "
|
||||
"strings to load multiple datasets."
|
||||
)
|
||||
|
||||
# A soft check to warn if the environment matches the dataset. Don't check if we are using a real world env (dora).
|
||||
if cfg.env.name != "dora":
|
||||
if isinstance(cfg.dataset_repo_id, str):
|
||||
dataset_repo_ids = [cfg.dataset_repo_id] # single dataset
|
||||
else:
|
||||
dataset_repo_ids = cfg.dataset_repo_id # multiple datasets
|
||||
|
||||
for dataset_repo_id in dataset_repo_ids:
|
||||
if cfg.env.name not in dataset_repo_id:
|
||||
logging.warning(
|
||||
f"There might be a mismatch between your training dataset ({dataset_repo_id=}) and your "
|
||||
f"environment ({cfg.env.name=})."
|
||||
)
|
||||
|
||||
resolve_delta_timestamps(cfg)
|
||||
|
||||
image_transforms = None
|
||||
if cfg.training.image_transforms.enable:
|
||||
cfg_tf = cfg.training.image_transforms
|
||||
image_transforms = get_image_transforms(
|
||||
brightness_weight=cfg_tf.brightness.weight,
|
||||
brightness_min_max=cfg_tf.brightness.min_max,
|
||||
contrast_weight=cfg_tf.contrast.weight,
|
||||
contrast_min_max=cfg_tf.contrast.min_max,
|
||||
saturation_weight=cfg_tf.saturation.weight,
|
||||
saturation_min_max=cfg_tf.saturation.min_max,
|
||||
hue_weight=cfg_tf.hue.weight,
|
||||
hue_min_max=cfg_tf.hue.min_max,
|
||||
sharpness_weight=cfg_tf.sharpness.weight,
|
||||
sharpness_min_max=cfg_tf.sharpness.min_max,
|
||||
max_num_transforms=cfg_tf.max_num_transforms,
|
||||
random_order=cfg_tf.random_order,
|
||||
)
|
||||
|
||||
if isinstance(cfg.dataset_repo_id, str):
|
||||
dataset = LeRobotDataset(
|
||||
cfg.dataset_repo_id,
|
||||
split=split,
|
||||
delta_timestamps=cfg.training.get("delta_timestamps"),
|
||||
image_transforms=image_transforms,
|
||||
video_backend=cfg.video_backend,
|
||||
)
|
||||
else:
|
||||
dataset = MultiLeRobotDataset(
|
||||
cfg.dataset_repo_id,
|
||||
split=split,
|
||||
delta_timestamps=cfg.training.get("delta_timestamps"),
|
||||
image_transforms=image_transforms,
|
||||
video_backend=cfg.video_backend,
|
||||
)
|
||||
|
||||
if cfg.get("override_dataset_stats"):
|
||||
for key, stats_dict in cfg.override_dataset_stats.items():
|
||||
|
||||
@@ -13,12 +13,16 @@
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import logging
|
||||
import os
|
||||
from pathlib import Path
|
||||
from typing import Callable
|
||||
|
||||
import datasets
|
||||
import torch
|
||||
import torch.utils
|
||||
|
||||
from lerobot.common.datasets.compute_stats import aggregate_stats
|
||||
from lerobot.common.datasets.utils import (
|
||||
calculate_episode_data_index,
|
||||
load_episode_data_index,
|
||||
@@ -32,7 +36,7 @@ from lerobot.common.datasets.utils import (
|
||||
from lerobot.common.datasets.video_utils import VideoFrame, load_from_videos
|
||||
|
||||
DATA_DIR = Path(os.environ["DATA_DIR"]) if "DATA_DIR" in os.environ else None
|
||||
CODEBASE_VERSION = "v1.4"
|
||||
CODEBASE_VERSION = "v1.5"
|
||||
|
||||
|
||||
class LeRobotDataset(torch.utils.data.Dataset):
|
||||
@@ -42,15 +46,16 @@ class LeRobotDataset(torch.utils.data.Dataset):
|
||||
version: str | None = CODEBASE_VERSION,
|
||||
root: Path | None = DATA_DIR,
|
||||
split: str = "train",
|
||||
transform: callable = None,
|
||||
image_transforms: Callable | None = None,
|
||||
delta_timestamps: dict[list[float]] | None = None,
|
||||
video_backend: str | None = None,
|
||||
):
|
||||
super().__init__()
|
||||
self.repo_id = repo_id
|
||||
self.version = version
|
||||
self.root = root
|
||||
self.split = split
|
||||
self.transform = transform
|
||||
self.image_transforms = image_transforms
|
||||
self.delta_timestamps = delta_timestamps
|
||||
# load data from hub or locally when root is provided
|
||||
# TODO(rcadene, aliberts): implement faster transfer
|
||||
@@ -65,6 +70,7 @@ class LeRobotDataset(torch.utils.data.Dataset):
|
||||
self.info = load_info(repo_id, version, root)
|
||||
if self.video:
|
||||
self.videos_dir = load_videos(repo_id, version, root)
|
||||
self.video_backend = video_backend if video_backend is not None else "pyav"
|
||||
|
||||
@property
|
||||
def fps(self) -> int:
|
||||
@@ -145,10 +151,12 @@ class LeRobotDataset(torch.utils.data.Dataset):
|
||||
self.video_frame_keys,
|
||||
self.videos_dir,
|
||||
self.tolerance_s,
|
||||
self.video_backend,
|
||||
)
|
||||
|
||||
if self.transform is not None:
|
||||
item = self.transform(item)
|
||||
if self.image_transforms is not None:
|
||||
for cam in self.camera_keys:
|
||||
item[cam] = self.image_transforms(item[cam])
|
||||
|
||||
return item
|
||||
|
||||
@@ -164,14 +172,14 @@ class LeRobotDataset(torch.utils.data.Dataset):
|
||||
f" Recorded Frames per Second: {self.fps},\n"
|
||||
f" Camera Keys: {self.camera_keys},\n"
|
||||
f" Video Frame Keys: {self.video_frame_keys if self.video else 'N/A'},\n"
|
||||
f" Transformations: {self.transform},\n"
|
||||
f" Transformations: {self.image_transforms},\n"
|
||||
f")"
|
||||
)
|
||||
|
||||
@classmethod
|
||||
def from_preloaded(
|
||||
cls,
|
||||
repo_id: str,
|
||||
repo_id: str = "from_preloaded",
|
||||
version: str | None = CODEBASE_VERSION,
|
||||
root: Path | None = None,
|
||||
split: str = "train",
|
||||
@@ -183,18 +191,218 @@ class LeRobotDataset(torch.utils.data.Dataset):
|
||||
stats=None,
|
||||
info=None,
|
||||
videos_dir=None,
|
||||
):
|
||||
video_backend=None,
|
||||
) -> "LeRobotDataset":
|
||||
"""Create a LeRobot Dataset from existing data and attributes instead of loading from the filesystem.
|
||||
|
||||
It is especially useful when converting raw data into LeRobotDataset before saving the dataset
|
||||
on the filesystem or uploading to the hub.
|
||||
|
||||
Note: Meta-data attributes like `repo_id`, `version`, `root`, etc are optional and potentially
|
||||
meaningless depending on the downstream usage of the return dataset.
|
||||
"""
|
||||
# create an empty object of type LeRobotDataset
|
||||
obj = cls.__new__(cls)
|
||||
obj.repo_id = repo_id
|
||||
obj.version = version
|
||||
obj.root = root
|
||||
obj.split = split
|
||||
obj.transform = transform
|
||||
obj.image_transforms = transform
|
||||
obj.delta_timestamps = delta_timestamps
|
||||
obj.hf_dataset = hf_dataset
|
||||
obj.episode_data_index = episode_data_index
|
||||
obj.stats = stats
|
||||
obj.info = info
|
||||
obj.info = info if info is not None else {}
|
||||
obj.videos_dir = videos_dir
|
||||
obj.video_backend = video_backend if video_backend is not None else "pyav"
|
||||
return obj
|
||||
|
||||
|
||||
class MultiLeRobotDataset(torch.utils.data.Dataset):
|
||||
"""A dataset consisting of multiple underlying `LeRobotDataset`s.
|
||||
|
||||
The underlying `LeRobotDataset`s are effectively concatenated, and this class adopts much of the API
|
||||
structure of `LeRobotDataset`.
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
repo_ids: list[str],
|
||||
version: str | None = CODEBASE_VERSION,
|
||||
root: Path | None = DATA_DIR,
|
||||
split: str = "train",
|
||||
image_transforms: Callable | None = None,
|
||||
delta_timestamps: dict[list[float]] | None = None,
|
||||
video_backend: str | None = None,
|
||||
):
|
||||
super().__init__()
|
||||
self.repo_ids = repo_ids
|
||||
# Construct the underlying datasets passing everything but `transform` and `delta_timestamps` which
|
||||
# are handled by this class.
|
||||
self._datasets = [
|
||||
LeRobotDataset(
|
||||
repo_id,
|
||||
version=version,
|
||||
root=root,
|
||||
split=split,
|
||||
delta_timestamps=delta_timestamps,
|
||||
image_transforms=image_transforms,
|
||||
video_backend=video_backend,
|
||||
)
|
||||
for repo_id in repo_ids
|
||||
]
|
||||
# Check that some properties are consistent across datasets. Note: We may relax some of these
|
||||
# consistency requirements in future iterations of this class.
|
||||
for repo_id, dataset in zip(self.repo_ids, self._datasets, strict=True):
|
||||
if dataset.info != self._datasets[0].info:
|
||||
raise ValueError(
|
||||
f"Detected a mismatch in dataset info between {self.repo_ids[0]} and {repo_id}. This is "
|
||||
"not yet supported."
|
||||
)
|
||||
# Disable any data keys that are not common across all of the datasets. Note: we may relax this
|
||||
# restriction in future iterations of this class. For now, this is necessary at least for being able
|
||||
# to use PyTorch's default DataLoader collate function.
|
||||
self.disabled_data_keys = set()
|
||||
intersection_data_keys = set(self._datasets[0].hf_dataset.features)
|
||||
for dataset in self._datasets:
|
||||
intersection_data_keys.intersection_update(dataset.hf_dataset.features)
|
||||
if len(intersection_data_keys) == 0:
|
||||
raise RuntimeError(
|
||||
"Multiple datasets were provided but they had no keys common to all of them. The "
|
||||
"multi-dataset functionality currently only keeps common keys."
|
||||
)
|
||||
for repo_id, dataset in zip(self.repo_ids, self._datasets, strict=True):
|
||||
extra_keys = set(dataset.hf_dataset.features).difference(intersection_data_keys)
|
||||
logging.warning(
|
||||
f"keys {extra_keys} of {repo_id} were disabled as they are not contained in all the "
|
||||
"other datasets."
|
||||
)
|
||||
self.disabled_data_keys.update(extra_keys)
|
||||
|
||||
self.version = version
|
||||
self.root = root
|
||||
self.split = split
|
||||
self.image_transforms = image_transforms
|
||||
self.delta_timestamps = delta_timestamps
|
||||
self.stats = aggregate_stats(self._datasets)
|
||||
|
||||
@property
|
||||
def repo_id_to_index(self):
|
||||
"""Return a mapping from dataset repo_id to a dataset index automatically created by this class.
|
||||
|
||||
This index is incorporated as a data key in the dictionary returned by `__getitem__`.
|
||||
"""
|
||||
return {repo_id: i for i, repo_id in enumerate(self.repo_ids)}
|
||||
|
||||
@property
|
||||
def repo_index_to_id(self):
|
||||
"""Return the inverse mapping if repo_id_to_index."""
|
||||
return {v: k for k, v in self.repo_id_to_index}
|
||||
|
||||
@property
|
||||
def fps(self) -> int:
|
||||
"""Frames per second used during data collection.
|
||||
|
||||
NOTE: Fow now, this relies on a check in __init__ to make sure all sub-datasets have the same info.
|
||||
"""
|
||||
return self._datasets[0].info["fps"]
|
||||
|
||||
@property
|
||||
def video(self) -> bool:
|
||||
"""Returns True if this dataset loads video frames from mp4 files.
|
||||
|
||||
Returns False if it only loads images from png files.
|
||||
|
||||
NOTE: Fow now, this relies on a check in __init__ to make sure all sub-datasets have the same info.
|
||||
"""
|
||||
return self._datasets[0].info.get("video", False)
|
||||
|
||||
@property
|
||||
def features(self) -> datasets.Features:
|
||||
features = {}
|
||||
for dataset in self._datasets:
|
||||
features.update({k: v for k, v in dataset.features.items() if k not in self.disabled_data_keys})
|
||||
return features
|
||||
|
||||
@property
|
||||
def camera_keys(self) -> list[str]:
|
||||
"""Keys to access image and video stream from cameras."""
|
||||
keys = []
|
||||
for key, feats in self.features.items():
|
||||
if isinstance(feats, (datasets.Image, VideoFrame)):
|
||||
keys.append(key)
|
||||
return keys
|
||||
|
||||
@property
|
||||
def video_frame_keys(self) -> list[str]:
|
||||
"""Keys to access video frames that requires to be decoded into images.
|
||||
|
||||
Note: It is empty if the dataset contains images only,
|
||||
or equal to `self.cameras` if the dataset contains videos only,
|
||||
or can even be a subset of `self.cameras` in a case of a mixed image/video dataset.
|
||||
"""
|
||||
video_frame_keys = []
|
||||
for key, feats in self.features.items():
|
||||
if isinstance(feats, VideoFrame):
|
||||
video_frame_keys.append(key)
|
||||
return video_frame_keys
|
||||
|
||||
@property
|
||||
def num_samples(self) -> int:
|
||||
"""Number of samples/frames."""
|
||||
return sum(d.num_samples for d in self._datasets)
|
||||
|
||||
@property
|
||||
def num_episodes(self) -> int:
|
||||
"""Number of episodes."""
|
||||
return sum(d.num_episodes for d in self._datasets)
|
||||
|
||||
@property
|
||||
def tolerance_s(self) -> float:
|
||||
"""Tolerance in seconds used to discard loaded frames when their timestamps
|
||||
are not close enough from the requested frames. It is only used when `delta_timestamps`
|
||||
is provided or when loading video frames from mp4 files.
|
||||
"""
|
||||
# 1e-4 to account for possible numerical error
|
||||
return 1 / self.fps - 1e-4
|
||||
|
||||
def __len__(self):
|
||||
return self.num_samples
|
||||
|
||||
def __getitem__(self, idx: int) -> dict[str, torch.Tensor]:
|
||||
if idx >= len(self):
|
||||
raise IndexError(f"Index {idx} out of bounds.")
|
||||
# Determine which dataset to get an item from based on the index.
|
||||
start_idx = 0
|
||||
dataset_idx = 0
|
||||
for dataset in self._datasets:
|
||||
if idx >= start_idx + dataset.num_samples:
|
||||
start_idx += dataset.num_samples
|
||||
dataset_idx += 1
|
||||
continue
|
||||
break
|
||||
else:
|
||||
raise AssertionError("We expect the loop to break out as long as the index is within bounds.")
|
||||
item = self._datasets[dataset_idx][idx - start_idx]
|
||||
item["dataset_index"] = torch.tensor(dataset_idx)
|
||||
for data_key in self.disabled_data_keys:
|
||||
if data_key in item:
|
||||
del item[data_key]
|
||||
|
||||
return item
|
||||
|
||||
def __repr__(self):
|
||||
return (
|
||||
f"{self.__class__.__name__}(\n"
|
||||
f" Repository IDs: '{self.repo_ids}',\n"
|
||||
f" Version: '{self.version}',\n"
|
||||
f" Split: '{self.split}',\n"
|
||||
f" Number of Samples: {self.num_samples},\n"
|
||||
f" Number of Episodes: {self.num_episodes},\n"
|
||||
f" Type: {'video (.mp4)' if self.video else 'image (.png)'},\n"
|
||||
f" Recorded Frames per Second: {self.fps},\n"
|
||||
f" Camera Keys: {self.camera_keys},\n"
|
||||
f" Video Frame Keys: {self.video_frame_keys if self.video else 'N/A'},\n"
|
||||
f" Transformations: {self.image_transforms},\n"
|
||||
f")"
|
||||
)
|
||||
|
||||
@@ -14,156 +14,119 @@
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""
|
||||
This file contains all obsolete download scripts. They are centralized here to not have to load
|
||||
useless dependencies when using datasets.
|
||||
This file contains download scripts for raw datasets.
|
||||
|
||||
Example of usage:
|
||||
```
|
||||
python lerobot/common/datasets/push_dataset_to_hub/_download_raw.py \
|
||||
--raw-dir data/cadene/pusht_raw \
|
||||
--repo-id cadene/pusht_raw
|
||||
```
|
||||
"""
|
||||
|
||||
import io
|
||||
import argparse
|
||||
import logging
|
||||
import shutil
|
||||
import warnings
|
||||
from pathlib import Path
|
||||
|
||||
import tqdm
|
||||
from huggingface_hub import snapshot_download
|
||||
|
||||
|
||||
def download_raw(raw_dir, dataset_id):
|
||||
if "aloha" in dataset_id or "image" in dataset_id:
|
||||
download_hub(raw_dir, dataset_id)
|
||||
elif "pusht" in dataset_id:
|
||||
download_pusht(raw_dir)
|
||||
elif "xarm" in dataset_id:
|
||||
download_xarm(raw_dir)
|
||||
elif "umi" in dataset_id:
|
||||
download_umi(raw_dir)
|
||||
else:
|
||||
raise ValueError(dataset_id)
|
||||
def download_raw(raw_dir: Path, repo_id: str):
|
||||
# Check repo_id is well formated
|
||||
if len(repo_id.split("/")) != 2:
|
||||
raise ValueError(
|
||||
f"`repo_id` is expected to contain a community or user id `/` the name of the dataset (e.g. 'lerobot/pusht'), but contains '{repo_id}'."
|
||||
)
|
||||
user_id, dataset_id = repo_id.split("/")
|
||||
|
||||
|
||||
def download_and_extract_zip(url: str, destination_folder: Path) -> bool:
|
||||
import zipfile
|
||||
|
||||
import requests
|
||||
|
||||
print(f"downloading from {url}")
|
||||
response = requests.get(url, stream=True)
|
||||
if response.status_code == 200:
|
||||
total_size = int(response.headers.get("content-length", 0))
|
||||
progress_bar = tqdm.tqdm(total=total_size, unit="B", unit_scale=True)
|
||||
|
||||
zip_file = io.BytesIO()
|
||||
for chunk in response.iter_content(chunk_size=1024):
|
||||
if chunk:
|
||||
zip_file.write(chunk)
|
||||
progress_bar.update(len(chunk))
|
||||
|
||||
progress_bar.close()
|
||||
|
||||
zip_file.seek(0)
|
||||
|
||||
with zipfile.ZipFile(zip_file, "r") as zip_ref:
|
||||
zip_ref.extractall(destination_folder)
|
||||
|
||||
|
||||
def download_pusht(raw_dir: str):
|
||||
pusht_url = "https://diffusion-policy.cs.columbia.edu/data/training/pusht.zip"
|
||||
if not dataset_id.endswith("_raw"):
|
||||
warnings.warn(
|
||||
f"`dataset_id` ({dataset_id}) doesn't end with '_raw' (e.g. 'lerobot/pusht_raw'). Following this naming convention by renaming your repository is advised, but not mandatory.",
|
||||
stacklevel=1,
|
||||
)
|
||||
|
||||
raw_dir = Path(raw_dir)
|
||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||
download_and_extract_zip(pusht_url, raw_dir)
|
||||
# file is created inside a useful "pusht" directory, so we move it out and delete the dir
|
||||
zarr_path = raw_dir / "pusht_cchi_v7_replay.zarr"
|
||||
shutil.move(raw_dir / "pusht" / "pusht_cchi_v7_replay.zarr", zarr_path)
|
||||
shutil.rmtree(raw_dir / "pusht")
|
||||
|
||||
|
||||
def download_xarm(raw_dir: Path):
|
||||
"""Download all xarm datasets at once"""
|
||||
import zipfile
|
||||
|
||||
import gdown
|
||||
|
||||
raw_dir = Path(raw_dir)
|
||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||
# from https://github.com/fyhMer/fowm/blob/main/scripts/download_datasets.py
|
||||
url = "https://drive.google.com/uc?id=1nhxpykGtPDhmQKm-_B8zBSywVRdgeVya"
|
||||
zip_path = raw_dir / "data.zip"
|
||||
gdown.download(url, str(zip_path), quiet=False)
|
||||
print("Extracting...")
|
||||
with zipfile.ZipFile(str(zip_path), "r") as zip_f:
|
||||
for pkl_path in zip_f.namelist():
|
||||
if pkl_path.startswith("data/xarm") and pkl_path.endswith(".pkl"):
|
||||
zip_f.extract(member=pkl_path)
|
||||
# move to corresponding raw directory
|
||||
extract_dir = pkl_path.replace("/buffer.pkl", "")
|
||||
raw_pkl_path = raw_dir / "buffer.pkl"
|
||||
shutil.move(pkl_path, raw_pkl_path)
|
||||
shutil.rmtree(extract_dir)
|
||||
zip_path.unlink()
|
||||
|
||||
|
||||
def download_hub(raw_dir: Path, dataset_id: str):
|
||||
raw_dir = Path(raw_dir)
|
||||
# Send warning if raw_dir isn't well formated
|
||||
if raw_dir.parts[-2] != user_id or raw_dir.parts[-1] != dataset_id:
|
||||
warnings.warn(
|
||||
f"`raw_dir` ({raw_dir}) doesn't contain a community or user id `/` the name of the dataset that match the `repo_id` (e.g. 'data/lerobot/pusht_raw'). Following this naming convention is advised, but not mandatory.",
|
||||
stacklevel=1,
|
||||
)
|
||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
logging.info(f"Start downloading from huggingface.co/cadene for {dataset_id}")
|
||||
snapshot_download(f"cadene/{dataset_id}_raw", repo_type="dataset", local_dir=raw_dir)
|
||||
logging.info(f"Finish downloading from huggingface.co/cadene for {dataset_id}")
|
||||
logging.info(f"Start downloading from huggingface.co/{user_id} for {dataset_id}")
|
||||
snapshot_download(f"{repo_id}", repo_type="dataset", local_dir=raw_dir)
|
||||
logging.info(f"Finish downloading from huggingface.co/{user_id} for {dataset_id}")
|
||||
|
||||
|
||||
def download_umi(raw_dir: Path):
|
||||
url_cup_in_the_wild = "https://real.stanford.edu/umi/data/zarr_datasets/cup_in_the_wild.zarr.zip"
|
||||
zarr_path = raw_dir / "cup_in_the_wild.zarr"
|
||||
def download_all_raw_datasets():
|
||||
data_dir = Path("data")
|
||||
repo_ids = [
|
||||
"cadene/pusht_image_raw",
|
||||
"cadene/xarm_lift_medium_image_raw",
|
||||
"cadene/xarm_lift_medium_replay_image_raw",
|
||||
"cadene/xarm_push_medium_image_raw",
|
||||
"cadene/xarm_push_medium_replay_image_raw",
|
||||
"cadene/aloha_sim_insertion_human_image_raw",
|
||||
"cadene/aloha_sim_insertion_scripted_image_raw",
|
||||
"cadene/aloha_sim_transfer_cube_human_image_raw",
|
||||
"cadene/aloha_sim_transfer_cube_scripted_image_raw",
|
||||
"cadene/pusht_raw",
|
||||
"cadene/xarm_lift_medium_raw",
|
||||
"cadene/xarm_lift_medium_replay_raw",
|
||||
"cadene/xarm_push_medium_raw",
|
||||
"cadene/xarm_push_medium_replay_raw",
|
||||
"cadene/aloha_sim_insertion_human_raw",
|
||||
"cadene/aloha_sim_insertion_scripted_raw",
|
||||
"cadene/aloha_sim_transfer_cube_human_raw",
|
||||
"cadene/aloha_sim_transfer_cube_scripted_raw",
|
||||
"cadene/aloha_mobile_cabinet_raw",
|
||||
"cadene/aloha_mobile_chair_raw",
|
||||
"cadene/aloha_mobile_elevator_raw",
|
||||
"cadene/aloha_mobile_shrimp_raw",
|
||||
"cadene/aloha_mobile_wash_pan_raw",
|
||||
"cadene/aloha_mobile_wipe_wine_raw",
|
||||
"cadene/aloha_static_battery_raw",
|
||||
"cadene/aloha_static_candy_raw",
|
||||
"cadene/aloha_static_coffee_raw",
|
||||
"cadene/aloha_static_coffee_new_raw",
|
||||
"cadene/aloha_static_cups_open_raw",
|
||||
"cadene/aloha_static_fork_pick_up_raw",
|
||||
"cadene/aloha_static_pingpong_test_raw",
|
||||
"cadene/aloha_static_pro_pencil_raw",
|
||||
"cadene/aloha_static_screw_driver_raw",
|
||||
"cadene/aloha_static_tape_raw",
|
||||
"cadene/aloha_static_thread_velcro_raw",
|
||||
"cadene/aloha_static_towel_raw",
|
||||
"cadene/aloha_static_vinh_cup_raw",
|
||||
"cadene/aloha_static_vinh_cup_left_raw",
|
||||
"cadene/aloha_static_ziploc_slide_raw",
|
||||
"cadene/umi_cup_in_the_wild_raw",
|
||||
]
|
||||
for repo_id in repo_ids:
|
||||
raw_dir = data_dir / repo_id
|
||||
download_raw(raw_dir, repo_id)
|
||||
|
||||
raw_dir = Path(raw_dir)
|
||||
raw_dir.mkdir(parents=True, exist_ok=True)
|
||||
download_and_extract_zip(url_cup_in_the_wild, zarr_path)
|
||||
|
||||
def main():
|
||||
parser = argparse.ArgumentParser()
|
||||
|
||||
parser.add_argument(
|
||||
"--raw-dir",
|
||||
type=Path,
|
||||
required=True,
|
||||
help="Directory containing input raw datasets (e.g. `data/aloha_mobile_chair_raw` or `data/pusht_raw).",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--repo-id",
|
||||
type=str,
|
||||
required=True,
|
||||
help="Repositery identifier on Hugging Face: a community or a user name `/` the name of the dataset (e.g. `lerobot/pusht_raw`, `cadene/aloha_sim_insertion_human_raw`).",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
download_raw(**vars(args))
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
data_dir = Path("data")
|
||||
dataset_ids = [
|
||||
"pusht_image",
|
||||
"xarm_lift_medium_image",
|
||||
"xarm_lift_medium_replay_image",
|
||||
"xarm_push_medium_image",
|
||||
"xarm_push_medium_replay_image",
|
||||
"aloha_sim_insertion_human_image",
|
||||
"aloha_sim_insertion_scripted_image",
|
||||
"aloha_sim_transfer_cube_human_image",
|
||||
"aloha_sim_transfer_cube_scripted_image",
|
||||
"pusht",
|
||||
"xarm_lift_medium",
|
||||
"xarm_lift_medium_replay",
|
||||
"xarm_push_medium",
|
||||
"xarm_push_medium_replay",
|
||||
"aloha_sim_insertion_human",
|
||||
"aloha_sim_insertion_scripted",
|
||||
"aloha_sim_transfer_cube_human",
|
||||
"aloha_sim_transfer_cube_scripted",
|
||||
"aloha_mobile_cabinet",
|
||||
"aloha_mobile_chair",
|
||||
"aloha_mobile_elevator",
|
||||
"aloha_mobile_shrimp",
|
||||
"aloha_mobile_wash_pan",
|
||||
"aloha_mobile_wipe_wine",
|
||||
"aloha_static_battery",
|
||||
"aloha_static_candy",
|
||||
"aloha_static_coffee",
|
||||
"aloha_static_coffee_new",
|
||||
"aloha_static_cups_open",
|
||||
"aloha_static_fork_pick_up",
|
||||
"aloha_static_pingpong_test",
|
||||
"aloha_static_pro_pencil",
|
||||
"aloha_static_screw_driver",
|
||||
"aloha_static_tape",
|
||||
"aloha_static_thread_velcro",
|
||||
"aloha_static_towel",
|
||||
"aloha_static_vinh_cup",
|
||||
"aloha_static_vinh_cup_left",
|
||||
"aloha_static_ziploc_slide",
|
||||
"umi_cup_in_the_wild",
|
||||
]
|
||||
for dataset_id in dataset_ids:
|
||||
raw_dir = data_dir / f"{dataset_id}_raw"
|
||||
download_raw(raw_dir, dataset_id)
|
||||
main()
|
||||
|
||||
@@ -30,6 +30,7 @@ from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.utils import (
|
||||
calculate_episode_data_index,
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
@@ -43,7 +44,8 @@ def get_cameras(hdf5_data):
|
||||
|
||||
|
||||
def check_format(raw_dir) -> bool:
|
||||
compressed_images = None
|
||||
# only frames from simulation are uncompressed
|
||||
compressed_images = "sim" not in raw_dir.name
|
||||
|
||||
hdf5_paths = list(raw_dir.glob("episode_*.hdf5"))
|
||||
assert len(hdf5_paths) != 0
|
||||
@@ -61,26 +63,25 @@ def check_format(raw_dir) -> bool:
|
||||
for camera in get_cameras(data):
|
||||
assert num_frames == data[f"/observations/images/{camera}"].shape[0]
|
||||
|
||||
assert data[f"/observations/images/{camera}"].ndim in [2, 4]
|
||||
if data[f"/observations/images/{camera}"].ndim == 2:
|
||||
assert compressed_images is None or compressed_images
|
||||
compressed_images = True
|
||||
if compressed_images:
|
||||
assert data[f"/observations/images/{camera}"].ndim == 2
|
||||
else:
|
||||
assert compressed_images is None or not compressed_images
|
||||
compressed_images = False
|
||||
assert data[f"/observations/images/{camera}"].ndim == 4
|
||||
b, h, w, c = data[f"/observations/images/{camera}"].shape
|
||||
assert c < h and c < w, f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
|
||||
return compressed_images
|
||||
|
||||
|
||||
def load_from_raw(raw_dir, out_dir, fps, video, debug, compressed_images):
|
||||
hdf5_files = list(raw_dir.glob("*.hdf5"))
|
||||
def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episodes: list[int] | None = None):
|
||||
# only frames from simulation are uncompressed
|
||||
compressed_images = "sim" not in raw_dir.name
|
||||
|
||||
hdf5_files = sorted(raw_dir.glob("episode_*.hdf5"))
|
||||
num_episodes = len(hdf5_files)
|
||||
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
|
||||
id_from = 0
|
||||
for ep_idx, ep_path in tqdm.tqdm(enumerate(hdf5_files), total=len(hdf5_files)):
|
||||
ep_ids = episodes if episodes else range(num_episodes)
|
||||
for ep_idx in tqdm.tqdm(ep_ids):
|
||||
ep_path = hdf5_files[ep_idx]
|
||||
with h5py.File(ep_path, "r") as ep:
|
||||
num_frames = ep["/action"].shape[0]
|
||||
|
||||
@@ -115,12 +116,12 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug, compressed_images):
|
||||
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = out_dir / "tmp_images"
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = out_dir / "videos" / fname
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
|
||||
# clean temporary images directory
|
||||
@@ -148,19 +149,13 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug, compressed_images):
|
||||
assert isinstance(ep_idx, int)
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(id_from + num_frames)
|
||||
|
||||
id_from += num_frames
|
||||
|
||||
gc.collect()
|
||||
|
||||
# process first episode only
|
||||
if debug:
|
||||
break
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
return data_dict, episode_data_index
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
@@ -198,16 +193,22 @@ def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
):
|
||||
# sanity check
|
||||
compressed_images = check_format(raw_dir)
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 50
|
||||
|
||||
data_dir, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug, compressed_images)
|
||||
hf_dataset = to_hf_dataset(data_dir, video)
|
||||
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
|
||||
101
lerobot/common/datasets/push_dataset_to_hub/cam_png_format.py
Normal file
101
lerobot/common/datasets/push_dataset_to_hub/cam_png_format.py
Normal file
@@ -0,0 +1,101 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""
|
||||
Contains utilities to process raw data format of png images files recorded with capture_camera_feed.py
|
||||
"""
|
||||
|
||||
from pathlib import Path
|
||||
|
||||
import torch
|
||||
from datasets import Dataset, Features, Image, Value
|
||||
from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes
|
||||
from lerobot.common.datasets.utils import calculate_episode_data_index, hf_transform_to_torch
|
||||
from lerobot.common.datasets.video_utils import VideoFrame
|
||||
|
||||
|
||||
def check_format(raw_dir: Path) -> bool:
|
||||
image_paths = list(raw_dir.glob("frame_*.png"))
|
||||
if len(image_paths) == 0:
|
||||
raise ValueError
|
||||
|
||||
|
||||
def load_from_raw(raw_dir: Path, fps: int, episodes: list[int] | None = None):
|
||||
if episodes is not None:
|
||||
# TODO(aliberts): add support for multi-episodes.
|
||||
raise NotImplementedError()
|
||||
|
||||
ep_dict = {}
|
||||
ep_idx = 0
|
||||
|
||||
image_paths = sorted(raw_dir.glob("frame_*.png"))
|
||||
num_frames = len(image_paths)
|
||||
|
||||
ep_dict["observation.image"] = [PILImage.open(x) for x in image_paths]
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
|
||||
ep_dicts = [ep_dict]
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
features = {}
|
||||
if video:
|
||||
features["observation.image"] = VideoFrame()
|
||||
else:
|
||||
features["observation.image"] = Image()
|
||||
|
||||
features["episode_index"] = Value(dtype="int64", id=None)
|
||||
features["frame_index"] = Value(dtype="int64", id=None)
|
||||
features["timestamp"] = Value(dtype="float32", id=None)
|
||||
features["index"] = Value(dtype="int64", id=None)
|
||||
|
||||
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||
hf_dataset.set_transform(hf_transform_to_torch)
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
):
|
||||
if video or episodes is not None:
|
||||
# TODO(aliberts): support this
|
||||
raise NotImplementedError
|
||||
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 30
|
||||
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
return hf_dataset, episode_data_index, info
|
||||
@@ -0,0 +1,220 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""
|
||||
Contains utilities to process raw data format from dora-record
|
||||
"""
|
||||
|
||||
import re
|
||||
from pathlib import Path
|
||||
|
||||
import pandas as pd
|
||||
import torch
|
||||
from datasets import Dataset, Features, Image, Sequence, Value
|
||||
|
||||
from lerobot.common.datasets.utils import (
|
||||
calculate_episode_data_index,
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame
|
||||
|
||||
|
||||
def check_format(raw_dir) -> bool:
|
||||
assert raw_dir.exists()
|
||||
|
||||
leader_file = list(raw_dir.glob("*.parquet"))
|
||||
if len(leader_file) == 0:
|
||||
raise ValueError(f"Missing parquet files in '{raw_dir}'")
|
||||
return True
|
||||
|
||||
|
||||
def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episodes: list[int] | None = None):
|
||||
# Load data stream that will be used as reference for the timestamps synchronization
|
||||
reference_files = list(raw_dir.glob("observation.images.cam_*.parquet"))
|
||||
if len(reference_files) == 0:
|
||||
raise ValueError(f"Missing reference files for camera, starting with in '{raw_dir}'")
|
||||
# select first camera in alphanumeric order
|
||||
reference_key = sorted(reference_files)[0].stem
|
||||
reference_df = pd.read_parquet(raw_dir / f"{reference_key}.parquet")
|
||||
reference_df = reference_df[["timestamp_utc", reference_key]]
|
||||
|
||||
# Merge all data stream using nearest backward strategy
|
||||
df = reference_df
|
||||
for path in raw_dir.glob("*.parquet"):
|
||||
key = path.stem # action or observation.state or ...
|
||||
if key == reference_key:
|
||||
continue
|
||||
if "failed_episode_index" in key:
|
||||
# TODO(rcadene): add support for removing episodes that are tagged as "failed"
|
||||
continue
|
||||
modality_df = pd.read_parquet(path)
|
||||
modality_df = modality_df[["timestamp_utc", key]]
|
||||
df = pd.merge_asof(
|
||||
df,
|
||||
modality_df,
|
||||
on="timestamp_utc",
|
||||
# "nearest" is the best option over "backward", since the latter can desynchronizes camera timestamps by
|
||||
# matching timestamps that are too far appart, in order to fit the backward constraints. It's not the case for "nearest".
|
||||
# However, note that "nearest" might synchronize the reference camera with other cameras on slightly future timestamps.
|
||||
# are too far appart.
|
||||
direction="nearest",
|
||||
tolerance=pd.Timedelta(f"{1/fps} seconds"),
|
||||
)
|
||||
# Remove rows with episode_index -1 which indicates data that correspond to in-between episodes
|
||||
df = df[df["episode_index"] != -1]
|
||||
|
||||
image_keys = [key for key in df if "observation.images." in key]
|
||||
|
||||
def get_episode_index(row):
|
||||
episode_index_per_cam = {}
|
||||
for key in image_keys:
|
||||
path = row[key][0]["path"]
|
||||
match = re.search(r"_(\d{6}).mp4", path)
|
||||
if not match:
|
||||
raise ValueError(path)
|
||||
episode_index = int(match.group(1))
|
||||
episode_index_per_cam[key] = episode_index
|
||||
if len(set(episode_index_per_cam.values())) != 1:
|
||||
raise ValueError(
|
||||
f"All cameras are expected to belong to the same episode, but getting {episode_index_per_cam}"
|
||||
)
|
||||
return episode_index
|
||||
|
||||
df["episode_index"] = df.apply(get_episode_index, axis=1)
|
||||
|
||||
# dora only use arrays, so single values are encapsulated into a list
|
||||
df["frame_index"] = df.groupby("episode_index").cumcount()
|
||||
df = df.reset_index()
|
||||
df["index"] = df.index
|
||||
|
||||
# set 'next.done' to True for the last frame of each episode
|
||||
df["next.done"] = False
|
||||
df.loc[df.groupby("episode_index").tail(1).index, "next.done"] = True
|
||||
|
||||
df["timestamp"] = df["timestamp_utc"].map(lambda x: x.timestamp())
|
||||
# each episode starts with timestamp 0 to match the ones from the video
|
||||
df["timestamp"] = df.groupby("episode_index")["timestamp"].transform(lambda x: x - x.iloc[0])
|
||||
|
||||
del df["timestamp_utc"]
|
||||
|
||||
# sanity check
|
||||
has_nan = df.isna().any().any()
|
||||
if has_nan:
|
||||
raise ValueError("Dataset contains Nan values.")
|
||||
|
||||
# sanity check episode indices go from 0 to n-1
|
||||
ep_ids = [ep_idx for ep_idx, _ in df.groupby("episode_index")]
|
||||
expected_ep_ids = list(range(df["episode_index"].max() + 1))
|
||||
if ep_ids != expected_ep_ids:
|
||||
raise ValueError(f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}")
|
||||
|
||||
# Create symlink to raw videos directory (that needs to be absolute not relative)
|
||||
videos_dir.parent.mkdir(parents=True, exist_ok=True)
|
||||
videos_dir.symlink_to((raw_dir / "videos").absolute())
|
||||
|
||||
# sanity check the video paths are well formated
|
||||
for key in df:
|
||||
if "observation.images." not in key:
|
||||
continue
|
||||
for ep_idx in ep_ids:
|
||||
video_path = videos_dir / f"{key}_episode_{ep_idx:06d}.mp4"
|
||||
if not video_path.exists():
|
||||
raise ValueError(f"Video file not found in {video_path}")
|
||||
|
||||
data_dict = {}
|
||||
for key in df:
|
||||
# is video frame
|
||||
if "observation.images." in key:
|
||||
# we need `[0] because dora only use arrays, so single values are encapsulated into a list.
|
||||
# it is the case for video_frame dictionary = [{"path": ..., "timestamp": ...}]
|
||||
data_dict[key] = [video_frame[0] for video_frame in df[key].values]
|
||||
|
||||
# sanity check the video path is well formated
|
||||
video_path = videos_dir.parent / data_dict[key][0]["path"]
|
||||
if not video_path.exists():
|
||||
raise ValueError(f"Video file not found in {video_path}")
|
||||
# is number
|
||||
elif df[key].iloc[0].ndim == 0 or df[key].iloc[0].shape[0] == 1:
|
||||
data_dict[key] = torch.from_numpy(df[key].values)
|
||||
# is vector
|
||||
elif df[key].iloc[0].shape[0] > 1:
|
||||
data_dict[key] = torch.stack([torch.from_numpy(x.copy()) for x in df[key].values])
|
||||
else:
|
||||
raise ValueError(key)
|
||||
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
features = {}
|
||||
|
||||
keys = [key for key in data_dict if "observation.images." in key]
|
||||
for key in keys:
|
||||
if video:
|
||||
features[key] = VideoFrame()
|
||||
else:
|
||||
features[key] = Image()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
if "observation.velocity" in data_dict:
|
||||
features["observation.velocity"] = Sequence(
|
||||
length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
if "observation.effort" in data_dict:
|
||||
features["observation.effort"] = Sequence(
|
||||
length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
features["episode_index"] = Value(dtype="int64", id=None)
|
||||
features["frame_index"] = Value(dtype="int64", id=None)
|
||||
features["timestamp"] = Value(dtype="float32", id=None)
|
||||
features["next.done"] = Value(dtype="bool", id=None)
|
||||
features["index"] = Value(dtype="int64", id=None)
|
||||
|
||||
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||
hf_dataset.set_transform(hf_transform_to_torch)
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
):
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 30
|
||||
else:
|
||||
raise NotImplementedError()
|
||||
|
||||
if not video:
|
||||
raise NotImplementedError()
|
||||
|
||||
data_df = load_from_raw(raw_dir, videos_dir, fps, episodes)
|
||||
hf_dataset = to_hf_dataset(data_df, video)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
return hf_dataset, episode_data_index, info
|
||||
676
lerobot/common/datasets/push_dataset_to_hub/oxe/configs.py
Normal file
676
lerobot/common/datasets/push_dataset_to_hub/oxe/configs.py
Normal file
@@ -0,0 +1,676 @@
|
||||
"""
|
||||
NOTE(YL): Adapted from:
|
||||
OpenVLA: https://github.com/openvla/openvla/blob/main/prismatic/vla/datasets/rlds/oxe/configs.py
|
||||
Octo: https://github.com/octo-models/octo/blob/main/octo/data/oxe/oxe_dataset_configs.py
|
||||
|
||||
TODO: implement the following:
|
||||
- Populate all `fps` for each dataset
|
||||
- Upload the dataset config to the Readme of each dataset on huggingface hub, for verbosity
|
||||
|
||||
configs.py
|
||||
|
||||
Defines per-dataset configuration (kwargs) for each dataset in Open-X Embodiment.
|
||||
|
||||
Configuration adopts the following structure:
|
||||
image_obs_keys:
|
||||
primary: primary external RGB
|
||||
secondary: secondary external RGB
|
||||
wrist: wrist RGB
|
||||
|
||||
depth_obs_keys:
|
||||
primary: primary external depth
|
||||
secondary: secondary external depth
|
||||
wrist: wrist depth
|
||||
|
||||
# Always 8-dim =>> changes based on `StateEncoding`
|
||||
state_obs_keys:
|
||||
StateEncoding.POS_EULER: EEF XYZ (3) + Roll-Pitch-Yaw (3) + <PAD> (1) + Gripper Open/Close (1)
|
||||
StateEncoding.POS_QUAT: EEF XYZ (3) + Quaternion (4) + Gripper Open/Close (1)
|
||||
StateEncoding.JOINT: Joint Angles (7, <PAD> if fewer) + Gripper Open/Close (1)
|
||||
|
||||
state_encoding: Type of `StateEncoding`
|
||||
action_encoding: Type of action encoding (e.g., EEF Position vs. Joint Position)
|
||||
"""
|
||||
|
||||
from enum import IntEnum
|
||||
|
||||
|
||||
# Defines Proprioceptive State Encoding Schemes
|
||||
class StateEncoding(IntEnum):
|
||||
# fmt: off
|
||||
NONE = -1 # No Proprioceptive State
|
||||
POS_EULER = 1 # EEF XYZ (3) + Roll-Pitch-Yaw (3) + <PAD> (1) + Gripper Open/Close (1)
|
||||
POS_QUAT = 2 # EEF XYZ (3) + Quaternion (4) + Gripper Open/Close (1)
|
||||
JOINT = 3 # Joint Angles (7, <PAD> if fewer) + Gripper Open/Close (1)
|
||||
JOINT_BIMANUAL = 4 # Joint Angles (2 x [ Joint Angles (6) + Gripper Open/Close (1) ])
|
||||
# fmt: on
|
||||
|
||||
|
||||
# Defines Action Encoding Schemes
|
||||
class ActionEncoding(IntEnum):
|
||||
# fmt: off
|
||||
EEF_POS = 1 # EEF Delta XYZ (3) + Roll-Pitch-Yaw (3) + Gripper Open/Close (1)
|
||||
JOINT_POS = 2 # Joint Delta Position (7) + Gripper Open/Close (1)
|
||||
JOINT_POS_BIMANUAL = 3 # Joint Delta Position (2 x [ Joint Delta Position (6) + Gripper Open/Close (1) ])
|
||||
EEF_R6 = 4 # EEF Delta XYZ (3) + R6 (6) + Gripper Open/Close (1)
|
||||
# fmt: on
|
||||
|
||||
|
||||
# === Individual Dataset Configs ===
|
||||
OXE_DATASET_CONFIGS = {
|
||||
"fractal20220817_data": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["base_pose_tool_reached", "gripper_closed"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 3,
|
||||
},
|
||||
"kuka": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": [
|
||||
"clip_function_input/base_pose_tool_reached",
|
||||
"gripper_closed",
|
||||
],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"bridge_oxe": { # Version of Bridge V2 in Open X-Embodiment mixture
|
||||
"image_obs_keys": {"primary": "image", "secondary": "image_1", "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 5,
|
||||
},
|
||||
"bridge_orig": { # Original version of Bridge V2 from project website
|
||||
"image_obs_keys": {"primary": "image_0", "secondary": "image_1", "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 5,
|
||||
},
|
||||
"bridge_dataset": { # Original version of Bridge V2 from project website
|
||||
"image_obs_keys": {"primary": "image_0", "secondary": "image_1", "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 5,
|
||||
},
|
||||
"taco_play": {
|
||||
"image_obs_keys": {
|
||||
"primary": "rgb_static",
|
||||
"secondary": None,
|
||||
"wrist": "rgb_gripper",
|
||||
},
|
||||
"depth_obs_keys": {
|
||||
"primary": "depth_static",
|
||||
"secondary": None,
|
||||
"wrist": "depth_gripper",
|
||||
},
|
||||
"state_obs_keys": ["state_eef", None, "state_gripper"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"jaco_play": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "image_wrist",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state_eef", None, "state_gripper"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"berkeley_cable_routing": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": "top_image",
|
||||
"wrist": "wrist45_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["robot_state", None],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"roboturk": {
|
||||
"image_obs_keys": {"primary": "front_rgb", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": [None, None, None, None, None, None, None, None],
|
||||
"state_encoding": StateEncoding.NONE,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"nyu_door_opening_surprising_effectiveness": {
|
||||
"image_obs_keys": {"primary": None, "secondary": None, "wrist": "image"},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": [None, None, None, None, None, None, None, None],
|
||||
"state_encoding": StateEncoding.NONE,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"viola": {
|
||||
"image_obs_keys": {
|
||||
"primary": "agentview_rgb",
|
||||
"secondary": None,
|
||||
"wrist": "eye_in_hand_rgb",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["joint_states", "gripper_states"],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"berkeley_autolab_ur5": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "hand_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": "depth", "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"toto": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"language_table": {
|
||||
"image_obs_keys": {"primary": "rgb", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["effector_translation", None, None, None, None, None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"columbia_cairlab_pusht_real": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["robot_state", None, None, None, None, None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"stanford_kuka_multimodal_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": "depth_image", "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["ee_position", "ee_orientation", None],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"nyu_rot_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"stanford_hydra_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"austin_buds_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state"],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 20,
|
||||
},
|
||||
"nyu_franka_play_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": "image_additional_view",
|
||||
"wrist": None,
|
||||
},
|
||||
"depth_obs_keys": {
|
||||
"primary": "depth",
|
||||
"secondary": "depth_additional_view",
|
||||
"wrist": None,
|
||||
},
|
||||
"state_obs_keys": ["eef_state", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 3,
|
||||
},
|
||||
"maniskill_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {
|
||||
"primary": "depth",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_depth",
|
||||
},
|
||||
"state_obs_keys": ["tcp_pose", "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"furniture_bench_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"cmu_franka_exploration_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "highres_image",
|
||||
"secondary": None,
|
||||
"wrist": None,
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": [None, None, None, None, None, None, None, None],
|
||||
"state_encoding": StateEncoding.NONE,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"ucsd_kitchen_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["joint_state", None],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"ucsd_pick_and_place_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"austin_sailor_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"austin_sirius_dataset_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"bc_z": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": [
|
||||
"present/xyz",
|
||||
"present/axis_angle",
|
||||
None,
|
||||
"present/sensed_close",
|
||||
],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"utokyo_pr2_opening_fridge_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"utokyo_xarm_pick_and_place_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": "image2",
|
||||
"wrist": "hand_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["end_effector_pose", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"utokyo_xarm_bimanual_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["pose_r", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"robo_net": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": "image1", "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"berkeley_mvp_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": None, "secondary": None, "wrist": "hand_image"},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["pose", "gripper"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.JOINT_POS,
|
||||
},
|
||||
"berkeley_rpt_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": None, "secondary": None, "wrist": "hand_image"},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["joint_pos", "gripper"],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.JOINT_POS,
|
||||
},
|
||||
"kaist_nonprehensile_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"stanford_mask_vit_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"tokyo_u_lsmo_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"dlr_sara_pour_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"dlr_sara_grid_clamp_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"dlr_edan_shared_control_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"asu_table_top_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"stanford_robocook_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {"primary": "image_1", "secondary": "image_2", "wrist": None},
|
||||
"depth_obs_keys": {"primary": "depth_1", "secondary": "depth_2", "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"imperialcollege_sawyer_wrist_cam": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": [None, None, None, None, None, None, None, "state"],
|
||||
"state_encoding": StateEncoding.NONE,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"iamlab_cmu_pickup_insert_converted_externally_to_rlds": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["joint_state", "gripper_state"],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"uiuc_d3field": {
|
||||
"image_obs_keys": {"primary": "image_1", "secondary": "image_2", "wrist": None},
|
||||
"depth_obs_keys": {"primary": "depth_1", "secondary": "depth_2", "wrist": None},
|
||||
"state_obs_keys": [None, None, None, None, None, None, None, None],
|
||||
"state_encoding": StateEncoding.NONE,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"utaustin_mutex": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state"],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"berkeley_fanuc_manipulation": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["joint_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"cmu_playing_with_food": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image",
|
||||
"secondary": None,
|
||||
"wrist": "finger_vision_1",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"cmu_play_fusion": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state"],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"cmu_stretch": {
|
||||
"image_obs_keys": {"primary": "image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["eef_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 10,
|
||||
},
|
||||
"berkeley_gnm_recon": {
|
||||
"image_obs_keys": {"primary": None, "secondary": None, "wrist": "image"},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"berkeley_gnm_cory_hall": {
|
||||
"image_obs_keys": {"primary": None, "secondary": None, "wrist": "image"},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"berkeley_gnm_sac_son": {
|
||||
"image_obs_keys": {"primary": None, "secondary": None, "wrist": "image"},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["state", None, None],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"droid": {
|
||||
"image_obs_keys": {
|
||||
"primary": "exterior_image_1_left",
|
||||
"secondary": "exterior_image_2_left",
|
||||
"wrist": "wrist_image_left",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["proprio"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
"droid100": { # For testing
|
||||
"image_obs_keys": {
|
||||
"primary": "exterior_image_1_left",
|
||||
"secondary": "exterior_image_2_left",
|
||||
"wrist": "wrist_image_left",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["proprio"],
|
||||
"state_encoding": StateEncoding.POS_QUAT,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
"fmb_dataset": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image_side_1",
|
||||
"secondary": "image_side_2",
|
||||
"wrist": "image_wrist_1",
|
||||
},
|
||||
"depth_obs_keys": {
|
||||
"primary": "image_side_1_depth",
|
||||
"secondary": "image_side_2_depth",
|
||||
"wrist": "image_wrist_1_depth",
|
||||
},
|
||||
"state_obs_keys": ["proprio"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"dobbe": {
|
||||
"image_obs_keys": {"primary": "wrist_image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["proprio"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
"roboset": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image_left",
|
||||
"secondary": "image_right",
|
||||
"wrist": "image_wrist",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["proprio"],
|
||||
"state_encoding": StateEncoding.JOINT,
|
||||
"action_encoding": ActionEncoding.JOINT_POS,
|
||||
},
|
||||
"rh20t": {
|
||||
"image_obs_keys": {
|
||||
"primary": "image_front",
|
||||
"secondary": "image_side_right",
|
||||
"wrist": "image_wrist",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["proprio"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
},
|
||||
### T-DROID datasets
|
||||
"tdroid_carrot_in_bowl": { # "put carrot in bowl" task, 50 demos @ 5 Hz control
|
||||
"image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
"tdroid_pour_corn_in_pot": { # "pour corn from red bowl into steel pot" task, 50 demos @ 5 Hz control
|
||||
"image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
"tdroid_flip_pot_upright": { # "flip pot upright" task, 10 demos @ 5 Hz control
|
||||
"image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
"tdroid_move_object_onto_plate": { # "move <object> onto plate" task, 150 demos @ 5 Hz control
|
||||
"image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
"tdroid_knock_object_over": { # "knock <object> over" task, 70 demos @ 5 Hz control
|
||||
"image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
"tdroid_cover_object_with_towel": { # "cover <object> with towel" task, 45 demos @ 5 Hz control
|
||||
"image_obs_keys": {"primary": "static_image", "secondary": None, "wrist": None},
|
||||
"depth_obs_keys": {"primary": "static_depth_image", "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["EEF_state", None, "gripper_state"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
### DROID Finetuning datasets
|
||||
"droid_wipe": {
|
||||
"image_obs_keys": {
|
||||
"primary": "exterior_image_2_left",
|
||||
"secondary": None,
|
||||
"wrist": "wrist_image_left",
|
||||
},
|
||||
"depth_obs_keys": {"primary": None, "secondary": None, "wrist": None},
|
||||
"state_obs_keys": ["proprio"],
|
||||
"state_encoding": StateEncoding.POS_EULER,
|
||||
"action_encoding": ActionEncoding.EEF_POS,
|
||||
"fps": 15,
|
||||
},
|
||||
}
|
||||
@@ -0,0 +1,91 @@
|
||||
"""
|
||||
NOTE(YL): Adapted from:
|
||||
Octo: https://github.com/octo-models/octo/blob/main/octo/data/utils/data_utils.py
|
||||
|
||||
data_utils.py
|
||||
|
||||
Additional utils for data processing.
|
||||
"""
|
||||
|
||||
from typing import Any, Dict, List
|
||||
|
||||
import tensorflow as tf
|
||||
|
||||
|
||||
def binarize_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
|
||||
"""
|
||||
Converts gripper actions from continuous to binary values (0 and 1).
|
||||
|
||||
We exploit that fact that most of the time, the gripper is fully open (near 1.0) or fully closed (near 0.0). As it
|
||||
transitions between the two, it sometimes passes through a few intermediate values. We relabel those intermediate
|
||||
values based on the state that is reached _after_ those intermediate values.
|
||||
|
||||
In the edge case that the trajectory ends with an intermediate value, we give up on binarizing and relabel that
|
||||
chunk of intermediate values as the last action in the trajectory.
|
||||
|
||||
The `scan_fn` implements the following logic:
|
||||
new_actions = np.empty_like(actions)
|
||||
carry = actions[-1]
|
||||
for i in reversed(range(actions.shape[0])):
|
||||
if in_between_mask[i]:
|
||||
carry = carry
|
||||
else:
|
||||
carry = float(open_mask[i])
|
||||
new_actions[i] = carry
|
||||
"""
|
||||
open_mask, closed_mask = actions > 0.95, actions < 0.05
|
||||
in_between_mask = tf.logical_not(tf.logical_or(open_mask, closed_mask))
|
||||
is_open_float = tf.cast(open_mask, tf.float32)
|
||||
|
||||
def scan_fn(carry, i):
|
||||
return tf.cond(in_between_mask[i], lambda: tf.cast(carry, tf.float32), lambda: is_open_float[i])
|
||||
|
||||
return tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), actions[-1], reverse=True)
|
||||
|
||||
|
||||
def invert_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
|
||||
return 1 - actions
|
||||
|
||||
|
||||
def rel2abs_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
|
||||
"""
|
||||
Converts relative gripper actions (+1 for closing, -1 for opening) to absolute actions (0 = closed; 1 = open).
|
||||
|
||||
Assumes that the first relative gripper is not redundant (i.e. close when already closed)!
|
||||
"""
|
||||
# Note =>> -1 for closing, 1 for opening, 0 for no change
|
||||
opening_mask, closing_mask = actions < -0.1, actions > 0.1
|
||||
thresholded_actions = tf.where(opening_mask, 1, tf.where(closing_mask, -1, 0))
|
||||
|
||||
def scan_fn(carry, i):
|
||||
return tf.cond(thresholded_actions[i] == 0, lambda: carry, lambda: thresholded_actions[i])
|
||||
|
||||
# If no relative grasp, assumes open for whole trajectory
|
||||
start = -1 * thresholded_actions[tf.argmax(thresholded_actions != 0, axis=0)]
|
||||
start = tf.cond(start == 0, lambda: 1, lambda: start)
|
||||
|
||||
# Note =>> -1 for closed, 1 for open
|
||||
new_actions = tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), start)
|
||||
new_actions = tf.cast(new_actions, tf.float32) / 2 + 0.5
|
||||
|
||||
return new_actions
|
||||
|
||||
|
||||
# === Bridge-V2 =>> Dataset-Specific Transform ===
|
||||
def relabel_bridge_actions(traj: Dict[str, Any]) -> Dict[str, Any]:
|
||||
"""Relabels actions to use reached proprioceptive state; discards last timestep (no-action)."""
|
||||
movement_actions = traj["observation"]["state"][1:, :6] - traj["observation"]["state"][:-1, :6]
|
||||
traj_truncated = tf.nest.map_structure(lambda x: x[:-1], traj)
|
||||
traj_truncated["action"] = tf.concat([movement_actions, traj["action"][:-1, -1:]], axis=1)
|
||||
|
||||
return traj_truncated
|
||||
|
||||
|
||||
# === RLDS Dataset Initialization Utilities ===
|
||||
def pprint_data_mixture(dataset_kwargs_list: List[Dict[str, Any]], dataset_weights: List[int]) -> None:
|
||||
print("\n######################################################################################")
|
||||
print(f"# Loading the following {len(dataset_kwargs_list)} datasets (incl. sampling weight):{'': >24} #")
|
||||
for dataset_kwargs, weight in zip(dataset_kwargs_list, dataset_weights, strict=False):
|
||||
pad = 80 - len(dataset_kwargs["name"])
|
||||
print(f"# {dataset_kwargs['name']}: {weight:=>{pad}f} #")
|
||||
print("######################################################################################\n")
|
||||
185
lerobot/common/datasets/push_dataset_to_hub/oxe/droid_utils.py
Normal file
185
lerobot/common/datasets/push_dataset_to_hub/oxe/droid_utils.py
Normal file
@@ -0,0 +1,185 @@
|
||||
"""
|
||||
NOTE(YL): Adapted from:
|
||||
OpenVLA: https://github.com/openvla/openvla
|
||||
|
||||
Episode transforms for DROID dataset.
|
||||
"""
|
||||
|
||||
from typing import Any, Dict
|
||||
|
||||
import tensorflow as tf
|
||||
import tensorflow_graphics.geometry.transformation as tfg
|
||||
|
||||
|
||||
def rmat_to_euler(rot_mat):
|
||||
return tfg.euler.from_rotation_matrix(rot_mat)
|
||||
|
||||
|
||||
def euler_to_rmat(euler):
|
||||
return tfg.rotation_matrix_3d.from_euler(euler)
|
||||
|
||||
|
||||
def invert_rmat(rot_mat):
|
||||
return tfg.rotation_matrix_3d.inverse(rot_mat)
|
||||
|
||||
|
||||
def rotmat_to_rot6d(mat):
|
||||
"""
|
||||
Converts rotation matrix to R6 rotation representation (first two rows in rotation matrix).
|
||||
Args:
|
||||
mat: rotation matrix
|
||||
|
||||
Returns: 6d vector (first two rows of rotation matrix)
|
||||
|
||||
"""
|
||||
r6 = mat[..., :2, :]
|
||||
r6_0, r6_1 = r6[..., 0, :], r6[..., 1, :]
|
||||
r6_flat = tf.concat([r6_0, r6_1], axis=-1)
|
||||
return r6_flat
|
||||
|
||||
|
||||
def velocity_act_to_wrist_frame(velocity, wrist_in_robot_frame):
|
||||
"""
|
||||
Translates velocity actions (translation + rotation) from base frame of the robot to wrist frame.
|
||||
Args:
|
||||
velocity: 6d velocity action (3 x translation, 3 x rotation)
|
||||
wrist_in_robot_frame: 6d pose of the end-effector in robot base frame
|
||||
|
||||
Returns: 9d velocity action in robot wrist frame (3 x translation, 6 x rotation as R6)
|
||||
|
||||
"""
|
||||
r_frame = euler_to_rmat(wrist_in_robot_frame[:, 3:6])
|
||||
r_frame_inv = invert_rmat(r_frame)
|
||||
|
||||
# world to wrist: dT_pi = R^-1 dT_rbt
|
||||
vel_t = (r_frame_inv @ velocity[:, :3][..., None])[..., 0]
|
||||
|
||||
# world to wrist: dR_pi = R^-1 dR_rbt R
|
||||
dr_ = euler_to_rmat(velocity[:, 3:6])
|
||||
dr_ = r_frame_inv @ (dr_ @ r_frame)
|
||||
dr_r6 = rotmat_to_rot6d(dr_)
|
||||
return tf.concat([vel_t, dr_r6], axis=-1)
|
||||
|
||||
|
||||
def rand_swap_exterior_images(img1, img2):
|
||||
"""
|
||||
Randomly swaps the two exterior images (for training with single exterior input).
|
||||
"""
|
||||
return tf.cond(tf.random.uniform(shape=[]) > 0.5, lambda: (img1, img2), lambda: (img2, img1))
|
||||
|
||||
|
||||
def droid_baseact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
"""
|
||||
DROID dataset transformation for actions expressed in *base* frame of the robot.
|
||||
"""
|
||||
dt = trajectory["action_dict"]["cartesian_velocity"][:, :3]
|
||||
dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6]
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
dt,
|
||||
dr_,
|
||||
1 - trajectory["action_dict"]["gripper_position"],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = (
|
||||
rand_swap_exterior_images(
|
||||
trajectory["observation"]["exterior_image_1_left"],
|
||||
trajectory["observation"]["exterior_image_2_left"],
|
||||
)
|
||||
)
|
||||
trajectory["observation"]["proprio"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["cartesian_position"],
|
||||
trajectory["observation"]["gripper_position"],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def droid_wristact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
"""
|
||||
DROID dataset transformation for actions expressed in *wrist* frame of the robot.
|
||||
"""
|
||||
wrist_act = velocity_act_to_wrist_frame(
|
||||
trajectory["action_dict"]["cartesian_velocity"], trajectory["observation"]["cartesian_position"]
|
||||
)
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
wrist_act,
|
||||
trajectory["action_dict"]["gripper_position"],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = (
|
||||
rand_swap_exterior_images(
|
||||
trajectory["observation"]["exterior_image_1_left"],
|
||||
trajectory["observation"]["exterior_image_2_left"],
|
||||
)
|
||||
)
|
||||
trajectory["observation"]["proprio"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["cartesian_position"],
|
||||
trajectory["observation"]["gripper_position"],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def droid_finetuning_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
"""
|
||||
DROID dataset transformation for actions expressed in *base* frame of the robot.
|
||||
"""
|
||||
dt = trajectory["action_dict"]["cartesian_velocity"][:, :3]
|
||||
dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6]
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
dt,
|
||||
dr_,
|
||||
1 - trajectory["action_dict"]["gripper_position"],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["observation"]["proprio"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["cartesian_position"],
|
||||
trajectory["observation"]["gripper_position"],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def zero_action_filter(traj: Dict) -> bool:
|
||||
"""
|
||||
Filters transitions whose actions are all-0 (only relative actions, no gripper action).
|
||||
Note: this filter is applied *after* action normalization, so need to compare to "normalized 0".
|
||||
"""
|
||||
droid_q01 = tf.convert_to_tensor(
|
||||
[
|
||||
-0.7776297926902771,
|
||||
-0.5803514122962952,
|
||||
-0.5795090794563293,
|
||||
-0.6464047729969025,
|
||||
-0.7041108310222626,
|
||||
-0.8895104378461838,
|
||||
]
|
||||
)
|
||||
droid_q99 = tf.convert_to_tensor(
|
||||
[
|
||||
0.7597932070493698,
|
||||
0.5726242214441299,
|
||||
0.7351000607013702,
|
||||
0.6705610305070877,
|
||||
0.6464948207139969,
|
||||
0.8897542208433151,
|
||||
]
|
||||
)
|
||||
droid_norm_0_act = (
|
||||
2 * (tf.zeros_like(traj["action"][:, :6]) - droid_q01) / (droid_q99 - droid_q01 + 1e-8) - 1
|
||||
)
|
||||
|
||||
return tf.reduce_any(tf.math.abs(traj["action"][:, :6] - droid_norm_0_act) > 1e-5)
|
||||
924
lerobot/common/datasets/push_dataset_to_hub/oxe/transforms.py
Normal file
924
lerobot/common/datasets/push_dataset_to_hub/oxe/transforms.py
Normal file
@@ -0,0 +1,924 @@
|
||||
"""
|
||||
NOTE(YL): Adapted from:
|
||||
OpenVLA: https://github.com/openvla/openvla
|
||||
Octo: https://github.com/octo-models/octo
|
||||
|
||||
transforms.py
|
||||
|
||||
Defines a registry of per-dataset standardization transforms for each dataset in Open-X Embodiment.
|
||||
|
||||
Transforms adopt the following structure:
|
||||
Input: Dictionary of *batched* features (i.e., has leading time dimension)
|
||||
Output: Dictionary `step` =>> {
|
||||
"observation": {
|
||||
<image_keys, depth_image_keys>
|
||||
State (in chosen state representation)
|
||||
},
|
||||
"action": Action (in chosen action representation),
|
||||
"language_instruction": str
|
||||
}
|
||||
"""
|
||||
|
||||
from typing import Any, Dict
|
||||
|
||||
import tensorflow as tf
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.oxe.data_utils import (
|
||||
binarize_gripper_actions,
|
||||
invert_gripper_actions,
|
||||
rel2abs_gripper_actions,
|
||||
relabel_bridge_actions,
|
||||
)
|
||||
|
||||
|
||||
def droid_baseact_transform_fn():
|
||||
from lerobot.common.datasets.push_dataset_to_hub.oxe.droid_utils import droid_baseact_transform
|
||||
|
||||
return droid_baseact_transform
|
||||
|
||||
|
||||
def droid_finetuning_transform_fn():
|
||||
from lerobot.common.datasets.push_dataset_to_hub.oxe.droid_utils import droid_finetuning_transform
|
||||
|
||||
return droid_finetuning_transform
|
||||
|
||||
|
||||
def bridge_oxe_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
"""
|
||||
Applies to version of Bridge V2 in Open X-Embodiment mixture.
|
||||
|
||||
Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it!
|
||||
"""
|
||||
for key in trajectory:
|
||||
if key == "traj_metadata":
|
||||
continue
|
||||
elif key in ["observation", "action"]:
|
||||
for key2 in trajectory[key]:
|
||||
trajectory[key][key2] = trajectory[key][key2][1:]
|
||||
else:
|
||||
trajectory[key] = trajectory[key][1:]
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
trajectory = relabel_bridge_actions(trajectory)
|
||||
trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
return trajectory
|
||||
|
||||
|
||||
def bridge_orig_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
"""
|
||||
Applies to original version of Bridge V2 from the official project website.
|
||||
|
||||
Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it!
|
||||
"""
|
||||
for key in trajectory:
|
||||
if key == "traj_metadata":
|
||||
continue
|
||||
elif key == "observation":
|
||||
for key2 in trajectory[key]:
|
||||
trajectory[key][key2] = trajectory[key][key2][1:]
|
||||
else:
|
||||
trajectory[key] = trajectory[key][1:]
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
[
|
||||
trajectory["action"][:, :6],
|
||||
binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
|
||||
],
|
||||
axis=1,
|
||||
)
|
||||
trajectory = relabel_bridge_actions(trajectory)
|
||||
trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
return trajectory
|
||||
|
||||
|
||||
def ppgm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
[
|
||||
trajectory["action"][:, :6],
|
||||
binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
|
||||
],
|
||||
axis=1,
|
||||
)
|
||||
trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"][:, -1:]
|
||||
return trajectory
|
||||
|
||||
|
||||
def rt1_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# make gripper action absolute action, +1 = open, 0 = close
|
||||
gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
|
||||
gripper_action = rel2abs_gripper_actions(gripper_action)
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
gripper_action[:, None],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def kuka_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# make gripper action absolute action, +1 = open, 0 = close
|
||||
gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
|
||||
gripper_action = rel2abs_gripper_actions(gripper_action)
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
gripper_action[:, None],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
# decode compressed state
|
||||
eef_value = tf.io.decode_compressed(
|
||||
trajectory["observation"]["clip_function_input/base_pose_tool_reached"],
|
||||
compression_type="ZLIB",
|
||||
)
|
||||
eef_value = tf.io.decode_raw(eef_value, tf.float32)
|
||||
trajectory["observation"]["clip_function_input/base_pose_tool_reached"] = tf.reshape(eef_value, (-1, 7))
|
||||
gripper_value = tf.io.decode_compressed(
|
||||
trajectory["observation"]["gripper_closed"], compression_type="ZLIB"
|
||||
)
|
||||
gripper_value = tf.io.decode_raw(gripper_value, tf.float32)
|
||||
trajectory["observation"]["gripper_closed"] = tf.reshape(gripper_value, (-1, 1))
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["observation"]["natural_language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def taco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["state_eef"] = trajectory["observation"]["robot_obs"][:, :6]
|
||||
trajectory["observation"]["state_gripper"] = trajectory["observation"]["robot_obs"][:, 7:8]
|
||||
trajectory["action"] = trajectory["action"]["rel_actions_world"]
|
||||
|
||||
# invert gripper action + clip, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :6],
|
||||
tf.clip_by_value(trajectory["action"][:, -1:], 0, 1),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def jaco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["state_eef"] = trajectory["observation"]["end_effector_cartesian_pos"][:, :6]
|
||||
trajectory["observation"]["state_gripper"] = trajectory["observation"]["end_effector_cartesian_pos"][
|
||||
:, -1:
|
||||
]
|
||||
|
||||
# make gripper action absolute action, +1 = open, 0 = close
|
||||
gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
|
||||
gripper_action = rel2abs_gripper_actions(gripper_action)
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
tf.zeros_like(trajectory["action"]["world_vector"]),
|
||||
gripper_action[:, None],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def berkeley_cable_routing_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
tf.zeros_like(trajectory["action"]["world_vector"][:, :1]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["observation"]["natural_language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def roboturk_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# invert absolute gripper action, +1 = open, 0 = close
|
||||
gripper_action = invert_gripper_actions(
|
||||
tf.clip_by_value(trajectory["action"]["gripper_closedness_action"], 0, 1)
|
||||
)
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
gripper_action,
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["observation"]["natural_language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def nyu_door_opening_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# make gripper action absolute action, +1 = open, 0 = close
|
||||
gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
|
||||
gripper_action = rel2abs_gripper_actions(gripper_action)
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
gripper_action[:, None],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["observation"]["natural_language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def viola_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# make gripper action, +1 = open, 0 = close
|
||||
gripper_action = trajectory["action"]["gripper_closedness_action"][:, None]
|
||||
gripper_action = tf.clip_by_value(gripper_action, 0, 1)
|
||||
gripper_action = invert_gripper_actions(gripper_action)
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
gripper_action,
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["observation"]["natural_language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def berkeley_autolab_ur5_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["state"] = trajectory["observation"]["robot_state"][:, 6:14]
|
||||
trajectory["observation"]["depth"] = trajectory["observation"].pop("image_with_depth")
|
||||
|
||||
# make gripper action absolute action, +1 = open, 0 = close
|
||||
gripper_action = trajectory["action"]["gripper_closedness_action"]
|
||||
gripper_action = rel2abs_gripper_actions(gripper_action)
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
gripper_action[:, None],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def toto_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["observation"]["natural_language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def language_table_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# default to "open" gripper
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"],
|
||||
tf.zeros_like(trajectory["action"]),
|
||||
tf.zeros_like(trajectory["action"]),
|
||||
tf.ones_like(trajectory["action"][:, :1]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
# decode language instruction
|
||||
instruction_bytes = trajectory["observation"]["instruction"]
|
||||
instruction_encoded = tf.strings.unicode_encode(instruction_bytes, output_encoding="UTF-8")
|
||||
# Remove trailing padding --> convert RaggedTensor to regular Tensor.
|
||||
trajectory["language_instruction"] = tf.strings.split(instruction_encoded, "\x00")[:, :1].to_tensor()[
|
||||
:, 0
|
||||
]
|
||||
return trajectory
|
||||
|
||||
|
||||
def pusht_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["world_vector"],
|
||||
trajectory["action"]["rotation_delta"],
|
||||
trajectory["action"]["gripper_closedness_action"][:, None],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def stanford_kuka_multimodal_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["depth_image"] = trajectory["observation"]["depth_image"][..., 0]
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :3],
|
||||
tf.zeros_like(trajectory["action"][:, :3]),
|
||||
trajectory["action"][:, -1:],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def nyu_rot_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][..., :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., -1:]
|
||||
trajectory["action"] = trajectory["action"][..., :7]
|
||||
return trajectory
|
||||
|
||||
|
||||
def stanford_hydra_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# invert gripper action, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :6],
|
||||
invert_gripper_actions(trajectory["action"][:, -1:]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
trajectory["observation"]["eef_state"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["state"][:, :3],
|
||||
trajectory["observation"]["state"][:, 7:10],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -3:-2]
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
return trajectory
|
||||
|
||||
|
||||
def austin_buds_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# invert gripper action + clip, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :6],
|
||||
invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8]
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
return trajectory
|
||||
|
||||
|
||||
def nyu_franka_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["depth"] = tf.cast(trajectory["observation"]["depth"][..., 0], tf.float32)
|
||||
trajectory["observation"]["depth_additional_view"] = tf.cast(
|
||||
trajectory["observation"]["depth_additional_view"][..., 0], tf.float32
|
||||
)
|
||||
trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, -6:]
|
||||
|
||||
# clip gripper action, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, -8:-2],
|
||||
tf.clip_by_value(trajectory["action"][:, -2:-1], 0, 1),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
return trajectory
|
||||
|
||||
|
||||
def maniskill_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., 7:8]
|
||||
return trajectory
|
||||
|
||||
|
||||
def furniture_bench_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
import tensorflow_graphics.geometry.transformation as tft
|
||||
|
||||
trajectory["observation"]["state"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["state"][:, :7],
|
||||
trajectory["observation"]["state"][:, -1:],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
# invert gripper action + clip, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :3],
|
||||
tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
|
||||
invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def cmu_franka_exploration_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = trajectory["action"][..., :-1]
|
||||
return trajectory
|
||||
|
||||
|
||||
def ucsd_kitchen_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7]
|
||||
trajectory["action"] = trajectory["action"][..., :-1]
|
||||
return trajectory
|
||||
|
||||
|
||||
def ucsd_pick_place_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :3],
|
||||
tf.zeros_like(trajectory["action"][:, :3]),
|
||||
trajectory["action"][:, -1:],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def austin_sailor_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# invert gripper action + clip, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :6],
|
||||
invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
return trajectory
|
||||
|
||||
|
||||
def austin_sirius_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# invert gripper action + clip, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :6],
|
||||
invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
return trajectory
|
||||
|
||||
|
||||
def bc_z_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["future/xyz_residual"][:, :3],
|
||||
trajectory["action"]["future/axis_angle_residual"][:, :3],
|
||||
invert_gripper_actions(tf.cast(trajectory["action"]["future/target_close"][:, :1], tf.float32)),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def tokyo_pr2_opening_fridge_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
trajectory["action"] = trajectory["action"][..., :-1]
|
||||
return trajectory
|
||||
|
||||
|
||||
def tokyo_pr2_tabletop_manipulation_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
trajectory["action"] = trajectory["action"][..., :-1]
|
||||
return trajectory
|
||||
|
||||
|
||||
def utokyo_xarm_pick_place_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
return trajectory
|
||||
|
||||
|
||||
def utokyo_xarm_bimanual_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = trajectory["action"][..., -7:]
|
||||
return trajectory
|
||||
|
||||
|
||||
def robo_net_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["state"][:, :4],
|
||||
tf.zeros_like(trajectory["observation"]["state"][:, :2]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :4],
|
||||
tf.zeros_like(trajectory["action"][:, :2]),
|
||||
trajectory["action"][:, -1:],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def berkeley_mvp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
return trajectory
|
||||
|
||||
|
||||
def berkeley_rpt_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
return trajectory
|
||||
|
||||
|
||||
def kaist_nonprehensible_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["state"] = trajectory["observation"]["state"][:, -7:]
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :6],
|
||||
tf.zeros_like(trajectory["action"][:, :1]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def stanford_mask_vit_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["end_effector_pose"][:, :4],
|
||||
tf.zeros_like(trajectory["observation"]["end_effector_pose"][:, :2]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["end_effector_pose"][:, -1:]
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :4],
|
||||
tf.zeros_like(trajectory["action"][:, :2]),
|
||||
trajectory["action"][:, -1:],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def tokyo_lsmo_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
return trajectory
|
||||
|
||||
|
||||
def dlr_sara_pour_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
return trajectory
|
||||
|
||||
|
||||
def dlr_sara_grid_clamp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :6]
|
||||
return trajectory
|
||||
|
||||
|
||||
def dlr_edan_shared_control_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# invert gripper action, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :6],
|
||||
invert_gripper_actions(trajectory["action"][:, -1:]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def asu_table_top_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = trajectory["ground_truth_states"]["EE"]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
return trajectory
|
||||
|
||||
|
||||
def robocook_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
return trajectory
|
||||
|
||||
|
||||
def imperial_wristcam_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = trajectory["action"][..., :-1]
|
||||
return trajectory
|
||||
|
||||
|
||||
def iamlab_pick_insert_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
import tensorflow_graphics.geometry.transformation as tft
|
||||
|
||||
trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 7:8]
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :3],
|
||||
tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
|
||||
trajectory["action"][:, 7:8],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def uiuc_d3field_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"],
|
||||
tf.zeros_like(trajectory["action"]),
|
||||
tf.zeros_like(trajectory["action"][:, :1]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def utaustin_mutex_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8]
|
||||
|
||||
# invert gripper action + clip, +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :6],
|
||||
invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
|
||||
# trajectory["language_instruction"] = tf.fill(
|
||||
# tf.shape(trajectory["language_instruction"]), ""
|
||||
# ) # delete uninformative language instruction
|
||||
return trajectory
|
||||
|
||||
|
||||
def berkeley_fanuc_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 6:7]
|
||||
|
||||
# dataset does not store gripper actions, so use gripper state info, invert so +1 = open, 0 = close
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"],
|
||||
invert_gripper_actions(trajectory["observation"]["gripper_state"]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def cmu_playing_with_food_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
import tensorflow_graphics.geometry.transformation as tft
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :3],
|
||||
tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
|
||||
trajectory["action"][:, -1:],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def playfusion_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :3],
|
||||
trajectory["action"][:, -4:],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def cmu_stretch_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["eef_state"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["state"][:, :3],
|
||||
tf.zeros_like(trajectory["observation"]["state"][:, :3]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
|
||||
trajectory["action"] = trajectory["action"][..., :-1]
|
||||
return trajectory
|
||||
|
||||
|
||||
def gnm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["observation"]["state"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["position"],
|
||||
tf.zeros_like(trajectory["observation"]["state"][:, :3]),
|
||||
trajectory["observation"]["yaw"],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"],
|
||||
tf.zeros_like(trajectory["action"]),
|
||||
tf.zeros_like(trajectory["action"]),
|
||||
tf.zeros_like(trajectory["action"][:, :1]),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def fmb_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# every input feature is batched, ie has leading batch dimension
|
||||
trajectory["observation"]["proprio"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["eef_pose"],
|
||||
trajectory["observation"]["state_gripper_pose"][..., None],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def dobbe_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# every input feature is batched, ie has leading batch dimension
|
||||
trajectory["observation"]["proprio"] = trajectory["observation"]["state"]
|
||||
return trajectory
|
||||
|
||||
|
||||
def roboset_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
# every input feature is batched, ie has leading batch dimension
|
||||
trajectory["observation"]["proprio"] = trajectory["observation"]["state"]
|
||||
|
||||
# gripper action is in -1...1 --> clip to 0...1, flip
|
||||
gripper_action = trajectory["action"][:, -1:]
|
||||
gripper_action = invert_gripper_actions(tf.clip_by_value(gripper_action, 0, 1))
|
||||
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"][:, :7],
|
||||
gripper_action,
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def rh20t_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
(
|
||||
trajectory["action"]["tcp_base"],
|
||||
tf.cast(trajectory["action"]["gripper"][:, None], tf.float32),
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
trajectory["observation"]["proprio"] = tf.concat(
|
||||
(
|
||||
trajectory["observation"]["tcp_base"],
|
||||
trajectory["observation"]["gripper_width"][..., None],
|
||||
),
|
||||
axis=-1,
|
||||
)
|
||||
return trajectory
|
||||
|
||||
|
||||
def tdroid_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
|
||||
trajectory["action"] = tf.concat(
|
||||
[
|
||||
trajectory["action"][:, :6],
|
||||
binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
|
||||
],
|
||||
axis=1,
|
||||
)
|
||||
trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"][:, :6]
|
||||
trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"][:, -1:]
|
||||
return trajectory
|
||||
|
||||
|
||||
# === Registry ===
|
||||
OXE_STANDARDIZATION_TRANSFORMS = {
|
||||
"bridge_oxe": bridge_oxe_dataset_transform,
|
||||
"bridge_orig": bridge_orig_dataset_transform,
|
||||
"bridge_dataset": bridge_orig_dataset_transform,
|
||||
"ppgm": ppgm_dataset_transform,
|
||||
"ppgm_static": ppgm_dataset_transform,
|
||||
"ppgm_wrist": ppgm_dataset_transform,
|
||||
"fractal20220817_data": rt1_dataset_transform,
|
||||
"kuka": kuka_dataset_transform,
|
||||
"taco_play": taco_play_dataset_transform,
|
||||
"jaco_play": jaco_play_dataset_transform,
|
||||
"berkeley_cable_routing": berkeley_cable_routing_dataset_transform,
|
||||
"roboturk": roboturk_dataset_transform,
|
||||
"nyu_door_opening_surprising_effectiveness": nyu_door_opening_dataset_transform,
|
||||
"viola": viola_dataset_transform,
|
||||
"berkeley_autolab_ur5": berkeley_autolab_ur5_dataset_transform,
|
||||
"toto": toto_dataset_transform,
|
||||
"language_table": language_table_dataset_transform,
|
||||
"columbia_cairlab_pusht_real": pusht_dataset_transform,
|
||||
"stanford_kuka_multimodal_dataset_converted_externally_to_rlds": stanford_kuka_multimodal_dataset_transform,
|
||||
"nyu_rot_dataset_converted_externally_to_rlds": nyu_rot_dataset_transform,
|
||||
"stanford_hydra_dataset_converted_externally_to_rlds": stanford_hydra_dataset_transform,
|
||||
"austin_buds_dataset_converted_externally_to_rlds": austin_buds_dataset_transform,
|
||||
"nyu_franka_play_dataset_converted_externally_to_rlds": nyu_franka_play_dataset_transform,
|
||||
"maniskill_dataset_converted_externally_to_rlds": maniskill_dataset_transform,
|
||||
"furniture_bench_dataset_converted_externally_to_rlds": furniture_bench_dataset_transform,
|
||||
"cmu_franka_exploration_dataset_converted_externally_to_rlds": cmu_franka_exploration_dataset_transform,
|
||||
"ucsd_kitchen_dataset_converted_externally_to_rlds": ucsd_kitchen_dataset_transform,
|
||||
"ucsd_pick_and_place_dataset_converted_externally_to_rlds": ucsd_pick_place_dataset_transform,
|
||||
"austin_sailor_dataset_converted_externally_to_rlds": austin_sailor_dataset_transform,
|
||||
"austin_sirius_dataset_converted_externally_to_rlds": austin_sirius_dataset_transform,
|
||||
"bc_z": bc_z_dataset_transform,
|
||||
"utokyo_pr2_opening_fridge_converted_externally_to_rlds": tokyo_pr2_opening_fridge_dataset_transform,
|
||||
"utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds": tokyo_pr2_tabletop_manipulation_dataset_transform,
|
||||
"utokyo_xarm_pick_and_place_converted_externally_to_rlds": utokyo_xarm_pick_place_dataset_transform,
|
||||
"utokyo_xarm_bimanual_converted_externally_to_rlds": utokyo_xarm_bimanual_dataset_transform,
|
||||
"robo_net": robo_net_dataset_transform,
|
||||
"berkeley_mvp_converted_externally_to_rlds": berkeley_mvp_dataset_transform,
|
||||
"berkeley_rpt_converted_externally_to_rlds": berkeley_rpt_dataset_transform,
|
||||
"kaist_nonprehensile_converted_externally_to_rlds": kaist_nonprehensible_dataset_transform,
|
||||
"stanford_mask_vit_converted_externally_to_rlds": stanford_mask_vit_dataset_transform,
|
||||
"tokyo_u_lsmo_converted_externally_to_rlds": tokyo_lsmo_dataset_transform,
|
||||
"dlr_sara_pour_converted_externally_to_rlds": dlr_sara_pour_dataset_transform,
|
||||
"dlr_sara_grid_clamp_converted_externally_to_rlds": dlr_sara_grid_clamp_dataset_transform,
|
||||
"dlr_edan_shared_control_converted_externally_to_rlds": dlr_edan_shared_control_dataset_transform,
|
||||
"asu_table_top_converted_externally_to_rlds": asu_table_top_dataset_transform,
|
||||
"stanford_robocook_converted_externally_to_rlds": robocook_dataset_transform,
|
||||
"imperialcollege_sawyer_wrist_cam": imperial_wristcam_dataset_transform,
|
||||
"iamlab_cmu_pickup_insert_converted_externally_to_rlds": iamlab_pick_insert_dataset_transform,
|
||||
"uiuc_d3field": uiuc_d3field_dataset_transform,
|
||||
"utaustin_mutex": utaustin_mutex_dataset_transform,
|
||||
"berkeley_fanuc_manipulation": berkeley_fanuc_dataset_transform,
|
||||
"cmu_playing_with_food": cmu_playing_with_food_dataset_transform,
|
||||
"cmu_play_fusion": playfusion_dataset_transform,
|
||||
"cmu_stretch": cmu_stretch_dataset_transform,
|
||||
"berkeley_gnm_recon": gnm_dataset_transform,
|
||||
"berkeley_gnm_cory_hall": gnm_dataset_transform,
|
||||
"berkeley_gnm_sac_son": gnm_dataset_transform,
|
||||
"droid": droid_baseact_transform_fn(),
|
||||
"droid100": droid_baseact_transform_fn(), # first 100 episodes of droid
|
||||
"fmb_dataset": fmb_dataset_transform,
|
||||
"dobbe": dobbe_dataset_transform,
|
||||
"roboset": roboset_dataset_transform,
|
||||
"rh20t": rh20t_dataset_transform,
|
||||
### T-DROID datasets
|
||||
"tdroid_carrot_in_bowl": tdroid_dataset_transform,
|
||||
"tdroid_pour_corn_in_pot": tdroid_dataset_transform,
|
||||
"tdroid_flip_pot_upright": tdroid_dataset_transform,
|
||||
"tdroid_move_object_onto_plate": tdroid_dataset_transform,
|
||||
"tdroid_knock_object_over": tdroid_dataset_transform,
|
||||
"tdroid_cover_object_with_towel": tdroid_dataset_transform,
|
||||
### DROID Finetuning datasets
|
||||
"droid_wipe": droid_finetuning_transform_fn(),
|
||||
}
|
||||
329
lerobot/common/datasets/push_dataset_to_hub/oxe_rlds_format.py
Normal file
329
lerobot/common/datasets/push_dataset_to_hub/oxe_rlds_format.py
Normal file
@@ -0,0 +1,329 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
"""
|
||||
For https://github.com/google-deepmind/open_x_embodiment (OXE) datasets.
|
||||
|
||||
Example:
|
||||
python lerobot/scripts/push_dataset_to_hub.py \
|
||||
--raw-dir /hdd/tensorflow_datasets/bridge_dataset/1.0.0/ \
|
||||
--repo-id youliangtan/sampled_bridge_data_v2 \
|
||||
--raw-format oxe_rlds.bridge_orig \
|
||||
--episodes 3 4 5 8 9
|
||||
|
||||
Exact dataset fps defined in oxe/config.py, obtained from:
|
||||
https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R
|
||||
"""
|
||||
|
||||
import shutil
|
||||
from pathlib import Path
|
||||
|
||||
import numpy as np
|
||||
import tensorflow as tf
|
||||
import tensorflow_datasets as tfds
|
||||
import torch
|
||||
import tqdm
|
||||
from datasets import Dataset, Features, Image, Sequence, Value
|
||||
from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.oxe.configs import OXE_DATASET_CONFIGS
|
||||
from lerobot.common.datasets.push_dataset_to_hub.oxe.transforms import OXE_STANDARDIZATION_TRANSFORMS
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.utils import (
|
||||
calculate_episode_data_index,
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
|
||||
np.set_printoptions(precision=2)
|
||||
|
||||
|
||||
def get_cameras_keys(obs_keys):
|
||||
return [key for key in obs_keys if "image" in key]
|
||||
|
||||
|
||||
def tf_to_torch(data):
|
||||
return torch.from_numpy(data.numpy())
|
||||
|
||||
|
||||
def tf_img_convert(img):
|
||||
if img.dtype == tf.string:
|
||||
img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8)
|
||||
elif img.dtype != tf.uint8:
|
||||
raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}")
|
||||
return img.numpy()
|
||||
|
||||
|
||||
def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict:
|
||||
"""
|
||||
In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps"
|
||||
entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the
|
||||
trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`.
|
||||
|
||||
NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/
|
||||
"""
|
||||
steps = traj.pop("steps")
|
||||
|
||||
traj_len = tf.shape(tf.nest.flatten(steps)[0])[0]
|
||||
|
||||
# broadcast metadata to the length of the trajectory
|
||||
metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj)
|
||||
|
||||
# put steps back in
|
||||
assert "traj_metadata" not in steps
|
||||
traj = {**steps, "traj_metadata": metadata}
|
||||
|
||||
assert "_len" not in traj
|
||||
assert "_traj_index" not in traj
|
||||
assert "_frame_index" not in traj
|
||||
traj["_len"] = tf.repeat(traj_len, traj_len)
|
||||
traj["_traj_index"] = tf.repeat(i, traj_len)
|
||||
traj["_frame_index"] = tf.range(traj_len)
|
||||
|
||||
return traj
|
||||
|
||||
|
||||
def load_from_raw(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int,
|
||||
video: bool,
|
||||
episodes: list[int],
|
||||
oxe_dataset_name: str | None = None,
|
||||
):
|
||||
"""
|
||||
Args:
|
||||
raw_dir (Path): _description_
|
||||
videos_dir (Path): _description_
|
||||
fps (int): _description_
|
||||
video (bool): _description_
|
||||
episodes (list[int] | None, optional): _description_. Defaults to None.
|
||||
"""
|
||||
ds_builder = tfds.builder_from_directory(str(raw_dir))
|
||||
dataset = ds_builder.as_dataset(
|
||||
split="all",
|
||||
decoders={"steps": tfds.decode.SkipDecoding()},
|
||||
)
|
||||
dataset_info = ds_builder.info
|
||||
print("dataset_info: ", dataset_info)
|
||||
|
||||
ds_length = len(dataset)
|
||||
dataset = dataset.take(ds_length)
|
||||
|
||||
# "flatten" the dataset as such we can apply trajectory level map() easily
|
||||
# each [obs][key] has a shape of (frame_size, ...)
|
||||
dataset = dataset.enumerate().map(_broadcast_metadata_rlds)
|
||||
|
||||
# we will apply the standardization transform if the dataset_name is provided
|
||||
if oxe_dataset_name is not None:
|
||||
print(" - applying standardization transform for dataset: ", oxe_dataset_name)
|
||||
assert oxe_dataset_name in OXE_STANDARDIZATION_TRANSFORMS
|
||||
transform_fn = OXE_STANDARDIZATION_TRANSFORMS[oxe_dataset_name]
|
||||
dataset = dataset.map(transform_fn)
|
||||
|
||||
image_keys = get_cameras_keys(dataset_info.features["steps"]["observation"].keys())
|
||||
lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None
|
||||
print(" - image_keys: ", image_keys)
|
||||
print(" - lang_key: ", lang_key)
|
||||
|
||||
it = iter(dataset)
|
||||
|
||||
ep_dicts = []
|
||||
|
||||
# if we user specified episodes, skip the ones not in the list
|
||||
if episodes is not None:
|
||||
if ds_length == 0:
|
||||
raise ValueError("No episodes found.")
|
||||
# convert episodes index to sorted list
|
||||
episodes = sorted(episodes)
|
||||
|
||||
for ep_idx in tqdm.tqdm(range(ds_length)):
|
||||
episode = next(it)
|
||||
|
||||
# if user specified episodes, skip the ones not in the list
|
||||
if episodes is not None:
|
||||
if len(episodes) == 0:
|
||||
break
|
||||
if ep_idx == episodes[0]:
|
||||
# process this episode
|
||||
print(" selecting episode idx: ", ep_idx)
|
||||
episodes.pop(0)
|
||||
else:
|
||||
continue # skip
|
||||
|
||||
num_frames = episode["action"].shape[0]
|
||||
|
||||
###########################################################
|
||||
# Handle the episodic data
|
||||
|
||||
# last step of demonstration is considered done
|
||||
done = torch.zeros(num_frames, dtype=torch.bool)
|
||||
done[-1] = True
|
||||
ep_dict = {}
|
||||
langs = [] # TODO: might be located in "observation"
|
||||
|
||||
image_array_dict = {key: [] for key in image_keys}
|
||||
|
||||
# We will create the state observation tensor by stacking the state
|
||||
# obs keys defined in the oxe/configs.py
|
||||
if oxe_dataset_name is not None:
|
||||
state_obs_keys = OXE_DATASET_CONFIGS[oxe_dataset_name]["state_obs_keys"]
|
||||
# stack the state observations, if is None, pad with zeros
|
||||
states = []
|
||||
for key in state_obs_keys:
|
||||
if key in episode["observation"]:
|
||||
states.append(tf_to_torch(episode["observation"][key]))
|
||||
else:
|
||||
states.append(torch.zeros(num_frames, 1)) # pad with zeros
|
||||
states = torch.cat(states, dim=1)
|
||||
# assert states.shape == (num_frames, 8), f"states shape: {states.shape}"
|
||||
else:
|
||||
states = tf_to_torch(episode["observation"]["state"])
|
||||
|
||||
actions = tf_to_torch(episode["action"])
|
||||
rewards = tf_to_torch(episode["reward"]).float()
|
||||
|
||||
# If lang_key is present, convert the entire tensor at once
|
||||
if lang_key is not None:
|
||||
langs = [str(x) for x in episode[lang_key]]
|
||||
|
||||
for im_key in image_keys:
|
||||
imgs = episode["observation"][im_key]
|
||||
image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
|
||||
|
||||
# simple assertions
|
||||
for item in [states, actions, rewards, done]:
|
||||
assert len(item) == num_frames
|
||||
|
||||
###########################################################
|
||||
|
||||
# loop through all cameras
|
||||
for im_key in image_keys:
|
||||
img_key = f"observation.images.{im_key}"
|
||||
imgs_array = image_array_dict[im_key]
|
||||
imgs_array = np.array(imgs_array)
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [
|
||||
{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
|
||||
]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
|
||||
if lang_key is not None:
|
||||
ep_dict["language_instruction"] = langs
|
||||
|
||||
ep_dict["observation.state"] = states
|
||||
ep_dict["action"] = actions
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["next.reward"] = rewards
|
||||
ep_dict["next.done"] = done
|
||||
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video) -> Dataset:
|
||||
features = {}
|
||||
|
||||
keys = [key for key in data_dict if "observation.images." in key]
|
||||
for key in keys:
|
||||
if video:
|
||||
features[key] = VideoFrame()
|
||||
else:
|
||||
features[key] = Image()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
if "observation.velocity" in data_dict:
|
||||
features["observation.velocity"] = Sequence(
|
||||
length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
if "observation.effort" in data_dict:
|
||||
features["observation.effort"] = Sequence(
|
||||
length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
if "language_instruction" in data_dict:
|
||||
features["language_instruction"] = Value(dtype="string", id=None)
|
||||
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
features["episode_index"] = Value(dtype="int64", id=None)
|
||||
features["frame_index"] = Value(dtype="int64", id=None)
|
||||
features["timestamp"] = Value(dtype="float32", id=None)
|
||||
features["next.reward"] = Value(dtype="float32", id=None)
|
||||
features["next.done"] = Value(dtype="bool", id=None)
|
||||
features["index"] = Value(dtype="int64", id=None)
|
||||
|
||||
hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
|
||||
hf_dataset.set_transform(hf_transform_to_torch)
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
oxe_dataset_name: str | None = None,
|
||||
):
|
||||
"""This is a test impl for rlds conversion"""
|
||||
if fps is None:
|
||||
if oxe_dataset_name is not None:
|
||||
if "fps" not in OXE_DATASET_CONFIGS[oxe_dataset_name]:
|
||||
raise ValueError(
|
||||
"fps for this dataset is not specified in oxe/configs.py yet,"
|
||||
"means it is not yet tested"
|
||||
)
|
||||
fps = OXE_DATASET_CONFIGS[oxe_dataset_name]["fps"]
|
||||
else:
|
||||
print(" - WARNING: fps is not provided, using default value of 5 fps")
|
||||
fps = 5
|
||||
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, oxe_dataset_name)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
}
|
||||
return hf_dataset, episode_data_index, info
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
# NOTE (YL): This mainly serves as a unit test
|
||||
# austin_buds_dataset_converted_externally_to_rlds is a smaller dataset in
|
||||
# open x embodiment datasets.
|
||||
raw_dir = Path("/hdd/tensorflow_datasets/austin_buds_dataset_converted_externally_to_rlds/0.1.0/")
|
||||
videos_dir = Path("/hdd/tmp/")
|
||||
hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(
|
||||
raw_dir,
|
||||
videos_dir,
|
||||
fps=50,
|
||||
video=True,
|
||||
episodes=[2, 3],
|
||||
)
|
||||
print(hf_dataset)
|
||||
print(episode_data_index)
|
||||
print(info)
|
||||
@@ -27,6 +27,7 @@ from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.utils import (
|
||||
calculate_episode_data_index,
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
@@ -53,7 +54,14 @@ def check_format(raw_dir):
|
||||
assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
|
||||
|
||||
|
||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
def load_from_raw(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int,
|
||||
video: bool,
|
||||
episodes: list[int] | None = None,
|
||||
keypoints_instead_of_image: bool = False,
|
||||
):
|
||||
try:
|
||||
import pymunk
|
||||
from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
|
||||
@@ -71,7 +79,6 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
|
||||
|
||||
episode_ids = torch.from_numpy(zarr_data.get_episode_idxs())
|
||||
num_episodes = zarr_data.meta["episode_ends"].shape[0]
|
||||
assert len(
|
||||
{zarr_data[key].shape[0] for key in zarr_data.keys()} # noqa: SIM118
|
||||
), "Some data type dont have the same number of total frames."
|
||||
@@ -84,32 +91,44 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
states = torch.from_numpy(zarr_data["state"])
|
||||
actions = torch.from_numpy(zarr_data["action"])
|
||||
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
# load data indices from which each episode starts and ends
|
||||
from_ids, to_ids = [], []
|
||||
from_idx = 0
|
||||
for to_idx in zarr_data.meta["episode_ends"]:
|
||||
from_ids.append(from_idx)
|
||||
to_ids.append(to_idx)
|
||||
from_idx = to_idx
|
||||
|
||||
id_from = 0
|
||||
for ep_idx in tqdm.tqdm(range(num_episodes)):
|
||||
id_to = zarr_data.meta["episode_ends"][ep_idx]
|
||||
num_frames = id_to - id_from
|
||||
num_episodes = len(from_ids)
|
||||
|
||||
ep_dicts = []
|
||||
ep_ids = episodes if episodes else range(num_episodes)
|
||||
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||
from_idx = from_ids[selected_ep_idx]
|
||||
to_idx = to_ids[selected_ep_idx]
|
||||
num_frames = to_idx - from_idx
|
||||
|
||||
# sanity check
|
||||
assert (episode_ids[id_from:id_to] == ep_idx).all()
|
||||
assert (episode_ids[from_idx:to_idx] == ep_idx).all()
|
||||
|
||||
# get image
|
||||
image = imgs[id_from:id_to]
|
||||
assert image.min() >= 0.0
|
||||
assert image.max() <= 255.0
|
||||
image = image.type(torch.uint8)
|
||||
if not keypoints_instead_of_image:
|
||||
image = imgs[from_idx:to_idx]
|
||||
assert image.min() >= 0.0
|
||||
assert image.max() <= 255.0
|
||||
image = image.type(torch.uint8)
|
||||
|
||||
# get state
|
||||
state = states[id_from:id_to]
|
||||
state = states[from_idx:to_idx]
|
||||
agent_pos = state[:, :2]
|
||||
block_pos = state[:, 2:4]
|
||||
block_angle = state[:, 4]
|
||||
|
||||
# get reward, success, done
|
||||
# get reward, success, done, and (maybe) keypoints
|
||||
reward = torch.zeros(num_frames)
|
||||
success = torch.zeros(num_frames, dtype=torch.bool)
|
||||
if keypoints_instead_of_image:
|
||||
keypoints = torch.zeros(num_frames, 16) # 8 keypoints each with 2 coords
|
||||
done = torch.zeros(num_frames, dtype=torch.bool)
|
||||
for i in range(num_frames):
|
||||
space = pymunk.Space()
|
||||
@@ -125,7 +144,7 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
]
|
||||
space.add(*walls)
|
||||
|
||||
block_body = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
|
||||
block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
|
||||
goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
|
||||
block_geom = pymunk_to_shapely(block_body, block_body.shapes)
|
||||
intersection_area = goal_geom.intersection(block_geom).area
|
||||
@@ -133,34 +152,41 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
coverage = intersection_area / goal_area
|
||||
reward[i] = np.clip(coverage / success_threshold, 0, 1)
|
||||
success[i] = coverage > success_threshold
|
||||
if keypoints_instead_of_image:
|
||||
keypoints[i] = torch.from_numpy(PushTEnv.get_keypoints(block_shapes).flatten())
|
||||
|
||||
# last step of demonstration is considered done
|
||||
done[-1] = True
|
||||
|
||||
ep_dict = {}
|
||||
|
||||
imgs_array = [x.numpy() for x in image]
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = out_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
if not keypoints_instead_of_image:
|
||||
imgs_array = [x.numpy() for x in image]
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = out_dir / "videos" / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
# clean temporary images directory
|
||||
shutil.rmtree(tmp_imgs_dir)
|
||||
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
# store the reference to the video frame
|
||||
ep_dict[img_key] = [
|
||||
{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
|
||||
]
|
||||
else:
|
||||
ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
|
||||
|
||||
ep_dict["observation.state"] = agent_pos
|
||||
ep_dict["action"] = actions[id_from:id_to]
|
||||
if keypoints_instead_of_image:
|
||||
ep_dict["observation.environment_state"] = keypoints
|
||||
ep_dict["action"] = actions[from_idx:to_idx]
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
@@ -171,31 +197,30 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
ep_dict["next.done"] = torch.cat([done[1:], done[[-1]]])
|
||||
ep_dict["next.success"] = torch.cat([success[1:], success[[-1]]])
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(id_from + num_frames)
|
||||
|
||||
id_from += num_frames
|
||||
|
||||
# process first episode only
|
||||
if debug:
|
||||
break
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
return data_dict, episode_data_index
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video):
|
||||
def to_hf_dataset(data_dict, video, keypoints_instead_of_image: bool = False):
|
||||
features = {}
|
||||
|
||||
if video:
|
||||
features["observation.image"] = VideoFrame()
|
||||
else:
|
||||
features["observation.image"] = Image()
|
||||
if not keypoints_instead_of_image:
|
||||
if video:
|
||||
features["observation.image"] = VideoFrame()
|
||||
else:
|
||||
features["observation.image"] = Image()
|
||||
|
||||
features["observation.state"] = Sequence(
|
||||
length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
if keypoints_instead_of_image:
|
||||
features["observation.environment_state"] = Sequence(
|
||||
length=data_dict["observation.environment_state"].shape[1],
|
||||
feature=Value(dtype="float32", id=None),
|
||||
)
|
||||
features["action"] = Sequence(
|
||||
length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
|
||||
)
|
||||
@@ -212,18 +237,28 @@ def to_hf_dataset(data_dict, video):
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
):
|
||||
# Manually change this to True to use keypoints of the T instead of an image observation (but don't merge
|
||||
# with True). Also make sure to use video = 0 in the `push_dataset_to_hub.py` script.
|
||||
keypoints_instead_of_image = False
|
||||
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 10
|
||||
|
||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, keypoints_instead_of_image)
|
||||
hf_dataset = to_hf_dataset(data_dict, video, keypoints_instead_of_image)
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
"video": video if not keypoints_instead_of_image else 0,
|
||||
}
|
||||
return hf_dataset, episode_data_index, info
|
||||
|
||||
@@ -19,7 +19,6 @@ import logging
|
||||
import shutil
|
||||
from pathlib import Path
|
||||
|
||||
import numpy as np
|
||||
import torch
|
||||
import tqdm
|
||||
import zarr
|
||||
@@ -29,6 +28,7 @@ from PIL import Image as PILImage
|
||||
from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.utils import (
|
||||
calculate_episode_data_index,
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
@@ -59,23 +59,7 @@ def check_format(raw_dir) -> bool:
|
||||
assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
|
||||
|
||||
|
||||
def get_episode_idxs(episode_ends: np.ndarray) -> np.ndarray:
|
||||
# Optimized and simplified version of this function: https://github.com/real-stanford/universal_manipulation_interface/blob/298776ce251f33b6b3185a98d6e7d1f9ad49168b/diffusion_policy/common/replay_buffer.py#L374
|
||||
from numba import jit
|
||||
|
||||
@jit(nopython=True)
|
||||
def _get_episode_idxs(episode_ends):
|
||||
result = np.zeros((episode_ends[-1],), dtype=np.int64)
|
||||
start_idx = 0
|
||||
for episode_number, end_idx in enumerate(episode_ends):
|
||||
result[start_idx:end_idx] = episode_number
|
||||
start_idx = end_idx
|
||||
return result
|
||||
|
||||
return _get_episode_idxs(episode_ends)
|
||||
|
||||
|
||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episodes: list[int] | None = None):
|
||||
zarr_path = raw_dir / "cup_in_the_wild.zarr"
|
||||
zarr_data = zarr.open(zarr_path, mode="r")
|
||||
|
||||
@@ -92,39 +76,41 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
episode_ends = zarr_data["meta/episode_ends"][:]
|
||||
num_episodes = episode_ends.shape[0]
|
||||
|
||||
episode_ids = torch.from_numpy(get_episode_idxs(episode_ends))
|
||||
|
||||
# We convert it in torch tensor later because the jit function does not support torch tensors
|
||||
episode_ends = torch.from_numpy(episode_ends)
|
||||
|
||||
# load data indices from which each episode starts and ends
|
||||
from_ids, to_ids = [], []
|
||||
from_idx = 0
|
||||
for to_idx in episode_ends:
|
||||
from_ids.append(from_idx)
|
||||
to_ids.append(to_idx)
|
||||
from_idx = to_idx
|
||||
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
|
||||
id_from = 0
|
||||
for ep_idx in tqdm.tqdm(range(num_episodes)):
|
||||
id_to = episode_ends[ep_idx]
|
||||
num_frames = id_to - id_from
|
||||
|
||||
# sanity heck
|
||||
assert (episode_ids[id_from:id_to] == ep_idx).all()
|
||||
ep_ids = episodes if episodes else range(num_episodes)
|
||||
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||
from_idx = from_ids[selected_ep_idx]
|
||||
to_idx = to_ids[selected_ep_idx]
|
||||
num_frames = to_idx - from_idx
|
||||
|
||||
# TODO(rcadene): save temporary images of the episode?
|
||||
|
||||
state = states[id_from:id_to]
|
||||
state = states[from_idx:to_idx]
|
||||
|
||||
ep_dict = {}
|
||||
|
||||
# load 57MB of images in RAM (400x224x224x3 uint8)
|
||||
imgs_array = zarr_data["data/camera0_rgb"][id_from:id_to]
|
||||
imgs_array = zarr_data["data/camera0_rgb"][from_idx:to_idx]
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = out_dir / "tmp_images"
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = out_dir / "videos" / fname
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
|
||||
# clean temporary images directory
|
||||
@@ -139,27 +125,18 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
|
||||
ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
|
||||
ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
|
||||
ep_dict["episode_data_index_from"] = torch.tensor([id_from] * num_frames)
|
||||
ep_dict["episode_data_index_to"] = torch.tensor([id_from + num_frames] * num_frames)
|
||||
ep_dict["end_pose"] = end_pose[id_from:id_to]
|
||||
ep_dict["start_pos"] = start_pos[id_from:id_to]
|
||||
ep_dict["gripper_width"] = gripper_width[id_from:id_to]
|
||||
ep_dict["episode_data_index_from"] = torch.tensor([from_idx] * num_frames)
|
||||
ep_dict["episode_data_index_to"] = torch.tensor([from_idx + num_frames] * num_frames)
|
||||
ep_dict["end_pose"] = end_pose[from_idx:to_idx]
|
||||
ep_dict["start_pos"] = start_pos[from_idx:to_idx]
|
||||
ep_dict["gripper_width"] = gripper_width[from_idx:to_idx]
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(id_from + num_frames)
|
||||
id_from += num_frames
|
||||
|
||||
# process first episode only
|
||||
if debug:
|
||||
break
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
|
||||
total_frames = id_from
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
|
||||
return data_dict, episode_data_index
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video):
|
||||
@@ -199,7 +176,13 @@ def to_hf_dataset(data_dict, video):
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
):
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
@@ -212,9 +195,9 @@ def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=Tru
|
||||
"Generating UMI dataset without `video=True` creates ~150GB on disk and requires ~80GB in RAM."
|
||||
)
|
||||
|
||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
|
||||
@@ -27,6 +27,7 @@ from PIL import Image as PILImage
|
||||
|
||||
from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, save_images_concurrently
|
||||
from lerobot.common.datasets.utils import (
|
||||
calculate_episode_data_index,
|
||||
hf_transform_to_torch,
|
||||
)
|
||||
from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
|
||||
@@ -54,37 +55,42 @@ def check_format(raw_dir):
|
||||
assert all(len(nested_dict[subkey]) == expected_len for subkey in subkeys if subkey in nested_dict)
|
||||
|
||||
|
||||
def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episodes: list[int] | None = None):
|
||||
pkl_path = raw_dir / "buffer.pkl"
|
||||
|
||||
with open(pkl_path, "rb") as f:
|
||||
pkl_data = pickle.load(f)
|
||||
|
||||
ep_dicts = []
|
||||
episode_data_index = {"from": [], "to": []}
|
||||
|
||||
id_from = 0
|
||||
id_to = 0
|
||||
ep_idx = 0
|
||||
total_frames = pkl_data["actions"].shape[0]
|
||||
for i in tqdm.tqdm(range(total_frames)):
|
||||
id_to += 1
|
||||
|
||||
if not pkl_data["dones"][i]:
|
||||
# load data indices from which each episode starts and ends
|
||||
from_ids, to_ids = [], []
|
||||
from_idx, to_idx = 0, 0
|
||||
for done in pkl_data["dones"]:
|
||||
to_idx += 1
|
||||
if not done:
|
||||
continue
|
||||
from_ids.append(from_idx)
|
||||
to_ids.append(to_idx)
|
||||
from_idx = to_idx
|
||||
|
||||
num_frames = id_to - id_from
|
||||
num_episodes = len(from_ids)
|
||||
|
||||
image = torch.tensor(pkl_data["observations"]["rgb"][id_from:id_to])
|
||||
ep_dicts = []
|
||||
ep_ids = episodes if episodes else range(num_episodes)
|
||||
for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
|
||||
from_idx = from_ids[selected_ep_idx]
|
||||
to_idx = to_ids[selected_ep_idx]
|
||||
num_frames = to_idx - from_idx
|
||||
|
||||
image = torch.tensor(pkl_data["observations"]["rgb"][from_idx:to_idx])
|
||||
image = einops.rearrange(image, "b c h w -> b h w c")
|
||||
state = torch.tensor(pkl_data["observations"]["state"][id_from:id_to])
|
||||
action = torch.tensor(pkl_data["actions"][id_from:id_to])
|
||||
state = torch.tensor(pkl_data["observations"]["state"][from_idx:to_idx])
|
||||
action = torch.tensor(pkl_data["actions"][from_idx:to_idx])
|
||||
# TODO(rcadene): we have a missing last frame which is the observation when the env is done
|
||||
# it is critical to have this frame for tdmpc to predict a "done observation/state"
|
||||
# next_image = torch.tensor(pkl_data["next_observations"]["rgb"][id_from:id_to])
|
||||
# next_state = torch.tensor(pkl_data["next_observations"]["state"][id_from:id_to])
|
||||
next_reward = torch.tensor(pkl_data["rewards"][id_from:id_to])
|
||||
next_done = torch.tensor(pkl_data["dones"][id_from:id_to])
|
||||
# next_image = torch.tensor(pkl_data["next_observations"]["rgb"][from_idx:to_idx])
|
||||
# next_state = torch.tensor(pkl_data["next_observations"]["state"][from_idx:to_idx])
|
||||
next_reward = torch.tensor(pkl_data["rewards"][from_idx:to_idx])
|
||||
next_done = torch.tensor(pkl_data["dones"][from_idx:to_idx])
|
||||
|
||||
ep_dict = {}
|
||||
|
||||
@@ -92,12 +98,12 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
img_key = "observation.image"
|
||||
if video:
|
||||
# save png images in temporary directory
|
||||
tmp_imgs_dir = out_dir / "tmp_images"
|
||||
tmp_imgs_dir = videos_dir / "tmp_images"
|
||||
save_images_concurrently(imgs_array, tmp_imgs_dir)
|
||||
|
||||
# encode images to a mp4 video
|
||||
fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
|
||||
video_path = out_dir / "videos" / fname
|
||||
video_path = videos_dir / fname
|
||||
encode_video_frames(tmp_imgs_dir, video_path, fps)
|
||||
|
||||
# clean temporary images directory
|
||||
@@ -119,18 +125,11 @@ def load_from_raw(raw_dir, out_dir, fps, video, debug):
|
||||
ep_dict["next.done"] = next_done
|
||||
ep_dicts.append(ep_dict)
|
||||
|
||||
episode_data_index["from"].append(id_from)
|
||||
episode_data_index["to"].append(id_from + num_frames)
|
||||
|
||||
id_from = id_to
|
||||
ep_idx += 1
|
||||
|
||||
# process first episode only
|
||||
if debug:
|
||||
break
|
||||
|
||||
data_dict = concatenate_episodes(ep_dicts)
|
||||
return data_dict, episode_data_index
|
||||
|
||||
total_frames = data_dict["frame_index"].shape[0]
|
||||
data_dict["index"] = torch.arange(0, total_frames, 1)
|
||||
return data_dict
|
||||
|
||||
|
||||
def to_hf_dataset(data_dict, video):
|
||||
@@ -161,16 +160,22 @@ def to_hf_dataset(data_dict, video):
|
||||
return hf_dataset
|
||||
|
||||
|
||||
def from_raw_to_lerobot_format(raw_dir: Path, out_dir: Path, fps=None, video=True, debug=False):
|
||||
def from_raw_to_lerobot_format(
|
||||
raw_dir: Path,
|
||||
videos_dir: Path,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
episodes: list[int] | None = None,
|
||||
):
|
||||
# sanity check
|
||||
check_format(raw_dir)
|
||||
|
||||
if fps is None:
|
||||
fps = 15
|
||||
|
||||
data_dict, episode_data_index = load_from_raw(raw_dir, out_dir, fps, video, debug)
|
||||
data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes)
|
||||
hf_dataset = to_hf_dataset(data_dict, video)
|
||||
|
||||
episode_data_index = calculate_episode_data_index(hf_dataset)
|
||||
info = {
|
||||
"fps": fps,
|
||||
"video": video,
|
||||
|
||||
61
lerobot/common/datasets/sampler.py
Normal file
61
lerobot/common/datasets/sampler.py
Normal file
@@ -0,0 +1,61 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
from typing import Iterator, Union
|
||||
|
||||
import torch
|
||||
|
||||
|
||||
class EpisodeAwareSampler:
|
||||
def __init__(
|
||||
self,
|
||||
episode_data_index: dict,
|
||||
episode_indices_to_use: Union[list, None] = None,
|
||||
drop_n_first_frames: int = 0,
|
||||
drop_n_last_frames: int = 0,
|
||||
shuffle: bool = False,
|
||||
):
|
||||
"""Sampler that optionally incorporates episode boundary information.
|
||||
|
||||
Args:
|
||||
episode_data_index: Dictionary with keys 'from' and 'to' containing the start and end indices of each episode.
|
||||
episode_indices_to_use: List of episode indices to use. If None, all episodes are used.
|
||||
Assumes that episodes are indexed from 0 to N-1.
|
||||
drop_n_first_frames: Number of frames to drop from the start of each episode.
|
||||
drop_n_last_frames: Number of frames to drop from the end of each episode.
|
||||
shuffle: Whether to shuffle the indices.
|
||||
"""
|
||||
indices = []
|
||||
for episode_idx, (start_index, end_index) in enumerate(
|
||||
zip(episode_data_index["from"], episode_data_index["to"], strict=True)
|
||||
):
|
||||
if episode_indices_to_use is None or episode_idx in episode_indices_to_use:
|
||||
indices.extend(
|
||||
range(start_index.item() + drop_n_first_frames, end_index.item() - drop_n_last_frames)
|
||||
)
|
||||
|
||||
self.indices = indices
|
||||
self.shuffle = shuffle
|
||||
|
||||
def __iter__(self) -> Iterator[int]:
|
||||
if self.shuffle:
|
||||
for i in torch.randperm(len(self.indices)):
|
||||
yield self.indices[i]
|
||||
else:
|
||||
for i in self.indices:
|
||||
yield i
|
||||
|
||||
def __len__(self) -> int:
|
||||
return len(self.indices)
|
||||
197
lerobot/common/datasets/transforms.py
Normal file
197
lerobot/common/datasets/transforms.py
Normal file
@@ -0,0 +1,197 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import collections
|
||||
from typing import Any, Callable, Dict, Sequence
|
||||
|
||||
import torch
|
||||
from torchvision.transforms import v2
|
||||
from torchvision.transforms.v2 import Transform
|
||||
from torchvision.transforms.v2 import functional as F # noqa: N812
|
||||
|
||||
|
||||
class RandomSubsetApply(Transform):
|
||||
"""Apply a random subset of N transformations from a list of transformations.
|
||||
|
||||
Args:
|
||||
transforms: list of transformations.
|
||||
p: represents the multinomial probabilities (with no replacement) used for sampling the transform.
|
||||
If the sum of the weights is not 1, they will be normalized. If ``None`` (default), all transforms
|
||||
have the same probability.
|
||||
n_subset: number of transformations to apply. If ``None``, all transforms are applied.
|
||||
Must be in [1, len(transforms)].
|
||||
random_order: apply transformations in a random order.
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
transforms: Sequence[Callable],
|
||||
p: list[float] | None = None,
|
||||
n_subset: int | None = None,
|
||||
random_order: bool = False,
|
||||
) -> None:
|
||||
super().__init__()
|
||||
if not isinstance(transforms, Sequence):
|
||||
raise TypeError("Argument transforms should be a sequence of callables")
|
||||
if p is None:
|
||||
p = [1] * len(transforms)
|
||||
elif len(p) != len(transforms):
|
||||
raise ValueError(
|
||||
f"Length of p doesn't match the number of transforms: {len(p)} != {len(transforms)}"
|
||||
)
|
||||
|
||||
if n_subset is None:
|
||||
n_subset = len(transforms)
|
||||
elif not isinstance(n_subset, int):
|
||||
raise TypeError("n_subset should be an int or None")
|
||||
elif not (1 <= n_subset <= len(transforms)):
|
||||
raise ValueError(f"n_subset should be in the interval [1, {len(transforms)}]")
|
||||
|
||||
self.transforms = transforms
|
||||
total = sum(p)
|
||||
self.p = [prob / total for prob in p]
|
||||
self.n_subset = n_subset
|
||||
self.random_order = random_order
|
||||
|
||||
def forward(self, *inputs: Any) -> Any:
|
||||
needs_unpacking = len(inputs) > 1
|
||||
|
||||
selected_indices = torch.multinomial(torch.tensor(self.p), self.n_subset)
|
||||
if not self.random_order:
|
||||
selected_indices = selected_indices.sort().values
|
||||
|
||||
selected_transforms = [self.transforms[i] for i in selected_indices]
|
||||
|
||||
for transform in selected_transforms:
|
||||
outputs = transform(*inputs)
|
||||
inputs = outputs if needs_unpacking else (outputs,)
|
||||
|
||||
return outputs
|
||||
|
||||
def extra_repr(self) -> str:
|
||||
return (
|
||||
f"transforms={self.transforms}, "
|
||||
f"p={self.p}, "
|
||||
f"n_subset={self.n_subset}, "
|
||||
f"random_order={self.random_order}"
|
||||
)
|
||||
|
||||
|
||||
class SharpnessJitter(Transform):
|
||||
"""Randomly change the sharpness of an image or video.
|
||||
|
||||
Similar to a v2.RandomAdjustSharpness with p=1 and a sharpness_factor sampled randomly.
|
||||
While v2.RandomAdjustSharpness applies — with a given probability — a fixed sharpness_factor to an image,
|
||||
SharpnessJitter applies a random sharpness_factor each time. This is to have a more diverse set of
|
||||
augmentations as a result.
|
||||
|
||||
A sharpness_factor of 0 gives a blurred image, 1 gives the original image while 2 increases the sharpness
|
||||
by a factor of 2.
|
||||
|
||||
If the input is a :class:`torch.Tensor`,
|
||||
it is expected to have [..., 1 or 3, H, W] shape, where ... means an arbitrary number of leading dimensions.
|
||||
|
||||
Args:
|
||||
sharpness: How much to jitter sharpness. sharpness_factor is chosen uniformly from
|
||||
[max(0, 1 - sharpness), 1 + sharpness] or the given
|
||||
[min, max]. Should be non negative numbers.
|
||||
"""
|
||||
|
||||
def __init__(self, sharpness: float | Sequence[float]) -> None:
|
||||
super().__init__()
|
||||
self.sharpness = self._check_input(sharpness)
|
||||
|
||||
def _check_input(self, sharpness):
|
||||
if isinstance(sharpness, (int, float)):
|
||||
if sharpness < 0:
|
||||
raise ValueError("If sharpness is a single number, it must be non negative.")
|
||||
sharpness = [1.0 - sharpness, 1.0 + sharpness]
|
||||
sharpness[0] = max(sharpness[0], 0.0)
|
||||
elif isinstance(sharpness, collections.abc.Sequence) and len(sharpness) == 2:
|
||||
sharpness = [float(v) for v in sharpness]
|
||||
else:
|
||||
raise TypeError(f"{sharpness=} should be a single number or a sequence with length 2.")
|
||||
|
||||
if not 0.0 <= sharpness[0] <= sharpness[1]:
|
||||
raise ValueError(f"sharpnesss values should be between (0., inf), but got {sharpness}.")
|
||||
|
||||
return float(sharpness[0]), float(sharpness[1])
|
||||
|
||||
def _generate_value(self, left: float, right: float) -> float:
|
||||
return torch.empty(1).uniform_(left, right).item()
|
||||
|
||||
def _transform(self, inpt: Any, params: Dict[str, Any]) -> Any:
|
||||
sharpness_factor = self._generate_value(self.sharpness[0], self.sharpness[1])
|
||||
return self._call_kernel(F.adjust_sharpness, inpt, sharpness_factor=sharpness_factor)
|
||||
|
||||
|
||||
def get_image_transforms(
|
||||
brightness_weight: float = 1.0,
|
||||
brightness_min_max: tuple[float, float] | None = None,
|
||||
contrast_weight: float = 1.0,
|
||||
contrast_min_max: tuple[float, float] | None = None,
|
||||
saturation_weight: float = 1.0,
|
||||
saturation_min_max: tuple[float, float] | None = None,
|
||||
hue_weight: float = 1.0,
|
||||
hue_min_max: tuple[float, float] | None = None,
|
||||
sharpness_weight: float = 1.0,
|
||||
sharpness_min_max: tuple[float, float] | None = None,
|
||||
max_num_transforms: int | None = None,
|
||||
random_order: bool = False,
|
||||
):
|
||||
def check_value(name, weight, min_max):
|
||||
if min_max is not None:
|
||||
if len(min_max) != 2:
|
||||
raise ValueError(
|
||||
f"`{name}_min_max` is expected to be a tuple of 2 dimensions, but {min_max} provided."
|
||||
)
|
||||
if weight < 0.0:
|
||||
raise ValueError(
|
||||
f"`{name}_weight` is expected to be 0 or positive, but is negative ({weight})."
|
||||
)
|
||||
|
||||
check_value("brightness", brightness_weight, brightness_min_max)
|
||||
check_value("contrast", contrast_weight, contrast_min_max)
|
||||
check_value("saturation", saturation_weight, saturation_min_max)
|
||||
check_value("hue", hue_weight, hue_min_max)
|
||||
check_value("sharpness", sharpness_weight, sharpness_min_max)
|
||||
|
||||
weights = []
|
||||
transforms = []
|
||||
if brightness_min_max is not None and brightness_weight > 0.0:
|
||||
weights.append(brightness_weight)
|
||||
transforms.append(v2.ColorJitter(brightness=brightness_min_max))
|
||||
if contrast_min_max is not None and contrast_weight > 0.0:
|
||||
weights.append(contrast_weight)
|
||||
transforms.append(v2.ColorJitter(contrast=contrast_min_max))
|
||||
if saturation_min_max is not None and saturation_weight > 0.0:
|
||||
weights.append(saturation_weight)
|
||||
transforms.append(v2.ColorJitter(saturation=saturation_min_max))
|
||||
if hue_min_max is not None and hue_weight > 0.0:
|
||||
weights.append(hue_weight)
|
||||
transforms.append(v2.ColorJitter(hue=hue_min_max))
|
||||
if sharpness_min_max is not None and sharpness_weight > 0.0:
|
||||
weights.append(sharpness_weight)
|
||||
transforms.append(SharpnessJitter(sharpness=sharpness_min_max))
|
||||
|
||||
n_subset = len(transforms)
|
||||
if max_num_transforms is not None:
|
||||
n_subset = min(n_subset, max_num_transforms)
|
||||
|
||||
if n_subset == 0:
|
||||
return v2.Identity()
|
||||
else:
|
||||
# TODO(rcadene, aliberts): add v2.ToDtype float16?
|
||||
return RandomSubsetApply(transforms, p=weights, n_subset=n_subset, random_order=random_order)
|
||||
@@ -59,20 +59,40 @@ def unflatten_dict(d, sep="/"):
|
||||
return outdict
|
||||
|
||||
|
||||
def hf_transform_to_torch(items_dict):
|
||||
def hf_transform_to_torch(
|
||||
items_dict: dict[torch.Tensor | None],
|
||||
lang_tokenizer_name: str = "t5-small",
|
||||
):
|
||||
"""Get a transform function that convert items from Hugging Face dataset (pyarrow)
|
||||
to torch tensors. Importantly, images are converted from PIL, which corresponds to
|
||||
a channel last representation (h w c) of uint8 type, to a torch image representation
|
||||
with channel first (c h w) of float32 type in range [0,1].
|
||||
"""
|
||||
# tokenize language instructions if it exists
|
||||
if "language_instruction" in items_dict:
|
||||
from transformers import AutoTokenizer
|
||||
|
||||
tokenizer = AutoTokenizer.from_pretrained(lang_tokenizer_name)
|
||||
tokenizer_kwargs = {
|
||||
"max_length": 64, # NOTE: adjust this value accordingly
|
||||
"padding": "max_length",
|
||||
"truncation": True,
|
||||
"return_tensors": "pt",
|
||||
}
|
||||
|
||||
for key in items_dict:
|
||||
first_item = items_dict[key][0]
|
||||
if isinstance(first_item, PILImage.Image):
|
||||
to_tensor = transforms.ToTensor()
|
||||
items_dict[key] = [to_tensor(img) for img in items_dict[key]]
|
||||
elif isinstance(first_item, str):
|
||||
# convert str to lang embeddings via language tokenizer
|
||||
items_dict[key] = [tokenizer.encode(x, **tokenizer_kwargs) for x in items_dict[key]]
|
||||
elif isinstance(first_item, dict) and "path" in first_item and "timestamp" in first_item:
|
||||
# video frame will be processed downstream
|
||||
pass
|
||||
elif first_item is None:
|
||||
pass
|
||||
else:
|
||||
items_dict[key] = [torch.tensor(x) for x in items_dict[key]]
|
||||
return items_dict
|
||||
@@ -318,8 +338,7 @@ def calculate_episode_data_index(hf_dataset: datasets.Dataset) -> Dict[str, torc
|
||||
|
||||
|
||||
def reset_episode_index(hf_dataset: datasets.Dataset) -> datasets.Dataset:
|
||||
"""
|
||||
Reset the `episode_index` of the provided HuggingFace Dataset.
|
||||
"""Reset the `episode_index` of the provided HuggingFace Dataset.
|
||||
|
||||
`episode_data_index` (and related functionality such as `load_previous_and_future_frames`) requires the
|
||||
`episode_index` to be sorted, continuous (1,1,1 and not 1,2,1) and start at 0.
|
||||
@@ -338,6 +357,7 @@ def reset_episode_index(hf_dataset: datasets.Dataset) -> datasets.Dataset:
|
||||
return example
|
||||
|
||||
hf_dataset = hf_dataset.map(modify_ep_idx_func)
|
||||
|
||||
return hf_dataset
|
||||
|
||||
|
||||
|
||||
@@ -16,6 +16,7 @@
|
||||
import logging
|
||||
import subprocess
|
||||
import warnings
|
||||
from collections import OrderedDict
|
||||
from dataclasses import dataclass, field
|
||||
from pathlib import Path
|
||||
from typing import Any, ClassVar
|
||||
@@ -27,7 +28,11 @@ from datasets.features.features import register_feature
|
||||
|
||||
|
||||
def load_from_videos(
|
||||
item: dict[str, torch.Tensor], video_frame_keys: list[str], videos_dir: Path, tolerance_s: float
|
||||
item: dict[str, torch.Tensor],
|
||||
video_frame_keys: list[str],
|
||||
videos_dir: Path,
|
||||
tolerance_s: float,
|
||||
backend: str = "pyav",
|
||||
):
|
||||
"""Note: When using data workers (e.g. DataLoader with num_workers>0), do not call this function
|
||||
in the main process (e.g. by using a second Dataloader with num_workers=0). It will result in a Segmentation Fault.
|
||||
@@ -46,14 +51,14 @@ def load_from_videos(
|
||||
raise NotImplementedError("All video paths are expected to be the same for now.")
|
||||
video_path = data_dir / paths[0]
|
||||
|
||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s)
|
||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
|
||||
item[key] = frames
|
||||
else:
|
||||
# load one frame
|
||||
timestamps = [item[key]["timestamp"]]
|
||||
video_path = data_dir / item[key]["path"]
|
||||
|
||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s)
|
||||
frames = decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
|
||||
item[key] = frames[0]
|
||||
|
||||
return item
|
||||
@@ -63,11 +68,22 @@ def decode_video_frames_torchvision(
|
||||
video_path: str,
|
||||
timestamps: list[float],
|
||||
tolerance_s: float,
|
||||
device: str = "cpu",
|
||||
backend: str = "pyav",
|
||||
log_loaded_timestamps: bool = False,
|
||||
):
|
||||
) -> torch.Tensor:
|
||||
"""Loads frames associated to the requested timestamps of a video
|
||||
|
||||
The backend can be either "pyav" (default) or "video_reader".
|
||||
"video_reader" requires installing torchvision from source, see:
|
||||
https://github.com/pytorch/vision/blob/main/torchvision/csrc/io/decoder/gpu/README.rst
|
||||
(note that you need to compile against ffmpeg<4.3)
|
||||
|
||||
While both use cpu, "video_reader" is supposedly faster than "pyav" but requires additional setup.
|
||||
For more info on video decoding, see `benchmark/video/README.md`
|
||||
|
||||
See torchvision doc for more info on these two backends:
|
||||
https://pytorch.org/vision/0.18/index.html?highlight=backend#torchvision.set_video_backend
|
||||
|
||||
Note: Video benefits from inter-frame compression. Instead of storing every frame individually,
|
||||
the encoder stores a reference frame (or a key frame) and subsequent frames as differences relative to
|
||||
that key frame. As a consequence, to access a requested frame, we need to load the preceding key frame,
|
||||
@@ -78,21 +94,9 @@ def decode_video_frames_torchvision(
|
||||
|
||||
# set backend
|
||||
keyframes_only = False
|
||||
if device == "cpu":
|
||||
# explicitely use pyav
|
||||
torchvision.set_video_backend("pyav")
|
||||
torchvision.set_video_backend(backend)
|
||||
if backend == "pyav":
|
||||
keyframes_only = True # pyav doesnt support accuracte seek
|
||||
elif device == "cuda":
|
||||
# TODO(rcadene, aliberts): implement video decoding with GPU
|
||||
# torchvision.set_video_backend("cuda")
|
||||
# torchvision.set_video_backend("video_reader")
|
||||
# requires installing torchvision from source, see: https://github.com/pytorch/vision/blob/main/torchvision/csrc/io/decoder/gpu/README.rst
|
||||
# check possible bug: https://github.com/pytorch/vision/issues/7745
|
||||
raise NotImplementedError(
|
||||
"Video decoding on gpu with cuda is currently not supported. Use `device='cpu'`."
|
||||
)
|
||||
else:
|
||||
raise ValueError(device)
|
||||
|
||||
# set a video stream reader
|
||||
# TODO(rcadene): also load audio stream at the same time
|
||||
@@ -120,7 +124,9 @@ def decode_video_frames_torchvision(
|
||||
if current_ts >= last_ts:
|
||||
break
|
||||
|
||||
reader.container.close()
|
||||
if backend == "pyav":
|
||||
reader.container.close()
|
||||
|
||||
reader = None
|
||||
|
||||
query_ts = torch.tensor(timestamps)
|
||||
@@ -136,6 +142,10 @@ def decode_video_frames_torchvision(
|
||||
"It means that the closest frame that can be loaded from the video is too far away in time."
|
||||
"This might be due to synchronization issues with timestamps during data collection."
|
||||
"To be safe, we advise to ignore this item during training."
|
||||
f"\nqueried timestamps: {query_ts}"
|
||||
f"\nloaded timestamps: {loaded_ts}"
|
||||
f"\nvideo: {video_path}"
|
||||
f"\nbackend: {backend}"
|
||||
)
|
||||
|
||||
# get closest frames to the query timestamps
|
||||
@@ -152,22 +162,52 @@ def decode_video_frames_torchvision(
|
||||
return closest_frames
|
||||
|
||||
|
||||
def encode_video_frames(imgs_dir: Path, video_path: Path, fps: int):
|
||||
"""More info on ffmpeg arguments tuning on `lerobot/common/datasets/_video_benchmark/README.md`"""
|
||||
def encode_video_frames(
|
||||
imgs_dir: Path,
|
||||
video_path: Path,
|
||||
fps: int,
|
||||
video_codec: str = "libsvtav1",
|
||||
pixel_format: str = "yuv420p",
|
||||
group_of_pictures_size: int | None = 2,
|
||||
constant_rate_factor: int | None = 30,
|
||||
fast_decode: int = 0,
|
||||
log_level: str | None = "error",
|
||||
overwrite: bool = False,
|
||||
) -> None:
|
||||
"""More info on ffmpeg arguments tuning on `benchmark/video/README.md`"""
|
||||
video_path = Path(video_path)
|
||||
video_path.parent.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
ffmpeg_cmd = (
|
||||
f"ffmpeg -r {fps} "
|
||||
"-f image2 "
|
||||
"-loglevel error "
|
||||
f"-i {str(imgs_dir / 'frame_%06d.png')} "
|
||||
"-vcodec libx264 "
|
||||
"-g 2 "
|
||||
"-pix_fmt yuv444p "
|
||||
f"{str(video_path)}"
|
||||
ffmpeg_args = OrderedDict(
|
||||
[
|
||||
("-f", "image2"),
|
||||
("-r", str(fps)),
|
||||
("-i", str(imgs_dir / "frame_%06d.png")),
|
||||
("-vcodec", video_codec),
|
||||
("-pix_fmt", pixel_format),
|
||||
]
|
||||
)
|
||||
subprocess.run(ffmpeg_cmd.split(" "), check=True)
|
||||
|
||||
if group_of_pictures_size is not None:
|
||||
ffmpeg_args["-g"] = str(group_of_pictures_size)
|
||||
|
||||
if constant_rate_factor is not None:
|
||||
ffmpeg_args["-crf"] = str(constant_rate_factor)
|
||||
|
||||
if fast_decode:
|
||||
key = "-svtav1-params" if video_codec == "libsvtav1" else "-tune"
|
||||
value = f"fast-decode={fast_decode}" if video_codec == "libsvtav1" else "fastdecode"
|
||||
ffmpeg_args[key] = value
|
||||
|
||||
if log_level is not None:
|
||||
ffmpeg_args["-loglevel"] = str(log_level)
|
||||
|
||||
ffmpeg_args = [item for pair in ffmpeg_args.items() for item in pair]
|
||||
if overwrite:
|
||||
ffmpeg_args.append("-y")
|
||||
|
||||
ffmpeg_cmd = ["ffmpeg"] + ffmpeg_args + [str(video_path)]
|
||||
subprocess.run(ffmpeg_cmd, check=True)
|
||||
|
||||
|
||||
@dataclass
|
||||
|
||||
@@ -27,14 +27,6 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
|
||||
if n_envs is not None and n_envs < 1:
|
||||
raise ValueError("`n_envs must be at least 1")
|
||||
|
||||
kwargs = {
|
||||
"obs_type": "pixels_agent_pos",
|
||||
"render_mode": "rgb_array",
|
||||
"max_episode_steps": cfg.env.episode_length,
|
||||
"visualization_width": 384,
|
||||
"visualization_height": 384,
|
||||
}
|
||||
|
||||
package_name = f"gym_{cfg.env.name}"
|
||||
|
||||
try:
|
||||
@@ -46,12 +38,16 @@ def make_env(cfg: DictConfig, n_envs: int | None = None) -> gym.vector.VectorEnv
|
||||
raise e
|
||||
|
||||
gym_handle = f"{package_name}/{cfg.env.task}"
|
||||
gym_kwgs = dict(cfg.env.get("gym", {}))
|
||||
|
||||
if cfg.env.get("episode_length"):
|
||||
gym_kwgs["max_episode_steps"] = cfg.env.episode_length
|
||||
|
||||
# batched version of the env that returns an observation of shape (b, c)
|
||||
env_cls = gym.vector.AsyncVectorEnv if cfg.eval.use_async_envs else gym.vector.SyncVectorEnv
|
||||
env = env_cls(
|
||||
[
|
||||
lambda: gym.make(gym_handle, disable_env_checker=True, **kwargs)
|
||||
lambda: gym.make(gym_handle, disable_env_checker=True, **gym_kwgs)
|
||||
for _ in range(n_envs if n_envs is not None else cfg.eval.batch_size)
|
||||
]
|
||||
)
|
||||
|
||||
@@ -28,31 +28,35 @@ def preprocess_observation(observations: dict[str, np.ndarray]) -> dict[str, Ten
|
||||
"""
|
||||
# map to expected inputs for the policy
|
||||
return_observations = {}
|
||||
if "pixels" in observations:
|
||||
if isinstance(observations["pixels"], dict):
|
||||
imgs = {f"observation.images.{key}": img for key, img in observations["pixels"].items()}
|
||||
else:
|
||||
imgs = {"observation.image": observations["pixels"]}
|
||||
|
||||
if isinstance(observations["pixels"], dict):
|
||||
imgs = {f"observation.images.{key}": img for key, img in observations["pixels"].items()}
|
||||
else:
|
||||
imgs = {"observation.image": observations["pixels"]}
|
||||
for imgkey, img in imgs.items():
|
||||
img = torch.from_numpy(img)
|
||||
|
||||
for imgkey, img in imgs.items():
|
||||
img = torch.from_numpy(img)
|
||||
# sanity check that images are channel last
|
||||
_, h, w, c = img.shape
|
||||
assert c < h and c < w, f"expect channel first images, but instead {img.shape}"
|
||||
|
||||
# sanity check that images are channel last
|
||||
_, h, w, c = img.shape
|
||||
assert c < h and c < w, f"expect channel first images, but instead {img.shape}"
|
||||
# sanity check that images are uint8
|
||||
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
||||
|
||||
# sanity check that images are uint8
|
||||
assert img.dtype == torch.uint8, f"expect torch.uint8, but instead {img.dtype=}"
|
||||
# convert to channel first of type float32 in range [0,1]
|
||||
img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
|
||||
img = img.type(torch.float32)
|
||||
img /= 255
|
||||
|
||||
# convert to channel first of type float32 in range [0,1]
|
||||
img = einops.rearrange(img, "b h w c -> b c h w").contiguous()
|
||||
img = img.type(torch.float32)
|
||||
img /= 255
|
||||
return_observations[imgkey] = img
|
||||
|
||||
return_observations[imgkey] = img
|
||||
if "environment_state" in observations:
|
||||
return_observations["observation.environment_state"] = torch.from_numpy(
|
||||
observations["environment_state"]
|
||||
).float()
|
||||
|
||||
# TODO(rcadene): enable pixels only baseline with `obs_type="pixels"` in environment by removing
|
||||
# requirement for "agent_pos"
|
||||
return_observations["observation.state"] = torch.from_numpy(observations["agent_pos"]).float()
|
||||
|
||||
return return_observations
|
||||
|
||||
@@ -13,25 +13,33 @@
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
"""Borrowed from https://github.com/fyhMer/fowm/blob/main/src/logger.py
|
||||
|
||||
# TODO(rcadene, alexander-soare): clean this file
|
||||
"""Borrowed from https://github.com/fyhMer/fowm/blob/main/src/logger.py"""
|
||||
"""
|
||||
|
||||
import logging
|
||||
import os
|
||||
import re
|
||||
from glob import glob
|
||||
from pathlib import Path
|
||||
|
||||
import torch
|
||||
from huggingface_hub.constants import SAFETENSORS_SINGLE_FILE
|
||||
from omegaconf import OmegaConf
|
||||
from omegaconf import DictConfig, OmegaConf
|
||||
from termcolor import colored
|
||||
from torch.optim import Optimizer
|
||||
from torch.optim.lr_scheduler import LRScheduler
|
||||
|
||||
from lerobot.common.policies.policy_protocol import Policy
|
||||
from lerobot.common.utils.utils import get_global_random_state, set_global_random_state
|
||||
|
||||
|
||||
def log_output_dir(out_dir):
|
||||
logging.info(colored("Output dir:", "yellow", attrs=["bold"]) + f" {out_dir}")
|
||||
|
||||
|
||||
def cfg_to_group(cfg, return_list=False):
|
||||
def cfg_to_group(cfg: DictConfig, return_list: bool = False) -> list[str] | str:
|
||||
"""Return a group name for logging. Optionally returns group name as list."""
|
||||
lst = [
|
||||
f"policy:{cfg.policy.name}",
|
||||
@@ -42,22 +50,54 @@ def cfg_to_group(cfg, return_list=False):
|
||||
return lst if return_list else "-".join(lst)
|
||||
|
||||
|
||||
class Logger:
|
||||
"""Primary logger object. Logs either locally or using wandb."""
|
||||
def get_wandb_run_id_from_filesystem(checkpoint_dir: Path) -> str:
|
||||
# Get the WandB run ID.
|
||||
paths = glob(str(checkpoint_dir / "../wandb/latest-run/run-*"))
|
||||
if len(paths) != 1:
|
||||
raise RuntimeError("Couldn't get the previous WandB run ID for run resumption.")
|
||||
match = re.search(r"run-([^\.]+).wandb", paths[0].split("/")[-1])
|
||||
if match is None:
|
||||
raise RuntimeError("Couldn't get the previous WandB run ID for run resumption.")
|
||||
wandb_run_id = match.groups(0)[0]
|
||||
return wandb_run_id
|
||||
|
||||
def __init__(self, log_dir, job_name, cfg):
|
||||
self._log_dir = Path(log_dir)
|
||||
self._log_dir.mkdir(parents=True, exist_ok=True)
|
||||
self._job_name = job_name
|
||||
self._model_dir = self._log_dir / "checkpoints"
|
||||
self._buffer_dir = self._log_dir / "buffers"
|
||||
self._save_model = cfg.training.save_model
|
||||
self._disable_wandb_artifact = cfg.wandb.disable_artifact
|
||||
self._save_buffer = cfg.training.get("save_buffer", False)
|
||||
self._group = cfg_to_group(cfg)
|
||||
self._seed = cfg.seed
|
||||
|
||||
class Logger:
|
||||
"""Primary logger object. Logs either locally or using wandb.
|
||||
|
||||
The logger creates the following directory structure:
|
||||
|
||||
provided_log_dir
|
||||
├── .hydra # hydra's configuration cache
|
||||
├── checkpoints
|
||||
│ ├── specific_checkpoint_name
|
||||
│ │ ├── pretrained_model # Hugging Face pretrained model directory
|
||||
│ │ │ ├── ...
|
||||
│ │ └── training_state.pth # optimizer, scheduler, and random states + training step
|
||||
| ├── another_specific_checkpoint_name
|
||||
│ │ ├── ...
|
||||
| ├── ...
|
||||
│ └── last # a softlink to the last logged checkpoint
|
||||
"""
|
||||
|
||||
pretrained_model_dir_name = "pretrained_model"
|
||||
training_state_file_name = "training_state.pth"
|
||||
|
||||
def __init__(self, cfg: DictConfig, log_dir: str, wandb_job_name: str | None = None):
|
||||
"""
|
||||
Args:
|
||||
log_dir: The directory to save all logs and training outputs to.
|
||||
job_name: The WandB job name.
|
||||
"""
|
||||
self._cfg = cfg
|
||||
self._eval = []
|
||||
self.log_dir = Path(log_dir)
|
||||
self.log_dir.mkdir(parents=True, exist_ok=True)
|
||||
self.checkpoints_dir = self.get_checkpoints_dir(log_dir)
|
||||
self.last_checkpoint_dir = self.get_last_checkpoint_dir(log_dir)
|
||||
self.last_pretrained_model_dir = self.get_last_pretrained_model_dir(log_dir)
|
||||
|
||||
# Set up WandB.
|
||||
self._group = cfg_to_group(cfg)
|
||||
project = cfg.get("wandb", {}).get("project")
|
||||
entity = cfg.get("wandb", {}).get("entity")
|
||||
enable_wandb = cfg.get("wandb", {}).get("enable", False)
|
||||
@@ -69,65 +109,127 @@ class Logger:
|
||||
os.environ["WANDB_SILENT"] = "true"
|
||||
import wandb
|
||||
|
||||
wandb_run_id = None
|
||||
if cfg.resume:
|
||||
wandb_run_id = get_wandb_run_id_from_filesystem(self.checkpoints_dir)
|
||||
|
||||
wandb.init(
|
||||
id=wandb_run_id,
|
||||
project=project,
|
||||
entity=entity,
|
||||
name=job_name,
|
||||
name=wandb_job_name,
|
||||
notes=cfg.get("wandb", {}).get("notes"),
|
||||
# group=self._group,
|
||||
tags=cfg_to_group(cfg, return_list=True),
|
||||
dir=self._log_dir,
|
||||
dir=log_dir,
|
||||
config=OmegaConf.to_container(cfg, resolve=True),
|
||||
# TODO(rcadene): try set to True
|
||||
save_code=False,
|
||||
# TODO(rcadene): split train and eval, and run async eval with job_type="eval"
|
||||
job_type="train_eval",
|
||||
# TODO(rcadene): add resume option
|
||||
resume=None,
|
||||
resume="must" if cfg.resume else None,
|
||||
)
|
||||
print(colored("Logs will be synced with wandb.", "blue", attrs=["bold"]))
|
||||
logging.info(f"Track this run --> {colored(wandb.run.get_url(), 'yellow', attrs=['bold'])}")
|
||||
self._wandb = wandb
|
||||
|
||||
def save_model(self, policy: Policy, identifier):
|
||||
if self._save_model:
|
||||
self._model_dir.mkdir(parents=True, exist_ok=True)
|
||||
save_dir = self._model_dir / str(identifier)
|
||||
policy.save_pretrained(save_dir)
|
||||
# Also save the full Hydra config for the env configuration.
|
||||
OmegaConf.save(self._cfg, save_dir / "config.yaml")
|
||||
if self._wandb and not self._disable_wandb_artifact:
|
||||
# note wandb artifact does not accept ":" or "/" in its name
|
||||
artifact = self._wandb.Artifact(
|
||||
f"{self._group.replace(':', '_').replace('/', '_')}-{self._seed}-{identifier}",
|
||||
type="model",
|
||||
)
|
||||
artifact.add_file(save_dir / SAFETENSORS_SINGLE_FILE)
|
||||
self._wandb.log_artifact(artifact)
|
||||
@classmethod
|
||||
def get_checkpoints_dir(cls, log_dir: str | Path) -> Path:
|
||||
"""Given the log directory, get the sub-directory in which checkpoints will be saved."""
|
||||
return Path(log_dir) / "checkpoints"
|
||||
|
||||
def save_buffer(self, buffer, identifier):
|
||||
self._buffer_dir.mkdir(parents=True, exist_ok=True)
|
||||
fp = self._buffer_dir / f"{str(identifier)}.pkl"
|
||||
buffer.save(fp)
|
||||
if self._wandb and not self._disable_wandb_artifact:
|
||||
@classmethod
|
||||
def get_last_checkpoint_dir(cls, log_dir: str | Path) -> Path:
|
||||
"""Given the log directory, get the sub-directory in which the last checkpoint will be saved."""
|
||||
return cls.get_checkpoints_dir(log_dir) / "last"
|
||||
|
||||
@classmethod
|
||||
def get_last_pretrained_model_dir(cls, log_dir: str | Path) -> Path:
|
||||
"""
|
||||
Given the log directory, get the sub-directory in which the last checkpoint's pretrained weights will
|
||||
be saved.
|
||||
"""
|
||||
return cls.get_last_checkpoint_dir(log_dir) / cls.pretrained_model_dir_name
|
||||
|
||||
def save_model(self, save_dir: Path, policy: Policy, wandb_artifact_name: str | None = None):
|
||||
"""Save the weights of the Policy model using PyTorchModelHubMixin.
|
||||
|
||||
The weights are saved in a folder called "pretrained_model" under the checkpoint directory.
|
||||
|
||||
Optionally also upload the model to WandB.
|
||||
"""
|
||||
self.checkpoints_dir.mkdir(parents=True, exist_ok=True)
|
||||
policy.save_pretrained(save_dir)
|
||||
# Also save the full Hydra config for the env configuration.
|
||||
OmegaConf.save(self._cfg, save_dir / "config.yaml")
|
||||
if self._wandb and not self._cfg.wandb.disable_artifact:
|
||||
# note wandb artifact does not accept ":" or "/" in its name
|
||||
artifact = self._wandb.Artifact(
|
||||
f"{self._group.replace(':', '_').replace('/', '_')}-{self._seed}-{identifier}",
|
||||
type="buffer",
|
||||
)
|
||||
artifact.add_file(fp)
|
||||
artifact = self._wandb.Artifact(wandb_artifact_name, type="model")
|
||||
artifact.add_file(save_dir / SAFETENSORS_SINGLE_FILE)
|
||||
self._wandb.log_artifact(artifact)
|
||||
if self.last_checkpoint_dir.exists():
|
||||
os.remove(self.last_checkpoint_dir)
|
||||
|
||||
def finish(self, agent, buffer):
|
||||
if self._save_model:
|
||||
self.save_model(agent, identifier="final")
|
||||
if self._save_buffer:
|
||||
self.save_buffer(buffer, identifier="buffer")
|
||||
if self._wandb:
|
||||
self._wandb.finish()
|
||||
def save_training_state(
|
||||
self,
|
||||
save_dir: Path,
|
||||
train_step: int,
|
||||
optimizer: Optimizer,
|
||||
scheduler: LRScheduler | None,
|
||||
):
|
||||
"""Checkpoint the global training_step, optimizer state, scheduler state, and random state.
|
||||
|
||||
All of these are saved as "training_state.pth" under the checkpoint directory.
|
||||
"""
|
||||
training_state = {
|
||||
"step": train_step,
|
||||
"optimizer": optimizer.state_dict(),
|
||||
**get_global_random_state(),
|
||||
}
|
||||
if scheduler is not None:
|
||||
training_state["scheduler"] = scheduler.state_dict()
|
||||
torch.save(training_state, save_dir / self.training_state_file_name)
|
||||
|
||||
def save_checkpont(
|
||||
self,
|
||||
train_step: int,
|
||||
policy: Policy,
|
||||
optimizer: Optimizer,
|
||||
scheduler: LRScheduler | None,
|
||||
identifier: str,
|
||||
):
|
||||
"""Checkpoint the model weights and the training state."""
|
||||
checkpoint_dir = self.checkpoints_dir / str(identifier)
|
||||
wandb_artifact_name = (
|
||||
None
|
||||
if self._wandb is None
|
||||
else f"{self._group.replace(':', '_').replace('/', '_')}-{self._cfg.seed}-{identifier}"
|
||||
)
|
||||
self.save_model(
|
||||
checkpoint_dir / self.pretrained_model_dir_name, policy, wandb_artifact_name=wandb_artifact_name
|
||||
)
|
||||
self.save_training_state(checkpoint_dir, train_step, optimizer, scheduler)
|
||||
os.symlink(checkpoint_dir.absolute(), self.last_checkpoint_dir)
|
||||
|
||||
def load_last_training_state(self, optimizer: Optimizer, scheduler: LRScheduler | None) -> int:
|
||||
"""
|
||||
Given the last checkpoint in the logging directory, load the optimizer state, scheduler state, and
|
||||
random state, and return the global training step.
|
||||
"""
|
||||
training_state = torch.load(self.last_checkpoint_dir / self.training_state_file_name)
|
||||
optimizer.load_state_dict(training_state["optimizer"])
|
||||
if scheduler is not None:
|
||||
scheduler.load_state_dict(training_state["scheduler"])
|
||||
elif "scheduler" in training_state:
|
||||
raise ValueError(
|
||||
"The checkpoint contains a scheduler state_dict, but no LRScheduler was provided."
|
||||
)
|
||||
# Small hack to get the expected keys: use `get_global_random_state`.
|
||||
set_global_random_state({k: training_state[k] for k in get_global_random_state()})
|
||||
return training_state["step"]
|
||||
|
||||
def log_dict(self, d, step, mode="train"):
|
||||
assert mode in {"train", "eval"}
|
||||
# TODO(alexander-soare): Add local text log.
|
||||
if self._wandb is not None:
|
||||
for k, v in d.items():
|
||||
if not isinstance(v, (int, float, str)):
|
||||
@@ -139,5 +241,6 @@ class Logger:
|
||||
|
||||
def log_video(self, video_path: str, step: int, mode: str = "train"):
|
||||
assert mode in {"train", "eval"}
|
||||
assert self._wandb is not None
|
||||
wandb_video = self._wandb.Video(video_path, fps=self._cfg.fps, format="mp4")
|
||||
self._wandb.log({f"{mode}/video": wandb_video}, step=step)
|
||||
|
||||
@@ -25,6 +25,16 @@ class ACTConfig:
|
||||
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||
Those are: `input_shapes` and 'output_shapes`.
|
||||
|
||||
Notes on the inputs and outputs:
|
||||
- Either:
|
||||
- At least one key starting with "observation.image is required as an input.
|
||||
AND/OR
|
||||
- The key "observation.environment_state" is required as input.
|
||||
- If there are multiple keys beginning with "observation.images." they are treated as multiple camera
|
||||
views. Right now we only support all images having the same shape.
|
||||
- May optionally work without an "observation.state" key for the proprioceptive robot state.
|
||||
- "action" is required as an output key.
|
||||
|
||||
Args:
|
||||
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
||||
current step and additional steps going back).
|
||||
@@ -33,15 +43,15 @@ class ACTConfig:
|
||||
This should be no greater than the chunk size. For example, if the chunk size size 100, you may
|
||||
set this to 50. This would mean that the model predicts 100 steps worth of actions, runs 50 in the
|
||||
environment, and throws the other 50 out.
|
||||
input_shapes: A dictionary defining the shapes of the input data for the policy.
|
||||
The key represents the input data name, and the value is a list indicating the dimensions
|
||||
of the corresponding data. For example, "observation.images.top" refers to an input from the
|
||||
"top" camera with dimensions [3, 96, 96], indicating it has three color channels and 96x96 resolution.
|
||||
Importantly, shapes doesn't include batch dimension or temporal dimension.
|
||||
output_shapes: A dictionary defining the shapes of the output data for the policy.
|
||||
The key represents the output data name, and the value is a list indicating the dimensions
|
||||
of the corresponding data. For example, "action" refers to an output shape of [14], indicating
|
||||
14-dimensional actions. Importantly, shapes doesn't include batch dimension or temporal dimension.
|
||||
input_shapes: A dictionary defining the shapes of the input data for the policy. The key represents
|
||||
the input data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||
For example, "observation.image" refers to an input from a camera with dimensions [3, 96, 96],
|
||||
indicating it has three color channels and 96x96 resolution. Importantly, `input_shapes` doesn't
|
||||
include batch dimension or temporal dimension.
|
||||
output_shapes: A dictionary defining the shapes of the output data for the policy. The key represents
|
||||
the output data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||
For example, "action" refers to an output shape of [14], indicating 14-dimensional actions.
|
||||
Importantly, `output_shapes` doesn't include batch dimension or temporal dimension.
|
||||
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||
@@ -155,3 +165,8 @@ class ACTConfig:
|
||||
raise ValueError(
|
||||
f"Multiple observation steps not handled yet. Got `nobs_steps={self.n_obs_steps}`"
|
||||
)
|
||||
if (
|
||||
not any(k.startswith("observation.image") for k in self.input_shapes)
|
||||
and "observation.environment_state" not in self.input_shapes
|
||||
):
|
||||
raise ValueError("You must provide at least one image or the environment state among the inputs.")
|
||||
|
||||
@@ -97,7 +97,8 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
self.eval()
|
||||
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
if len(self.expected_image_keys) > 0:
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
|
||||
# If we are doing temporal ensembling, keep track of the exponential moving average (EMA), and return
|
||||
# the first action.
|
||||
@@ -135,7 +136,8 @@ class ACTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||
"""Run the batch through the model and compute the loss for training or validation."""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
if len(self.expected_image_keys) > 0:
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
batch = self.normalize_targets(batch)
|
||||
actions_hat, (mu_hat, log_sigma_x2_hat) = self.model(batch)
|
||||
|
||||
@@ -198,56 +200,75 @@ class ACT(nn.Module):
|
||||
def __init__(self, config: ACTConfig):
|
||||
super().__init__()
|
||||
self.config = config
|
||||
# BERT style VAE encoder with input [cls, *joint_space_configuration, *action_sequence].
|
||||
# BERT style VAE encoder with input tokens [cls, robot_state, *action_sequence].
|
||||
# The cls token forms parameters of the latent's distribution (like this [*means, *log_variances]).
|
||||
self.use_robot_state = "observation.state" in config.input_shapes
|
||||
self.use_images = any(k.startswith("observation.image") for k in config.input_shapes)
|
||||
self.use_env_state = "observation.environment_state" in config.input_shapes
|
||||
if self.config.use_vae:
|
||||
self.vae_encoder = ACTEncoder(config)
|
||||
self.vae_encoder_cls_embed = nn.Embedding(1, config.dim_model)
|
||||
# Projection layer for joint-space configuration to hidden dimension.
|
||||
self.vae_encoder_robot_state_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.state"][0], config.dim_model
|
||||
)
|
||||
if self.use_robot_state:
|
||||
self.vae_encoder_robot_state_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.state"][0], config.dim_model
|
||||
)
|
||||
# Projection layer for action (joint-space target) to hidden dimension.
|
||||
self.vae_encoder_action_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.state"][0], config.dim_model
|
||||
config.output_shapes["action"][0], config.dim_model
|
||||
)
|
||||
self.latent_dim = config.latent_dim
|
||||
# Projection layer from the VAE encoder's output to the latent distribution's parameter space.
|
||||
self.vae_encoder_latent_output_proj = nn.Linear(config.dim_model, self.latent_dim * 2)
|
||||
# Fixed sinusoidal positional embedding the whole input to the VAE encoder. Unsqueeze for batch
|
||||
self.vae_encoder_latent_output_proj = nn.Linear(config.dim_model, config.latent_dim * 2)
|
||||
# Fixed sinusoidal positional embedding for the input to the VAE encoder. Unsqueeze for batch
|
||||
# dimension.
|
||||
num_input_token_encoder = 1 + config.chunk_size
|
||||
if self.use_robot_state:
|
||||
num_input_token_encoder += 1
|
||||
self.register_buffer(
|
||||
"vae_encoder_pos_enc",
|
||||
create_sinusoidal_pos_embedding(1 + 1 + config.chunk_size, config.dim_model).unsqueeze(0),
|
||||
create_sinusoidal_pos_embedding(num_input_token_encoder, config.dim_model).unsqueeze(0),
|
||||
)
|
||||
|
||||
# Backbone for image feature extraction.
|
||||
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
||||
replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
|
||||
weights=config.pretrained_backbone_weights,
|
||||
norm_layer=FrozenBatchNorm2d,
|
||||
)
|
||||
# Note: The assumption here is that we are using a ResNet model (and hence layer4 is the final feature
|
||||
# map).
|
||||
# Note: The forward method of this returns a dict: {"feature_map": output}.
|
||||
self.backbone = IntermediateLayerGetter(backbone_model, return_layers={"layer4": "feature_map"})
|
||||
if self.use_images:
|
||||
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
||||
replace_stride_with_dilation=[False, False, config.replace_final_stride_with_dilation],
|
||||
weights=config.pretrained_backbone_weights,
|
||||
norm_layer=FrozenBatchNorm2d,
|
||||
)
|
||||
# Note: The assumption here is that we are using a ResNet model (and hence layer4 is the final
|
||||
# feature map).
|
||||
# Note: The forward method of this returns a dict: {"feature_map": output}.
|
||||
self.backbone = IntermediateLayerGetter(backbone_model, return_layers={"layer4": "feature_map"})
|
||||
|
||||
# Transformer (acts as VAE decoder when training with the variational objective).
|
||||
self.encoder = ACTEncoder(config)
|
||||
self.decoder = ACTDecoder(config)
|
||||
|
||||
# Transformer encoder input projections. The tokens will be structured like
|
||||
# [latent, robot_state, image_feature_map_pixels].
|
||||
self.encoder_robot_state_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.state"][0], config.dim_model
|
||||
)
|
||||
self.encoder_latent_input_proj = nn.Linear(self.latent_dim, config.dim_model)
|
||||
self.encoder_img_feat_input_proj = nn.Conv2d(
|
||||
backbone_model.fc.in_features, config.dim_model, kernel_size=1
|
||||
)
|
||||
# [latent, (robot_state), (env_state), (image_feature_map_pixels)].
|
||||
if self.use_robot_state:
|
||||
self.encoder_robot_state_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.state"][0], config.dim_model
|
||||
)
|
||||
if self.use_env_state:
|
||||
self.encoder_env_state_input_proj = nn.Linear(
|
||||
config.input_shapes["observation.environment_state"][0], config.dim_model
|
||||
)
|
||||
self.encoder_latent_input_proj = nn.Linear(config.latent_dim, config.dim_model)
|
||||
if self.use_images:
|
||||
self.encoder_img_feat_input_proj = nn.Conv2d(
|
||||
backbone_model.fc.in_features, config.dim_model, kernel_size=1
|
||||
)
|
||||
# Transformer encoder positional embeddings.
|
||||
self.encoder_robot_and_latent_pos_embed = nn.Embedding(2, config.dim_model)
|
||||
self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(config.dim_model // 2)
|
||||
n_1d_tokens = 1 # for the latent
|
||||
if self.use_robot_state:
|
||||
n_1d_tokens += 1
|
||||
if self.use_env_state:
|
||||
n_1d_tokens += 1
|
||||
self.encoder_1d_feature_pos_embed = nn.Embedding(n_1d_tokens, config.dim_model)
|
||||
if self.use_images:
|
||||
self.encoder_cam_feat_pos_embed = ACTSinusoidalPositionEmbedding2d(config.dim_model // 2)
|
||||
|
||||
# Transformer decoder.
|
||||
# Learnable positional embedding for the transformer's decoder (in the style of DETR object queries).
|
||||
@@ -268,10 +289,13 @@ class ACT(nn.Module):
|
||||
"""A forward pass through the Action Chunking Transformer (with optional VAE encoder).
|
||||
|
||||
`batch` should have the following structure:
|
||||
|
||||
{
|
||||
"observation.state": (B, state_dim) batch of robot states.
|
||||
"observation.state" (optional): (B, state_dim) batch of robot states.
|
||||
|
||||
"observation.images": (B, n_cameras, C, H, W) batch of images.
|
||||
AND/OR
|
||||
"observation.environment_state": (B, env_dim) batch of environment states.
|
||||
|
||||
"action" (optional, only if training with VAE): (B, chunk_size, action dim) batch of actions.
|
||||
}
|
||||
|
||||
@@ -285,7 +309,11 @@ class ACT(nn.Module):
|
||||
"action" in batch
|
||||
), "actions must be provided when using the variational objective in training mode."
|
||||
|
||||
batch_size = batch["observation.state"].shape[0]
|
||||
batch_size = (
|
||||
batch["observation.images"]
|
||||
if "observation.images" in batch
|
||||
else batch["observation.environment_state"]
|
||||
).shape[0]
|
||||
|
||||
# Prepare the latent for input to the transformer encoder.
|
||||
if self.config.use_vae and "action" in batch:
|
||||
@@ -293,79 +321,103 @@ class ACT(nn.Module):
|
||||
cls_embed = einops.repeat(
|
||||
self.vae_encoder_cls_embed.weight, "1 d -> b 1 d", b=batch_size
|
||||
) # (B, 1, D)
|
||||
robot_state_embed = self.vae_encoder_robot_state_input_proj(batch["observation.state"]).unsqueeze(
|
||||
1
|
||||
) # (B, 1, D)
|
||||
if self.use_robot_state:
|
||||
robot_state_embed = self.vae_encoder_robot_state_input_proj(batch["observation.state"])
|
||||
robot_state_embed = robot_state_embed.unsqueeze(1) # (B, 1, D)
|
||||
action_embed = self.vae_encoder_action_input_proj(batch["action"]) # (B, S, D)
|
||||
vae_encoder_input = torch.cat([cls_embed, robot_state_embed, action_embed], axis=1) # (B, S+2, D)
|
||||
|
||||
if self.use_robot_state:
|
||||
vae_encoder_input = [cls_embed, robot_state_embed, action_embed] # (B, S+2, D)
|
||||
else:
|
||||
vae_encoder_input = [cls_embed, action_embed]
|
||||
vae_encoder_input = torch.cat(vae_encoder_input, axis=1)
|
||||
|
||||
# Prepare fixed positional embedding.
|
||||
# Note: detach() shouldn't be necessary but leaving it the same as the original code just in case.
|
||||
pos_embed = self.vae_encoder_pos_enc.clone().detach() # (1, S+2, D)
|
||||
|
||||
# Prepare key padding mask for the transformer encoder. We have 1 or 2 extra tokens at the start of the
|
||||
# sequence depending whether we use the input states or not (cls and robot state)
|
||||
# False means not a padding token.
|
||||
cls_joint_is_pad = torch.full(
|
||||
(batch_size, 2 if self.use_robot_state else 1),
|
||||
False,
|
||||
device=batch["observation.state"].device,
|
||||
)
|
||||
key_padding_mask = torch.cat(
|
||||
[cls_joint_is_pad, batch["action_is_pad"]], axis=1
|
||||
) # (bs, seq+1 or 2)
|
||||
|
||||
# Forward pass through VAE encoder to get the latent PDF parameters.
|
||||
cls_token_out = self.vae_encoder(
|
||||
vae_encoder_input.permute(1, 0, 2), pos_embed=pos_embed.permute(1, 0, 2)
|
||||
vae_encoder_input.permute(1, 0, 2),
|
||||
pos_embed=pos_embed.permute(1, 0, 2),
|
||||
key_padding_mask=key_padding_mask,
|
||||
)[0] # select the class token, with shape (B, D)
|
||||
latent_pdf_params = self.vae_encoder_latent_output_proj(cls_token_out)
|
||||
mu = latent_pdf_params[:, : self.latent_dim]
|
||||
mu = latent_pdf_params[:, : self.config.latent_dim]
|
||||
# This is 2log(sigma). Done this way to match the original implementation.
|
||||
log_sigma_x2 = latent_pdf_params[:, self.latent_dim :]
|
||||
log_sigma_x2 = latent_pdf_params[:, self.config.latent_dim :]
|
||||
|
||||
# Sample the latent with the reparameterization trick.
|
||||
latent_sample = mu + log_sigma_x2.div(2).exp() * torch.randn_like(mu)
|
||||
else:
|
||||
# When not using the VAE encoder, we set the latent to be all zeros.
|
||||
mu = log_sigma_x2 = None
|
||||
latent_sample = torch.zeros([batch_size, self.latent_dim], dtype=torch.float32).to(
|
||||
# TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use buffer
|
||||
latent_sample = torch.zeros([batch_size, self.config.latent_dim], dtype=torch.float32).to(
|
||||
batch["observation.state"].device
|
||||
)
|
||||
|
||||
# Prepare all other transformer encoder inputs.
|
||||
# Prepare transformer encoder inputs.
|
||||
encoder_in_tokens = [self.encoder_latent_input_proj(latent_sample)]
|
||||
encoder_in_pos_embed = list(self.encoder_1d_feature_pos_embed.weight.unsqueeze(1))
|
||||
# Robot state token.
|
||||
if self.use_robot_state:
|
||||
encoder_in_tokens.append(self.encoder_robot_state_input_proj(batch["observation.state"]))
|
||||
# Environment state token.
|
||||
if self.use_env_state:
|
||||
encoder_in_tokens.append(
|
||||
self.encoder_env_state_input_proj(batch["observation.environment_state"])
|
||||
)
|
||||
|
||||
# Camera observation features and positional embeddings.
|
||||
all_cam_features = []
|
||||
all_cam_pos_embeds = []
|
||||
images = batch["observation.images"]
|
||||
for cam_index in range(images.shape[-4]):
|
||||
cam_features = self.backbone(images[:, cam_index])["feature_map"]
|
||||
cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(dtype=cam_features.dtype)
|
||||
cam_features = self.encoder_img_feat_input_proj(cam_features) # (B, C, h, w)
|
||||
all_cam_features.append(cam_features)
|
||||
all_cam_pos_embeds.append(cam_pos_embed)
|
||||
# Concatenate camera observation feature maps and positional embeddings along the width dimension.
|
||||
encoder_in = torch.cat(all_cam_features, axis=-1)
|
||||
cam_pos_embed = torch.cat(all_cam_pos_embeds, axis=-1)
|
||||
if self.use_images:
|
||||
all_cam_features = []
|
||||
all_cam_pos_embeds = []
|
||||
images = batch["observation.images"]
|
||||
|
||||
# Get positional embeddings for robot state and latent.
|
||||
robot_state_embed = self.encoder_robot_state_input_proj(batch["observation.state"]) # (B, C)
|
||||
latent_embed = self.encoder_latent_input_proj(latent_sample) # (B, C)
|
||||
for cam_index in range(images.shape[-4]):
|
||||
cam_features = self.backbone(images[:, cam_index])["feature_map"]
|
||||
# TODO(rcadene, alexander-soare): remove call to `.to` to speedup forward ; precompute and use
|
||||
# buffer
|
||||
cam_pos_embed = self.encoder_cam_feat_pos_embed(cam_features).to(dtype=cam_features.dtype)
|
||||
cam_features = self.encoder_img_feat_input_proj(cam_features) # (B, C, h, w)
|
||||
all_cam_features.append(cam_features)
|
||||
all_cam_pos_embeds.append(cam_pos_embed)
|
||||
# Concatenate camera observation feature maps and positional embeddings along the width dimension,
|
||||
# and move to (sequence, batch, dim).
|
||||
all_cam_features = torch.cat(all_cam_features, axis=-1)
|
||||
encoder_in_tokens.extend(einops.rearrange(all_cam_features, "b c h w -> (h w) b c"))
|
||||
all_cam_pos_embeds = torch.cat(all_cam_pos_embeds, axis=-1)
|
||||
encoder_in_pos_embed.extend(einops.rearrange(all_cam_pos_embeds, "b c h w -> (h w) b c"))
|
||||
|
||||
# Stack encoder input and positional embeddings moving to (S, B, C).
|
||||
encoder_in = torch.cat(
|
||||
[
|
||||
torch.stack([latent_embed, robot_state_embed], axis=0),
|
||||
einops.rearrange(encoder_in, "b c h w -> (h w) b c"),
|
||||
]
|
||||
)
|
||||
pos_embed = torch.cat(
|
||||
[
|
||||
self.encoder_robot_and_latent_pos_embed.weight.unsqueeze(1),
|
||||
cam_pos_embed.flatten(2).permute(2, 0, 1),
|
||||
],
|
||||
axis=0,
|
||||
)
|
||||
# Stack all tokens along the sequence dimension.
|
||||
encoder_in_tokens = torch.stack(encoder_in_tokens, axis=0)
|
||||
encoder_in_pos_embed = torch.stack(encoder_in_pos_embed, axis=0)
|
||||
|
||||
# Forward pass through the transformer modules.
|
||||
encoder_out = self.encoder(encoder_in, pos_embed=pos_embed)
|
||||
encoder_out = self.encoder(encoder_in_tokens, pos_embed=encoder_in_pos_embed)
|
||||
# TODO(rcadene, alexander-soare): remove call to `device` ; precompute and use buffer
|
||||
decoder_in = torch.zeros(
|
||||
(self.config.chunk_size, batch_size, self.config.dim_model),
|
||||
dtype=pos_embed.dtype,
|
||||
device=pos_embed.device,
|
||||
dtype=encoder_in_pos_embed.dtype,
|
||||
device=encoder_in_pos_embed.device,
|
||||
)
|
||||
decoder_out = self.decoder(
|
||||
decoder_in,
|
||||
encoder_out,
|
||||
encoder_pos_embed=pos_embed,
|
||||
encoder_pos_embed=encoder_in_pos_embed,
|
||||
decoder_pos_embed=self.decoder_pos_embed.weight.unsqueeze(1),
|
||||
)
|
||||
|
||||
@@ -385,9 +437,11 @@ class ACTEncoder(nn.Module):
|
||||
self.layers = nn.ModuleList([ACTEncoderLayer(config) for _ in range(config.n_encoder_layers)])
|
||||
self.norm = nn.LayerNorm(config.dim_model) if config.pre_norm else nn.Identity()
|
||||
|
||||
def forward(self, x: Tensor, pos_embed: Tensor | None = None) -> Tensor:
|
||||
def forward(
|
||||
self, x: Tensor, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None
|
||||
) -> Tensor:
|
||||
for layer in self.layers:
|
||||
x = layer(x, pos_embed=pos_embed)
|
||||
x = layer(x, pos_embed=pos_embed, key_padding_mask=key_padding_mask)
|
||||
x = self.norm(x)
|
||||
return x
|
||||
|
||||
@@ -410,12 +464,13 @@ class ACTEncoderLayer(nn.Module):
|
||||
self.activation = get_activation_fn(config.feedforward_activation)
|
||||
self.pre_norm = config.pre_norm
|
||||
|
||||
def forward(self, x, pos_embed: Tensor | None = None) -> Tensor:
|
||||
def forward(self, x, pos_embed: Tensor | None = None, key_padding_mask: Tensor | None = None) -> Tensor:
|
||||
skip = x
|
||||
if self.pre_norm:
|
||||
x = self.norm1(x)
|
||||
q = k = x if pos_embed is None else x + pos_embed
|
||||
x = self.self_attn(q, k, value=x)[0] # select just the output, not the attention weights
|
||||
x = self.self_attn(q, k, value=x, key_padding_mask=key_padding_mask)
|
||||
x = x[0] # note: [0] to select just the output, not the attention weights
|
||||
x = skip + self.dropout1(x)
|
||||
if self.pre_norm:
|
||||
skip = x
|
||||
|
||||
@@ -26,21 +26,31 @@ class DiffusionConfig:
|
||||
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||
Those are: `input_shapes` and `output_shapes`.
|
||||
|
||||
Notes on the inputs and outputs:
|
||||
- "observation.state" is required as an input key.
|
||||
- Either:
|
||||
- At least one key starting with "observation.image is required as an input.
|
||||
AND/OR
|
||||
- The key "observation.environment_state" is required as input.
|
||||
- If there are multiple keys beginning with "observation.image" they are treated as multiple camera
|
||||
views. Right now we only support all images having the same shape.
|
||||
- "action" is required as an output key.
|
||||
|
||||
Args:
|
||||
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
||||
current step and additional steps going back).
|
||||
horizon: Diffusion model action prediction size as detailed in `DiffusionPolicy.select_action`.
|
||||
n_action_steps: The number of action steps to run in the environment for one invocation of the policy.
|
||||
See `DiffusionPolicy.select_action` for more details.
|
||||
input_shapes: A dictionary defining the shapes of the input data for the policy.
|
||||
The key represents the input data name, and the value is a list indicating the dimensions
|
||||
of the corresponding data. For example, "observation.image" refers to an input from
|
||||
a camera with dimensions [3, 96, 96], indicating it has three color channels and 96x96 resolution.
|
||||
Importantly, shapes doesnt include batch dimension or temporal dimension.
|
||||
output_shapes: A dictionary defining the shapes of the output data for the policy.
|
||||
The key represents the output data name, and the value is a list indicating the dimensions
|
||||
of the corresponding data. For example, "action" refers to an output shape of [14], indicating
|
||||
14-dimensional actions. Importantly, shapes doesnt include batch dimension or temporal dimension.
|
||||
input_shapes: A dictionary defining the shapes of the input data for the policy. The key represents
|
||||
the input data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||
For example, "observation.image" refers to an input from a camera with dimensions [3, 96, 96],
|
||||
indicating it has three color channels and 96x96 resolution. Importantly, `input_shapes` doesn't
|
||||
include batch dimension or temporal dimension.
|
||||
output_shapes: A dictionary defining the shapes of the output data for the policy. The key represents
|
||||
the output data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||
For example, "action" refers to an output shape of [14], indicating 14-dimensional actions.
|
||||
Importantly, `output_shapes` doesn't include batch dimension or temporal dimension.
|
||||
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||
@@ -148,22 +158,33 @@ class DiffusionConfig:
|
||||
raise ValueError(
|
||||
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||
)
|
||||
# There should only be one image key.
|
||||
|
||||
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
||||
if len(image_keys) != 1:
|
||||
raise ValueError(
|
||||
f"{self.__class__.__name__} only handles one image for now. Got image keys {image_keys}."
|
||||
)
|
||||
image_key = next(iter(image_keys))
|
||||
if (
|
||||
self.crop_shape[0] > self.input_shapes[image_key][1]
|
||||
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
||||
):
|
||||
raise ValueError(
|
||||
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
||||
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
||||
"`input_shapes[{image_key}]`."
|
||||
)
|
||||
|
||||
if len(image_keys) == 0 and "observation.environment_state" not in self.input_shapes:
|
||||
raise ValueError("You must provide at least one image or the environment state among the inputs.")
|
||||
|
||||
if len(image_keys) > 0:
|
||||
if self.crop_shape is not None:
|
||||
for image_key in image_keys:
|
||||
if (
|
||||
self.crop_shape[0] > self.input_shapes[image_key][1]
|
||||
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
||||
):
|
||||
raise ValueError(
|
||||
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
||||
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
||||
"`input_shapes[{image_key}]`."
|
||||
)
|
||||
# Check that all input images have the same shape.
|
||||
first_image_key = next(iter(image_keys))
|
||||
for image_key in image_keys:
|
||||
if self.input_shapes[image_key] != self.input_shapes[first_image_key]:
|
||||
raise ValueError(
|
||||
f"`input_shapes[{image_key}]` does not match `input_shapes[{first_image_key}]`, but we "
|
||||
"expect all image shapes to match."
|
||||
)
|
||||
|
||||
supported_prediction_types = ["epsilon", "sample"]
|
||||
if self.prediction_type not in supported_prediction_types:
|
||||
raise ValueError(
|
||||
|
||||
@@ -18,7 +18,6 @@
|
||||
|
||||
TODO(alexander-soare):
|
||||
- Remove reliance on diffusers for DDPMScheduler and LR scheduler.
|
||||
- Make compatible with multiple image keys.
|
||||
"""
|
||||
|
||||
import math
|
||||
@@ -83,23 +82,21 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
|
||||
self.diffusion = DiffusionModel(config)
|
||||
|
||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
# Note: This check is covered in the post-init of the config but have a sanity check just in case.
|
||||
if len(image_keys) != 1:
|
||||
raise NotImplementedError(
|
||||
f"{self.__class__.__name__} only handles one image for now. Got image keys {image_keys}."
|
||||
)
|
||||
self.input_image_key = image_keys[0]
|
||||
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
self.use_env_state = "observation.environment_state" in config.input_shapes
|
||||
|
||||
self.reset()
|
||||
|
||||
def reset(self):
|
||||
"""Clear observation and action queues. Should be called on `env.reset()`"""
|
||||
self._queues = {
|
||||
"observation.image": deque(maxlen=self.config.n_obs_steps),
|
||||
"observation.state": deque(maxlen=self.config.n_obs_steps),
|
||||
"action": deque(maxlen=self.config.n_action_steps),
|
||||
}
|
||||
if len(self.expected_image_keys) > 0:
|
||||
self._queues["observation.images"] = deque(maxlen=self.config.n_obs_steps)
|
||||
if self.use_env_state:
|
||||
self._queues["observation.environment_state"] = deque(maxlen=self.config.n_obs_steps)
|
||||
|
||||
@torch.no_grad
|
||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
@@ -124,8 +121,9 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
actually measured from the first observation which (if `n_obs_steps` > 1) happened in the past.
|
||||
"""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
|
||||
if len(self.expected_image_keys) > 0:
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
# Note: It's important that this happens after stacking the images into a single key.
|
||||
self._queues = populate_queues(self._queues, batch)
|
||||
|
||||
if len(self._queues["action"]) == 0:
|
||||
@@ -144,7 +142,8 @@ class DiffusionPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||
"""Run the batch through the model and compute the loss for training or validation."""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
if len(self.expected_image_keys) > 0:
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
batch = self.normalize_targets(batch)
|
||||
loss = self.diffusion.compute_loss(batch)
|
||||
return {"loss": loss}
|
||||
@@ -168,12 +167,20 @@ class DiffusionModel(nn.Module):
|
||||
super().__init__()
|
||||
self.config = config
|
||||
|
||||
self.rgb_encoder = DiffusionRgbEncoder(config)
|
||||
self.unet = DiffusionConditionalUnet1d(
|
||||
config,
|
||||
global_cond_dim=(config.output_shapes["action"][0] + self.rgb_encoder.feature_dim)
|
||||
* config.n_obs_steps,
|
||||
)
|
||||
# Build observation encoders (depending on which observations are provided).
|
||||
global_cond_dim = config.input_shapes["observation.state"][0]
|
||||
num_images = len([k for k in config.input_shapes if k.startswith("observation.image")])
|
||||
self._use_images = False
|
||||
self._use_env_state = False
|
||||
if num_images > 0:
|
||||
self._use_images = True
|
||||
self.rgb_encoder = DiffusionRgbEncoder(config)
|
||||
global_cond_dim += self.rgb_encoder.feature_dim * num_images
|
||||
if "observation.environment_state" in config.input_shapes:
|
||||
self._use_env_state = True
|
||||
global_cond_dim += config.input_shapes["observation.environment_state"][0]
|
||||
|
||||
self.unet = DiffusionConditionalUnet1d(config, global_cond_dim=global_cond_dim * config.n_obs_steps)
|
||||
|
||||
self.noise_scheduler = _make_noise_scheduler(
|
||||
config.noise_scheduler_type,
|
||||
@@ -220,29 +227,48 @@ class DiffusionModel(nn.Module):
|
||||
|
||||
return sample
|
||||
|
||||
def _prepare_global_conditioning(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""Encode image features and concatenate them all together along with the state vector."""
|
||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||
global_cond_feats = [batch["observation.state"]]
|
||||
# Extract image feature (first combine batch, sequence, and camera index dims).
|
||||
if self._use_images:
|
||||
img_features = self.rgb_encoder(
|
||||
einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
|
||||
)
|
||||
# Separate batch dim and sequence dim back out. The camera index dim gets absorbed into the
|
||||
# feature dim (effectively concatenating the camera features).
|
||||
img_features = einops.rearrange(
|
||||
img_features, "(b s n) ... -> b s (n ...)", b=batch_size, s=n_obs_steps
|
||||
)
|
||||
global_cond_feats.append(img_features)
|
||||
|
||||
if self._use_env_state:
|
||||
global_cond_feats.append(batch["observation.environment_state"])
|
||||
|
||||
# Concatenate features then flatten to (B, global_cond_dim).
|
||||
return torch.cat(global_cond_feats, dim=-1).flatten(start_dim=1)
|
||||
|
||||
def generate_actions(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""
|
||||
This function expects `batch` to have:
|
||||
{
|
||||
"observation.state": (B, n_obs_steps, state_dim)
|
||||
"observation.image": (B, n_obs_steps, C, H, W)
|
||||
|
||||
"observation.images": (B, n_obs_steps, num_cameras, C, H, W)
|
||||
AND/OR
|
||||
"observation.environment_state": (B, environment_dim)
|
||||
}
|
||||
"""
|
||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||
assert n_obs_steps == self.config.n_obs_steps
|
||||
|
||||
# Extract image feature (first combine batch and sequence dims).
|
||||
img_features = self.rgb_encoder(einops.rearrange(batch["observation.image"], "b n ... -> (b n) ..."))
|
||||
# Separate batch and sequence dims.
|
||||
img_features = einops.rearrange(img_features, "(b n) ... -> b n ...", b=batch_size)
|
||||
# Concatenate state and image features then flatten to (B, global_cond_dim).
|
||||
global_cond = torch.cat([batch["observation.state"], img_features], dim=-1).flatten(start_dim=1)
|
||||
# Encode image features and concatenate them all together along with the state vector.
|
||||
global_cond = self._prepare_global_conditioning(batch) # (B, global_cond_dim)
|
||||
|
||||
# run sampling
|
||||
sample = self.conditional_sample(batch_size, global_cond=global_cond)
|
||||
actions = self.conditional_sample(batch_size, global_cond=global_cond)
|
||||
|
||||
# `horizon` steps worth of actions (from the first observation).
|
||||
actions = sample[..., : self.config.output_shapes["action"][0]]
|
||||
# Extract `n_action_steps` steps worth of actions (from the current observation).
|
||||
start = n_obs_steps - 1
|
||||
end = start + self.config.n_action_steps
|
||||
@@ -255,28 +281,28 @@ class DiffusionModel(nn.Module):
|
||||
This function expects `batch` to have (at least):
|
||||
{
|
||||
"observation.state": (B, n_obs_steps, state_dim)
|
||||
"observation.image": (B, n_obs_steps, C, H, W)
|
||||
|
||||
"observation.images": (B, n_obs_steps, num_cameras, C, H, W)
|
||||
AND/OR
|
||||
"observation.environment_state": (B, environment_dim)
|
||||
|
||||
"action": (B, horizon, action_dim)
|
||||
"action_is_pad": (B, horizon)
|
||||
}
|
||||
"""
|
||||
# Input validation.
|
||||
assert set(batch).issuperset({"observation.state", "observation.image", "action", "action_is_pad"})
|
||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||
assert set(batch).issuperset({"observation.state", "action", "action_is_pad"})
|
||||
assert "observation.images" in batch or "observation.environment_state" in batch
|
||||
n_obs_steps = batch["observation.state"].shape[1]
|
||||
horizon = batch["action"].shape[1]
|
||||
assert horizon == self.config.horizon
|
||||
assert n_obs_steps == self.config.n_obs_steps
|
||||
|
||||
# Extract image feature (first combine batch and sequence dims).
|
||||
img_features = self.rgb_encoder(einops.rearrange(batch["observation.image"], "b n ... -> (b n) ..."))
|
||||
# Separate batch and sequence dims.
|
||||
img_features = einops.rearrange(img_features, "(b n) ... -> b n ...", b=batch_size)
|
||||
# Concatenate state and image features then flatten to (B, global_cond_dim).
|
||||
global_cond = torch.cat([batch["observation.state"], img_features], dim=-1).flatten(start_dim=1)
|
||||
|
||||
trajectory = batch["action"]
|
||||
# Encode image features and concatenate them all together along with the state vector.
|
||||
global_cond = self._prepare_global_conditioning(batch) # (B, global_cond_dim)
|
||||
|
||||
# Forward diffusion.
|
||||
trajectory = batch["action"]
|
||||
# Sample noise to add to the trajectory.
|
||||
eps = torch.randn(trajectory.shape, device=trajectory.device)
|
||||
# Sample a random noising timestep for each item in the batch.
|
||||
@@ -304,7 +330,12 @@ class DiffusionModel(nn.Module):
|
||||
loss = F.mse_loss(pred, target, reduction="none")
|
||||
|
||||
# Mask loss wherever the action is padded with copies (edges of the dataset trajectory).
|
||||
if self.config.do_mask_loss_for_padding and "action_is_pad" in batch:
|
||||
if self.config.do_mask_loss_for_padding:
|
||||
if "action_is_pad" not in batch:
|
||||
raise ValueError(
|
||||
"You need to provide 'action_is_pad' in the batch when "
|
||||
f"{self.config.do_mask_loss_for_padding=}."
|
||||
)
|
||||
in_episode_bound = ~batch["action_is_pad"]
|
||||
loss = loss * in_episode_bound.unsqueeze(-1)
|
||||
|
||||
@@ -423,11 +454,15 @@ class DiffusionRgbEncoder(nn.Module):
|
||||
# Set up pooling and final layers.
|
||||
# Use a dry run to get the feature map shape.
|
||||
# The dummy input should take the number of image channels from `config.input_shapes` and it should
|
||||
# use the height and width from `config.crop_shape`.
|
||||
# use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
|
||||
# height and width from `config.input_shapes`.
|
||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
assert len(image_keys) == 1
|
||||
# Note: we have a check in the config class to make sure all images have the same shape.
|
||||
image_key = image_keys[0]
|
||||
dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *config.crop_shape))
|
||||
dummy_input_h_w = (
|
||||
config.crop_shape if config.crop_shape is not None else config.input_shapes[image_key][1:]
|
||||
)
|
||||
dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *dummy_input_h_w))
|
||||
with torch.inference_mode():
|
||||
dummy_feature_map = self.backbone(dummy_input)
|
||||
feature_map_shape = tuple(dummy_feature_map.shape[1:])
|
||||
|
||||
@@ -28,9 +28,15 @@ def _policy_cfg_from_hydra_cfg(policy_cfg_class, hydra_cfg):
|
||||
logging.warning(
|
||||
f"Hydra config is missing arguments: {set(expected_kwargs).difference(hydra_cfg.policy)}"
|
||||
)
|
||||
|
||||
# OmegaConf.to_container returns lists where sequences are found, but our dataclasses use tuples to avoid
|
||||
# issues with mutable defaults. This filter changes all lists to tuples.
|
||||
def list_to_tuple(item):
|
||||
return tuple(item) if isinstance(item, list) else item
|
||||
|
||||
policy_cfg = policy_cfg_class(
|
||||
**{
|
||||
k: v
|
||||
k: list_to_tuple(v)
|
||||
for k, v in OmegaConf.to_container(hydra_cfg.policy, resolve=True).items()
|
||||
if k in expected_kwargs
|
||||
}
|
||||
@@ -55,6 +61,11 @@ def get_policy_and_config_classes(name: str) -> tuple[Policy, object]:
|
||||
from lerobot.common.policies.act.modeling_act import ACTPolicy
|
||||
|
||||
return ACTPolicy, ACTConfig
|
||||
elif name == "vqbet":
|
||||
from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
|
||||
from lerobot.common.policies.vqbet.modeling_vqbet import VQBeTPolicy
|
||||
|
||||
return VQBeTPolicy, VQBeTConfig
|
||||
else:
|
||||
raise NotImplementedError(f"Policy with name {name} is not implemented.")
|
||||
|
||||
@@ -75,7 +86,9 @@ def make_policy(
|
||||
policy. Therefore, this argument is mutually exclusive with `pretrained_policy_name_or_path`.
|
||||
"""
|
||||
if not (pretrained_policy_name_or_path is None) ^ (dataset_stats is None):
|
||||
raise ValueError("Only one of `pretrained_policy_name_or_path` and `dataset_stats` may be provided.")
|
||||
raise ValueError(
|
||||
"Exactly one of `pretrained_policy_name_or_path` and `dataset_stats` must be provided."
|
||||
)
|
||||
|
||||
policy_cls, policy_cfg_class = get_policy_and_config_classes(hydra_cfg.policy.name)
|
||||
|
||||
@@ -86,9 +99,10 @@ def make_policy(
|
||||
else:
|
||||
# Load a pretrained policy and override the config if needed (for example, if there are inference-time
|
||||
# hyperparameters that we want to vary).
|
||||
# TODO(alexander-soare): This hack makes use of huggingface_hub's tooling to load the policy with, pretrained
|
||||
# weights which are then loaded into a fresh policy with the desired config. This PR in huggingface_hub should
|
||||
# make it possible to avoid the hack: https://github.com/huggingface/huggingface_hub/pull/2274.
|
||||
# TODO(alexander-soare): This hack makes use of huggingface_hub's tooling to load the policy with,
|
||||
# pretrained weights which are then loaded into a fresh policy with the desired config. This PR in
|
||||
# huggingface_hub should make it possible to avoid the hack:
|
||||
# https://github.com/huggingface/huggingface_hub/pull/2274.
|
||||
policy = policy_cls(policy_cfg)
|
||||
policy.load_state_dict(policy_cls.from_pretrained(pretrained_policy_name_or_path).state_dict())
|
||||
|
||||
|
||||
@@ -147,7 +147,7 @@ class Normalize(nn.Module):
|
||||
assert not torch.isinf(min).any(), _no_stats_error_str("min")
|
||||
assert not torch.isinf(max).any(), _no_stats_error_str("max")
|
||||
# normalize to [0,1]
|
||||
batch[key] = (batch[key] - min) / (max - min)
|
||||
batch[key] = (batch[key] - min) / (max - min + 1e-8)
|
||||
# normalize to [-1, 1]
|
||||
batch[key] = batch[key] * 2 - 1
|
||||
else:
|
||||
|
||||
@@ -57,7 +57,7 @@ class Policy(Protocol):
|
||||
other items should be logging-friendly, native Python types.
|
||||
"""
|
||||
|
||||
def select_action(self, batch: dict[str, Tensor]):
|
||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""Return one action to run in the environment (potentially in batch mode).
|
||||
|
||||
When the model uses a history of observations, or outputs a sequence of actions, this method deals
|
||||
|
||||
@@ -31,6 +31,15 @@ class TDMPCConfig:
|
||||
n_action_repeats: The number of times to repeat the action returned by the planning. (hint: Google
|
||||
action repeats in Q-learning or ask your favorite chatbot)
|
||||
horizon: Horizon for model predictive control.
|
||||
input_shapes: A dictionary defining the shapes of the input data for the policy. The key represents
|
||||
the input data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||
For example, "observation.image" refers to an input from a camera with dimensions [3, 96, 96],
|
||||
indicating it has three color channels and 96x96 resolution. Importantly, `input_shapes` doesn't
|
||||
include batch dimension or temporal dimension.
|
||||
output_shapes: A dictionary defining the shapes of the output data for the policy. The key represents
|
||||
the output data name, and the value is a list indicating the dimensions of the corresponding data.
|
||||
For example, "action" refers to an output shape of [14], indicating 14-dimensional actions.
|
||||
Importantly, `output_shapes` doesn't include batch dimension or temporal dimension.
|
||||
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||
|
||||
@@ -134,7 +134,7 @@ class TDMPCPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
self._prev_mean: torch.Tensor | None = None
|
||||
|
||||
@torch.no_grad()
|
||||
def select_action(self, batch: dict[str, Tensor]):
|
||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""Select a single action given environment observations."""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.image"] = batch[self.input_image_key]
|
||||
|
||||
167
lerobot/common/policies/vqbet/configuration_vqbet.py
Normal file
167
lerobot/common/policies/vqbet/configuration_vqbet.py
Normal file
@@ -0,0 +1,167 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 Seungjae Lee and Yibin Wang and Haritheja Etukuru
|
||||
# and H. Jin Kim and Nur Muhammad Mahi Shafiullah and Lerrel Pinto
|
||||
# and The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
from dataclasses import dataclass, field
|
||||
|
||||
|
||||
@dataclass
|
||||
class VQBeTConfig:
|
||||
"""Configuration class for VQ-BeT.
|
||||
|
||||
Defaults are configured for training with PushT providing proprioceptive and single camera observations.
|
||||
|
||||
The parameters you will most likely need to change are the ones which depend on the environment / sensors.
|
||||
Those are: `input_shapes` and `output_shapes`.
|
||||
|
||||
Notes on the inputs and outputs:
|
||||
- "observation.state" is required as an input key.
|
||||
- At least one key starting with "observation.image is required as an input.
|
||||
- If there are multiple keys beginning with "observation.image" they are treated as multiple camera
|
||||
views. Right now we only support all images having the same shape.
|
||||
- "action" is required as an output key.
|
||||
|
||||
Args:
|
||||
n_obs_steps: Number of environment steps worth of observations to pass to the policy (takes the
|
||||
current step and additional steps going back).
|
||||
n_action_pred_token: Total number of current token and future tokens that VQ-BeT predicts.
|
||||
action_chunk_size: Action chunk size of each action prediction token.
|
||||
input_shapes: A dictionary defining the shapes of the input data for the policy.
|
||||
The key represents the input data name, and the value is a list indicating the dimensions
|
||||
of the corresponding data. For example, "observation.image" refers to an input from
|
||||
a camera with dimensions [3, 96, 96], indicating it has three color channels and 96x96 resolution.
|
||||
Importantly, shapes doesnt include batch dimension or temporal dimension.
|
||||
output_shapes: A dictionary defining the shapes of the output data for the policy.
|
||||
The key represents the output data name, and the value is a list indicating the dimensions
|
||||
of the corresponding data. For example, "action" refers to an output shape of [14], indicating
|
||||
14-dimensional actions. Importantly, shapes doesnt include batch dimension or temporal dimension.
|
||||
input_normalization_modes: A dictionary with key representing the modality (e.g. "observation.state"),
|
||||
and the value specifies the normalization mode to apply. The two available modes are "mean_std"
|
||||
which subtracts the mean and divides by the standard deviation and "min_max" which rescale in a
|
||||
[-1, 1] range.
|
||||
output_normalization_modes: Similar dictionary as `normalize_input_modes`, but to unnormalize to the
|
||||
original scale. Note that this is also used for normalizing the training targets.
|
||||
vision_backbone: Name of the torchvision resnet backbone to use for encoding images.
|
||||
crop_shape: (H, W) shape to crop images to as a preprocessing step for the vision backbone. Must fit
|
||||
within the image size. If None, no cropping is done.
|
||||
crop_is_random: Whether the crop should be random at training time (it's always a center crop in eval
|
||||
mode).
|
||||
pretrained_backbone_weights: Pretrained weights from torchvision to initalize the backbone.
|
||||
`None` means no pretrained weights.
|
||||
use_group_norm: Whether to replace batch normalization with group normalization in the backbone.
|
||||
The group sizes are set to be about 16 (to be precise, feature_dim // 16).
|
||||
spatial_softmax_num_keypoints: Number of keypoints for SpatialSoftmax.
|
||||
n_vqvae_training_steps: Number of optimization steps for training Residual VQ.
|
||||
vqvae_n_embed: Number of embedding vectors in the RVQ dictionary (each layer).
|
||||
vqvae_embedding_dim: Dimension of each embedding vector in the RVQ dictionary.
|
||||
vqvae_enc_hidden_dim: Size of hidden dimensions of Encoder / Decoder part of Residaul VQ-VAE
|
||||
gpt_block_size: Max block size of minGPT (should be larger than the number of input tokens)
|
||||
gpt_input_dim: Size of output input of GPT. This is also used as the dimension of observation features.
|
||||
gpt_output_dim: Size of output dimension of GPT. This is also used as a input dimension of offset / bin prediction headers.
|
||||
gpt_n_layer: Number of layers of GPT
|
||||
gpt_n_head: Number of headers of GPT
|
||||
gpt_hidden_dim: Size of hidden dimensions of GPT
|
||||
dropout: Dropout rate for GPT
|
||||
mlp_hidden_dim: Size of hidden dimensions of offset header / bin prediction headers parts of VQ-BeT
|
||||
offset_loss_weight: A constant that is multiplied to the offset loss
|
||||
primary_code_loss_weight: A constant that is multiplied to the primary code prediction loss
|
||||
secondary_code_loss_weight: A constant that is multiplied to the secondary code prediction loss
|
||||
bet_softmax_temperature: Sampling temperature of code for rollout with VQ-BeT
|
||||
sequentially_select: Whether select code of primary / secondary as sequentially (pick primary code,
|
||||
and then select secodnary code), or at the same time.
|
||||
"""
|
||||
|
||||
# Inputs / output structure.
|
||||
n_obs_steps: int = 5
|
||||
n_action_pred_token: int = 3
|
||||
action_chunk_size: int = 5
|
||||
|
||||
input_shapes: dict[str, list[int]] = field(
|
||||
default_factory=lambda: {
|
||||
"observation.image": [3, 96, 96],
|
||||
"observation.state": [2],
|
||||
}
|
||||
)
|
||||
output_shapes: dict[str, list[int]] = field(
|
||||
default_factory=lambda: {
|
||||
"action": [2],
|
||||
}
|
||||
)
|
||||
|
||||
# Normalization / Unnormalization
|
||||
input_normalization_modes: dict[str, str] = field(
|
||||
default_factory=lambda: {
|
||||
"observation.image": "mean_std",
|
||||
"observation.state": "min_max",
|
||||
}
|
||||
)
|
||||
output_normalization_modes: dict[str, str] = field(default_factory=lambda: {"action": "min_max"})
|
||||
|
||||
# Architecture / modeling.
|
||||
# Vision backbone.
|
||||
vision_backbone: str = "resnet18"
|
||||
crop_shape: tuple[int, int] | None = (84, 84)
|
||||
crop_is_random: bool = True
|
||||
pretrained_backbone_weights: str | None = None
|
||||
use_group_norm: bool = True
|
||||
spatial_softmax_num_keypoints: int = 32
|
||||
# VQ-VAE
|
||||
n_vqvae_training_steps: int = 20000
|
||||
vqvae_n_embed: int = 16
|
||||
vqvae_embedding_dim: int = 256
|
||||
vqvae_enc_hidden_dim: int = 128
|
||||
# VQ-BeT
|
||||
gpt_block_size: int = 500
|
||||
gpt_input_dim: int = 512
|
||||
gpt_output_dim: int = 512
|
||||
gpt_n_layer: int = 8
|
||||
gpt_n_head: int = 8
|
||||
gpt_hidden_dim: int = 512
|
||||
dropout: float = 0.1
|
||||
mlp_hidden_dim: int = 1024
|
||||
offset_loss_weight: float = 10000.0
|
||||
primary_code_loss_weight: float = 5.0
|
||||
secondary_code_loss_weight: float = 0.5
|
||||
bet_softmax_temperature: float = 0.1
|
||||
sequentially_select: bool = False
|
||||
|
||||
def __post_init__(self):
|
||||
"""Input validation (not exhaustive)."""
|
||||
if not self.vision_backbone.startswith("resnet"):
|
||||
raise ValueError(
|
||||
f"`vision_backbone` must be one of the ResNet variants. Got {self.vision_backbone}."
|
||||
)
|
||||
image_keys = {k for k in self.input_shapes if k.startswith("observation.image")}
|
||||
if self.crop_shape is not None:
|
||||
for image_key in image_keys:
|
||||
if (
|
||||
self.crop_shape[0] > self.input_shapes[image_key][1]
|
||||
or self.crop_shape[1] > self.input_shapes[image_key][2]
|
||||
):
|
||||
raise ValueError(
|
||||
f"`crop_shape` should fit within `input_shapes[{image_key}]`. Got {self.crop_shape} "
|
||||
f"for `crop_shape` and {self.input_shapes[image_key]} for "
|
||||
"`input_shapes[{image_key}]`."
|
||||
)
|
||||
# Check that all input images have the same shape.
|
||||
first_image_key = next(iter(image_keys))
|
||||
for image_key in image_keys:
|
||||
if self.input_shapes[image_key] != self.input_shapes[first_image_key]:
|
||||
raise ValueError(
|
||||
f"`input_shapes[{image_key}]` does not match `input_shapes[{first_image_key}]`, but we "
|
||||
"expect all image shapes to match."
|
||||
)
|
||||
951
lerobot/common/policies/vqbet/modeling_vqbet.py
Normal file
951
lerobot/common/policies/vqbet/modeling_vqbet.py
Normal file
@@ -0,0 +1,951 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 Seungjae Lee and Yibin Wang and Haritheja Etukuru
|
||||
# and H. Jin Kim and Nur Muhammad Mahi Shafiullah and Lerrel Pinto
|
||||
# and The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
import math
|
||||
import warnings
|
||||
from collections import deque
|
||||
from typing import Callable, List
|
||||
|
||||
import einops
|
||||
import numpy as np
|
||||
import torch
|
||||
import torch.nn.functional as F # noqa: N812
|
||||
import torchvision
|
||||
from huggingface_hub import PyTorchModelHubMixin
|
||||
from torch import Tensor, nn
|
||||
from torch.optim.lr_scheduler import LambdaLR
|
||||
|
||||
from lerobot.common.policies.normalize import Normalize, Unnormalize
|
||||
from lerobot.common.policies.utils import get_device_from_parameters, populate_queues
|
||||
from lerobot.common.policies.vqbet.configuration_vqbet import VQBeTConfig
|
||||
from lerobot.common.policies.vqbet.vqbet_utils import GPT, ResidualVQ
|
||||
|
||||
# ruff: noqa: N806
|
||||
|
||||
|
||||
class VQBeTPolicy(nn.Module, PyTorchModelHubMixin):
|
||||
"""
|
||||
VQ-BeT Policy as per "Behavior Generation with Latent Actions"
|
||||
"""
|
||||
|
||||
name = "vqbet"
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
config: VQBeTConfig | None = None,
|
||||
dataset_stats: dict[str, dict[str, Tensor]] | None = None,
|
||||
):
|
||||
"""
|
||||
Args:
|
||||
config: Policy configuration class instance or None, in which case the default instantiation of
|
||||
the configuration class is used.
|
||||
dataset_stats: Dataset statistics to be used for normalization. If not passed here, it is expected
|
||||
that they will be passed with a call to `load_state_dict` before the policy is used.
|
||||
"""
|
||||
super().__init__()
|
||||
if config is None:
|
||||
config = VQBeTConfig()
|
||||
self.config = config
|
||||
self.normalize_inputs = Normalize(
|
||||
config.input_shapes, config.input_normalization_modes, dataset_stats
|
||||
)
|
||||
self.normalize_targets = Normalize(
|
||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||
)
|
||||
self.unnormalize_outputs = Unnormalize(
|
||||
config.output_shapes, config.output_normalization_modes, dataset_stats
|
||||
)
|
||||
|
||||
self.vqbet = VQBeTModel(config)
|
||||
|
||||
self.expected_image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
|
||||
self.reset()
|
||||
|
||||
def reset(self):
|
||||
"""
|
||||
Clear observation and action queues. Should be called on `env.reset()`
|
||||
queues are populated during rollout of the policy, they contain the n latest observations and actions
|
||||
"""
|
||||
self._queues = {
|
||||
"observation.images": deque(maxlen=self.config.n_obs_steps),
|
||||
"observation.state": deque(maxlen=self.config.n_obs_steps),
|
||||
"action": deque(maxlen=self.config.action_chunk_size),
|
||||
}
|
||||
|
||||
@torch.no_grad
|
||||
def select_action(self, batch: dict[str, Tensor]) -> Tensor:
|
||||
"""Select a single action given environment observations.
|
||||
|
||||
This method wraps `select_actions` in order to return one action at a time for execution in the
|
||||
environment. It works by managing the actions in a queue and only calling `select_actions` when the
|
||||
queue is empty.
|
||||
"""
|
||||
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
# Note: It's important that this happens after stacking the images into a single key.
|
||||
self._queues = populate_queues(self._queues, batch)
|
||||
|
||||
if not self.vqbet.action_head.vqvae_model.discretized.item():
|
||||
warnings.warn(
|
||||
"To evaluate in the environment, your VQ-BeT model should contain a pretrained Residual VQ.",
|
||||
stacklevel=1,
|
||||
)
|
||||
|
||||
if len(self._queues["action"]) == 0:
|
||||
batch = {k: torch.stack(list(self._queues[k]), dim=1) for k in batch if k in self._queues}
|
||||
actions = self.vqbet(batch, rollout=True)[:, : self.config.action_chunk_size]
|
||||
|
||||
# the dimension of returned action is (batch_size, action_chunk_size, action_dim)
|
||||
actions = self.unnormalize_outputs({"action": actions})["action"]
|
||||
# since the data in the action queue's dimension is (action_chunk_size, batch_size, action_dim), we transpose the action and fill the queue
|
||||
self._queues["action"].extend(actions.transpose(0, 1))
|
||||
|
||||
action = self._queues["action"].popleft()
|
||||
return action
|
||||
|
||||
def forward(self, batch: dict[str, Tensor]) -> dict[str, Tensor]:
|
||||
"""Run the batch through the model and compute the loss for training or validation."""
|
||||
batch = self.normalize_inputs(batch)
|
||||
batch["observation.images"] = torch.stack([batch[k] for k in self.expected_image_keys], dim=-4)
|
||||
batch = self.normalize_targets(batch)
|
||||
# VQ-BeT discretizes action using VQ-VAE before training BeT (please refer to section 3.2 in the VQ-BeT paper https://arxiv.org/pdf/2403.03181)
|
||||
if not self.vqbet.action_head.vqvae_model.discretized.item():
|
||||
# loss: total loss of training RVQ
|
||||
# n_different_codes: how many of the total possible VQ codes are being used in single batch (how many of them have at least one encoder embedding as a nearest neighbor). This can be at most `vqvae_n_embed * number of layers of RVQ (=2)`.
|
||||
# n_different_combinations: how many different code combinations are being used out of all possible combinations in single batch. This can be at most `vqvae_n_embed ^ number of layers of RVQ (=2)` (hint consider the RVQ as a decision tree).
|
||||
loss, n_different_codes, n_different_combinations, recon_l1_error = (
|
||||
self.vqbet.action_head.discretize(self.config.n_vqvae_training_steps, batch["action"])
|
||||
)
|
||||
return {
|
||||
"loss": loss,
|
||||
"n_different_codes": n_different_codes,
|
||||
"n_different_combinations": n_different_combinations,
|
||||
"recon_l1_error": recon_l1_error,
|
||||
}
|
||||
# if Residual VQ is already trained, VQ-BeT trains its GPT and bin prediction head / offset prediction head parts.
|
||||
_, loss_dict = self.vqbet(batch, rollout=False)
|
||||
|
||||
return loss_dict
|
||||
|
||||
|
||||
class SpatialSoftmax(nn.Module):
|
||||
"""
|
||||
Spatial Soft Argmax operation described in "Deep Spatial Autoencoders for Visuomotor Learning" by Finn et al.
|
||||
(https://arxiv.org/pdf/1509.06113). A minimal port of the robomimic implementation.
|
||||
|
||||
At a high level, this takes 2D feature maps (from a convnet/ViT) and returns the "center of mass"
|
||||
of activations of each channel, i.e., keypoints in the image space for the policy to focus on.
|
||||
|
||||
Example: take feature maps of size (512x10x12). We generate a grid of normalized coordinates (10x12x2):
|
||||
-----------------------------------------------------
|
||||
| (-1., -1.) | (-0.82, -1.) | ... | (1., -1.) |
|
||||
| (-1., -0.78) | (-0.82, -0.78) | ... | (1., -0.78) |
|
||||
| ... | ... | ... | ... |
|
||||
| (-1., 1.) | (-0.82, 1.) | ... | (1., 1.) |
|
||||
-----------------------------------------------------
|
||||
This is achieved by applying channel-wise softmax over the activations (512x120) and computing the dot
|
||||
product with the coordinates (120x2) to get expected points of maximal activation (512x2).
|
||||
|
||||
The example above results in 512 keypoints (corresponding to the 512 input channels). We can optionally
|
||||
provide num_kp != None to control the number of keypoints. This is achieved by a first applying a learnable
|
||||
linear mapping (in_channels, H, W) -> (num_kp, H, W).
|
||||
"""
|
||||
|
||||
def __init__(self, input_shape, num_kp=None):
|
||||
"""
|
||||
Args:
|
||||
input_shape (list): (C, H, W) input feature map shape.
|
||||
num_kp (int): number of keypoints in output. If None, output will have the same number of channels as input.
|
||||
"""
|
||||
super().__init__()
|
||||
|
||||
assert len(input_shape) == 3
|
||||
self._in_c, self._in_h, self._in_w = input_shape
|
||||
|
||||
if num_kp is not None:
|
||||
self.nets = torch.nn.Conv2d(self._in_c, num_kp, kernel_size=1)
|
||||
self._out_c = num_kp
|
||||
else:
|
||||
self.nets = None
|
||||
self._out_c = self._in_c
|
||||
|
||||
# we could use torch.linspace directly but that seems to behave slightly differently than numpy
|
||||
# and causes a small degradation in pc_success of pre-trained models.
|
||||
pos_x, pos_y = np.meshgrid(np.linspace(-1.0, 1.0, self._in_w), np.linspace(-1.0, 1.0, self._in_h))
|
||||
pos_x = torch.from_numpy(pos_x.reshape(self._in_h * self._in_w, 1)).float()
|
||||
pos_y = torch.from_numpy(pos_y.reshape(self._in_h * self._in_w, 1)).float()
|
||||
# register as buffer so it's moved to the correct device.
|
||||
self.register_buffer("pos_grid", torch.cat([pos_x, pos_y], dim=1))
|
||||
|
||||
def forward(self, features: Tensor) -> Tensor:
|
||||
"""
|
||||
Args:
|
||||
features: (B, C, H, W) input feature maps.
|
||||
Returns:
|
||||
(B, K, 2) image-space coordinates of keypoints.
|
||||
"""
|
||||
if self.nets is not None:
|
||||
features = self.nets(features)
|
||||
|
||||
# [B, K, H, W] -> [B * K, H * W] where K is number of keypoints
|
||||
features = features.reshape(-1, self._in_h * self._in_w)
|
||||
# 2d softmax normalization
|
||||
attention = F.softmax(features, dim=-1)
|
||||
# [B * K, H * W] x [H * W, 2] -> [B * K, 2] for spatial coordinate mean in x and y dimensions
|
||||
expected_xy = attention @ self.pos_grid
|
||||
# reshape to [B, K, 2]
|
||||
feature_keypoints = expected_xy.view(-1, self._out_c, 2)
|
||||
|
||||
return feature_keypoints
|
||||
|
||||
|
||||
class VQBeTModel(nn.Module):
|
||||
"""VQ-BeT: The underlying neural network for VQ-BeT
|
||||
|
||||
Note: In this code we use the terms `rgb_encoder`, 'policy', `action_head`. The meanings are as follows.
|
||||
- The `rgb_encoder` process rgb-style image observations to one-dimensional embedding vectors
|
||||
- A `policy` is a minGPT architecture, that takes observation sequences and action query tokens to generate `features`.
|
||||
- These `features` pass through the action head, which passes through the code prediction, offset prediction head,
|
||||
and finally generates a prediction for the action chunks.
|
||||
|
||||
-------------------------------** legend **-------------------------------
|
||||
│ n = n_obs_steps, p = n_action_pred_token, c = action_chunk_size) │
|
||||
│ o_{t} : visual observation at timestep {t} │
|
||||
│ s_{t} : state observation at timestep {t} │
|
||||
│ a_{t} : action at timestep {t} │
|
||||
│ A_Q : action_query_token │
|
||||
--------------------------------------------------------------------------
|
||||
|
||||
|
||||
Training Phase 1. Discretize action using Residual VQ (for config.n_vqvae_training_steps steps)
|
||||
|
||||
|
||||
┌─────────────────┐ ┌─────────────────┐ ┌─────────────────┐
|
||||
│ │ │ │ │ │
|
||||
│ RVQ encoder │ ─► │ Residual │ ─► │ RVQ Decoder │
|
||||
│ (a_{t}~a_{t+p}) │ │ Code Quantizer │ │ │
|
||||
│ │ │ │ │ │
|
||||
└─────────────────┘ └─────────────────┘ └─────────────────┘
|
||||
|
||||
Training Phase 2.
|
||||
|
||||
timestep {t-n+1} timestep {t-n+2} timestep {t}
|
||||
┌─────┴─────┐ ┌─────┴─────┐ ┌─────┴─────┐
|
||||
|
||||
o_{t-n+1} o_{t-n+2} ... o_{t}
|
||||
│ │ │
|
||||
│ s_{t-n+1} │ s_{t-n+2} ... │ s_{t} p
|
||||
│ │ │ │ │ │ ┌───────┴───────┐
|
||||
│ │ A_Q │ │ A_Q ... │ │ A_Q ... A_Q
|
||||
│ │ │ │ │ │ │ │ │ │
|
||||
┌───▼─────▼─────▼─────▼─────▼─────▼─────────────────▼─────▼─────▼───────────────▼───┐
|
||||
│ │
|
||||
│ GPT │ => policy
|
||||
│ │
|
||||
└───────────────▼─────────────────▼─────────────────────────────▼───────────────▼───┘
|
||||
│ │ │ │
|
||||
┌───┴───┐ ┌───┴───┐ ┌───┴───┐ ┌───┴───┐
|
||||
code offset code offset code offset code offset
|
||||
▼ │ ▼ │ ▼ │ ▼ │ => action_head
|
||||
RVQ Decoder │ RVQ Decoder │ RVQ Decoder │ RVQ Decoder │
|
||||
└── + ──┘ └── + ──┘ └── + ──┘ └── + ──┘
|
||||
▼ ▼ ▼ ▼
|
||||
action chunk action chunk action chunk action chunk
|
||||
a_{t-n+1} ~ a_{t-n+2} ~ a_{t} ~ ... a_{t+p-1} ~
|
||||
a_{t-n+c} a_{t-n+c+1} a_{t+c-1} a_{t+p+c-1}
|
||||
|
||||
▼
|
||||
ONLY this chunk is used in rollout!
|
||||
"""
|
||||
|
||||
def __init__(self, config: VQBeTConfig):
|
||||
super().__init__()
|
||||
self.config = config
|
||||
|
||||
self.rgb_encoder = VQBeTRgbEncoder(config)
|
||||
self.num_images = len([k for k in config.input_shapes if k.startswith("observation.image")])
|
||||
# This action query token is used as a prompt for querying action chunks. Please refer to "A_Q" in the image above.
|
||||
# Note: During the forward pass, this token is repeated as many times as needed. The authors also experimented with initializing the necessary number of tokens independently and observed inferior results.
|
||||
self.action_token = nn.Parameter(torch.randn(1, 1, self.config.gpt_input_dim))
|
||||
|
||||
# To input state and observation features into GPT layers, we first project the features to fit the shape of input size of GPT.
|
||||
self.state_projector = MLP(
|
||||
config.output_shapes["action"][0], hidden_channels=[self.config.gpt_input_dim]
|
||||
)
|
||||
self.rgb_feature_projector = MLP(
|
||||
self.rgb_encoder.feature_dim, hidden_channels=[self.config.gpt_input_dim]
|
||||
)
|
||||
|
||||
# GPT part of VQ-BeT
|
||||
self.policy = GPT(config)
|
||||
# bin prediction head / offset prediction head part of VQ-BeT
|
||||
self.action_head = VQBeTHead(config)
|
||||
|
||||
# Action tokens for: each observation step, the current action token, and all future action tokens.
|
||||
num_tokens = self.config.n_action_pred_token + self.config.n_obs_steps - 1
|
||||
self.register_buffer(
|
||||
"select_target_actions_indices",
|
||||
torch.row_stack([torch.arange(i, i + self.config.action_chunk_size) for i in range(num_tokens)]),
|
||||
)
|
||||
|
||||
def forward(self, batch: dict[str, Tensor], rollout: bool) -> Tensor:
|
||||
# Input validation.
|
||||
assert set(batch).issuperset({"observation.state", "observation.images"})
|
||||
batch_size, n_obs_steps = batch["observation.state"].shape[:2]
|
||||
assert n_obs_steps == self.config.n_obs_steps
|
||||
|
||||
# Extract image feature (first combine batch and sequence dims).
|
||||
img_features = self.rgb_encoder(
|
||||
einops.rearrange(batch["observation.images"], "b s n ... -> (b s n) ...")
|
||||
)
|
||||
# Separate batch and sequence dims.
|
||||
img_features = einops.rearrange(
|
||||
img_features, "(b s n) ... -> b s n ...", b=batch_size, s=n_obs_steps, n=self.num_images
|
||||
)
|
||||
|
||||
# Arrange prior and current observation step tokens as shown in the class docstring.
|
||||
# First project features to token dimension.
|
||||
rgb_tokens = self.rgb_feature_projector(
|
||||
img_features
|
||||
) # (batch, obs_step, number of different cameras, projection dims)
|
||||
input_tokens = [rgb_tokens[:, :, i] for i in range(rgb_tokens.size(2))]
|
||||
input_tokens.append(
|
||||
self.state_projector(batch["observation.state"])
|
||||
) # (batch, obs_step, projection dims)
|
||||
input_tokens.append(einops.repeat(self.action_token, "1 1 d -> b n d", b=batch_size, n=n_obs_steps))
|
||||
# Interleave tokens by stacking and rearranging.
|
||||
input_tokens = torch.stack(input_tokens, dim=2)
|
||||
input_tokens = einops.rearrange(input_tokens, "b n t d -> b (n t) d")
|
||||
|
||||
len_additional_action_token = self.config.n_action_pred_token - 1
|
||||
future_action_tokens = self.action_token.repeat(batch_size, len_additional_action_token, 1)
|
||||
|
||||
# add additional action query tokens for predicting future action chunks
|
||||
input_tokens = torch.cat([input_tokens, future_action_tokens], dim=1)
|
||||
|
||||
# get action features (pass through GPT)
|
||||
features = self.policy(input_tokens)
|
||||
# len(self.config.input_shapes) is the number of different observation modes. this line gets the index of action prompt tokens.
|
||||
historical_act_pred_index = np.arange(0, n_obs_steps) * (len(self.config.input_shapes) + 1) + len(
|
||||
self.config.input_shapes
|
||||
)
|
||||
|
||||
# only extract the output tokens at the position of action query:
|
||||
# Behavior Transformer (BeT), and VQ-BeT are both sequence-to-sequence prediction models, mapping sequential observation to sequential action (please refer to section 2.2 in BeT paper https://arxiv.org/pdf/2206.11251).
|
||||
# Thus, it predict historical action sequence, in addition to current and future actions (predicting future actions : optional).
|
||||
features = torch.cat(
|
||||
[features[:, historical_act_pred_index], features[:, -len_additional_action_token:]], dim=1
|
||||
)
|
||||
# pass through action head
|
||||
action_head_output = self.action_head(features)
|
||||
# if rollout, VQ-BeT don't calculate loss
|
||||
if rollout:
|
||||
return action_head_output["predicted_action"][:, n_obs_steps - 1, :].reshape(
|
||||
batch_size, self.config.action_chunk_size, -1
|
||||
)
|
||||
# else, it calculate overall loss (bin prediction loss, and offset loss)
|
||||
else:
|
||||
output = batch["action"][:, self.select_target_actions_indices]
|
||||
loss = self.action_head.loss_fn(action_head_output, output, reduction="mean")
|
||||
return action_head_output, loss
|
||||
|
||||
|
||||
class VQBeTHead(nn.Module):
|
||||
def __init__(self, config: VQBeTConfig):
|
||||
"""
|
||||
VQBeTHead takes output of GPT layers, and pass the feature through bin prediction head (`self.map_to_cbet_preds_bin`), and offset prediction head (`self.map_to_cbet_preds_offset`)
|
||||
|
||||
self.map_to_cbet_preds_bin: outputs probability of each code (for each layer).
|
||||
The input dimension of `self.map_to_cbet_preds_bin` is same with the output of GPT,
|
||||
and the output dimension of `self.map_to_cbet_preds_bin` is `self.vqvae_model.vqvae_num_layers (=fixed as 2) * self.config.vqvae_n_embed`.
|
||||
if the agent select the code sequentially, we use self.map_to_cbet_preds_primary_bin and self.map_to_cbet_preds_secondary_bin instead of self._map_to_cbet_preds_bin.
|
||||
|
||||
self.map_to_cbet_preds_offset: output the predicted offsets for all the codes in all the layers.
|
||||
The input dimension of ` self.map_to_cbet_preds_offset` is same with the output of GPT,
|
||||
and the output dimension of ` self.map_to_cbet_preds_offset` is `self.vqvae_model.vqvae_num_layers (=fixed as 2) * self.config.vqvae_n_embed * config.action_chunk_size * config.output_shapes["action"][0]`.
|
||||
"""
|
||||
|
||||
super().__init__()
|
||||
self.config = config
|
||||
# init vqvae
|
||||
self.vqvae_model = VqVae(config)
|
||||
if config.sequentially_select:
|
||||
self.map_to_cbet_preds_primary_bin = MLP(
|
||||
in_channels=config.gpt_output_dim,
|
||||
hidden_channels=[self.config.vqvae_n_embed],
|
||||
)
|
||||
self.map_to_cbet_preds_secondary_bin = MLP(
|
||||
in_channels=config.gpt_output_dim + self.config.vqvae_n_embed,
|
||||
hidden_channels=[self.config.vqvae_n_embed],
|
||||
)
|
||||
else:
|
||||
self.map_to_cbet_preds_bin = MLP(
|
||||
in_channels=config.gpt_output_dim,
|
||||
hidden_channels=[self.vqvae_model.vqvae_num_layers * self.config.vqvae_n_embed],
|
||||
)
|
||||
self.map_to_cbet_preds_offset = MLP(
|
||||
in_channels=config.gpt_output_dim,
|
||||
hidden_channels=[
|
||||
self.vqvae_model.vqvae_num_layers
|
||||
* self.config.vqvae_n_embed
|
||||
* config.action_chunk_size
|
||||
* config.output_shapes["action"][0],
|
||||
],
|
||||
)
|
||||
# loss
|
||||
self._focal_loss_fn = FocalLoss(gamma=2.0)
|
||||
|
||||
def discretize(self, n_vqvae_training_steps, actions):
|
||||
# Resize the action sequence data to fit the action chunk size using a sliding window approach.
|
||||
actions = torch.cat(
|
||||
[
|
||||
actions[:, j : j + self.config.action_chunk_size, :]
|
||||
for j in range(actions.shape[1] + 1 - self.config.action_chunk_size)
|
||||
],
|
||||
dim=0,
|
||||
)
|
||||
# `actions` is a tensor of shape (new_batch, action_chunk_size, action_dim) where new_batch is the number of possible chunks created from the original sequences using the sliding window.
|
||||
|
||||
loss, metric = self.vqvae_model.vqvae_forward(actions)
|
||||
n_different_codes = sum(
|
||||
[len(torch.unique(metric[2][:, i])) for i in range(self.vqvae_model.vqvae_num_layers)]
|
||||
)
|
||||
n_different_combinations = len(torch.unique(metric[2], dim=0))
|
||||
recon_l1_error = metric[0].detach().cpu().item()
|
||||
self.vqvae_model.optimized_steps += 1
|
||||
# if we updated RVQ more than `n_vqvae_training_steps` steps, we freeze the RVQ part.
|
||||
if self.vqvae_model.optimized_steps >= n_vqvae_training_steps:
|
||||
self.vqvae_model.discretized = torch.tensor(True)
|
||||
self.vqvae_model.vq_layer.freeze_codebook = torch.tensor(True)
|
||||
print("Finished discretizing action data!")
|
||||
self.vqvae_model.eval()
|
||||
for param in self.vqvae_model.vq_layer.parameters():
|
||||
param.requires_grad = False
|
||||
return loss, n_different_codes, n_different_combinations, recon_l1_error
|
||||
|
||||
def forward(self, x, **kwargs):
|
||||
# N is the batch size, and T is number of action query tokens, which are process through same GPT
|
||||
N, T, _ = x.shape
|
||||
# we calculate N and T side parallely. Thus, the dimensions would be
|
||||
# (batch size * number of action query tokens, action chunk size, action dimension)
|
||||
x = einops.rearrange(x, "N T WA -> (N T) WA")
|
||||
|
||||
# sample offsets
|
||||
cbet_offsets = self.map_to_cbet_preds_offset(x)
|
||||
cbet_offsets = einops.rearrange(
|
||||
cbet_offsets,
|
||||
"(NT) (G C WA) -> (NT) G C WA",
|
||||
G=self.vqvae_model.vqvae_num_layers,
|
||||
C=self.config.vqvae_n_embed,
|
||||
)
|
||||
# if self.config.sequentially_select is True, bin prediction head first sample the primary code, and then sample secondary code
|
||||
if self.config.sequentially_select:
|
||||
cbet_primary_logits = self.map_to_cbet_preds_primary_bin(x)
|
||||
|
||||
# select primary bin first
|
||||
cbet_primary_probs = torch.softmax(
|
||||
cbet_primary_logits / self.config.bet_softmax_temperature, dim=-1
|
||||
)
|
||||
NT, choices = cbet_primary_probs.shape
|
||||
sampled_primary_centers = einops.rearrange(
|
||||
torch.multinomial(cbet_primary_probs.view(-1, choices), num_samples=1),
|
||||
"(NT) 1 -> NT",
|
||||
NT=NT,
|
||||
)
|
||||
|
||||
cbet_secondary_logits = self.map_to_cbet_preds_secondary_bin(
|
||||
torch.cat(
|
||||
(x, F.one_hot(sampled_primary_centers, num_classes=self.config.vqvae_n_embed)),
|
||||
axis=1,
|
||||
)
|
||||
)
|
||||
cbet_secondary_probs = torch.softmax(
|
||||
cbet_secondary_logits / self.config.bet_softmax_temperature, dim=-1
|
||||
)
|
||||
sampled_secondary_centers = einops.rearrange(
|
||||
torch.multinomial(cbet_secondary_probs.view(-1, choices), num_samples=1),
|
||||
"(NT) 1 -> NT",
|
||||
NT=NT,
|
||||
)
|
||||
sampled_centers = torch.stack((sampled_primary_centers, sampled_secondary_centers), axis=1)
|
||||
cbet_logits = torch.stack([cbet_primary_logits, cbet_secondary_logits], dim=1)
|
||||
# if self.config.sequentially_select is False, bin prediction head samples primary and secondary code at once.
|
||||
else:
|
||||
cbet_logits = self.map_to_cbet_preds_bin(x)
|
||||
cbet_logits = einops.rearrange(
|
||||
cbet_logits, "(NT) (G C) -> (NT) G C", G=self.vqvae_model.vqvae_num_layers
|
||||
)
|
||||
cbet_probs = torch.softmax(cbet_logits / self.config.bet_softmax_temperature, dim=-1)
|
||||
NT, G, choices = cbet_probs.shape
|
||||
sampled_centers = einops.rearrange(
|
||||
torch.multinomial(cbet_probs.view(-1, choices), num_samples=1),
|
||||
"(NT G) 1 -> NT G",
|
||||
NT=NT,
|
||||
)
|
||||
|
||||
device = get_device_from_parameters(self)
|
||||
indices = (
|
||||
torch.arange(NT, device=device).unsqueeze(1),
|
||||
torch.arange(self.vqvae_model.vqvae_num_layers, device=device).unsqueeze(0),
|
||||
sampled_centers,
|
||||
)
|
||||
# Use advanced indexing to sample the values (Extract the only offsets corresponding to the sampled codes.)
|
||||
sampled_offsets = cbet_offsets[indices]
|
||||
# Then, sum the offsets over the RVQ layers to get a net offset for the bin prediction
|
||||
sampled_offsets = sampled_offsets.sum(dim=1)
|
||||
with torch.no_grad():
|
||||
# Get the centroids (= vectors corresponding to the codes) of each layer to pass it through RVQ decoder
|
||||
return_decoder_input = self.vqvae_model.get_embeddings_from_code(sampled_centers).clone().detach()
|
||||
# pass the centroids through decoder to get actions.
|
||||
decoded_action = self.vqvae_model.get_action_from_latent(return_decoder_input).clone().detach()
|
||||
# reshaped extracted offset to match with decoded centroids
|
||||
sampled_offsets = einops.rearrange(
|
||||
sampled_offsets, "NT (W A) -> NT W A", W=self.config.action_chunk_size
|
||||
)
|
||||
# add offset and decoded centroids
|
||||
predicted_action = decoded_action + sampled_offsets
|
||||
predicted_action = einops.rearrange(
|
||||
predicted_action,
|
||||
"(N T) W A -> N T (W A)",
|
||||
N=N,
|
||||
T=T,
|
||||
W=self.config.action_chunk_size,
|
||||
)
|
||||
|
||||
return {
|
||||
"cbet_logits": cbet_logits,
|
||||
"predicted_action": predicted_action,
|
||||
"sampled_centers": sampled_centers,
|
||||
"decoded_action": decoded_action,
|
||||
}
|
||||
|
||||
def loss_fn(self, pred, target, **kwargs):
|
||||
"""
|
||||
for given ground truth action values (target), and prediction (pred) this function calculates the overall loss.
|
||||
|
||||
predicted_action: predicted action chunk (offset + decoded centroids)
|
||||
sampled_centers: sampled centroids (code of RVQ)
|
||||
decoded_action: decoded action, which is produced by passing sampled_centers through RVQ decoder
|
||||
NT: batch size * T
|
||||
T: number of action query tokens, which are process through same GPT
|
||||
cbet_logits: probability of all codes in each layer
|
||||
"""
|
||||
action_seq = target
|
||||
predicted_action = pred["predicted_action"]
|
||||
sampled_centers = pred["sampled_centers"]
|
||||
decoded_action = pred["decoded_action"]
|
||||
NT = predicted_action.shape[0] * predicted_action.shape[1]
|
||||
|
||||
cbet_logits = pred["cbet_logits"]
|
||||
|
||||
predicted_action = einops.rearrange(
|
||||
predicted_action, "N T (W A) -> (N T) W A", W=self.config.action_chunk_size
|
||||
)
|
||||
|
||||
action_seq = einops.rearrange(action_seq, "N T W A -> (N T) W A")
|
||||
# Figure out the loss for the actions.
|
||||
# First, we need to find the closest cluster center for each ground truth action.
|
||||
with torch.no_grad():
|
||||
state_vq, action_bins = self.vqvae_model.get_code(action_seq) # action_bins: NT, G
|
||||
|
||||
# Now we can compute the loss.
|
||||
|
||||
# offset loss is L1 distance between the predicted action and ground truth action
|
||||
offset_loss = F.l1_loss(action_seq, predicted_action)
|
||||
|
||||
# calculate primary code prediction loss
|
||||
cbet_loss1 = self._focal_loss_fn(
|
||||
cbet_logits[:, 0, :],
|
||||
action_bins[:, 0],
|
||||
)
|
||||
# calculate secondary code prediction loss
|
||||
cbet_loss2 = self._focal_loss_fn(
|
||||
cbet_logits[:, 1, :],
|
||||
action_bins[:, 1],
|
||||
)
|
||||
# add all the prediction loss
|
||||
cbet_loss = (
|
||||
cbet_loss1 * self.config.primary_code_loss_weight
|
||||
+ cbet_loss2 * self.config.secondary_code_loss_weight
|
||||
)
|
||||
|
||||
equal_primary_code_rate = torch.sum((action_bins[:, 0] == sampled_centers[:, 0]).int()) / (NT)
|
||||
equal_secondary_code_rate = torch.sum((action_bins[:, 1] == sampled_centers[:, 1]).int()) / (NT)
|
||||
|
||||
action_mse_error = torch.mean((action_seq - predicted_action) ** 2)
|
||||
vq_action_error = torch.mean(torch.abs(action_seq - decoded_action))
|
||||
offset_action_error = torch.mean(torch.abs(action_seq - predicted_action))
|
||||
action_error_max = torch.max(torch.abs(action_seq - predicted_action))
|
||||
|
||||
loss = cbet_loss + self.config.offset_loss_weight * offset_loss
|
||||
|
||||
loss_dict = {
|
||||
"loss": loss,
|
||||
"classification_loss": cbet_loss.detach().cpu().item(),
|
||||
"offset_loss": offset_loss.detach().cpu().item(),
|
||||
"equal_primary_code_rate": equal_primary_code_rate.detach().cpu().item(),
|
||||
"equal_secondary_code_rate": equal_secondary_code_rate.detach().cpu().item(),
|
||||
"vq_action_error": vq_action_error.detach().cpu().item(),
|
||||
"offset_action_error": offset_action_error.detach().cpu().item(),
|
||||
"action_error_max": action_error_max.detach().cpu().item(),
|
||||
"action_mse_error": action_mse_error.detach().cpu().item(),
|
||||
}
|
||||
return loss_dict
|
||||
|
||||
|
||||
class VQBeTOptimizer(torch.optim.Adam):
|
||||
def __init__(self, policy, cfg):
|
||||
vqvae_params = (
|
||||
list(policy.vqbet.action_head.vqvae_model.encoder.parameters())
|
||||
+ list(policy.vqbet.action_head.vqvae_model.decoder.parameters())
|
||||
+ list(policy.vqbet.action_head.vqvae_model.vq_layer.parameters())
|
||||
)
|
||||
decay_params, no_decay_params = policy.vqbet.policy.configure_parameters()
|
||||
decay_params = (
|
||||
decay_params
|
||||
+ list(policy.vqbet.rgb_encoder.parameters())
|
||||
+ list(policy.vqbet.state_projector.parameters())
|
||||
+ list(policy.vqbet.rgb_feature_projector.parameters())
|
||||
+ [policy.vqbet.action_token]
|
||||
+ list(policy.vqbet.action_head.map_to_cbet_preds_offset.parameters())
|
||||
)
|
||||
|
||||
if cfg.policy.sequentially_select:
|
||||
decay_params = (
|
||||
decay_params
|
||||
+ list(policy.vqbet.action_head.map_to_cbet_preds_primary_bin.parameters())
|
||||
+ list(policy.vqbet.action_head.map_to_cbet_preds_secondary_bin.parameters())
|
||||
)
|
||||
else:
|
||||
decay_params = decay_params + list(policy.vqbet.action_head.map_to_cbet_preds_bin.parameters())
|
||||
|
||||
optim_groups = [
|
||||
{
|
||||
"params": decay_params,
|
||||
"weight_decay": cfg.training.adam_weight_decay,
|
||||
"lr": cfg.training.lr,
|
||||
},
|
||||
{
|
||||
"params": vqvae_params,
|
||||
"weight_decay": 0.0001,
|
||||
"lr": cfg.training.vqvae_lr,
|
||||
},
|
||||
{
|
||||
"params": no_decay_params,
|
||||
"weight_decay": 0.0,
|
||||
"lr": cfg.training.lr,
|
||||
},
|
||||
]
|
||||
super().__init__(
|
||||
optim_groups,
|
||||
cfg.training.lr,
|
||||
cfg.training.adam_betas,
|
||||
cfg.training.adam_eps,
|
||||
)
|
||||
|
||||
|
||||
class VQBeTScheduler(nn.Module):
|
||||
def __init__(self, optimizer, cfg):
|
||||
super().__init__()
|
||||
n_vqvae_training_steps = cfg.training.n_vqvae_training_steps
|
||||
|
||||
num_warmup_steps = cfg.training.lr_warmup_steps
|
||||
num_training_steps = cfg.training.offline_steps
|
||||
num_cycles = 0.5
|
||||
|
||||
def lr_lambda(current_step):
|
||||
if current_step < n_vqvae_training_steps:
|
||||
return float(1)
|
||||
else:
|
||||
current_step = current_step - n_vqvae_training_steps
|
||||
if current_step < num_warmup_steps:
|
||||
return float(current_step) / float(max(1, num_warmup_steps))
|
||||
progress = float(current_step - num_warmup_steps) / float(
|
||||
max(1, num_training_steps - num_warmup_steps)
|
||||
)
|
||||
return max(0.0, 0.5 * (1.0 + math.cos(math.pi * float(num_cycles) * 2.0 * progress)))
|
||||
|
||||
self.lr_scheduler = LambdaLR(optimizer, lr_lambda, -1)
|
||||
|
||||
def step(self):
|
||||
self.lr_scheduler.step()
|
||||
|
||||
|
||||
class VQBeTRgbEncoder(nn.Module):
|
||||
"""Encode an RGB image into a 1D feature vector.
|
||||
|
||||
Includes the ability to normalize and crop the image first.
|
||||
|
||||
Same with DiffusionRgbEncoder from modeling_diffusion.py
|
||||
"""
|
||||
|
||||
def __init__(self, config: VQBeTConfig):
|
||||
super().__init__()
|
||||
# Set up optional preprocessing.
|
||||
if config.crop_shape is not None:
|
||||
self.do_crop = True
|
||||
# Always use center crop for eval
|
||||
self.center_crop = torchvision.transforms.CenterCrop(config.crop_shape)
|
||||
if config.crop_is_random:
|
||||
self.maybe_random_crop = torchvision.transforms.RandomCrop(config.crop_shape)
|
||||
else:
|
||||
self.maybe_random_crop = self.center_crop
|
||||
else:
|
||||
self.do_crop = False
|
||||
|
||||
# Set up backbone.
|
||||
backbone_model = getattr(torchvision.models, config.vision_backbone)(
|
||||
weights=config.pretrained_backbone_weights
|
||||
)
|
||||
# Note: This assumes that the layer4 feature map is children()[-3]
|
||||
# TODO(alexander-soare): Use a safer alternative.
|
||||
self.backbone = nn.Sequential(*(list(backbone_model.children())[:-2]))
|
||||
if config.use_group_norm:
|
||||
if config.pretrained_backbone_weights:
|
||||
raise ValueError(
|
||||
"You can't replace BatchNorm in a pretrained model without ruining the weights!"
|
||||
)
|
||||
self.backbone = _replace_submodules(
|
||||
root_module=self.backbone,
|
||||
predicate=lambda x: isinstance(x, nn.BatchNorm2d),
|
||||
func=lambda x: nn.GroupNorm(num_groups=x.num_features // 16, num_channels=x.num_features),
|
||||
)
|
||||
|
||||
# Set up pooling and final layers.
|
||||
# Use a dry run to get the feature map shape.
|
||||
# The dummy input should take the number of image channels from `config.input_shapes` and it should
|
||||
# use the height and width from `config.crop_shape` if it is provided, otherwise it should use the
|
||||
# height and width from `config.input_shapes`.
|
||||
image_keys = [k for k in config.input_shapes if k.startswith("observation.image")]
|
||||
assert len(image_keys) == 1
|
||||
image_key = image_keys[0]
|
||||
dummy_input_h_w = (
|
||||
config.crop_shape if config.crop_shape is not None else config.input_shapes[image_key][1:]
|
||||
)
|
||||
dummy_input = torch.zeros(size=(1, config.input_shapes[image_key][0], *dummy_input_h_w))
|
||||
with torch.inference_mode():
|
||||
dummy_feature_map = self.backbone(dummy_input)
|
||||
feature_map_shape = tuple(dummy_feature_map.shape[1:])
|
||||
self.pool = SpatialSoftmax(feature_map_shape, num_kp=config.spatial_softmax_num_keypoints)
|
||||
self.feature_dim = config.spatial_softmax_num_keypoints * 2
|
||||
self.out = nn.Linear(config.spatial_softmax_num_keypoints * 2, self.feature_dim)
|
||||
self.relu = nn.ReLU()
|
||||
|
||||
def forward(self, x: Tensor) -> Tensor:
|
||||
"""
|
||||
Args:
|
||||
x: (B, C, H, W) image tensor with pixel values in [0, 1].
|
||||
Returns:
|
||||
(B, D) image feature.
|
||||
"""
|
||||
# Preprocess: maybe crop (if it was set up in the __init__).
|
||||
if self.do_crop:
|
||||
if self.training: # noqa: SIM108
|
||||
x = self.maybe_random_crop(x)
|
||||
else:
|
||||
# Always use center crop for eval.
|
||||
x = self.center_crop(x)
|
||||
# Extract backbone feature.
|
||||
x = torch.flatten(self.pool(self.backbone(x)), start_dim=1)
|
||||
# Final linear layer with non-linearity.
|
||||
x = self.relu(self.out(x))
|
||||
return x
|
||||
|
||||
|
||||
def _replace_submodules(
|
||||
root_module: nn.Module, predicate: Callable[[nn.Module], bool], func: Callable[[nn.Module], nn.Module]
|
||||
) -> nn.Module:
|
||||
"""
|
||||
Args:
|
||||
root_module: The module for which the submodules need to be replaced
|
||||
predicate: Takes a module as an argument and must return True if the that module is to be replaced.
|
||||
func: Takes a module as an argument and returns a new module to replace it with.
|
||||
Returns:
|
||||
The root module with its submodules replaced.
|
||||
"""
|
||||
if predicate(root_module):
|
||||
return func(root_module)
|
||||
|
||||
replace_list = [k.split(".") for k, m in root_module.named_modules(remove_duplicate=True) if predicate(m)]
|
||||
for *parents, k in replace_list:
|
||||
parent_module = root_module
|
||||
if len(parents) > 0:
|
||||
parent_module = root_module.get_submodule(".".join(parents))
|
||||
if isinstance(parent_module, nn.Sequential):
|
||||
src_module = parent_module[int(k)]
|
||||
else:
|
||||
src_module = getattr(parent_module, k)
|
||||
tgt_module = func(src_module)
|
||||
if isinstance(parent_module, nn.Sequential):
|
||||
parent_module[int(k)] = tgt_module
|
||||
else:
|
||||
setattr(parent_module, k, tgt_module)
|
||||
# verify that all BN are replaced
|
||||
assert not any(predicate(m) for _, m in root_module.named_modules(remove_duplicate=True))
|
||||
return root_module
|
||||
|
||||
|
||||
class VqVae(nn.Module):
|
||||
def __init__(
|
||||
self,
|
||||
config: VQBeTConfig,
|
||||
):
|
||||
"""
|
||||
VQ-VAE is composed of three parts: encoder, vq_layer, and decoder.
|
||||
Encoder and decoder are MLPs consisting of an input, output layer, and hidden layer, respectively.
|
||||
The vq_layer uses residual VQs.
|
||||
|
||||
This class contains functions for training the encoder and decoder along with the residual VQ layer (for trainign phase 1),
|
||||
as well as functions to help BeT training part in training phase 2.
|
||||
"""
|
||||
|
||||
super().__init__()
|
||||
self.config = config
|
||||
# 'discretized' indicates whether the Residual VQ part is trained or not. (After finishing the training, we set discretized=True)
|
||||
self.register_buffer("discretized", torch.tensor(False))
|
||||
self.optimized_steps = 0
|
||||
# we use the fixed number of layers for Residual VQ across all environments.
|
||||
self.vqvae_num_layers = 2
|
||||
|
||||
self.vq_layer = ResidualVQ(
|
||||
dim=config.vqvae_embedding_dim,
|
||||
num_quantizers=self.vqvae_num_layers,
|
||||
codebook_size=config.vqvae_n_embed,
|
||||
)
|
||||
|
||||
self.encoder = MLP(
|
||||
in_channels=self.config.output_shapes["action"][0] * self.config.action_chunk_size,
|
||||
hidden_channels=[
|
||||
config.vqvae_enc_hidden_dim,
|
||||
config.vqvae_enc_hidden_dim,
|
||||
config.vqvae_embedding_dim,
|
||||
],
|
||||
)
|
||||
self.decoder = MLP(
|
||||
in_channels=config.vqvae_embedding_dim,
|
||||
hidden_channels=[
|
||||
config.vqvae_enc_hidden_dim,
|
||||
config.vqvae_enc_hidden_dim,
|
||||
self.config.output_shapes["action"][0] * self.config.action_chunk_size,
|
||||
],
|
||||
)
|
||||
|
||||
def get_embeddings_from_code(self, encoding_indices):
|
||||
# This function gets code indices as inputs, and outputs embedding vectors corresponding to the code indices.
|
||||
with torch.no_grad():
|
||||
z_embed = self.vq_layer.get_codebook_vector_from_indices(encoding_indices)
|
||||
# since the RVQ has multiple layers, it adds the vectors in the axis of layers to provide a vector for that code combination.
|
||||
z_embed = z_embed.sum(dim=0)
|
||||
return z_embed
|
||||
|
||||
def get_action_from_latent(self, latent):
|
||||
# given latent vector, this function outputs the decoded action.
|
||||
output = self.decoder(latent)
|
||||
if self.config.action_chunk_size == 1:
|
||||
return einops.rearrange(output, "N (T A) -> N T A", A=self.config.output_shapes["action"][0])
|
||||
else:
|
||||
return einops.rearrange(output, "N (T A) -> N T A", A=self.config.output_shapes["action"][0])
|
||||
|
||||
def get_code(self, state):
|
||||
# in phase 2 of VQ-BeT training, we need a `ground truth labels of action data` to calculate the Focal loss for code prediction head. (please refer to section 3.3 in the paper https://arxiv.org/pdf/2403.03181)
|
||||
# this function outputs the `GT code` of given action using frozen encoder and quantization layers. (please refer to Figure 2. in the paper https://arxiv.org/pdf/2403.03181)
|
||||
state = einops.rearrange(state, "N T A -> N (T A)")
|
||||
with torch.no_grad():
|
||||
state_rep = self.encoder(state)
|
||||
state_rep_shape = state_rep.shape[:-1]
|
||||
state_rep_flat = state_rep.view(state_rep.size(0), -1, state_rep.size(1))
|
||||
state_rep_flat, vq_code, vq_loss_state = self.vq_layer(state_rep_flat)
|
||||
state_vq = state_rep_flat.view(*state_rep_shape, -1)
|
||||
vq_code = vq_code.view(*state_rep_shape, -1)
|
||||
vq_loss_state = torch.sum(vq_loss_state)
|
||||
return state_vq, vq_code
|
||||
|
||||
def vqvae_forward(self, state):
|
||||
# This function passes the given data through Residual VQ with Encoder and Decoder. Please refer to section 3.2 in the paper https://arxiv.org/pdf/2403.03181).
|
||||
state = einops.rearrange(state, "N T A -> N (T A)")
|
||||
# We start with passing action (or action chunk) at:t+n through the encoder ϕ.
|
||||
state_rep = self.encoder(state)
|
||||
state_rep_shape = state_rep.shape[:-1]
|
||||
state_rep_flat = state_rep.view(state_rep.size(0), -1, state_rep.size(1))
|
||||
# The resulting latent embedding vector x = ϕ(at:t+n) is then mapped to an embedding vector in the codebook of the RVQ layers by the nearest neighbor look-up.
|
||||
state_rep_flat, vq_code, vq_loss_state = self.vq_layer(state_rep_flat)
|
||||
state_vq = state_rep_flat.view(*state_rep_shape, -1)
|
||||
vq_code = vq_code.view(*state_rep_shape, -1)
|
||||
# since the RVQ has multiple layers, it adds the vectors in the axis of layers to provide a vector for that code combination.
|
||||
vq_loss_state = torch.sum(vq_loss_state)
|
||||
# Then, the discretized vector zq(x) is reconstructed as ψ(zq(x)) by passing through the decoder ψ.
|
||||
dec_out = self.decoder(state_vq)
|
||||
# Calculate L1 reconstruction loss
|
||||
encoder_loss = (state - dec_out).abs().mean()
|
||||
# add encoder reconstruction loss and commitment loss
|
||||
rep_loss = encoder_loss + vq_loss_state * 5
|
||||
|
||||
metric = (
|
||||
encoder_loss.clone().detach(),
|
||||
vq_loss_state.clone().detach(),
|
||||
vq_code,
|
||||
rep_loss.item(),
|
||||
)
|
||||
return rep_loss, metric
|
||||
|
||||
|
||||
class FocalLoss(nn.Module):
|
||||
"""
|
||||
From https://github.com/notmahi/miniBET/blob/main/behavior_transformer/bet.py
|
||||
"""
|
||||
|
||||
def __init__(self, gamma: float = 0, size_average: bool = True):
|
||||
super().__init__()
|
||||
self.gamma = gamma
|
||||
self.size_average = size_average
|
||||
|
||||
def forward(self, input, target):
|
||||
if len(input.shape) == 3:
|
||||
N, T, _ = input.shape
|
||||
logpt = F.log_softmax(input, dim=-1)
|
||||
logpt = logpt.gather(-1, target.view(N, T, 1)).view(N, T)
|
||||
elif len(input.shape) == 2:
|
||||
logpt = F.log_softmax(input, dim=-1)
|
||||
logpt = logpt.gather(-1, target.view(-1, 1)).view(-1)
|
||||
pt = logpt.exp()
|
||||
|
||||
loss = -1 * (1 - pt) ** self.gamma * logpt
|
||||
if self.size_average:
|
||||
return loss.mean()
|
||||
else:
|
||||
return loss.sum()
|
||||
|
||||
|
||||
class MLP(torch.nn.Sequential):
|
||||
def __init__(
|
||||
self,
|
||||
in_channels: int,
|
||||
hidden_channels: List[int],
|
||||
):
|
||||
layers = []
|
||||
in_dim = in_channels
|
||||
for hidden_dim in hidden_channels[:-1]:
|
||||
layers.append(torch.nn.Linear(in_dim, hidden_dim))
|
||||
layers.append(torch.nn.ReLU())
|
||||
in_dim = hidden_dim
|
||||
|
||||
layers.append(torch.nn.Linear(in_dim, hidden_channels[-1]))
|
||||
|
||||
super().__init__(*layers)
|
||||
1462
lerobot/common/policies/vqbet/vqbet_utils.py
Normal file
1462
lerobot/common/policies/vqbet/vqbet_utils.py
Normal file
File diff suppressed because it is too large
Load Diff
92
lerobot/common/utils/benchmark.py
Normal file
92
lerobot/common/utils/benchmark.py
Normal file
@@ -0,0 +1,92 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
import threading
|
||||
import time
|
||||
from contextlib import ContextDecorator
|
||||
|
||||
|
||||
class TimeBenchmark(ContextDecorator):
|
||||
"""
|
||||
Measures execution time using a context manager or decorator.
|
||||
|
||||
This class supports both context manager and decorator usage, and is thread-safe for multithreaded
|
||||
environments.
|
||||
|
||||
Args:
|
||||
print: If True, prints the elapsed time upon exiting the context or completing the function. Defaults
|
||||
to False.
|
||||
|
||||
Examples:
|
||||
|
||||
Using as a context manager:
|
||||
|
||||
>>> benchmark = TimeBenchmark()
|
||||
>>> with benchmark:
|
||||
... time.sleep(1)
|
||||
>>> print(f"Block took {benchmark.result:.4f} seconds")
|
||||
Block took approximately 1.0000 seconds
|
||||
|
||||
Using with multithreading:
|
||||
|
||||
```python
|
||||
import threading
|
||||
|
||||
benchmark = TimeBenchmark()
|
||||
|
||||
def context_manager_example():
|
||||
with benchmark:
|
||||
time.sleep(0.01)
|
||||
print(f"Block took {benchmark.result_ms:.2f} milliseconds")
|
||||
|
||||
threads = []
|
||||
for _ in range(3):
|
||||
t1 = threading.Thread(target=context_manager_example)
|
||||
threads.append(t1)
|
||||
|
||||
for t in threads:
|
||||
t.start()
|
||||
|
||||
for t in threads:
|
||||
t.join()
|
||||
```
|
||||
Expected output:
|
||||
Block took approximately 10.00 milliseconds
|
||||
Block took approximately 10.00 milliseconds
|
||||
Block took approximately 10.00 milliseconds
|
||||
"""
|
||||
|
||||
def __init__(self, print=False):
|
||||
self.local = threading.local()
|
||||
self.print_time = print
|
||||
|
||||
def __enter__(self):
|
||||
self.local.start_time = time.perf_counter()
|
||||
return self
|
||||
|
||||
def __exit__(self, *exc):
|
||||
self.local.end_time = time.perf_counter()
|
||||
self.local.elapsed_time = self.local.end_time - self.local.start_time
|
||||
if self.print_time:
|
||||
print(f"Elapsed time: {self.local.elapsed_time:.4f} seconds")
|
||||
return False
|
||||
|
||||
@property
|
||||
def result(self):
|
||||
return getattr(self.local, "elapsed_time", None)
|
||||
|
||||
@property
|
||||
def result_ms(self):
|
||||
return self.result * 1e3
|
||||
@@ -19,7 +19,7 @@ import random
|
||||
from contextlib import contextmanager
|
||||
from datetime import datetime
|
||||
from pathlib import Path
|
||||
from typing import Generator
|
||||
from typing import Any, Generator
|
||||
|
||||
import hydra
|
||||
import numpy as np
|
||||
@@ -48,12 +48,38 @@ def get_safe_torch_device(cfg_device: str, log: bool = False) -> torch.device:
|
||||
return device
|
||||
|
||||
|
||||
def get_global_random_state() -> dict[str, Any]:
|
||||
"""Get the random state for `random`, `numpy`, and `torch`."""
|
||||
random_state_dict = {
|
||||
"random_state": random.getstate(),
|
||||
"numpy_random_state": np.random.get_state(),
|
||||
"torch_random_state": torch.random.get_rng_state(),
|
||||
}
|
||||
if torch.cuda.is_available():
|
||||
random_state_dict["torch_cuda_random_state"] = torch.cuda.random.get_rng_state()
|
||||
return random_state_dict
|
||||
|
||||
|
||||
def set_global_random_state(random_state_dict: dict[str, Any]):
|
||||
"""Set the random state for `random`, `numpy`, and `torch`.
|
||||
|
||||
Args:
|
||||
random_state_dict: A dictionary of the form returned by `get_global_random_state`.
|
||||
"""
|
||||
random.setstate(random_state_dict["random_state"])
|
||||
np.random.set_state(random_state_dict["numpy_random_state"])
|
||||
torch.random.set_rng_state(random_state_dict["torch_random_state"])
|
||||
if torch.cuda.is_available():
|
||||
torch.cuda.random.set_rng_state(random_state_dict["torch_cuda_random_state"])
|
||||
|
||||
|
||||
def set_global_seed(seed):
|
||||
"""Set seed for reproducibility."""
|
||||
random.seed(seed)
|
||||
np.random.seed(seed)
|
||||
torch.manual_seed(seed)
|
||||
torch.cuda.manual_seed_all(seed)
|
||||
if torch.cuda.is_available():
|
||||
torch.cuda.manual_seed_all(seed)
|
||||
|
||||
|
||||
@contextmanager
|
||||
@@ -69,16 +95,10 @@ def seeded_context(seed: int) -> Generator[None, None, None]:
|
||||
c = random.random() # produces yet another random number, but the same it would have if we never made `b`
|
||||
```
|
||||
"""
|
||||
random_state = random.getstate()
|
||||
np_random_state = np.random.get_state()
|
||||
torch_random_state = torch.random.get_rng_state()
|
||||
torch_cuda_random_state = torch.cuda.random.get_rng_state()
|
||||
random_state_dict = get_global_random_state()
|
||||
set_global_seed(seed)
|
||||
yield None
|
||||
random.setstate(random_state)
|
||||
np.random.set_state(np_random_state)
|
||||
torch.random.set_rng_state(torch_random_state)
|
||||
torch.cuda.random.set_rng_state(torch_cuda_random_state)
|
||||
set_global_random_state(random_state_dict)
|
||||
|
||||
|
||||
def init_logging():
|
||||
@@ -100,13 +120,13 @@ def init_logging():
|
||||
logging.getLogger().addHandler(console_handler)
|
||||
|
||||
|
||||
def format_big_number(num):
|
||||
def format_big_number(num, precision=0):
|
||||
suffixes = ["", "K", "M", "B", "T", "Q"]
|
||||
divisor = 1000.0
|
||||
|
||||
for suffix in suffixes:
|
||||
if abs(num) < divisor:
|
||||
return f"{num:.0f}{suffix}"
|
||||
return f"{num:.{precision}f}{suffix}"
|
||||
num /= divisor
|
||||
|
||||
return num
|
||||
|
||||
@@ -5,10 +5,17 @@ defaults:
|
||||
|
||||
hydra:
|
||||
run:
|
||||
# Set `dir` to where you would like to save all of the run outputs. If you run another training session
|
||||
# with the same value for `dir` its contents will be overwritten unless you set `resume` to true.
|
||||
dir: outputs/train/${now:%Y-%m-%d}/${now:%H-%M-%S}_${env.name}_${policy.name}_${hydra.job.name}
|
||||
job:
|
||||
name: default
|
||||
|
||||
# Set `resume` to true to resume a previous run. In order for this to work, you will need to make sure
|
||||
# `hydra.run.dir` is the directory of an existing run with at least one checkpoint in it.
|
||||
# Note that when resuming a run, the default behavior is to use the configuration from the checkpoint,
|
||||
# regardless of what's provided with the training command at the time of resumption.
|
||||
resume: false
|
||||
device: cuda # cpu
|
||||
# `use_amp` determines whether to use Automatic Mixed Precision (AMP) for training and evaluation. With AMP,
|
||||
# automatic gradient scaling is used.
|
||||
@@ -16,7 +23,12 @@ use_amp: false
|
||||
# `seed` is used for training (eg: model initialization, dataset shuffling)
|
||||
# AND for the evaluation environments.
|
||||
seed: ???
|
||||
# You may provide a list of datasets here. `train.py` creates them all and concatenates them. Note: only data
|
||||
# keys common between the datasets are kept. Each dataset gets and additional transform that inserts the
|
||||
# "dataset_index" into the returned item. The index mapping is made according to the order in which the
|
||||
# datsets are provided.
|
||||
dataset_repo_id: lerobot/pusht
|
||||
video_backend: pyav
|
||||
|
||||
training:
|
||||
offline_steps: ???
|
||||
@@ -27,9 +39,46 @@ training:
|
||||
# `online_env_seed` is used for environments for online training data rollouts.
|
||||
online_env_seed: ???
|
||||
eval_freq: ???
|
||||
log_freq: 200
|
||||
save_checkpoint: true
|
||||
# Checkpoint is saved every `save_freq` training iterations and after the last training step.
|
||||
save_freq: ???
|
||||
log_freq: 250
|
||||
save_model: true
|
||||
num_workers: 4
|
||||
batch_size: ???
|
||||
image_transforms:
|
||||
# These transforms are all using standard torchvision.transforms.v2
|
||||
# You can find out how these transformations affect images here:
|
||||
# https://pytorch.org/vision/0.18/auto_examples/transforms/plot_transforms_illustrations.html
|
||||
# We use a custom RandomSubsetApply container to sample them.
|
||||
# For each transform, the following parameters are available:
|
||||
# weight: This represents the multinomial probability (with no replacement)
|
||||
# used for sampling the transform. If the sum of the weights is not 1,
|
||||
# they will be normalized.
|
||||
# min_max: Lower & upper bound respectively used for sampling the transform's parameter
|
||||
# (following uniform distribution) when it's applied.
|
||||
# Set this flag to `true` to enable transforms during training
|
||||
enable: false
|
||||
# This is the maximum number of transforms (sampled from these below) that will be applied to each frame.
|
||||
# It's an integer in the interval [1, number of available transforms].
|
||||
max_num_transforms: 3
|
||||
# By default, transforms are applied in Torchvision's suggested order (shown below).
|
||||
# Set this to True to apply them in a random order.
|
||||
random_order: false
|
||||
brightness:
|
||||
weight: 1
|
||||
min_max: [0.8, 1.2]
|
||||
contrast:
|
||||
weight: 1
|
||||
min_max: [0.8, 1.2]
|
||||
saturation:
|
||||
weight: 1
|
||||
min_max: [0.5, 1.5]
|
||||
hue:
|
||||
weight: 1
|
||||
min_max: [-0.05, 0.05]
|
||||
sharpness:
|
||||
weight: 1
|
||||
min_max: [0.8, 1.2]
|
||||
|
||||
eval:
|
||||
n_episodes: 1
|
||||
@@ -40,7 +89,7 @@ eval:
|
||||
|
||||
wandb:
|
||||
enable: false
|
||||
# Set to true to disable saving an artifact despite save_model == True
|
||||
# Set to true to disable saving an artifact despite save_checkpoint == True
|
||||
disable_artifact: false
|
||||
project: lerobot
|
||||
notes: ""
|
||||
|
||||
10
lerobot/configs/env/aloha.yaml
vendored
10
lerobot/configs/env/aloha.yaml
vendored
@@ -5,10 +5,10 @@ fps: 50
|
||||
env:
|
||||
name: aloha
|
||||
task: AlohaInsertion-v0
|
||||
from_pixels: True
|
||||
pixels_only: False
|
||||
image_size: [3, 480, 640]
|
||||
episode_length: 400
|
||||
fps: ${fps}
|
||||
state_dim: 14
|
||||
action_dim: 14
|
||||
fps: ${fps}
|
||||
episode_length: 400
|
||||
gym:
|
||||
obs_type: pixels_agent_pos
|
||||
render_mode: rgb_array
|
||||
|
||||
14
lerobot/configs/env/aloha_thom.yaml
vendored
14
lerobot/configs/env/aloha_thom.yaml
vendored
@@ -1,14 +0,0 @@
|
||||
# @package _global_
|
||||
|
||||
fps: 50
|
||||
|
||||
env:
|
||||
name: aloha
|
||||
task: AlohaInsertion-v0
|
||||
from_pixels: True
|
||||
pixels_only: False
|
||||
image_size: [3, 480, 640]
|
||||
episode_length: 500
|
||||
fps: ${fps}
|
||||
state_dim: 6
|
||||
action_dim: 6
|
||||
13
lerobot/configs/env/dora_aloha_real.yaml
vendored
Normal file
13
lerobot/configs/env/dora_aloha_real.yaml
vendored
Normal file
@@ -0,0 +1,13 @@
|
||||
# @package _global_
|
||||
|
||||
fps: 30
|
||||
|
||||
env:
|
||||
name: dora
|
||||
task: DoraAloha-v0
|
||||
state_dim: 14
|
||||
action_dim: 14
|
||||
fps: ${fps}
|
||||
episode_length: 400
|
||||
gym:
|
||||
fps: ${fps}
|
||||
11
lerobot/configs/env/pusht.yaml
vendored
11
lerobot/configs/env/pusht.yaml
vendored
@@ -5,10 +5,13 @@ fps: 10
|
||||
env:
|
||||
name: pusht
|
||||
task: PushT-v0
|
||||
from_pixels: True
|
||||
pixels_only: False
|
||||
image_size: 96
|
||||
episode_length: 300
|
||||
fps: ${fps}
|
||||
state_dim: 2
|
||||
action_dim: 2
|
||||
fps: ${fps}
|
||||
episode_length: 300
|
||||
gym:
|
||||
obs_type: pixels_agent_pos
|
||||
render_mode: rgb_array
|
||||
visualization_width: 384
|
||||
visualization_height: 384
|
||||
|
||||
11
lerobot/configs/env/xarm.yaml
vendored
11
lerobot/configs/env/xarm.yaml
vendored
@@ -5,10 +5,13 @@ fps: 15
|
||||
env:
|
||||
name: xarm
|
||||
task: XarmLift-v0
|
||||
from_pixels: True
|
||||
pixels_only: False
|
||||
image_size: 84
|
||||
episode_length: 25
|
||||
fps: ${fps}
|
||||
state_dim: 4
|
||||
action_dim: 4
|
||||
fps: ${fps}
|
||||
episode_length: 25
|
||||
gym:
|
||||
obs_type: pixels_agent_pos
|
||||
render_mode: rgb_array
|
||||
visualization_width: 384
|
||||
visualization_height: 384
|
||||
|
||||
@@ -10,12 +10,11 @@ override_dataset_stats:
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
|
||||
training:
|
||||
offline_steps: 80000
|
||||
offline_steps: 100000
|
||||
online_steps: 0
|
||||
eval_freq: 10000
|
||||
save_freq: 100000
|
||||
log_freq: 250
|
||||
save_model: true
|
||||
eval_freq: 20000
|
||||
save_freq: 20000
|
||||
save_checkpoint: true
|
||||
|
||||
batch_size: 8
|
||||
lr: 1e-5
|
||||
|
||||
114
lerobot/configs/policy/act_real.yaml
Normal file
114
lerobot/configs/policy/act_real.yaml
Normal file
@@ -0,0 +1,114 @@
|
||||
# @package _global_
|
||||
|
||||
# Use `act_real.yaml` to train on real-world Aloha/Aloha2 datasets.
|
||||
# Compared to `act.yaml`, it contains 4 cameras (i.e. cam_right_wrist, cam_left_wrist, images,
|
||||
# cam_low) instead of 1 camera (i.e. top). Also, `training.eval_freq` is set to -1. This config is used
|
||||
# to evaluate checkpoints at a certain frequency of training steps. When it is set to -1, it deactivates evaluation.
|
||||
# This is because real-world evaluation is done through [dora-lerobot](https://github.com/dora-rs/dora-lerobot).
|
||||
# Look at its README for more information on how to evaluate a checkpoint in the real-world.
|
||||
#
|
||||
# Example of usage for training:
|
||||
# ```bash
|
||||
# python lerobot/scripts/train.py \
|
||||
# policy=act_real \
|
||||
# env=dora_aloha_real
|
||||
# ```
|
||||
|
||||
seed: 1000
|
||||
dataset_repo_id: lerobot/aloha_static_vinh_cup
|
||||
|
||||
override_dataset_stats:
|
||||
observation.images.cam_right_wrist:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
observation.images.cam_left_wrist:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
observation.images.cam_high:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
observation.images.cam_low:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
|
||||
training:
|
||||
offline_steps: 100000
|
||||
online_steps: 0
|
||||
eval_freq: -1
|
||||
save_freq: 20000
|
||||
save_checkpoint: true
|
||||
|
||||
batch_size: 8
|
||||
lr: 1e-5
|
||||
lr_backbone: 1e-5
|
||||
weight_decay: 1e-4
|
||||
grad_clip_norm: 10
|
||||
online_steps_between_rollouts: 1
|
||||
|
||||
delta_timestamps:
|
||||
action: "[i / ${fps} for i in range(${policy.chunk_size})]"
|
||||
|
||||
eval:
|
||||
n_episodes: 50
|
||||
batch_size: 50
|
||||
|
||||
# See `configuration_act.py` for more details.
|
||||
policy:
|
||||
name: act
|
||||
|
||||
# Input / output structure.
|
||||
n_obs_steps: 1
|
||||
chunk_size: 100 # chunk_size
|
||||
n_action_steps: 100
|
||||
|
||||
input_shapes:
|
||||
# TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
|
||||
observation.images.cam_right_wrist: [3, 480, 640]
|
||||
observation.images.cam_left_wrist: [3, 480, 640]
|
||||
observation.images.cam_high: [3, 480, 640]
|
||||
observation.images.cam_low: [3, 480, 640]
|
||||
observation.state: ["${env.state_dim}"]
|
||||
output_shapes:
|
||||
action: ["${env.action_dim}"]
|
||||
|
||||
# Normalization / Unnormalization
|
||||
input_normalization_modes:
|
||||
observation.images.cam_right_wrist: mean_std
|
||||
observation.images.cam_left_wrist: mean_std
|
||||
observation.images.cam_high: mean_std
|
||||
observation.images.cam_low: mean_std
|
||||
observation.state: mean_std
|
||||
output_normalization_modes:
|
||||
action: mean_std
|
||||
|
||||
# Architecture.
|
||||
# Vision backbone.
|
||||
vision_backbone: resnet18
|
||||
pretrained_backbone_weights: ResNet18_Weights.IMAGENET1K_V1
|
||||
replace_final_stride_with_dilation: false
|
||||
# Transformer layers.
|
||||
pre_norm: false
|
||||
dim_model: 512
|
||||
n_heads: 8
|
||||
dim_feedforward: 3200
|
||||
feedforward_activation: relu
|
||||
n_encoder_layers: 4
|
||||
# Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
|
||||
# that means only the first layer is used. Here we match the original implementation by setting this to 1.
|
||||
# See this issue https://github.com/tonyzhaozh/act/issues/25#issue-2258740521.
|
||||
n_decoder_layers: 1
|
||||
# VAE.
|
||||
use_vae: true
|
||||
latent_dim: 32
|
||||
n_vae_encoder_layers: 4
|
||||
|
||||
# Inference.
|
||||
temporal_ensemble_momentum: null
|
||||
|
||||
# Training and loss computation.
|
||||
dropout: 0.1
|
||||
kl_weight: 10.0
|
||||
110
lerobot/configs/policy/act_real_no_state.yaml
Normal file
110
lerobot/configs/policy/act_real_no_state.yaml
Normal file
@@ -0,0 +1,110 @@
|
||||
# @package _global_
|
||||
|
||||
# Use `act_real_no_state.yaml` to train on real-world Aloha/Aloha2 datasets when cameras are moving (e.g. wrist cameras)
|
||||
# Compared to `act_real.yaml`, it is camera only and does not use the state as input which is vector of robot joint positions.
|
||||
# We validated experimentaly that not using state reaches better success rate. Our hypothesis is that `act_real.yaml` might
|
||||
# overfits to the state, because the images are more complex to learn from since they are moving.
|
||||
#
|
||||
# Example of usage for training:
|
||||
# ```bash
|
||||
# python lerobot/scripts/train.py \
|
||||
# policy=act_real_no_state \
|
||||
# env=dora_aloha_real
|
||||
# ```
|
||||
|
||||
seed: 1000
|
||||
dataset_repo_id: lerobot/aloha_static_vinh_cup
|
||||
|
||||
override_dataset_stats:
|
||||
observation.images.cam_right_wrist:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
observation.images.cam_left_wrist:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
observation.images.cam_high:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
observation.images.cam_low:
|
||||
# stats from imagenet, since we use a pretrained vision model
|
||||
mean: [[[0.485]], [[0.456]], [[0.406]]] # (c,1,1)
|
||||
std: [[[0.229]], [[0.224]], [[0.225]]] # (c,1,1)
|
||||
|
||||
training:
|
||||
offline_steps: 100000
|
||||
online_steps: 0
|
||||
eval_freq: -1
|
||||
save_freq: 20000
|
||||
save_checkpoint: true
|
||||
|
||||
batch_size: 8
|
||||
lr: 1e-5
|
||||
lr_backbone: 1e-5
|
||||
weight_decay: 1e-4
|
||||
grad_clip_norm: 10
|
||||
online_steps_between_rollouts: 1
|
||||
|
||||
delta_timestamps:
|
||||
action: "[i / ${fps} for i in range(${policy.chunk_size})]"
|
||||
|
||||
eval:
|
||||
n_episodes: 50
|
||||
batch_size: 50
|
||||
|
||||
# See `configuration_act.py` for more details.
|
||||
policy:
|
||||
name: act
|
||||
|
||||
# Input / output structure.
|
||||
n_obs_steps: 1
|
||||
chunk_size: 100 # chunk_size
|
||||
n_action_steps: 100
|
||||
|
||||
input_shapes:
|
||||
# TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
|
||||
observation.images.cam_right_wrist: [3, 480, 640]
|
||||
observation.images.cam_left_wrist: [3, 480, 640]
|
||||
observation.images.cam_high: [3, 480, 640]
|
||||
observation.images.cam_low: [3, 480, 640]
|
||||
output_shapes:
|
||||
action: ["${env.action_dim}"]
|
||||
|
||||
# Normalization / Unnormalization
|
||||
input_normalization_modes:
|
||||
observation.images.cam_right_wrist: mean_std
|
||||
observation.images.cam_left_wrist: mean_std
|
||||
observation.images.cam_high: mean_std
|
||||
observation.images.cam_low: mean_std
|
||||
output_normalization_modes:
|
||||
action: mean_std
|
||||
|
||||
# Architecture.
|
||||
# Vision backbone.
|
||||
vision_backbone: resnet18
|
||||
pretrained_backbone_weights: ResNet18_Weights.IMAGENET1K_V1
|
||||
replace_final_stride_with_dilation: false
|
||||
# Transformer layers.
|
||||
pre_norm: false
|
||||
dim_model: 512
|
||||
n_heads: 8
|
||||
dim_feedforward: 3200
|
||||
feedforward_activation: relu
|
||||
n_encoder_layers: 4
|
||||
# Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
|
||||
# that means only the first layer is used. Here we match the original implementation by setting this to 1.
|
||||
# See this issue https://github.com/tonyzhaozh/act/issues/25#issue-2258740521.
|
||||
n_decoder_layers: 1
|
||||
# VAE.
|
||||
use_vae: true
|
||||
latent_dim: 32
|
||||
n_vae_encoder_layers: 4
|
||||
|
||||
# Inference.
|
||||
temporal_ensemble_momentum: null
|
||||
|
||||
# Training and loss computation.
|
||||
dropout: 0.1
|
||||
kl_weight: 10.0
|
||||
@@ -24,10 +24,9 @@ override_dataset_stats:
|
||||
training:
|
||||
offline_steps: 200000
|
||||
online_steps: 0
|
||||
eval_freq: 5000
|
||||
save_freq: 5000
|
||||
log_freq: 250
|
||||
save_model: true
|
||||
eval_freq: 25000
|
||||
save_freq: 25000
|
||||
save_checkpoint: true
|
||||
|
||||
batch_size: 64
|
||||
grad_clip_norm: 10
|
||||
@@ -44,6 +43,10 @@ training:
|
||||
observation.state: "[i / ${fps} for i in range(1 - ${policy.n_obs_steps}, 1)]"
|
||||
action: "[i / ${fps} for i in range(1 - ${policy.n_obs_steps}, 1 - ${policy.n_obs_steps} + ${policy.horizon})]"
|
||||
|
||||
# The original implementation doesn't sample frames for the last 7 steps,
|
||||
# which avoids excessive padding and leads to improved training results.
|
||||
drop_n_last_frames: 7 # ${policy.horizon} - ${policy.n_action_steps} - ${policy.n_obs_steps} + 1
|
||||
|
||||
eval:
|
||||
n_episodes: 50
|
||||
batch_size: 50
|
||||
@@ -95,7 +98,7 @@ policy:
|
||||
clip_sample_range: 1.0
|
||||
|
||||
# Inference
|
||||
num_inference_steps: 100
|
||||
num_inference_steps: null # if not provided, defaults to `num_train_timesteps`
|
||||
|
||||
# Loss computation
|
||||
do_mask_loss_for_padding: false
|
||||
|
||||
110
lerobot/configs/policy/diffusion_pusht_keypoints.yaml
Normal file
110
lerobot/configs/policy/diffusion_pusht_keypoints.yaml
Normal file
@@ -0,0 +1,110 @@
|
||||
# @package _global_
|
||||
|
||||
# Defaults for training for the pusht_keypoints dataset.
|
||||
|
||||
# They keypoints are on the vertices of the rectangles that make up the PushT as documented in the PushT
|
||||
# environment:
|
||||
# https://github.com/huggingface/gym-pusht/blob/5e2489be9ff99ed9cd47b6c653dda3b7aa844d24/gym_pusht/envs/pusht.py#L522-L534
|
||||
# For completeness, the diagram is copied here:
|
||||
# 0───────────1
|
||||
# │ │
|
||||
# 3───4───5───2
|
||||
# │ │
|
||||
# │ │
|
||||
# │ │
|
||||
# │ │
|
||||
# 7───6
|
||||
|
||||
|
||||
# Note: The original work trains keypoints-only with conditioning via inpainting. Here, we encode the
|
||||
# observation along with the agent position and use the encoding as global conditioning for the denoising
|
||||
# U-Net.
|
||||
|
||||
# Note: We do not track EMA model weights as we discovered it does not improve the results. See
|
||||
# https://github.com/huggingface/lerobot/pull/134 for more details.
|
||||
|
||||
seed: 100000
|
||||
dataset_repo_id: lerobot/pusht_keypoints
|
||||
|
||||
training:
|
||||
offline_steps: 200000
|
||||
online_steps: 0
|
||||
eval_freq: 5000
|
||||
save_freq: 5000
|
||||
log_freq: 250
|
||||
save_checkpoint: true
|
||||
|
||||
batch_size: 64
|
||||
grad_clip_norm: 10
|
||||
lr: 1.0e-4
|
||||
lr_scheduler: cosine
|
||||
lr_warmup_steps: 500
|
||||
adam_betas: [0.95, 0.999]
|
||||
adam_eps: 1.0e-8
|
||||
adam_weight_decay: 1.0e-6
|
||||
online_steps_between_rollouts: 1
|
||||
|
||||
delta_timestamps:
|
||||
observation.environment_state: "[i / ${fps} for i in range(1 - ${policy.n_obs_steps}, 1)]"
|
||||
observation.state: "[i / ${fps} for i in range(1 - ${policy.n_obs_steps}, 1)]"
|
||||
action: "[i / ${fps} for i in range(1 - ${policy.n_obs_steps}, 1 - ${policy.n_obs_steps} + ${policy.horizon})]"
|
||||
|
||||
# The original implementation doesn't sample frames for the last 7 steps,
|
||||
# which avoids excessive padding and leads to improved training results.
|
||||
drop_n_last_frames: 7 # ${policy.horizon} - ${policy.n_action_steps} - ${policy.n_obs_steps} + 1
|
||||
|
||||
eval:
|
||||
n_episodes: 50
|
||||
batch_size: 50
|
||||
|
||||
policy:
|
||||
name: diffusion
|
||||
|
||||
# Input / output structure.
|
||||
n_obs_steps: 2
|
||||
horizon: 16
|
||||
n_action_steps: 8
|
||||
|
||||
input_shapes:
|
||||
# TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
|
||||
observation.environment_state: [16]
|
||||
observation.state: ["${env.state_dim}"]
|
||||
output_shapes:
|
||||
action: ["${env.action_dim}"]
|
||||
|
||||
# Normalization / Unnormalization
|
||||
input_normalization_modes:
|
||||
observation.environment_state: min_max
|
||||
observation.state: min_max
|
||||
output_normalization_modes:
|
||||
action: min_max
|
||||
|
||||
# Architecture / modeling.
|
||||
# Vision backbone.
|
||||
vision_backbone: resnet18
|
||||
crop_shape: [84, 84]
|
||||
crop_is_random: True
|
||||
pretrained_backbone_weights: null
|
||||
use_group_norm: True
|
||||
spatial_softmax_num_keypoints: 32
|
||||
# Unet.
|
||||
down_dims: [256, 512, 1024]
|
||||
kernel_size: 5
|
||||
n_groups: 8
|
||||
diffusion_step_embed_dim: 128
|
||||
use_film_scale_modulation: True
|
||||
# Noise scheduler.
|
||||
noise_scheduler_type: DDIM
|
||||
num_train_timesteps: 100
|
||||
beta_schedule: squaredcos_cap_v2
|
||||
beta_start: 0.0001
|
||||
beta_end: 0.02
|
||||
prediction_type: epsilon # epsilon / sample
|
||||
clip_sample: True
|
||||
clip_sample_range: 1.0
|
||||
|
||||
# Inference
|
||||
num_inference_steps: 10 # if not provided, defaults to `num_train_timesteps`
|
||||
|
||||
# Loss computation
|
||||
do_mask_loss_for_padding: false
|
||||
@@ -11,6 +11,7 @@ training:
|
||||
online_steps_between_rollouts: 1
|
||||
online_sampling_ratio: 0.5
|
||||
online_env_seed: 10000
|
||||
log_freq: 100
|
||||
|
||||
batch_size: 256
|
||||
grad_clip_norm: 10.0
|
||||
@@ -54,7 +55,7 @@ policy:
|
||||
discount: 0.9
|
||||
|
||||
# Inference.
|
||||
use_mpc: false
|
||||
use_mpc: true
|
||||
cem_iterations: 6
|
||||
max_std: 2.0
|
||||
min_std: 0.05
|
||||
|
||||
103
lerobot/configs/policy/vqbet.yaml
Normal file
103
lerobot/configs/policy/vqbet.yaml
Normal file
@@ -0,0 +1,103 @@
|
||||
# @package _global_
|
||||
|
||||
# Defaults for training for the PushT dataset.
|
||||
|
||||
seed: 100000
|
||||
dataset_repo_id: lerobot/pusht
|
||||
|
||||
override_dataset_stats:
|
||||
# TODO(rcadene, alexander-soare): should we remove image stats as well? do we use a pretrained vision model?
|
||||
observation.image:
|
||||
mean: [[[0.5]], [[0.5]], [[0.5]]] # (c,1,1)
|
||||
std: [[[0.5]], [[0.5]], [[0.5]]] # (c,1,1)
|
||||
# TODO(rcadene, alexander-soare): we override state and action stats to use the same as the pretrained model
|
||||
# from the original codebase, but we should remove these and train our own pretrained model
|
||||
observation.state:
|
||||
min: [13.456424, 32.938293]
|
||||
max: [496.14618, 510.9579]
|
||||
action:
|
||||
min: [12.0, 25.0]
|
||||
max: [511.0, 511.0]
|
||||
|
||||
training:
|
||||
offline_steps: 250000
|
||||
online_steps: 0
|
||||
eval_freq: 25000
|
||||
save_freq: 25000
|
||||
save_checkpoint: true
|
||||
|
||||
batch_size: 64
|
||||
grad_clip_norm: 10
|
||||
lr: 1.0e-4
|
||||
lr_scheduler: cosine
|
||||
lr_warmup_steps: 500
|
||||
adam_betas: [0.95, 0.999]
|
||||
adam_eps: 1.0e-8
|
||||
adam_weight_decay: 1.0e-6
|
||||
online_steps_between_rollouts: 1
|
||||
|
||||
# VQ-BeT specific
|
||||
vqvae_lr: 1.0e-3
|
||||
n_vqvae_training_steps: 20000
|
||||
bet_weight_decay: 2e-4
|
||||
bet_learning_rate: 5.5e-5
|
||||
bet_betas: [0.9, 0.999]
|
||||
|
||||
delta_timestamps:
|
||||
observation.image: "[i / ${fps} for i in range(1 - ${policy.n_obs_steps}, 1)]"
|
||||
observation.state: "[i / ${fps} for i in range(1 - ${policy.n_obs_steps}, 1)]"
|
||||
action: "[i / ${fps} for i in range(1 - ${policy.n_obs_steps}, ${policy.n_action_pred_token} + ${policy.action_chunk_size} - 1)]"
|
||||
|
||||
eval:
|
||||
n_episodes: 50
|
||||
batch_size: 50
|
||||
|
||||
policy:
|
||||
name: vqbet
|
||||
|
||||
# Input / output structure.
|
||||
n_obs_steps: 5
|
||||
n_action_pred_token: 7
|
||||
action_chunk_size: 5
|
||||
|
||||
input_shapes:
|
||||
# TODO(rcadene, alexander-soare): add variables for height and width from the dataset/env?
|
||||
observation.image: [3, 96, 96]
|
||||
observation.state: ["${env.state_dim}"]
|
||||
output_shapes:
|
||||
action: ["${env.action_dim}"]
|
||||
|
||||
# Normalization / Unnormalization
|
||||
input_normalization_modes:
|
||||
observation.image: mean_std
|
||||
observation.state: min_max
|
||||
output_normalization_modes:
|
||||
action: min_max
|
||||
|
||||
# Architecture / modeling.
|
||||
# Vision backbone.
|
||||
vision_backbone: resnet18
|
||||
crop_shape: [84, 84]
|
||||
crop_is_random: True
|
||||
pretrained_backbone_weights: null
|
||||
use_group_norm: True
|
||||
spatial_softmax_num_keypoints: 32
|
||||
# VQ-VAE
|
||||
n_vqvae_training_steps: ${training.n_vqvae_training_steps}
|
||||
vqvae_n_embed: 16
|
||||
vqvae_embedding_dim: 256
|
||||
vqvae_enc_hidden_dim: 128
|
||||
# VQ-BeT
|
||||
gpt_block_size: 500
|
||||
gpt_input_dim: 512
|
||||
gpt_output_dim: 512
|
||||
gpt_n_layer: 8
|
||||
gpt_n_head: 8
|
||||
gpt_hidden_dim: 512
|
||||
dropout: 0.1
|
||||
mlp_hidden_dim: 1024
|
||||
offset_loss_weight: 10000.
|
||||
primary_code_loss_weight: 5.0
|
||||
secondary_code_loss_weight: 0.5
|
||||
bet_softmax_temperature: 0.1
|
||||
sequentially_select: False
|
||||
@@ -13,39 +13,71 @@
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
"""Use this script to get a quick summary of your system config.
|
||||
It should be able to run without any of LeRobot's dependencies or LeRobot itself installed.
|
||||
"""
|
||||
|
||||
import platform
|
||||
|
||||
import huggingface_hub
|
||||
HAS_HF_HUB = True
|
||||
HAS_HF_DATASETS = True
|
||||
HAS_NP = True
|
||||
HAS_TORCH = True
|
||||
HAS_LEROBOT = True
|
||||
|
||||
# import dataset
|
||||
import numpy as np
|
||||
import torch
|
||||
try:
|
||||
import huggingface_hub
|
||||
except ImportError:
|
||||
HAS_HF_HUB = False
|
||||
|
||||
from lerobot import __version__ as version
|
||||
try:
|
||||
import datasets
|
||||
except ImportError:
|
||||
HAS_HF_DATASETS = False
|
||||
|
||||
pt_version = torch.__version__
|
||||
pt_cuda_available = torch.cuda.is_available()
|
||||
pt_cuda_available = torch.cuda.is_available()
|
||||
cuda_version = torch._C._cuda_getCompiledVersion() if torch.version.cuda is not None else "N/A"
|
||||
try:
|
||||
import numpy as np
|
||||
except ImportError:
|
||||
HAS_NP = False
|
||||
|
||||
try:
|
||||
import torch
|
||||
except ImportError:
|
||||
HAS_TORCH = False
|
||||
|
||||
try:
|
||||
import lerobot
|
||||
except ImportError:
|
||||
HAS_LEROBOT = False
|
||||
|
||||
|
||||
lerobot_version = lerobot.__version__ if HAS_LEROBOT else "N/A"
|
||||
hf_hub_version = huggingface_hub.__version__ if HAS_HF_HUB else "N/A"
|
||||
hf_datasets_version = datasets.__version__ if HAS_HF_DATASETS else "N/A"
|
||||
np_version = np.__version__ if HAS_NP else "N/A"
|
||||
|
||||
torch_version = torch.__version__ if HAS_TORCH else "N/A"
|
||||
torch_cuda_available = torch.cuda.is_available() if HAS_TORCH else "N/A"
|
||||
cuda_version = torch._C._cuda_getCompiledVersion() if HAS_TORCH and torch.version.cuda is not None else "N/A"
|
||||
|
||||
|
||||
# TODO(aliberts): refactor into an actual command `lerobot env`
|
||||
def display_sys_info() -> dict:
|
||||
"""Run this to get basic system info to help for tracking issues & bugs."""
|
||||
info = {
|
||||
"`lerobot` version": version,
|
||||
"`lerobot` version": lerobot_version,
|
||||
"Platform": platform.platform(),
|
||||
"Python version": platform.python_version(),
|
||||
"Huggingface_hub version": huggingface_hub.__version__,
|
||||
# TODO(aliberts): Add dataset when https://github.com/huggingface/lerobot/pull/73 is merged
|
||||
# "Dataset version": dataset.__version__,
|
||||
"Numpy version": np.__version__,
|
||||
"PyTorch version (GPU?)": f"{pt_version} ({pt_cuda_available})",
|
||||
"Huggingface_hub version": hf_hub_version,
|
||||
"Dataset version": hf_datasets_version,
|
||||
"Numpy version": np_version,
|
||||
"PyTorch version (GPU?)": f"{torch_version} ({torch_cuda_available})",
|
||||
"Cuda version": cuda_version,
|
||||
"Using GPU in script?": "<fill in>",
|
||||
"Using distributed or parallel set-up in script?": "<fill in>",
|
||||
# "Using distributed or parallel set-up in script?": "<fill in>",
|
||||
}
|
||||
print("\nCopy-and-paste the text below in your GitHub issue and FILL OUT the two last points.\n")
|
||||
print("\nCopy-and-paste the text below in your GitHub issue and FILL OUT the last point.\n")
|
||||
print(format_dict(info))
|
||||
return info
|
||||
|
||||
|
||||
@@ -28,7 +28,7 @@ OR, you want to evaluate a model checkpoint from the LeRobot training script for
|
||||
|
||||
```
|
||||
python lerobot/scripts/eval.py \
|
||||
-p outputs/train/diffusion_pusht/checkpoints/005000 \
|
||||
-p outputs/train/diffusion_pusht/checkpoints/005000/pretrained_model \
|
||||
eval.n_episodes=10
|
||||
```
|
||||
|
||||
@@ -61,7 +61,7 @@ from huggingface_hub import snapshot_download
|
||||
from huggingface_hub.utils._errors import RepositoryNotFoundError
|
||||
from huggingface_hub.utils._validators import HFValidationError
|
||||
from PIL import Image as PILImage
|
||||
from torch import Tensor
|
||||
from torch import Tensor, nn
|
||||
from tqdm import trange
|
||||
|
||||
from lerobot.common.datasets.factory import make_dataset
|
||||
@@ -99,13 +99,13 @@ def rollout(
|
||||
"reward": A (batch, sequence) tensor of rewards received for applying the actions.
|
||||
"success": A (batch, sequence) tensor of success conditions (the only time this can be True is upon
|
||||
environment termination/truncation).
|
||||
"don": A (batch, sequence) tensor of **cumulative** done conditions. For any given batch element,
|
||||
"done": A (batch, sequence) tensor of **cumulative** done conditions. For any given batch element,
|
||||
the first True is followed by True's all the way till the end. This can be used for masking
|
||||
extraneous elements from the sequences above.
|
||||
|
||||
Args:
|
||||
env: The batch of environments.
|
||||
policy: The policy.
|
||||
policy: The policy. Must be a PyTorch nn module.
|
||||
seeds: The environments are seeded once at the start of the rollout. If provided, this argument
|
||||
specifies the seeds for each of the environments.
|
||||
return_observations: Whether to include all observations in the returned rollout data. Observations
|
||||
@@ -116,6 +116,7 @@ def rollout(
|
||||
Returns:
|
||||
The dictionary described above.
|
||||
"""
|
||||
assert isinstance(policy, nn.Module), "Policy must be a PyTorch nn module."
|
||||
device = get_device_from_parameters(policy)
|
||||
|
||||
# Reset the policy and environments.
|
||||
@@ -209,7 +210,7 @@ def eval_policy(
|
||||
policy: torch.nn.Module,
|
||||
n_episodes: int,
|
||||
max_episodes_rendered: int = 0,
|
||||
video_dir: Path | None = None,
|
||||
videos_dir: Path | None = None,
|
||||
return_episode_data: bool = False,
|
||||
start_seed: int | None = None,
|
||||
enable_progbar: bool = False,
|
||||
@@ -221,7 +222,7 @@ def eval_policy(
|
||||
policy: The policy.
|
||||
n_episodes: The number of episodes to evaluate.
|
||||
max_episodes_rendered: Maximum number of episodes to render into videos.
|
||||
video_dir: Where to save rendered videos.
|
||||
videos_dir: Where to save rendered videos.
|
||||
return_episode_data: Whether to return episode data for online training. Incorporates the data into
|
||||
the "episodes" key of the returned dictionary.
|
||||
start_seed: The first seed to use for the first individual rollout. For all subsequent rollouts the
|
||||
@@ -231,6 +232,10 @@ def eval_policy(
|
||||
Returns:
|
||||
Dictionary with metrics and data regarding the rollouts.
|
||||
"""
|
||||
if max_episodes_rendered > 0 and not videos_dir:
|
||||
raise ValueError("If max_episodes_rendered > 0, videos_dir must be provided.")
|
||||
|
||||
assert isinstance(policy, Policy)
|
||||
start = time.time()
|
||||
policy.eval()
|
||||
|
||||
@@ -271,11 +276,16 @@ def eval_policy(
|
||||
if max_episodes_rendered > 0:
|
||||
ep_frames: list[np.ndarray] = []
|
||||
|
||||
seeds = range(start_seed + (batch_ix * env.num_envs), start_seed + ((batch_ix + 1) * env.num_envs))
|
||||
if start_seed is None:
|
||||
seeds = None
|
||||
else:
|
||||
seeds = range(
|
||||
start_seed + (batch_ix * env.num_envs), start_seed + ((batch_ix + 1) * env.num_envs)
|
||||
)
|
||||
rollout_data = rollout(
|
||||
env,
|
||||
policy,
|
||||
seeds=seeds,
|
||||
seeds=list(seeds) if seeds else None,
|
||||
return_observations=return_episode_data,
|
||||
render_callback=render_frame if max_episodes_rendered > 0 else None,
|
||||
enable_progbar=enable_inner_progbar,
|
||||
@@ -285,7 +295,8 @@ def eval_policy(
|
||||
# this won't be included).
|
||||
n_steps = rollout_data["done"].shape[1]
|
||||
# Note: this relies on a property of argmax: that it returns the first occurrence as a tiebreaker.
|
||||
done_indices = torch.argmax(rollout_data["done"].to(int), axis=1) # (batch_size, rollout_steps)
|
||||
done_indices = torch.argmax(rollout_data["done"].to(int), dim=1)
|
||||
|
||||
# Make a mask with shape (batch, n_steps) to mask out rollout data after the first done
|
||||
# (batch-element-wise). Note the `done_indices + 1` to make sure to keep the data from the done step.
|
||||
mask = (torch.arange(n_steps) <= einops.repeat(done_indices + 1, "b -> b s", s=n_steps)).int()
|
||||
@@ -296,8 +307,12 @@ def eval_policy(
|
||||
max_rewards.extend(batch_max_rewards.tolist())
|
||||
batch_successes = einops.reduce((rollout_data["success"] * mask), "b n -> b", "any")
|
||||
all_successes.extend(batch_successes.tolist())
|
||||
all_seeds.extend(seeds)
|
||||
if seeds:
|
||||
all_seeds.extend(seeds)
|
||||
else:
|
||||
all_seeds.append(None)
|
||||
|
||||
# FIXME: episode_data is either None or it doesn't exist
|
||||
if return_episode_data:
|
||||
this_episode_data = _compile_episode_data(
|
||||
rollout_data,
|
||||
@@ -347,8 +362,9 @@ def eval_policy(
|
||||
):
|
||||
if n_episodes_rendered >= max_episodes_rendered:
|
||||
break
|
||||
video_dir.mkdir(parents=True, exist_ok=True)
|
||||
video_path = video_dir / f"eval_episode_{n_episodes_rendered}.mp4"
|
||||
|
||||
videos_dir.mkdir(parents=True, exist_ok=True)
|
||||
video_path = videos_dir / f"eval_episode_{n_episodes_rendered}.mp4"
|
||||
video_paths.append(str(video_path))
|
||||
thread = threading.Thread(
|
||||
target=write_video,
|
||||
@@ -503,22 +519,20 @@ def _compile_episode_data(
|
||||
}
|
||||
|
||||
|
||||
def eval(
|
||||
pretrained_policy_path: str | None = None,
|
||||
def main(
|
||||
pretrained_policy_path: Path | None = None,
|
||||
hydra_cfg_path: str | None = None,
|
||||
out_dir: str | None = None,
|
||||
config_overrides: list[str] | None = None,
|
||||
):
|
||||
assert (pretrained_policy_path is None) ^ (hydra_cfg_path is None)
|
||||
if hydra_cfg_path is None:
|
||||
hydra_cfg = init_hydra_config(pretrained_policy_path / "config.yaml", config_overrides)
|
||||
if pretrained_policy_path is not None:
|
||||
hydra_cfg = init_hydra_config(str(pretrained_policy_path / "config.yaml"), config_overrides)
|
||||
else:
|
||||
hydra_cfg = init_hydra_config(hydra_cfg_path, config_overrides)
|
||||
out_dir = (
|
||||
f"outputs/eval/{dt.now().strftime('%Y-%m-%d/%H-%M-%S')}_{hydra_cfg.env.name}_{hydra_cfg.policy.name}"
|
||||
)
|
||||
|
||||
if out_dir is None:
|
||||
raise NotImplementedError()
|
||||
out_dir = f"outputs/eval/{dt.now().strftime('%Y-%m-%d/%H-%M-%S')}_{hydra_cfg.env.name}_{hydra_cfg.policy.name}"
|
||||
|
||||
# Check device is available
|
||||
device = get_safe_torch_device(hydra_cfg.device, log=True)
|
||||
@@ -534,10 +548,12 @@ def eval(
|
||||
|
||||
logging.info("Making policy.")
|
||||
if hydra_cfg_path is None:
|
||||
policy = make_policy(hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=pretrained_policy_path)
|
||||
policy = make_policy(hydra_cfg=hydra_cfg, pretrained_policy_name_or_path=str(pretrained_policy_path))
|
||||
else:
|
||||
# Note: We need the dataset stats to pass to the policy's normalization modules.
|
||||
policy = make_policy(hydra_cfg=hydra_cfg, dataset_stats=make_dataset(hydra_cfg).stats)
|
||||
|
||||
assert isinstance(policy, nn.Module)
|
||||
policy.eval()
|
||||
|
||||
with torch.no_grad(), torch.autocast(device_type=device.type) if hydra_cfg.use_amp else nullcontext():
|
||||
@@ -546,7 +562,7 @@ def eval(
|
||||
policy,
|
||||
hydra_cfg.eval.n_episodes,
|
||||
max_episodes_rendered=10,
|
||||
video_dir=Path(out_dir) / "eval",
|
||||
videos_dir=Path(out_dir) / "videos",
|
||||
start_seed=hydra_cfg.seed,
|
||||
enable_progbar=True,
|
||||
enable_inner_progbar=True,
|
||||
@@ -586,6 +602,13 @@ if __name__ == "__main__":
|
||||
),
|
||||
)
|
||||
parser.add_argument("--revision", help="Optionally provide the Hugging Face Hub revision ID.")
|
||||
parser.add_argument(
|
||||
"--out-dir",
|
||||
help=(
|
||||
"Where to save the evaluation outputs. If not provided, outputs are saved in "
|
||||
"outputs/eval/{timestamp}_{env_name}_{policy_name}"
|
||||
),
|
||||
)
|
||||
parser.add_argument(
|
||||
"overrides",
|
||||
nargs="*",
|
||||
@@ -594,7 +617,7 @@ if __name__ == "__main__":
|
||||
args = parser.parse_args()
|
||||
|
||||
if args.pretrained_policy_name_or_path is None:
|
||||
eval(hydra_cfg_path=args.config, config_overrides=args.overrides)
|
||||
main(hydra_cfg_path=args.config, out_dir=args.out_dir, config_overrides=args.overrides)
|
||||
else:
|
||||
try:
|
||||
pretrained_policy_path = Path(
|
||||
@@ -618,4 +641,8 @@ if __name__ == "__main__":
|
||||
"repo ID, nor is it an existing local directory."
|
||||
)
|
||||
|
||||
eval(pretrained_policy_path=pretrained_policy_path, config_overrides=args.overrides)
|
||||
main(
|
||||
pretrained_policy_path=pretrained_policy_path,
|
||||
out_dir=args.out_dir,
|
||||
config_overrides=args.overrides,
|
||||
)
|
||||
|
||||
@@ -18,81 +18,126 @@ Use this script to convert your dataset into LeRobot dataset format and upload i
|
||||
or store it locally. LeRobot dataset format is lightweight, fast to load from, and does not require any
|
||||
installation of neural net specific packages like pytorch, tensorflow, jax.
|
||||
|
||||
Example:
|
||||
Example of how to download raw datasets, convert them into LeRobotDataset format, and push them to the hub:
|
||||
```
|
||||
python lerobot/scripts/push_dataset_to_hub.py \
|
||||
--data-dir data \
|
||||
--dataset-id pusht \
|
||||
--raw-dir data/pusht_raw \
|
||||
--raw-format pusht_zarr \
|
||||
--community-id lerobot \
|
||||
--dry-run 1 \
|
||||
--save-to-disk 1 \
|
||||
--save-tests-to-disk 0 \
|
||||
--debug 1
|
||||
--repo-id lerobot/pusht
|
||||
|
||||
python lerobot/scripts/push_dataset_to_hub.py \
|
||||
--data-dir data \
|
||||
--dataset-id xarm_lift_medium \
|
||||
--raw-dir data/xarm_lift_medium_raw \
|
||||
--raw-format xarm_pkl \
|
||||
--community-id lerobot \
|
||||
--dry-run 1 \
|
||||
--save-to-disk 1 \
|
||||
--save-tests-to-disk 0 \
|
||||
--debug 1
|
||||
--repo-id lerobot/xarm_lift_medium
|
||||
|
||||
python lerobot/scripts/push_dataset_to_hub.py \
|
||||
--data-dir data \
|
||||
--dataset-id aloha_sim_insertion_scripted \
|
||||
--raw-dir data/aloha_sim_insertion_scripted_raw \
|
||||
--raw-format aloha_hdf5 \
|
||||
--community-id lerobot \
|
||||
--dry-run 1 \
|
||||
--save-to-disk 1 \
|
||||
--save-tests-to-disk 0 \
|
||||
--debug 1
|
||||
--repo-id lerobot/aloha_sim_insertion_scripted
|
||||
|
||||
python lerobot/scripts/push_dataset_to_hub.py \
|
||||
--data-dir data \
|
||||
--dataset-id umi_cup_in_the_wild \
|
||||
--raw-dir data/umi_cup_in_the_wild_raw \
|
||||
--raw-format umi_zarr \
|
||||
--community-id lerobot \
|
||||
--dry-run 1 \
|
||||
--save-to-disk 1 \
|
||||
--save-tests-to-disk 0 \
|
||||
--debug 1
|
||||
--repo-id lerobot/umi_cup_in_the_wild
|
||||
```
|
||||
|
||||
**WARNING: Updating an existing dataset**
|
||||
|
||||
If you want to update an existing dataset, you need to change the `CODEBASE_VERSION` from `lerobot_dataset.py`
|
||||
before running `push_dataset_to_hub.py`. This is especially useful if you introduce a breaking change
|
||||
intentionally or not (i.e. something not backward compatible such as modifying the reward functions used,
|
||||
deleting some frames at the end of an episode, etc.). That way, people running a previous version of the
|
||||
codebase won't be affected by your change and backward compatibility is maintained.
|
||||
|
||||
For instance, Pusht has many versions to maintain backward compatibility between LeRobot codebase versions:
|
||||
- [v1.0](https://huggingface.co/datasets/lerobot/pusht/tree/v1.0)
|
||||
- [v1.1](https://huggingface.co/datasets/lerobot/pusht/tree/v1.1)
|
||||
- [v1.2](https://huggingface.co/datasets/lerobot/pusht/tree/v1.2)
|
||||
- [v1.3](https://huggingface.co/datasets/lerobot/pusht/tree/v1.3)
|
||||
- [v1.4](https://huggingface.co/datasets/lerobot/pusht/tree/v1.4)
|
||||
- [v1.5](https://huggingface.co/datasets/lerobot/pusht/tree/v1.5) <-- last version
|
||||
- [main](https://huggingface.co/datasets/lerobot/pusht/tree/main) <-- points to the last version
|
||||
|
||||
However, you will need to update the version of ALL the other datasets so that they have the new
|
||||
`CODEBASE_VERSION` as a branch in their hugging face dataset repository. Don't worry, there is an easy way
|
||||
that doesn't require to run `push_dataset_to_hub.py`. You can just "branch-out" from the `main` branch on HF
|
||||
dataset repo by running this script which corresponds to a `git checkout -b` (so no copy or upload needed):
|
||||
|
||||
```python
|
||||
import os
|
||||
|
||||
from huggingface_hub import create_branch, hf_hub_download
|
||||
from huggingface_hub.utils._errors import RepositoryNotFoundError
|
||||
|
||||
from lerobot import available_datasets
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
|
||||
|
||||
os.environ["HF_HUB_DISABLE_PROGRESS_BARS"] = "1" # makes it easier to see the print-out below
|
||||
|
||||
NEW_CODEBASE_VERSION = "v1.5" # REPLACE THIS WITH YOUR DESIRED VERSION
|
||||
|
||||
for repo_id in available_datasets:
|
||||
# First check if the newer version already exists.
|
||||
try:
|
||||
hf_hub_download(
|
||||
repo_id=repo_id, repo_type="dataset", filename=".gitattributes", revision=NEW_CODEBASE_VERSION
|
||||
)
|
||||
print(f"Found existing branch for {repo_id}. Please contact a member of the core LeRobot team.")
|
||||
print("Exiting early")
|
||||
break
|
||||
except RepositoryNotFoundError:
|
||||
# Now create a branch.
|
||||
create_branch(repo_id, repo_type="dataset", branch=NEW_CODEBASE_VERSION, revision=CODEBASE_VERSION)
|
||||
print(f"{repo_id} successfully updated")
|
||||
|
||||
```
|
||||
|
||||
On the other hand, if you are pushing a new dataset, you don't need to worry about any of the instructions
|
||||
above, nor to be compatible with previous codebase versions.
|
||||
"""
|
||||
|
||||
import argparse
|
||||
import json
|
||||
import shutil
|
||||
import warnings
|
||||
from pathlib import Path
|
||||
from typing import Any
|
||||
|
||||
import torch
|
||||
from huggingface_hub import HfApi
|
||||
from huggingface_hub import HfApi, create_branch
|
||||
from safetensors.torch import save_file
|
||||
|
||||
from lerobot.common.datasets.compute_stats import compute_stats
|
||||
from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION, LeRobotDataset
|
||||
from lerobot.common.datasets.push_dataset_to_hub._download_raw import download_raw
|
||||
from lerobot.common.datasets.push_dataset_to_hub.compute_stats import compute_stats
|
||||
from lerobot.common.datasets.utils import flatten_dict
|
||||
|
||||
|
||||
def get_from_raw_to_lerobot_format_fn(raw_format):
|
||||
def get_from_raw_to_lerobot_format_fn(raw_format: str):
|
||||
if raw_format == "pusht_zarr":
|
||||
from lerobot.common.datasets.push_dataset_to_hub.pusht_zarr_format import from_raw_to_lerobot_format
|
||||
elif raw_format == "umi_zarr":
|
||||
from lerobot.common.datasets.push_dataset_to_hub.umi_zarr_format import from_raw_to_lerobot_format
|
||||
elif raw_format == "aloha_hdf5":
|
||||
from lerobot.common.datasets.push_dataset_to_hub.aloha_hdf5_format import from_raw_to_lerobot_format
|
||||
elif "oxe_rlds" in raw_format:
|
||||
from lerobot.common.datasets.push_dataset_to_hub.oxe_rlds_format import from_raw_to_lerobot_format
|
||||
elif raw_format == "dora_parquet":
|
||||
from lerobot.common.datasets.push_dataset_to_hub.dora_parquet_format import from_raw_to_lerobot_format
|
||||
elif raw_format == "xarm_pkl":
|
||||
from lerobot.common.datasets.push_dataset_to_hub.xarm_pkl_format import from_raw_to_lerobot_format
|
||||
elif raw_format == "cam_png":
|
||||
from lerobot.common.datasets.push_dataset_to_hub.cam_png_format import from_raw_to_lerobot_format
|
||||
else:
|
||||
raise ValueError(raw_format)
|
||||
raise ValueError(
|
||||
f"The selected {raw_format} can't be found. Did you add it to `lerobot/scripts/push_dataset_to_hub.py::get_from_raw_to_lerobot_format_fn`?"
|
||||
)
|
||||
|
||||
return from_raw_to_lerobot_format
|
||||
|
||||
|
||||
def save_meta_data(info, stats, episode_data_index, meta_data_dir):
|
||||
def save_meta_data(
|
||||
info: dict[str, Any], stats: dict, episode_data_index: dict[str, list], meta_data_dir: Path
|
||||
):
|
||||
meta_data_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
# save info
|
||||
@@ -110,7 +155,7 @@ def save_meta_data(info, stats, episode_data_index, meta_data_dir):
|
||||
save_file(episode_data_index, ep_data_idx_path)
|
||||
|
||||
|
||||
def push_meta_data_to_hub(repo_id, meta_data_dir, revision):
|
||||
def push_meta_data_to_hub(repo_id: str, meta_data_dir: str | Path, revision: str | None):
|
||||
"""Expect all meta data files to be all stored in a single "meta_data" directory.
|
||||
On the hugging face repositery, they will be uploaded in a "meta_data" directory at the root.
|
||||
"""
|
||||
@@ -124,7 +169,7 @@ def push_meta_data_to_hub(repo_id, meta_data_dir, revision):
|
||||
)
|
||||
|
||||
|
||||
def push_videos_to_hub(repo_id, videos_dir, revision):
|
||||
def push_videos_to_hub(repo_id: str, videos_dir: str | Path, revision: str | None):
|
||||
"""Expect mp4 files to be all stored in a single "videos" directory.
|
||||
On the hugging face repositery, they will be uploaded in a "videos" directory at the root.
|
||||
"""
|
||||
@@ -140,55 +185,91 @@ def push_videos_to_hub(repo_id, videos_dir, revision):
|
||||
|
||||
|
||||
def push_dataset_to_hub(
|
||||
data_dir: Path,
|
||||
dataset_id: str,
|
||||
raw_format: str | None,
|
||||
community_id: str,
|
||||
revision: str,
|
||||
dry_run: bool,
|
||||
save_to_disk: bool,
|
||||
tests_data_dir: Path,
|
||||
save_tests_to_disk: bool,
|
||||
fps: int | None,
|
||||
video: bool,
|
||||
batch_size: int,
|
||||
num_workers: int,
|
||||
debug: bool,
|
||||
raw_dir: Path,
|
||||
raw_format: str,
|
||||
repo_id: str,
|
||||
push_to_hub: bool = True,
|
||||
local_dir: Path | None = None,
|
||||
fps: int | None = None,
|
||||
video: bool = True,
|
||||
batch_size: int = 32,
|
||||
num_workers: int = 8,
|
||||
episodes: list[int] | None = None,
|
||||
force_override: bool = False,
|
||||
cache_dir: Path = Path("/tmp"),
|
||||
tests_data_dir: Path | None = None,
|
||||
):
|
||||
repo_id = f"{community_id}/{dataset_id}"
|
||||
|
||||
raw_dir = data_dir / f"{dataset_id}_raw"
|
||||
|
||||
out_dir = data_dir / repo_id
|
||||
meta_data_dir = out_dir / "meta_data"
|
||||
videos_dir = out_dir / "videos"
|
||||
|
||||
tests_out_dir = tests_data_dir / repo_id
|
||||
tests_meta_data_dir = tests_out_dir / "meta_data"
|
||||
tests_videos_dir = tests_out_dir / "videos"
|
||||
|
||||
if out_dir.exists():
|
||||
shutil.rmtree(out_dir)
|
||||
|
||||
if tests_out_dir.exists() and save_tests_to_disk:
|
||||
shutil.rmtree(tests_out_dir)
|
||||
# Check repo_id is well formated
|
||||
if len(repo_id.split("/")) != 2:
|
||||
raise ValueError(
|
||||
f"`repo_id` is expected to contain a community or user id `/` the name of the dataset (e.g. 'lerobot/pusht'), but instead contains '{repo_id}'."
|
||||
)
|
||||
user_id, dataset_id = repo_id.split("/")
|
||||
|
||||
# Robustify when `raw_dir` is str instead of Path
|
||||
raw_dir = Path(raw_dir)
|
||||
if not raw_dir.exists():
|
||||
download_raw(raw_dir, dataset_id)
|
||||
raise NotADirectoryError(
|
||||
f"{raw_dir} does not exists. Check your paths or run this command to download an existing raw dataset on the hub:"
|
||||
f"python lerobot/common/datasets/push_dataset_to_hub/_download_raw.py --raw-dir your/raw/dir --repo-id your/repo/id_raw"
|
||||
)
|
||||
|
||||
if local_dir:
|
||||
# Robustify when `local_dir` is str instead of Path
|
||||
local_dir = Path(local_dir)
|
||||
|
||||
# Send warning if local_dir isn't well formated
|
||||
if local_dir.parts[-2] != user_id or local_dir.parts[-1] != dataset_id:
|
||||
warnings.warn(
|
||||
f"`local_dir` ({local_dir}) doesn't contain a community or user id `/` the name of the dataset that match the `repo_id` (e.g. 'data/lerobot/pusht'). Following this naming convention is advised, but not mandatory.",
|
||||
stacklevel=1,
|
||||
)
|
||||
|
||||
# Check we don't override an existing `local_dir` by mistake
|
||||
if local_dir.exists():
|
||||
if force_override:
|
||||
shutil.rmtree(local_dir)
|
||||
else:
|
||||
raise ValueError(f"`local_dir` already exists ({local_dir}). Use `--force-override 1`.")
|
||||
|
||||
meta_data_dir = local_dir / "meta_data"
|
||||
videos_dir = local_dir / "videos"
|
||||
else:
|
||||
# Temporary directory used to store images, videos, meta_data
|
||||
meta_data_dir = Path(cache_dir) / "meta_data"
|
||||
videos_dir = Path(cache_dir) / "videos"
|
||||
|
||||
if raw_format is None:
|
||||
# TODO(rcadene, adilzouitine): implement auto_find_raw_format
|
||||
raise NotImplementedError()
|
||||
# raw_format = auto_find_raw_format(raw_dir)
|
||||
|
||||
# convert dataset from original raw format to LeRobot format
|
||||
from_raw_to_lerobot_format = get_from_raw_to_lerobot_format_fn(raw_format)
|
||||
|
||||
# convert dataset from original raw format to LeRobot format
|
||||
hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(raw_dir, out_dir, fps, video, debug)
|
||||
if "oxe_rlds" in raw_format:
|
||||
# User could provide official OXE dataset name to convert it to LeRobot format
|
||||
# the raw_format str is as such:
|
||||
# oxe_rlds (default)
|
||||
# oxe_rlds.bridge_orig: (with bridge_orig as oxe_dataset_name)
|
||||
splited_raw_format = raw_format.split(".")
|
||||
assert len(splited_raw_format) <= 2, f"Invalid raw_format: {raw_format}"
|
||||
if len(splited_raw_format) == 2:
|
||||
oxe_dataset_name = splited_raw_format[1]
|
||||
print(f"Converting dataset [{oxe_dataset_name}] from 'oxe_rlds' to LeRobot format.")
|
||||
else:
|
||||
oxe_dataset_name = None
|
||||
|
||||
hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(
|
||||
raw_dir, videos_dir, fps, video, episodes, oxe_dataset_name=oxe_dataset_name
|
||||
)
|
||||
else:
|
||||
hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(
|
||||
raw_dir, videos_dir, fps, video, episodes
|
||||
)
|
||||
|
||||
lerobot_dataset = LeRobotDataset.from_preloaded(
|
||||
repo_id=repo_id,
|
||||
version=revision,
|
||||
hf_dataset=hf_dataset,
|
||||
episode_data_index=episode_data_index,
|
||||
info=info,
|
||||
@@ -196,102 +277,81 @@ def push_dataset_to_hub(
|
||||
)
|
||||
stats = compute_stats(lerobot_dataset, batch_size, num_workers)
|
||||
|
||||
if save_to_disk:
|
||||
if local_dir:
|
||||
hf_dataset = hf_dataset.with_format(None) # to remove transforms that cant be saved
|
||||
hf_dataset.save_to_disk(str(out_dir / "train"))
|
||||
hf_dataset.save_to_disk(str(local_dir / "train"))
|
||||
|
||||
if not dry_run or save_to_disk:
|
||||
if push_to_hub or local_dir:
|
||||
# mandatory for upload
|
||||
save_meta_data(info, stats, episode_data_index, meta_data_dir)
|
||||
|
||||
if not dry_run:
|
||||
hf_dataset.push_to_hub(repo_id, token=True, revision="main")
|
||||
hf_dataset.push_to_hub(repo_id, token=True, revision=revision)
|
||||
|
||||
if push_to_hub:
|
||||
hf_dataset.push_to_hub(repo_id, revision="main")
|
||||
push_meta_data_to_hub(repo_id, meta_data_dir, revision="main")
|
||||
push_meta_data_to_hub(repo_id, meta_data_dir, revision=revision)
|
||||
|
||||
if video:
|
||||
push_videos_to_hub(repo_id, videos_dir, revision="main")
|
||||
push_videos_to_hub(repo_id, videos_dir, revision=revision)
|
||||
create_branch(repo_id, repo_type="dataset", branch=CODEBASE_VERSION)
|
||||
|
||||
if save_tests_to_disk:
|
||||
if tests_data_dir:
|
||||
# get the first episode
|
||||
num_items_first_ep = episode_data_index["to"][0] - episode_data_index["from"][0]
|
||||
test_hf_dataset = hf_dataset.select(range(num_items_first_ep))
|
||||
episode_data_index = {k: v[:1] for k, v in episode_data_index.items()}
|
||||
|
||||
test_hf_dataset = test_hf_dataset.with_format(None)
|
||||
test_hf_dataset.save_to_disk(str(tests_out_dir / "train"))
|
||||
test_hf_dataset.save_to_disk(str(tests_data_dir / repo_id / "train"))
|
||||
|
||||
save_meta_data(info, stats, episode_data_index, tests_meta_data_dir)
|
||||
tests_meta_data = tests_data_dir / repo_id / "meta_data"
|
||||
save_meta_data(info, stats, episode_data_index, tests_meta_data)
|
||||
|
||||
# copy videos of first episode to tests directory
|
||||
episode_index = 0
|
||||
tests_videos_dir = tests_data_dir / repo_id / "videos"
|
||||
tests_videos_dir.mkdir(parents=True, exist_ok=True)
|
||||
for key in lerobot_dataset.video_frame_keys:
|
||||
fname = f"{key}_episode_{episode_index:06d}.mp4"
|
||||
shutil.copy(videos_dir / fname, tests_videos_dir / fname)
|
||||
|
||||
if not save_to_disk and out_dir.exists():
|
||||
# remove possible temporary files remaining in the output directory
|
||||
shutil.rmtree(out_dir)
|
||||
if local_dir is None:
|
||||
# clear cache
|
||||
shutil.rmtree(meta_data_dir)
|
||||
shutil.rmtree(videos_dir)
|
||||
|
||||
return lerobot_dataset
|
||||
|
||||
|
||||
def main():
|
||||
parser = argparse.ArgumentParser()
|
||||
|
||||
parser.add_argument(
|
||||
"--data-dir",
|
||||
"--raw-dir",
|
||||
type=Path,
|
||||
required=True,
|
||||
help="Root directory containing datasets (e.g. `data` or `tmp/data` or `/tmp/lerobot/data`).",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--dataset-id",
|
||||
type=str,
|
||||
required=True,
|
||||
help="Name of the dataset (e.g. `pusht`, `aloha_sim_insertion_human`), which matches the folder where the data is stored (e.g. `data/pusht`).",
|
||||
help="Directory containing input raw datasets (e.g. `data/aloha_mobile_chair_raw` or `data/pusht_raw).",
|
||||
)
|
||||
# TODO(rcadene): add automatic detection of the format
|
||||
parser.add_argument(
|
||||
"--raw-format",
|
||||
type=str,
|
||||
help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`). If not provided, will be detected automatically.",
|
||||
required=True,
|
||||
help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`).",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--community-id",
|
||||
"--repo-id",
|
||||
type=str,
|
||||
default="lerobot",
|
||||
help="Community or user ID under which the dataset will be hosted on the Hub.",
|
||||
required=True,
|
||||
help="Repositery identifier on Hugging Face: a community or a user name `/` the name of the dataset (e.g. `lerobot/pusht`, `cadene/aloha_sim_insertion_human`).",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--revision",
|
||||
type=str,
|
||||
default=CODEBASE_VERSION,
|
||||
help="Codebase version used to generate the dataset.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--dry-run",
|
||||
type=int,
|
||||
default=0,
|
||||
help="Run everything without uploading to hub, for testing purposes or storing a dataset locally.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--save-to-disk",
|
||||
type=int,
|
||||
default=1,
|
||||
help="Save the dataset in the directory specified by `--data-dir`.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--tests-data-dir",
|
||||
"--local-dir",
|
||||
type=Path,
|
||||
default="tests/data",
|
||||
help="Directory containing tests artifacts datasets.",
|
||||
help="When provided, writes the dataset converted to LeRobotDataset format in this directory (e.g. `data/lerobot/aloha_mobile_chair`).",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--save-tests-to-disk",
|
||||
"--push-to-hub",
|
||||
type=int,
|
||||
default=1,
|
||||
help="Save the dataset with 1 episode used for unit tests in the directory specified by `--tests-data-dir`.",
|
||||
help="Upload to hub.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--fps",
|
||||
@@ -317,10 +377,24 @@ def main():
|
||||
help="Number of processes of Dataloader for computing the dataset statistics.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--debug",
|
||||
"--episodes",
|
||||
type=int,
|
||||
nargs="*",
|
||||
help="When provided, only converts the provided episodes (e.g `--episodes 2 3 4`). Useful to test the code on 1 episode.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--force-override",
|
||||
type=int,
|
||||
default=0,
|
||||
help="Debug mode process the first episode only.",
|
||||
help="When set to 1, removes provided output directory if it already exists. By default, raises a ValueError exception.",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--tests-data-dir",
|
||||
type=Path,
|
||||
help=(
|
||||
"When provided, save tests artifacts into the given directory "
|
||||
"(e.g. `--tests-data-dir tests/data` will save to tests/data/{--repo-id})."
|
||||
),
|
||||
)
|
||||
|
||||
args = parser.parse_args()
|
||||
|
||||
@@ -16,16 +16,20 @@
|
||||
import logging
|
||||
import time
|
||||
from contextlib import nullcontext
|
||||
from copy import deepcopy
|
||||
from pathlib import Path
|
||||
from pprint import pformat
|
||||
|
||||
import hydra
|
||||
import torch
|
||||
from omegaconf import DictConfig
|
||||
from deepdiff import DeepDiff
|
||||
from omegaconf import DictConfig, OmegaConf
|
||||
from termcolor import colored
|
||||
from torch import nn
|
||||
from torch.cuda.amp import GradScaler
|
||||
from tqdm import tqdm
|
||||
|
||||
from lerobot.common.datasets.factory import make_dataset
|
||||
from lerobot.common.datasets.factory import make_dataset, resolve_delta_timestamps
|
||||
from lerobot.common.datasets.lerobot_dataset import MultiLeRobotDataset
|
||||
from lerobot.common.datasets.sampler import EpisodeAwareSampler
|
||||
from lerobot.common.datasets.utils import cycle
|
||||
from lerobot.common.envs.factory import make_env
|
||||
from lerobot.common.logger import Logger, log_output_dir
|
||||
@@ -35,6 +39,7 @@ from lerobot.common.policies.utils import get_device_from_parameters
|
||||
from lerobot.common.utils.utils import (
|
||||
format_big_number,
|
||||
get_safe_torch_device,
|
||||
init_hydra_config,
|
||||
init_logging,
|
||||
set_global_seed,
|
||||
)
|
||||
@@ -48,12 +53,14 @@ def make_optimizer_and_scheduler(cfg, policy):
|
||||
"params": [
|
||||
p
|
||||
for n, p in policy.named_parameters()
|
||||
if not n.startswith("backbone") and p.requires_grad
|
||||
if not n.startswith("model.backbone") and p.requires_grad
|
||||
]
|
||||
},
|
||||
{
|
||||
"params": [
|
||||
p for n, p in policy.named_parameters() if n.startswith("backbone") and p.requires_grad
|
||||
p
|
||||
for n, p in policy.named_parameters()
|
||||
if n.startswith("model.backbone") and p.requires_grad
|
||||
],
|
||||
"lr": cfg.training.lr_backbone,
|
||||
},
|
||||
@@ -81,6 +88,11 @@ def make_optimizer_and_scheduler(cfg, policy):
|
||||
elif policy.name == "tdmpc":
|
||||
optimizer = torch.optim.Adam(policy.parameters(), cfg.training.lr)
|
||||
lr_scheduler = None
|
||||
elif cfg.policy.name == "vqbet":
|
||||
from lerobot.common.policies.vqbet.modeling_vqbet import VQBeTOptimizer, VQBeTScheduler
|
||||
|
||||
optimizer = VQBeTOptimizer(policy, cfg)
|
||||
lr_scheduler = VQBeTScheduler(optimizer, cfg)
|
||||
else:
|
||||
raise NotImplementedError()
|
||||
|
||||
@@ -141,29 +153,12 @@ def update_policy(
|
||||
return info
|
||||
|
||||
|
||||
@hydra.main(version_base="1.2", config_name="default", config_path="../configs")
|
||||
def train_cli(cfg: dict):
|
||||
train(
|
||||
cfg,
|
||||
out_dir=hydra.core.hydra_config.HydraConfig.get().run.dir,
|
||||
job_name=hydra.core.hydra_config.HydraConfig.get().job.name,
|
||||
)
|
||||
|
||||
|
||||
def train_notebook(out_dir=None, job_name=None, config_name="default", config_path="../configs"):
|
||||
from hydra import compose, initialize
|
||||
|
||||
hydra.core.global_hydra.GlobalHydra.instance().clear()
|
||||
initialize(config_path=config_path)
|
||||
cfg = compose(config_name=config_name)
|
||||
train(cfg, out_dir=out_dir, job_name=job_name)
|
||||
|
||||
|
||||
def log_train_info(logger: Logger, info, step, cfg, dataset, is_offline):
|
||||
loss = info["loss"]
|
||||
grad_norm = info["grad_norm"]
|
||||
lr = info["lr"]
|
||||
update_s = info["update_s"]
|
||||
dataloading_s = info["dataloading_s"]
|
||||
|
||||
# A sample is an (observation,action) pair, where observation and action
|
||||
# can be on multiple timestamps. In a batch, we have `batch_size`` number of samples.
|
||||
@@ -184,6 +179,7 @@ def log_train_info(logger: Logger, info, step, cfg, dataset, is_offline):
|
||||
f"lr:{lr:0.1e}",
|
||||
# in seconds
|
||||
f"updt_s:{update_s:.3f}",
|
||||
f"data_s:{dataloading_s:.3f}", # if not ~0, you are bottlenecked by cpu or io
|
||||
]
|
||||
logging.info(" ".join(log_items))
|
||||
|
||||
@@ -238,36 +234,97 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
||||
|
||||
init_logging()
|
||||
|
||||
# If we are resuming a run, we need to check that a checkpoint exists in the log directory, and we need
|
||||
# to check for any differences between the provided config and the checkpoint's config.
|
||||
if cfg.resume:
|
||||
if not Logger.get_last_checkpoint_dir(out_dir).exists():
|
||||
raise RuntimeError(
|
||||
"You have set resume=True, but there is no model checkpoint in "
|
||||
f"{Logger.get_last_checkpoint_dir(out_dir)}"
|
||||
)
|
||||
checkpoint_cfg_path = str(Logger.get_last_pretrained_model_dir(out_dir) / "config.yaml")
|
||||
logging.info(
|
||||
colored(
|
||||
"You have set resume=True, indicating that you wish to resume a run",
|
||||
color="yellow",
|
||||
attrs=["bold"],
|
||||
)
|
||||
)
|
||||
# Get the configuration file from the last checkpoint.
|
||||
checkpoint_cfg = init_hydra_config(checkpoint_cfg_path)
|
||||
# Check for differences between the checkpoint configuration and provided configuration.
|
||||
# Hack to resolve the delta_timestamps ahead of time in order to properly diff.
|
||||
resolve_delta_timestamps(cfg)
|
||||
diff = DeepDiff(OmegaConf.to_container(checkpoint_cfg), OmegaConf.to_container(cfg))
|
||||
# Ignore the `resume` and parameters.
|
||||
if "values_changed" in diff and "root['resume']" in diff["values_changed"]:
|
||||
del diff["values_changed"]["root['resume']"]
|
||||
# Log a warning about differences between the checkpoint configuration and the provided
|
||||
# configuration.
|
||||
if len(diff) > 0:
|
||||
logging.warning(
|
||||
"At least one difference was detected between the checkpoint configuration and "
|
||||
f"the provided configuration: \n{pformat(diff)}\nNote that the checkpoint configuration "
|
||||
"takes precedence.",
|
||||
)
|
||||
# Use the checkpoint config instead of the provided config (but keep `resume` parameter).
|
||||
cfg = checkpoint_cfg
|
||||
cfg.resume = True
|
||||
elif Logger.get_last_checkpoint_dir(out_dir).exists():
|
||||
raise RuntimeError(
|
||||
f"The configured output directory {Logger.get_last_checkpoint_dir(out_dir)} already exists."
|
||||
)
|
||||
|
||||
# log metrics to terminal and wandb
|
||||
logger = Logger(cfg, out_dir, wandb_job_name=job_name)
|
||||
|
||||
if cfg.training.online_steps > 0:
|
||||
raise NotImplementedError("Online training is not implemented yet.")
|
||||
|
||||
set_global_seed(cfg.seed)
|
||||
|
||||
# Check device is available
|
||||
device = get_safe_torch_device(cfg.device, log=True)
|
||||
|
||||
torch.backends.cudnn.benchmark = True
|
||||
torch.backends.cuda.matmul.allow_tf32 = True
|
||||
set_global_seed(cfg.seed)
|
||||
|
||||
logging.info("make_dataset")
|
||||
offline_dataset = make_dataset(cfg)
|
||||
if isinstance(offline_dataset, MultiLeRobotDataset):
|
||||
logging.info(
|
||||
"Multiple datasets were provided. Applied the following index mapping to the provided datasets: "
|
||||
f"{pformat(offline_dataset.repo_id_to_index , indent=2)}"
|
||||
)
|
||||
|
||||
logging.info("make_env")
|
||||
eval_env = make_env(cfg)
|
||||
# Create environment used for evaluating checkpoints during training on simulation data.
|
||||
# On real-world data, no need to create an environment as evaluations are done outside train.py,
|
||||
# using the eval.py instead, with gym_dora environment and dora-rs.
|
||||
eval_env = None
|
||||
if cfg.training.eval_freq > 0:
|
||||
logging.info("make_env")
|
||||
eval_env = make_env(cfg)
|
||||
|
||||
logging.info("make_policy")
|
||||
policy = make_policy(hydra_cfg=cfg, dataset_stats=offline_dataset.stats)
|
||||
|
||||
policy = make_policy(
|
||||
hydra_cfg=cfg,
|
||||
dataset_stats=offline_dataset.stats if not cfg.resume else None,
|
||||
pretrained_policy_name_or_path=str(logger.last_pretrained_model_dir) if cfg.resume else None,
|
||||
)
|
||||
assert isinstance(policy, nn.Module)
|
||||
# Create optimizer and scheduler
|
||||
# Temporary hack to move optimizer out of policy
|
||||
optimizer, lr_scheduler = make_optimizer_and_scheduler(cfg, policy)
|
||||
grad_scaler = GradScaler(enabled=cfg.use_amp)
|
||||
|
||||
step = 0 # number of policy updates (forward + backward + optim)
|
||||
|
||||
if cfg.resume:
|
||||
step = logger.load_last_training_state(optimizer, lr_scheduler)
|
||||
|
||||
num_learnable_params = sum(p.numel() for p in policy.parameters() if p.requires_grad)
|
||||
num_total_params = sum(p.numel() for p in policy.parameters())
|
||||
|
||||
# log metrics to terminal and wandb
|
||||
logger = Logger(out_dir, job_name, cfg)
|
||||
|
||||
log_output_dir(out_dir)
|
||||
logging.info(f"{cfg.env.task=}")
|
||||
logging.info(f"{cfg.training.offline_steps=} ({format_big_number(cfg.training.offline_steps)})")
|
||||
@@ -279,51 +336,72 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
||||
|
||||
# Note: this helper will be used in offline and online training loops.
|
||||
def evaluate_and_checkpoint_if_needed(step):
|
||||
if step % cfg.training.eval_freq == 0:
|
||||
_num_digits = max(6, len(str(cfg.training.offline_steps + cfg.training.online_steps)))
|
||||
step_identifier = f"{step:0{_num_digits}d}"
|
||||
|
||||
if cfg.training.eval_freq > 0 and step % cfg.training.eval_freq == 0:
|
||||
logging.info(f"Eval policy at step {step}")
|
||||
with torch.no_grad(), torch.autocast(device_type=device.type) if cfg.use_amp else nullcontext():
|
||||
assert eval_env is not None
|
||||
eval_info = eval_policy(
|
||||
eval_env,
|
||||
policy,
|
||||
cfg.eval.n_episodes,
|
||||
video_dir=Path(out_dir) / "eval",
|
||||
videos_dir=Path(out_dir) / "eval" / f"videos_step_{step_identifier}",
|
||||
max_episodes_rendered=4,
|
||||
start_seed=cfg.seed,
|
||||
)
|
||||
log_eval_info(logger, eval_info["aggregated"], step, cfg, offline_dataset, is_offline)
|
||||
log_eval_info(logger, eval_info["aggregated"], step, cfg, offline_dataset, is_offline=True)
|
||||
if cfg.wandb.enable:
|
||||
logger.log_video(eval_info["video_paths"][0], step, mode="eval")
|
||||
logging.info("Resume training")
|
||||
|
||||
if cfg.training.save_model and step % cfg.training.save_freq == 0:
|
||||
if cfg.training.save_checkpoint and (
|
||||
step % cfg.training.save_freq == 0
|
||||
or step == cfg.training.offline_steps + cfg.training.online_steps
|
||||
):
|
||||
logging.info(f"Checkpoint policy after step {step}")
|
||||
# Note: Save with step as the identifier, and format it to have at least 6 digits but more if
|
||||
# needed (choose 6 as a minimum for consistency without being overkill).
|
||||
logger.save_model(
|
||||
logger.save_checkpont(
|
||||
step,
|
||||
policy,
|
||||
identifier=str(step).zfill(
|
||||
max(6, len(str(cfg.training.offline_steps + cfg.training.online_steps)))
|
||||
),
|
||||
optimizer,
|
||||
lr_scheduler,
|
||||
identifier=step_identifier,
|
||||
)
|
||||
logging.info("Resume training")
|
||||
|
||||
# create dataloader for offline training
|
||||
if cfg.training.get("drop_n_last_frames"):
|
||||
shuffle = False
|
||||
sampler = EpisodeAwareSampler(
|
||||
offline_dataset.episode_data_index,
|
||||
drop_n_last_frames=cfg.training.drop_n_last_frames,
|
||||
shuffle=True,
|
||||
)
|
||||
else:
|
||||
shuffle = True
|
||||
sampler = None
|
||||
dataloader = torch.utils.data.DataLoader(
|
||||
offline_dataset,
|
||||
num_workers=4,
|
||||
num_workers=cfg.training.num_workers,
|
||||
batch_size=cfg.training.batch_size,
|
||||
shuffle=True,
|
||||
shuffle=shuffle,
|
||||
sampler=sampler,
|
||||
pin_memory=device.type != "cpu",
|
||||
drop_last=False,
|
||||
)
|
||||
dl_iter = cycle(dataloader)
|
||||
|
||||
policy.train()
|
||||
is_offline = True
|
||||
for offline_step in tqdm(range(cfg.training.offline_steps)):
|
||||
if offline_step == 0:
|
||||
for _ in range(step, cfg.training.offline_steps):
|
||||
if step == 0:
|
||||
logging.info("Start offline training on a fixed dataset")
|
||||
|
||||
start_time = time.perf_counter()
|
||||
batch = next(dl_iter)
|
||||
dataloading_s = time.perf_counter() - start_time
|
||||
|
||||
for key in batch:
|
||||
batch[key] = batch[key].to(device, non_blocking=True)
|
||||
@@ -338,37 +416,39 @@ def train(cfg: DictConfig, out_dir: str | None = None, job_name: str | None = No
|
||||
use_amp=cfg.use_amp,
|
||||
)
|
||||
|
||||
# TODO(rcadene): is it ok if step_t=0 = 0 and not 1 as previously done?
|
||||
if offline_step % cfg.training.log_freq == 0:
|
||||
log_train_info(logger, train_info, offline_step, cfg, offline_dataset, is_offline)
|
||||
train_info["dataloading_s"] = dataloading_s
|
||||
|
||||
if step % cfg.training.log_freq == 0:
|
||||
log_train_info(logger, train_info, step, cfg, offline_dataset, is_offline=True)
|
||||
|
||||
# Note: evaluate_and_checkpoint_if_needed happens **after** the `step`th training update has completed,
|
||||
# so we pass in step + 1.
|
||||
evaluate_and_checkpoint_if_needed(offline_step + 1)
|
||||
evaluate_and_checkpoint_if_needed(step + 1)
|
||||
|
||||
# create an empty online dataset similar to offline dataset
|
||||
online_dataset = deepcopy(offline_dataset)
|
||||
online_dataset.hf_dataset = {}
|
||||
online_dataset.episode_data_index = {}
|
||||
step += 1
|
||||
|
||||
# create dataloader for online training
|
||||
concat_dataset = torch.utils.data.ConcatDataset([offline_dataset, online_dataset])
|
||||
weights = [1.0] * len(concat_dataset)
|
||||
sampler = torch.utils.data.WeightedRandomSampler(
|
||||
weights, num_samples=len(concat_dataset), replacement=True
|
||||
)
|
||||
dataloader = torch.utils.data.DataLoader(
|
||||
concat_dataset,
|
||||
num_workers=4,
|
||||
batch_size=cfg.training.batch_size,
|
||||
sampler=sampler,
|
||||
pin_memory=device.type != "cpu",
|
||||
drop_last=False,
|
||||
)
|
||||
|
||||
eval_env.close()
|
||||
if eval_env:
|
||||
eval_env.close()
|
||||
logging.info("End of training")
|
||||
|
||||
|
||||
@hydra.main(version_base="1.2", config_name="default", config_path="../configs")
|
||||
def train_cli(cfg: dict):
|
||||
train(
|
||||
cfg,
|
||||
out_dir=hydra.core.hydra_config.HydraConfig.get().run.dir,
|
||||
job_name=hydra.core.hydra_config.HydraConfig.get().job.name,
|
||||
)
|
||||
|
||||
|
||||
def train_notebook(out_dir=None, job_name=None, config_name="default", config_path="../configs"):
|
||||
from hydra import compose, initialize
|
||||
|
||||
hydra.core.global_hydra.GlobalHydra.instance().clear()
|
||||
initialize(config_path=config_path)
|
||||
cfg = compose(config_name=config_name)
|
||||
train(cfg, out_dir=out_dir, job_name=job_name)
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
train_cli()
|
||||
|
||||
@@ -66,28 +66,31 @@ import gc
|
||||
import logging
|
||||
import time
|
||||
from pathlib import Path
|
||||
from typing import Iterator
|
||||
|
||||
import numpy as np
|
||||
import rerun as rr
|
||||
import torch
|
||||
import torch.utils.data
|
||||
import tqdm
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
|
||||
|
||||
class EpisodeSampler(torch.utils.data.Sampler):
|
||||
def __init__(self, dataset, episode_index):
|
||||
def __init__(self, dataset: LeRobotDataset, episode_index: int):
|
||||
from_idx = dataset.episode_data_index["from"][episode_index].item()
|
||||
to_idx = dataset.episode_data_index["to"][episode_index].item()
|
||||
self.frame_ids = range(from_idx, to_idx)
|
||||
|
||||
def __iter__(self):
|
||||
def __iter__(self) -> Iterator:
|
||||
return iter(self.frame_ids)
|
||||
|
||||
def __len__(self):
|
||||
def __len__(self) -> int:
|
||||
return len(self.frame_ids)
|
||||
|
||||
|
||||
def to_hwc_uint8_numpy(chw_float32_torch):
|
||||
def to_hwc_uint8_numpy(chw_float32_torch: torch.Tensor) -> np.ndarray:
|
||||
assert chw_float32_torch.dtype == torch.float32
|
||||
assert chw_float32_torch.ndim == 3
|
||||
c, h, w = chw_float32_torch.shape
|
||||
@@ -106,6 +109,7 @@ def visualize_dataset(
|
||||
ws_port: int = 9087,
|
||||
save: bool = False,
|
||||
output_dir: Path | None = None,
|
||||
root: Path | None = None,
|
||||
) -> Path | None:
|
||||
if save:
|
||||
assert (
|
||||
@@ -113,7 +117,7 @@ def visualize_dataset(
|
||||
), "Set an output directory where to write .rrd files with `--output-dir path/to/directory`."
|
||||
|
||||
logging.info("Loading dataset")
|
||||
dataset = LeRobotDataset(repo_id)
|
||||
dataset = LeRobotDataset(repo_id, root=root)
|
||||
|
||||
logging.info("Loading dataloader")
|
||||
episode_sampler = EpisodeSampler(dataset, episode_index)
|
||||
@@ -224,7 +228,8 @@ def main():
|
||||
help=(
|
||||
"Mode of viewing between 'local' or 'distant'. "
|
||||
"'local' requires data to be on a local machine. It spawns a viewer to visualize the data locally. "
|
||||
"'distant' creates a server on the distant machine where the data is stored. Visualize the data by connecting to the server with `rerun ws://localhost:PORT` on the local machine."
|
||||
"'distant' creates a server on the distant machine where the data is stored. "
|
||||
"Visualize the data by connecting to the server with `rerun ws://localhost:PORT` on the local machine."
|
||||
),
|
||||
)
|
||||
parser.add_argument(
|
||||
@@ -245,8 +250,8 @@ def main():
|
||||
default=0,
|
||||
help=(
|
||||
"Save a .rrd file in the directory provided by `--output-dir`. "
|
||||
"It also deactivates the spawning of a viewer. ",
|
||||
"Visualize the data by running `rerun path/to/file.rrd` on your local machine.",
|
||||
"It also deactivates the spawning of a viewer. "
|
||||
"Visualize the data by running `rerun path/to/file.rrd` on your local machine."
|
||||
),
|
||||
)
|
||||
parser.add_argument(
|
||||
@@ -255,6 +260,12 @@ def main():
|
||||
help="Directory path to write a .rrd file when `--save 1` is set.",
|
||||
)
|
||||
|
||||
parser.add_argument(
|
||||
"--root",
|
||||
type=str,
|
||||
help="Root directory for a dataset stored on a local machine.",
|
||||
)
|
||||
|
||||
args = parser.parse_args()
|
||||
visualize_dataset(**vars(args))
|
||||
|
||||
|
||||
175
lerobot/scripts/visualize_image_transforms.py
Normal file
175
lerobot/scripts/visualize_image_transforms.py
Normal file
@@ -0,0 +1,175 @@
|
||||
#!/usr/bin/env python
|
||||
|
||||
# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
""" Visualize effects of image transforms for a given configuration.
|
||||
|
||||
This script will generate examples of transformed images as they are output by LeRobot dataset.
|
||||
Additionally, each individual transform can be visualized separately as well as examples of combined transforms
|
||||
|
||||
|
||||
--- Usage Examples ---
|
||||
|
||||
Increase hue jitter
|
||||
```
|
||||
python lerobot/scripts/visualize_image_transforms.py \
|
||||
dataset_repo_id=lerobot/aloha_mobile_shrimp \
|
||||
training.image_transforms.hue.min_max=[-0.25,0.25]
|
||||
```
|
||||
|
||||
Increase brightness & brightness weight
|
||||
```
|
||||
python lerobot/scripts/visualize_image_transforms.py \
|
||||
dataset_repo_id=lerobot/aloha_mobile_shrimp \
|
||||
training.image_transforms.brightness.weight=10.0 \
|
||||
training.image_transforms.brightness.min_max=[1.0,2.0]
|
||||
```
|
||||
|
||||
Blur images and disable saturation & hue
|
||||
```
|
||||
python lerobot/scripts/visualize_image_transforms.py \
|
||||
dataset_repo_id=lerobot/aloha_mobile_shrimp \
|
||||
training.image_transforms.sharpness.weight=10.0 \
|
||||
training.image_transforms.sharpness.min_max=[0.0,1.0] \
|
||||
training.image_transforms.saturation.weight=0.0 \
|
||||
training.image_transforms.hue.weight=0.0
|
||||
```
|
||||
|
||||
Use all transforms with random order
|
||||
```
|
||||
python lerobot/scripts/visualize_image_transforms.py \
|
||||
dataset_repo_id=lerobot/aloha_mobile_shrimp \
|
||||
training.image_transforms.max_num_transforms=5 \
|
||||
training.image_transforms.random_order=true
|
||||
```
|
||||
|
||||
"""
|
||||
|
||||
from pathlib import Path
|
||||
|
||||
import hydra
|
||||
from torchvision.transforms import ToPILImage
|
||||
|
||||
from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
|
||||
from lerobot.common.datasets.transforms import get_image_transforms
|
||||
|
||||
OUTPUT_DIR = Path("outputs/image_transforms")
|
||||
to_pil = ToPILImage()
|
||||
|
||||
|
||||
def save_config_all_transforms(cfg, original_frame, output_dir, n_examples):
|
||||
tf = get_image_transforms(
|
||||
brightness_weight=cfg.brightness.weight,
|
||||
brightness_min_max=cfg.brightness.min_max,
|
||||
contrast_weight=cfg.contrast.weight,
|
||||
contrast_min_max=cfg.contrast.min_max,
|
||||
saturation_weight=cfg.saturation.weight,
|
||||
saturation_min_max=cfg.saturation.min_max,
|
||||
hue_weight=cfg.hue.weight,
|
||||
hue_min_max=cfg.hue.min_max,
|
||||
sharpness_weight=cfg.sharpness.weight,
|
||||
sharpness_min_max=cfg.sharpness.min_max,
|
||||
max_num_transforms=cfg.max_num_transforms,
|
||||
random_order=cfg.random_order,
|
||||
)
|
||||
|
||||
output_dir_all = output_dir / "all"
|
||||
output_dir_all.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
for i in range(1, n_examples + 1):
|
||||
transformed_frame = tf(original_frame)
|
||||
to_pil(transformed_frame).save(output_dir_all / f"{i}.png", quality=100)
|
||||
|
||||
print("Combined transforms examples saved to:")
|
||||
print(f" {output_dir_all}")
|
||||
|
||||
|
||||
def save_config_single_transforms(cfg, original_frame, output_dir, n_examples):
|
||||
transforms = [
|
||||
"brightness",
|
||||
"contrast",
|
||||
"saturation",
|
||||
"hue",
|
||||
"sharpness",
|
||||
]
|
||||
print("Individual transforms examples saved to:")
|
||||
for transform in transforms:
|
||||
# Apply one transformation with random value in min_max range
|
||||
kwargs = {
|
||||
f"{transform}_weight": cfg[f"{transform}"].weight,
|
||||
f"{transform}_min_max": cfg[f"{transform}"].min_max,
|
||||
}
|
||||
tf = get_image_transforms(**kwargs)
|
||||
output_dir_single = output_dir / f"{transform}"
|
||||
output_dir_single.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
for i in range(1, n_examples + 1):
|
||||
transformed_frame = tf(original_frame)
|
||||
to_pil(transformed_frame).save(output_dir_single / f"{i}.png", quality=100)
|
||||
|
||||
# Apply min transformation
|
||||
min_value, max_value = cfg[f"{transform}"].min_max
|
||||
kwargs = {
|
||||
f"{transform}_weight": cfg[f"{transform}"].weight,
|
||||
f"{transform}_min_max": (min_value, min_value),
|
||||
}
|
||||
tf = get_image_transforms(**kwargs)
|
||||
transformed_frame = tf(original_frame)
|
||||
to_pil(transformed_frame).save(output_dir_single / "min.png", quality=100)
|
||||
|
||||
# Apply max transformation
|
||||
kwargs = {
|
||||
f"{transform}_weight": cfg[f"{transform}"].weight,
|
||||
f"{transform}_min_max": (max_value, max_value),
|
||||
}
|
||||
tf = get_image_transforms(**kwargs)
|
||||
transformed_frame = tf(original_frame)
|
||||
to_pil(transformed_frame).save(output_dir_single / "max.png", quality=100)
|
||||
|
||||
# Apply mean transformation
|
||||
mean_value = (min_value + max_value) / 2
|
||||
kwargs = {
|
||||
f"{transform}_weight": cfg[f"{transform}"].weight,
|
||||
f"{transform}_min_max": (mean_value, mean_value),
|
||||
}
|
||||
tf = get_image_transforms(**kwargs)
|
||||
transformed_frame = tf(original_frame)
|
||||
to_pil(transformed_frame).save(output_dir_single / "mean.png", quality=100)
|
||||
|
||||
print(f" {output_dir_single}")
|
||||
|
||||
|
||||
def visualize_transforms(cfg, output_dir: Path, n_examples: int = 5):
|
||||
dataset = LeRobotDataset(cfg.dataset_repo_id)
|
||||
|
||||
output_dir = output_dir / cfg.dataset_repo_id.split("/")[-1]
|
||||
output_dir.mkdir(parents=True, exist_ok=True)
|
||||
|
||||
# Get 1st frame from 1st camera of 1st episode
|
||||
original_frame = dataset[0][dataset.camera_keys[0]]
|
||||
to_pil(original_frame).save(output_dir / "original_frame.png", quality=100)
|
||||
print("\nOriginal frame saved to:")
|
||||
print(f" {output_dir / 'original_frame.png'}.")
|
||||
|
||||
save_config_all_transforms(cfg.training.image_transforms, original_frame, output_dir, n_examples)
|
||||
save_config_single_transforms(cfg.training.image_transforms, original_frame, output_dir, n_examples)
|
||||
|
||||
|
||||
@hydra.main(version_base="1.2", config_name="default", config_path="../configs")
|
||||
def visualize_transforms_cli(cfg):
|
||||
visualize_transforms(cfg, output_dir=OUTPUT_DIR)
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
visualize_transforms()
|
||||
1915
poetry.lock
generated
1915
poetry.lock
generated
File diff suppressed because it is too large
Load Diff
@@ -41,12 +41,13 @@ numba = ">=0.59.0"
|
||||
torch = "^2.2.1"
|
||||
opencv-python = ">=4.9.0"
|
||||
diffusers = "^0.27.2"
|
||||
torchvision = ">=0.18.0"
|
||||
torchvision = ">=0.17.1"
|
||||
h5py = ">=3.10.0"
|
||||
huggingface-hub = {extras = ["hf-transfer"], version = "^0.23.0"}
|
||||
gymnasium = ">=0.29.1"
|
||||
cmake = ">=3.29.0.1"
|
||||
gym-pusht = { version = ">=0.1.3", optional = true}
|
||||
gym-dora = { git = "https://github.com/dora-rs/dora-lerobot.git", subdirectory = "gym_dora", optional = true }
|
||||
gym-pusht = { version = ">=0.1.5", optional = true}
|
||||
gym-xarm = { version = ">=0.1.1", optional = true}
|
||||
gym-aloha = { version = ">=0.1.1", optional = true}
|
||||
pre-commit = {version = ">=3.7.0", optional = true}
|
||||
@@ -58,15 +59,21 @@ imagecodecs = { version = ">=2024.1.1", optional = true }
|
||||
pyav = ">=12.0.5"
|
||||
moviepy = ">=1.0.3"
|
||||
rerun-sdk = ">=0.15.1"
|
||||
deepdiff = ">=7.0.1"
|
||||
scikit-image = {version = "^0.23.2", optional = true}
|
||||
pandas = {version = "^2.2.2", optional = true}
|
||||
pytest-mock = {version = "^3.14.0", optional = true}
|
||||
|
||||
|
||||
[tool.poetry.extras]
|
||||
dora = ["gym-dora"]
|
||||
pusht = ["gym-pusht"]
|
||||
xarm = ["gym-xarm"]
|
||||
aloha = ["gym-aloha"]
|
||||
dev = ["pre-commit", "debugpy"]
|
||||
test = ["pytest", "pytest-cov"]
|
||||
test = ["pytest", "pytest-cov", "pytest-mock"]
|
||||
umi = ["imagecodecs"]
|
||||
video_benchmark = ["scikit-image", "pandas"]
|
||||
|
||||
[tool.ruff]
|
||||
line-length = 110
|
||||
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:d5883aa2c8ba2bcd8d047a77064112aa5d4c1c9b8595bb28935ec93ed53627e5
|
||||
oid sha256:52723265cba2ec839a5fcf75733813ecf91019ec0f7a49865fe233616e674583
|
||||
size 3056
|
||||
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:0eab443dd492d0e271094290ae3cec2c9b2f4a19d35434eb5952cb37b0d40890
|
||||
size 18272
|
||||
oid sha256:8552d4ac6b618a5b2741e174d51f1d4fc0e5f4e6cc7026bebdb6ed145373b042
|
||||
size 18320
|
||||
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:8c1a72239bb56a6c5714f18d849557c89feb858840e8f86689d017bb49551379
|
||||
oid sha256:a522c7815565f1f81a8bb5a853263405ab8c3b087ecbc7a3b004848891d77342
|
||||
size 247
|
||||
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:a1cd3db853d0f92e1696fe297c550200219d85befdeb5b5eacae4b10a74d9896
|
||||
size 136
|
||||
3
tests/data/lerobot/pusht_keypoints/meta_data/info.json
Normal file
3
tests/data/lerobot/pusht_keypoints/meta_data/info.json
Normal file
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:dbf25de102227dd2d8c3b6c61e1fc25a026d44f151161b88bc9a9eb101e942e4
|
||||
size 33
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:50b3c026da835560f9b87e7dfd28673e766bfb58d56c85002687d0a599b6fa43
|
||||
size 3304
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:958798d23a1690449744961f8c3ed934efe950c664e5fd729468959362840218
|
||||
size 20336
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:686d9d9bad8815d67597b997058d9853a04e5bdbe4eed038f4da9806f867af3d
|
||||
size 1098
|
||||
3
tests/data/lerobot/pusht_keypoints/train/state.json
Normal file
3
tests/data/lerobot/pusht_keypoints/train/state.json
Normal file
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:f22ee3500aca1bea0afdda429e841c57a3278dfea92c79bbbf5dac5f984ed648
|
||||
size 247
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:d9cc073bcb335024500fe7c823f142a3b4f038ff458d8c47fb6a6918f8f6d5fd
|
||||
oid sha256:b99bbb7332557d47b108fd0262d911c99f5bfce30fa3e76dc802b927284135e7
|
||||
size 111338
|
||||
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:58c50ef6413b6b3acb7ad280281cdd4eba553f7d3d0b4dad20c262025d610f2b
|
||||
oid sha256:0f63430455e1ca7a5fe28c81a15fc0eb82758035e6b3d623e7e7952e71cb262a
|
||||
size 111338
|
||||
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:bd1d26e983e2910ec170cd6ac1f4de4d7cb447ee24b516a74f42765d4894e048
|
||||
oid sha256:0b88c39db5b13da646fd5876bd765213569387591d30ec665d048ae1070db0b9
|
||||
size 111338
|
||||
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:e1247a9d4683520ed338f3fd410cc200999e4b82da573cd499095ba02037586f
|
||||
oid sha256:68eb245890f9537851ea7fb227472dcd4f1fa3820a7c3294a4989e2b9896d078
|
||||
size 111338
|
||||
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:b24f3c3d41428b768082eb3b02b5e22dc9540aa4dbe756d43be214d51e97adba
|
||||
oid sha256:00c74e17bbf7d428b0b0869f388d348820a938c417b3c888a1384980bb53d4d0
|
||||
size 111338
|
||||
|
||||
@@ -1,3 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:5301dc61b585fbfbdb6ce681ffcd52fc26b64a3767567c228a9e4404f7bcb926
|
||||
oid sha256:a5a7f66704640ba18f756fc44c00721c77a406f412a3a9fcc1a2b1868c978444
|
||||
size 111338
|
||||
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:1ae7f6a7f4ee8340ec73b0e7f1e167046af2af0a22381e0cd3ff42f311e098e0
|
||||
size 794
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:2eeb1b185b505450f8a2b6042537d65d2d8f5ee1396cf878a50d3d2aa3a22822
|
||||
size 794
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:7f2bb24887f9d4c49ad562429f419b7b66f4310a59877104a98d3c5c6ddca996
|
||||
size 794
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:a52fe583c816fdfb962111dd1ee1c113a5f4b9699246fab8648f89e056979f8e
|
||||
size 794
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:70dbf161581b860e255573eb1ef90f4defd134d8dcf0afea16099c859c4a8f85
|
||||
size 794
|
||||
@@ -0,0 +1,3 @@
|
||||
version https://git-lfs.github.com/spec/v1
|
||||
oid sha256:198abd0ec4231c13cadf707d553cba3860acbc74a073406ed184eab5495acdfa
|
||||
size 794
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user