Add test3 test4

Co-authored-by: jess-moss <jess.moss@huggingface.co>
Co-authored-by: Simon Alibert <75076266+aliberts@users.noreply.github.com>

.cache/calibration/aloha_default/left_follower.json

@@ -0,0 +1,68 @@
+{
+    "homing_offset": [
+        2048,
+        3072,
+        3072,
+        -1024,
+        -1024,
+        2048,
+        -2048,
+        2048,
+        -2048
+    ],
+    "drive_mode": [
+        1,
+        1,
+        1,
+        0,
+        0,
+        1,
+        0,
+        1,
+        0
+    ],
+    "start_pos": [
+        2015,
+        3058,
+        3061,
+        1071,
+        1071,
+        2035,
+        2152,
+        2029,
+        2499
+    ],
+    "end_pos": [
+        -1008,
+        -1963,
+        -1966,
+        2141,
+        2143,
+        -971,
+        3043,
+        -1077,
+        3144
+    ],
+    "calib_mode": [
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "LINEAR"
+    ],
+    "motor_names": [
+        "waist",
+        "shoulder",
+        "shoulder_shadow",
+        "elbow",
+        "elbow_shadow",
+        "forearm_roll",
+        "wrist_angle",
+        "wrist_rotate",
+        "gripper"
+    ]
+}

.cache/calibration/aloha_default/left_leader.json

@@ -0,0 +1,68 @@
+{
+    "homing_offset": [
+        2048,
+        3072,
+        3072,
+        -1024,
+        -1024,
+        2048,
+        -2048,
+        2048,
+        -1024
+    ],
+    "drive_mode": [
+        1,
+        1,
+        1,
+        0,
+        0,
+        1,
+        0,
+        1,
+        0
+    ],
+    "start_pos": [
+        2035,
+        3024,
+        3019,
+        979,
+        981,
+        1982,
+        2166,
+        2124,
+        1968
+    ],
+    "end_pos": [
+        -990,
+        -2017,
+        -2015,
+        2078,
+        2076,
+        -1030,
+        3117,
+        -1016,
+        2556
+    ],
+    "calib_mode": [
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "LINEAR"
+    ],
+    "motor_names": [
+        "waist",
+        "shoulder",
+        "shoulder_shadow",
+        "elbow",
+        "elbow_shadow",
+        "forearm_roll",
+        "wrist_angle",
+        "wrist_rotate",
+        "gripper"
+    ]
+}

.cache/calibration/aloha_default/right_follower.json

@@ -0,0 +1,68 @@
+{
+    "homing_offset": [
+        2048,
+        3072,
+        3072,
+        -1024,
+        -1024,
+        2048,
+        -2048,
+        2048,
+        -2048
+    ],
+    "drive_mode": [
+        1,
+        1,
+        1,
+        0,
+        0,
+        1,
+        0,
+        1,
+        0
+    ],
+    "start_pos": [
+        2056,
+        2895,
+        2896,
+        1191,
+        1190,
+        2018,
+        2051,
+        2056,
+        2509
+    ],
+    "end_pos": [
+        -1040,
+        -2004,
+        -2006,
+        2126,
+        2127,
+        -1010,
+        3050,
+        -1117,
+        3143
+    ],
+    "calib_mode": [
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "LINEAR"
+    ],
+    "motor_names": [
+        "waist",
+        "shoulder",
+        "shoulder_shadow",
+        "elbow",
+        "elbow_shadow",
+        "forearm_roll",
+        "wrist_angle",
+        "wrist_rotate",
+        "gripper"
+    ]
+}

.cache/calibration/aloha_default/right_leader.json

@@ -0,0 +1,68 @@
+{
+    "homing_offset": [
+        2048,
+        3072,
+        3072,
+        -1024,
+        -1024,
+        2048,
+        -2048,
+        2048,
+        -2048
+    ],
+    "drive_mode": [
+        1,
+        1,
+        1,
+        0,
+        0,
+        1,
+        0,
+        1,
+        0
+    ],
+    "start_pos": [
+        2068,
+        3034,
+        3030,
+        1038,
+        1041,
+        1991,
+        1948,
+        2090,
+        1985
+    ],
+    "end_pos": [
+        -1025,
+        -2014,
+        -2015,
+        2058,
+        2060,
+        -955,
+        3091,
+        -940,
+        2576
+    ],
+    "calib_mode": [
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "DEGREE",
+        "LINEAR"
+    ],
+    "motor_names": [
+        "waist",
+        "shoulder",
+        "shoulder_shadow",
+        "elbow",
+        "elbow_shadow",
+        "forearm_roll",
+        "wrist_angle",
+        "wrist_rotate",
+        "gripper"
+    ]
+}

.dockerignore

@@ -0,0 +1,146 @@
+# Misc
+.git
+tmp
+wandb
+data
+outputs
+.vscode
+rl
+media
+
+
+# Logging
+logs
+
+# HPC
+nautilus/*.yaml
+*.key
+
+# Slurm
+sbatch*.sh
+
+# Byte-compiled / optimized / DLL files
+__pycache__/
+*.py[cod]
+*$py.class
+
+# C extensions
+*.so
+
+# Distribution / packaging
+.Python
+build/
+develop-eggs/
+dist/
+downloads/
+eggs/
+.eggs/
+lib/
+lib64/
+parts/
+sdist/
+var/
+wheels/
+pip-wheel-metadata/
+share/python-wheels/
+*.egg-info/
+.installed.cfg
+*.egg
+MANIFEST
+
+# PyInstaller
+#  Usually these files are written by a python script from a template
+#  before PyInstaller builds the exe, so as to inject date/other infos into it.
+*.manifest
+*.spec
+
+# Installer logs
+pip-log.txt
+pip-delete-this-directory.txt
+
+# Unit test / coverage reports
+!tests/data
+htmlcov/
+.tox/
+.nox/
+.coverage
+.coverage.*
+nosetests.xml
+coverage.xml
+*.cover
+*.py,cover
+.hypothesis/
+.pytest_cache/
+
+# Ignore .cache except calibration
+.cache/*
+!.cache/calibration/
+!.cache/calibration/**
+
+# Translations
+*.mo
+*.pot
+
+# Django stuff:
+*.log
+local_settings.py
+db.sqlite3
+db.sqlite3-journal
+
+# Flask stuff:
+instance/
+.webassets-cache
+
+# Scrapy stuff:
+.scrapy
+
+# Sphinx documentation
+docs/_build/
+
+# PyBuilder
+target/
+
+# Jupyter Notebook
+.ipynb_checkpoints
+
+# IPython
+profile_default/
+ipython_config.py
+
+# pyenv
+.python-version
+
+# pipenv
+#   According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control.
+#   However, in case of collaboration, if having platform-specific dependencies or dependencies
+#   having no cross-platform support, pipenv may install dependencies that don't work, or not
+#   install all needed dependencies.
+#Pipfile.lock
+
+# PEP 582; used by e.g. github.com/David-OConnor/pyflow
+__pypackages__/
+
+# Celery stuff
+celerybeat-schedule
+celerybeat.pid
+
+# SageMath parsed files
+*.sage.py
+
+# Spyder project settings
+.spyderproject
+.spyproject
+
+# Rope project settings
+.ropeproject
+
+# mkdocs documentation
+/site
+
+# mypy
+.mypy_cache/
+.dmypy.json
+dmypy.json
+
+# Pyre type checker
+.pyre/

.gitattributes

@@ -1 +1,6 @@
 *.memmap filter=lfs diff=lfs merge=lfs -text
+*.stl filter=lfs diff=lfs merge=lfs -text
+*.safetensors filter=lfs diff=lfs merge=lfs -text
+*.mp4 filter=lfs diff=lfs merge=lfs -text
+*.arrow filter=lfs diff=lfs merge=lfs -text
+*.json !text !filter !merge !diff

.github/ISSUE_TEMPLATE/bug-report.yml

@@ -0,0 +1,54 @@
+name: "\U0001F41B Bug Report"
+description: Submit a bug report to help us improve LeRobot
+body:
+  - type: markdown
+    attributes:
+      value: |
+        Thanks for taking the time to submit a bug report! 🐛
+        If this is not a bug related to the LeRobot library directly, but instead a general question about your code or the library specifically please use our [discord](https://discord.gg/s3KuuzsPFb).
+
+  - type: textarea
+    id: system-info
+    attributes:
+      label: System Info
+      description: If needed, you can share your lerobot configuration with us by running `python -m lerobot.scripts.display_sys_info` and copy-pasting its outputs below
+      render: Shell
+      placeholder: lerobot version, OS, python version, numpy version, torch version, and lerobot's configuration
+    validations:
+      required: true
+
+  - type: checkboxes
+    id: information-scripts-examples
+    attributes:
+      label: Information
+      description: 'The problem arises when using:'
+      options:
+        - label: "One of the scripts in the examples/ folder of LeRobot"
+        - label: "My own task or dataset (give details below)"
+
+  - type: textarea
+    id: reproduction
+    validations:
+      required: true
+    attributes:
+      label: Reproduction
+      description: |
+        If needed, provide a simple code sample that reproduces the problem you ran into. It can be a Colab link or just a code snippet.
+        Sharing error messages or stack traces could be useful as well!
+        Important! Use code tags to correctly format your code. See https://help.github.com/en/github/writing-on-github/creating-and-highlighting-code-blocks#syntax-highlighting
+        Try to avoid screenshots, as they are hard to read and don't allow copy-and-pasting.
+
+      placeholder: |
+        Steps to reproduce the behavior:
+
+          1.
+          2.
+          3.
+
+  - type: textarea
+    id: expected-behavior
+    validations:
+      required: true
+    attributes:
+      label: Expected behavior
+      description: "A clear and concise description of what you would expect to happen."

.github/PULL_REQUEST_TEMPLATE.md

@@ -0,0 +1,34 @@
+## What this does
+Explain what this PR does. Feel free to tag your PR with the appropriate label(s).
+
+Examples:
+|  Title               | Label           |
+|----------------------|-----------------|
+| Fixes #[issue]       | (🐛 Bug)        |
+| Adds new dataset     | (🗃️ Dataset)    |
+| Optimizes something  | (⚡️ Performance) |
+
+## How it was tested
+Explain/show how you tested your changes.
+
+Examples:
+- Added `test_something` in `tests/test_stuff.py`.
+- Added `new_feature` and checked that training converges with policy X on dataset/environment Y.
+- Optimized `some_function`, it now runs X times faster than previously.
+
+## How to checkout & try? (for the reviewer)
+Provide a simple way for the reviewer to try out your changes.
+
+Examples:
+```bash
+DATA_DIR=tests/data pytest -sx tests/test_stuff.py::test_something
+```
+```bash
+python lerobot/scripts/train.py --some.option=true
+```
+
+## SECTION TO REMOVE BEFORE SUBMITTING YOUR PR
+**Note**: Anyone in the community is free to review the PR once the tests have passed. Feel free to tag
+members/contributors who may be interested in your PR. Try to avoid tagging more than 3 people.
+
+**Note**: Before submitting this PR, please read the [contributor guideline](https://github.com/huggingface/lerobot/blob/main/CONTRIBUTING.md#submitting-a-pull-request-pr).

.github/poetry/cpu/pyproject.toml

@@ -1,107 +0,0 @@
-[tool.poetry]
-name = "lerobot"
-version = "0.1.0"
-description = "Le robot is learning"
-authors = [
-    "Rémi Cadène <re.cadene@gmail.com>",
-    "Simon Alibert <alibert.sim@gmail.com>",
-]
-repository = "https://github.com/Cadene/lerobot"
-readme = "README.md"
-license = "MIT"
-classifiers=[
-    "Development Status :: 3 - Alpha",
-    "Intended Audience :: Developers",
-    "Topic :: Software Development :: Build Tools",
-    "License :: OSI Approved :: MIT License",
-    "Programming Language :: Python :: 3.10",
-]
-packages = [{include = "lerobot"}]
-
-
-[tool.poetry.dependencies]
-python = "^3.10"
-cython = "^3.0.8"
-termcolor = "^2.4.0"
-omegaconf = "^2.3.0"
-dm-env = "^1.6"
-pandas = "^2.2.1"
-wandb = "^0.16.3"
-moviepy = "^1.0.3"
-imageio = {extras = ["pyav"], version = "^2.34.0"}
-gdown = "^5.1.0"
-hydra-core = "^1.3.2"
-einops = "^0.7.0"
-pygame = "^2.5.2"
-pymunk = "^6.6.0"
-zarr = "^2.17.0"
-shapely = "^2.0.3"
-scikit-image = "^0.22.0"
-numba = "^0.59.0"
-mpmath = "^1.3.0"
-torch = {version = "^2.2.1", source = "torch-cpu"}
-tensordict = {git = "https://github.com/pytorch/tensordict"}
-torchrl = {git = "https://github.com/pytorch/rl", rev = "13bef426dcfa5887c6e5034a6e9697993fa92c37"}
-mujoco = "^3.1.2"
-mujoco-py = "^2.1.2.14"
-gym = "^0.26.2"
-opencv-python = "^4.9.0.80"
-diffusers = "^0.26.3"
-torchvision = {version = "^0.17.1", source = "torch-cpu"}
-h5py = "^3.10.0"
-dm = "^1.3"
-dm-control = "^1.0.16"
-huggingface-hub = "^0.21.4"
-
-
-[tool.poetry.group.dev.dependencies]
-pre-commit = "^3.6.2"
-debugpy = "^1.8.1"
-pytest = "^8.1.0"
-
-
-[[tool.poetry.source]]
-name = "torch-cpu"
-url = "https://download.pytorch.org/whl/cpu"
-priority = "supplemental"
-
-
-[tool.ruff]
-line-length = 110
-target-version = "py310"
-exclude = [
-    ".bzr",
-    ".direnv",
-    ".eggs",
-    ".git",
-    ".git-rewrite",
-    ".hg",
-    ".mypy_cache",
-    ".nox",
-    ".pants.d",
-    ".pytype",
-    ".ruff_cache",
-    ".svn",
-    ".tox",
-    ".venv",
-    "__pypackages__",
-    "_build",
-    "buck-out",
-    "build",
-    "dist",
-    "node_modules",
-    "venv",
-]
-
-
-[tool.ruff.lint]
-select = ["E4", "E7", "E9", "F", "I", "N", "B", "C4", "SIM"]
-
-
-[tool.poetry-dynamic-versioning]
-enable = true
-
-
-[build-system]
-requires = ["poetry-core>=1.0.0", "poetry-dynamic-versioning>=1.0.0,<2.0.0"]
-build-backend = "poetry_dynamic_versioning.backend"

.github/workflows/build-docker-images.yml

@@ -0,0 +1,109 @@
+# Inspired by
+# https://github.com/huggingface/peft/blob/main/.github/workflows/build_docker_images.yml
+name: Builds
+
+on:
+  workflow_dispatch:
+  workflow_call:
+  schedule:
+    - cron: "0 1 * * *"
+
+env:
+  PYTHON_VERSION: "3.10"
+
+jobs:
+  latest-cpu:
+    name: CPU
+    runs-on:
+      group: aws-general-8-plus
+    steps:
+      - name: Install Git LFS
+        run: |
+          sudo apt-get update
+          sudo apt-get install git-lfs
+          git lfs install
+
+      - name: Set up Docker Buildx
+        uses: docker/setup-buildx-action@v3
+
+      - name: Check out code
+        uses: actions/checkout@v4
+        with:
+          lfs: true
+
+      - name: Login to DockerHub
+        uses: docker/login-action@v3
+        with:
+          username: ${{ secrets.DOCKERHUB_USERNAME }}
+          password: ${{ secrets.DOCKERHUB_PASSWORD }}
+
+      - name: Build and Push CPU
+        uses: docker/build-push-action@v5
+        with:
+          context: .
+          file: ./docker/lerobot-cpu/Dockerfile
+          push: true
+          tags: huggingface/lerobot-cpu
+          build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
+
+
+  latest-cuda:
+    name: GPU
+    runs-on:
+      group: aws-general-8-plus
+    steps:
+      - name: Install Git LFS
+        run: |
+          sudo apt-get update
+          sudo apt-get install git-lfs
+          git lfs install
+
+      - name: Set up Docker Buildx
+        uses: docker/setup-buildx-action@v3
+
+      - name: Check out code
+        uses: actions/checkout@v4
+        with:
+          lfs: true
+
+      - name: Login to DockerHub
+        uses: docker/login-action@v3
+        with:
+          username: ${{ secrets.DOCKERHUB_USERNAME }}
+          password: ${{ secrets.DOCKERHUB_PASSWORD }}
+
+      - name: Build and Push GPU
+        uses: docker/build-push-action@v5
+        with:
+          context: .
+          file: ./docker/lerobot-gpu/Dockerfile
+          push: true
+          tags: huggingface/lerobot-gpu
+          build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}
+
+
+  latest-cuda-dev:
+    name: GPU Dev
+    runs-on:
+      group: aws-general-8-plus
+    steps:
+      - name: Set up Docker Buildx
+        uses: docker/setup-buildx-action@v3
+
+      - name: Check out code
+        uses: actions/checkout@v4
+
+      - name: Login to DockerHub
+        uses: docker/login-action@v3
+        with:
+          username: ${{ secrets.DOCKERHUB_USERNAME }}
+          password: ${{ secrets.DOCKERHUB_PASSWORD }}
+
+      - name: Build and Push GPU dev
+        uses: docker/build-push-action@v5
+        with:
+          context: .
+          file: ./docker/lerobot-gpu-dev/Dockerfile
+          push: true
+          tags: huggingface/lerobot-gpu:dev
+          build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}

.github/workflows/nightly-tests.yml

@@ -0,0 +1,83 @@
+# Inspired by
+# https://github.com/huggingface/peft/blob/main/.github/workflows/nightly.yml
+name: Nightly
+
+on:
+  workflow_dispatch:
+  schedule:
+    - cron: "0 2 * * *"
+
+env:
+  DATA_DIR: tests/data
+  # SLACK_API_TOKEN: ${{ secrets.SLACK_API_TOKEN }}
+
+jobs:
+  run_all_tests_cpu:
+    name: CPU
+    strategy:
+      fail-fast: false
+    runs-on:
+      group: aws-general-8-plus
+    container:
+      image: huggingface/lerobot-cpu:latest
+      options: --shm-size "16gb"
+      credentials:
+        username: ${{ secrets.DOCKERHUB_USERNAME }}
+        password: ${{ secrets.DOCKERHUB_PASSWORD }}
+    defaults:
+      run:
+        shell: bash
+        working-directory: /lerobot
+    steps:
+      - name: Tests
+        env:
+          DATA_DIR: tests/data
+        run: pytest -v --cov=./lerobot --disable-warnings tests
+
+      - name: Tests end-to-end
+        env:
+          DATA_DIR: tests/data
+        run: make test-end-to-end
+
+
+  run_all_tests_single_gpu:
+    name: GPU
+    strategy:
+      fail-fast: false
+    runs-on:
+      group: aws-g6-4xlarge-plus
+    env:
+      CUDA_VISIBLE_DEVICES: "0"
+      TEST_TYPE: "single_gpu"
+    container:
+      image: huggingface/lerobot-gpu:latest
+      options: --gpus all --shm-size "16gb"
+      credentials:
+        username: ${{ secrets.DOCKERHUB_USERNAME }}
+        password: ${{ secrets.DOCKERHUB_PASSWORD }}
+    defaults:
+      run:
+        shell: bash
+        working-directory: /lerobot
+    steps:
+      - name: Nvidia-smi
+        run: nvidia-smi
+
+      - name: Test
+        run: pytest -v --cov=./lerobot --cov-report=xml --disable-warnings tests
+      #   TODO(aliberts): Link with HF Codecov account
+      # - name: Upload coverage reports to Codecov with GitHub Action
+      #   uses: codecov/codecov-action@v4
+      #   with:
+      #     files: ./coverage.xml
+      #     verbose: true
+      - name: Tests end-to-end
+        env:
+          DEVICE: cuda
+        run: make test-end-to-end
+
+    #   - name: Generate Report
+    #     if: always()
+    #     run: |
+    #       pip install slack_sdk tabulate
+    #       python scripts/log_reports.py >> $GITHUB_STEP_SUMMARY

.github/workflows/quality.yml

@@ -0,0 +1,84 @@
+name: Quality
+
+on:
+  workflow_dispatch:
+  workflow_call:
+  pull_request:
+    branches:
+      - main
+  push:
+    branches:
+      - main
+
+env:
+  PYTHON_VERSION: "3.10"
+
+jobs:
+  style:
+    name: Style
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout Repository
+        uses: actions/checkout@v3
+
+      - name: Set up Python
+        uses: actions/setup-python@v4
+        with:
+          python-version: ${{ env.PYTHON_VERSION }}
+
+      - name: Get Ruff Version from pre-commit-config.yaml
+        id: get-ruff-version
+        run: |
+          RUFF_VERSION=$(awk '/repo: https:\/\/github.com\/astral-sh\/ruff-pre-commit/{flag=1;next}/rev:/{if(flag){print $2;exit}}' .pre-commit-config.yaml)
+          echo "RUFF_VERSION=${RUFF_VERSION}" >> $GITHUB_ENV
+
+      - name: Install Ruff
+        run: python -m pip install "ruff==${{ env.RUFF_VERSION }}"
+
+      - name: Ruff check
+        run: ruff check
+
+      - name: Ruff format
+        run: ruff format --diff
+
+
+  poetry_check:
+    name: Poetry check
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout Repository
+        uses: actions/checkout@v3
+
+      - name: Install poetry
+        run: pipx install poetry
+
+      - name: Poetry check
+        run: poetry check
+
+
+  poetry_relax:
+    name: Poetry relax
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout Repository
+        uses: actions/checkout@v3
+
+      - name: Install poetry
+        run: pipx install poetry
+
+      - name: Install poetry-relax
+        run: poetry self add poetry-relax
+
+      - name: Poetry relax
+        id: poetry_relax
+        run: |
+          output=$(poetry relax --check 2>&1)
+          if echo "$output" | grep -q "Proposing updates"; then
+            echo "$output"
+            echo ""
+            echo "Some dependencies have caret '^' version requirement added by poetry by default."
+            echo "Please replace them with '>='. You can do this by hand or use poetry-relax to do this."
+            exit 1
+          else
+            echo "$output"
+          fi

.github/workflows/test-docker-build.yml

@@ -0,0 +1,65 @@
+# Inspired by
+# https://github.com/huggingface/peft/blob/main/.github/workflows/test-docker-build.yml
+name: Test Dockerfiles
+
+on:
+  pull_request:
+    branches:
+      - main
+    paths:
+      # Run only when DockerFile files are modified
+      - "docker/**"
+
+env:
+  PYTHON_VERSION: "3.10"
+
+jobs:
+  get_changed_files:
+    name: Detect modified Dockerfiles
+    runs-on: ubuntu-latest
+    outputs:
+      matrix: ${{ steps.set-matrix.outputs.matrix }}
+    steps:
+      - name: Check out code
+        uses: actions/checkout@v4
+
+      - name: Get changed files
+        id: changed-files
+        uses: tj-actions/changed-files@v44
+        with:
+          files: docker/**
+          json: "true"
+
+      - name: Run step if only the files listed above change
+        if: steps.changed-files.outputs.any_changed == 'true'
+        id: set-matrix
+        env:
+          ALL_CHANGED_FILES: ${{ steps.changed-files.outputs.all_changed_files }}
+        run: |
+          echo "matrix=${{ steps.changed-files.outputs.all_changed_files}}" >> $GITHUB_OUTPUT
+
+
+  build_modified_dockerfiles:
+    name: Build modified Docker images
+    needs: get_changed_files
+    runs-on:
+      group: aws-general-8-plus
+    if: ${{ needs.get_changed_files.outputs.matrix }} != ''
+    strategy:
+      fail-fast: false
+      matrix:
+        docker-file: ${{ fromJson(needs.get_changed_files.outputs.matrix) }}
+    steps:
+      - name: Set up Docker Buildx
+        uses: docker/setup-buildx-action@v3
+
+      - name: Check out code
+        uses: actions/checkout@v4
+
+      - name: Build Docker image
+        uses: docker/build-push-action@v5
+        with:
+          file: ${{ matrix.docker-file }}
+          context: .
+          push: False
+          build-args: PYTHON_VERSION=${{ env.PYTHON_VERSION }}

.github/workflows/test.yml

@@ -1,144 +1,142 @@
-name: Test
+name: Tests
 
 on:
   pull_request:
     branches:
       - main
-    types: [opened, synchronize, reopened, labeled]
+    paths:
+      - "lerobot/**"
+      - "tests/**"
+      - "examples/**"
+      - ".github/**"
+      - "poetry.lock"
+      - "Makefile"
+      - ".cache/**"
   push:
     branches:
       - main
+    paths:
+      - "lerobot/**"
+      - "tests/**"
+      - "examples/**"
+      - ".github/**"
+      - "poetry.lock"
+      - "Makefile"
+      - ".cache/**"
 
 jobs:
-  test:
-    if: |
-      ${{ github.event_name == 'pull_request' && contains(github.event.pull_request.labels.*.name, 'CI') }} ||
-      ${{ github.event_name == 'push' }}
+  pytest:
+    name: Pytest
     runs-on: ubuntu-latest
     env:
-      POETRY_VERSION: 1.8.1
       DATA_DIR: tests/data
-      TMPDIR: ~/tmp
-      TEMP: ~/tmp
-      TMP: ~/tmp
-      PYOPENGL_PLATFORM: egl
       MUJOCO_GL: egl
-      LEROBOT_TESTS_DEVICE: cpu
     steps:
-      #----------------------------------------------
-      #       check-out repo and set-up python
-      #----------------------------------------------
-      - name: Check out repository
-        uses: actions/checkout@v4
+      - uses: actions/checkout@v4
         with:
-          lfs: true
+          lfs: true  # Ensure LFS files are pulled
 
-      - name: Set up python
-        id: setup-python
+      - name: Install apt dependencies
+      # portaudio19-dev is needed to install pyaudio
+        run: |
+          sudo apt-get update && \
+          sudo apt-get install -y libegl1-mesa-dev ffmpeg portaudio19-dev
+
+      - name: Install poetry
+        run: |
+          pipx install poetry && poetry config virtualenvs.in-project true
+          echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
+
+      # TODO(rcadene, aliberts): python 3.12 seems to be used in the tests, not python 3.10
+      - name: Set up Python 3.10
         uses: actions/setup-python@v5
         with:
-          python-version: '3.10'
+          python-version: "3.10"
+          cache: "poetry"
 
-      #----------------------------------------------
-      #         install & configure poetry
-      #----------------------------------------------
-      - name: Load cached Poetry installation
-        id: restore-poetry-cache
-        uses: actions/cache/restore@v3
-        with:
-          path: ~/.local
-          key: poetry-${{ env.POETRY_VERSION }}
-
-      - name: Install Poetry
-        if: steps.restore-poetry-cache.outputs.cache-hit != 'true'
-        uses: snok/install-poetry@v1
-        with:
-          version: ${{ env.POETRY_VERSION }}
-          virtualenvs-create: true
-          installer-parallel: true
-
-      - name: Save cached Poetry installation
-        if: |
-          steps.restore-poetry-cache.outputs.cache-hit != 'true' &&
-          github.ref_name == 'main'
-        id: save-poetry-cache
-        uses: actions/cache/save@v3
-        with:
-          path: ~/.local
-          key: poetry-${{ env.POETRY_VERSION }}
-
-      - name: Configure Poetry
-        run: poetry config virtualenvs.in-project true
-
-      #----------------------------------------------
-      #           install dependencies
-      #----------------------------------------------
-      # TODO(aliberts): move to gpu runners
-      - name: Select cpu dependencies  # HACK
-        run: cp -t . .github/poetry/cpu/pyproject.toml .github/poetry/cpu/poetry.lock
-
-      - name: Load cached venv
-        id: restore-dependencies-cache
-        uses: actions/cache/restore@v3
-        with:
-          path: .venv
-          key: venv-${{ steps.setup-python.outputs.python-version }}-${{ env.POETRY_VERSION }}-${{ hashFiles('**/poetry.lock') }}
-
-      - name: Install dependencies
-        if: steps.restore-dependencies-cache.outputs.cache-hit != 'true'
+      - name: Install poetry dependencies
         run: |
-          mkdir ~/tmp
-          poetry install --no-interaction --no-root
+          poetry install --all-extras
 
-      - name: Save cached venv
-        if: |
-            steps.restore-dependencies-cache.outputs.cache-hit != 'true' &&
-            github.ref_name == 'main'
-        id: save-dependencies-cache
-        uses: actions/cache/save@v3
+      - name: Test with pytest
+        run: |
+          pytest tests -v --cov=./lerobot --durations=0 \
+            -W ignore::DeprecationWarning:imageio_ffmpeg._utils:7 \
+            -W ignore::UserWarning:torch.utils.data.dataloader:558 \
+            -W ignore::UserWarning:gymnasium.utils.env_checker:247 \
+            && rm -rf tests/outputs outputs
+
+  pytest-minimal:
+    name: Pytest (minimal install)
+    runs-on: ubuntu-latest
+    env:
+      DATA_DIR: tests/data
+      MUJOCO_GL: egl
+    steps:
+      - uses: actions/checkout@v4
         with:
-          path: .venv
-          key: venv-${{ steps.setup-python.outputs.python-version }}-${{ env.POETRY_VERSION }}-${{ hashFiles('**/poetry.lock') }}
+          lfs: true  # Ensure LFS files are pulled
 
-      - name: Install libegl1-mesa-dev (to use MUJOCO_GL=egl)
-        run: sudo apt-get update && sudo apt-get install -y libegl1-mesa-dev
+      - name: Install apt dependencies
+        run: sudo apt-get update && sudo apt-get install -y ffmpeg
 
-      #----------------------------------------------
-      #             install project
-      #----------------------------------------------
-      - name: Install project
-        run: poetry install --no-interaction
-
-      #----------------------------------------------
-      #               run tests
-      #----------------------------------------------
-      - name: Run tests
+      - name: Install poetry
         run: |
-          source .venv/bin/activate
-          pytest tests
+          pipx install poetry && poetry config virtualenvs.in-project true
+          echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
 
-      - name: Test train pusht end-to-end
-        run: |
-          source .venv/bin/activate
-          python lerobot/scripts/train.py \
-            hydra.job.name=pusht \
-            env=pusht \
-            wandb.enable=False \
-            offline_steps=2 \
-            online_steps=0 \
-            device=cpu \
-            save_model=true \
-            save_freq=1 \
-            hydra.run.dir=tests/outputs/
+      # TODO(rcadene, aliberts): python 3.12 seems to be used in the tests, not python 3.10
+      - name: Set up Python 3.10
+        uses: actions/setup-python@v5
+        with:
+          python-version: "3.10"
 
-      - name: Test eval pusht end-to-end
+      - name: Install poetry dependencies
         run: |
-          source .venv/bin/activate
-          python lerobot/scripts/eval.py \
-            hydra.job.name=pusht \
-            env=pusht \
-            wandb.enable=False \
-            eval_episodes=1 \
-            env.episode_length=8 \
-            device=cpu \
-            policy.pretrained_model_path=tests/outputs/models/1.pt
+          poetry install --extras "test"
+
+      - name: Test with pytest
+        run: |
+          pytest tests -v --cov=./lerobot --durations=0 \
+            -W ignore::DeprecationWarning:imageio_ffmpeg._utils:7 \
+            -W ignore::UserWarning:torch.utils.data.dataloader:558 \
+            -W ignore::UserWarning:gymnasium.utils.env_checker:247 \
+            && rm -rf tests/outputs outputs
+
+
+  end-to-end:
+    name: End-to-end
+    runs-on: ubuntu-latest
+    env:
+      DATA_DIR: tests/data
+      MUJOCO_GL: egl
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          lfs: true  # Ensure LFS files are pulled
+
+      - name: Install apt dependencies
+      # portaudio19-dev is needed to install pyaudio
+        run: |
+          sudo apt-get update && \
+          sudo apt-get install -y libegl1-mesa-dev portaudio19-dev
+
+      - name: Install poetry
+        run: |
+          pipx install poetry && poetry config virtualenvs.in-project true
+          echo "${{ github.workspace }}/.venv/bin" >> $GITHUB_PATH
+
+      - name: Set up Python 3.10
+        uses: actions/setup-python@v5
+        with:
+          python-version: "3.10"
+          cache: "poetry"
+
+      - name: Install poetry dependencies
+        run: |
+          poetry install --all-extras
+
+      - name: Test end-to-end
+        run: |
+          make test-end-to-end \
+            && rm -rf outputs

.github/workflows/trufflehog.yml

@@ -0,0 +1,20 @@
+on:
+  push:
+
+name: Secret Leaks
+
+permissions:
+  contents: read
+
+jobs:
+  trufflehog:
+    runs-on: ubuntu-latest
+    steps:
+    - name: Checkout code
+      uses: actions/checkout@v4
+      with:
+        fetch-depth: 0
+    - name: Secret Scanning
+      uses: trufflesecurity/trufflehog@main
+      with:
+        extra_args: --only-verified

.gitignore

@@ -2,15 +2,24 @@
 logs
 tmp
 wandb
+
+# Data
 data
 outputs
+
+# Apple
+.DS_Store
+
+# VS Code
 .vscode
-rl
 
 # HPC
 nautilus/*.yaml
 *.key
 
+# Slurm
+sbatch*.sh
+
 # Byte-compiled / optimized / DLL files
 __pycache__/
 *.py[cod]
@@ -57,7 +66,6 @@ htmlcov/
 .nox/
 .coverage
 .coverage.*
-.cache
 nosetests.xml
 coverage.xml
 *.cover
@@ -65,6 +73,11 @@ coverage.xml
 .hypothesis/
 .pytest_cache/
 
+# Ignore .cache except calibration
+.cache/*
+!.cache/calibration/
+!.cache/calibration/**
+
 # Translations
 *.mo
 *.pot
@@ -86,6 +99,7 @@ instance/
 docs/_build/
 
 # PyBuilder
+.pybuilder/
 target/
 
 # Jupyter Notebook
@@ -98,13 +112,6 @@ ipython_config.py
 # pyenv
 .python-version
 
-# pipenv
-#   According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control.
-#   However, in case of collaboration, if having platform-specific dependencies or dependencies
-#   having no cross-platform support, pipenv may install dependencies that don't work, or not
-#   install all needed dependencies.
-#Pipfile.lock
-
 # PEP 582; used by e.g. github.com/David-OConnor/pyflow
 __pypackages__/
 
@@ -115,6 +122,14 @@ celerybeat.pid
 # SageMath parsed files
 *.sage.py
 
+# Environments
+.env
+.venv
+env/
+venv/
+env.bak/
+venv.bak/
+
 # Spyder project settings
 .spyderproject
 .spyproject
@@ -132,3 +147,9 @@ dmypy.json
 
 # Pyre type checker
 .pyre/
+
+# pytype static type analyzer
+.pytype/
+
+# Cython debug symbols
+cython_debug/

.pre-commit-config.yaml

@@ -1,9 +1,9 @@
-exclude: ^(data/|tests/)
+exclude: ^(tests/data)
 default_language_version:
     python: python3.10
 repos:
   - repo: https://github.com/pre-commit/pre-commit-hooks
-    rev: v4.5.0
+    rev: v4.6.0
     hooks:
       - id: check-added-large-files
       - id: debug-statements
@@ -14,11 +14,11 @@ repos:
       - id: end-of-file-fixer
       - id: trailing-whitespace
   - repo: https://github.com/asottile/pyupgrade
-    rev: v3.15.1
+    rev: v3.16.0
     hooks:
     -   id: pyupgrade
   - repo: https://github.com/astral-sh/ruff-pre-commit
-    rev: v0.2.2
+    rev: v0.5.2
     hooks:
       - id: ruff
         args: [--fix]
@@ -31,3 +31,7 @@ repos:
         args:
           - "--check"
           - "--no-update"
+  - repo: https://github.com/gitleaks/gitleaks
+    rev: v8.18.4
+    hooks:
+      - id: gitleaks

CODE_OF_CONDUCT.md

@@ -0,0 +1,133 @@
+
+# Contributor Covenant Code of Conduct
+
+## Our Pledge
+
+We as members, contributors, and leaders pledge to make participation in our
+community a harassment-free experience for everyone, regardless of age, body
+size, visible or invisible disability, ethnicity, sex characteristics, gender
+identity and expression, level of experience, education, socio-economic status,
+nationality, personal appearance, race, caste, color, religion, or sexual
+identity and orientation.
+
+We pledge to act and interact in ways that contribute to an open, welcoming,
+diverse, inclusive, and healthy community.
+
+## Our Standards
+
+Examples of behavior that contributes to a positive environment for our
+community include:
+
+* Demonstrating empathy and kindness toward other people
+* Being respectful of differing opinions, viewpoints, and experiences
+* Giving and gracefully accepting constructive feedback
+* Accepting responsibility and apologizing to those affected by our mistakes,
+  and learning from the experience
+* Focusing on what is best not just for us as individuals, but for the overall
+  community
+
+Examples of unacceptable behavior include:
+
+* The use of sexualized language or imagery, and sexual attention or advances of
+  any kind
+* Trolling, insulting or derogatory comments, and personal or political attacks
+* Public or private harassment
+* Publishing others' private information, such as a physical or email address,
+  without their explicit permission
+* Other conduct which could reasonably be considered inappropriate in a
+  professional setting
+
+## Enforcement Responsibilities
+
+Community leaders are responsible for clarifying and enforcing our standards of
+acceptable behavior and will take appropriate and fair corrective action in
+response to any behavior that they deem inappropriate, threatening, offensive,
+or harmful.
+
+Community leaders have the right and responsibility to remove, edit, or reject
+comments, commits, code, wiki edits, issues, and other contributions that are
+not aligned to this Code of Conduct, and will communicate reasons for moderation
+decisions when appropriate.
+
+## Scope
+
+This Code of Conduct applies within all community spaces, and also applies when
+an individual is officially representing the community in public spaces.
+Examples of representing our community include using an official email address,
+posting via an official social media account, or acting as an appointed
+representative at an online or offline event.
+
+## Enforcement
+
+Instances of abusive, harassing, or otherwise unacceptable behavior may be
+reported to the community leaders responsible for enforcement at
+[feedback@huggingface.co](mailto:feedback@huggingface.co).
+All complaints will be reviewed and investigated promptly and fairly.
+
+All community leaders are obligated to respect the privacy and security of the
+reporter of any incident.
+
+## Enforcement Guidelines
+
+Community leaders will follow these Community Impact Guidelines in determining
+the consequences for any action they deem in violation of this Code of Conduct:
+
+### 1. Correction
+
+**Community Impact**: Use of inappropriate language or other behavior deemed
+unprofessional or unwelcome in the community.
+
+**Consequence**: A private, written warning from community leaders, providing
+clarity around the nature of the violation and an explanation of why the
+behavior was inappropriate. A public apology may be requested.
+
+### 2. Warning
+
+**Community Impact**: A violation through a single incident or series of
+actions.
+
+**Consequence**: A warning with consequences for continued behavior. No
+interaction with the people involved, including unsolicited interaction with
+those enforcing the Code of Conduct, for a specified period of time. This
+includes avoiding interactions in community spaces as well as external channels
+like social media. Violating these terms may lead to a temporary or permanent
+ban.
+
+### 3. Temporary Ban
+
+**Community Impact**: A serious violation of community standards, including
+sustained inappropriate behavior.
+
+**Consequence**: A temporary ban from any sort of interaction or public
+communication with the community for a specified period of time. No public or
+private interaction with the people involved, including unsolicited interaction
+with those enforcing the Code of Conduct, is allowed during this period.
+Violating these terms may lead to a permanent ban.
+
+### 4. Permanent Ban
+
+**Community Impact**: Demonstrating a pattern of violation of community
+standards, including sustained inappropriate behavior, harassment of an
+individual, or aggression toward or disparagement of classes of individuals.
+
+**Consequence**: A permanent ban from any sort of public interaction within the
+community.
+
+## Attribution
+
+This Code of Conduct is adapted from the [Contributor Covenant][homepage],
+version 2.1, available at
+[https://www.contributor-covenant.org/version/2/1/code_of_conduct.html][v2.1].
+
+Community Impact Guidelines were inspired by
+[Mozilla's code of conduct enforcement ladder][Mozilla CoC].
+
+For answers to common questions about this code of conduct, see the FAQ at
+[https://www.contributor-covenant.org/faq][FAQ]. Translations are available at
+[https://www.contributor-covenant.org/translations][translations].
+
+[homepage]: https://www.contributor-covenant.org
+[v2.1]: https://www.contributor-covenant.org/version/2/1/code_of_conduct.html
+[Mozilla CoC]: https://github.com/mozilla/diversity
+[FAQ]: https://www.contributor-covenant.org/faq
+[translations]: https://www.contributor-covenant.org/translations

CONTRIBUTING.md

@@ -0,0 +1,275 @@
+# How to contribute to 🤗 LeRobot?
+
+Everyone is welcome to contribute, and we value everybody's contribution. Code
+is thus not the only way to help the community. Answering questions, helping
+others, reaching out and improving the documentations are immensely valuable to
+the community.
+
+It also helps us if you spread the word: reference the library from blog posts
+on the awesome projects it made possible, shout out on Twitter when it has
+helped you, or simply ⭐️ the repo to say "thank you".
+
+Whichever way you choose to contribute, please be mindful to respect our
+[code of conduct](https://github.com/huggingface/lerobot/blob/main/CODE_OF_CONDUCT.md).
+
+## You can contribute in so many ways!
+
+Some of the ways you can contribute to 🤗 LeRobot:
+* Fixing outstanding issues with the existing code.
+* Implementing new models, datasets or simulation environments.
+* Contributing to the examples or to the documentation.
+* Submitting issues related to bugs or desired new features.
+
+Following the guides below, feel free to open issues and PRs and to coordinate your efforts with the community on our [Discord Channel](https://discord.gg/VjFz58wn3R). For specific inquiries, reach out to [Remi Cadene](mailto:remi.cadene@huggingface.co).
+
+If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/orgs/huggingface/projects/46)
+
+## Submitting a new issue or feature request
+
+Do your best to follow these guidelines when submitting an issue or a feature
+request. It will make it easier for us to come back to you quickly and with good
+feedback.
+
+### Did you find a bug?
+
+The 🤗 LeRobot library is robust and reliable thanks to the users who notify us of
+the problems they encounter. So thank you for reporting an issue.
+
+First, we would really appreciate it if you could **make sure the bug was not
+already reported** (use the search bar on Github under Issues).
+
+Did not find it? :( So we can act quickly on it, please follow these steps:
+
+* Include your **OS type and version**, the versions of **Python** and **PyTorch**.
+* A short, self-contained, code snippet that allows us to reproduce the bug in
+  less than 30s.
+* The full traceback if an exception is raised.
+* Attach any other additional information, like screenshots, you think may help.
+
+### Do you want a new feature?
+
+A good feature request addresses the following points:
+
+1. Motivation first:
+* Is it related to a problem/frustration with the library? If so, please explain
+  why. Providing a code snippet that demonstrates the problem is best.
+* Is it related to something you would need for a project? We'd love to hear
+  about it!
+* Is it something you worked on and think could benefit the community?
+  Awesome! Tell us what problem it solved for you.
+2. Write a *paragraph* describing the feature.
+3. Provide a **code snippet** that demonstrates its future use.
+4. In case this is related to a paper, please attach a link.
+5. Attach any additional information (drawings, screenshots, etc.) you think may help.
+
+If your issue is well written we're already 80% of the way there by the time you
+post it.
+
+## Adding new policies, datasets or environments
+
+Look at our implementations for [datasets](./lerobot/common/datasets/), [policies](./lerobot/common/policies/),
+environments ([aloha](https://github.com/huggingface/gym-aloha),
+[xarm](https://github.com/huggingface/gym-xarm),
+[pusht](https://github.com/huggingface/gym-pusht))
+and follow the same api design.
+
+When implementing a new dataset loadable with LeRobotDataset follow these steps:
+- Update `available_datasets_per_env` in `lerobot/__init__.py`
+
+When implementing a new environment (e.g. `gym_aloha`), follow these steps:
+- Update `available_tasks_per_env` and `available_datasets_per_env` in `lerobot/__init__.py`
+
+When implementing a new policy class (e.g. `DiffusionPolicy`) follow these steps:
+- Update `available_policies` and `available_policies_per_env`, in `lerobot/__init__.py`
+- Set the required `name` class attribute.
+- Update variables in `tests/test_available.py` by importing your new Policy class
+
+## Submitting a pull request (PR)
+
+Before writing code, we strongly advise you to search through the existing PRs or
+issues to make sure that nobody is already working on the same thing. If you are
+unsure, it is always a good idea to open an issue to get some feedback.
+
+You will need basic `git` proficiency to be able to contribute to
+🤗 LeRobot. `git` is not the easiest tool to use but it has the greatest
+manual. Type `git --help` in a shell and enjoy. If you prefer books, [Pro
+Git](https://git-scm.com/book/en/v2) is a very good reference.
+
+Follow these steps to start contributing:
+
+1. Fork the [repository](https://github.com/huggingface/lerobot) by
+   clicking on the 'Fork' button on the repository's page. This creates a copy of the code
+   under your GitHub user account.
+
+2. Clone your fork to your local disk, and add the base repository as a remote. The following command
+   assumes you have your public SSH key uploaded to GitHub. See the following guide for more
+   [information](https://docs.github.com/en/repositories/creating-and-managing-repositories/cloning-a-repository).
+
+   ```bash
+   git clone git@github.com:<your Github handle>/lerobot.git
+   cd lerobot
+   git remote add upstream https://github.com/huggingface/lerobot.git
+   ```
+
+3. Create a new branch to hold your development changes, and do this for every new PR you work on.
+
+   Start by synchronizing your `main` branch with the `upstream/main` branch (more details in the [GitHub Docs](https://docs.github.com/en/github/collaborating-with-issues-and-pull-requests/syncing-a-fork)):
+
+   ```bash
+   git checkout main
+   git fetch upstream
+   git rebase upstream/main
+   ```
+
+   Once your `main` branch is synchronized, create a new branch from it:
+
+   ```bash
+   git checkout -b a-descriptive-name-for-my-changes
+   ```
+
+   🚨 **Do not** work on the `main` branch.
+
+4. for development, we use `poetry` instead of just `pip` to easily track our dependencies.
+   If you don't have it already, follow the [instructions](https://python-poetry.org/docs/#installation) to install it.
+
+   Set up a development environment with conda or miniconda:
+   ```bash
+   conda create -y -n lerobot-dev python=3.10 && conda activate lerobot-dev
+   ```
+
+   To develop on 🤗 LeRobot, you will at least need to install the `dev` and `test` extras dependencies along with the core library:
+   ```bash
+   poetry install --sync --extras "dev test"
+   ```
+
+   You can also install the project with all its dependencies (including environments):
+   ```bash
+   poetry install --sync --all-extras
+   ```
+
+   > **Note:** If you don't install simulation environments with `--all-extras`, the tests that require them will be skipped when running the pytest suite locally. However, they *will* be tested in the CI. In general, we advise you to install everything and test locally before pushing.
+
+   Whichever command you chose to install the project (e.g. `poetry install --sync --all-extras`), you should run it again when pulling code with an updated version of `pyproject.toml` and `poetry.lock` in order to synchronize your virtual environment with the new dependencies.
+
+   The equivalent of `pip install some-package`, would just be:
+   ```bash
+   poetry add some-package
+   ```
+
+   When making changes to the poetry sections of the `pyproject.toml`, you should run the following command to lock dependencies.
+   ```bash
+   poetry lock --no-update
+   ```
+
+5. Develop the features on your branch.
+
+   As you work on the features, you should make sure that the test suite
+   passes. You should run the tests impacted by your changes like this (see
+   below an explanation regarding the environment variable):
+
+   ```bash
+   pytest tests/<TEST_TO_RUN>.py
+   ```
+
+6. Follow our style.
+
+   `lerobot` relies on `ruff` to format its source code
+   consistently. Set up [`pre-commit`](https://pre-commit.com/) to run these checks
+   automatically as Git commit hooks.
+
+   Install `pre-commit` hooks:
+   ```bash
+   pre-commit install
+   ```
+
+   You can run these hooks whenever you need on staged files with:
+   ```bash
+   pre-commit
+   ```
+
+   Once you're happy with your changes, add changed files using `git add` and
+   make a commit with `git commit` to record your changes locally:
+
+   ```bash
+   git add modified_file.py
+   git commit
+   ```
+
+   Note, if you already commited some changes that have a wrong formatting, you can use:
+   ```bash
+   pre-commit run --all-files
+   ```
+
+   Please write [good commit messages](https://chris.beams.io/posts/git-commit/).
+
+   It is a good idea to sync your copy of the code with the original
+   repository regularly. This way you can quickly account for changes:
+
+   ```bash
+   git fetch upstream
+   git rebase upstream/main
+   ```
+
+   Push the changes to your account using:
+
+   ```bash
+   git push -u origin a-descriptive-name-for-my-changes
+   ```
+
+6. Once you are satisfied (**and the checklist below is happy too**), go to the
+   webpage of your fork on GitHub. Click on 'Pull request' to send your changes
+   to the project maintainers for review.
+
+7. It's ok if maintainers ask you for changes. It happens to core contributors
+   too! So everyone can see the changes in the Pull request, work in your local
+   branch and push the changes to your fork. They will automatically appear in
+   the pull request.
+
+
+### Checklist
+
+1. The title of your pull request should be a summary of its contribution;
+2. If your pull request addresses an issue, please mention the issue number in
+   the pull request description to make sure they are linked (and people
+   consulting the issue know you are working on it);
+3. To indicate a work in progress please prefix the title with `[WIP]`, or preferably mark
+   the PR as a draft PR. These are useful to avoid duplicated work, and to differentiate
+   it from PRs ready to be merged;
+4. Make sure existing tests pass;
+<!-- 5. Add high-coverage tests. No quality testing = no merge.
+
+See an example of a good PR here: https://github.com/huggingface/lerobot/pull/ -->
+
+### Tests
+
+An extensive test suite is included to test the library behavior and several examples. Library tests can be found in the [tests folder](https://github.com/huggingface/lerobot/tree/main/tests).
+
+Install [git lfs](https://git-lfs.com/) to retrieve test artifacts (if you don't have it already).
+
+On Mac:
+```bash
+brew install git-lfs
+git lfs install
+```
+
+On Ubuntu:
+```bash
+sudo apt-get install git-lfs
+git lfs install
+```
+
+Pull artifacts if they're not in [tests/data](tests/data)
+```bash
+git lfs pull
+```
+
+We use `pytest` in order to run the tests. From the root of the
+repository, here's how to run tests with `pytest` for the library:
+
+```bash
+DATA_DIR="tests/data" python -m pytest -sv ./tests
+```
+
+
+You can specify a smaller set of tests in order to test only the feature
+you're working on.

LICENSE

@@ -253,6 +253,31 @@ OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
 SOFTWARE.
 
 
+## Some of lerobot's code is derived from simxarm, which is subject to the following copyright notice:
+
+MIT License
+
+Copyright (c) 2023 Nicklas Hansen & Yanjie Ze
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+
+
 ## Some of lerobot's code is derived from ALOHA, which is subject to the following copyright notice:
 
 MIT License
@@ -276,3 +301,207 @@ AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
 LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
 OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
 SOFTWARE.
+
+## Some of lerobot's code is derived from DETR, which is subject to the following copyright notice:
+
+                                 Apache License
+                           Version 2.0, January 2004
+                        http://www.apache.org/licenses/
+
+   TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+   1. Definitions.
+
+      "License" shall mean the terms and conditions for use, reproduction,
+      and distribution as defined by Sections 1 through 9 of this document.
+
+      "Licensor" shall mean the copyright owner or entity authorized by
+      the copyright owner that is granting the License.
+
+      "Legal Entity" shall mean the union of the acting entity and all
+      other entities that control, are controlled by, or are under common
+      control with that entity. For the purposes of this definition,
+      "control" means (i) the power, direct or indirect, to cause the
+      direction or management of such entity, whether by contract or
+      otherwise, or (ii) ownership of fifty percent (50%) or more of the
+      outstanding shares, or (iii) beneficial ownership of such entity.
+
+      "You" (or "Your") shall mean an individual or Legal Entity
+      exercising permissions granted by this License.
+
+      "Source" form shall mean the preferred form for making modifications,
+      including but not limited to software source code, documentation
+      source, and configuration files.
+
+      "Object" form shall mean any form resulting from mechanical
+      transformation or translation of a Source form, including but
+      not limited to compiled object code, generated documentation,
+      and conversions to other media types.
+
+      "Work" shall mean the work of authorship, whether in Source or
+      Object form, made available under the License, as indicated by a
+      copyright notice that is included in or attached to the work
+      (an example is provided in the Appendix below).
+
+      "Derivative Works" shall mean any work, whether in Source or Object
+      form, that is based on (or derived from) the Work and for which the
+      editorial revisions, annotations, elaborations, or other modifications
+      represent, as a whole, an original work of authorship. For the purposes
+      of this License, Derivative Works shall not include works that remain
+      separable from, or merely link (or bind by name) to the interfaces of,
+      the Work and Derivative Works thereof.
+
+      "Contribution" shall mean any work of authorship, including
+      the original version of the Work and any modifications or additions
+      to that Work or Derivative Works thereof, that is intentionally
+      submitted to Licensor for inclusion in the Work by the copyright owner
+      or by an individual or Legal Entity authorized to submit on behalf of
+      the copyright owner. For the purposes of this definition, "submitted"
+      means any form of electronic, verbal, or written communication sent
+      to the Licensor or its representatives, including but not limited to
+      communication on electronic mailing lists, source code control systems,
+      and issue tracking systems that are managed by, or on behalf of, the
+      Licensor for the purpose of discussing and improving the Work, but
+      excluding communication that is conspicuously marked or otherwise
+      designated in writing by the copyright owner as "Not a Contribution."
+
+      "Contributor" shall mean Licensor and any individual or Legal Entity
+      on behalf of whom a Contribution has been received by Licensor and
+      subsequently incorporated within the Work.
+
+   2. Grant of Copyright License. Subject to the terms and conditions of
+      this License, each Contributor hereby grants to You a perpetual,
+      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+      copyright license to reproduce, prepare Derivative Works of,
+      publicly display, publicly perform, sublicense, and distribute the
+      Work and such Derivative Works in Source or Object form.
+
+   3. Grant of Patent License. Subject to the terms and conditions of
+      this License, each Contributor hereby grants to You a perpetual,
+      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+      (except as stated in this section) patent license to make, have made,
+      use, offer to sell, sell, import, and otherwise transfer the Work,
+      where such license applies only to those patent claims licensable
+      by such Contributor that are necessarily infringed by their
+      Contribution(s) alone or by combination of their Contribution(s)
+      with the Work to which such Contribution(s) was submitted. If You
+      institute patent litigation against any entity (including a
+      cross-claim or counterclaim in a lawsuit) alleging that the Work
+      or a Contribution incorporated within the Work constitutes direct
+      or contributory patent infringement, then any patent licenses
+      granted to You under this License for that Work shall terminate
+      as of the date such litigation is filed.
+
+   4. Redistribution. You may reproduce and distribute copies of the
+      Work or Derivative Works thereof in any medium, with or without
+      modifications, and in Source or Object form, provided that You
+      meet the following conditions:
+
+      (a) You must give any other recipients of the Work or
+          Derivative Works a copy of this License; and
+
+      (b) You must cause any modified files to carry prominent notices
+          stating that You changed the files; and
+
+      (c) You must retain, in the Source form of any Derivative Works
+          that You distribute, all copyright, patent, trademark, and
+          attribution notices from the Source form of the Work,
+          excluding those notices that do not pertain to any part of
+          the Derivative Works; and
+
+      (d) If the Work includes a "NOTICE" text file as part of its
+          distribution, then any Derivative Works that You distribute must
+          include a readable copy of the attribution notices contained
+          within such NOTICE file, excluding those notices that do not
+          pertain to any part of the Derivative Works, in at least one
+          of the following places: within a NOTICE text file distributed
+          as part of the Derivative Works; within the Source form or
+          documentation, if provided along with the Derivative Works; or,
+          within a display generated by the Derivative Works, if and
+          wherever such third-party notices normally appear. The contents
+          of the NOTICE file are for informational purposes only and
+          do not modify the License. You may add Your own attribution
+          notices within Derivative Works that You distribute, alongside
+          or as an addendum to the NOTICE text from the Work, provided
+          that such additional attribution notices cannot be construed
+          as modifying the License.
+
+      You may add Your own copyright statement to Your modifications and
+      may provide additional or different license terms and conditions
+      for use, reproduction, or distribution of Your modifications, or
+      for any such Derivative Works as a whole, provided Your use,
+      reproduction, and distribution of the Work otherwise complies with
+      the conditions stated in this License.
+
+   5. Submission of Contributions. Unless You explicitly state otherwise,
+      any Contribution intentionally submitted for inclusion in the Work
+      by You to the Licensor shall be under the terms and conditions of
+      this License, without any additional terms or conditions.
+      Notwithstanding the above, nothing herein shall supersede or modify
+      the terms of any separate license agreement you may have executed
+      with Licensor regarding such Contributions.
+
+   6. Trademarks. This License does not grant permission to use the trade
+      names, trademarks, service marks, or product names of the Licensor,
+      except as required for reasonable and customary use in describing the
+      origin of the Work and reproducing the content of the NOTICE file.
+
+   7. Disclaimer of Warranty. Unless required by applicable law or
+      agreed to in writing, Licensor provides the Work (and each
+      Contributor provides its Contributions) on an "AS IS" BASIS,
+      WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+      implied, including, without limitation, any warranties or conditions
+      of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
+      PARTICULAR PURPOSE. You are solely responsible for determining the
+      appropriateness of using or redistributing the Work and assume any
+      risks associated with Your exercise of permissions under this License.
+
+   8. Limitation of Liability. In no event and under no legal theory,
+      whether in tort (including negligence), contract, or otherwise,
+      unless required by applicable law (such as deliberate and grossly
+      negligent acts) or agreed to in writing, shall any Contributor be
+      liable to You for damages, including any direct, indirect, special,
+      incidental, or consequential damages of any character arising as a
+      result of this License or out of the use or inability to use the
+      Work (including but not limited to damages for loss of goodwill,
+      work stoppage, computer failure or malfunction, or any and all
+      other commercial damages or losses), even if such Contributor
+      has been advised of the possibility of such damages.
+
+   9. Accepting Warranty or Additional Liability. While redistributing
+      the Work or Derivative Works thereof, You may choose to offer,
+      and charge a fee for, acceptance of support, warranty, indemnity,
+      or other liability obligations and/or rights consistent with this
+      License. However, in accepting such obligations, You may act only
+      on Your own behalf and on Your sole responsibility, not on behalf
+      of any other Contributor, and only if You agree to indemnify,
+      defend, and hold each Contributor harmless for any liability
+      incurred by, or claims asserted against, such Contributor by reason
+      of your accepting any such warranty or additional liability.
+
+   END OF TERMS AND CONDITIONS
+
+   APPENDIX: How to apply the Apache License to your work.
+
+      To apply the Apache License to your work, attach the following
+      boilerplate notice, with the fields enclosed by brackets "[]"
+      replaced with your own identifying information. (Don't include
+      the brackets!)  The text should be enclosed in the appropriate
+      comment syntax for the file format. We also recommend that a
+      file or class name and description of purpose be included on the
+      same "printed page" as the copyright notice for easier
+      identification within third-party archives.
+
+   Copyright 2020 - present, Facebook, Inc
+
+   Licensed under the Apache License, Version 2.0 (the "License");
+   you may not use this file except in compliance with the License.
+   You may obtain a copy of the License at
+
+       http://www.apache.org/licenses/LICENSE-2.0
+
+   Unless required by applicable law or agreed to in writing, software
+   distributed under the License is distributed on an "AS IS" BASIS,
+   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+   See the License for the specific language governing permissions and
+   limitations under the License.

Makefile

@@ -0,0 +1,190 @@
+.PHONY: tests
+
+PYTHON_PATH := $(shell which python)
+
+# If Poetry is installed, redefine PYTHON_PATH to use the Poetry-managed Python
+POETRY_CHECK := $(shell command -v poetry)
+ifneq ($(POETRY_CHECK),)
+	PYTHON_PATH := $(shell poetry run which python)
+endif
+
+export PATH := $(dir $(PYTHON_PATH)):$(PATH)
+
+DEVICE ?= cpu
+
+build-cpu:
+	docker build -t lerobot:latest -f docker/lerobot-cpu/Dockerfile .
+
+build-gpu:
+	docker build -t lerobot:latest -f docker/lerobot-gpu/Dockerfile .
+
+test-end-to-end:
+	${MAKE} DEVICE=$(DEVICE) test-act-ete-train
+	${MAKE} DEVICE=$(DEVICE) test-act-ete-eval
+	${MAKE} DEVICE=$(DEVICE) test-act-ete-train-amp
+	${MAKE} DEVICE=$(DEVICE) test-act-ete-eval-amp
+	${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-train
+	${MAKE} DEVICE=$(DEVICE) test-diffusion-ete-eval
+	${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train
+	${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-train-with-online
+	${MAKE} DEVICE=$(DEVICE) test-tdmpc-ete-eval
+	${MAKE} DEVICE=$(DEVICE) test-default-ete-eval
+	${MAKE} DEVICE=$(DEVICE) test-act-pusht-tutorial
+
+test-act-ete-train:
+	python lerobot/scripts/train.py \
+		policy=act \
+		policy.dim_model=64 \
+		env=aloha \
+		wandb.enable=False \
+		training.offline_steps=2 \
+		training.online_steps=0 \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		device=$(DEVICE) \
+		training.save_checkpoint=true \
+		training.save_freq=2 \
+		policy.n_action_steps=20 \
+		policy.chunk_size=20 \
+		training.batch_size=2 \
+		training.image_transforms.enable=true \
+		hydra.run.dir=tests/outputs/act/
+
+test-act-ete-eval:
+	python lerobot/scripts/eval.py \
+		-p tests/outputs/act/checkpoints/000002/pretrained_model \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		env.episode_length=8 \
+		device=$(DEVICE) \
+
+test-act-ete-train-amp:
+	python lerobot/scripts/train.py \
+		policy=act \
+		policy.dim_model=64 \
+		env=aloha \
+		wandb.enable=False \
+		training.offline_steps=2 \
+		training.online_steps=0 \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		device=$(DEVICE) \
+		training.save_checkpoint=true \
+		training.save_freq=2 \
+		policy.n_action_steps=20 \
+		policy.chunk_size=20 \
+		training.batch_size=2 \
+		hydra.run.dir=tests/outputs/act_amp/ \
+		training.image_transforms.enable=true \
+		use_amp=true
+
+test-act-ete-eval-amp:
+	python lerobot/scripts/eval.py \
+		-p tests/outputs/act_amp/checkpoints/000002/pretrained_model \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		env.episode_length=8 \
+		device=$(DEVICE) \
+		use_amp=true
+
+test-diffusion-ete-train:
+	python lerobot/scripts/train.py \
+		policy=diffusion \
+		policy.down_dims=\[64,128,256\] \
+		policy.diffusion_step_embed_dim=32 \
+		policy.num_inference_steps=10 \
+		env=pusht \
+		wandb.enable=False \
+		training.offline_steps=2 \
+		training.online_steps=0 \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		device=$(DEVICE) \
+		training.save_checkpoint=true \
+		training.save_freq=2 \
+		training.batch_size=2 \
+		training.image_transforms.enable=true \
+		hydra.run.dir=tests/outputs/diffusion/
+
+test-diffusion-ete-eval:
+	python lerobot/scripts/eval.py \
+		-p tests/outputs/diffusion/checkpoints/000002/pretrained_model \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		env.episode_length=8 \
+		device=$(DEVICE) \
+
+test-tdmpc-ete-train:
+	python lerobot/scripts/train.py \
+		policy=tdmpc \
+		env=xarm \
+		env.task=XarmLift-v0 \
+		dataset_repo_id=lerobot/xarm_lift_medium \
+		wandb.enable=False \
+		training.offline_steps=2 \
+		training.online_steps=0 \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		env.episode_length=2 \
+		device=$(DEVICE) \
+		training.save_checkpoint=true \
+		training.save_freq=2 \
+		training.batch_size=2 \
+		training.image_transforms.enable=true \
+		hydra.run.dir=tests/outputs/tdmpc/
+
+test-tdmpc-ete-train-with-online:
+	python lerobot/scripts/train.py \
+		env=pusht \
+		env.gym.obs_type=environment_state_agent_pos \
+		policy=tdmpc_pusht_keypoints \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		env.episode_length=10 \
+		device=$(DEVICE) \
+		training.offline_steps=2 \
+		training.online_steps=20 \
+		training.save_checkpoint=false \
+		training.save_freq=10 \
+		training.batch_size=2 \
+		training.online_rollout_n_episodes=2 \
+		training.online_rollout_batch_size=2 \
+		training.online_steps_between_rollouts=10 \
+		training.online_buffer_capacity=15 \
+		eval.use_async_envs=true \
+		hydra.run.dir=tests/outputs/tdmpc_online/
+
+
+test-tdmpc-ete-eval:
+	python lerobot/scripts/eval.py \
+		-p tests/outputs/tdmpc/checkpoints/000002/pretrained_model \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		env.episode_length=8 \
+		device=$(DEVICE) \
+
+test-default-ete-eval:
+	python lerobot/scripts/eval.py \
+		--config lerobot/configs/default.yaml \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		env.episode_length=8 \
+		device=$(DEVICE) \
+
+test-act-pusht-tutorial:
+	cp examples/advanced/1_train_act_pusht/act_pusht.yaml lerobot/configs/policy/created_by_Makefile.yaml
+	python lerobot/scripts/train.py \
+		policy=created_by_Makefile.yaml \
+		env=pusht \
+		wandb.enable=False \
+		training.offline_steps=2 \
+		eval.n_episodes=1 \
+		eval.batch_size=1 \
+		env.episode_length=2 \
+		device=$(DEVICE) \
+		training.save_model=true \
+		training.save_freq=2 \
+		training.batch_size=2 \
+		training.image_transforms.enable=true \
+		hydra.run.dir=tests/outputs/act_pusht/
+	rm lerobot/configs/policy/created_by_Makefile.yaml

README.md

@@ -1,72 +1,348 @@
-# LeRobot
+<p align="center">
+  <picture>
+    <source media="(prefers-color-scheme: dark)" srcset="media/lerobot-logo-thumbnail.png">
+    <source media="(prefers-color-scheme: light)" srcset="media/lerobot-logo-thumbnail.png">
+    <img alt="LeRobot, Hugging Face Robotics Library" src="media/lerobot-logo-thumbnail.png" style="max-width: 100%;">
+  </picture>
+  <br/>
+  <br/>
+</p>
+
+<div align="center">
+
+[![Tests](https://github.com/huggingface/lerobot/actions/workflows/nightly-tests.yml/badge.svg?branch=main)](https://github.com/huggingface/lerobot/actions/workflows/nightly-tests.yml?query=branch%3Amain)
+[![Coverage](https://codecov.io/gh/huggingface/lerobot/branch/main/graph/badge.svg?token=TODO)](https://codecov.io/gh/huggingface/lerobot)
+[![Python versions](https://img.shields.io/pypi/pyversions/lerobot)](https://www.python.org/downloads/)
+[![License](https://img.shields.io/badge/License-Apache%202.0-blue.svg)](https://github.com/huggingface/lerobot/blob/main/LICENSE)
+[![Status](https://img.shields.io/pypi/status/lerobot)](https://pypi.org/project/lerobot/)
+[![Version](https://img.shields.io/pypi/v/lerobot)](https://pypi.org/project/lerobot/)
+[![Examples](https://img.shields.io/badge/Examples-green.svg)](https://github.com/huggingface/lerobot/tree/main/examples)
+[![Contributor Covenant](https://img.shields.io/badge/Contributor%20Covenant-v2.1%20adopted-ff69b4.svg)](https://github.com/huggingface/lerobot/blob/main/CODE_OF_CONDUCT.md)
+[![Discord](https://dcbadge.vercel.app/api/server/C5P34WJ68S?style=flat)](https://discord.gg/s3KuuzsPFb)
+
+</div>
+
+<h2 align="center">
+    <p><a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">New robot in town: SO-100</a></p>
+</h2>
+
+<div align="center">
+    <img src="media/so100/leader_follower.webp?raw=true" alt="SO-100 leader and follower arms" title="SO-100 leader and follower arms" width="50%">
+    <p>We just added a new tutorial on how to build a more affordable robot, at the price of $110 per arm!</p>
+    <p>Teach it new skills by showing it a few moves with just a laptop.</p>
+    <p>Then watch your homemade robot act autonomously 🤯</p>
+    <p>Follow the link to the <a href="https://github.com/huggingface/lerobot/blob/main/examples/10_use_so100.md">full tutorial for SO-100</a>.</p>
+</div>
+
+<br/>
+
+<h3 align="center">
+    <p>LeRobot: State-of-the-art AI for real-world robotics</p>
+</h3>
+
+---
+
+
+🤗 LeRobot aims to provide models, datasets, and tools for real-world robotics in PyTorch. The goal is to lower the barrier to entry to robotics so that everyone can contribute and benefit from sharing datasets and pretrained models.
+
+🤗 LeRobot contains state-of-the-art approaches that have been shown to transfer to the real-world with a focus on imitation learning and reinforcement learning.
+
+🤗 LeRobot already provides a set of pretrained models, datasets with human collected demonstrations, and simulation environments to get started without assembling a robot. In the coming weeks, the plan is to add more and more support for real-world robotics on the most affordable and capable robots out there.
+
+🤗 LeRobot hosts pretrained models and datasets on this Hugging Face community page: [huggingface.co/lerobot](https://huggingface.co/lerobot)
+
+#### Examples of pretrained models on simulation environments
+
+<table>
+  <tr>
+    <td><img src="http://remicadene.com/assets/gif/aloha_act.gif" width="100%" alt="ACT policy on ALOHA env"/></td>
+    <td><img src="http://remicadene.com/assets/gif/simxarm_tdmpc.gif" width="100%" alt="TDMPC policy on SimXArm env"/></td>
+    <td><img src="http://remicadene.com/assets/gif/pusht_diffusion.gif" width="100%" alt="Diffusion policy on PushT env"/></td>
+  </tr>
+  <tr>
+    <td align="center">ACT policy on ALOHA env</td>
+    <td align="center">TDMPC policy on SimXArm env</td>
+    <td align="center">Diffusion policy on PushT env</td>
+  </tr>
+</table>
+
+### Acknowledgment
+
+- Thanks to Tony Zaho, Zipeng Fu and colleagues for open sourcing ACT policy, ALOHA environments and datasets. Ours are adapted from [ALOHA](https://tonyzhaozh.github.io/aloha) and [Mobile ALOHA](https://mobile-aloha.github.io).
+- Thanks to Cheng Chi, Zhenjia Xu and colleagues for open sourcing Diffusion policy, Pusht environment and datasets, as well as UMI datasets. Ours are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu) and [UMI Gripper](https://umi-gripper.github.io).
+- Thanks to Nicklas Hansen, Yunhai Feng and colleagues for open sourcing TDMPC policy, Simxarm environments and datasets. Ours are adapted from [TDMPC](https://github.com/nicklashansen/tdmpc) and [FOWM](https://www.yunhaifeng.com/FOWM).
+- Thanks to Antonio Loquercio and Ashish Kumar for their early support.
+- Thanks to [Seungjae (Jay) Lee](https://sjlee.cc/), [Mahi Shafiullah](https://mahis.life/) and colleagues for open sourcing [VQ-BeT](https://sjlee.cc/vq-bet/) policy and helping us adapt the codebase to our repository. The policy is adapted from [VQ-BeT repo](https://github.com/jayLEE0301/vq_bet_official).
+
 
 ## Installation
 
-Create a virtual environment with Python 3.10, e.g. using `conda`:
+Download our source code:
+```bash
+git clone https://github.com/huggingface/lerobot.git
+cd lerobot
 ```
+
+Create a virtual environment with Python 3.10 and activate it, e.g. with [`miniconda`](https://docs.anaconda.com/free/miniconda/index.html):
+```bash
 conda create -y -n lerobot python=3.10
 conda activate lerobot
 ```
 
-[Install `poetry`](https://python-poetry.org/docs/#installation) (if you don't have it already)
-```
-curl -sSL https://install.python-poetry.org | python -
+Install 🤗 LeRobot:
+```bash
+pip install -e .
 ```
 
-Install dependencies
-```
-poetry install
+> **NOTE:** Depending on your platform, If you encounter any build errors during this step
+you may need to install `cmake` and `build-essential` for building some of our dependencies.
+On linux: `sudo apt-get install cmake build-essential`
+
+For simulations, 🤗 LeRobot comes with gymnasium environments that can be installed as extras:
+- [aloha](https://github.com/huggingface/gym-aloha)
+- [xarm](https://github.com/huggingface/gym-xarm)
+- [pusht](https://github.com/huggingface/gym-pusht)
+
+For instance, to install 🤗 LeRobot with aloha and pusht, use:
+```bash
+pip install -e ".[aloha, pusht]"
 ```
 
-If you encounter a disk space error, try to change your tmp dir to a location where you have enough disk space, e.g.
-```
-mkdir ~/tmp
-export TMPDIR='~/tmp'
-```
-
-To use [Weights and Biases](https://docs.wandb.ai/quickstart) for experiments tracking, log in with
-```
+To use [Weights and Biases](https://docs.wandb.ai/quickstart) for experiment tracking, log in with
+```bash
 wandb login
 ```
 
-## Usage
+(note: you will also need to enable WandB in the configuration. See below.)
 
-
-### Train
+## Walkthrough
 
 ```
-python lerobot/scripts/train.py \
-hydra.job.name=pusht \
-env=pusht
+.
+├── examples             # contains demonstration examples, start here to learn about LeRobot
+|   └── advanced         # contains even more examples for those who have mastered the basics
+├── lerobot
+|   ├── configs          # contains hydra yaml files with all options that you can override in the command line
+|   |   ├── default.yaml   # selected by default, it loads pusht environment and diffusion policy
+|   |   ├── env            # various sim environments and their datasets: aloha.yaml, pusht.yaml, xarm.yaml
+|   |   └── policy         # various policies: act.yaml, diffusion.yaml, tdmpc.yaml
+|   ├── common           # contains classes and utilities
+|   |   ├── datasets       # various datasets of human demonstrations: aloha, pusht, xarm
+|   |   ├── envs           # various sim environments: aloha, pusht, xarm
+|   |   ├── policies       # various policies: act, diffusion, tdmpc
+|   |   ├── robot_devices  # various real devices: dynamixel motors, opencv cameras, koch robots
+|   |   └── utils          # various utilities
+|   └── scripts          # contains functions to execute via command line
+|       ├── eval.py                 # load policy and evaluate it on an environment
+|       ├── train.py                # train a policy via imitation learning and/or reinforcement learning
+|       ├── control_robot.py        # teleoperate a real robot, record data, run a policy
+|       ├── push_dataset_to_hub.py  # convert your dataset into LeRobot dataset format and upload it to the Hugging Face hub
+|       └── visualize_dataset.py    # load a dataset and render its demonstrations
+├── outputs               # contains results of scripts execution: logs, videos, model checkpoints
+└── tests                 # contains pytest utilities for continuous integration
 ```
 
-### Visualize offline buffer
+### Visualize datasets
 
-```
+Check out [example 1](./examples/1_load_lerobot_dataset.py) that illustrates how to use our dataset class which automatically download data from the Hugging Face hub.
+
+You can also locally visualize episodes from a dataset on the hub by executing our script from the command line:
+```bash
 python lerobot/scripts/visualize_dataset.py \
-hydra.run.dir=tmp/$(date +"%Y_%m_%d") \
-env=pusht
+    --repo-id lerobot/pusht \
+    --episode-index 0
 ```
 
-### Visualize online buffer / Eval
+or from a dataset in a local folder with the root `DATA_DIR` environment variable (in the following case the dataset will be searched for in `./my_local_data_dir/lerobot/pusht`)
+```bash
+DATA_DIR='./my_local_data_dir' python lerobot/scripts/visualize_dataset.py \
+    --repo-id lerobot/pusht \
+    --episode-index 0
+```
+
+
+It will open `rerun.io` and display the camera streams, robot states and actions, like this:
+
+https://github-production-user-asset-6210df.s3.amazonaws.com/4681518/328035972-fd46b787-b532-47e2-bb6f-fd536a55a7ed.mov?X-Amz-Algorithm=AWS4-HMAC-SHA256&X-Amz-Credential=AKIAVCODYLSA53PQK4ZA%2F20240505%2Fus-east-1%2Fs3%2Faws4_request&X-Amz-Date=20240505T172924Z&X-Amz-Expires=300&X-Amz-Signature=d680b26c532eeaf80740f08af3320d22ad0b8a4e4da1bcc4f33142c15b509eda&X-Amz-SignedHeaders=host&actor_id=24889239&key_id=0&repo_id=748713144
+
+
+Our script can also visualize datasets stored on a distant server. See `python lerobot/scripts/visualize_dataset.py --help` for more instructions.
+
+### The `LeRobotDataset` format
+
+A dataset in `LeRobotDataset` format is very simple to use. It can be loaded from a repository on the Hugging Face hub or a local folder simply with e.g. `dataset = LeRobotDataset("lerobot/aloha_static_coffee")` and can be indexed into like any Hugging Face and PyTorch dataset. For instance `dataset[0]` will retrieve a single temporal frame from the dataset containing observation(s) and an action as PyTorch tensors ready to be fed to a model.
+
+A specificity of `LeRobotDataset` is that, rather than retrieving a single frame by its index, we can retrieve several frames based on their temporal relationship with the indexed frame, by setting `delta_timestamps` to a list of relative times with respect to the indexed frame. For example, with `delta_timestamps = {"observation.image": [-1, -0.5, -0.2, 0]}`  one can retrieve, for a given index, 4 frames: 3 "previous" frames 1 second, 0.5 seconds, and 0.2 seconds before the indexed frame, and the indexed frame itself (corresponding to the 0 entry). See example [1_load_lerobot_dataset.py](examples/1_load_lerobot_dataset.py) for more details on `delta_timestamps`.
+
+Under the hood, the `LeRobotDataset` format makes use of several ways to serialize data which can be useful to understand if you plan to work more closely with this format. We tried to make a flexible yet simple dataset format that would cover most type of features and specificities present in reinforcement learning and robotics, in simulation and in real-world, with a focus on cameras and robot states but easily extended to other types of sensory inputs as long as they can be represented by a tensor.
+
+Here are the important details and internal structure organization of a typical `LeRobotDataset` instantiated with `dataset = LeRobotDataset("lerobot/aloha_static_coffee")`. The exact features will change from dataset to dataset but not the main aspects:
 
 ```
+dataset attributes:
+  ├ hf_dataset: a Hugging Face dataset (backed by Arrow/parquet). Typical features example:
+  │  ├ observation.images.cam_high (VideoFrame):
+  │  │   VideoFrame = {'path': path to a mp4 video, 'timestamp' (float32): timestamp in the video}
+  │  ├ observation.state (list of float32): position of an arm joints (for instance)
+  │  ... (more observations)
+  │  ├ action (list of float32): goal position of an arm joints (for instance)
+  │  ├ episode_index (int64): index of the episode for this sample
+  │  ├ frame_index (int64): index of the frame for this sample in the episode ; starts at 0 for each episode
+  │  ├ timestamp (float32): timestamp in the episode
+  │  ├ next.done (bool): indicates the end of en episode ; True for the last frame in each episode
+  │  └ index (int64): general index in the whole dataset
+  ├ episode_data_index: contains 2 tensors with the start and end indices of each episode
+  │  ├ from (1D int64 tensor): first frame index for each episode — shape (num episodes,) starts with 0
+  │  └ to: (1D int64 tensor): last frame index for each episode — shape (num episodes,)
+  ├ stats: a dictionary of statistics (max, mean, min, std) for each feature in the dataset, for instance
+  │  ├ observation.images.cam_high: {'max': tensor with same number of dimensions (e.g. `(c, 1, 1)` for images, `(c,)` for states), etc.}
+  │  ...
+  ├ info: a dictionary of metadata on the dataset
+  │  ├ codebase_version (str): this is to keep track of the codebase version the dataset was created with
+  │  ├ fps (float): frame per second the dataset is recorded/synchronized to
+  │  ├ video (bool): indicates if frames are encoded in mp4 video files to save space or stored as png files
+  │  └ encoding (dict): if video, this documents the main options that were used with ffmpeg to encode the videos
+  ├ videos_dir (Path): where the mp4 videos or png images are stored/accessed
+  └ camera_keys (list of string): the keys to access camera features in the item returned by the dataset (e.g. `["observation.images.cam_high", ...]`)
+```
+
+A `LeRobotDataset` is serialised using several widespread file formats for each of its parts, namely:
+- hf_dataset stored using Hugging Face datasets library serialization to parquet
+- videos are stored in mp4 format to save space or png files
+- episode_data_index saved using `safetensor` tensor serialization format
+- stats saved using `safetensor` tensor serialization format
+- info are saved using JSON
+
+Dataset can be uploaded/downloaded from the HuggingFace hub seamlessly. To work on a local dataset, you can set the `DATA_DIR` environment variable to your root dataset folder as illustrated in the above section on dataset visualization.
+
+### Evaluate a pretrained policy
+
+Check out [example 2](./examples/2_evaluate_pretrained_policy.py) that illustrates how to download a pretrained policy from Hugging Face hub, and run an evaluation on its corresponding environment.
+
+We also provide a more capable script to parallelize the evaluation over multiple environments during the same rollout. Here is an example with a pretrained model hosted on [lerobot/diffusion_pusht](https://huggingface.co/lerobot/diffusion_pusht):
+```bash
 python lerobot/scripts/eval.py \
-hydra.run.dir=tmp/$(date +"%Y_%m_%d") \
-env=pusht
+    -p lerobot/diffusion_pusht \
+    eval.n_episodes=10 \
+    eval.batch_size=10
 ```
 
+Note: After training your own policy, you can re-evaluate the checkpoints with:
 
-## TODO
+```bash
+python lerobot/scripts/eval.py -p {OUTPUT_DIR}/checkpoints/last/pretrained_model
+```
 
-If you are not sure how to contribute or want to know the next features we working on, look on this project page: [LeRobot TODO](https://github.com/users/Cadene/projects/1)
+See `python lerobot/scripts/eval.py --help` for more instructions.
 
-Ask [Remi Cadene](re.cadene@gmail.com) for access if needed.
+### Train your own policy
+
+Check out [example 3](./examples/3_train_policy.py) that illustrates how to train a model using our core library in python, and [example 4](./examples/4_train_policy_with_script.md) that shows how to use our training script from command line.
+
+In general, you can use our training script to easily train any policy. Here is an example of training the ACT policy on trajectories collected by humans on the Aloha simulation environment for the insertion task:
+
+```bash
+python lerobot/scripts/train.py \
+    policy=act \
+    env=aloha \
+    env.task=AlohaInsertion-v0 \
+    dataset_repo_id=lerobot/aloha_sim_insertion_human \
+```
+
+The experiment directory is automatically generated and will show up in yellow in your terminal. It looks like `outputs/train/2024-05-05/20-21-12_aloha_act_default`. You can manually specify an experiment directory by adding this argument to the `train.py` python command:
+```bash
+    hydra.run.dir=your/new/experiment/dir
+```
+
+In the experiment directory there will be a folder called `checkpoints` which will have the following structure:
+
+```bash
+checkpoints
+├── 000250  # checkpoint_dir for training step 250
+│   ├── pretrained_model  # Hugging Face pretrained model dir
+│   │   ├── config.json  # Hugging Face pretrained model config
+│   │   ├── config.yaml  # consolidated Hydra config
+│   │   ├── model.safetensors  # model weights
+│   │   └── README.md  # Hugging Face model card
+│   └── training_state.pth  # optimizer/scheduler/rng state and training step
+```
+
+To resume training from a checkpoint, you can add these to the `train.py` python command:
+```bash
+    hydra.run.dir=your/original/experiment/dir resume=true
+```
+
+It will load the pretrained model, optimizer and scheduler states for training. For more information please see our tutorial on training resumption [here](https://github.com/huggingface/lerobot/blob/main/examples/5_resume_training.md).
+
+To use wandb for logging training and evaluation curves, make sure you've run `wandb login` as a one-time setup step. Then, when running the training command above, enable WandB in the configuration by adding:
+
+```bash
+    wandb.enable=true
+```
+
+A link to the wandb logs for the run will also show up in yellow in your terminal. Here is an example of what they look like in your browser. Please also check [here](https://github.com/huggingface/lerobot/blob/main/examples/4_train_policy_with_script.md#typical-logs-and-metrics) for the explaination of some commonly used metrics in logs.
+
+![](media/wandb.png)
+
+Note: For efficiency, during training every checkpoint is evaluated on a low number of episodes. You may use `eval.n_episodes=500` to evaluate on more episodes than the default. Or, after training, you may want to re-evaluate your best checkpoints on more episodes or change the evaluation settings. See `python lerobot/scripts/eval.py --help` for more instructions.
+
+#### Reproduce state-of-the-art (SOTA)
+
+We have organized our configuration files (found under [`lerobot/configs`](./lerobot/configs)) such that they reproduce SOTA results from a given model variant in their respective original works. Simply running:
+
+```bash
+python lerobot/scripts/train.py policy=diffusion env=pusht
+```
+
+reproduces SOTA results for Diffusion Policy on the PushT task.
+
+Pretrained policies, along with reproduction details, can be found under the "Models" section of https://huggingface.co/lerobot.
+
+## Contribute
+
+If you would like to contribute to 🤗 LeRobot, please check out our [contribution guide](https://github.com/huggingface/lerobot/blob/main/CONTRIBUTING.md).
+
+### Add a new dataset
+
+To add a dataset to the hub, you need to login using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
+```bash
+huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
+```
+
+Then point to your raw dataset folder (e.g. `data/aloha_static_pingpong_test_raw`), and push your dataset to the hub with:
+```bash
+python lerobot/scripts/push_dataset_to_hub.py \
+--raw-dir data/aloha_static_pingpong_test_raw \
+--out-dir data \
+--repo-id lerobot/aloha_static_pingpong_test \
+--raw-format aloha_hdf5
+```
+
+See `python lerobot/scripts/push_dataset_to_hub.py --help` for more instructions.
+
+If your dataset format is not supported, implement your own in `lerobot/common/datasets/push_dataset_to_hub/${raw_format}_format.py` by copying examples like [pusht_zarr](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/pusht_zarr_format.py), [umi_zarr](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/umi_zarr_format.py), [aloha_hdf5](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/aloha_hdf5_format.py), or [xarm_pkl](https://github.com/huggingface/lerobot/blob/main/lerobot/common/datasets/push_dataset_to_hub/xarm_pkl_format.py).
 
 
-## Profile
+### Add a pretrained policy
 
-**Example**
+Once you have trained a policy you may upload it to the Hugging Face hub using a hub id that looks like `${hf_user}/${repo_name}` (e.g. [lerobot/diffusion_pusht](https://huggingface.co/lerobot/diffusion_pusht)).
+
+You first need to find the checkpoint folder located inside your experiment directory (e.g. `outputs/train/2024-05-05/20-21-12_aloha_act_default/checkpoints/002500`). Within that there is a `pretrained_model` directory which should contain:
+- `config.json`: A serialized version of the policy configuration (following the policy's dataclass config).
+- `model.safetensors`: A set of `torch.nn.Module` parameters, saved in [Hugging Face Safetensors](https://huggingface.co/docs/safetensors/index) format.
+- `config.yaml`: A consolidated Hydra training configuration containing the policy, environment, and dataset configs. The policy configuration should match `config.json` exactly. The environment config is useful for anyone who wants to evaluate your policy. The dataset config just serves as a paper trail for reproducibility.
+
+To upload these to the hub, run the following:
+```bash
+huggingface-cli upload ${hf_user}/${repo_name} path/to/pretrained_model
+```
+
+See [eval.py](https://github.com/huggingface/lerobot/blob/main/lerobot/scripts/eval.py) for an example of how other people may use your policy.
+
+
+### Improve your code with profiling
+
+An example of a code snippet to profile the evaluation of a policy:
 ```python
 from torch.profiler import profile, record_function, ProfilerActivity
 
@@ -85,87 +361,59 @@ with profile(
     with record_function("eval_policy"):
         for i in range(num_episodes):
             prof.step()
+            # insert code to profile, potentially whole body of eval_policy function
 ```
 
-```bash
-python lerobot/scripts/eval.py \
-pretrained_model_path=/home/rcadene/code/fowm/logs/xarm_lift/all/default/2/models/final.pt \
-eval_episodes=7
+## Citation
+
+If you want, you can cite this work with:
+```bibtex
+@misc{cadene2024lerobot,
+    author = {Cadene, Remi and Alibert, Simon and Soare, Alexander and Gallouedec, Quentin and Zouitine, Adil and Wolf, Thomas},
+    title = {LeRobot: State-of-the-art Machine Learning for Real-World Robotics in Pytorch},
+    howpublished = "\url{https://github.com/huggingface/lerobot}",
+    year = {2024}
+}
 ```
 
-## Contribute
+Additionally, if you are using any of the particular policy architecture, pretrained models, or datasets, it is recommended to cite the original authors of the work as they appear below:
 
-**Style**
+- [Diffusion Policy](https://diffusion-policy.cs.columbia.edu)
+```bibtex
+@article{chi2024diffusionpolicy,
+	author = {Cheng Chi and Zhenjia Xu and Siyuan Feng and Eric Cousineau and Yilun Du and Benjamin Burchfiel and Russ Tedrake and Shuran Song},
+	title ={Diffusion Policy: Visuomotor Policy Learning via Action Diffusion},
+	journal = {The International Journal of Robotics Research},
+	year = {2024},
+}
 ```
-# install if needed
-pre-commit install
-# apply style and linter checks before git commit
-pre-commit run -a
+- [ACT or ALOHA](https://tonyzhaozh.github.io/aloha)
+```bibtex
+@article{zhao2023learning,
+  title={Learning fine-grained bimanual manipulation with low-cost hardware},
+  author={Zhao, Tony Z and Kumar, Vikash and Levine, Sergey and Finn, Chelsea},
+  journal={arXiv preprint arXiv:2304.13705},
+  year={2023}
+}
 ```
 
-**Adding dependencies (temporary)**
+- [TDMPC](https://www.nicklashansen.com/td-mpc/)
 
-Right now, for the CI to work, whenever a new dependency is added it needs to be also added to the cpu env, eg:
-
-```
-# Run in this directory, adds the package to the main env with cuda
-poetry add some-package
-
-# Adds the same package to the cpu env
-cd .github/poetry/cpu && poetry add some-package
+```bibtex
+@inproceedings{Hansen2022tdmpc,
+	title={Temporal Difference Learning for Model Predictive Control},
+	author={Nicklas Hansen and Xiaolong Wang and Hao Su},
+	booktitle={ICML},
+	year={2022}
+}
 ```
 
-**Tests**
-
-Install [git lfs](https://git-lfs.com/) to retrieve test artifacts (if you don't have it already).
-
-On Mac:
+- [VQ-BeT](https://sjlee.cc/vq-bet/)
+```bibtex
+@article{lee2024behavior,
+  title={Behavior generation with latent actions},
+  author={Lee, Seungjae and Wang, Yibin and Etukuru, Haritheja and Kim, H Jin and Shafiullah, Nur Muhammad Mahi and Pinto, Lerrel},
+  journal={arXiv preprint arXiv:2403.03181},
+  year={2024}
+}
 ```
-brew install git-lfs
-git lfs install
-```
-
-On Ubuntu:
-```
-sudo apt-get install git-lfs
-git lfs install
-```
-
-Pull artifacts if they're not in [tests/data](tests/data)
-```
-git lfs pull
-```
-
-When adding a new dataset, mock it with
-```
-python tests/scripts/mock_dataset.py --in-data-dir data/<dataset_id> --out-data-dir tests/data/<dataset_id>
-```
-
-Run tests
-```
-DATA_DIR="tests/data" pytest -sx tests
-```
-
-**Datasets**
-
-To add a pytorch rl dataset to the hub, first login and use a token generated from [huggingface settings](https://huggingface.co/settings/tokens) with write access:
-```
-huggingface-cli login --token $HUGGINGFACE_TOKEN --add-to-git-credential
-```
-
-Then you can upload it to the hub with:
-```
-HF_HUB_ENABLE_HF_TRANSFER=1 huggingface-cli upload --repo-type dataset $HF_USER/$DATASET data/$DATASET
-```
-
-For instance, for [cadene/pusht](https://huggingface.co/datasets/cadene/pusht), we used:
-```
-HF_USER=cadene
-DATASET=pusht
-```
-
-
-## Acknowledgment
-- Our Diffusion policy and Pusht environment are adapted from [Diffusion Policy](https://diffusion-policy.cs.columbia.edu/)
-- Our TDMPC policy and Simxarm environment are adapted from [FOWM](https://www.yunhaifeng.com/FOWM/)
-- Our ACT policy and ALOHA environment are adapted from [ALOHA](https://tonyzhaozh.github.io/aloha/)

benchmarks/video/README.md

@@ -0,0 +1,271 @@
+# Video benchmark
+
+
+## Questions
+What is the optimal trade-off between:
+- maximizing loading time with random access,
+- minimizing memory space on disk,
+- maximizing success rate of policies,
+- compatibility across devices/platforms for decoding videos (e.g. video players, web browsers).
+
+How to encode videos?
+- Which video codec (`-vcodec`) to use? h264, h265, AV1?
+- What pixel format to use (`-pix_fmt`)? `yuv444p` or `yuv420p`?
+- How much compression (`-crf`)? No compression with `0`, intermediate compression with `25` or extreme with `50+`?
+- Which frequency to chose for key frames (`-g`)? A key frame every `10` frames?
+
+How to decode videos?
+- Which `decoder`? `torchvision`, `torchaudio`, `ffmpegio`, `decord`, or `nvc`?
+- What scenarios to use for the requesting timestamps during benchmark? (`timestamps_mode`)
+
+
+## Variables
+**Image content & size**
+We don't expect the same optimal settings for a dataset of images from a simulation, or from real-world in an appartment, or in a factory, or outdoor, or with lots of moving objects in the scene, etc. Similarly, loading times might not vary linearly with the image size (resolution).
+For these reasons, we run this benchmark on four representative datasets:
+- `lerobot/pusht_image`: (96 x 96 pixels) simulation with simple geometric shapes, fixed camera.
+- `aliberts/aloha_mobile_shrimp_image`: (480 x 640 pixels) real-world indoor, moving camera.
+- `aliberts/paris_street`: (720 x 1280 pixels) real-world outdoor, moving camera.
+- `aliberts/kitchen`: (1080 x 1920 pixels) real-world indoor, fixed camera.
+
+Note: The datasets used for this benchmark need to be image datasets, not video datasets.
+
+**Data augmentations**
+We might revisit this benchmark and find better settings if we train our policies with various data augmentations to make them more robust (e.g. robust to color changes, compression, etc.).
+
+### Encoding parameters
+| parameter   | values                                                       |
+|-------------|--------------------------------------------------------------|
+| **vcodec**  | `libx264`, `libx265`, `libsvtav1`                            |
+| **pix_fmt** | `yuv444p`, `yuv420p`                                         |
+| **g**       | `1`, `2`, `3`, `4`, `5`, `6`, `10`, `15`, `20`, `40`, `None` |
+| **crf**     | `0`, `5`, `10`, `15`, `20`, `25`, `30`, `40`, `50`, `None`   |
+
+Note that `crf` value might be interpreted differently by various video codecs. In other words, the same value used with one codec doesn't necessarily translate into the same compression level with another codec. In fact, the default value (`None`) isn't the same amongst the different video codecs. Importantly, it is also the case for many other ffmpeg arguments like `g` which specifies the frequency of the key frames.
+
+For a comprehensive list and documentation of these parameters, see the ffmpeg documentation depending on the video codec used:
+- h264: https://trac.ffmpeg.org/wiki/Encode/H.264
+- h265: https://trac.ffmpeg.org/wiki/Encode/H.265
+- AV1: https://trac.ffmpeg.org/wiki/Encode/AV1
+
+### Decoding parameters
+**Decoder**
+We tested two video decoding backends from torchvision:
+- `pyav` (default)
+- `video_reader` (requires to build torchvision from source)
+
+**Requested timestamps**
+Given the way video decoding works, once a keyframe has been loaded, the decoding of subsequent frames is fast.
+This of course is affected by the `-g` parameter during encoding, which specifies the frequency of the keyframes. Given our typical use cases in robotics policies which might request a few timestamps in different random places, we want to replicate these use cases with the following scenarios:
+- `1_frame`: 1 frame,
+- `2_frames`: 2 consecutive frames (e.g. `[t, t + 1 / fps]`),
+- `6_frames`: 6 consecutive frames (e.g. `[t + i / fps for i in range(6)]`)
+
+Note that this differs significantly from a typical use case like watching a movie, in which every frame is loaded sequentially from the beginning to the end and it's acceptable to have big values for `-g`.
+
+Additionally, because some policies might request single timestamps that are a few frames appart, we also have the following scenario:
+- `2_frames_4_space`: 2 frames with 4 consecutive frames of spacing in between (e.g `[t, t + 5 / fps]`),
+
+However, due to how video decoding is implemented with `pyav`, we don't have access to an accurate seek so in practice this scenario is essentially the same as `6_frames` since all 6 frames between `t` and `t + 5 / fps` will be decoded.
+
+
+## Metrics
+**Data compression ratio (lower is better)**
+`video_images_size_ratio` is the ratio of the memory space on disk taken by the encoded video over the memory space taken by the original images. For instance, `video_images_size_ratio=25%` means that the video takes 4 times less memory space on disk compared to the original images.
+
+**Loading time ratio (lower is better)**
+`video_images_load_time_ratio` is the ratio of the time it takes to decode frames from the video at a given timestamps over the time it takes to load the exact same original images. Lower is better. For instance, `video_images_load_time_ratio=200%` means that decoding from video is 2 times slower than loading the original images.
+
+**Average Mean Square Error (lower is better)**
+`avg_mse` is the average mean square error between each decoded frame and its corresponding original image over all requested timestamps, and also divided by the number of pixels in the image to be comparable when switching to different image sizes.
+
+**Average Peak Signal to Noise Ratio (higher is better)**
+`avg_psnr` measures the ratio between the maximum possible power of a signal and the power of corrupting noise that affects the fidelity of its representation. Higher PSNR indicates better quality.
+
+**Average Structural Similarity Index Measure (higher is better)**
+`avg_ssim` evaluates the perceived quality of images by comparing luminance, contrast, and structure. SSIM values range from -1 to 1, where 1 indicates perfect similarity.
+
+One aspect that can't be measured here with those metrics is the compatibility of the encoding accross platforms, in particular on web browser, for visualization purposes.
+h264, h265 and AV1 are all commonly used codecs and should not be pose an issue. However, the chroma subsampling (`pix_fmt`) format might affect compatibility:
+- `yuv420p` is more widely supported across various platforms, including web browsers.
+- `yuv444p` offers higher color fidelity but might not be supported as broadly.
+
+
+<!-- **Loss of a pretrained policy (higher is better)** (not available)
+`loss_pretrained` is the result of evaluating with the selected encoding/decoding settings a policy pretrained on original images. It is easier to understand than `avg_l2_error`.
+
+**Success rate after retraining (higher is better)** (not available)
+`success_rate` is the result of training and evaluating a policy with the selected encoding/decoding settings. It is the most difficult metric to get but also the very best. -->
+
+
+## How the benchmark works
+The benchmark evaluates both encoding and decoding of video frames on the first episode of each dataset.
+
+**Encoding:** for each `vcodec` and `pix_fmt` pair, we use a default value for `g` and `crf` upon which we change a single value (either `g` or `crf`) to one of the specified values (we don't test every combination of those as this would be computationally too heavy).
+This gives a unique set of encoding parameters which is used to encode the episode.
+
+**Decoding:** Then, for each of those unique encodings, we iterate through every combination of the decoding parameters `backend` and `timestamps_mode`. For each of them, we record the metrics of a number of samples (given by `--num-samples`). This is parallelized for efficiency and the number of processes can be controlled with `--num-workers`. Ideally, it's best to have a `--num-samples` that is divisible by `--num-workers`.
+
+Intermediate results saved for each `vcodec` and `pix_fmt` combination in csv tables.
+These are then all concatenated to a single table ready for analysis.
+
+## Caveats
+We tried to measure the most impactful parameters for both encoding and decoding. However, for computational reasons we can't test out every combination.
+
+Additional encoding parameters exist that are not included in this benchmark. In particular:
+- `-preset` which allows for selecting encoding presets. This represents a collection of options that will provide a certain encoding speed to compression ratio. By leaving this parameter unspecified, it is considered to be `medium` for libx264 and libx265 and `8` for libsvtav1.
+- `-tune` which allows to optimize the encoding for certains aspects (e.g. film quality, fast decoding, etc.).
+
+See the documentation mentioned above for more detailled info on these settings and for a more comprehensive list of other parameters.
+
+Similarly on the decoding side, other decoders exist but are not implemented in our current benchmark. To name a few:
+- `torchaudio`
+- `ffmpegio`
+- `decord`
+- `nvc`
+
+Note as well that since we are mostly interested in the performance at decoding time (also because encoding is done only once before uploading a dataset), we did not measure encoding times nor have any metrics regarding encoding.
+However, besides the necessity to build ffmpeg from source, encoding did not pose any issue and it didn't take a significant amount of time during this benchmark.
+
+
+## Install
+Building ffmpeg from source is required to include libx265 and libaom/libsvtav1 (av1) video codecs ([compilation guide](https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu)).
+
+**Note:** While you still need to build torchvision with a conda-installed `ffmpeg<4.3` to use the `video_reader` decoder (as described in [#220](https://github.com/huggingface/lerobot/pull/220)), you also need another version which is custom-built with all the video codecs for encoding. For the script to then use that version, you can prepend the command above with `PATH="$HOME/bin:$PATH"`, which is where ffmpeg should be built.
+
+
+## Adding a video decoder
+Right now, we're only benchmarking the two video decoder available with torchvision: `pyav` and `video_reader`.
+You can easily add a new decoder to benchmark by adding it to this function in the script:
+```diff
+def decode_video_frames(
+    video_path: str,
+    timestamps: list[float],
+    tolerance_s: float,
+    backend: str,
+) -> torch.Tensor:
+    if backend in ["pyav", "video_reader"]:
+        return decode_video_frames_torchvision(
+            video_path, timestamps, tolerance_s, backend
+        )
++    elif backend == ["your_decoder"]:
++        return your_decoder_function(
++            video_path, timestamps, tolerance_s, backend
++        )
+    else:
+        raise NotImplementedError(backend)
+```
+
+
+## Example
+For a quick run, you can try these parameters:
+```bash
+python benchmark/video/run_video_benchmark.py \
+    --output-dir outputs/video_benchmark \
+    --repo-ids \
+        lerobot/pusht_image \
+        aliberts/aloha_mobile_shrimp_image \
+    --vcodec libx264 libx265 \
+    --pix-fmt yuv444p yuv420p \
+    --g 2 20 None \
+    --crf 10 40 None \
+    --timestamps-modes 1_frame 2_frames \
+    --backends pyav video_reader \
+    --num-samples 5 \
+    --num-workers 5 \
+    --save-frames 0
+```
+
+
+## Results
+
+### Reproduce
+We ran the benchmark with the following parameters:
+```bash
+# h264 and h265 encodings
+python benchmark/video/run_video_benchmark.py \
+    --output-dir outputs/video_benchmark \
+    --repo-ids \
+        lerobot/pusht_image \
+        aliberts/aloha_mobile_shrimp_image \
+        aliberts/paris_street \
+        aliberts/kitchen \
+    --vcodec libx264 libx265 \
+    --pix-fmt yuv444p yuv420p \
+    --g 1 2 3 4 5 6 10 15 20 40 None \
+    --crf 0 5 10 15 20 25 30 40 50 None \
+    --timestamps-modes 1_frame 2_frames 6_frames \
+    --backends pyav video_reader \
+    --num-samples 50 \
+    --num-workers 5 \
+    --save-frames 1
+
+# av1 encoding (only compatible with yuv420p and pyav decoder)
+python benchmark/video/run_video_benchmark.py \
+    --output-dir outputs/video_benchmark \
+    --repo-ids \
+        lerobot/pusht_image \
+        aliberts/aloha_mobile_shrimp_image \
+        aliberts/paris_street \
+        aliberts/kitchen \
+    --vcodec libsvtav1 \
+    --pix-fmt yuv420p \
+    --g 1 2 3 4 5 6 10 15 20 40 None \
+    --crf 0 5 10 15 20 25 30 40 50 None \
+    --timestamps-modes 1_frame 2_frames 6_frames \
+    --backends pyav \
+    --num-samples 50 \
+    --num-workers 5 \
+    --save-frames 1
+```
+
+The full results are available [here](https://docs.google.com/spreadsheets/d/1OYJB43Qu8fC26k_OyoMFgGBBKfQRCi4BIuYitQnq3sw/edit?usp=sharing)
+
+
+### Parameters selected for LeRobotDataset
+Considering these results, we chose what we think is the best set of encoding parameter:
+- vcodec: `libsvtav1`
+- pix-fmt: `yuv420p`
+- g: `2`
+- crf: `30`
+
+Since we're using av1 encoding, we're choosing the `pyav` decoder as `video_reader` does not support it (and `pyav` doesn't require a custom build of `torchvision`).
+
+### Summary
+
+These tables show the results for `g=2` and `crf=30`, using `timestamps-modes=6_frames` and `backend=pyav`
+
+| video_images_size_ratio            | vcodec     | pix_fmt |           |           |           |
+|------------------------------------|------------|---------|-----------|-----------|-----------|
+|                                    | libx264    |         | libx265   |           | libsvtav1 |
+| repo_id                            | yuv420p    | yuv444p | yuv420p   | yuv444p   | yuv420p   |
+| lerobot/pusht_image                | **16.97%** | 17.58%  | 18.57%    | 18.86%    | 22.06%    |
+| aliberts/aloha_mobile_shrimp_image | 2.14%      | 2.11%   | 1.38%     | **1.37%** | 5.59%     |
+| aliberts/paris_street              | 2.12%      | 2.13%   | **1.54%** | **1.54%** | 4.43%     |
+| aliberts/kitchen                   | 1.40%      | 1.39%   | **1.00%** | **1.00%** | 2.52%     |
+
+| video_images_load_time_ratio       | vcodec  | pix_fmt |          |         |           |
+|------------------------------------|---------|---------|----------|---------|-----------|
+|                                    | libx264 |         | libx265  |         | libsvtav1 |
+| repo_id                            | yuv420p | yuv444p | yuv420p  | yuv444p | yuv420p   |
+| lerobot/pusht_image                | 6.45    | 5.19    | **1.90** | 2.12    | 2.47      |
+| aliberts/aloha_mobile_shrimp_image | 11.80   | 7.92    | 0.71     | 0.85    | **0.48**  |
+| aliberts/paris_street              | 2.21    | 2.05    | 0.36     | 0.49    | **0.30**  |
+| aliberts/kitchen                   | 1.46    | 1.46    | 0.28     | 0.51    | **0.26**  |
+
+|                                    |          | vcodec   | pix_fmt      |          |           |              |
+|------------------------------------|----------|----------|--------------|----------|-----------|--------------|
+|                                    |          | libx264  |              | libx265  |           | libsvtav1    |
+| repo_id                            | metric   | yuv420p  | yuv444p      | yuv420p  | yuv444p   | yuv420p      |
+| lerobot/pusht_image                | avg_mse  | 2.90E-04 | **2.03E-04** | 3.13E-04 | 2.29E-04  | 2.19E-04     |
+|                                    | avg_psnr | 35.44    | 37.07        | 35.49    | **37.30** | 37.20        |
+|                                    | avg_ssim | 98.28%   | **98.85%**   | 98.31%   | 98.84%    | 98.72%       |
+| aliberts/aloha_mobile_shrimp_image | avg_mse  | 2.76E-04 | 2.59E-04     | 3.17E-04 | 3.06E-04  | **1.30E-04** |
+|                                    | avg_psnr | 35.91    | 36.21        | 35.88    | 36.09     | **40.17**    |
+|                                    | avg_ssim | 95.19%   | 95.18%       | 95.00%   | 95.05%    | **97.73%**   |
+| aliberts/paris_street              | avg_mse  | 6.89E-04 | 6.70E-04     | 4.03E-03 | 4.02E-03  | **3.09E-04** |
+|                                    | avg_psnr | 33.48    | 33.68        | 32.05    | 32.15     | **35.40**    |
+|                                    | avg_ssim | 93.76%   | 93.75%       | 89.46%   | 89.46%    | **95.46%**   |
+| aliberts/kitchen                   | avg_mse  | 2.50E-04 | 2.24E-04     | 4.28E-04 | 4.18E-04  | **1.53E-04** |
+|                                    | avg_psnr | 36.73    | 37.33        | 36.56    | 36.75     | **39.12**    |
+|                                    | avg_ssim | 95.47%   | 95.58%       | 95.52%   | 95.53%    | **96.82%**   |

benchmarks/video/capture_camera_feed.py

@@ -0,0 +1,90 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Capture video feed from a camera as raw images."""
+
+import argparse
+import datetime as dt
+from pathlib import Path
+
+import cv2
+
+
+def display_and_save_video_stream(output_dir: Path, fps: int, width: int, height: int):
+    now = dt.datetime.now()
+    capture_dir = output_dir / f"{now:%Y-%m-%d}" / f"{now:%H-%M-%S}"
+    if not capture_dir.exists():
+        capture_dir.mkdir(parents=True, exist_ok=True)
+
+    # Opens the default webcam
+    cap = cv2.VideoCapture(0)
+    if not cap.isOpened():
+        print("Error: Could not open video stream.")
+        return
+
+    cap.set(cv2.CAP_PROP_FPS, fps)
+    cap.set(cv2.CAP_PROP_FRAME_WIDTH, width)
+    cap.set(cv2.CAP_PROP_FRAME_HEIGHT, height)
+
+    frame_index = 0
+    while True:
+        ret, frame = cap.read()
+
+        if not ret:
+            print("Error: Could not read frame.")
+            break
+
+        cv2.imshow("Video Stream", frame)
+        cv2.imwrite(str(capture_dir / f"frame_{frame_index:06d}.png"), frame)
+        frame_index += 1
+
+        # Break the loop on 'q' key press
+        if cv2.waitKey(1) & 0xFF == ord("q"):
+            break
+
+    # Release the capture and destroy all windows
+    cap.release()
+    cv2.destroyAllWindows()
+
+
+if __name__ == "__main__":
+    parser = argparse.ArgumentParser()
+
+    parser.add_argument(
+        "--output-dir",
+        type=Path,
+        default=Path("outputs/cam_capture/"),
+        help="Directory where the capture images are written. A subfolder named with the current date & time will be created inside it for each capture.",
+    )
+    parser.add_argument(
+        "--fps",
+        type=int,
+        default=30,
+        help="Frames Per Second of the capture.",
+    )
+    parser.add_argument(
+        "--width",
+        type=int,
+        default=1280,
+        help="Width of the captured images.",
+    )
+    parser.add_argument(
+        "--height",
+        type=int,
+        default=720,
+        help="Height of the captured images.",
+    )
+    args = parser.parse_args()
+    display_and_save_video_stream(**vars(args))

benchmarks/video/run_video_benchmark.py

@@ -0,0 +1,490 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Assess the performance of video decoding in various configurations.
+
+This script will benchmark different video encoding and decoding parameters.
+See the provided README.md or run `python benchmark/video/run_video_benchmark.py --help` for usage info.
+"""
+
+import argparse
+import datetime as dt
+import random
+import shutil
+from collections import OrderedDict
+from concurrent.futures import ThreadPoolExecutor, as_completed
+from pathlib import Path
+
+import einops
+import numpy as np
+import pandas as pd
+import PIL
+import torch
+from skimage.metrics import mean_squared_error, peak_signal_noise_ratio, structural_similarity
+from tqdm import tqdm
+
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
+from lerobot.common.datasets.video_utils import (
+    decode_video_frames_torchvision,
+    encode_video_frames,
+)
+from lerobot.common.utils.benchmark import TimeBenchmark
+
+BASE_ENCODING = OrderedDict(
+    [
+        ("vcodec", "libx264"),
+        ("pix_fmt", "yuv444p"),
+        ("g", 2),
+        ("crf", None),
+        # TODO(aliberts): Add fastdecode
+        # ("fastdecode", 0),
+    ]
+)
+
+
+# TODO(rcadene, aliberts): move to `utils.py` folder when we want to refactor
+def parse_int_or_none(value) -> int | None:
+    if value.lower() == "none":
+        return None
+    try:
+        return int(value)
+    except ValueError as e:
+        raise argparse.ArgumentTypeError(f"Invalid int or None: {value}") from e
+
+
+def check_datasets_formats(repo_ids: list) -> None:
+    for repo_id in repo_ids:
+        dataset = LeRobotDataset(repo_id)
+        if dataset.video:
+            raise ValueError(
+                f"Use only image dataset for running this benchmark. Video dataset provided: {repo_id}"
+            )
+
+
+def get_directory_size(directory: Path) -> int:
+    total_size = 0
+    for item in directory.rglob("*"):
+        if item.is_file():
+            total_size += item.stat().st_size
+    return total_size
+
+
+def load_original_frames(imgs_dir: Path, timestamps: list[float], fps: int) -> torch.Tensor:
+    frames = []
+    for ts in timestamps:
+        idx = int(ts * fps)
+        frame = PIL.Image.open(imgs_dir / f"frame_{idx:06d}.png")
+        frame = torch.from_numpy(np.array(frame))
+        frame = frame.type(torch.float32) / 255
+        frame = einops.rearrange(frame, "h w c -> c h w")
+        frames.append(frame)
+    return torch.stack(frames)
+
+
+def save_decoded_frames(
+    imgs_dir: Path, save_dir: Path, frames: torch.Tensor, timestamps: list[float], fps: int
+) -> None:
+    if save_dir.exists() and len(list(save_dir.glob("frame_*.png"))) == len(timestamps):
+        return
+
+    save_dir.mkdir(parents=True, exist_ok=True)
+    for i, ts in enumerate(timestamps):
+        idx = int(ts * fps)
+        frame_hwc = (frames[i].permute((1, 2, 0)) * 255).type(torch.uint8).cpu().numpy()
+        PIL.Image.fromarray(frame_hwc).save(save_dir / f"frame_{idx:06d}_decoded.png")
+        shutil.copyfile(imgs_dir / f"frame_{idx:06d}.png", save_dir / f"frame_{idx:06d}_original.png")
+
+
+def save_first_episode(imgs_dir: Path, dataset: LeRobotDataset) -> None:
+    ep_num_images = dataset.episode_data_index["to"][0].item()
+    if imgs_dir.exists() and len(list(imgs_dir.glob("frame_*.png"))) == ep_num_images:
+        return
+
+    imgs_dir.mkdir(parents=True, exist_ok=True)
+    hf_dataset = dataset.hf_dataset.with_format(None)
+
+    # We only save images from the first camera
+    img_keys = [key for key in hf_dataset.features if key.startswith("observation.image")]
+    imgs_dataset = hf_dataset.select_columns(img_keys[0])
+
+    for i, item in enumerate(
+        tqdm(imgs_dataset, desc=f"saving {dataset.repo_id} first episode images", leave=False)
+    ):
+        img = item[img_keys[0]]
+        img.save(str(imgs_dir / f"frame_{i:06d}.png"), quality=100)
+
+        if i >= ep_num_images - 1:
+            break
+
+
+def sample_timestamps(timestamps_mode: str, ep_num_images: int, fps: int) -> list[float]:
+    # Start at 5 to allow for 2_frames_4_space and 6_frames
+    idx = random.randint(5, ep_num_images - 1)
+    match timestamps_mode:
+        case "1_frame":
+            frame_indexes = [idx]
+        case "2_frames":
+            frame_indexes = [idx - 1, idx]
+        case "2_frames_4_space":
+            frame_indexes = [idx - 5, idx]
+        case "6_frames":
+            frame_indexes = [idx - i for i in range(6)][::-1]
+        case _:
+            raise ValueError(timestamps_mode)
+
+    return [idx / fps for idx in frame_indexes]
+
+
+def decode_video_frames(
+    video_path: str,
+    timestamps: list[float],
+    tolerance_s: float,
+    backend: str,
+) -> torch.Tensor:
+    if backend in ["pyav", "video_reader"]:
+        return decode_video_frames_torchvision(video_path, timestamps, tolerance_s, backend)
+    else:
+        raise NotImplementedError(backend)
+
+
+def benchmark_decoding(
+    imgs_dir: Path,
+    video_path: Path,
+    timestamps_mode: str,
+    backend: str,
+    ep_num_images: int,
+    fps: int,
+    num_samples: int = 50,
+    num_workers: int = 4,
+    save_frames: bool = False,
+) -> dict:
+    def process_sample(sample: int):
+        time_benchmark = TimeBenchmark()
+        timestamps = sample_timestamps(timestamps_mode, ep_num_images, fps)
+        num_frames = len(timestamps)
+        result = {
+            "psnr_values": [],
+            "ssim_values": [],
+            "mse_values": [],
+        }
+
+        with time_benchmark:
+            frames = decode_video_frames(video_path, timestamps=timestamps, tolerance_s=5e-1, backend=backend)
+        result["load_time_video_ms"] = time_benchmark.result_ms / num_frames
+
+        with time_benchmark:
+            original_frames = load_original_frames(imgs_dir, timestamps, fps)
+        result["load_time_images_ms"] = time_benchmark.result_ms / num_frames
+
+        frames_np, original_frames_np = frames.numpy(), original_frames.numpy()
+        for i in range(num_frames):
+            result["mse_values"].append(mean_squared_error(original_frames_np[i], frames_np[i]))
+            result["psnr_values"].append(
+                peak_signal_noise_ratio(original_frames_np[i], frames_np[i], data_range=1.0)
+            )
+            result["ssim_values"].append(
+                structural_similarity(original_frames_np[i], frames_np[i], data_range=1.0, channel_axis=0)
+            )
+
+        if save_frames and sample == 0:
+            save_dir = video_path.with_suffix("") / f"{timestamps_mode}_{backend}"
+            save_decoded_frames(imgs_dir, save_dir, frames, timestamps, fps)
+
+        return result
+
+    load_times_video_ms = []
+    load_times_images_ms = []
+    mse_values = []
+    psnr_values = []
+    ssim_values = []
+
+    # A sample is a single set of decoded frames specified by timestamps_mode (e.g. a single frame, 2 frames, etc.).
+    # For each sample, we record metrics (loading time and quality metrics) which are then averaged over all samples.
+    # As these samples are independent, we run them in parallel threads to speed up the benchmark.
+    with ThreadPoolExecutor(max_workers=num_workers) as executor:
+        futures = [executor.submit(process_sample, i) for i in range(num_samples)]
+        for future in tqdm(as_completed(futures), total=num_samples, desc="samples", leave=False):
+            result = future.result()
+            load_times_video_ms.append(result["load_time_video_ms"])
+            load_times_images_ms.append(result["load_time_images_ms"])
+            psnr_values.extend(result["psnr_values"])
+            ssim_values.extend(result["ssim_values"])
+            mse_values.extend(result["mse_values"])
+
+    avg_load_time_video_ms = float(np.array(load_times_video_ms).mean())
+    avg_load_time_images_ms = float(np.array(load_times_images_ms).mean())
+    video_images_load_time_ratio = avg_load_time_video_ms / avg_load_time_images_ms
+
+    return {
+        "avg_load_time_video_ms": avg_load_time_video_ms,
+        "avg_load_time_images_ms": avg_load_time_images_ms,
+        "video_images_load_time_ratio": video_images_load_time_ratio,
+        "avg_mse": float(np.mean(mse_values)),
+        "avg_psnr": float(np.mean(psnr_values)),
+        "avg_ssim": float(np.mean(ssim_values)),
+    }
+
+
+def benchmark_encoding_decoding(
+    dataset: LeRobotDataset,
+    video_path: Path,
+    imgs_dir: Path,
+    encoding_cfg: dict,
+    decoding_cfg: dict,
+    num_samples: int,
+    num_workers: int,
+    save_frames: bool,
+    overwrite: bool = False,
+    seed: int = 1337,
+) -> list[dict]:
+    fps = dataset.fps
+
+    if overwrite or not video_path.is_file():
+        tqdm.write(f"encoding {video_path}")
+        encode_video_frames(
+            imgs_dir=imgs_dir,
+            video_path=video_path,
+            fps=fps,
+            vcodec=encoding_cfg["vcodec"],
+            pix_fmt=encoding_cfg["pix_fmt"],
+            g=encoding_cfg.get("g"),
+            crf=encoding_cfg.get("crf"),
+            # fast_decode=encoding_cfg.get("fastdecode"),
+            overwrite=True,
+        )
+
+    ep_num_images = dataset.episode_data_index["to"][0].item()
+    width, height = tuple(dataset[0][dataset.camera_keys[0]].shape[-2:])
+    num_pixels = width * height
+    video_size_bytes = video_path.stat().st_size
+    images_size_bytes = get_directory_size(imgs_dir)
+    video_images_size_ratio = video_size_bytes / images_size_bytes
+
+    random.seed(seed)
+    benchmark_table = []
+    for timestamps_mode in tqdm(
+        decoding_cfg["timestamps_modes"], desc="decodings (timestamps_modes)", leave=False
+    ):
+        for backend in tqdm(decoding_cfg["backends"], desc="decodings (backends)", leave=False):
+            benchmark_row = benchmark_decoding(
+                imgs_dir,
+                video_path,
+                timestamps_mode,
+                backend,
+                ep_num_images,
+                fps,
+                num_samples,
+                num_workers,
+                save_frames,
+            )
+            benchmark_row.update(
+                **{
+                    "repo_id": dataset.repo_id,
+                    "resolution": f"{width} x {height}",
+                    "num_pixels": num_pixels,
+                    "video_size_bytes": video_size_bytes,
+                    "images_size_bytes": images_size_bytes,
+                    "video_images_size_ratio": video_images_size_ratio,
+                    "timestamps_mode": timestamps_mode,
+                    "backend": backend,
+                },
+                **encoding_cfg,
+            )
+            benchmark_table.append(benchmark_row)
+
+    return benchmark_table
+
+
+def main(
+    output_dir: Path,
+    repo_ids: list[str],
+    vcodec: list[str],
+    pix_fmt: list[str],
+    g: list[int],
+    crf: list[int],
+    # fastdecode: list[int],
+    timestamps_modes: list[str],
+    backends: list[str],
+    num_samples: int,
+    num_workers: int,
+    save_frames: bool,
+):
+    check_datasets_formats(repo_ids)
+    encoding_benchmarks = {
+        "g": g,
+        "crf": crf,
+        # "fastdecode": fastdecode,
+    }
+    decoding_benchmarks = {
+        "timestamps_modes": timestamps_modes,
+        "backends": backends,
+    }
+    headers = ["repo_id", "resolution", "num_pixels"]
+    headers += list(BASE_ENCODING.keys())
+    headers += [
+        "timestamps_mode",
+        "backend",
+        "video_size_bytes",
+        "images_size_bytes",
+        "video_images_size_ratio",
+        "avg_load_time_video_ms",
+        "avg_load_time_images_ms",
+        "video_images_load_time_ratio",
+        "avg_mse",
+        "avg_psnr",
+        "avg_ssim",
+    ]
+    file_paths = []
+    for video_codec in tqdm(vcodec, desc="encodings (vcodec)"):
+        for pixel_format in tqdm(pix_fmt, desc="encodings (pix_fmt)", leave=False):
+            benchmark_table = []
+            for repo_id in tqdm(repo_ids, desc="encodings (datasets)", leave=False):
+                dataset = LeRobotDataset(repo_id)
+                imgs_dir = output_dir / "images" / dataset.repo_id.replace("/", "_")
+                # We only use the first episode
+                save_first_episode(imgs_dir, dataset)
+                for key, values in tqdm(encoding_benchmarks.items(), desc="encodings (g, crf)", leave=False):
+                    for value in tqdm(values, desc=f"encodings ({key})", leave=False):
+                        encoding_cfg = BASE_ENCODING.copy()
+                        encoding_cfg["vcodec"] = video_codec
+                        encoding_cfg["pix_fmt"] = pixel_format
+                        encoding_cfg[key] = value
+                        args_path = Path("_".join(str(value) for value in encoding_cfg.values()))
+                        video_path = output_dir / "videos" / args_path / f"{repo_id.replace('/', '_')}.mp4"
+                        benchmark_table += benchmark_encoding_decoding(
+                            dataset,
+                            video_path,
+                            imgs_dir,
+                            encoding_cfg,
+                            decoding_benchmarks,
+                            num_samples,
+                            num_workers,
+                            save_frames,
+                        )
+
+            # Save intermediate results
+            benchmark_df = pd.DataFrame(benchmark_table, columns=headers)
+            now = dt.datetime.now()
+            csv_path = (
+                output_dir
+                / f"{now:%Y-%m-%d}_{now:%H-%M-%S}_{video_codec}_{pixel_format}_{num_samples}-samples.csv"
+            )
+            benchmark_df.to_csv(csv_path, header=True, index=False)
+            file_paths.append(csv_path)
+            del benchmark_df
+
+    # Concatenate all results
+    df_list = [pd.read_csv(csv_path) for csv_path in file_paths]
+    concatenated_df = pd.concat(df_list, ignore_index=True)
+    concatenated_path = output_dir / f"{now:%Y-%m-%d}_{now:%H-%M-%S}_all_{num_samples}-samples.csv"
+    concatenated_df.to_csv(concatenated_path, header=True, index=False)
+
+
+if __name__ == "__main__":
+    parser = argparse.ArgumentParser()
+    parser.add_argument(
+        "--output-dir",
+        type=Path,
+        default=Path("outputs/video_benchmark"),
+        help="Directory where the video benchmark outputs are written.",
+    )
+    parser.add_argument(
+        "--repo-ids",
+        type=str,
+        nargs="*",
+        default=[
+            "lerobot/pusht_image",
+            "aliberts/aloha_mobile_shrimp_image",
+            "aliberts/paris_street",
+            "aliberts/kitchen",
+        ],
+        help="Datasets repo-ids to test against. First episodes only are used. Must be images.",
+    )
+    parser.add_argument(
+        "--vcodec",
+        type=str,
+        nargs="*",
+        default=["libx264", "libx265", "libsvtav1"],
+        help="Video codecs to be tested",
+    )
+    parser.add_argument(
+        "--pix-fmt",
+        type=str,
+        nargs="*",
+        default=["yuv444p", "yuv420p"],
+        help="Pixel formats (chroma subsampling) to be tested",
+    )
+    parser.add_argument(
+        "--g",
+        type=parse_int_or_none,
+        nargs="*",
+        default=[1, 2, 3, 4, 5, 6, 10, 15, 20, 40, 100, None],
+        help="Group of pictures sizes to be tested.",
+    )
+    parser.add_argument(
+        "--crf",
+        type=parse_int_or_none,
+        nargs="*",
+        default=[0, 5, 10, 15, 20, 25, 30, 40, 50, None],
+        help="Constant rate factors to be tested.",
+    )
+    # parser.add_argument(
+    #     "--fastdecode",
+    #     type=int,
+    #     nargs="*",
+    #     default=[0, 1],
+    #     help="Use the fastdecode tuning option. 0 disables it. "
+    #         "For libx264 and libx265, only 1 is possible. "
+    #         "For libsvtav1, 1, 2 or 3 are possible values with a higher number meaning a faster decoding optimization",
+    # )
+    parser.add_argument(
+        "--timestamps-modes",
+        type=str,
+        nargs="*",
+        default=[
+            "1_frame",
+            "2_frames",
+            "2_frames_4_space",
+            "6_frames",
+        ],
+        help="Timestamps scenarios to be tested.",
+    )
+    parser.add_argument(
+        "--backends",
+        type=str,
+        nargs="*",
+        default=["pyav", "video_reader"],
+        help="Torchvision decoding backend to be tested.",
+    )
+    parser.add_argument(
+        "--num-samples",
+        type=int,
+        default=50,
+        help="Number of samples for each encoding x decoding config.",
+    )
+    parser.add_argument(
+        "--num-workers",
+        type=int,
+        default=10,
+        help="Number of processes for parallelized sample processing.",
+    )
+    parser.add_argument(
+        "--save-frames",
+        type=int,
+        default=0,
+        help="Whether to save decoded frames or not. Enter a non-zero number for true.",
+    )
+    args = parser.parse_args()
+    main(**vars(args))

docker/lerobot-cpu/Dockerfile

@@ -0,0 +1,32 @@
+# Configure image
+ARG PYTHON_VERSION=3.10
+
+FROM python:${PYTHON_VERSION}-slim
+ARG PYTHON_VERSION
+ARG DEBIAN_FRONTEND=noninteractive
+
+# Install apt dependencies
+RUN apt-get update && apt-get install -y --no-install-recommends \
+    build-essential cmake \
+    libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
+    speech-dispatcher \
+    && apt-get clean && rm -rf /var/lib/apt/lists/*
+
+# Create virtual environment
+RUN ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python
+RUN python -m venv /opt/venv
+ENV PATH="/opt/venv/bin:$PATH"
+RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
+
+# Install LeRobot
+COPY . /lerobot
+WORKDIR /lerobot
+RUN pip install --upgrade --no-cache-dir pip
+RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]" \
+    --extra-index-url https://download.pytorch.org/whl/cpu
+
+# Set EGL as the rendering backend for MuJoCo
+ENV MUJOCO_GL="egl"
+
+# Execute in bash shell rather than python
+CMD ["/bin/bash"]

docker/lerobot-gpu-dev/Dockerfile

@@ -0,0 +1,68 @@
+FROM nvidia/cuda:12.2.2-devel-ubuntu22.04
+
+# Configure image
+ARG PYTHON_VERSION=3.10
+ARG DEBIAN_FRONTEND=noninteractive
+
+# Install apt dependencies
+RUN apt-get update && apt-get install -y --no-install-recommends \
+    build-essential cmake \
+    git git-lfs openssh-client \
+    nano vim less util-linux tree \
+    htop atop nvtop \
+    sed gawk grep curl wget zip unzip \
+    tcpdump sysstat screen tmux \
+    libglib2.0-0 libgl1-mesa-glx libegl1-mesa \
+    speech-dispatcher \
+    python${PYTHON_VERSION} python${PYTHON_VERSION}-venv \
+    && apt-get clean && rm -rf /var/lib/apt/lists/*
+
+# Install ffmpeg build dependencies. See:
+# https://trac.ffmpeg.org/wiki/CompilationGuide/Ubuntu
+# TODO(aliberts): create image to build dependencies from source instead
+RUN apt-get update && apt-get install -y --no-install-recommends \
+    autoconf automake yasm \
+    libass-dev \
+    libfreetype6-dev \
+    libgnutls28-dev \
+    libunistring-dev \
+    libmp3lame-dev \
+    libtool \
+    libvorbis-dev \
+    meson \
+    ninja-build \
+    pkg-config \
+    texinfo \
+    yasm \
+    zlib1g-dev \
+    nasm \
+    libx264-dev \
+    libx265-dev libnuma-dev \
+    libvpx-dev \
+    libfdk-aac-dev \
+    libopus-dev \
+    libsvtav1-dev libsvtav1enc-dev libsvtav1dec-dev \
+    libdav1d-dev
+
+# Install gh cli tool
+RUN (type -p wget >/dev/null || (apt update && apt-get install wget -y)) \
+    && mkdir -p -m 755 /etc/apt/keyrings \
+    && wget -qO- https://cli.github.com/packages/githubcli-archive-keyring.gpg | tee /etc/apt/keyrings/githubcli-archive-keyring.gpg > /dev/null \
+    && chmod go+r /etc/apt/keyrings/githubcli-archive-keyring.gpg \
+    && echo "deb [arch=$(dpkg --print-architecture) signed-by=/etc/apt/keyrings/githubcli-archive-keyring.gpg] https://cli.github.com/packages stable main" | tee /etc/apt/sources.list.d/github-cli.list > /dev/null \
+    && apt update \
+    && apt install gh -y \
+    && apt clean && rm -rf /var/lib/apt/lists/*
+
+# Setup `python`
+RUN ln -s /usr/bin/python3 /usr/bin/python
+
+# Install poetry
+RUN curl -sSL https://install.python-poetry.org | python -
+ENV PATH="/root/.local/bin:$PATH"
+RUN echo 'if [ "$HOME" != "/root" ]; then ln -sf /root/.local/bin/poetry $HOME/.local/bin/poetry; fi' >> /root/.bashrc
+RUN poetry config virtualenvs.create false
+RUN poetry config virtualenvs.in-project true
+
+# Set EGL as the rendering backend for MuJoCo
+ENV MUJOCO_GL="egl"

docker/lerobot-gpu/Dockerfile

@@ -0,0 +1,30 @@
+FROM nvidia/cuda:12.4.1-base-ubuntu22.04
+
+# Configure image
+ARG PYTHON_VERSION=3.10
+ARG DEBIAN_FRONTEND=noninteractive
+
+
+# Install apt dependencies
+RUN apt-get update && apt-get install -y --no-install-recommends \
+    build-essential cmake \
+    libglib2.0-0 libgl1-mesa-glx libegl1-mesa ffmpeg \
+    speech-dispatcher \
+    python${PYTHON_VERSION}-dev python${PYTHON_VERSION}-venv \
+    && apt-get clean && rm -rf /var/lib/apt/lists/*
+
+
+# Create virtual environment
+RUN ln -s /usr/bin/python${PYTHON_VERSION} /usr/bin/python
+RUN python -m venv /opt/venv
+ENV PATH="/opt/venv/bin:$PATH"
+RUN echo "source /opt/venv/bin/activate" >> /root/.bashrc
+
+# Install LeRobot
+COPY . /lerobot
+WORKDIR /lerobot
+RUN pip install --upgrade --no-cache-dir pip
+RUN pip install --no-cache-dir ".[test, aloha, xarm, pusht, dynamixel]"
+
+# Set EGL as the rendering backend for MuJoCo
+ENV MUJOCO_GL="egl"

examples/10_use_so100.md

@@ -0,0 +1,280 @@
+This tutorial explains how to use [SO-100](https://github.com/TheRobotStudio/SO-ARM100) with LeRobot.
+
+## Source the parts
+
+Follow this [README](https://github.com/TheRobotStudio/SO-ARM100). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
+
+**Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
+
+## Install LeRobot
+
+On your computer:
+
+1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
+```bash
+mkdir -p ~/miniconda3
+wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
+bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
+rm ~/miniconda3/miniconda.sh
+~/miniconda3/bin/conda init bash
+```
+
+2. Restart shell or `source ~/.bashrc`
+
+3. Create and activate a fresh conda environment for lerobot
+```bash
+conda create -y -n lerobot python=3.10 && conda activate lerobot
+```
+
+4. Clone LeRobot:
+```bash
+git clone https://github.com/huggingface/lerobot.git ~/lerobot
+```
+
+5. Install LeRobot with dependencies for the feetech motors:
+```bash
+cd ~/lerobot && pip install -e ".[feetech]"
+```
+
+For Linux only (not Mac), install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
+
+## Configure the motors
+
+Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the use of our scripts below.
+
+**Find USB ports associated to your arms**
+To find the correct ports for each arm, run the utility script twice:
+```bash
+python lerobot/scripts/find_motors_bus_port.py
+```
+
+Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
+```
+Finding all available ports for the MotorBus.
+['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
+Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
+
+[...Disconnect leader arm and press Enter...]
+
+The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
+Reconnect the usb cable.
+```
+
+Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
+```
+Finding all available ports for the MotorBus.
+['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
+Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
+
+[...Disconnect follower arm and press Enter...]
+
+The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
+Reconnect the usb cable.
+```
+
+Troubleshooting: On Linux, you might need to give access to the USB ports by running:
+```bash
+sudo chmod 666 /dev/ttyACM0
+sudo chmod 666 /dev/ttyACM1
+```
+
+**Configure your motors**
+Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
+```bash
+python lerobot/scripts/configure_motor.py \
+  --port /dev/tty.usbmodem58760432961 \
+  --brand feetech \
+  --model sts3215 \
+  --baudrate 1000000 \
+  --ID 1
+```
+
+Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).
+
+Then unplug your motor and plug the second motor and set its ID to 2.
+```bash
+python lerobot/scripts/configure_motor.py \
+  --port /dev/tty.usbmodem58760432961 \
+  --brand feetech \
+  --model sts3215 \
+  --baudrate 1000000 \
+  --ID 2
+```
+
+Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
+
+**Remove the gears of the 6 leader motors**
+Follow step 2 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
+
+**Add motor horn to the motors**
+Follow step 3 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). For SO-100, you need to align the holes on the motor horn to the motor spline to be approximately 1:30, 4:30, 7:30 and 10:30.
+Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
+
+## Assemble the arms
+
+Follow step 4 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
+
+## Calibrate
+
+Next, you'll need to calibrate your SO-100 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one SO-100 robot to work on another.
+
+**Auto-calibration of follower arm**
+Follow step 5 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the auto-calibration of the follower arm. You first need to manually move your follower arm to this initial position:
+
+<div style="text-align:center;">
+  <img src="../media/so100/follower_initial.webp?raw=true" alt="SO-100 follower arm initial position" title="SO-100 follower arm initial position" width="50%">
+</div>
+
+Then run this script to launch auto-calibration:
+```bash
+python lerobot/scripts/control_robot.py calibrate \
+    --robot-path lerobot/configs/robot/so100.yaml \
+    --robot-overrides '~cameras' --arms main_follower
+```
+
+Note: You can't run auto-calibration for the leader arm, since we removed the gears. Thus, you will need to manually calibrate the leader arm. It's less precise than auto-calibration, but precision is not as critical for the leader arm.
+
+**Manual calibration of leader arm**
+Follow step 6 of the [assembly video](https://www.youtube.com/watch?v=FioA2oeFZ5I) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
+
+| 1. Zero position | 2. Rotated position | 3. Rest position |
+|---|---|---|
+| <img src="../media/so100/leader_zero.webp?raw=true" alt="SO-100 leader arm zero position" title="SO-100 leader arm zero position" style="width:100%;"> | <img src="../media/so100/leader_rotated.webp?raw=true" alt="SO-100 leader arm rotated position" title="SO-100 leader arm rotated position" style="width:100%;"> | <img src="../media/so100/leader_rest.webp?raw=true" alt="SO-100 leader arm rest position" title="SO-100 leader arm rest position" style="width:100%;"> |
+
+Run this script to launch manual calibration:
+```bash
+python lerobot/scripts/control_robot.py calibrate \
+    --robot-path lerobot/configs/robot/so100.yaml \
+    --robot-overrides '~cameras' --arms main_leader
+```
+
+## Teleoperate
+
+**Simple teleop**
+Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
+```bash
+python lerobot/scripts/control_robot.py teleoperate \
+    --robot-path lerobot/configs/robot/so100.yaml \
+    --robot-overrides '~cameras' \
+    --display-cameras 0
+```
+
+
+**Teleop with displaying cameras**
+Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
+```bash
+python lerobot/scripts/control_robot.py teleoperate \
+    --robot-path lerobot/configs/robot/so100.yaml
+```
+
+## Record a dataset
+
+Once you're familiar with teleoperation, you can record your first dataset with SO-100.
+
+If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
+```bash
+huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
+```
+
+Store your Hugging Face repository name in a variable to run these commands:
+```bash
+HF_USER=$(huggingface-cli whoami | head -n 1)
+echo $HF_USER
+```
+
+Record 2 episodes and upload your dataset to the hub:
+```bash
+python lerobot/scripts/control_robot.py record \
+    --robot-path lerobot/configs/robot/so100.yaml \
+    --fps 30 \
+    --root data \
+    --repo-id ${HF_USER}/so100_test \
+    --tags so100 tutorial \
+    --warmup-time-s 5 \
+    --episode-time-s 40 \
+    --reset-time-s 10 \
+    --num-episodes 2 \
+    --push-to-hub 1
+```
+
+## Visualize a dataset
+
+If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
+```bash
+echo ${HF_USER}/so100_test
+```
+
+If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
+```bash
+python lerobot/scripts/visualize_dataset_html.py \
+  --root data \
+  --repo-id ${HF_USER}/so100_test
+```
+
+## Replay an episode
+
+Now try to replay the first episode on your robot:
+```bash
+DATA_DIR=data python lerobot/scripts/control_robot.py replay \
+    --robot-path lerobot/configs/robot/so100.yaml \
+    --fps 30 \
+    --root data \
+    --repo-id ${HF_USER}/so100_test \
+    --episode 0
+```
+
+## Train a policy
+
+To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
+```bash
+DATA_DIR=data python lerobot/scripts/train.py \
+  dataset_repo_id=${HF_USER}/so100_test \
+  policy=act_so100_real \
+  env=so100_real \
+  hydra.run.dir=outputs/train/act_so100_test \
+  hydra.job.name=act_so100_test \
+  device=cuda \
+  wandb.enable=true
+```
+
+Let's explain it:
+1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/so100_test`.
+2. We provided the policy with `policy=act_so100_real`. This loads configurations from [`lerobot/configs/policy/act_so100_real.yaml`](../lerobot/configs/policy/act_so100_real.yaml). Importantly, this policy uses 2 cameras as input `laptop`, `phone`.
+3. We provided an environment as argument with `env=so100_real`. This loads configurations from [`lerobot/configs/env/so100_real.yaml`](../lerobot/configs/env/so100_real.yaml).
+4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
+5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
+6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
+
+Training should take several hours. You will find checkpoints in `outputs/train/act_so100_test/checkpoints`.
+
+## Evaluate your policy
+
+You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
+```bash
+python lerobot/scripts/control_robot.py record \
+  --robot-path lerobot/configs/robot/so100.yaml \
+  --fps 30 \
+  --root data \
+  --repo-id ${HF_USER}/eval_act_so100_test \
+  --tags so100 tutorial eval \
+  --warmup-time-s 5 \
+  --episode-time-s 40 \
+  --reset-time-s 10 \
+  --num-episodes 10 \
+  -p outputs/train/act_so100_test/checkpoints/last/pretrained_model
+```
+
+As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
+1. There is an additional `-p` argument which indicates the path to your policy checkpoint with  (e.g. `-p outputs/train/eval_so100_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_so100_test`).
+2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_so100_test`).
+
+## More
+
+Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
+
+If you have any question or need help, please reach out on Discord in the channel [`#so100-arm`](https://discord.com/channels/1216765309076115607/1237741463832363039).

examples/11_use_moss.md

@@ -0,0 +1,280 @@
+This tutorial explains how to use [Moss v1](https://github.com/jess-moss/moss-robot-arms) with LeRobot.
+
+## Source the parts
+
+Follow this [README](https://github.com/jess-moss/moss-robot-arms). It contains the bill of materials, with link to source the parts, as well as the instructions to 3D print the parts, and advices if it's your first time printing or if you don't own a 3D printer already.
+
+**Important**: Before assembling, you will first need to configure your motors. To this end, we provide a nice script, so let's first install LeRobot. After configuration, we will also guide you through assembly.
+
+## Install LeRobot
+
+On your computer:
+
+1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
+```bash
+mkdir -p ~/miniconda3
+wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
+bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
+rm ~/miniconda3/miniconda.sh
+~/miniconda3/bin/conda init bash
+```
+
+2. Restart shell or `source ~/.bashrc`
+
+3. Create and activate a fresh conda environment for lerobot
+```bash
+conda create -y -n lerobot python=3.10 && conda activate lerobot
+```
+
+4. Clone LeRobot:
+```bash
+git clone https://github.com/huggingface/lerobot.git ~/lerobot
+```
+
+5. Install LeRobot with dependencies for the feetech motors:
+```bash
+cd ~/lerobot && pip install -e ".[feetech]"
+```
+
+For Linux only (not Mac), install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
+
+## Configure the motors
+
+Follow steps 1 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the use of our scripts below.
+
+**Find USB ports associated to your arms**
+To find the correct ports for each arm, run the utility script twice:
+```bash
+python lerobot/scripts/find_motors_bus_port.py
+```
+
+Example output when identifying the leader arm's port (e.g., `/dev/tty.usbmodem575E0031751` on Mac, or possibly `/dev/ttyACM0` on Linux):
+```
+Finding all available ports for the MotorBus.
+['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
+Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
+
+[...Disconnect leader arm and press Enter...]
+
+The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0031751
+Reconnect the usb cable.
+```
+
+Example output when identifying the follower arm's port (e.g., `/dev/tty.usbmodem575E0032081`, or possibly `/dev/ttyACM1` on Linux):
+```
+Finding all available ports for the MotorBus.
+['/dev/tty.usbmodem575E0032081', '/dev/tty.usbmodem575E0031751']
+Remove the usb cable from your DynamixelMotorsBus and press Enter when done.
+
+[...Disconnect follower arm and press Enter...]
+
+The port of this DynamixelMotorsBus is /dev/tty.usbmodem575E0032081
+Reconnect the usb cable.
+```
+
+Troubleshooting: On Linux, you might need to give access to the USB ports by running:
+```bash
+sudo chmod 666 /dev/ttyACM0
+sudo chmod 666 /dev/ttyACM1
+```
+
+**Configure your motors**
+Plug your first motor and run this script to set its ID to 1. It will also set its present position to 2048, so expect your motor to rotate:
+```bash
+python lerobot/scripts/configure_motor.py \
+  --port /dev/tty.usbmodem58760432961 \
+  --brand feetech \
+  --model sts3215 \
+  --baudrate 1000000 \
+  --ID 1
+```
+
+Note: These motors are currently limitated. They can take values between 0 and 4096 only, which corresponds to a full turn. They can't turn more than that. 2048 is at the middle of this range, so we can take -2048 steps (180 degrees anticlockwise) and reach the maximum range, or take +2048 steps (180 degrees clockwise) and reach the maximum range. The configuration step also sets the homing offset to 0, so that if you misassembled the arm, you can always update the homing offset to account for a shift up to ± 2048 steps (± 180 degrees).
+
+Then unplug your motor and plug the second motor and set its ID to 2.
+```bash
+python lerobot/scripts/configure_motor.py \
+  --port /dev/tty.usbmodem58760432961 \
+  --brand feetech \
+  --model sts3215 \
+  --baudrate 1000000 \
+  --ID 2
+```
+
+Redo the process for all your motors until ID 6. Do the same for the 6 motors of the leader arm.
+
+**Remove the gears of the 6 leader motors**
+Follow step 2 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). You need to remove the gear for the motors of the leader arm. As a result, you will only use the position encoding of the motor and reduce friction to more easily operate the leader arm.
+
+**Add motor horn to the motors**
+Follow step 3 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). For Moss v1, you need to align the holes on the motor horn to the motor spline to be approximately 3, 6, 9 and 12 o'clock.
+Try to avoid rotating the motor while doing so to keep position 2048 set during configuration. It is especially tricky for the leader motors as it is more sensible without the gears, but it's ok if it's a bit rotated.
+
+## Assemble the arms
+
+Follow step 4 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic). The first arm should take a bit more than 1 hour to assemble, but once you get use to it, you can do it under 1 hour for the second arm.
+
+## Calibrate
+
+Next, you'll need to calibrate your Moss v1 robot to ensure that the leader and follower arms have the same position values when they are in the same physical position. This calibration is essential because it allows a neural network trained on one Moss v1 robot to work on another.
+
+**Auto-calibration of follower arm**
+Follow step 5 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the auto-calibration of the follower arm. You first need to manually move your follower arm to this initial position:
+
+<div style="text-align:center;">
+  <img src="../media/moss/follower_initial.webp?raw=true" alt="Moss v1 follower arm initial position" title="Moss v1 follower arm initial position" width="50%">
+</div>
+
+Then run this script to launch auto-calibration:
+```bash
+python lerobot/scripts/control_robot.py calibrate \
+    --robot-path lerobot/configs/robot/moss.yaml \
+    --robot-overrides '~cameras' --arms main_follower
+```
+
+Note: You can't run auto-calibration for the leader arm, since we removed the gears. Thus, you will need to manually calibrate the leader arm. It's less precise than auto-calibration, but precision is not as critical for the leader arm.
+
+**Manual calibration of leader arm**
+Follow step 6 of the [assembly video](https://www.youtube.com/watch?v=DA91NJOtMic) which illustrates the manual calibration. You will need to move the leader arm to these positions sequentially:
+
+| 1. Zero position | 2. Rotated position | 3. Rest position |
+|---|---|---|
+| <img src="../media/moss/leader_zero.webp?raw=true" alt="Moss v1 leader arm zero position" title="Moss v1 leader arm zero position" style="width:100%;"> | <img src="../media/moss/leader_rotated.webp?raw=true" alt="Moss v1 leader arm rotated position" title="Moss v1 leader arm rotated position" style="width:100%;"> | <img src="../media/moss/leader_rest.webp?raw=true" alt="Moss v1 leader arm rest position" title="Moss v1 leader arm rest position" style="width:100%;"> |
+
+Run this script to launch manual calibration:
+```bash
+python lerobot/scripts/control_robot.py calibrate \
+    --robot-path lerobot/configs/robot/moss.yaml \
+    --robot-overrides '~cameras' --arms main_leader
+```
+
+## Teleoperate
+
+**Simple teleop**
+Then you are ready to teleoperate your robot! Run this simple script (it won't connect and display the cameras):
+```bash
+python lerobot/scripts/control_robot.py teleoperate \
+    --robot-path lerobot/configs/robot/moss.yaml \
+    --robot-overrides '~cameras' \
+    --display-cameras 0
+```
+
+
+**Teleop with displaying cameras**
+Follow [this guide to setup your cameras](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#c-add-your-cameras-with-opencvcamera). Then you will be able to display the cameras on your computer while you are teleoperating by running the following code. This is useful to prepare your setup before recording your first dataset.
+```bash
+python lerobot/scripts/control_robot.py teleoperate \
+    --robot-path lerobot/configs/robot/moss.yaml
+```
+
+## Record a dataset
+
+Once you're familiar with teleoperation, you can record your first dataset with Moss v1.
+
+If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
+```bash
+huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
+```
+
+Store your Hugging Face repository name in a variable to run these commands:
+```bash
+HF_USER=$(huggingface-cli whoami | head -n 1)
+echo $HF_USER
+```
+
+Record 2 episodes and upload your dataset to the hub:
+```bash
+python lerobot/scripts/control_robot.py record \
+    --robot-path lerobot/configs/robot/moss.yaml \
+    --fps 30 \
+    --root data \
+    --repo-id ${HF_USER}/moss_test \
+    --tags moss tutorial \
+    --warmup-time-s 5 \
+    --episode-time-s 40 \
+    --reset-time-s 10 \
+    --num-episodes 2 \
+    --push-to-hub 1
+```
+
+## Visualize a dataset
+
+If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
+```bash
+echo ${HF_USER}/moss_test
+```
+
+If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
+```bash
+python lerobot/scripts/visualize_dataset_html.py \
+  --root data \
+  --repo-id ${HF_USER}/moss_test
+```
+
+## Replay an episode
+
+Now try to replay the first episode on your robot:
+```bash
+DATA_DIR=data python lerobot/scripts/control_robot.py replay \
+    --robot-path lerobot/configs/robot/moss.yaml \
+    --fps 30 \
+    --root data \
+    --repo-id ${HF_USER}/moss_test \
+    --episode 0
+```
+
+## Train a policy
+
+To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
+```bash
+DATA_DIR=data python lerobot/scripts/train.py \
+  dataset_repo_id=${HF_USER}/moss_test \
+  policy=act_moss_real \
+  env=moss_real \
+  hydra.run.dir=outputs/train/act_moss_test \
+  hydra.job.name=act_moss_test \
+  device=cuda \
+  wandb.enable=true
+```
+
+Let's explain it:
+1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/moss_test`.
+2. We provided the policy with `policy=act_moss_real`. This loads configurations from [`lerobot/configs/policy/act_moss_real.yaml`](../lerobot/configs/policy/act_moss_real.yaml). Importantly, this policy uses 2 cameras as input `laptop`, `phone`.
+3. We provided an environment as argument with `env=moss_real`. This loads configurations from [`lerobot/configs/env/moss_real.yaml`](../lerobot/configs/env/moss_real.yaml).
+4. We provided `device=cuda` since we are training on a Nvidia GPU, but you can also use `device=mps` if you are using a Mac with Apple silicon, or `device=cpu` otherwise.
+5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
+6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
+
+Training should take several hours. You will find checkpoints in `outputs/train/act_moss_test/checkpoints`.
+
+## Evaluate your policy
+
+You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
+```bash
+python lerobot/scripts/control_robot.py record \
+  --robot-path lerobot/configs/robot/moss.yaml \
+  --fps 30 \
+  --root data \
+  --repo-id ${HF_USER}/eval_act_moss_test \
+  --tags moss tutorial eval \
+  --warmup-time-s 5 \
+  --episode-time-s 40 \
+  --reset-time-s 10 \
+  --num-episodes 10 \
+  -p outputs/train/act_moss_test/checkpoints/last/pretrained_model
+```
+
+As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
+1. There is an additional `-p` argument which indicates the path to your policy checkpoint with  (e.g. `-p outputs/train/eval_moss_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_moss_test`).
+2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_moss_test`).
+
+## More
+
+Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth tutorial on controlling real robots with LeRobot.
+
+If you have any question or need help, please reach out on Discord in the channel [`#moss-arm`](https://discord.com/channels/1216765309076115607/1275374638985252925).

examples/1_load_lerobot_dataset.py

@@ -0,0 +1,91 @@
+"""
+This script demonstrates the use of `LeRobotDataset` class for handling and processing robotic datasets from Hugging Face.
+It illustrates how to load datasets, manipulate them, and apply transformations suitable for machine learning tasks in PyTorch.
+
+Features included in this script:
+- Loading a dataset and accessing its properties.
+- Filtering data by episode number.
+- Converting tensor data for visualization.
+- Saving video files from dataset frames.
+- Using advanced dataset features like timestamp-based frame selection.
+- Demonstrating compatibility with PyTorch DataLoader for batch processing.
+
+The script ends with examples of how to batch process data using PyTorch's DataLoader.
+"""
+
+from pathlib import Path
+from pprint import pprint
+
+import imageio
+import torch
+
+import lerobot
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
+
+print("List of available datasets:")
+pprint(lerobot.available_datasets)
+
+# Let's take one for this example
+repo_id = "lerobot/pusht"
+
+# You can easily load a dataset from a Hugging Face repository
+dataset = LeRobotDataset(repo_id)
+
+# LeRobotDataset is actually a thin wrapper around an underlying Hugging Face dataset
+# (see https://huggingface.co/docs/datasets/index for more information).
+print(dataset)
+print(dataset.hf_dataset)
+
+# And provides additional utilities for robotics and compatibility with Pytorch
+print(f"\naverage number of frames per episode: {dataset.num_samples / dataset.num_episodes:.3f}")
+print(f"frames per second used during data collection: {dataset.fps=}")
+print(f"keys to access images from cameras: {dataset.camera_keys=}\n")
+
+# Access frame indexes associated to first episode
+episode_index = 0
+from_idx = dataset.episode_data_index["from"][episode_index].item()
+to_idx = dataset.episode_data_index["to"][episode_index].item()
+
+# LeRobot datasets actually subclass PyTorch datasets so you can do everything you know and love from working
+# with the latter, like iterating through the dataset. Here we grab all the image frames.
+frames = [dataset[idx]["observation.image"] for idx in range(from_idx, to_idx)]
+
+# Video frames are now float32 in range [0,1] channel first (c,h,w) to follow pytorch convention. To visualize
+# them, we convert to uint8 in range [0,255]
+frames = [(frame * 255).type(torch.uint8) for frame in frames]
+# and to channel last (h,w,c).
+frames = [frame.permute((1, 2, 0)).numpy() for frame in frames]
+
+# Finally, we save the frames to a mp4 video for visualization.
+Path("outputs/examples/1_load_lerobot_dataset").mkdir(parents=True, exist_ok=True)
+imageio.mimsave("outputs/examples/1_load_lerobot_dataset/episode_0.mp4", frames, fps=dataset.fps)
+
+# For many machine learning applications we need to load the history of past observations or trajectories of
+# future actions. Our datasets can load previous and future frames for each key/modality, using timestamps
+# differences with the current loaded frame. For instance:
+delta_timestamps = {
+    # loads 4 images: 1 second before current frame, 500 ms before, 200 ms before, and current frame
+    "observation.image": [-1, -0.5, -0.20, 0],
+    # loads 8 state vectors: 1.5 seconds before, 1 second before, ... 20 ms, 10 ms, and current frame
+    "observation.state": [-1.5, -1, -0.5, -0.20, -0.10, -0.02, -0.01, 0],
+    # loads 64 action vectors: current frame, 1 frame in the future, 2 frames, ... 63 frames in the future
+    "action": [t / dataset.fps for t in range(64)],
+}
+dataset = LeRobotDataset(repo_id, delta_timestamps=delta_timestamps)
+print(f"\n{dataset[0]['observation.image'].shape=}")  # (4,c,h,w)
+print(f"{dataset[0]['observation.state'].shape=}")  # (8,c)
+print(f"{dataset[0]['action'].shape=}\n")  # (64,c)
+
+# Finally, our datasets are fully compatible with PyTorch dataloaders and samplers because they are just
+# PyTorch datasets.
+dataloader = torch.utils.data.DataLoader(
+    dataset,
+    num_workers=0,
+    batch_size=32,
+    shuffle=True,
+)
+for batch in dataloader:
+    print(f"{batch['observation.image'].shape=}")  # (32,4,c,h,w)
+    print(f"{batch['observation.state'].shape=}")  # (32,8,c)
+    print(f"{batch['action'].shape=}")  # (32,64,c)
+    break

examples/2_evaluate_pretrained_policy.py

@@ -0,0 +1,121 @@
+"""
+This scripts demonstrates how to evaluate a pretrained policy from the HuggingFace Hub or from your local
+training outputs directory. In the latter case, you might want to run examples/3_train_policy.py first.
+"""
+
+from pathlib import Path
+
+import gym_pusht  # noqa: F401
+import gymnasium as gym
+import imageio
+import numpy
+import torch
+from huggingface_hub import snapshot_download
+
+from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
+
+# Create a directory to store the video of the evaluation
+output_directory = Path("outputs/eval/example_pusht_diffusion")
+output_directory.mkdir(parents=True, exist_ok=True)
+
+# Download the diffusion policy for pusht environment
+pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
+# OR uncomment the following to evaluate a policy from the local outputs/train folder.
+# pretrained_policy_path = Path("outputs/train/example_pusht_diffusion")
+
+policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
+policy.eval()
+
+# Check if GPU is available
+if torch.cuda.is_available():
+    device = torch.device("cuda")
+    print("GPU is available. Device set to:", device)
+else:
+    device = torch.device("cpu")
+    print(f"GPU is not available. Device set to: {device}. Inference will be slower than on GPU.")
+    # Decrease the number of reverse-diffusion steps (trades off a bit of quality for 10x speed)
+    policy.diffusion.num_inference_steps = 10
+
+policy.to(device)
+
+# Initialize evaluation environment to render two observation types:
+# an image of the scene and state/position of the agent. The environment
+# also automatically stops running after 300 interactions/steps.
+env = gym.make(
+    "gym_pusht/PushT-v0",
+    obs_type="pixels_agent_pos",
+    max_episode_steps=300,
+)
+
+# Reset the policy and environmens to prepare for rollout
+policy.reset()
+numpy_observation, info = env.reset(seed=42)
+
+# Prepare to collect every rewards and all the frames of the episode,
+# from initial state to final state.
+rewards = []
+frames = []
+
+# Render frame of the initial state
+frames.append(env.render())
+
+step = 0
+done = False
+while not done:
+    # Prepare observation for the policy running in Pytorch
+    state = torch.from_numpy(numpy_observation["agent_pos"])
+    image = torch.from_numpy(numpy_observation["pixels"])
+
+    # Convert to float32 with image from channel first in [0,255]
+    # to channel last in [0,1]
+    state = state.to(torch.float32)
+    image = image.to(torch.float32) / 255
+    image = image.permute(2, 0, 1)
+
+    # Send data tensors from CPU to GPU
+    state = state.to(device, non_blocking=True)
+    image = image.to(device, non_blocking=True)
+
+    # Add extra (empty) batch dimension, required to forward the policy
+    state = state.unsqueeze(0)
+    image = image.unsqueeze(0)
+
+    # Create the policy input dictionary
+    observation = {
+        "observation.state": state,
+        "observation.image": image,
+    }
+
+    # Predict the next action with respect to the current observation
+    with torch.inference_mode():
+        action = policy.select_action(observation)
+
+    # Prepare the action for the environment
+    numpy_action = action.squeeze(0).to("cpu").numpy()
+
+    # Step through the environment and receive a new observation
+    numpy_observation, reward, terminated, truncated, info = env.step(numpy_action)
+    print(f"{step=} {reward=} {terminated=}")
+
+    # Keep track of all the rewards and frames
+    rewards.append(reward)
+    frames.append(env.render())
+
+    # The rollout is considered done when the success state is reach (i.e. terminated is True),
+    # or the maximum number of iterations is reached (i.e. truncated is True)
+    done = terminated | truncated | done
+    step += 1
+
+if terminated:
+    print("Success!")
+else:
+    print("Failure!")
+
+# Get the speed of environment (i.e. its number of frames per second).
+fps = env.metadata["render_fps"]
+
+# Encode all frames into a mp4 video.
+video_path = output_directory / "rollout.mp4"
+imageio.mimsave(str(video_path), numpy.stack(frames), fps=fps)
+
+print(f"Video of the evaluation is available in '{video_path}'.")

examples/3_train_policy.py

@@ -0,0 +1,79 @@
+"""This scripts demonstrates how to train Diffusion Policy on the PushT environment.
+
+Once you have trained a model with this script, you can try to evaluate it on
+examples/2_evaluate_pretrained_policy.py
+"""
+
+from pathlib import Path
+
+import torch
+
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
+from lerobot.common.policies.diffusion.configuration_diffusion import DiffusionConfig
+from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
+
+# Create a directory to store the training checkpoint.
+output_directory = Path("outputs/train/example_pusht_diffusion")
+output_directory.mkdir(parents=True, exist_ok=True)
+
+# Number of offline training steps (we'll only do offline training for this example.)
+# Adjust as you prefer. 5000 steps are needed to get something worth evaluating.
+training_steps = 5000
+device = torch.device("cuda")
+log_freq = 250
+
+# Set up the dataset.
+delta_timestamps = {
+    # Load the previous image and state at -0.1 seconds before current frame,
+    # then load current image and state corresponding to 0.0 second.
+    "observation.image": [-0.1, 0.0],
+    "observation.state": [-0.1, 0.0],
+    # Load the previous action (-0.1), the next action to be executed (0.0),
+    # and 14 future actions with a 0.1 seconds spacing. All these actions will be
+    # used to supervise the policy.
+    "action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
+}
+dataset = LeRobotDataset("lerobot/pusht", delta_timestamps=delta_timestamps)
+
+# Set up the the policy.
+# Policies are initialized with a configuration class, in this case `DiffusionConfig`.
+# For this example, no arguments need to be passed because the defaults are set up for PushT.
+# If you're doing something different, you will likely need to change at least some of the defaults.
+cfg = DiffusionConfig()
+policy = DiffusionPolicy(cfg, dataset_stats=dataset.stats)
+policy.train()
+policy.to(device)
+
+optimizer = torch.optim.Adam(policy.parameters(), lr=1e-4)
+
+# Create dataloader for offline training.
+dataloader = torch.utils.data.DataLoader(
+    dataset,
+    num_workers=4,
+    batch_size=64,
+    shuffle=True,
+    pin_memory=device != torch.device("cpu"),
+    drop_last=True,
+)
+
+# Run training loop.
+step = 0
+done = False
+while not done:
+    for batch in dataloader:
+        batch = {k: v.to(device, non_blocking=True) for k, v in batch.items()}
+        output_dict = policy.forward(batch)
+        loss = output_dict["loss"]
+        loss.backward()
+        optimizer.step()
+        optimizer.zero_grad()
+
+        if step % log_freq == 0:
+            print(f"step: {step} loss: {loss.item():.3f}")
+        step += 1
+        if step >= training_steps:
+            done = True
+            break
+
+# Save a policy checkpoint.
+policy.save_pretrained(output_directory)

examples/4_train_policy_with_script.md

@@ -0,0 +1,213 @@
+This tutorial will explain the training script, how to use it, and particularly the use of Hydra to configure everything needed for the training run.
+
+## The training script
+
+LeRobot offers a training script at [`lerobot/scripts/train.py`](../../lerobot/scripts/train.py). At a high level it does the following:
+
+- Loads a Hydra configuration file for the following steps (more on Hydra in a moment).
+- Makes a simulation environment.
+- Makes a dataset corresponding to that simulation environment.
+- Makes a policy.
+- Runs a standard training loop with forward pass, backward pass, optimization step, and occasional logging, evaluation (of the policy on the environment), and checkpointing.
+
+## Basics of how we use Hydra
+
+Explaining the ins and outs of [Hydra](https://hydra.cc/docs/intro/) is beyond the scope of this document, but here we'll share the main points you need to know.
+
+First, `lerobot/configs` has a directory structure like this:
+
+```
+.
+├── default.yaml
+├── env
+│   ├── aloha.yaml
+│   ├── pusht.yaml
+│   └── xarm.yaml
+└── policy
+    ├── act.yaml
+    ├── diffusion.yaml
+    └── tdmpc.yaml
+```
+
+**_For brevity, in the rest of this document we'll drop the leading `lerobot/configs` path. So `default.yaml` really refers to `lerobot/configs/default.yaml`._**
+
+When you run the training script with
+
+```python
+python lerobot/scripts/train.py
+```
+
+Hydra is set up to read `default.yaml` (via the `@hydra.main` decorator). If you take a look at the `@hydra.main`'s arguments you will see `config_path="../configs", config_name="default"`. At the top of `default.yaml`, is a `defaults` section which looks likes this:
+
+```yaml
+defaults:
+  - _self_
+  - env: pusht
+  - policy: diffusion
+```
+
+This logic tells Hydra to incorporate configuration parameters from `env/pusht.yaml` and `policy/diffusion.yaml`. _Note: Be aware of the order as any configuration parameters with the same name will be overidden. Thus, `default.yaml` is overridden by `env/pusht.yaml`  which is overidden by `policy/diffusion.yaml`_.
+
+Then, `default.yaml` also contains common configuration parameters such as `device: cuda` or `use_amp: false` (for enabling fp16 training). Some other parameters are set to `???` which indicates that they are expected to be set in additional yaml files. For instance, `training.offline_steps: ???` in `default.yaml` is set to `200000` in `diffusion.yaml`.
+
+Thanks to this `defaults` section in `default.yaml`, if you want to train Diffusion Policy with PushT, you really only need to run:
+
+```bash
+python lerobot/scripts/train.py
+```
+
+However, you can be more explicit and launch the exact same Diffusion Policy training on PushT with:
+
+```bash
+python lerobot/scripts/train.py policy=diffusion env=pusht
+```
+
+This way of overriding defaults via the CLI is especially useful when you want to change the policy and/or environment. For instance, you can train ACT on the default Aloha environment with:
+
+```bash
+python lerobot/scripts/train.py policy=act env=aloha
+```
+
+There are two things to note here:
+- Config overrides are passed as `param_name=param_value`.
+- Here we have overridden the defaults section. `policy=act` tells Hydra to use `policy/act.yaml`, and `env=aloha` tells Hydra to use `env/aloha.yaml`.
+
+_As an aside: we've set up all of our configurations so that they reproduce state-of-the-art results from papers in the literature._
+
+## Overriding configuration parameters in the CLI
+
+Now let's say that we want to train on a different task in the Aloha environment. If you look in `env/aloha.yaml` you will see something like:
+
+```yaml
+# lerobot/configs/env/aloha.yaml
+env:
+  task: AlohaInsertion-v0
+```
+
+And if you look in `policy/act.yaml` you will see something like:
+
+```yaml
+# lerobot/configs/policy/act.yaml
+dataset_repo_id: lerobot/aloha_sim_insertion_human
+```
+
+But our Aloha environment actually supports a cube transfer task as well. To train for this task, you could manually modify the two yaml configuration files respectively.
+
+First, we'd need to switch to using the cube transfer task for the ALOHA environment.
+
+```diff
+# lerobot/configs/env/aloha.yaml
+env:
+-  task: AlohaInsertion-v0
++  task: AlohaTransferCube-v0
+```
+
+Then, we'd also need to switch to using the cube transfer dataset.
+
+```diff
+# lerobot/configs/policy/act.yaml
+-dataset_repo_id: lerobot/aloha_sim_insertion_human
++dataset_repo_id: lerobot/aloha_sim_transfer_cube_human
+```
+
+Then, you'd be able to run:
+
+```bash
+python lerobot/scripts/train.py policy=act env=aloha
+```
+
+and you'd be training and evaluating on the cube transfer task.
+
+An alternative approach to editing the yaml configuration files, would be to override the defaults via the command line:
+
+```bash
+python lerobot/scripts/train.py \
+    policy=act \
+    dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
+    env=aloha \
+    env.task=AlohaTransferCube-v0
+```
+
+There's something new here. Notice the `.` delimiter used to traverse the configuration hierarchy. _But be aware that the `defaults` section is an exception. As you saw above, we didn't need to write `defaults.policy=act` in the CLI. `policy=act` was enough._
+
+Putting all that knowledge together, here's the command that was used to train https://huggingface.co/lerobot/act_aloha_sim_transfer_cube_human.
+
+```bash
+python lerobot/scripts/train.py \
+    hydra.run.dir=outputs/train/act_aloha_sim_transfer_cube_human \
+    device=cuda
+    env=aloha \
+    env.task=AlohaTransferCube-v0 \
+    dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
+    policy=act \
+    training.eval_freq=10000 \
+    training.log_freq=250 \
+    training.offline_steps=100000 \
+    training.save_model=true \
+    training.save_freq=25000 \
+    eval.n_episodes=50 \
+    eval.batch_size=50 \
+    wandb.enable=false \
+```
+
+There's one new thing here: `hydra.run.dir=outputs/train/act_aloha_sim_transfer_cube_human`, which specifies where to save the training output.
+
+## Using a configuration file not in `lerobot/configs`
+
+Above we discusses the our training script is set up such that Hydra looks for `default.yaml` in `lerobot/configs`. But, if you have a configuration file elsewhere in your filesystem you may use:
+
+```bash
+python lerobot/scripts/train.py --config-dir PARENT/PATH --config-name FILE_NAME_WITHOUT_EXTENSION
+```
+
+Note: here we use regular syntax for providing CLI arguments to a Python script, not Hydra's `param_name=param_value` syntax.
+
+As a concrete example, this becomes particularly handy when you have a folder with training outputs, and would like to re-run the training. For example, say you previously ran the training script with one of the earlier commands and have `outputs/train/my_experiment/checkpoints/pretrained_model/config.yaml`. This `config.yaml` file will have the full set of configuration parameters within it. To run the training with the same configuration again, do:
+
+```bash
+python lerobot/scripts/train.py --config-dir outputs/train/my_experiment/checkpoints/last/pretrained_model --config-name config
+```
+
+Note that you may still use the regular syntax for config parameter overrides (eg: by adding `training.offline_steps=200000`).
+
+## Typical logs and metrics
+
+When you start the training process, you will first see your full configuration being printed in the terminal. You can check it to make sure that you config it correctly and your config is not overrided by other files. The final configuration will also be saved with the checkpoint.
+
+After that, you will see training log like this one:
+
+```
+INFO 2024-08-14 13:35:12 ts/train.py:192 step:0 smpl:64 ep:1 epch:0.00 loss:1.112 grdn:15.387 lr:2.0e-07 updt_s:1.738 data_s:4.774
+```
+
+or evaluation log like:
+
+```
+INFO 2024-08-14 13:38:45 ts/train.py:226 step:100 smpl:6K ep:52 epch:0.25 ∑rwrd:20.693 success:0.0% eval_s:120.266
+```
+
+These logs will also be saved in wandb if `wandb.enable` is set to `true`. Here are the meaning of some abbreviations:
+
+- `smpl`: number of samples seen during training.
+- `ep`: number of episodes seen during training. An episode contains multiple samples in a complete manipulation task.
+- `epch`: number of time all unique samples are seen (epoch).
+- `grdn`: gradient norm.
+- `∑rwrd`: compute the sum of rewards in every evaluation episode and then take an average of them.
+- `success`: average success rate of eval episodes. Reward and success are usually different except for the sparsing reward setting, where reward=1 only when the task is completed successfully.
+- `eval_s`: time to evaluate the policy in the environment, in second.
+- `updt_s`: time to update the network parameters, in second.
+- `data_s`: time to load a batch of data, in second.
+
+Some metrics are useful for initial performance profiling. For example, if you find the current GPU utilization is low via the `nvidia-smi` command and `data_s` sometimes is too high, you may need to modify batch size or number of dataloading workers to accelerate dataloading. We also recommend [pytorch profiler](https://github.com/huggingface/lerobot?tab=readme-ov-file#improve-your-code-with-profiling) for detailed performance probing.
+
+---
+
+So far we've seen how to train Diffusion Policy for PushT and ACT for ALOHA. Now, what if we want to train ACT for PushT? Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
+
+```bash
+python lerobot/scripts/train.py policy=act env=pusht dataset_repo_id=lerobot/pusht
+```
+
+Please, head on over to our [advanced tutorial on adapting policy configuration to various environments](./advanced/train_act_pusht/train_act_pusht.md) to learn more.
+
+Or in the meantime, happy coding! 🤗

examples/5_resume_training.md

@@ -0,0 +1,37 @@
+This tutorial explains how to resume a training run that you've started with the training script. If you don't know how our training script and configuration system works, please read [4_train_policy_with_script.md](./4_train_policy_with_script.md) first.
+
+## Basic training resumption
+
+Let's consider the example of training ACT for one of the ALOHA tasks. Here's a command that can achieve that:
+
+```bash
+python lerobot/scripts/train.py \
+    hydra.run.dir=outputs/train/run_resumption \
+    policy=act \
+    dataset_repo_id=lerobot/aloha_sim_transfer_cube_human \
+    env=aloha \
+    env.task=AlohaTransferCube-v0 \
+    training.log_freq=25 \
+    training.save_checkpoint=true \
+    training.save_freq=100
+```
+
+Here we're using the default dataset and environment for ACT, and we've taken care to set up the log frequency and checkpointing frequency to low numbers so we can test resumption. You should be able to see some logging and have a first checkpoint within 1 minute. Please interrupt the training after the first checkpoint.
+
+To resume, all that we have to do is run the training script, providing the run directory, and the resume option:
+
+```bash
+python lerobot/scripts/train.py \
+    hydra.run.dir=outputs/train/run_resumption \
+    resume=true
+```
+
+You should see from the logging that your training picks up from where it left off.
+
+Note that with `resume=true`, the configuration file from the last checkpoint in the training output directory is loaded. So it doesn't matter that we haven't provided all the other configuration parameters from our previous command (although there may be warnings to notify you that your command has a different configuration than than the checkpoint).
+
+---
+
+Now you should know how to resume your training run in case it gets interrupted or you want to extend a finished training run.
+
+Happy coding! 🤗

examples/6_add_image_transforms.py

@@ -0,0 +1,52 @@
+"""
+This script demonstrates how to use torchvision's image transformation with LeRobotDataset for data
+augmentation purposes. The transformations are passed to the dataset as an argument upon creation, and
+transforms are applied to the observation images before they are returned in the dataset's __get_item__.
+"""
+
+from pathlib import Path
+
+from torchvision.transforms import ToPILImage, v2
+
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
+
+dataset_repo_id = "lerobot/aloha_static_tape"
+
+# Create a LeRobotDataset with no transformations
+dataset = LeRobotDataset(dataset_repo_id)
+# This is equivalent to `dataset = LeRobotDataset(dataset_repo_id, image_transforms=None)`
+
+# Get the index of the first observation in the first episode
+first_idx = dataset.episode_data_index["from"][0].item()
+
+# Get the frame corresponding to the first camera
+frame = dataset[first_idx][dataset.camera_keys[0]]
+
+
+# Define the transformations
+transforms = v2.Compose(
+    [
+        v2.ColorJitter(brightness=(0.5, 1.5)),
+        v2.ColorJitter(contrast=(0.5, 1.5)),
+        v2.RandomAdjustSharpness(sharpness_factor=2, p=1),
+    ]
+)
+
+# Create another LeRobotDataset with the defined transformations
+transformed_dataset = LeRobotDataset(dataset_repo_id, image_transforms=transforms)
+
+# Get a frame from the transformed dataset
+transformed_frame = transformed_dataset[first_idx][transformed_dataset.camera_keys[0]]
+
+# Create a directory to store output images
+output_dir = Path("outputs/image_transforms")
+output_dir.mkdir(parents=True, exist_ok=True)
+
+# Save the original frame
+to_pil = ToPILImage()
+to_pil(frame).save(output_dir / "original_frame.png", quality=100)
+print(f"Original frame saved to {output_dir / 'original_frame.png'}.")
+
+# Save the transformed frame
+to_pil(transformed_frame).save(output_dir / "transformed_frame.png", quality=100)
+print(f"Transformed frame saved to {output_dir / 'transformed_frame.png'}.")

examples/8_use_stretch.md

@@ -0,0 +1,158 @@
+This tutorial explains how to use [Stretch 3](https://hello-robot.com/stretch-3-product) with LeRobot.
+
+## Setup
+
+Familiarize yourself with Stretch by following its [tutorials](https://docs.hello-robot.com/0.3/getting_started/hello_robot/) (recommended).
+
+To use LeRobot on Stretch, 3 options are available:
+- [tethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#tethered-setup)
+- [untethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#untethered-setup)
+- ssh directly into Stretch (you will first need to install and configure openssh-server on stretch using one of the two above setups)
+
+
+## Install LeRobot
+
+On Stretch's CLI, follow these steps:
+
+1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
+```bash
+mkdir -p ~/miniconda3
+wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
+bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
+rm ~/miniconda3/miniconda.sh
+~/miniconda3/bin/conda init bash
+```
+
+2. Comment out these lines in `~/.profile` (this can mess up paths used by conda and ~/.local/bin should already be in your PATH)
+```
+# set PATH so it includes user's private bin if it exists
+if [ -d "$HOME/.local/bin" ] ; then
+    PATH="$HOME/.local/bin:$PATH"
+fi
+```
+
+3. Restart shell or `source ~/.bashrc`
+
+4. Create and activate a fresh conda environment for lerobot
+```bash
+conda create -y -n lerobot python=3.10 && conda activate lerobot
+```
+
+5. Clone LeRobot:
+```bash
+git clone https://github.com/huggingface/lerobot.git ~/lerobot
+```
+
+6. Install LeRobot with stretch dependencies:
+```bash
+cd ~/lerobot && pip install -e ".[stretch]"
+```
+
+> **Note:** If you get this message, you can ignore it: `ERROR: pip's dependency resolver does not currently take into account all the packages that are installed.`
+
+For Linux only (not Mac), install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
+
+7. Run a [system check](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#system-check) to make sure your robot is ready:
+```bash
+stretch_system_check.py
+```
+
+> **Note:** You may need to free the "robot process" after booting Stretch by running `stretch_free_robot_process.py`. For more info this Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#turning-off-gamepad-teleoperation).
+
+You should get something like this:
+```bash
+For use with S T R E T C H (R) from Hello Robot Inc.
+---------------------------------------------------------------------
+
+Model = Stretch 3
+Tool = DexWrist 3 w/ Gripper
+Serial Number = stretch-se3-3054
+
+---- Checking Hardware ----
+[Pass] Comms are ready
+[Pass] Actuators are ready
+[Warn] Sensors not ready (IMU AZ = -10.19 out of range -10.1 to -9.5)
+[Pass] Battery voltage is 13.6 V
+
+---- Checking Software ----
+[Pass] Ubuntu 22.04 is ready
+[Pass] All APT pkgs are setup correctly
+[Pass] Firmware is up-to-date
+[Pass] Python pkgs are up-to-date
+[Pass] ROS2 Humble is ready
+```
+
+## Teleoperate, record a dataset and run a policy
+
+**Calibrate (Optional)**
+Before operating Stretch, you need to [home](https://docs.hello-robot.com/0.3/getting_started/stretch_hardware_overview/#homing) it first. Be mindful about giving Stretch some space as this procedure will move the robot's arm and gripper. Now run this command:
+```bash
+python lerobot/scripts/control_robot.py calibrate \
+    --robot-path lerobot/configs/robot/stretch.yaml
+```
+This is equivalent to running `stretch_robot_home.py`
+
+> **Note:** If you run any of the LeRobot scripts below and Stretch is not poperly homed, it will automatically home/calibrate first.
+
+**Teleoperate**
+Before trying teleoperation, you need activate the gamepad controller by pressing the middle button. For more info, see Stretch's [doc](https://docs.hello-robot.com/0.3/getting_started/hello_robot/#gamepad-teleoperation).
+
+Now try out teleoperation (see above documentation to learn about the gamepad controls):
+```bash
+python lerobot/scripts/control_robot.py teleoperate \
+    --robot-path lerobot/configs/robot/stretch.yaml
+```
+This is essentially the same as running `stretch_gamepad_teleop.py`
+
+**Record a dataset**
+Once you're familiar with the gamepad controls and after a bit of practice, you can try to record your first dataset with Stretch.
+
+If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
+```bash
+huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
+```
+
+Store your Hugging Face repository name in a variable to run these commands:
+```bash
+HF_USER=$(huggingface-cli whoami | head -n 1)
+echo $HF_USER
+```
+
+Record one episode:
+```bash
+python lerobot/scripts/control_robot.py record \
+    --robot-path lerobot/configs/robot/stretch.yaml \
+    --fps 20 \
+    --root data \
+    --repo-id ${HF_USER}/stretch_test \
+    --tags stretch tutorial \
+    --warmup-time-s 3 \
+    --episode-time-s 40 \
+    --reset-time-s 10 \
+    --num-episodes 1 \
+    --push-to-hub 0
+```
+
+> **Note:** If you're using ssh to connect to Stretch and run this script, you won't be able to visualize its cameras feed (though they will still be recording). To see the cameras stream, use [tethered](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#tethered-setup) or [untethered setup](https://docs.hello-robot.com/0.3/getting_started/connecting_to_stretch/#untethered-setup).
+
+**Replay an episode**
+Now try to replay this episode (make sure the robot's initial position is the same):
+```bash
+python lerobot/scripts/control_robot.py replay \
+    --robot-path lerobot/configs/robot/stretch.yaml \
+    --fps 20 \
+    --root data \
+    --repo-id ${HF_USER}/stretch_test \
+    --episode 0
+```
+
+Follow [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) to train a policy on your data and run inference on your robot. You will need to adapt the code for Stretch.
+
+> TODO(rcadene, aliberts): Add already setup environment and policy yaml configuration files
+
+If you need help, please reach out on Discord in the channel `#stretch3-mobile-arm`.

examples/9_use_aloha.md

@@ -0,0 +1,179 @@
+This tutorial explains how to use [Aloha and Aloha 2 stationary](https://www.trossenrobotics.com/aloha-stationary) with LeRobot.
+
+## Setup
+
+Follow the [documentation from Trossen Robotics](https://docs.trossenrobotics.com/aloha_docs/getting_started/stationary/hardware_setup.html) for setting up the hardware and plugging the 4 arms and 4 cameras to your computer.
+
+
+## Install LeRobot
+
+On your computer:
+
+1. [Install Miniconda](https://docs.anaconda.com/miniconda/#quick-command-line-install):
+```bash
+mkdir -p ~/miniconda3
+wget https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh -O ~/miniconda3/miniconda.sh
+bash ~/miniconda3/miniconda.sh -b -u -p ~/miniconda3
+rm ~/miniconda3/miniconda.sh
+~/miniconda3/bin/conda init bash
+```
+
+2. Restart shell or `source ~/.bashrc`
+
+3. Create and activate a fresh conda environment for lerobot
+```bash
+conda create -y -n lerobot python=3.10 && conda activate lerobot
+```
+
+4. Clone LeRobot:
+```bash
+git clone https://github.com/huggingface/lerobot.git ~/lerobot
+```
+
+5. Install LeRobot with dependencies for the Aloha motors (dynamixel) and cameras (intelrealsense):
+```bash
+cd ~/lerobot && pip install -e ".[dynamixel, intelrealsense]"
+```
+
+For Linux only (not Mac), install extra dependencies for recording datasets:
+```bash
+conda install -y -c conda-forge ffmpeg
+pip uninstall -y opencv-python
+conda install -y -c conda-forge "opencv>=4.10.0"
+```
+
+## Teleoperate
+
+**/!\ FOR SAFETY, READ THIS /!\**
+Teleoperation consists in manually operating the leader arms to move the follower arms. Importantly:
+1. Make sure your leader arms are in the same position as the follower arms, so that the follower arms don't move too fast to match the leader arms,
+2. Our code assumes that your robot has been assembled following Trossen Robotics instructions. This allows us to skip calibration, as we use the pre-defined calibration files in `.cache/calibration/aloha_default`. If you replace a motor, make sure you follow the exact instructions from Trossen Robotics.
+
+By running the following code, you can start your first **SAFE** teleoperation:
+```bash
+python lerobot/scripts/control_robot.py teleoperate \
+    --robot-path lerobot/configs/robot/aloha.yaml \
+    --robot-overrides max_relative_target=5
+```
+
+By adding `--robot-overrides max_relative_target=5`, we override the default value for `max_relative_target` defined in `lerobot/configs/robot/aloha.yaml`. It is expected to be `5` to limit the magnitude of the movement for more safety, but the teloperation won't be smooth. When you feel confident, you can disable this limit by adding `--robot-overrides max_relative_target=null` to the command line:
+```bash
+python lerobot/scripts/control_robot.py teleoperate \
+    --robot-path lerobot/configs/robot/aloha.yaml \
+    --robot-overrides max_relative_target=null
+```
+
+## Record a dataset
+
+Once you're familiar with teleoperation, you can record your first dataset with Aloha.
+
+If you want to use the Hugging Face hub features for uploading your dataset and you haven't previously done it, make sure you've logged in using a write-access token, which can be generated from the [Hugging Face settings](https://huggingface.co/settings/tokens):
+```bash
+huggingface-cli login --token ${HUGGINGFACE_TOKEN} --add-to-git-credential
+```
+
+Store your Hugging Face repository name in a variable to run these commands:
+```bash
+HF_USER=$(huggingface-cli whoami | head -n 1)
+echo $HF_USER
+```
+
+Record 2 episodes and upload your dataset to the hub:
+```bash
+python lerobot/scripts/control_robot.py record \
+    --robot-path lerobot/configs/robot/aloha.yaml \
+    --robot-overrides max_relative_target=null \
+    --fps 30 \
+    --root data \
+    --repo-id ${HF_USER}/aloha_test \
+    --tags aloha tutorial \
+    --warmup-time-s 5 \
+    --episode-time-s 40 \
+    --reset-time-s 10 \
+    --num-episodes 2 \
+    --push-to-hub 1
+```
+
+## Visualize a dataset
+
+If you uploaded your dataset to the hub with `--push-to-hub 1`, you can [visualize your dataset online](https://huggingface.co/spaces/lerobot/visualize_dataset) by copy pasting your repo id given by:
+```bash
+echo ${HF_USER}/aloha_test
+```
+
+If you didn't upload with `--push-to-hub 0`, you can also visualize it locally with:
+```bash
+python lerobot/scripts/visualize_dataset_html.py \
+  --root data \
+  --repo-id ${HF_USER}/aloha_test
+```
+
+## Replay an episode
+
+**/!\ FOR SAFETY, READ THIS /!\**
+Replay consists in automatically replaying the sequence of actions (i.e. goal positions for your motors) recorded in a given dataset episode. Make sure the current initial position of your robot is similar to the one in your episode, so that your follower arms don't move too fast to go to the first goal positions. For safety, you might want to add `--robot-overrides max_relative_target=5` to your command line as explained above.
+
+Now try to replay the first episode on your robot:
+```bash
+python lerobot/scripts/control_robot.py replay \
+    --robot-path lerobot/configs/robot/aloha.yaml \
+    --robot-overrides max_relative_target=null \
+    --fps 30 \
+    --root data \
+    --repo-id ${HF_USER}/aloha_test \
+    --episode 0
+```
+
+## Train a policy
+
+To train a policy to control your robot, use the [`python lerobot/scripts/train.py`](../lerobot/scripts/train.py) script. A few arguments are required. Here is an example command:
+```bash
+DATA_DIR=data python lerobot/scripts/train.py \
+  dataset_repo_id=${HF_USER}/aloha_test \
+  policy=act_aloha_real \
+  env=aloha_real \
+  hydra.run.dir=outputs/train/act_aloha_test \
+  hydra.job.name=act_aloha_test \
+  device=cuda \
+  wandb.enable=true
+```
+
+Let's explain it:
+1. We provided the dataset as argument with `dataset_repo_id=${HF_USER}/aloha_test`.
+2. We provided the policy with `policy=act_aloha_real`. This loads configurations from [`lerobot/configs/policy/act_aloha_real.yaml`](../lerobot/configs/policy/act_aloha_real.yaml). Importantly, this policy uses 4 cameras as input `cam_right_wrist`, `cam_left_wrist`, `cam_high`, and `cam_low`.
+3. We provided an environment as argument with `env=aloha_real`. This loads configurations from [`lerobot/configs/env/aloha_real.yaml`](../lerobot/configs/env/aloha_real.yaml). Note: this yaml defines 18 dimensions for the `state_dim` and `action_dim`, corresponding to 18 motors, not 14 motors as used in previous Aloha work. This is because, we include the `shoulder_shadow` and `elbow_shadow` motors for simplicity.
+4. We provided `device=cuda` since we are training on a Nvidia GPU.
+5. We provided `wandb.enable=true` to use [Weights and Biases](https://docs.wandb.ai/quickstart) for visualizing training plots. This is optional but if you use it, make sure you are logged in by running `wandb login`.
+6. We added `DATA_DIR=data` to access your dataset stored in your local `data` directory. If you dont provide `DATA_DIR`, your dataset will be downloaded from Hugging Face hub to your cache folder `$HOME/.cache/hugginface`. In future versions of `lerobot`, both directories will be in sync.
+
+Training should take several hours. You will find checkpoints in `outputs/train/act_aloha_test/checkpoints`.
+
+## Evaluate your policy
+
+You can use the `record` function from [`lerobot/scripts/control_robot.py`](../lerobot/scripts/control_robot.py) but with a policy checkpoint as input. For instance, run this command to record 10 evaluation episodes:
+```bash
+python lerobot/scripts/control_robot.py record \
+  --robot-path lerobot/configs/robot/aloha.yaml \
+  --robot-overrides max_relative_target=null \
+  --fps 30 \
+  --root data \
+  --repo-id ${HF_USER}/eval_act_aloha_test \
+  --tags aloha tutorial eval \
+  --warmup-time-s 5 \
+  --episode-time-s 40 \
+  --reset-time-s 10 \
+  --num-episodes 10 \
+  --num-image-writer-processes 1 \
+  -p outputs/train/act_aloha_test/checkpoints/last/pretrained_model
+```
+
+As you can see, it's almost the same command as previously used to record your training dataset. Two things changed:
+1. There is an additional `-p` argument which indicates the path to your policy checkpoint with  (e.g. `-p outputs/train/eval_aloha_test/checkpoints/last/pretrained_model`). You can also use the model repository if you uploaded a model checkpoint to the hub (e.g. `-p ${HF_USER}/act_aloha_test`).
+2. The name of dataset begins by `eval` to reflect that you are running inference (e.g. `--repo-id ${HF_USER}/eval_act_aloha_test`).
+3. We use `--num-image-writer-processes 1` instead of the default value (`0`). On our computer, using a dedicated process to write images from the 4 cameras on disk allows to reach constent 30 fps during inference. Feel free to explore different values for `--num-image-writer-processes`.
+
+## More
+
+Follow this [previous tutorial](https://github.com/huggingface/lerobot/blob/main/examples/7_get_started_with_real_robot.md#4-train-a-policy-on-your-data) for a more in-depth explaination.
+
+If you have any question or need help, please reach out on Discord in the channel `#aloha-arm`.

examples/advanced/1_train_act_pusht/act_pusht.yaml

@@ -0,0 +1,87 @@
+# @package _global_
+
+# Change the seed to match what PushT eval uses
+# (to avoid evaluating on seeds used for generating the training data).
+seed: 100000
+# Change the dataset repository to the PushT one.
+dataset_repo_id: lerobot/pusht
+
+override_dataset_stats:
+  observation.image:
+    # stats from imagenet, since we use a pretrained vision model
+    mean: [[[0.485]], [[0.456]], [[0.406]]]  # (c,1,1)
+    std: [[[0.229]], [[0.224]], [[0.225]]]  # (c,1,1)
+
+training:
+  offline_steps: 80000
+  online_steps: 0
+  eval_freq: 10000
+  save_freq: 100000
+  log_freq: 250
+  save_model: true
+
+  batch_size: 8
+  lr: 1e-5
+  lr_backbone: 1e-5
+  weight_decay: 1e-4
+  grad_clip_norm: 10
+  online_steps_between_rollouts: 1
+
+  delta_timestamps:
+    action: "[i / ${fps} for i in range(${policy.chunk_size})]"
+
+eval:
+  n_episodes: 50
+  batch_size: 50
+
+# See `configuration_act.py` for more details.
+policy:
+  name: act
+
+  # Input / output structure.
+  n_obs_steps: 1
+  chunk_size: 100 # chunk_size
+  n_action_steps: 100
+
+  input_shapes:
+    observation.image: [3, 96, 96]
+    observation.state: ["${env.state_dim}"]
+  output_shapes:
+    action: ["${env.action_dim}"]
+
+  # Normalization / Unnormalization
+  input_normalization_modes:
+    observation.image: mean_std
+    # Use min_max normalization just because it's more standard.
+    observation.state: min_max
+  output_normalization_modes:
+    # Use min_max normalization just because it's more standard.
+    action: min_max
+
+  # Architecture.
+  # Vision backbone.
+  vision_backbone: resnet18
+  pretrained_backbone_weights: ResNet18_Weights.IMAGENET1K_V1
+  replace_final_stride_with_dilation: false
+  # Transformer layers.
+  pre_norm: false
+  dim_model: 512
+  n_heads: 8
+  dim_feedforward: 3200
+  feedforward_activation: relu
+  n_encoder_layers: 4
+    # Note: Although the original ACT implementation has 7 for `n_decoder_layers`, there is a bug in the code
+  # that means only the first layer is used. Here we match the original implementation by setting this to 1.
+  # See this issue https://github.com/tonyzhaozh/act/issues/25#issue-2258740521.
+  n_decoder_layers: 1
+  # VAE.
+  use_vae: true
+  latent_dim: 32
+  n_vae_encoder_layers: 4
+
+  # Inference.
+  temporal_ensemble_coeff: null
+
+  # Training and loss computation.
+  dropout: 0.1
+  kl_weight: 10.0

examples/advanced/1_train_act_pusht/train_act_pusht.md

@@ -0,0 +1,70 @@
+In this tutorial we will learn how to adapt a policy configuration to be compatible with a new environment and dataset. As a concrete example, we will adapt the default configuration for ACT to be compatible with the PushT environment and dataset.
+
+If you haven't already read our tutorial on the [training script and configuration tooling](../4_train_policy_with_script.md) please do so prior to tackling this tutorial.
+
+Let's get started!
+
+Suppose we want to train ACT for PushT. Well, there are aspects of the ACT configuration that are specific to the ALOHA environments, and these happen to be incompatible with PushT. Therefore, trying to run the following will almost certainly raise an exception of sorts (eg: feature dimension mismatch):
+
+```bash
+python lerobot/scripts/train.py policy=act env=pusht dataset_repo_id=lerobot/pusht
+```
+
+We need to adapt the parameters of the ACT policy configuration to the PushT environment. The most important ones are the image keys.
+
+ALOHA's datasets and environments typically use a variable number of cameras. In `lerobot/configs/policy/act.yaml` you may notice two relevant sections. Here we show you the minimal diff needed to adjust to PushT:
+
+```diff
+override_dataset_stats:
+-  observation.images.top:
++  observation.image:
+    # stats from imagenet, since we use a pretrained vision model
+    mean: [[[0.485]], [[0.456]], [[0.406]]]  # (c,1,1)
+    std: [[[0.229]], [[0.224]], [[0.225]]]  # (c,1,1)
+
+policy:
+  input_shapes:
+-    observation.images.top: [3, 480, 640]
++    observation.image: [3, 96, 96]
+    observation.state: ["${env.state_dim}"]
+  output_shapes:
+    action: ["${env.action_dim}"]
+
+  input_normalization_modes:
+-    observation.images.top: mean_std
++    observation.image: mean_std
+     observation.state: min_max
+  output_normalization_modes:
+    action: min_max
+```
+
+Here we've accounted for the following:
+- PushT uses "observation.image" for its image key.
+- PushT provides smaller images.
+
+_Side note: technically we could override these via the CLI, but with many changes it gets a bit messy, and we also have a bit of a challenge in that we're using `.` in our observation keys which is treated by Hydra as a hierarchical separator_.
+
+For your convenience, we provide [`act_pusht.yaml`](./act_pusht.yaml) in this directory. It contains the diff above, plus some other (optional) ones that are explained within. Please copy it into `lerobot/configs/policy` with:
+
+```bash
+cp examples/advanced/1_train_act_pusht/act_pusht.yaml lerobot/configs/policy/act_pusht.yaml
+```
+
+(remember from a [previous tutorial](../4_train_policy_with_script.md) that Hydra will look in the `lerobot/configs` directory). Now try running the following.
+
+<!-- Note to contributor: are you changing this command? Note that it's tested in `Makefile`, so change it there too! -->
+```bash
+python lerobot/scripts/train.py policy=act_pusht env=pusht
+```
+
+Notice that this is much the same as the command that failed at the start of the tutorial, only:
+- Now we are using `policy=act_pusht` to point to our new configuration file.
+- We can drop `dataset_repo_id=lerobot/pusht` as the change is incorporated in our new configuration file.
+
+Hurrah! You're now training ACT for the PushT environment.
+
+---
+
+The bottom line of this tutorial is that when training policies for different environments and datasets you will need to understand what parts of the policy configuration are specific to those and make changes accordingly.
+
+Happy coding! 🤗

examples/advanced/2_calculate_validation_loss.py

@@ -0,0 +1,90 @@
+"""This script demonstrates how to slice a dataset and calculate the loss on a subset of the data.
+
+This technique can be useful for debugging and testing purposes, as well as identifying whether a policy
+is learning effectively.
+
+Furthermore, relying on validation loss to evaluate performance is generally not considered a good practice,
+especially in the context of imitation learning. The most reliable approach is to evaluate the policy directly
+on the target environment, whether that be in simulation or the real world.
+"""
+
+import math
+from pathlib import Path
+
+import torch
+from huggingface_hub import snapshot_download
+
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
+from lerobot.common.policies.diffusion.modeling_diffusion import DiffusionPolicy
+
+device = torch.device("cuda")
+
+# Download the diffusion policy for pusht environment
+pretrained_policy_path = Path(snapshot_download("lerobot/diffusion_pusht"))
+# OR uncomment the following to evaluate a policy from the local outputs/train folder.
+# pretrained_policy_path = Path("outputs/train/example_pusht_diffusion")
+
+policy = DiffusionPolicy.from_pretrained(pretrained_policy_path)
+policy.eval()
+policy.to(device)
+
+# Set up the dataset.
+delta_timestamps = {
+    # Load the previous image and state at -0.1 seconds before current frame,
+    # then load current image and state corresponding to 0.0 second.
+    "observation.image": [-0.1, 0.0],
+    "observation.state": [-0.1, 0.0],
+    # Load the previous action (-0.1), the next action to be executed (0.0),
+    # and 14 future actions with a 0.1 seconds spacing. All these actions will be
+    # used to calculate the loss.
+    "action": [-0.1, 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0, 1.1, 1.2, 1.3, 1.4],
+}
+
+# Load the last 10% of episodes of the dataset as a validation set.
+# - Load full dataset
+full_dataset = LeRobotDataset("lerobot/pusht", split="train")
+# - Calculate train and val subsets
+num_train_episodes = math.floor(full_dataset.num_episodes * 90 / 100)
+num_val_episodes = full_dataset.num_episodes - num_train_episodes
+print(f"Number of episodes in full dataset: {full_dataset.num_episodes}")
+print(f"Number of episodes in training dataset (90% subset): {num_train_episodes}")
+print(f"Number of episodes in validation dataset (10% subset): {num_val_episodes}")
+# - Get first frame index of the validation set
+first_val_frame_index = full_dataset.episode_data_index["from"][num_train_episodes].item()
+# - Load frames subset belonging to validation set using the `split` argument.
+#   It utilizes the `datasets` library's syntax for slicing datasets.
+#   For more information on the Slice API, please see:
+#   https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
+train_dataset = LeRobotDataset(
+    "lerobot/pusht", split=f"train[:{first_val_frame_index}]", delta_timestamps=delta_timestamps
+)
+val_dataset = LeRobotDataset(
+    "lerobot/pusht", split=f"train[{first_val_frame_index}:]", delta_timestamps=delta_timestamps
+)
+print(f"Number of frames in training dataset (90% subset): {len(train_dataset)}")
+print(f"Number of frames in validation dataset (10% subset): {len(val_dataset)}")
+
+# Create dataloader for evaluation.
+val_dataloader = torch.utils.data.DataLoader(
+    val_dataset,
+    num_workers=4,
+    batch_size=64,
+    shuffle=False,
+    pin_memory=device != torch.device("cpu"),
+    drop_last=False,
+)
+
+# Run validation loop.
+loss_cumsum = 0
+n_examples_evaluated = 0
+for batch in val_dataloader:
+    batch = {k: v.to(device, non_blocking=True) for k, v in batch.items()}
+    output_dict = policy.forward(batch)
+
+    loss_cumsum += output_dict["loss"].item()
+    n_examples_evaluated += batch["index"].shape[0]
+
+# Calculate the average loss over the validation set.
+average_loss = loss_cumsum / n_examples_evaluated
+
+print(f"Average loss on validation set: {average_loss:.4f}")

examples/test.py

@@ -0,0 +1,681 @@
+import threading
+import time
+from typing import Callable
+
+import cv2
+import numpy as np
+
+# from qai_hub_models.models.mediapipe_hand.app import MediaPipeHandApp
+# from qai_hub_models.models.mediapipe_hand.model import (
+#     MediaPipeHand,
+# )
+# from qai_hub_models.utils.image_processing import (
+#     app_to_net_image_inputs,
+# )
+from lerobot.common.robot_devices.motors.feetech import (
+    CalibrationMode,
+    FeetechMotorsBus,
+)
+
+LOWER_BOUND_LINEAR = -100
+UPPER_BOUND_LINEAR = 200
+
+import serial
+
+
+class HomonculusGlove:
+    def __init__(self):
+        self.serial_port = "/dev/tty.usbmodem21401"
+        self.baud_rate = 115200
+        self.serial = serial.Serial(self.serial_port, self.baud_rate, timeout=1)
+        self.thread = threading.Thread(target=self.async_read)
+        self.thread.start()
+        self.last_d = {
+            "thumb_0": 100,
+            "thumb_1": 100,
+            "thumb_2": 100,
+            "thumb_3": 100,
+            "index_0": 100,
+            "index_1": 100,
+            "index_2": 100,
+            "middle_0": 100,
+            "middle_1": 100,
+            "middle_2": 100,
+            "ring_0": 100,
+            "ring_1": 100,
+            "ring_2": 100,
+            "pinky_0": 100,
+            "pinky_1": 100,
+            "pinky_2": 100,
+            "battery_voltage": 100,
+        }
+        self.calibration = None
+
+    @property
+    def joint_names(self):
+        return list(self.last_d.keys())
+
+    def read(self, motor_names: list[str] | None = None):
+        if motor_names is None:
+            motor_names = self.joint_names
+
+        values = np.array([self.last_d[k] for k in motor_names])
+
+        print(motor_names)
+        print(values)
+
+        if self.calibration is not None:
+            values = self.apply_calibration(values, motor_names)
+            print(values)
+        return values
+
+    def async_read(self):
+        while True:
+            if self.serial.in_waiting > 0:
+                self.serial.flush()
+                vals = self.serial.readline().decode("utf-8").strip()
+                vals = vals.split(" ")
+                if len(vals) != 17:
+                    continue
+                vals = [int(val) for val in vals]
+
+                d = {
+                    "thumb_0": vals[0],
+                    "thumb_1": vals[1],
+                    "thumb_2": vals[2],
+                    "thumb_3": vals[3],
+                    "index_0": vals[4],
+                    "index_1": vals[5],
+                    "index_2": vals[6],
+                    "middle_0": vals[7],
+                    "middle_1": vals[8],
+                    "middle_2": vals[9],
+                    "ring_0": vals[10],
+                    "ring_1": vals[11],
+                    "ring_2": vals[12],
+                    "pinky_0": vals[13],
+                    "pinky_1": vals[14],
+                    "pinky_2": vals[15],
+                    "battery_voltage": vals[16],
+                }
+                self.last_d = d
+                # print(d.values())
+
+    def run_calibration(self):
+        print("\nMove arm to open position")
+        input("Press Enter to continue...")
+        open_pos_list = []
+        for _ in range(300):
+            open_pos = self.read()
+            open_pos_list.append(open_pos)
+            time.sleep(0.01)
+        open_pos = np.array(open_pos_list)
+        max_open_pos = open_pos.max(axis=0)
+        min_open_pos = open_pos.min(axis=0)
+
+        print(f"{max_open_pos=}")
+        print(f"{min_open_pos=}")
+
+        print("\nMove arm to closed position")
+        input("Press Enter to continue...")
+        closed_pos_list = []
+        for _ in range(300):
+            closed_pos = self.read()
+            closed_pos_list.append(closed_pos)
+            time.sleep(0.01)
+        closed_pos = np.array(closed_pos_list)
+        max_closed_pos = closed_pos.max(axis=0)
+        closed_pos[closed_pos < 1000] = 60000
+        min_closed_pos = closed_pos.min(axis=0)
+
+        print(f"{max_closed_pos=}")
+        print(f"{min_closed_pos=}")
+
+        open_pos = np.array([max_open_pos, max_closed_pos]).max(axis=0)
+        closed_pos = np.array([min_open_pos, min_closed_pos]).min(axis=0)
+
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        for i, jname in enumerate(self.joint_names):
+            if jname in ["thumb_0", "thumb_3", "index_2", "middle_2", "ring_2", "pinky_0", "pinky_2"]:
+                tmp_pos = open_pos[i]
+                open_pos[i] = closed_pos[i]
+                closed_pos[i] = tmp_pos
+
+        print()
+        print(f"{open_pos=}")
+        print(f"{closed_pos=}")
+
+        homing_offset = [0] * len(self.joint_names)
+        drive_mode = [0] * len(self.joint_names)
+        calib_modes = [CalibrationMode.LINEAR.name] * len(self.joint_names)
+
+        calib_dict = {
+            "homing_offset": homing_offset,
+            "drive_mode": drive_mode,
+            "start_pos": open_pos,
+            "end_pos": closed_pos,
+            "calib_mode": calib_modes,
+            "motor_names": self.joint_names,
+        }
+        # return calib_dict
+        self.set_calibration(calib_dict)
+
+    def set_calibration(self, calibration: dict[str, list]):
+        self.calibration = calibration
+
+    def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+        """Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
+        a "zero position" at 0 degree.
+
+        Note: We say "nominal degree range" since the motors can take values outside this range. For instance, 190 degrees, if the motor
+        rotate more than a half a turn from the zero position. However, most motors can't rotate more than 180 degrees and will stay in this range.
+
+        Joints values are original in [0, 2**32[ (unsigned int32). Each motor are expected to complete a full rotation
+        when given a goal position that is + or - their resolution. For instance, feetech xl330-m077 have a resolution of 4096, and
+        at any position in their original range, let's say the position 56734, they complete a full rotation clockwise by moving to 60830,
+        or anticlockwise by moving to 52638. The position in the original range is arbitrary and might change a lot between each motor.
+        To harmonize between motors of the same model, different robots, or even models of different brands, we propose to work
+        in the centered nominal degree range ]-180, 180[.
+        """
+        if motor_names is None:
+            motor_names = self.motor_names
+
+        # Convert from unsigned int32 original range [0, 2**32] to signed float32 range
+        values = values.astype(np.float32)
+
+        for i, name in enumerate(motor_names):
+            calib_idx = self.calibration["motor_names"].index(name)
+            calib_mode = self.calibration["calib_mode"][calib_idx]
+
+            if CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
+                start_pos = self.calibration["start_pos"][calib_idx]
+                end_pos = self.calibration["end_pos"][calib_idx]
+
+                # Rescale the present position to a nominal range [0, 100] %,
+                # useful for joints with linear motions like Aloha gripper
+                values[i] = (values[i] - start_pos) / (end_pos - start_pos) * 100
+
+                if (values[i] < LOWER_BOUND_LINEAR) or (values[i] > UPPER_BOUND_LINEAR):
+                    if name == "pinky_1" and (values[i] < LOWER_BOUND_LINEAR):
+                        values[i] = end_pos
+                    else:
+                        msg = (
+                            f"Wrong motor position range detected for {name}. "
+                            f"Expected to be in nominal range of [0, 100] % (a full linear translation), "
+                            f"with a maximum range of [{LOWER_BOUND_LINEAR}, {UPPER_BOUND_LINEAR}] % to account for some imprecision during calibration, "
+                            f"but present value is {values[i]} %. "
+                            "This might be due to a cable connection issue creating an artificial jump in motor values. "
+                            "You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
+                        )
+                        print(msg)
+                        # raise JointOutOfRangeError(msg)
+
+        return values
+
+    # def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+    #     """Inverse of `apply_calibration`."""
+    #     if motor_names is None:
+    #         motor_names = self.motor_names
+
+    #     for i, name in enumerate(motor_names):
+    #         calib_idx = self.calibration["motor_names"].index(name)
+    #         calib_mode = self.calibration["calib_mode"][calib_idx]
+
+    #         if CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
+    #             start_pos = self.calibration["start_pos"][calib_idx]
+    #             end_pos = self.calibration["end_pos"][calib_idx]
+
+    #             # Convert from nominal lnear range of [0, 100] % to
+    #             # actual motor range of values which can be arbitrary.
+    #             values[i] = values[i] / 100 * (end_pos - start_pos) + start_pos
+
+    #     values = np.round(values).astype(np.int32)
+    #     return values
+
+
+class HopeJuniorRobot:
+    def __init__(self):
+        self.arm_bus = FeetechMotorsBus(
+            port="/dev/tty.usbmodem58760429571",
+            motors={
+                # "motor1": (2, "sts3250"),
+                # "motor2": (1, "scs0009"),
+                "shoulder_pitch": [1, "sts3250"],
+                "shoulder_yaw": [2, "sts3215"],  # TODO: sts3250
+                "shoulder_roll": [3, "sts3215"],  # TODO: sts3250
+                "elbow_flex": [4, "sts3250"],
+                "wrist_roll": [5, "sts3215"],
+                "wrist_yaw": [6, "sts3215"],
+                "wrist_pitch": [7, "sts3215"],
+            },
+            protocol_version=0,
+        )
+        self.hand_bus = FeetechMotorsBus(
+            port="/dev/tty.usbmodem585A0077581",
+            motors={
+                "thumb_basel_rotation": [30, "scs0009"],
+                "thumb_flexor": [27, "scs0009"],
+                "thumb_pinky_side": [26, "scs0009"],
+                "thumb_thumb_side": [28, "scs0009"],
+                "index_flexor": [25, "scs0009"],
+                "index_pinky_side": [31, "scs0009"],
+                "index_thumb_side": [32, "scs0009"],
+                "middle_flexor": [24, "scs0009"],
+                "middle_pinky_side": [33, "scs0009"],
+                "middle_thumb_side": [34, "scs0009"],
+                "ring_flexor": [21, "scs0009"],
+                "ring_pinky_side": [36, "scs0009"],
+                "ring_thumb_side": [35, "scs0009"],
+                "pinky_flexor": [23, "scs0009"],
+                "pinky_pinky_side": [38, "scs0009"],
+                "pinky_thumb_side": [37, "scs0009"],
+            },
+            protocol_version=1,
+            group_sync_read=False,
+        )
+
+    def get_hand_calibration(self):
+        homing_offset = [0] * len(self.hand_bus.motor_names)
+        drive_mode = [0] * len(self.hand_bus.motor_names)
+
+        start_pos = [
+            500,
+            900,
+            1000,
+            0,
+            100,
+            250,
+            750,
+            100,
+            400,
+            150,
+            100,
+            120,
+            980,
+            100,
+            950,
+            750,
+        ]
+
+        end_pos = [
+            500 - 250,
+            900 - 300,
+            1000 - 550,
+            0 + 550,
+            1000,
+            250 + 700,
+            750 - 700,
+            1000,
+            400 + 700,
+            150 + 700,
+            1000,
+            120 + 700,
+            980 - 700,
+            1000,
+            950 - 700,
+            750 - 700,
+        ]
+
+        calib_modes = [CalibrationMode.LINEAR.name] * len(self.hand_bus.motor_names)
+
+        calib_dict = {
+            "homing_offset": homing_offset,
+            "drive_mode": drive_mode,
+            "start_pos": start_pos,
+            "end_pos": end_pos,
+            "calib_mode": calib_modes,
+            "motor_names": self.hand_bus.motor_names,
+        }
+        return calib_dict
+
+    def connect(self):
+        self.arm_bus.connect()
+        self.hand_bus.connect()
+
+
+ESCAPE_KEY_ID = 27
+
+
+def capture_and_display_processed_frames(
+    frame_processor: Callable[[np.ndarray], np.ndarray],
+    window_display_name: str,
+    cap_device: int = 0,
+) -> None:
+    """
+    Capture frames from the given input camera device, run them through
+    the frame processor, and display the outputs in a window with the given name.
+
+    User should press Esc to exit.
+
+    Inputs:
+        frame_processor: Callable[[np.ndarray], np.ndarray]
+            Processes frames.
+            Input and output are numpy arrays of shape (H W C) with BGR channel layout and dtype uint8 / byte.
+        window_display_name: str
+            Name of the window used to display frames.
+        cap_device: int
+            Identifier for the camera to use to capture frames.
+    """
+    cv2.namedWindow(window_display_name)
+    capture = cv2.VideoCapture(cap_device)
+    if not capture.isOpened():
+        raise ValueError("Unable to open video capture.")
+
+    frame_count = 0
+    has_frame, frame = capture.read()
+    while has_frame:
+        assert isinstance(frame, np.ndarray)
+
+        frame_count = frame_count + 1
+        # mirror frame
+        frame = np.ascontiguousarray(frame[:, ::-1, ::-1])
+
+        # process & show frame
+        processed_frame = frame_processor(frame)
+        cv2.imshow(window_display_name, processed_frame[:, :, ::-1])
+
+        has_frame, frame = capture.read()
+        key = cv2.waitKey(1)
+        if key == ESCAPE_KEY_ID:
+            break
+
+    capture.release()
+
+
+def main():
+    robot = HopeJuniorRobot()
+    robot.connect()
+
+    # robot.hand_bus.calibration = None
+
+    # breakpoint()
+    # print(robot.arm_bus.read("Present_Position"))
+    robot.arm_bus.write("Torque_Enable", 1)
+    robot.arm_bus.write("Acceleration", 20)
+    robot.arm_bus.read("Acceleration")
+
+    calibration = robot.get_hand_calibration()
+    robot.hand_bus.write("Goal_Position", calibration["start_pos"])
+    # robot.hand_bus.write("Goal_Position", calibration["end_pos"][:4], robot.hand_bus.motor_names[:4])
+    robot.hand_bus.set_calibration(calibration)
+    lol = 1
+
+    # # print(motors_bus.write("Goal_Position", 500))
+    # print(robot.hand_bus.read("Present_Position"))
+    # # pos = hand_bus.read("Present_Position")
+    # # hand_bus.write("Goal_Position", pos[0]+20, hand_bus.motor_names[0])
+    # # hand_bus.write("Goal_Position", pos[i]+delta, hand_bus.motor_names[i])
+    # robot.hand_bus.read("Acceleration")
+    # robot.hand_bus.write("Acceleration", 10)
+
+    # sleep = 1
+    # # robot.hand_bus.write(
+    # #     "Goal_Position", [glove.last_d['index_2']-1500,300,300], ["index_pinky_side", "index_flexor", "index_thumb_side"]
+    # # )
+    # #time.sleep(sleep)
+    # time.sleep(sleep)
+    # robot.hand_bus.write(
+    #     "Goal_Position", [100, 100, 100], ["index_flexor", "index_pinky_side", "index_thumb_side"]
+    # )
+    # time.sleep(sleep)
+    # robot.hand_bus.write(
+    #     "Goal_Position", [100, 0, 0], ["middle_flexor", "middle_pinky_side", "middle_thumb_side"]
+    # )
+    # time.sleep(sleep)
+    # robot.hand_bus.write(
+    #     "Goal_Position", [200, 200, 0], ["ring_flexor", "ring_pinky_side", "ring_thumb_side"]
+    # )
+    # time.sleep(sleep)
+    # robot.hand_bus.write(
+    #     "Goal_Position", [200, 100, 600], ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"]
+    # )
+    # time.sleep(sleep)
+
+    # breakpoint()
+
+    glove = HomonculusGlove()
+    glove.run_calibration()
+    # while True:
+    #     joint_names = ["index_1", "index_2"]
+    #     joint_values = glove.read(joint_names)
+    #     print(joint_values)
+
+    input()
+    while True:
+        joint_names = []
+        joint_names += ["thumb_0", "thumb_2", "thumb_3"]
+        joint_names += ["index_1", "index_2"]
+        joint_names += ["middle_1", "middle_2"]
+        joint_names += ["ring_1", "ring_2"]
+        joint_names += ["pinky_1", "pinky_2"]
+        joint_values = glove.read(joint_names)
+        joint_values = joint_values.round().astype(int)
+        joint_dict = {k: v for k, v in zip(joint_names, joint_values, strict=False)}
+
+        motor_values = []
+        motor_names = []
+        motor_names += ["thumb_basel_rotation", "thumb_flexor", "thumb_pinky_side", "thumb_thumb_side"]
+        motor_values += [
+            joint_dict["thumb_3"],
+            joint_dict["thumb_0"],
+            joint_dict["thumb_2"],
+            joint_dict["thumb_2"],
+        ]
+        motor_names += ["index_flexor", "index_pinky_side", "index_thumb_side"]
+        motor_values += [joint_dict["index_2"], joint_dict["index_1"], joint_dict["index_1"]]
+        motor_names += ["middle_flexor", "middle_pinky_side", "middle_thumb_side"]
+        motor_values += [joint_dict["middle_2"], joint_dict["middle_1"], joint_dict["middle_1"]]
+        motor_names += ["ring_flexor", "ring_pinky_side", "ring_thumb_side"]
+        motor_values += [joint_dict["ring_2"], joint_dict["ring_1"], joint_dict["ring_1"]]
+        motor_names += ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"]
+
+        motor_values += [joint_dict["pinky_2"], joint_dict["pinky_1"], joint_dict["pinky_1"]]
+
+        motor_values = np.array(motor_values)
+        motor_values = np.clip(motor_values, 0, 100)
+
+        robot.hand_bus.write("Goal_Position", motor_values, motor_names)
+        time.sleep(0.02)
+
+    while True:
+        # print(glove.read()['index_2']-1500)
+        glove_index_flexor = glove.read()["index_2"] - 1500
+        glove_index_subflexor = glove.read()["index_1"] - 1500
+        glove_index_side = glove.read()["index_0"] - 2100
+
+        vals = [glove_index_flexor, 1000 - (glove_index_subflexor), glove_index_subflexor]
+
+        keys = ["index_flexor", "index_pinky_side", "index_thumb_side"]
+
+        glove_middle_flexor = glove.read()["middle_2"] - 1500
+        glove_middle_subflexor = 1000 - (glove.read()["middle_1"] - 1700)
+        vals += [glove_middle_flexor, glove_middle_subflexor, glove_middle_subflexor - 200]
+        keys += ["middle_flexor", "middle_pinky_side", "middle_thumb_side"]
+
+        glove_ring_flexor = glove.read()["ring_2"] - 1300
+        print(glove_ring_flexor)
+        glove_ring_subflexor = glove.read()["ring_1"] - 1100
+
+        vals += [glove_ring_flexor, 1000 - glove_ring_subflexor, glove_ring_subflexor]
+        keys += ["ring_flexor", "ring_pinky_side", "ring_thumb_side"]
+
+        glove_pinky_flexor = glove.read()["pinky_2"] - 1500
+        glove_pinky_subflexor = glove.read()["pinky_1"] - 1300
+        vals += [300 + glove_pinky_flexor, max(1000 - glove_pinky_subflexor - 100, 0), glove_pinky_subflexor]
+        keys += ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"]
+
+        robot.hand_bus.write("Goal_Position", vals, keys)
+        time.sleep(0.1)
+
+    time.sleep(3)
+
+    def move_arm(loop=10):
+        sleep = 1
+        for i in range(loop):
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1195])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 2195])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1457, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 2357, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 974, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 2674, 1957, 1695])
+            time.sleep(sleep + 2)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 1632, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 1369, 1632, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 1330, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [2381, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1681, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+
+    def move_hand(loop=10):
+        sleep = 0.5
+        for i in range(loop):
+            robot.hand_bus.write(
+                "Goal_Position",
+                [500, 1000, 0, 1000],
+                ["thumb_basel_rotation", "thumb_flexor", "thumb_pinky_side", "thumb_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position", [100, 100, 100], ["index_flexor", "index_pinky_side", "index_thumb_side"]
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position", [100, 1000, 150], ["middle_flexor", "middle_pinky_side", "middle_thumb_side"]
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position", [200, 200, 0], ["ring_flexor", "ring_pinky_side", "ring_thumb_side"]
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position", [200, 100, 700], ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"]
+            )
+            time.sleep(sleep)
+
+            robot.hand_bus.write(
+                "Goal_Position",
+                [500, 1000 - 250, 0 + 300, 1000 - 200],
+                ["thumb_basel_rotation", "thumb_flexor", "thumb_pinky_side", "thumb_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position",
+                [100 + 450, 100 + 400, 100 + 400],
+                ["index_flexor", "index_pinky_side", "index_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position",
+                [100 + 350, 1000 - 450, 150 + 450],
+                ["middle_flexor", "middle_pinky_side", "middle_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position",
+                [200 + 650, 200 + 350, 0 + 350],
+                ["ring_flexor", "ring_pinky_side", "ring_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position",
+                [200 + 450, 100 + 400, 700 - 400],
+                ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"],
+            )
+            time.sleep(sleep)
+
+    move_hand(3)
+
+    move_arm(1)
+
+    from concurrent.futures import ThreadPoolExecutor
+
+    with ThreadPoolExecutor() as executor:
+        executor.submit(move_arm)
+        executor.submit(move_hand)
+
+    # initial position
+    for i in range(3):
+        robot.hand_bus.write(
+            "Goal_Position", [500, 1000, 0, 1000, 100, 950, 100, 100, 1000, 150, 200, 200, 0, 200, 100, 700]
+        )
+        time.sleep(1)
+
+    # for i in range(3):
+    #     robot.hand_bus.write("Goal_Position", [500, 1000-150, 0+250, 1000-150,
+    #                                             100+300, 950-250, 100+250,
+    #                                             100+200, 1000-300, 150+300,
+    #                                             200+500, 200+200, 0+200,
+    #                                             200+300, 100+200, 700-200])
+    #     time.sleep(1)
+
+    # camera = 0
+    # score_threshold = 0.95
+    # iou_threshold = 0.3
+
+    # app = MediaPipeHandApp(MediaPipeHand.from_pretrained(), score_threshold, iou_threshold)
+
+    # def frame_processor(frame: np.ndarray) -> np.ndarray:
+    #     # Input Prep
+    #     NHWC_int_numpy_frames, NCHW_fp32_torch_frames = app_to_net_image_inputs(frame)
+
+    #     # Run Bounding Box & Keypoint Detector
+    #     batched_selected_boxes, batched_selected_keypoints = app._run_box_detector(NCHW_fp32_torch_frames)
+
+    #     # The region of interest ( bounding box of 4 (x, y) corners).
+    #     # list[torch.Tensor(shape=[Num Boxes, 4, 2])],
+    #     # where 2 == (x, y)
+    #     #
+    #     # A list element will be None if there is no selected ROI.
+    #     batched_roi_4corners = app._compute_object_roi(batched_selected_boxes, batched_selected_keypoints)
+
+    #     # selected landmarks for the ROI (if any)
+    #     # list[torch.Tensor(shape=[Num Selected Landmarks, K, 3])],
+    #     # where K == number of landmark keypoints, 3 == (x, y, confidence)
+    #     #
+    #     # A list element will be None if there is no ROI.
+    #     landmarks_out = app._run_landmark_detector(NHWC_int_numpy_frames, batched_roi_4corners)
+
+    #     app._draw_predictions(
+    #         NHWC_int_numpy_frames,
+    #         batched_selected_boxes,
+    #         batched_selected_keypoints,
+    #         batched_roi_4corners,
+    #         *landmarks_out,
+    #     )
+
+    #     return NHWC_int_numpy_frames[0]
+
+    # capture_and_display_processed_frames(frame_processor, "QAIHM Mediapipe Hand Demo", camera)
+
+
+if __name__ == "__main__":
+    main()

examples/test2.py

@@ -0,0 +1,133 @@
+#!/usr/bin/env python
+#
+# *********     Ping Example      *********
+#
+#
+# Available SCServo model on this example : All models using Protocol SCS
+# This example is tested with a SCServo(STS/SMS/SCS), and an URT
+# Be sure that SCServo(STS/SMS/SCS) properties are already set as %% ID : 1 / Baudnum : 6 (Baudrate : 1000000)
+#
+
+import os
+
+if os.name == "nt":
+    import msvcrt
+
+    def getch():
+        return msvcrt.getch().decode()
+else:
+    import sys
+    import termios
+    import tty
+
+    fd = sys.stdin.fileno()
+    old_settings = termios.tcgetattr(fd)
+
+    def getch():
+        try:
+            tty.setraw(sys.stdin.fileno())
+            ch = sys.stdin.read(1)
+        finally:
+            termios.tcsetattr(fd, termios.TCSADRAIN, old_settings)
+        return ch
+
+
+from scservo_sdk import *  # Uses SCServo SDK library
+
+# Default setting
+SCS_ID = 1  # SCServo ID : 1
+BAUDRATE = 1000000  # SCServo default baudrate : 1000000
+DEVICENAME = "/dev/tty.usbserial-2130"  # Check which port is being used on your controller
+# ex) Windows: "COM1"   Linux: "/dev/ttyUSB0" Mac: "/dev/tty.usbserial-*"
+
+protocol_end = 1  # SCServo bit end(STS/SMS=0, SCS=1)
+
+# Initialize PortHandler instance
+# Set the port path
+# Get methods and members of PortHandlerLinux or PortHandlerWindows
+portHandler = PortHandler(DEVICENAME)
+
+# Initialize PacketHandler instance
+# Get methods and members of Protocol
+packetHandler = PacketHandler(protocol_end)
+
+# Open port
+if portHandler.openPort():
+    print("Succeeded to open the port")
+else:
+    print("Failed to open the port")
+    print("Press any key to terminate...")
+    getch()
+    quit()
+
+
+# Set port baudrate
+if portHandler.setBaudRate(BAUDRATE):
+    print("Succeeded to change the baudrate")
+else:
+    print("Failed to change the baudrate")
+    print("Press any key to terminate...")
+    getch()
+    quit()
+
+# Try to ping the SCServo
+# Get SCServo model number
+scs_model_number, scs_comm_result, scs_error = packetHandler.ping(portHandler, SCS_ID)
+if scs_comm_result != COMM_SUCCESS:
+    print("%s" % packetHandler.getTxRxResult(scs_comm_result))
+elif scs_error != 0:
+    print("%s" % packetHandler.getRxPacketError(scs_error))
+else:
+    print("[ID:%03d] ping Succeeded. SCServo model number : %d" % (SCS_ID, scs_model_number))
+
+
+ADDR_SCS_PRESENT_POSITION = 56
+scs_present_position, scs_comm_result, scs_error = packetHandler.read2ByteTxRx(
+    portHandler, SCS_ID, ADDR_SCS_PRESENT_POSITION
+)
+if scs_comm_result != COMM_SUCCESS:
+    print(packetHandler.getTxRxResult(scs_comm_result))
+elif scs_error != 0:
+    print(packetHandler.getRxPacketError(scs_error))
+
+breakpoint()
+scs_present_position = SCS_LOWORD(scs_present_position)
+# scs_present_speed = SCS_HIWORD(scs_present_position_speed)
+# print("[ID:%03d] PresPos:%03d PresSpd:%03d" % (SCS_ID, scs_present_position, SCS_TOHOST(scs_present_speed, 15)))
+print("[ID:%03d] PresPos:%03d" % (SCS_ID, scs_present_position))
+
+groupSyncRead = GroupSyncRead(portHandler, packetHandler, ADDR_SCS_PRESENT_POSITION, 2)
+
+scs_addparam_result = groupSyncRead.addParam(SCS_ID)
+if scs_addparam_result != True:
+    print("[ID:%03d] groupSyncRead addparam failed" % SCS_ID)
+    quit()
+
+# Syncread present position
+scs_comm_result = groupSyncRead.txRxPacket()
+if scs_comm_result != COMM_SUCCESS:
+    print("%s" % packetHandler.getTxRxResult(scs_comm_result))
+
+# Check if groupsyncread data of SCServo#1 is available
+scs_getdata_result = groupSyncRead.isAvailable(SCS_ID, ADDR_SCS_PRESENT_POSITION, 2)
+if scs_getdata_result == True:
+    # Get SCServo#1 present position value
+    scs_present_position = groupSyncRead.getData(SCS_ID, ADDR_SCS_PRESENT_POSITION, 2)
+else:
+    scs_present_position = 0
+    print("[ID:%03d] groupSyncRead getdata failed" % SCS_ID)
+
+# # Check if groupsyncread data of SCServo#2 is available
+# scs_getdata_result = groupSyncRead.isAvailable(SCS2_ID, ADDR_SCS_PRESENT_POSITION, 2)
+# if scs_getdata_result == True:
+#     # Get SCServo#2 present position value
+#     scs2_present_position_speed = groupSyncRead.getData(SCS2_ID, ADDR_SCS_PRESENT_POSITION, 2)
+# else:
+#     print("[ID:%03d] groupSyncRead getdata failed" % SCS2_ID)
+
+scs_present_position = SCS_LOWORD(scs_present_position)
+print("[ID:%03d] PresPos:%03d" % (SCS_ID, scs_present_position))
+
+
+# Close port
+portHandler.closePort()

examples/test3.py

@@ -0,0 +1,45 @@
+import serial
+
+
+class HomonculusGlove:
+    def __init__(self):
+        self.serial_port = "/dev/tty.usbmodem1101"
+        self.baud_rate = 115200
+        self.serial = serial.Serial(self.serial_port, self.baud_rate, timeout=1)
+
+    def read(self):
+        while True:
+            if self.serial.in_waiting > 0:
+                vals = self.serial.readline().decode("utf-8").strip()
+                vals = vals.split(" ")
+                vals = [int(val) for val in vals]
+
+                d = {
+                    "thumb_0": vals[0],
+                    "thumb_1": vals[1],
+                    "thumb_2": vals[2],
+                    "thumb_3": vals[3],
+                    "index_0": vals[4],
+                    "index_1": vals[5],
+                    "index_2": vals[6],
+                    "middle_0": vals[7],
+                    "middle_1": vals[8],
+                    "middle_2": vals[9],
+                    "ring_0": vals[10],
+                    "ring_1": vals[11],
+                    "ring_2": vals[12],
+                    "pinky_0": vals[13],
+                    "pinky_1": vals[14],
+                    "pinky_2": vals[15],
+                }
+                return d
+
+        # if ser.in_waiting > 0:
+        #     line = ser.readline().decode('utf-8').strip()
+        #     print(line)
+
+
+if __name__ == "__main__":
+    glove = HomonculusGlove()
+    d = glove.read()
+    lol = 1

examples/test4.py

@@ -0,0 +1,693 @@
+import threading
+import time
+from typing import Callable
+
+import cv2
+import numpy as np
+
+# from qai_hub_models.models.mediapipe_hand.app import MediaPipeHandApp
+# from qai_hub_models.models.mediapipe_hand.model import (
+#     MediaPipeHand,
+# )
+# from qai_hub_models.utils.image_processing import (
+#     app_to_net_image_inputs,
+# )
+from lerobot.common.robot_devices.motors.feetech import (
+    CalibrationMode,
+    FeetechMotorsBus,
+)
+
+LOWER_BOUND_LINEAR = -100
+UPPER_BOUND_LINEAR = 200
+
+import serial
+
+
+class HomonculusGlove:
+    def __init__(self):
+        self.serial_port = "/dev/tty.usbmodem1401"
+        self.baud_rate = 115200
+        self.serial = serial.Serial(self.serial_port, self.baud_rate, timeout=1)
+        self.thread = threading.Thread(target=self.async_read)
+        self.thread.start()
+        self.last_d = {
+            "thumb_0": 100,
+            "thumb_1": 100,
+            "thumb_2": 100,
+            "thumb_3": 100,
+            "index_0": 100,
+            "index_1": 100,
+            "index_2": 100,
+            "middle_0": 100,
+            "middle_1": 100,
+            "middle_2": 100,
+            "ring_0": 100,
+            "ring_1": 100,
+            "ring_2": 100,
+            "pinky_0": 100,
+            "pinky_1": 100,
+            "pinky_2": 100,
+            "battery_voltage": 100,
+        }
+        self.calibration = None
+
+    @property
+    def joint_names(self):
+        return list(self.last_d.keys())
+
+    def read(self, motor_names: list[str] | None = None):
+        if motor_names is None:
+            motor_names = self.joint_names
+
+        values = np.array([self.last_d[k] for k in motor_names])
+
+        print(motor_names)
+        print(values)
+
+        if self.calibration is not None:
+            values = self.apply_calibration(values, motor_names)
+            print(values)
+        return values
+
+    def async_read(self):
+        while True:
+            if self.serial.in_waiting > 0:
+                self.serial.flush()
+                vals = self.serial.readline().decode("utf-8").strip()
+                vals = vals.split(" ")
+                if len(vals) != 17:
+                    continue
+                vals = [int(val) for val in vals]
+
+                d = {
+                    "thumb_0": vals[0],
+                    "thumb_1": vals[1],
+                    "thumb_2": vals[2],
+                    "thumb_3": vals[3],
+                    "index_0": vals[4],
+                    "index_1": vals[5],
+                    "index_2": vals[6],
+                    "middle_0": vals[7],
+                    "middle_1": vals[8],
+                    "middle_2": vals[9],
+                    "ring_0": vals[10],
+                    "ring_1": vals[11],
+                    "ring_2": vals[12],
+                    "pinky_0": vals[13],
+                    "pinky_1": vals[14],
+                    "pinky_2": vals[15],
+                    "battery_voltage": vals[16],
+                }
+                self.last_d = d
+                # print(d.values())
+
+    def run_calibration(self):
+        print("\nMove arm to open position")
+        input("Press Enter to continue...")
+        open_pos_list = []
+        for _ in range(300):
+            open_pos = self.read()
+            open_pos_list.append(open_pos)
+            time.sleep(0.01)
+        open_pos = np.array(open_pos_list)
+        max_open_pos = open_pos.max(axis=0)
+        min_open_pos = open_pos.min(axis=0)
+
+        print(f"{max_open_pos=}")
+        print(f"{min_open_pos=}")
+
+        print("\nMove arm to closed position")
+        input("Press Enter to continue...")
+        closed_pos_list = []
+        for _ in range(300):
+            closed_pos = self.read()
+            closed_pos_list.append(closed_pos)
+            time.sleep(0.01)
+        closed_pos = np.array(closed_pos_list)
+        max_closed_pos = closed_pos.max(axis=0)
+        closed_pos[closed_pos < 1000] = 60000
+        min_closed_pos = closed_pos.min(axis=0)
+
+        print(f"{max_closed_pos=}")
+        print(f"{min_closed_pos=}")
+
+        open_pos = np.array([max_open_pos, max_closed_pos]).max(axis=0)
+        closed_pos = np.array([min_open_pos, min_closed_pos]).min(axis=0)
+
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        # INVERTION
+        for i, jname in enumerate(self.joint_names):
+            if jname in [
+                "thumb_0",
+                "thumb_3",
+                "index_2",
+                "middle_2",
+                "ring_2",
+                "pinky_0",
+                "pinky_2",
+                "index_0",
+            ]:
+                tmp_pos = open_pos[i]
+                open_pos[i] = closed_pos[i]
+                closed_pos[i] = tmp_pos
+
+        print()
+        print(f"{open_pos=}")
+        print(f"{closed_pos=}")
+
+        homing_offset = [0] * len(self.joint_names)
+        drive_mode = [0] * len(self.joint_names)
+        calib_modes = [CalibrationMode.LINEAR.name] * len(self.joint_names)
+
+        calib_dict = {
+            "homing_offset": homing_offset,
+            "drive_mode": drive_mode,
+            "start_pos": open_pos,
+            "end_pos": closed_pos,
+            "calib_mode": calib_modes,
+            "motor_names": self.joint_names,
+        }
+        # return calib_dict
+        self.set_calibration(calib_dict)
+
+    def set_calibration(self, calibration: dict[str, list]):
+        self.calibration = calibration
+
+    def apply_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+        """Convert from unsigned int32 joint position range [0, 2**32[ to the universal float32 nominal degree range ]-180.0, 180.0[ with
+        a "zero position" at 0 degree.
+
+        Note: We say "nominal degree range" since the motors can take values outside this range. For instance, 190 degrees, if the motor
+        rotate more than a half a turn from the zero position. However, most motors can't rotate more than 180 degrees and will stay in this range.
+
+        Joints values are original in [0, 2**32[ (unsigned int32). Each motor are expected to complete a full rotation
+        when given a goal position that is + or - their resolution. For instance, feetech xl330-m077 have a resolution of 4096, and
+        at any position in their original range, let's say the position 56734, they complete a full rotation clockwise by moving to 60830,
+        or anticlockwise by moving to 52638. The position in the original range is arbitrary and might change a lot between each motor.
+        To harmonize between motors of the same model, different robots, or even models of different brands, we propose to work
+        in the centered nominal degree range ]-180, 180[.
+        """
+        if motor_names is None:
+            motor_names = self.motor_names
+
+        # Convert from unsigned int32 original range [0, 2**32] to signed float32 range
+        values = values.astype(np.float32)
+
+        for i, name in enumerate(motor_names):
+            calib_idx = self.calibration["motor_names"].index(name)
+            calib_mode = self.calibration["calib_mode"][calib_idx]
+
+            if CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
+                start_pos = self.calibration["start_pos"][calib_idx]
+                end_pos = self.calibration["end_pos"][calib_idx]
+
+                # Rescale the present position to a nominal range [0, 100] %,
+                # useful for joints with linear motions like Aloha gripper
+                values[i] = (values[i] - start_pos) / (end_pos - start_pos) * 100
+
+                if (values[i] < LOWER_BOUND_LINEAR) or (values[i] > UPPER_BOUND_LINEAR):
+                    if name == "pinky_1" and (values[i] < LOWER_BOUND_LINEAR):
+                        values[i] = end_pos
+                    else:
+                        msg = (
+                            f"Wrong motor position range detected for {name}. "
+                            f"Expected to be in nominal range of [0, 100] % (a full linear translation), "
+                            f"with a maximum range of [{LOWER_BOUND_LINEAR}, {UPPER_BOUND_LINEAR}] % to account for some imprecision during calibration, "
+                            f"but present value is {values[i]} %. "
+                            "This might be due to a cable connection issue creating an artificial jump in motor values. "
+                            "You need to recalibrate by running: `python lerobot/scripts/control_robot.py calibrate`"
+                        )
+                        print(msg)
+                        # raise JointOutOfRangeError(msg)
+
+        return values
+
+    # def revert_calibration(self, values: np.ndarray | list, motor_names: list[str] | None):
+    #     """Inverse of `apply_calibration`."""
+    #     if motor_names is None:
+    #         motor_names = self.motor_names
+
+    #     for i, name in enumerate(motor_names):
+    #         calib_idx = self.calibration["motor_names"].index(name)
+    #         calib_mode = self.calibration["calib_mode"][calib_idx]
+
+    #         if CalibrationMode[calib_mode] == CalibrationMode.LINEAR:
+    #             start_pos = self.calibration["start_pos"][calib_idx]
+    #             end_pos = self.calibration["end_pos"][calib_idx]
+
+    #             # Convert from nominal lnear range of [0, 100] % to
+    #             # actual motor range of values which can be arbitrary.
+    #             values[i] = values[i] / 100 * (end_pos - start_pos) + start_pos
+
+    #     values = np.round(values).astype(np.int32)
+    #     return values
+
+
+class HopeJuniorRobot:
+    def __init__(self):
+        self.arm_bus = FeetechMotorsBus(
+            port="/dev/tty.usbmodem58760429571",
+            motors={
+                # "motor1": (2, "sts3250"),
+                # "motor2": (1, "scs0009"),
+                "shoulder_pitch": [1, "sts3250"],
+                "shoulder_yaw": [2, "sts3215"],  # TODO: sts3250
+                "shoulder_roll": [3, "sts3215"],  # TODO: sts3250
+                "elbow_flex": [4, "sts3250"],
+                "wrist_roll": [5, "sts3215"],
+                "wrist_yaw": [6, "sts3215"],
+                "wrist_pitch": [7, "sts3215"],
+            },
+            protocol_version=0,
+        )
+        self.hand_bus = FeetechMotorsBus(
+            port="/dev/tty.usbmodem585A0077581",
+            motors={
+                "thumb_basel_rotation": [30, "scs0009"],
+                "thumb_flexor": [27, "scs0009"],
+                "thumb_pinky_side": [26, "scs0009"],
+                "thumb_thumb_side": [28, "scs0009"],
+                "index_flexor": [25, "scs0009"],
+                "index_pinky_side": [31, "scs0009"],
+                "index_thumb_side": [32, "scs0009"],
+                "middle_flexor": [24, "scs0009"],
+                "middle_pinky_side": [33, "scs0009"],
+                "middle_thumb_side": [34, "scs0009"],
+                "ring_flexor": [21, "scs0009"],
+                "ring_pinky_side": [36, "scs0009"],
+                "ring_thumb_side": [35, "scs0009"],
+                "pinky_flexor": [23, "scs0009"],
+                "pinky_pinky_side": [38, "scs0009"],
+                "pinky_thumb_side": [37, "scs0009"],
+            },
+            protocol_version=1,
+            group_sync_read=False,
+        )
+
+    def get_hand_calibration(self):
+        homing_offset = [0] * len(self.hand_bus.motor_names)
+        drive_mode = [0] * len(self.hand_bus.motor_names)
+
+        start_pos = [
+            500,
+            900,
+            1000,
+            0,
+            100,
+            250,
+            750,
+            100,
+            400,
+            150,
+            100,
+            120,
+            980,
+            100,
+            950,
+            750,
+        ]
+
+        end_pos = [
+            500 - 250,
+            900 - 300,
+            1000 - 550,
+            0 + 550,
+            1000,
+            start_pos[5] + 500,
+            start_pos[6] - 500,
+            1000,
+            400 + 700,
+            150 + 700,
+            1000,
+            120 + 700,
+            980 - 700,
+            1000,
+            950 - 700,
+            750 - 700,
+        ]
+
+        calib_modes = [CalibrationMode.LINEAR.name] * len(self.hand_bus.motor_names)
+
+        calib_dict = {
+            "homing_offset": homing_offset,
+            "drive_mode": drive_mode,
+            "start_pos": start_pos,
+            "end_pos": end_pos,
+            "calib_mode": calib_modes,
+            "motor_names": self.hand_bus.motor_names,
+        }
+        return calib_dict
+
+    def connect(self):
+        self.arm_bus.connect()
+        self.hand_bus.connect()
+
+
+ESCAPE_KEY_ID = 27
+
+
+def capture_and_display_processed_frames(
+    frame_processor: Callable[[np.ndarray], np.ndarray],
+    window_display_name: str,
+    cap_device: int = 0,
+) -> None:
+    """
+    Capture frames from the given input camera device, run them through
+    the frame processor, and display the outputs in a window with the given name.
+
+    User should press Esc to exit.
+
+    Inputs:
+        frame_processor: Callable[[np.ndarray], np.ndarray]
+            Processes frames.
+            Input and output are numpy arrays of shape (H W C) with BGR channel layout and dtype uint8 / byte.
+        window_display_name: str
+            Name of the window used to display frames.
+        cap_device: int
+            Identifier for the camera to use to capture frames.
+    """
+    cv2.namedWindow(window_display_name)
+    capture = cv2.VideoCapture(cap_device)
+    if not capture.isOpened():
+        raise ValueError("Unable to open video capture.")
+
+    frame_count = 0
+    has_frame, frame = capture.read()
+    while has_frame:
+        assert isinstance(frame, np.ndarray)
+
+        frame_count = frame_count + 1
+        # mirror frame
+        frame = np.ascontiguousarray(frame[:, ::-1, ::-1])
+
+        # process & show frame
+        processed_frame = frame_processor(frame)
+        cv2.imshow(window_display_name, processed_frame[:, :, ::-1])
+
+        has_frame, frame = capture.read()
+        key = cv2.waitKey(1)
+        if key == ESCAPE_KEY_ID:
+            break
+
+    capture.release()
+
+
+def main():
+    robot = HopeJuniorRobot()
+    robot.connect()
+
+    # robot.hand_bus.calibration = None
+
+    # breakpoint()
+    # print(robot.arm_bus.read("Present_Position"))
+    robot.arm_bus.write("Torque_Enable", 1)
+    robot.arm_bus.write("Acceleration", 20)
+    robot.arm_bus.read("Acceleration")
+
+    calibration = robot.get_hand_calibration()
+    robot.hand_bus.write("Goal_Position", calibration["start_pos"])
+    # robot.hand_bus.write("Goal_Position", calibration["end_pos"][:4], robot.hand_bus.motor_names[:4])
+    robot.hand_bus.set_calibration(calibration)
+    lol = 1
+
+    # # print(motors_bus.write("Goal_Position", 500))
+    # print(robot.hand_bus.read("Present_Position"))
+    # # pos = hand_bus.read("Present_Position")
+    # # hand_bus.write("Goal_Position", pos[0]+20, hand_bus.motor_names[0])
+    # # hand_bus.write("Goal_Position", pos[i]+delta, hand_bus.motor_names[i])
+    # robot.hand_bus.read("Acceleration")
+    # robot.hand_bus.write("Acceleration", 10)
+
+    # sleep = 1
+    # # robot.hand_bus.write(
+    # #     "Goal_Position", [glove.last_d['index_2']-1500,300,300], ["index_pinky_side", "index_flexor", "index_thumb_side"]
+    # # )
+    # #time.sleep(sleep)
+    # time.sleep(sleep)
+    # robot.hand_bus.write(
+    #     "Goal_Position", [100, 100, 100], ["index_flexor", "index_pinky_side", "index_thumb_side"]
+    # )
+    # time.sleep(sleep)
+    # robot.hand_bus.write(
+    #     "Goal_Position", [100, 0, 0], ["middle_flexor", "middle_pinky_side", "middle_thumb_side"]
+    # )
+    # time.sleep(sleep)
+    # robot.hand_bus.write(
+    #     "Goal_Position", [200, 200, 0], ["ring_flexor", "ring_pinky_side", "ring_thumb_side"]
+    # )
+    # time.sleep(sleep)
+    # robot.hand_bus.write(
+    #     "Goal_Position", [200, 100, 600], ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"]
+    # )
+    # time.sleep(sleep)
+
+    # breakpoint()
+
+    glove = HomonculusGlove()
+    glove.run_calibration()
+    # while True:
+    #     joint_names = ["index_1", "index_2"]
+    #     joint_values = glove.read(joint_names)
+    #     print(joint_values)
+
+    input()
+    while True:
+        joint_names = []
+        # joint_names += ["thumb_0", "thumb_2", "thumb_3"]
+        joint_names += ["index_0", "index_1"]
+        # joint_names += ["middle_1", "middle_2"]
+        # joint_names += ["ring_1", "ring_2"]
+        # joint_names += ["pinky_0", "pinky_2"]
+        joint_values = glove.read(joint_names)
+        joint_values = joint_values.round().astype(int)
+        joint_dict = {k: v for k, v in zip(joint_names, joint_values, strict=False)}
+
+        motor_values = []
+        motor_names = []
+        # motor_names += ["thumb_basel_rotation", "thumb_flexor", "thumb_pinky_side", "thumb_thumb_side"]
+        # motor_values += [joint_dict["thumb_3"], joint_dict["thumb_0"], joint_dict["thumb_2"], joint_dict["thumb_2"]]
+        motor_names += ["index_pinky_side", "index_thumb_side"]
+        # if joint_dict["index_0"] -2100 > 0:
+        splayamount = 0.5
+        motor_values += [
+            (100 - joint_dict["index_0"]) * splayamount + joint_dict["index_1"] * (1 - splayamount),
+            (joint_dict["index_0"]) * splayamount + joint_dict["index_1"] * (1 - splayamount),
+        ]
+        # else:
+        #     motor_values += [100-joint_dict["index_0"], joint_dict["index_0"]]
+
+        # motor_names += ["middle_flexor", "middle_pinky_side", "middle_thumb_side"]
+        # motor_values += [joint_dict["middle_2"], joint_dict["middle_1"], joint_dict["middle_1"]]
+        # motor_names += ["ring_flexor", "ring_pinky_side", "ring_thumb_side"]
+        # motor_values += [joint_dict["ring_2"], joint_dict["ring_1"], joint_dict["ring_1"]]
+        # motor_names += ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"]
+
+        # motor_values += [joint_dict["pinky_2"], joint_dict["pinky_0"], joint_dict["pinky_0"]]
+
+        motor_values = np.array(motor_values)
+        motor_values = np.clip(motor_values, 0, 100)
+
+        robot.hand_bus.write("Goal_Position", motor_values, motor_names)
+        time.sleep(0.02)
+
+    while True:
+        # print(glove.read()['index_2']-1500)
+        glove_index_flexor = glove.read()["index_2"] - 1500
+        glove_index_subflexor = glove.read()["index_1"] - 1500
+        glove_index_side = glove.read()["index_0"] - 2100
+
+        vals = [glove_index_flexor, 1000 - (glove_index_subflexor), glove_index_subflexor]
+
+        keys = ["index_flexor", "index_pinky_side", "index_thumb_side"]
+
+        glove_middle_flexor = glove.read()["middle_2"] - 1500
+        glove_middle_subflexor = 1000 - (glove.read()["middle_1"] - 1700)
+        vals += [glove_middle_flexor, glove_middle_subflexor, glove_middle_subflexor - 200]
+        keys += ["middle_flexor", "middle_pinky_side", "middle_thumb_side"]
+
+        glove_ring_flexor = glove.read()["ring_2"] - 1300
+        print(glove_ring_flexor)
+        glove_ring_subflexor = glove.read()["ring_1"] - 1100
+
+        vals += [glove_ring_flexor, 1000 - glove_ring_subflexor, glove_ring_subflexor]
+        keys += ["ring_flexor", "ring_pinky_side", "ring_thumb_side"]
+
+        glove_pinky_flexor = glove.read()["pinky_2"] - 1500
+        glove_pinky_subflexor = glove.read()["pinky_1"] - 1300
+        vals += [300 + glove_pinky_flexor, max(1000 - glove_pinky_subflexor - 100, 0), glove_pinky_subflexor]
+        keys += ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"]
+
+        robot.hand_bus.write("Goal_Position", vals, keys)
+        time.sleep(0.1)
+
+    time.sleep(3)
+
+    def move_arm(loop=10):
+        sleep = 1
+        for i in range(loop):
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1195])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 2195])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1457, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 2357, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 974, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 2674, 1957, 1695])
+            time.sleep(sleep + 2)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 1632, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 1369, 1632, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 1330, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [2381, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1681, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+            robot.arm_bus.write("Goal_Position", [1981, 2030, 2069, 2032, 1874, 1957, 1695])
+            time.sleep(sleep)
+
+    def move_hand(loop=10):
+        sleep = 0.5
+        for i in range(loop):
+            robot.hand_bus.write(
+                "Goal_Position",
+                [500, 1000, 0, 1000],
+                ["thumb_basel_rotation", "thumb_flexor", "thumb_pinky_side", "thumb_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position", [100, 100, 100], ["index_flexor", "index_pinky_side", "index_thumb_side"]
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position", [100, 1000, 150], ["middle_flexor", "middle_pinky_side", "middle_thumb_side"]
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position", [200, 200, 0], ["ring_flexor", "ring_pinky_side", "ring_thumb_side"]
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position", [200, 100, 700], ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"]
+            )
+            time.sleep(sleep)
+
+            robot.hand_bus.write(
+                "Goal_Position",
+                [500, 1000 - 250, 0 + 300, 1000 - 200],
+                ["thumb_basel_rotation", "thumb_flexor", "thumb_pinky_side", "thumb_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position",
+                [100 + 450, 100 + 400, 100 + 400],
+                ["index_flexor", "index_pinky_side", "index_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position",
+                [100 + 350, 1000 - 450, 150 + 450],
+                ["middle_flexor", "middle_pinky_side", "middle_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position",
+                [200 + 650, 200 + 350, 0 + 350],
+                ["ring_flexor", "ring_pinky_side", "ring_thumb_side"],
+            )
+            time.sleep(sleep)
+            robot.hand_bus.write(
+                "Goal_Position",
+                [200 + 450, 100 + 400, 700 - 400],
+                ["pinky_flexor", "pinky_pinky_side", "pinky_thumb_side"],
+            )
+            time.sleep(sleep)
+
+    move_hand(3)
+
+    move_arm(1)
+
+    from concurrent.futures import ThreadPoolExecutor
+
+    with ThreadPoolExecutor() as executor:
+        executor.submit(move_arm)
+        executor.submit(move_hand)
+
+    # initial position
+    for i in range(3):
+        robot.hand_bus.write(
+            "Goal_Position", [500, 1000, 0, 1000, 100, 950, 100, 100, 1000, 150, 200, 200, 0, 200, 100, 700]
+        )
+        time.sleep(1)
+
+    # for i in range(3):
+    #     robot.hand_bus.write("Goal_Position", [500, 1000-150, 0+250, 1000-150,
+    #                                             100+300, 950-250, 100+250,
+    #                                             100+200, 1000-300, 150+300,
+    #                                             200+500, 200+200, 0+200,
+    #                                             200+300, 100+200, 700-200])
+    #     time.sleep(1)
+
+    # camera = 0
+    # score_threshold = 0.95
+    # iou_threshold = 0.3
+
+    # app = MediaPipeHandApp(MediaPipeHand.from_pretrained(), score_threshold, iou_threshold)
+
+    # def frame_processor(frame: np.ndarray) -> np.ndarray:
+    #     # Input Prep
+    #     NHWC_int_numpy_frames, NCHW_fp32_torch_frames = app_to_net_image_inputs(frame)
+
+    #     # Run Bounding Box & Keypoint Detector
+    #     batched_selected_boxes, batched_selected_keypoints = app._run_box_detector(NCHW_fp32_torch_frames)
+
+    #     # The region of interest ( bounding box of 4 (x, y) corners).
+    #     # list[torch.Tensor(shape=[Num Boxes, 4, 2])],
+    #     # where 2 == (x, y)
+    #     #
+    #     # A list element will be None if there is no selected ROI.
+    #     batched_roi_4corners = app._compute_object_roi(batched_selected_boxes, batched_selected_keypoints)
+
+    #     # selected landmarks for the ROI (if any)
+    #     # list[torch.Tensor(shape=[Num Selected Landmarks, K, 3])],
+    #     # where K == number of landmark keypoints, 3 == (x, y, confidence)
+    #     #
+    #     # A list element will be None if there is no ROI.
+    #     landmarks_out = app._run_landmark_detector(NHWC_int_numpy_frames, batched_roi_4corners)
+
+    #     app._draw_predictions(
+    #         NHWC_int_numpy_frames,
+    #         batched_selected_boxes,
+    #         batched_selected_keypoints,
+    #         batched_roi_4corners,
+    #         *landmarks_out,
+    #     )
+
+    #     return NHWC_int_numpy_frames[0]
+
+    # capture_and_display_processed_frames(frame_processor, "QAIHM Mediapipe Hand Demo", camera)
+
+
+if __name__ == "__main__":
+    main()

lerobot/__init__.py

@@ -1 +1,236 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+This file contains lists of available environments, dataset and policies to reflect the current state of LeRobot library.
+We do not want to import all the dependencies, but instead we keep it lightweight to ensure fast access to these variables.
+
+Example:
+    ```python
+        import lerobot
+        print(lerobot.available_envs)
+        print(lerobot.available_tasks_per_env)
+        print(lerobot.available_datasets)
+        print(lerobot.available_datasets_per_env)
+        print(lerobot.available_real_world_datasets)
+        print(lerobot.available_policies)
+        print(lerobot.available_policies_per_env)
+        print(lerobot.available_robots)
+        print(lerobot.available_cameras)
+        print(lerobot.available_motors)
+    ```
+
+When implementing a new dataset loadable with LeRobotDataset follow these steps:
+- Update `available_datasets_per_env` in `lerobot/__init__.py`
+
+When implementing a new environment (e.g. `gym_aloha`), follow these steps:
+- Update `available_tasks_per_env` and `available_datasets_per_env` in `lerobot/__init__.py`
+
+When implementing a new policy class (e.g. `DiffusionPolicy`) follow these steps:
+- Update `available_policies` and `available_policies_per_env`, in `lerobot/__init__.py`
+- Set the required `name` class attribute.
+- Update variables in `tests/test_available.py` by importing your new Policy class
+"""
+
+import itertools
+
 from lerobot.__version__ import __version__  # noqa: F401
+
+# TODO(rcadene): Improve policies and envs. As of now, an item in `available_policies`
+# refers to a yaml file AND a modeling name. Same for `available_envs` which refers to
+# a yaml file AND a environment name. The difference should be more obvious.
+available_tasks_per_env = {
+    "aloha": [
+        "AlohaInsertion-v0",
+        "AlohaTransferCube-v0",
+    ],
+    "pusht": ["PushT-v0"],
+    "xarm": ["XarmLift-v0"],
+    "dora_aloha_real": ["DoraAloha-v0", "DoraKoch-v0", "DoraReachy2-v0"],
+}
+available_envs = list(available_tasks_per_env.keys())
+
+available_datasets_per_env = {
+    "aloha": [
+        "lerobot/aloha_sim_insertion_human",
+        "lerobot/aloha_sim_insertion_scripted",
+        "lerobot/aloha_sim_transfer_cube_human",
+        "lerobot/aloha_sim_transfer_cube_scripted",
+        "lerobot/aloha_sim_insertion_human_image",
+        "lerobot/aloha_sim_insertion_scripted_image",
+        "lerobot/aloha_sim_transfer_cube_human_image",
+        "lerobot/aloha_sim_transfer_cube_scripted_image",
+    ],
+    # TODO(alexander-soare): Add "lerobot/pusht_keypoints". Right now we can't because this is too tightly
+    # coupled with tests.
+    "pusht": ["lerobot/pusht", "lerobot/pusht_image"],
+    "xarm": [
+        "lerobot/xarm_lift_medium",
+        "lerobot/xarm_lift_medium_replay",
+        "lerobot/xarm_push_medium",
+        "lerobot/xarm_push_medium_replay",
+        "lerobot/xarm_lift_medium_image",
+        "lerobot/xarm_lift_medium_replay_image",
+        "lerobot/xarm_push_medium_image",
+        "lerobot/xarm_push_medium_replay_image",
+    ],
+    "dora_aloha_real": [
+        "lerobot/aloha_static_battery",
+        "lerobot/aloha_static_candy",
+        "lerobot/aloha_static_coffee",
+        "lerobot/aloha_static_coffee_new",
+        "lerobot/aloha_static_cups_open",
+        "lerobot/aloha_static_fork_pick_up",
+        "lerobot/aloha_static_pingpong_test",
+        "lerobot/aloha_static_pro_pencil",
+        "lerobot/aloha_static_screw_driver",
+        "lerobot/aloha_static_tape",
+        "lerobot/aloha_static_thread_velcro",
+        "lerobot/aloha_static_towel",
+        "lerobot/aloha_static_vinh_cup",
+        "lerobot/aloha_static_vinh_cup_left",
+        "lerobot/aloha_static_ziploc_slide",
+    ],
+}
+
+available_real_world_datasets = [
+    "lerobot/aloha_mobile_cabinet",
+    "lerobot/aloha_mobile_chair",
+    "lerobot/aloha_mobile_elevator",
+    "lerobot/aloha_mobile_shrimp",
+    "lerobot/aloha_mobile_wash_pan",
+    "lerobot/aloha_mobile_wipe_wine",
+    "lerobot/aloha_static_battery",
+    "lerobot/aloha_static_candy",
+    "lerobot/aloha_static_coffee",
+    "lerobot/aloha_static_coffee_new",
+    "lerobot/aloha_static_cups_open",
+    "lerobot/aloha_static_fork_pick_up",
+    "lerobot/aloha_static_pingpong_test",
+    "lerobot/aloha_static_pro_pencil",
+    "lerobot/aloha_static_screw_driver",
+    "lerobot/aloha_static_tape",
+    "lerobot/aloha_static_thread_velcro",
+    "lerobot/aloha_static_towel",
+    "lerobot/aloha_static_vinh_cup",
+    "lerobot/aloha_static_vinh_cup_left",
+    "lerobot/aloha_static_ziploc_slide",
+    "lerobot/umi_cup_in_the_wild",
+    "lerobot/unitreeh1_fold_clothes",
+    "lerobot/unitreeh1_rearrange_objects",
+    "lerobot/unitreeh1_two_robot_greeting",
+    "lerobot/unitreeh1_warehouse",
+    "lerobot/nyu_rot_dataset",
+    "lerobot/utokyo_saytap",
+    "lerobot/imperialcollege_sawyer_wrist_cam",
+    "lerobot/utokyo_xarm_bimanual",
+    "lerobot/tokyo_u_lsmo",
+    "lerobot/utokyo_pr2_opening_fridge",
+    "lerobot/cmu_franka_exploration_dataset",
+    "lerobot/cmu_stretch",
+    "lerobot/asu_table_top",
+    "lerobot/utokyo_pr2_tabletop_manipulation",
+    "lerobot/utokyo_xarm_pick_and_place",
+    "lerobot/ucsd_kitchen_dataset",
+    "lerobot/austin_buds_dataset",
+    "lerobot/dlr_sara_grid_clamp",
+    "lerobot/conq_hose_manipulation",
+    "lerobot/columbia_cairlab_pusht_real",
+    "lerobot/dlr_sara_pour",
+    "lerobot/dlr_edan_shared_control",
+    "lerobot/ucsd_pick_and_place_dataset",
+    "lerobot/berkeley_cable_routing",
+    "lerobot/nyu_franka_play_dataset",
+    "lerobot/austin_sirius_dataset",
+    "lerobot/cmu_play_fusion",
+    "lerobot/berkeley_gnm_sac_son",
+    "lerobot/nyu_door_opening_surprising_effectiveness",
+    "lerobot/berkeley_fanuc_manipulation",
+    "lerobot/jaco_play",
+    "lerobot/viola",
+    "lerobot/kaist_nonprehensile",
+    "lerobot/berkeley_mvp",
+    "lerobot/uiuc_d3field",
+    "lerobot/berkeley_gnm_recon",
+    "lerobot/austin_sailor_dataset",
+    "lerobot/utaustin_mutex",
+    "lerobot/roboturk",
+    "lerobot/stanford_hydra_dataset",
+    "lerobot/berkeley_autolab_ur5",
+    "lerobot/stanford_robocook",
+    "lerobot/toto",
+    "lerobot/fmb",
+    "lerobot/droid_100",
+    "lerobot/berkeley_rpt",
+    "lerobot/stanford_kuka_multimodal_dataset",
+    "lerobot/iamlab_cmu_pickup_insert",
+    "lerobot/taco_play",
+    "lerobot/berkeley_gnm_cory_hall",
+    "lerobot/usc_cloth_sim",
+]
+
+available_datasets = list(
+    itertools.chain(*available_datasets_per_env.values(), available_real_world_datasets)
+)
+
+# lists all available policies from `lerobot/common/policies`
+available_policies = [
+    "act",
+    "diffusion",
+    "tdmpc",
+    "vqbet",
+]
+
+# lists all available robots from `lerobot/common/robot_devices/robots`
+available_robots = [
+    "koch",
+    "koch_bimanual",
+    "aloha",
+    "so100",
+    "moss",
+]
+
+# lists all available cameras from `lerobot/common/robot_devices/cameras`
+available_cameras = [
+    "opencv",
+    "intelrealsense",
+]
+
+# lists all available motors from `lerobot/common/robot_devices/motors`
+available_motors = [
+    "dynamixel",
+    "feetech",
+]
+
+# keys and values refer to yaml files
+available_policies_per_env = {
+    "aloha": ["act"],
+    "pusht": ["diffusion", "vqbet"],
+    "xarm": ["tdmpc"],
+    "koch_real": ["act_koch_real"],
+    "aloha_real": ["act_aloha_real"],
+    "dora_aloha_real": ["act_aloha_real"],
+}
+
+env_task_pairs = [(env, task) for env, tasks in available_tasks_per_env.items() for task in tasks]
+env_dataset_pairs = [
+    (env, dataset) for env, datasets in available_datasets_per_env.items() for dataset in datasets
+]
+env_dataset_policy_triplets = [
+    (env, dataset, policy)
+    for env, datasets in available_datasets_per_env.items()
+    for dataset in datasets
+    for policy in available_policies_per_env[env]
+]

lerobot/__version__.py

@@ -1,4 +1,19 @@
-""" To enable `lerobot.__version__` """
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""To enable `lerobot.__version__`"""
 
 from importlib.metadata import PackageNotFoundError, version
 

lerobot/common/datasets/abstract.py

@@ -1,159 +0,0 @@
-import logging
-from pathlib import Path
-from typing import Callable
-
-import einops
-import torch
-import torchrl
-import tqdm
-from huggingface_hub import snapshot_download
-from tensordict import TensorDict
-from torchrl.data.replay_buffers.replay_buffers import TensorDictReplayBuffer
-from torchrl.data.replay_buffers.samplers import SliceSampler
-from torchrl.data.replay_buffers.storages import TensorStorage, _collate_id
-from torchrl.data.replay_buffers.writers import ImmutableDatasetWriter, Writer
-from torchrl.envs.transforms.transforms import Compose
-
-
-class AbstractExperienceReplay(TensorDictReplayBuffer):
-    def __init__(
-        self,
-        dataset_id: str,
-        batch_size: int = None,
-        *,
-        shuffle: bool = True,
-        root: Path | None = None,
-        pin_memory: bool = False,
-        prefetch: int = None,
-        sampler: SliceSampler = None,
-        collate_fn: Callable = None,
-        writer: Writer = None,
-        transform: "torchrl.envs.Transform" = None,
-    ):
-        self.dataset_id = dataset_id
-        self.shuffle = shuffle
-        self.root = root
-        storage = self._download_or_load_dataset()
-
-        super().__init__(
-            storage=storage,
-            sampler=sampler,
-            writer=ImmutableDatasetWriter() if writer is None else writer,
-            collate_fn=_collate_id if collate_fn is None else collate_fn,
-            pin_memory=pin_memory,
-            prefetch=prefetch,
-            batch_size=batch_size,
-            transform=transform,
-        )
-
-    @property
-    def stats_patterns(self) -> dict:
-        return {
-            ("observation", "state"): "b c -> 1 c",
-            ("observation", "image"): "b c h w -> 1 c 1 1",
-            ("action",): "b c -> 1 c",
-        }
-
-    @property
-    def image_keys(self) -> list:
-        return [("observation", "image")]
-
-    @property
-    def num_cameras(self) -> int:
-        return len(self.image_keys)
-
-    @property
-    def num_samples(self) -> int:
-        return len(self)
-
-    @property
-    def num_episodes(self) -> int:
-        return len(self._storage._storage["episode"].unique())
-
-    @property
-    def transform(self):
-        return self._transform
-
-    def set_transform(self, transform):
-        if not isinstance(transform, Compose):
-            # required since torchrl calls `len(self._transform)` downstream
-            if isinstance(transform, list):
-                self._transform = Compose(*transform)
-            else:
-                self._transform = Compose(transform)
-        else:
-            self._transform = transform
-
-    def compute_or_load_stats(self, num_batch=100, batch_size=32) -> TensorDict:
-        stats_path = self.data_dir / "stats.pth"
-        if stats_path.exists():
-            stats = torch.load(stats_path)
-        else:
-            logging.info(f"compute_stats and save to {stats_path}")
-            stats = self._compute_stats(num_batch, batch_size)
-            torch.save(stats, stats_path)
-        return stats
-
-    def _download_or_load_dataset(self) -> torch.StorageBase:
-        if self.root is None:
-            self.data_dir = snapshot_download(repo_id=f"cadene/{self.dataset_id}", repo_type="dataset")
-        else:
-            self.data_dir = self.root / self.dataset_id
-        return TensorStorage(TensorDict.load_memmap(self.data_dir))
-
-    def _compute_stats(self, num_batch=100, batch_size=32):
-        rb = TensorDictReplayBuffer(
-            storage=self._storage,
-            batch_size=batch_size,
-            prefetch=True,
-        )
-
-        mean, std, max, min = {}, {}, {}, {}
-
-        # compute mean, min, max
-        for _ in tqdm.tqdm(range(num_batch)):
-            batch = rb.sample()
-            for key, pattern in self.stats_patterns.items():
-                batch[key] = batch[key].float()
-                if key not in mean:
-                    # first batch initialize mean, min, max
-                    mean[key] = einops.reduce(batch[key], pattern, "mean")
-                    max[key] = einops.reduce(batch[key], pattern, "max")
-                    min[key] = einops.reduce(batch[key], pattern, "min")
-                else:
-                    mean[key] += einops.reduce(batch[key], pattern, "mean")
-                    max[key] = torch.maximum(max[key], einops.reduce(batch[key], pattern, "max"))
-                    min[key] = torch.minimum(min[key], einops.reduce(batch[key], pattern, "min"))
-                batch = rb.sample()
-
-        for key in self.stats_patterns:
-            mean[key] /= num_batch
-
-        # compute std, min, max
-        for _ in tqdm.tqdm(range(num_batch)):
-            batch = rb.sample()
-            for key, pattern in self.stats_patterns.items():
-                batch[key] = batch[key].float()
-                batch_mean = einops.reduce(batch[key], pattern, "mean")
-                if key not in std:
-                    # first batch initialize std
-                    std[key] = (batch_mean - mean[key]) ** 2
-                else:
-                    std[key] += (batch_mean - mean[key]) ** 2
-                max[key] = torch.maximum(max[key], einops.reduce(batch[key], pattern, "max"))
-                min[key] = torch.minimum(min[key], einops.reduce(batch[key], pattern, "min"))
-
-        for key in self.stats_patterns:
-            std[key] = torch.sqrt(std[key] / num_batch)
-
-        stats = TensorDict({}, batch_size=[])
-        for key in self.stats_patterns:
-            stats[(*key, "mean")] = mean[key]
-            stats[(*key, "std")] = std[key]
-            stats[(*key, "max")] = max[key]
-            stats[(*key, "min")] = min[key]
-
-            if key[0] == "observation":
-                # use same stats for the next observations
-                stats[("next", *key)] = stats[key]
-        return stats

lerobot/common/datasets/aloha.py

@@ -1,183 +0,0 @@
-import logging
-from pathlib import Path
-from typing import Callable
-
-import einops
-import gdown
-import h5py
-import torch
-import torchrl
-import tqdm
-from tensordict import TensorDict
-from torchrl.data.replay_buffers.samplers import SliceSampler
-from torchrl.data.replay_buffers.storages import TensorStorage
-from torchrl.data.replay_buffers.writers import Writer
-
-from lerobot.common.datasets.abstract import AbstractExperienceReplay
-
-DATASET_IDS = [
-    "aloha_sim_insertion_human",
-    "aloha_sim_insertion_scripted",
-    "aloha_sim_transfer_cube_human",
-    "aloha_sim_transfer_cube_scripted",
-]
-
-FOLDER_URLS = {
-    "aloha_sim_insertion_human": "https://drive.google.com/drive/folders/1RgyD0JgTX30H4IM5XZn8I3zSV_mr8pyF",
-    "aloha_sim_insertion_scripted": "https://drive.google.com/drive/folders/1TsojQQSXtHEoGnqgJ3gmpPQR2DPLtS2N",
-    "aloha_sim_transfer_cube_human": "https://drive.google.com/drive/folders/1sc-E4QYW7A0o23m1u2VWNGVq5smAsfCo",
-    "aloha_sim_transfer_cube_scripted": "https://drive.google.com/drive/folders/1aRyoOhQwxhyt1J8XgEig4s6kzaw__LXj",
-}
-
-EP48_URLS = {
-    "aloha_sim_insertion_human": "https://drive.google.com/file/d/18Cudl6nikDtgRolea7je8iF_gGKzynOP/view?usp=drive_link",
-    "aloha_sim_insertion_scripted": "https://drive.google.com/file/d/1wfMSZ24oOh5KR_0aaP3Cnu_c4ZCveduB/view?usp=drive_link",
-    "aloha_sim_transfer_cube_human": "https://drive.google.com/file/d/18smMymtr8tIxaNUQ61gW6dG50pt3MvGq/view?usp=drive_link",
-    "aloha_sim_transfer_cube_scripted": "https://drive.google.com/file/d/1pnGIOd-E4-rhz2P3VxpknMKRZCoKt6eI/view?usp=drive_link",
-}
-
-EP49_URLS = {
-    "aloha_sim_insertion_human": "https://drive.google.com/file/d/1C1kZYyROzs-PrLc0SkDgUgMi4-L3lauE/view?usp=drive_link",
-    "aloha_sim_insertion_scripted": "https://drive.google.com/file/d/17EuCUWS6uCCr6yyNzpXdcdE-_TTNCKtf/view?usp=drive_link",
-    "aloha_sim_transfer_cube_human": "https://drive.google.com/file/d/1Nk7l53d9sJoGDBKAOnNrExX5nLacATc6/view?usp=drive_link",
-    "aloha_sim_transfer_cube_scripted": "https://drive.google.com/file/d/1GKReZHrXU73NMiC5zKCq_UtqPVtYq8eo/view?usp=drive_link",
-}
-
-NUM_EPISODES = {
-    "aloha_sim_insertion_human": 50,
-    "aloha_sim_insertion_scripted": 50,
-    "aloha_sim_transfer_cube_human": 50,
-    "aloha_sim_transfer_cube_scripted": 50,
-}
-
-EPISODE_LEN = {
-    "aloha_sim_insertion_human": 500,
-    "aloha_sim_insertion_scripted": 400,
-    "aloha_sim_transfer_cube_human": 400,
-    "aloha_sim_transfer_cube_scripted": 400,
-}
-
-CAMERAS = {
-    "aloha_sim_insertion_human": ["top"],
-    "aloha_sim_insertion_scripted": ["top"],
-    "aloha_sim_transfer_cube_human": ["top"],
-    "aloha_sim_transfer_cube_scripted": ["top"],
-}
-
-
-def download(data_dir, dataset_id):
-    assert dataset_id in DATASET_IDS
-    assert dataset_id in FOLDER_URLS
-    assert dataset_id in EP48_URLS
-    assert dataset_id in EP49_URLS
-
-    data_dir.mkdir(parents=True, exist_ok=True)
-
-    gdown.download_folder(FOLDER_URLS[dataset_id], output=str(data_dir))
-
-    # because of the 50 files limit per directory, two files episode 48 and 49 were missing
-    gdown.download(EP48_URLS[dataset_id], output=str(data_dir / "episode_48.hdf5"), fuzzy=True)
-    gdown.download(EP49_URLS[dataset_id], output=str(data_dir / "episode_49.hdf5"), fuzzy=True)
-
-
-class AlohaExperienceReplay(AbstractExperienceReplay):
-    def __init__(
-        self,
-        dataset_id: str,
-        batch_size: int = None,
-        *,
-        shuffle: bool = True,
-        root: Path | None = None,
-        pin_memory: bool = False,
-        prefetch: int = None,
-        sampler: SliceSampler = None,
-        collate_fn: Callable = None,
-        writer: Writer = None,
-        transform: "torchrl.envs.Transform" = None,
-    ):
-        assert dataset_id in DATASET_IDS
-
-        super().__init__(
-            dataset_id,
-            batch_size,
-            shuffle=shuffle,
-            root=root,
-            pin_memory=pin_memory,
-            prefetch=prefetch,
-            sampler=sampler,
-            collate_fn=collate_fn,
-            writer=writer,
-            transform=transform,
-        )
-
-    @property
-    def stats_patterns(self) -> dict:
-        d = {
-            ("observation", "state"): "b c -> 1 c",
-            ("action",): "b c -> 1 c",
-        }
-        for cam in CAMERAS[self.dataset_id]:
-            d[("observation", "image", cam)] = "b c h w -> 1 c 1 1"
-        return d
-
-    @property
-    def image_keys(self) -> list:
-        return [("observation", "image", cam) for cam in CAMERAS[self.dataset_id]]
-
-    def _download_and_preproc_obsolete(self):
-        assert self.root is not None
-        raw_dir = self.root / f"{self.dataset_id}_raw"
-        if not raw_dir.is_dir():
-            download(raw_dir, self.dataset_id)
-
-        total_num_frames = 0
-        logging.info("Compute total number of frames to initialize offline buffer")
-        for ep_id in range(NUM_EPISODES[self.dataset_id]):
-            ep_path = raw_dir / f"episode_{ep_id}.hdf5"
-            with h5py.File(ep_path, "r") as ep:
-                total_num_frames += ep["/action"].shape[0] - 1
-        logging.info(f"{total_num_frames=}")
-
-        logging.info("Initialize and feed offline buffer")
-        idxtd = 0
-        for ep_id in tqdm.tqdm(range(NUM_EPISODES[self.dataset_id])):
-            ep_path = raw_dir / f"episode_{ep_id}.hdf5"
-            with h5py.File(ep_path, "r") as ep:
-                ep_num_frames = ep["/action"].shape[0]
-
-                # last step of demonstration is considered done
-                done = torch.zeros(ep_num_frames, 1, dtype=torch.bool)
-                done[-1] = True
-
-                state = torch.from_numpy(ep["/observations/qpos"][:])
-                action = torch.from_numpy(ep["/action"][:])
-
-                ep_td = TensorDict(
-                    {
-                        ("observation", "state"): state[:-1],
-                        "action": action[:-1],
-                        "episode": torch.tensor([ep_id] * (ep_num_frames - 1)),
-                        "frame_id": torch.arange(0, ep_num_frames - 1, 1),
-                        ("next", "observation", "state"): state[1:],
-                        # TODO: compute reward and success
-                        # ("next", "reward"): reward[1:],
-                        ("next", "done"): done[1:],
-                        # ("next", "success"): success[1:],
-                    },
-                    batch_size=ep_num_frames - 1,
-                )
-
-                for cam in CAMERAS[self.dataset_id]:
-                    image = torch.from_numpy(ep[f"/observations/images/{cam}"][:])
-                    image = einops.rearrange(image, "b h w c -> b c h w").contiguous()
-                    ep_td["observation", "image", cam] = image[:-1]
-                    ep_td["next", "observation", "image", cam] = image[1:]
-
-                if ep_id == 0:
-                    # hack to initialize tensordict data structure to store episodes
-                    td_data = ep_td[0].expand(total_num_frames).memmap_like(self.root / f"{self.dataset_id}")
-
-                td_data[idxtd : idxtd + len(ep_td)] = ep_td
-                idxtd = idxtd + len(ep_td)
-
-        return TensorStorage(td_data.lock_())

lerobot/common/datasets/compute_stats.py

@@ -0,0 +1,213 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+from copy import deepcopy
+from math import ceil
+
+import einops
+import torch
+import tqdm
+from datasets import Image
+
+from lerobot.common.datasets.video_utils import VideoFrame
+
+
+def get_stats_einops_patterns(dataset, num_workers=0):
+    """These einops patterns will be used to aggregate batches and compute statistics.
+
+    Note: We assume the images are in channel first format
+    """
+
+    dataloader = torch.utils.data.DataLoader(
+        dataset,
+        num_workers=num_workers,
+        batch_size=2,
+        shuffle=False,
+    )
+    batch = next(iter(dataloader))
+
+    stats_patterns = {}
+    for key, feats_type in dataset.features.items():
+        # NOTE: skip language_instruction embedding in stats computation
+        if key == "language_instruction":
+            continue
+
+        # sanity check that tensors are not float64
+        assert batch[key].dtype != torch.float64
+
+        if isinstance(feats_type, (VideoFrame, Image)):
+            # sanity check that images are channel first
+            _, c, h, w = batch[key].shape
+            assert c < h and c < w, f"expect channel first images, but instead {batch[key].shape}"
+
+            # sanity check that images are float32 in range [0,1]
+            assert batch[key].dtype == torch.float32, f"expect torch.float32, but instead {batch[key].dtype=}"
+            assert batch[key].max() <= 1, f"expect pixels lower than 1, but instead {batch[key].max()=}"
+            assert batch[key].min() >= 0, f"expect pixels greater than 1, but instead {batch[key].min()=}"
+
+            stats_patterns[key] = "b c h w -> c 1 1"
+        elif batch[key].ndim == 2:
+            stats_patterns[key] = "b c -> c "
+        elif batch[key].ndim == 1:
+            stats_patterns[key] = "b -> 1"
+        else:
+            raise ValueError(f"{key}, {feats_type}, {batch[key].shape}")
+
+    return stats_patterns
+
+
+def compute_stats(dataset, batch_size=8, num_workers=8, max_num_samples=None):
+    """Compute mean/std and min/max statistics of all data keys in a LeRobotDataset."""
+    if max_num_samples is None:
+        max_num_samples = len(dataset)
+
+    # for more info on why we need to set the same number of workers, see `load_from_videos`
+    stats_patterns = get_stats_einops_patterns(dataset, num_workers)
+
+    # mean and std will be computed incrementally while max and min will track the running value.
+    mean, std, max, min = {}, {}, {}, {}
+    for key in stats_patterns:
+        mean[key] = torch.tensor(0.0).float()
+        std[key] = torch.tensor(0.0).float()
+        max[key] = torch.tensor(-float("inf")).float()
+        min[key] = torch.tensor(float("inf")).float()
+
+    def create_seeded_dataloader(dataset, batch_size, seed):
+        generator = torch.Generator()
+        generator.manual_seed(seed)
+        dataloader = torch.utils.data.DataLoader(
+            dataset,
+            num_workers=num_workers,
+            batch_size=batch_size,
+            shuffle=True,
+            drop_last=False,
+            generator=generator,
+        )
+        return dataloader
+
+    # Note: Due to be refactored soon. The point of storing `first_batch` is to make sure we don't get
+    # surprises when rerunning the sampler.
+    first_batch = None
+    running_item_count = 0  # for online mean computation
+    dataloader = create_seeded_dataloader(dataset, batch_size, seed=1337)
+    for i, batch in enumerate(
+        tqdm.tqdm(dataloader, total=ceil(max_num_samples / batch_size), desc="Compute mean, min, max")
+    ):
+        this_batch_size = len(batch["index"])
+        running_item_count += this_batch_size
+        if first_batch is None:
+            first_batch = deepcopy(batch)
+        for key, pattern in stats_patterns.items():
+            batch[key] = batch[key].float()
+            # Numerically stable update step for mean computation.
+            batch_mean = einops.reduce(batch[key], pattern, "mean")
+            # Hint: to update the mean we need x̄ₙ = (Nₙ₋₁x̄ₙ₋₁ + Bₙxₙ) / Nₙ, where the subscript represents
+            # the update step, N is the running item count, B is this batch size, x̄ is the running mean,
+            # and x is the current batch mean. Some rearrangement is then required to avoid risking
+            # numerical overflow. Another hint: Nₙ₋₁ = Nₙ - Bₙ. Rearrangement yields
+            # x̄ₙ = x̄ₙ₋₁ + Bₙ * (xₙ - x̄ₙ₋₁) / Nₙ
+            mean[key] = mean[key] + this_batch_size * (batch_mean - mean[key]) / running_item_count
+            max[key] = torch.maximum(max[key], einops.reduce(batch[key], pattern, "max"))
+            min[key] = torch.minimum(min[key], einops.reduce(batch[key], pattern, "min"))
+
+        if i == ceil(max_num_samples / batch_size) - 1:
+            break
+
+    first_batch_ = None
+    running_item_count = 0  # for online std computation
+    dataloader = create_seeded_dataloader(dataset, batch_size, seed=1337)
+    for i, batch in enumerate(
+        tqdm.tqdm(dataloader, total=ceil(max_num_samples / batch_size), desc="Compute std")
+    ):
+        this_batch_size = len(batch["index"])
+        running_item_count += this_batch_size
+        # Sanity check to make sure the batches are still in the same order as before.
+        if first_batch_ is None:
+            first_batch_ = deepcopy(batch)
+            for key in stats_patterns:
+                assert torch.equal(first_batch_[key], first_batch[key])
+        for key, pattern in stats_patterns.items():
+            batch[key] = batch[key].float()
+            # Numerically stable update step for mean computation (where the mean is over squared
+            # residuals).See notes in the mean computation loop above.
+            batch_std = einops.reduce((batch[key] - mean[key]) ** 2, pattern, "mean")
+            std[key] = std[key] + this_batch_size * (batch_std - std[key]) / running_item_count
+
+        if i == ceil(max_num_samples / batch_size) - 1:
+            break
+
+    for key in stats_patterns:
+        std[key] = torch.sqrt(std[key])
+
+    stats = {}
+    for key in stats_patterns:
+        stats[key] = {
+            "mean": mean[key],
+            "std": std[key],
+            "max": max[key],
+            "min": min[key],
+        }
+    return stats
+
+
+def aggregate_stats(ls_datasets) -> dict[str, torch.Tensor]:
+    """Aggregate stats of multiple LeRobot datasets into one set of stats without recomputing from scratch.
+
+    The final stats will have the union of all data keys from each of the datasets.
+
+    The final stats will have the union of all data keys from each of the datasets. For instance:
+    - new_max = max(max_dataset_0, max_dataset_1, ...)
+    - new_min = min(min_dataset_0, min_dataset_1, ...)
+    - new_mean = (mean of all data)
+    - new_std = (std of all data)
+    """
+    data_keys = set()
+    for dataset in ls_datasets:
+        data_keys.update(dataset.stats.keys())
+    stats = {k: {} for k in data_keys}
+    for data_key in data_keys:
+        for stat_key in ["min", "max"]:
+            # compute `max(dataset_0["max"], dataset_1["max"], ...)`
+            stats[data_key][stat_key] = einops.reduce(
+                torch.stack([d.stats[data_key][stat_key] for d in ls_datasets if data_key in d.stats], dim=0),
+                "n ... -> ...",
+                stat_key,
+            )
+        total_samples = sum(d.num_samples for d in ls_datasets if data_key in d.stats)
+        # Compute the "sum" statistic by multiplying each mean by the number of samples in the respective
+        # dataset, then divide by total_samples to get the overall "mean".
+        # NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
+        # numerical overflow!
+        stats[data_key]["mean"] = sum(
+            d.stats[data_key]["mean"] * (d.num_samples / total_samples)
+            for d in ls_datasets
+            if data_key in d.stats
+        )
+        # The derivation for standard deviation is a little more involved but is much in the same spirit as
+        # the computation of the mean.
+        # Given two sets of data where the statistics are known:
+        # σ_combined = sqrt[ (n1 * (σ1^2 + d1^2) + n2 * (σ2^2 + d2^2)) / (n1 + n2) ]
+        # where d1 = μ1 - μ_combined, d2 = μ2 - μ_combined
+        # NOTE: the brackets around (d.num_samples / total_samples) are needed tor minimize the risk of
+        # numerical overflow!
+        stats[data_key]["std"] = torch.sqrt(
+            sum(
+                (d.stats[data_key]["std"] ** 2 + (d.stats[data_key]["mean"] - stats[data_key]["mean"]) ** 2)
+                * (d.num_samples / total_samples)
+                for d in ls_datasets
+                if data_key in d.stats
+            )
+        )
+    return stats

lerobot/common/datasets/factory.py

@@ -1,131 +1,117 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
 import logging
-import os
-from pathlib import Path
 
 import torch
-from torchrl.data.replay_buffers import PrioritizedSliceSampler, SliceSampler
+from omegaconf import ListConfig, OmegaConf
 
-from lerobot.common.envs.transforms import NormalizeTransform, Prod
-
-# DATA_DIR specifies to location where datasets are loaded. By default, DATA_DIR is None and
-# we load from `$HOME/.cache/huggingface/hub/datasets`. For our unit tests, we set `DATA_DIR=tests/data`
-# to load a subset of our datasets for faster continuous integration.
-DATA_DIR = Path(os.environ["DATA_DIR"]) if "DATA_DIR" in os.environ else None
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset, MultiLeRobotDataset
+from lerobot.common.datasets.transforms import get_image_transforms
 
 
-def make_offline_buffer(
-    cfg, overwrite_sampler=None, normalize=True, overwrite_batch_size=None, overwrite_prefetch=None
-):
-    if cfg.policy.balanced_sampling:
-        assert cfg.online_steps > 0
-        batch_size = None
-        pin_memory = False
-        prefetch = None
-    else:
-        assert cfg.online_steps == 0
-        num_slices = cfg.policy.batch_size
-        batch_size = cfg.policy.horizon * num_slices
-        pin_memory = cfg.device == "cuda"
-        prefetch = cfg.prefetch
+def resolve_delta_timestamps(cfg):
+    """Resolves delta_timestamps config key (in-place) by using `eval`.
 
-    if overwrite_batch_size is not None:
-        batch_size = overwrite_batch_size
+    Doesn't do anything if delta_timestamps is not specified or has already been resolve (as evidenced by
+    the data type of its values).
+    """
+    delta_timestamps = cfg.training.get("delta_timestamps")
+    if delta_timestamps is not None:
+        for key in delta_timestamps:
+            if isinstance(delta_timestamps[key], str):
+                # TODO(rcadene, alexander-soare): remove `eval` to avoid exploit
+                cfg.training.delta_timestamps[key] = eval(delta_timestamps[key])
 
-    if overwrite_prefetch is not None:
-        prefetch = overwrite_prefetch
 
-    if overwrite_sampler is None:
-        # TODO(rcadene): move batch_size outside
-        num_traj_per_batch = cfg.policy.batch_size  # // cfg.horizon
-        # TODO(rcadene): Sampler outputs a batch_size <= cfg.batch_size.
-        # We would need to add a transform to pad the tensordict to ensure batch_size == cfg.batch_size.
+def make_dataset(cfg, split: str = "train") -> LeRobotDataset | MultiLeRobotDataset:
+    """
+    Args:
+        cfg: A Hydra config as per the LeRobot config scheme.
+        split: Select the data subset used to create an instance of LeRobotDataset.
+            All datasets hosted on [lerobot](https://huggingface.co/lerobot) contain only one subset: "train".
+            Thus, by default, `split="train"` selects all the available data. `split` aims to work like the
+            slicer in the hugging face datasets:
+            https://huggingface.co/docs/datasets/v2.19.0/loading#slice-splits
+            As of now, it only supports `split="train[:n]"` to load the first n frames of the dataset or
+            `split="train[n:]"` to load the last n frames. For instance `split="train[:1000]"`.
+    Returns:
+        The LeRobotDataset.
+    """
+    if not isinstance(cfg.dataset_repo_id, (str, ListConfig)):
+        raise ValueError(
+            "Expected cfg.dataset_repo_id to be either a single string to load one dataset or a list of "
+            "strings to load multiple datasets."
+        )
 
-        if cfg.offline_prioritized_sampler:
-            logging.info("use prioritized sampler for offline dataset")
-            sampler = PrioritizedSliceSampler(
-                max_capacity=100_000,
-                alpha=cfg.policy.per_alpha,
-                beta=cfg.policy.per_beta,
-                num_slices=num_traj_per_batch,
-                strict_length=False,
-            )
+    # A soft check to warn if the environment matches the dataset. Don't check if we are using a real world env (dora).
+    if cfg.env.name != "dora":
+        if isinstance(cfg.dataset_repo_id, str):
+            dataset_repo_ids = [cfg.dataset_repo_id]  # single dataset
         else:
-            logging.info("use simple sampler for offline dataset")
-            sampler = SliceSampler(
-                num_slices=num_traj_per_batch,
-                strict_length=False,
-            )
+            dataset_repo_ids = cfg.dataset_repo_id  # multiple datasets
+
+        for dataset_repo_id in dataset_repo_ids:
+            if cfg.env.name not in dataset_repo_id:
+                logging.warning(
+                    f"There might be a mismatch between your training dataset ({dataset_repo_id=}) and your "
+                    f"environment ({cfg.env.name=})."
+                )
+
+    resolve_delta_timestamps(cfg)
+
+    image_transforms = None
+    if cfg.training.image_transforms.enable:
+        cfg_tf = cfg.training.image_transforms
+        image_transforms = get_image_transforms(
+            brightness_weight=cfg_tf.brightness.weight,
+            brightness_min_max=cfg_tf.brightness.min_max,
+            contrast_weight=cfg_tf.contrast.weight,
+            contrast_min_max=cfg_tf.contrast.min_max,
+            saturation_weight=cfg_tf.saturation.weight,
+            saturation_min_max=cfg_tf.saturation.min_max,
+            hue_weight=cfg_tf.hue.weight,
+            hue_min_max=cfg_tf.hue.min_max,
+            sharpness_weight=cfg_tf.sharpness.weight,
+            sharpness_min_max=cfg_tf.sharpness.min_max,
+            max_num_transforms=cfg_tf.max_num_transforms,
+            random_order=cfg_tf.random_order,
+        )
+
+    if isinstance(cfg.dataset_repo_id, str):
+        dataset = LeRobotDataset(
+            cfg.dataset_repo_id,
+            split=split,
+            delta_timestamps=cfg.training.get("delta_timestamps"),
+            image_transforms=image_transforms,
+            video_backend=cfg.video_backend,
+        )
     else:
-        sampler = overwrite_sampler
+        dataset = MultiLeRobotDataset(
+            cfg.dataset_repo_id,
+            split=split,
+            delta_timestamps=cfg.training.get("delta_timestamps"),
+            image_transforms=image_transforms,
+            video_backend=cfg.video_backend,
+        )
 
-    if cfg.env.name == "simxarm":
-        from lerobot.common.datasets.simxarm import SimxarmExperienceReplay
+    if cfg.get("override_dataset_stats"):
+        for key, stats_dict in cfg.override_dataset_stats.items():
+            for stats_type, listconfig in stats_dict.items():
+                # example of stats_type: min, max, mean, std
+                stats = OmegaConf.to_container(listconfig, resolve=True)
+                dataset.stats[key][stats_type] = torch.tensor(stats, dtype=torch.float32)
 
-        clsfunc = SimxarmExperienceReplay
-        dataset_id = f"xarm_{cfg.env.task}_medium"
-
-    elif cfg.env.name == "pusht":
-        from lerobot.common.datasets.pusht import PushtExperienceReplay
-
-        clsfunc = PushtExperienceReplay
-        dataset_id = "pusht"
-
-    elif cfg.env.name == "aloha":
-        from lerobot.common.datasets.aloha import AlohaExperienceReplay
-
-        clsfunc = AlohaExperienceReplay
-        dataset_id = f"aloha_{cfg.env.task}"
-    else:
-        raise ValueError(cfg.env.name)
-
-    offline_buffer = clsfunc(
-        dataset_id=dataset_id,
-        sampler=sampler,
-        batch_size=batch_size,
-        root=DATA_DIR,
-        pin_memory=pin_memory,
-        prefetch=prefetch if isinstance(prefetch, int) else None,
-    )
-
-    if cfg.policy.name == "tdmpc":
-        img_keys = []
-        for key in offline_buffer.image_keys:
-            img_keys.append(("next", *key))
-        img_keys += offline_buffer.image_keys
-    else:
-        img_keys = offline_buffer.image_keys
-
-    transforms = [Prod(in_keys=img_keys, prod=1 / 255)]
-
-    if normalize:
-        # TODO(rcadene): make normalization strategy configurable between mean_std, min_max, manual_min_max, min_max_from_spec
-        stats = offline_buffer.compute_or_load_stats()
-
-        # we only normalize the state and action, since the images are usually normalized inside the model for now (except for tdmpc: see the following)
-        in_keys = [("observation", "state"), ("action")]
-
-        if cfg.policy.name == "tdmpc":
-            # TODO(rcadene): we add img_keys to the keys to normalize for tdmpc only, since diffusion and act policies normalize the image inside the model for now
-            in_keys += img_keys
-            # TODO(racdene): since we use next observations in tdmpc, we also add them to the normalization. We are wasting a bit of compute on this for now.
-            in_keys += [("next", *key) for key in img_keys]
-            in_keys.append(("next", "observation", "state"))
-
-        if cfg.policy.name == "diffusion" and cfg.env.name == "pusht":
-            # TODO(rcadene): we overwrite stats to have the same as pretrained model, but we should remove this
-            stats["observation", "state", "min"] = torch.tensor([13.456424, 32.938293], dtype=torch.float32)
-            stats["observation", "state", "max"] = torch.tensor([496.14618, 510.9579], dtype=torch.float32)
-            stats["action", "min"] = torch.tensor([12.0, 25.0], dtype=torch.float32)
-            stats["action", "max"] = torch.tensor([511.0, 511.0], dtype=torch.float32)
-
-        # TODO(rcadene): remove this and put it in config. Ideally we want to reproduce SOTA results just with mean_std
-        normalization_mode = "mean_std" if cfg.env.name == "aloha" else "min_max"
-        transforms.append(NormalizeTransform(stats, in_keys, mode=normalization_mode))
-
-    offline_buffer.set_transform(transforms)
-
-    if not overwrite_sampler:
-        index = torch.arange(0, offline_buffer.num_samples, 1)
-        sampler.extend(index)
-
-    return offline_buffer
+    return dataset

lerobot/common/datasets/lerobot_dataset.py

@@ -0,0 +1,401 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+import logging
+import os
+from pathlib import Path
+from typing import Callable
+
+import datasets
+import torch
+import torch.utils
+
+from lerobot.common.datasets.compute_stats import aggregate_stats
+from lerobot.common.datasets.utils import (
+    calculate_episode_data_index,
+    load_episode_data_index,
+    load_hf_dataset,
+    load_info,
+    load_previous_and_future_frames,
+    load_stats,
+    load_videos,
+    reset_episode_index,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, load_from_videos
+
+# For maintainers, see lerobot/common/datasets/push_dataset_to_hub/CODEBASE_VERSION.md
+CODEBASE_VERSION = "v1.6"
+DATA_DIR = Path(os.environ["DATA_DIR"]) if "DATA_DIR" in os.environ else None
+
+
+class LeRobotDataset(torch.utils.data.Dataset):
+    def __init__(
+        self,
+        repo_id: str,
+        root: Path | None = DATA_DIR,
+        split: str = "train",
+        image_transforms: Callable | None = None,
+        delta_timestamps: dict[list[float]] | None = None,
+        video_backend: str | None = None,
+    ):
+        super().__init__()
+        self.repo_id = repo_id
+        self.root = root
+        self.split = split
+        self.image_transforms = image_transforms
+        self.delta_timestamps = delta_timestamps
+        # load data from hub or locally when root is provided
+        # TODO(rcadene, aliberts): implement faster transfer
+        # https://huggingface.co/docs/huggingface_hub/en/guides/download#faster-downloads
+        self.hf_dataset = load_hf_dataset(repo_id, CODEBASE_VERSION, root, split)
+        if split == "train":
+            self.episode_data_index = load_episode_data_index(repo_id, CODEBASE_VERSION, root)
+        else:
+            self.episode_data_index = calculate_episode_data_index(self.hf_dataset)
+            self.hf_dataset = reset_episode_index(self.hf_dataset)
+        self.stats = load_stats(repo_id, CODEBASE_VERSION, root)
+        self.info = load_info(repo_id, CODEBASE_VERSION, root)
+        if self.video:
+            self.videos_dir = load_videos(repo_id, CODEBASE_VERSION, root)
+            self.video_backend = video_backend if video_backend is not None else "pyav"
+
+    @property
+    def fps(self) -> int:
+        """Frames per second used during data collection."""
+        return self.info["fps"]
+
+    @property
+    def video(self) -> bool:
+        """Returns True if this dataset loads video frames from mp4 files.
+        Returns False if it only loads images from png files.
+        """
+        return self.info.get("video", False)
+
+    @property
+    def features(self) -> datasets.Features:
+        return self.hf_dataset.features
+
+    @property
+    def camera_keys(self) -> list[str]:
+        """Keys to access image and video stream from cameras."""
+        keys = []
+        for key, feats in self.hf_dataset.features.items():
+            if isinstance(feats, (datasets.Image, VideoFrame)):
+                keys.append(key)
+        return keys
+
+    @property
+    def video_frame_keys(self) -> list[str]:
+        """Keys to access video frames that requires to be decoded into images.
+
+        Note: It is empty if the dataset contains images only,
+        or equal to `self.cameras` if the dataset contains videos only,
+        or can even be a subset of `self.cameras` in a case of a mixed image/video dataset.
+        """
+        video_frame_keys = []
+        for key, feats in self.hf_dataset.features.items():
+            if isinstance(feats, VideoFrame):
+                video_frame_keys.append(key)
+        return video_frame_keys
+
+    @property
+    def num_samples(self) -> int:
+        """Number of samples/frames."""
+        return len(self.hf_dataset)
+
+    @property
+    def num_episodes(self) -> int:
+        """Number of episodes."""
+        return len(self.hf_dataset.unique("episode_index"))
+
+    @property
+    def tolerance_s(self) -> float:
+        """Tolerance in seconds used to discard loaded frames when their timestamps
+        are not close enough from the requested frames. It is only used when `delta_timestamps`
+        is provided or when loading video frames from mp4 files.
+        """
+        # 1e-4 to account for possible numerical error
+        return 1 / self.fps - 1e-4
+
+    def __len__(self):
+        return self.num_samples
+
+    def __getitem__(self, idx):
+        item = self.hf_dataset[idx]
+
+        if self.delta_timestamps is not None:
+            item = load_previous_and_future_frames(
+                item,
+                self.hf_dataset,
+                self.episode_data_index,
+                self.delta_timestamps,
+                self.tolerance_s,
+            )
+
+        if self.video:
+            item = load_from_videos(
+                item,
+                self.video_frame_keys,
+                self.videos_dir,
+                self.tolerance_s,
+                self.video_backend,
+            )
+
+        if self.image_transforms is not None:
+            for cam in self.camera_keys:
+                item[cam] = self.image_transforms(item[cam])
+
+        return item
+
+    def __repr__(self):
+        return (
+            f"{self.__class__.__name__}(\n"
+            f"  Repository ID: '{self.repo_id}',\n"
+            f"  Split: '{self.split}',\n"
+            f"  Number of Samples: {self.num_samples},\n"
+            f"  Number of Episodes: {self.num_episodes},\n"
+            f"  Type: {'video (.mp4)' if self.video else 'image (.png)'},\n"
+            f"  Recorded Frames per Second: {self.fps},\n"
+            f"  Camera Keys: {self.camera_keys},\n"
+            f"  Video Frame Keys: {self.video_frame_keys if self.video else 'N/A'},\n"
+            f"  Transformations: {self.image_transforms},\n"
+            f"  Codebase Version: {self.info.get('codebase_version', '< v1.6')},\n"
+            f")"
+        )
+
+    @classmethod
+    def from_preloaded(
+        cls,
+        repo_id: str = "from_preloaded",
+        root: Path | None = None,
+        split: str = "train",
+        transform: callable = None,
+        delta_timestamps: dict[list[float]] | None = None,
+        # additional preloaded attributes
+        hf_dataset=None,
+        episode_data_index=None,
+        stats=None,
+        info=None,
+        videos_dir=None,
+        video_backend=None,
+    ) -> "LeRobotDataset":
+        """Create a LeRobot Dataset from existing data and attributes instead of loading from the filesystem.
+
+        It is especially useful when converting raw data into LeRobotDataset before saving the dataset
+        on the filesystem or uploading to the hub.
+
+        Note: Meta-data attributes like `repo_id`, `version`, `root`, etc are optional and potentially
+        meaningless depending on the downstream usage of the return dataset.
+        """
+        # create an empty object of type LeRobotDataset
+        obj = cls.__new__(cls)
+        obj.repo_id = repo_id
+        obj.root = root
+        obj.split = split
+        obj.image_transforms = transform
+        obj.delta_timestamps = delta_timestamps
+        obj.hf_dataset = hf_dataset
+        obj.episode_data_index = episode_data_index
+        obj.stats = stats
+        obj.info = info if info is not None else {}
+        obj.videos_dir = videos_dir
+        obj.video_backend = video_backend if video_backend is not None else "pyav"
+        return obj
+
+
+class MultiLeRobotDataset(torch.utils.data.Dataset):
+    """A dataset consisting of multiple underlying `LeRobotDataset`s.
+
+    The underlying `LeRobotDataset`s are effectively concatenated, and this class adopts much of the API
+    structure of `LeRobotDataset`.
+    """
+
+    def __init__(
+        self,
+        repo_ids: list[str],
+        root: Path | None = DATA_DIR,
+        split: str = "train",
+        image_transforms: Callable | None = None,
+        delta_timestamps: dict[list[float]] | None = None,
+        video_backend: str | None = None,
+    ):
+        super().__init__()
+        self.repo_ids = repo_ids
+        # Construct the underlying datasets passing everything but `transform` and `delta_timestamps` which
+        # are handled by this class.
+        self._datasets = [
+            LeRobotDataset(
+                repo_id,
+                root=root,
+                split=split,
+                delta_timestamps=delta_timestamps,
+                image_transforms=image_transforms,
+                video_backend=video_backend,
+            )
+            for repo_id in repo_ids
+        ]
+        # Check that some properties are consistent across datasets. Note: We may relax some of these
+        # consistency requirements in future iterations of this class.
+        for repo_id, dataset in zip(self.repo_ids, self._datasets, strict=True):
+            if dataset.info != self._datasets[0].info:
+                raise ValueError(
+                    f"Detected a mismatch in dataset info between {self.repo_ids[0]} and {repo_id}. This is "
+                    "not yet supported."
+                )
+        # Disable any data keys that are not common across all of the datasets. Note: we may relax this
+        # restriction in future iterations of this class. For now, this is necessary at least for being able
+        # to use PyTorch's default DataLoader collate function.
+        self.disabled_data_keys = set()
+        intersection_data_keys = set(self._datasets[0].hf_dataset.features)
+        for dataset in self._datasets:
+            intersection_data_keys.intersection_update(dataset.hf_dataset.features)
+        if len(intersection_data_keys) == 0:
+            raise RuntimeError(
+                "Multiple datasets were provided but they had no keys common to all of them. The "
+                "multi-dataset functionality currently only keeps common keys."
+            )
+        for repo_id, dataset in zip(self.repo_ids, self._datasets, strict=True):
+            extra_keys = set(dataset.hf_dataset.features).difference(intersection_data_keys)
+            logging.warning(
+                f"keys {extra_keys} of {repo_id} were disabled as they are not contained in all the "
+                "other datasets."
+            )
+            self.disabled_data_keys.update(extra_keys)
+
+        self.root = root
+        self.split = split
+        self.image_transforms = image_transforms
+        self.delta_timestamps = delta_timestamps
+        self.stats = aggregate_stats(self._datasets)
+
+    @property
+    def repo_id_to_index(self):
+        """Return a mapping from dataset repo_id to a dataset index automatically created by this class.
+
+        This index is incorporated as a data key in the dictionary returned by `__getitem__`.
+        """
+        return {repo_id: i for i, repo_id in enumerate(self.repo_ids)}
+
+    @property
+    def repo_index_to_id(self):
+        """Return the inverse mapping if repo_id_to_index."""
+        return {v: k for k, v in self.repo_id_to_index}
+
+    @property
+    def fps(self) -> int:
+        """Frames per second used during data collection.
+
+        NOTE: Fow now, this relies on a check in __init__ to make sure all sub-datasets have the same info.
+        """
+        return self._datasets[0].info["fps"]
+
+    @property
+    def video(self) -> bool:
+        """Returns True if this dataset loads video frames from mp4 files.
+
+        Returns False if it only loads images from png files.
+
+        NOTE: Fow now, this relies on a check in __init__ to make sure all sub-datasets have the same info.
+        """
+        return self._datasets[0].info.get("video", False)
+
+    @property
+    def features(self) -> datasets.Features:
+        features = {}
+        for dataset in self._datasets:
+            features.update({k: v for k, v in dataset.features.items() if k not in self.disabled_data_keys})
+        return features
+
+    @property
+    def camera_keys(self) -> list[str]:
+        """Keys to access image and video stream from cameras."""
+        keys = []
+        for key, feats in self.features.items():
+            if isinstance(feats, (datasets.Image, VideoFrame)):
+                keys.append(key)
+        return keys
+
+    @property
+    def video_frame_keys(self) -> list[str]:
+        """Keys to access video frames that requires to be decoded into images.
+
+        Note: It is empty if the dataset contains images only,
+        or equal to `self.cameras` if the dataset contains videos only,
+        or can even be a subset of `self.cameras` in a case of a mixed image/video dataset.
+        """
+        video_frame_keys = []
+        for key, feats in self.features.items():
+            if isinstance(feats, VideoFrame):
+                video_frame_keys.append(key)
+        return video_frame_keys
+
+    @property
+    def num_samples(self) -> int:
+        """Number of samples/frames."""
+        return sum(d.num_samples for d in self._datasets)
+
+    @property
+    def num_episodes(self) -> int:
+        """Number of episodes."""
+        return sum(d.num_episodes for d in self._datasets)
+
+    @property
+    def tolerance_s(self) -> float:
+        """Tolerance in seconds used to discard loaded frames when their timestamps
+        are not close enough from the requested frames. It is only used when `delta_timestamps`
+        is provided or when loading video frames from mp4 files.
+        """
+        # 1e-4 to account for possible numerical error
+        return 1 / self.fps - 1e-4
+
+    def __len__(self):
+        return self.num_samples
+
+    def __getitem__(self, idx: int) -> dict[str, torch.Tensor]:
+        if idx >= len(self):
+            raise IndexError(f"Index {idx} out of bounds.")
+        # Determine which dataset to get an item from based on the index.
+        start_idx = 0
+        dataset_idx = 0
+        for dataset in self._datasets:
+            if idx >= start_idx + dataset.num_samples:
+                start_idx += dataset.num_samples
+                dataset_idx += 1
+                continue
+            break
+        else:
+            raise AssertionError("We expect the loop to break out as long as the index is within bounds.")
+        item = self._datasets[dataset_idx][idx - start_idx]
+        item["dataset_index"] = torch.tensor(dataset_idx)
+        for data_key in self.disabled_data_keys:
+            if data_key in item:
+                del item[data_key]
+
+        return item
+
+    def __repr__(self):
+        return (
+            f"{self.__class__.__name__}(\n"
+            f"  Repository IDs: '{self.repo_ids}',\n"
+            f"  Split: '{self.split}',\n"
+            f"  Number of Samples: {self.num_samples},\n"
+            f"  Number of Episodes: {self.num_episodes},\n"
+            f"  Type: {'video (.mp4)' if self.video else 'image (.png)'},\n"
+            f"  Recorded Frames per Second: {self.fps},\n"
+            f"  Camera Keys: {self.camera_keys},\n"
+            f"  Video Frame Keys: {self.video_frame_keys if self.video else 'N/A'},\n"
+            f"  Transformations: {self.image_transforms},\n"
+            f")"
+        )

lerobot/common/datasets/online_buffer.py

@@ -0,0 +1,384 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""An online buffer for the online training loop in train.py
+
+Note to maintainers: This duplicates some logic from LeRobotDataset and EpisodeAwareSampler. We should
+consider converging to one approach. Here we have opted to use numpy.memmap to back the data buffer. It's much
+faster than using HuggingFace Datasets as there's no conversion to an intermediate non-python object. Also it
+supports in-place slicing and mutation which is very handy for a dynamic buffer.
+"""
+
+import os
+from pathlib import Path
+from typing import Any
+
+import numpy as np
+import torch
+
+from lerobot.common.datasets.lerobot_dataset import LeRobotDataset
+
+
+def _make_memmap_safe(**kwargs) -> np.memmap:
+    """Make a numpy memmap with checks on available disk space first.
+
+    Expected kwargs are: "filename", "dtype" (must by np.dtype), "mode" and "shape"
+
+    For information on dtypes:
+    https://numpy.org/doc/stable/reference/arrays.dtypes.html#arrays-dtypes-constructing
+    """
+    if kwargs["mode"].startswith("w"):
+        required_space = kwargs["dtype"].itemsize * np.prod(kwargs["shape"])  # bytes
+        stats = os.statvfs(Path(kwargs["filename"]).parent)
+        available_space = stats.f_bavail * stats.f_frsize  # bytes
+        if required_space >= available_space * 0.8:
+            raise RuntimeError(
+                f"You're about to take up {required_space} of {available_space} bytes available."
+            )
+    return np.memmap(**kwargs)
+
+
+class OnlineBuffer(torch.utils.data.Dataset):
+    """FIFO data buffer for the online training loop in train.py.
+
+    Follows the protocol of LeRobotDataset as much as is required to have it be used by the online training
+    loop in the same way that a LeRobotDataset would be used.
+
+    The underlying data structure will have data inserted in a circular fashion. Always insert after the
+    last index, and when you reach the end, wrap around to the start.
+
+    The data is stored in a numpy memmap.
+    """
+
+    NEXT_INDEX_KEY = "_next_index"
+    OCCUPANCY_MASK_KEY = "_occupancy_mask"
+    INDEX_KEY = "index"
+    FRAME_INDEX_KEY = "frame_index"
+    EPISODE_INDEX_KEY = "episode_index"
+    TIMESTAMP_KEY = "timestamp"
+    IS_PAD_POSTFIX = "_is_pad"
+
+    def __init__(
+        self,
+        write_dir: str | Path,
+        data_spec: dict[str, Any] | None,
+        buffer_capacity: int | None,
+        fps: float | None = None,
+        delta_timestamps: dict[str, list[float]] | dict[str, np.ndarray] | None = None,
+    ):
+        """
+        The online buffer can be provided from scratch or you can load an existing online buffer by passing
+        a `write_dir` associated with an existing buffer.
+
+        Args:
+            write_dir: Where to keep the numpy memmap files. One memmap file will be stored for each data key.
+                Note that if the files already exist, they are opened in read-write mode (used for training
+                resumption.)
+            data_spec: A mapping from data key to data specification, like {data_key: {"shape": tuple[int],
+                "dtype": np.dtype}}. This should include all the data that you wish to record into the buffer,
+                but note that "index", "frame_index" and "episode_index" are already accounted for by this
+                class, so you don't need to include them.
+            buffer_capacity: How many frames should be stored in the buffer as a maximum. Be aware of your
+                system's available disk space when choosing this.
+            fps: Same as the fps concept in LeRobot dataset. Here it needs to be provided for the
+                 delta_timestamps logic. You can pass None if you are not using delta_timestamps.
+            delta_timestamps: Same as the delta_timestamps concept in LeRobotDataset. This is internally
+                converted to dict[str, np.ndarray] for optimization purposes.
+
+        """
+        self.set_delta_timestamps(delta_timestamps)
+        self._fps = fps
+        # Tolerance in seconds used to discard loaded frames when their timestamps are not close enough from
+        # the requested frames. It is only used when `delta_timestamps` is provided.
+        # minus 1e-4 to account for possible numerical error
+        self.tolerance_s = 1 / self.fps - 1e-4 if fps is not None else None
+        self._buffer_capacity = buffer_capacity
+        data_spec = self._make_data_spec(data_spec, buffer_capacity)
+        Path(write_dir).mkdir(parents=True, exist_ok=True)
+        self._data = {}
+        for k, v in data_spec.items():
+            self._data[k] = _make_memmap_safe(
+                filename=Path(write_dir) / k,
+                dtype=v["dtype"] if v is not None else None,
+                mode="r+" if (Path(write_dir) / k).exists() else "w+",
+                shape=tuple(v["shape"]) if v is not None else None,
+            )
+
+    @property
+    def delta_timestamps(self) -> dict[str, np.ndarray] | None:
+        return self._delta_timestamps
+
+    def set_delta_timestamps(self, value: dict[str, list[float]] | None):
+        """Set delta_timestamps converting the values to numpy arrays.
+
+        The conversion is for an optimization in the __getitem__. The loop is much slower if the arrays
+        need to be converted into numpy arrays.
+        """
+        if value is not None:
+            self._delta_timestamps = {k: np.array(v) for k, v in value.items()}
+        else:
+            self._delta_timestamps = None
+
+    def _make_data_spec(self, data_spec: dict[str, Any], buffer_capacity: int) -> dict[str, dict[str, Any]]:
+        """Makes the data spec for np.memmap."""
+        if any(k.startswith("_") for k in data_spec):
+            raise ValueError(
+                "data_spec keys should not start with '_'. This prefix is reserved for internal logic."
+            )
+        preset_keys = {
+            OnlineBuffer.INDEX_KEY,
+            OnlineBuffer.FRAME_INDEX_KEY,
+            OnlineBuffer.EPISODE_INDEX_KEY,
+            OnlineBuffer.TIMESTAMP_KEY,
+        }
+        if len(intersection := set(data_spec).intersection(preset_keys)) > 0:
+            raise ValueError(
+                f"data_spec should not contain any of {preset_keys} as these are handled internally. "
+                f"The provided data_spec has {intersection}."
+            )
+        complete_data_spec = {
+            # _next_index will be a pointer to the next index that we should start filling from when we add
+            # more data.
+            OnlineBuffer.NEXT_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": ()},
+            # Since the memmap is initialized with all-zeros, this keeps track of which indices are occupied
+            # with real data rather than the dummy initialization.
+            OnlineBuffer.OCCUPANCY_MASK_KEY: {"dtype": np.dtype("?"), "shape": (buffer_capacity,)},
+            OnlineBuffer.INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
+            OnlineBuffer.FRAME_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
+            OnlineBuffer.EPISODE_INDEX_KEY: {"dtype": np.dtype("int64"), "shape": (buffer_capacity,)},
+            OnlineBuffer.TIMESTAMP_KEY: {"dtype": np.dtype("float64"), "shape": (buffer_capacity,)},
+        }
+        for k, v in data_spec.items():
+            complete_data_spec[k] = {"dtype": v["dtype"], "shape": (buffer_capacity, *v["shape"])}
+        return complete_data_spec
+
+    def add_data(self, data: dict[str, np.ndarray]):
+        """Add new data to the buffer, which could potentially mean shifting old data out.
+
+        The new data should contain all the frames (in order) of any number of episodes. The indices should
+        start from 0 (note to the developer: this can easily be generalized). See the `rollout` and
+        `eval_policy` functions in `eval.py` for more information on how the data is constructed.
+
+        Shift the incoming data index and episode_index to continue on from the last frame. Note that this
+        will be done in place!
+        """
+        if len(missing_keys := (set(self.data_keys).difference(set(data)))) > 0:
+            raise ValueError(f"Missing data keys: {missing_keys}")
+        new_data_length = len(data[self.data_keys[0]])
+        if not all(len(data[k]) == new_data_length for k in self.data_keys):
+            raise ValueError("All data items should have the same length")
+
+        next_index = self._data[OnlineBuffer.NEXT_INDEX_KEY]
+
+        # Sanity check to make sure that the new data indices start from 0.
+        assert data[OnlineBuffer.EPISODE_INDEX_KEY][0].item() == 0
+        assert data[OnlineBuffer.INDEX_KEY][0].item() == 0
+
+        # Shift the incoming indices if necessary.
+        if self.num_samples > 0:
+            last_episode_index = self._data[OnlineBuffer.EPISODE_INDEX_KEY][next_index - 1]
+            last_data_index = self._data[OnlineBuffer.INDEX_KEY][next_index - 1]
+            data[OnlineBuffer.EPISODE_INDEX_KEY] += last_episode_index + 1
+            data[OnlineBuffer.INDEX_KEY] += last_data_index + 1
+
+        # Insert the new data starting from next_index. It may be necessary to wrap around to the start.
+        n_surplus = max(0, new_data_length - (self._buffer_capacity - next_index))
+        for k in self.data_keys:
+            if n_surplus == 0:
+                slc = slice(next_index, next_index + new_data_length)
+                self._data[k][slc] = data[k]
+                self._data[OnlineBuffer.OCCUPANCY_MASK_KEY][slc] = True
+            else:
+                self._data[k][next_index:] = data[k][:-n_surplus]
+                self._data[OnlineBuffer.OCCUPANCY_MASK_KEY][next_index:] = True
+                self._data[k][:n_surplus] = data[k][-n_surplus:]
+        if n_surplus == 0:
+            self._data[OnlineBuffer.NEXT_INDEX_KEY] = next_index + new_data_length
+        else:
+            self._data[OnlineBuffer.NEXT_INDEX_KEY] = n_surplus
+
+    @property
+    def data_keys(self) -> list[str]:
+        keys = set(self._data)
+        keys.remove(OnlineBuffer.OCCUPANCY_MASK_KEY)
+        keys.remove(OnlineBuffer.NEXT_INDEX_KEY)
+        return sorted(keys)
+
+    @property
+    def fps(self) -> float | None:
+        return self._fps
+
+    @property
+    def num_episodes(self) -> int:
+        return len(
+            np.unique(self._data[OnlineBuffer.EPISODE_INDEX_KEY][self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]])
+        )
+
+    @property
+    def num_samples(self) -> int:
+        return np.count_nonzero(self._data[OnlineBuffer.OCCUPANCY_MASK_KEY])
+
+    def __len__(self):
+        return self.num_samples
+
+    def _item_to_tensors(self, item: dict) -> dict:
+        item_ = {}
+        for k, v in item.items():
+            if isinstance(v, torch.Tensor):
+                item_[k] = v
+            elif isinstance(v, np.ndarray):
+                item_[k] = torch.from_numpy(v)
+            else:
+                item_[k] = torch.tensor(v)
+        return item_
+
+    def __getitem__(self, idx: int) -> dict[str, torch.Tensor]:
+        if idx >= len(self) or idx < -len(self):
+            raise IndexError
+
+        item = {k: v[idx] for k, v in self._data.items() if not k.startswith("_")}
+
+        if self.delta_timestamps is None:
+            return self._item_to_tensors(item)
+
+        episode_index = item[OnlineBuffer.EPISODE_INDEX_KEY]
+        current_ts = item[OnlineBuffer.TIMESTAMP_KEY]
+        episode_data_indices = np.where(
+            np.bitwise_and(
+                self._data[OnlineBuffer.EPISODE_INDEX_KEY] == episode_index,
+                self._data[OnlineBuffer.OCCUPANCY_MASK_KEY],
+            )
+        )[0]
+        episode_timestamps = self._data[OnlineBuffer.TIMESTAMP_KEY][episode_data_indices]
+
+        for data_key in self.delta_timestamps:
+            # Note: The logic in this loop is copied from `load_previous_and_future_frames`.
+            # Get timestamps used as query to retrieve data of previous/future frames.
+            query_ts = current_ts + self.delta_timestamps[data_key]
+
+            # Compute distances between each query timestamp and all timestamps of all the frames belonging to
+            # the episode.
+            dist = np.abs(query_ts[:, None] - episode_timestamps[None, :])
+            argmin_ = np.argmin(dist, axis=1)
+            min_ = dist[np.arange(dist.shape[0]), argmin_]
+
+            is_pad = min_ > self.tolerance_s
+
+            # Check violated query timestamps are all outside the episode range.
+            assert (
+                (query_ts[is_pad] < episode_timestamps[0]) | (episode_timestamps[-1] < query_ts[is_pad])
+            ).all(), (
+                f"One or several timestamps unexpectedly violate the tolerance ({min_} > {self.tolerance_s=}"
+                ") inside the episode range."
+            )
+
+            # Load frames for this data key.
+            item[data_key] = self._data[data_key][episode_data_indices[argmin_]]
+
+            item[f"{data_key}{OnlineBuffer.IS_PAD_POSTFIX}"] = is_pad
+
+        return self._item_to_tensors(item)
+
+    def get_data_by_key(self, key: str) -> torch.Tensor:
+        """Returns all data for a given data key as a Tensor."""
+        return torch.from_numpy(self._data[key][self._data[OnlineBuffer.OCCUPANCY_MASK_KEY]])
+
+
+def compute_sampler_weights(
+    offline_dataset: LeRobotDataset,
+    offline_drop_n_last_frames: int = 0,
+    online_dataset: OnlineBuffer | None = None,
+    online_sampling_ratio: float | None = None,
+    online_drop_n_last_frames: int = 0,
+) -> torch.Tensor:
+    """Compute the sampling weights for the online training dataloader in train.py.
+
+    Args:
+        offline_dataset: The LeRobotDataset used for offline pre-training.
+        online_drop_n_last_frames: Number of frames to drop from the end of each offline dataset episode.
+        online_dataset: The OnlineBuffer used in online training.
+        online_sampling_ratio: The proportion of data that should be sampled from the online dataset. If an
+            online dataset is provided, this value must also be provided.
+        online_drop_n_first_frames: See `offline_drop_n_last_frames`. This is the same, but for the online
+            dataset.
+    Returns:
+        Tensor of weights for [offline_dataset; online_dataset], normalized to 1.
+
+    Notes to maintainers:
+        - This duplicates some logic from EpisodeAwareSampler. We should consider converging to one approach.
+        - When used with `torch.utils.data.WeightedRandomSampler`, it could completely replace
+          `EpisodeAwareSampler` as the online dataset related arguments are optional. The only missing feature
+          is the ability to turn shuffling off.
+        - Options `drop_first_n_frames` and `episode_indices_to_use` can be added easily. They were not
+          included here to avoid adding complexity.
+    """
+    if len(offline_dataset) == 0 and (online_dataset is None or len(online_dataset) == 0):
+        raise ValueError("At least one of `offline_dataset` or `online_dataset` should be contain data.")
+    if (online_dataset is None) ^ (online_sampling_ratio is None):
+        raise ValueError(
+            "`online_dataset` and `online_sampling_ratio` must be provided together or not at all."
+        )
+    offline_sampling_ratio = 0 if online_sampling_ratio is None else 1 - online_sampling_ratio
+
+    weights = []
+
+    if len(offline_dataset) > 0:
+        offline_data_mask_indices = []
+        for start_index, end_index in zip(
+            offline_dataset.episode_data_index["from"],
+            offline_dataset.episode_data_index["to"],
+            strict=True,
+        ):
+            offline_data_mask_indices.extend(
+                range(start_index.item(), end_index.item() - offline_drop_n_last_frames)
+            )
+        offline_data_mask = torch.zeros(len(offline_dataset), dtype=torch.bool)
+        offline_data_mask[torch.tensor(offline_data_mask_indices)] = True
+        weights.append(
+            torch.full(
+                size=(len(offline_dataset),),
+                fill_value=offline_sampling_ratio / offline_data_mask.sum(),
+            )
+            * offline_data_mask
+        )
+
+    if online_dataset is not None and len(online_dataset) > 0:
+        online_data_mask_indices = []
+        episode_indices = online_dataset.get_data_by_key("episode_index")
+        for episode_idx in torch.unique(episode_indices):
+            where_episode = torch.where(episode_indices == episode_idx)
+            start_index = where_episode[0][0]
+            end_index = where_episode[0][-1] + 1
+            online_data_mask_indices.extend(
+                range(start_index.item(), end_index.item() - online_drop_n_last_frames)
+            )
+        online_data_mask = torch.zeros(len(online_dataset), dtype=torch.bool)
+        online_data_mask[torch.tensor(online_data_mask_indices)] = True
+        weights.append(
+            torch.full(
+                size=(len(online_dataset),),
+                fill_value=online_sampling_ratio / online_data_mask.sum(),
+            )
+            * online_data_mask
+        )
+
+    weights = torch.cat(weights)
+
+    if weights.sum() == 0:
+        weights += 1 / len(weights)
+    else:
+        weights /= weights.sum()
+
+    return weights

lerobot/common/datasets/populate_dataset.py

@@ -0,0 +1,468 @@
+"""Functions to create an empty dataset, and populate it with frames."""
+# TODO(rcadene, aliberts): to adapt as class methods of next version of LeRobotDataset
+
+import concurrent
+import json
+import logging
+import multiprocessing
+import shutil
+from pathlib import Path
+
+import torch
+import tqdm
+from PIL import Image
+
+from lerobot.common.datasets.compute_stats import compute_stats
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION, LeRobotDataset
+from lerobot.common.datasets.push_dataset_to_hub.aloha_hdf5_format import to_hf_dataset
+from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes, get_default_encoding
+from lerobot.common.datasets.utils import calculate_episode_data_index, create_branch
+from lerobot.common.datasets.video_utils import encode_video_frames
+from lerobot.common.utils.utils import log_say
+from lerobot.scripts.push_dataset_to_hub import (
+    push_dataset_card_to_hub,
+    push_meta_data_to_hub,
+    push_videos_to_hub,
+    save_meta_data,
+)
+
+########################################################################################
+# Asynchrounous saving of images on disk
+########################################################################################
+
+
+def safe_stop_image_writer(func):
+    # TODO(aliberts): Allow to pass custom exceptions
+    # (e.g. ThreadServiceExit, KeyboardInterrupt, SystemExit, UnpluggedError, DynamixelCommError)
+    def wrapper(*args, **kwargs):
+        try:
+            return func(*args, **kwargs)
+        except Exception as e:
+            image_writer = kwargs.get("dataset", {}).get("image_writer")
+            if image_writer is not None:
+                print("Waiting for image writer to terminate...")
+                stop_image_writer(image_writer, timeout=20)
+            raise e
+
+    return wrapper
+
+
+def save_image(img_tensor, key, frame_index, episode_index, videos_dir: str):
+    img = Image.fromarray(img_tensor.numpy())
+    path = Path(videos_dir) / f"{key}_episode_{episode_index:06d}" / f"frame_{frame_index:06d}.png"
+    path.parent.mkdir(parents=True, exist_ok=True)
+    img.save(str(path), quality=100)
+
+
+def loop_to_save_images_in_threads(image_queue, num_threads):
+    if num_threads < 1:
+        raise NotImplementedError(f"Only `num_threads>=1` is supported for now, but {num_threads=} given.")
+
+    with concurrent.futures.ThreadPoolExecutor(max_workers=num_threads) as executor:
+        futures = []
+        while True:
+            # Blocks until a frame is available
+            frame_data = image_queue.get()
+
+            # As usually done, exit loop when receiving None to stop the worker
+            if frame_data is None:
+                break
+
+            image, key, frame_index, episode_index, videos_dir = frame_data
+            futures.append(executor.submit(save_image, image, key, frame_index, episode_index, videos_dir))
+
+        # Before exiting function, wait for all threads to complete
+        with tqdm.tqdm(total=len(futures), desc="Writing images") as progress_bar:
+            concurrent.futures.wait(futures)
+            progress_bar.update(len(futures))
+
+
+def start_image_writer_processes(image_queue, num_processes, num_threads_per_process):
+    if num_processes < 1:
+        raise ValueError(f"Only `num_processes>=1` is supported, but {num_processes=} given.")
+
+    if num_threads_per_process < 1:
+        raise NotImplementedError(
+            "Only `num_threads_per_process>=1` is supported for now, but {num_threads_per_process=} given."
+        )
+
+    processes = []
+    for _ in range(num_processes):
+        process = multiprocessing.Process(
+            target=loop_to_save_images_in_threads,
+            args=(image_queue, num_threads_per_process),
+        )
+        process.start()
+        processes.append(process)
+    return processes
+
+
+def stop_processes(processes, queue, timeout):
+    # Send None to each process to signal them to stop
+    for _ in processes:
+        queue.put(None)
+
+    # Wait maximum 20 seconds for all processes to terminate
+    for process in processes:
+        process.join(timeout=timeout)
+
+    # If not terminated after 20 seconds, force termination
+    if process.is_alive():
+        process.terminate()
+
+    # Close the queue, no more items can be put in the queue
+    queue.close()
+
+    # Ensure all background queue threads have finished
+    queue.join_thread()
+
+
+def start_image_writer(num_processes, num_threads):
+    """This function abstract away the initialisation of processes or/and threads to
+    save images on disk asynchrounously, which is critical to control a robot and record data
+    at a high frame rate.
+
+    When `num_processes=0`, it returns a dictionary containing a threads pool of size `num_threads`.
+    When `num_processes>0`, it returns a dictionary containing a processes pool of size `num_processes`,
+    where each subprocess starts their own threads pool of size `num_threads`.
+
+    The optimal number of processes and threads depends on your computer capabilities.
+    We advise to use 4 threads per camera with 0 processes. If the fps is not stable, try to increase or lower
+    the number of threads. If it is still not stable, try to use 1 subprocess, or more.
+    """
+    image_writer = {}
+
+    if num_processes == 0:
+        futures = []
+        threads_pool = concurrent.futures.ThreadPoolExecutor(max_workers=num_threads)
+        image_writer["threads_pool"], image_writer["futures"] = threads_pool, futures
+    else:
+        # TODO(rcadene): When using num_processes>1, `multiprocessing.Manager().Queue()`
+        # might be better than `multiprocessing.Queue()`. Source: https://www.geeksforgeeks.org/python-multiprocessing-queue-vs-multiprocessing-manager-queue
+        image_queue = multiprocessing.Queue()
+        processes_pool = start_image_writer_processes(
+            image_queue, num_processes=num_processes, num_threads_per_process=num_threads
+        )
+        image_writer["processes_pool"], image_writer["image_queue"] = processes_pool, image_queue
+
+    return image_writer
+
+
+def async_save_image(image_writer, image, key, frame_index, episode_index, videos_dir):
+    """This function abstract away the saving of an image on disk asynchrounously. It uses a dictionary
+    called image writer which contains either a pool of processes or a pool of threads.
+    """
+    if "threads_pool" in image_writer:
+        threads_pool, futures = image_writer["threads_pool"], image_writer["futures"]
+        futures.append(threads_pool.submit(save_image, image, key, frame_index, episode_index, videos_dir))
+    else:
+        image_queue = image_writer["image_queue"]
+        image_queue.put((image, key, frame_index, episode_index, videos_dir))
+
+
+def stop_image_writer(image_writer, timeout):
+    if "threads_pool" in image_writer:
+        futures = image_writer["futures"]
+        # Before exiting function, wait for all threads to complete
+        with tqdm.tqdm(total=len(futures), desc="Writing images") as progress_bar:
+            concurrent.futures.wait(futures, timeout=timeout)
+            progress_bar.update(len(futures))
+    else:
+        processes_pool, image_queue = image_writer["processes_pool"], image_writer["image_queue"]
+        stop_processes(processes_pool, image_queue, timeout=timeout)
+
+
+########################################################################################
+# Functions to initialize, resume and populate a dataset
+########################################################################################
+
+
+def init_dataset(
+    repo_id,
+    root,
+    force_override,
+    fps,
+    video,
+    write_images,
+    num_image_writer_processes,
+    num_image_writer_threads,
+):
+    local_dir = Path(root) / repo_id
+    if local_dir.exists() and force_override:
+        shutil.rmtree(local_dir)
+
+    episodes_dir = local_dir / "episodes"
+    episodes_dir.mkdir(parents=True, exist_ok=True)
+
+    videos_dir = local_dir / "videos"
+    videos_dir.mkdir(parents=True, exist_ok=True)
+
+    # Logic to resume data recording
+    rec_info_path = episodes_dir / "data_recording_info.json"
+    if rec_info_path.exists():
+        with open(rec_info_path) as f:
+            rec_info = json.load(f)
+        num_episodes = rec_info["last_episode_index"] + 1
+    else:
+        num_episodes = 0
+
+    dataset = {
+        "repo_id": repo_id,
+        "local_dir": local_dir,
+        "videos_dir": videos_dir,
+        "episodes_dir": episodes_dir,
+        "fps": fps,
+        "video": video,
+        "rec_info_path": rec_info_path,
+        "num_episodes": num_episodes,
+    }
+
+    if write_images:
+        # Initialize processes or/and threads dedicated to save images on disk asynchronously,
+        # which is critical to control a robot and record data at a high frame rate.
+        image_writer = start_image_writer(
+            num_processes=num_image_writer_processes,
+            num_threads=num_image_writer_threads,
+        )
+        dataset["image_writer"] = image_writer
+
+    return dataset
+
+
+def add_frame(dataset, observation, action):
+    if "current_episode" not in dataset:
+        # initialize episode dictionary
+        ep_dict = {}
+        for key in observation:
+            if key not in ep_dict:
+                ep_dict[key] = []
+        for key in action:
+            if key not in ep_dict:
+                ep_dict[key] = []
+
+        ep_dict["episode_index"] = []
+        ep_dict["frame_index"] = []
+        ep_dict["timestamp"] = []
+        ep_dict["next.done"] = []
+
+        dataset["current_episode"] = ep_dict
+        dataset["current_frame_index"] = 0
+
+    ep_dict = dataset["current_episode"]
+    episode_index = dataset["num_episodes"]
+    frame_index = dataset["current_frame_index"]
+    videos_dir = dataset["videos_dir"]
+    video = dataset["video"]
+    fps = dataset["fps"]
+
+    ep_dict["episode_index"].append(episode_index)
+    ep_dict["frame_index"].append(frame_index)
+    ep_dict["timestamp"].append(frame_index / fps)
+    ep_dict["next.done"].append(False)
+
+    img_keys = [key for key in observation if "image" in key]
+    non_img_keys = [key for key in observation if "image" not in key]
+
+    # Save all observed modalities except images
+    for key in non_img_keys:
+        ep_dict[key].append(observation[key])
+
+    # Save actions
+    for key in action:
+        ep_dict[key].append(action[key])
+
+    if "image_writer" not in dataset:
+        dataset["current_frame_index"] += 1
+        return
+
+    # Save images
+    image_writer = dataset["image_writer"]
+    for key in img_keys:
+        imgs_dir = videos_dir / f"{key}_episode_{episode_index:06d}"
+        async_save_image(
+            image_writer,
+            image=observation[key],
+            key=key,
+            frame_index=frame_index,
+            episode_index=episode_index,
+            videos_dir=str(videos_dir),
+        )
+
+        if video:
+            fname = f"{key}_episode_{episode_index:06d}.mp4"
+            frame_info = {"path": f"videos/{fname}", "timestamp": frame_index / fps}
+        else:
+            frame_info = str(imgs_dir / f"frame_{frame_index:06d}.png")
+
+        ep_dict[key].append(frame_info)
+
+    dataset["current_frame_index"] += 1
+
+
+def delete_current_episode(dataset):
+    del dataset["current_episode"]
+    del dataset["current_frame_index"]
+
+    # delete temporary images
+    episode_index = dataset["num_episodes"]
+    videos_dir = dataset["videos_dir"]
+    for tmp_imgs_dir in videos_dir.glob(f"*_episode_{episode_index:06d}"):
+        shutil.rmtree(tmp_imgs_dir)
+
+
+def save_current_episode(dataset):
+    episode_index = dataset["num_episodes"]
+    ep_dict = dataset["current_episode"]
+    episodes_dir = dataset["episodes_dir"]
+    rec_info_path = dataset["rec_info_path"]
+
+    ep_dict["next.done"][-1] = True
+
+    for key in ep_dict:
+        if "observation" in key and "image" not in key:
+            ep_dict[key] = torch.stack(ep_dict[key])
+
+    ep_dict["action"] = torch.stack(ep_dict["action"])
+    ep_dict["episode_index"] = torch.tensor(ep_dict["episode_index"])
+    ep_dict["frame_index"] = torch.tensor(ep_dict["frame_index"])
+    ep_dict["timestamp"] = torch.tensor(ep_dict["timestamp"])
+    ep_dict["next.done"] = torch.tensor(ep_dict["next.done"])
+
+    ep_path = episodes_dir / f"episode_{episode_index}.pth"
+    torch.save(ep_dict, ep_path)
+
+    rec_info = {
+        "last_episode_index": episode_index,
+    }
+    with open(rec_info_path, "w") as f:
+        json.dump(rec_info, f)
+
+    # force re-initialization of episode dictionnary during add_frame
+    del dataset["current_episode"]
+
+    dataset["num_episodes"] += 1
+
+
+def encode_videos(dataset, image_keys, play_sounds):
+    log_say("Encoding videos", play_sounds)
+
+    num_episodes = dataset["num_episodes"]
+    videos_dir = dataset["videos_dir"]
+    local_dir = dataset["local_dir"]
+    fps = dataset["fps"]
+
+    # Use ffmpeg to convert frames stored as png into mp4 videos
+    for episode_index in tqdm.tqdm(range(num_episodes)):
+        for key in image_keys:
+            # key = f"observation.images.{name}"
+            tmp_imgs_dir = videos_dir / f"{key}_episode_{episode_index:06d}"
+            fname = f"{key}_episode_{episode_index:06d}.mp4"
+            video_path = local_dir / "videos" / fname
+            if video_path.exists():
+                # Skip if video is already encoded. Could be the case when resuming data recording.
+                continue
+            # note: `encode_video_frames` is a blocking call. Making it asynchronous shouldn't speedup encoding,
+            # since video encoding with ffmpeg is already using multithreading.
+            encode_video_frames(tmp_imgs_dir, video_path, fps, overwrite=True)
+            shutil.rmtree(tmp_imgs_dir)
+
+
+def from_dataset_to_lerobot_dataset(dataset, play_sounds):
+    log_say("Consolidate episodes", play_sounds)
+
+    num_episodes = dataset["num_episodes"]
+    episodes_dir = dataset["episodes_dir"]
+    videos_dir = dataset["videos_dir"]
+    video = dataset["video"]
+    fps = dataset["fps"]
+    repo_id = dataset["repo_id"]
+
+    ep_dicts = []
+    for episode_index in tqdm.tqdm(range(num_episodes)):
+        ep_path = episodes_dir / f"episode_{episode_index}.pth"
+        ep_dict = torch.load(ep_path)
+        ep_dicts.append(ep_dict)
+    data_dict = concatenate_episodes(ep_dicts)
+
+    if video:
+        image_keys = [key for key in data_dict if "image" in key]
+        encode_videos(dataset, image_keys, play_sounds)
+
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    lerobot_dataset = LeRobotDataset.from_preloaded(
+        repo_id=repo_id,
+        hf_dataset=hf_dataset,
+        episode_data_index=episode_data_index,
+        info=info,
+        videos_dir=videos_dir,
+    )
+
+    return lerobot_dataset
+
+
+def save_lerobot_dataset_on_disk(lerobot_dataset):
+    hf_dataset = lerobot_dataset.hf_dataset
+    info = lerobot_dataset.info
+    stats = lerobot_dataset.stats
+    episode_data_index = lerobot_dataset.episode_data_index
+    local_dir = lerobot_dataset.videos_dir.parent
+    meta_data_dir = local_dir / "meta_data"
+
+    hf_dataset = hf_dataset.with_format(None)  # to remove transforms that cant be saved
+    hf_dataset.save_to_disk(str(local_dir / "train"))
+
+    save_meta_data(info, stats, episode_data_index, meta_data_dir)
+
+
+def push_lerobot_dataset_to_hub(lerobot_dataset, tags):
+    hf_dataset = lerobot_dataset.hf_dataset
+    local_dir = lerobot_dataset.videos_dir.parent
+    videos_dir = lerobot_dataset.videos_dir
+    repo_id = lerobot_dataset.repo_id
+    video = lerobot_dataset.video
+    meta_data_dir = local_dir / "meta_data"
+
+    if not (local_dir / "train").exists():
+        raise ValueError(
+            "You need to run `save_lerobot_dataset_on_disk(lerobot_dataset)` before pushing to the hub."
+        )
+
+    hf_dataset.push_to_hub(repo_id, revision="main")
+    push_meta_data_to_hub(repo_id, meta_data_dir, revision="main")
+    push_dataset_card_to_hub(repo_id, revision="main", tags=tags)
+    if video:
+        push_videos_to_hub(repo_id, videos_dir, revision="main")
+    create_branch(repo_id, repo_type="dataset", branch=CODEBASE_VERSION)
+
+
+def create_lerobot_dataset(dataset, run_compute_stats, push_to_hub, tags, play_sounds):
+    if "image_writer" in dataset:
+        logging.info("Waiting for image writer to terminate...")
+        image_writer = dataset["image_writer"]
+        stop_image_writer(image_writer, timeout=20)
+
+    lerobot_dataset = from_dataset_to_lerobot_dataset(dataset, play_sounds)
+
+    if run_compute_stats:
+        log_say("Computing dataset statistics", play_sounds)
+        lerobot_dataset.stats = compute_stats(lerobot_dataset)
+    else:
+        logging.info("Skipping computation of the dataset statistics")
+        lerobot_dataset.stats = {}
+
+    save_lerobot_dataset_on_disk(lerobot_dataset)
+
+    if push_to_hub:
+        push_lerobot_dataset_to_hub(lerobot_dataset, tags)
+
+    return lerobot_dataset

lerobot/common/datasets/push_dataset_to_hub/CODEBASE_VERSION.md

@@ -0,0 +1,56 @@
+## Using / Updating `CODEBASE_VERSION` (for maintainers)
+
+Since our dataset pushed to the hub are decoupled with the evolution of this repo, we ensure compatibility of
+the datasets with our code, we use a `CODEBASE_VERSION` (defined in
+lerobot/common/datasets/lerobot_dataset.py) variable.
+
+For instance, [`lerobot/pusht`](https://huggingface.co/datasets/lerobot/pusht) has many versions to maintain backward compatibility between LeRobot codebase versions:
+- [v1.0](https://huggingface.co/datasets/lerobot/pusht/tree/v1.0)
+- [v1.1](https://huggingface.co/datasets/lerobot/pusht/tree/v1.1)
+- [v1.2](https://huggingface.co/datasets/lerobot/pusht/tree/v1.2)
+- [v1.3](https://huggingface.co/datasets/lerobot/pusht/tree/v1.3)
+- [v1.4](https://huggingface.co/datasets/lerobot/pusht/tree/v1.4)
+- [v1.5](https://huggingface.co/datasets/lerobot/pusht/tree/v1.5)
+- [v1.6](https://huggingface.co/datasets/lerobot/pusht/tree/v1.6) <-- last version
+- [main](https://huggingface.co/datasets/lerobot/pusht/tree/main) <-- points to the last version
+
+Starting with v1.6, every dataset pushed to the hub or saved locally also have this version number in their
+`info.json` metadata.
+
+### Uploading a new dataset
+If you are pushing a new dataset, you don't need to worry about any of the instructions below, nor to be
+compatible with previous codebase versions. The `push_dataset_to_hub.py` script will automatically tag your
+dataset with the current `CODEBASE_VERSION`.
+
+### Updating an existing dataset
+If you want to update an existing dataset, you need to change the `CODEBASE_VERSION` from `lerobot_dataset.py`
+before running `push_dataset_to_hub.py`. This is especially useful if you introduce a breaking change
+intentionally or not (i.e. something not backward compatible such as modifying the reward functions used,
+deleting some frames at the end of an episode, etc.). That way, people running a previous version of the
+codebase won't be affected by your change and backward compatibility is maintained.
+
+However, you will need to update the version of ALL the other datasets so that they have the new
+`CODEBASE_VERSION` as a branch in their hugging face dataset repository. Don't worry, there is an easy way
+that doesn't require to run `push_dataset_to_hub.py`. You can just "branch-out" from the `main` branch on HF
+dataset repo by running this script which corresponds to a `git checkout -b` (so no copy or upload needed):
+
+```python
+from huggingface_hub import HfApi
+
+from lerobot import available_datasets
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+
+api = HfApi()
+
+for repo_id in available_datasets:
+    dataset_info = api.list_repo_refs(repo_id, repo_type="dataset")
+    branches = [b.name for b in dataset_info.branches]
+    if CODEBASE_VERSION in branches:
+        print(f"{repo_id} already @{CODEBASE_VERSION}, skipping.")
+        continue
+    else:
+        # Now create a branch named after the new version by branching out from "main"
+        # which is expected to be the preceding version
+        api.create_branch(repo_id, repo_type="dataset", branch=CODEBASE_VERSION, revision="main")
+        print(f"{repo_id} successfully updated @{CODEBASE_VERSION}")
+```

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_cabinet.txt

@@ -0,0 +1,85 @@
+https://drive.google.com/file/d/1_SOJkgfP5yZyVjMhTt3nwhvyUjcnlI51/view?usp=drive_link
+https://drive.google.com/file/d/1rmgN8UUzph1qwJnzG1d-uOafodn-gLvb/view?usp=drive_link
+https://drive.google.com/file/d/1NYQ-XxsBVinB6dUoZmVWweT83367P3i2/view?usp=drive_link
+https://drive.google.com/file/d/1oAv_j74zxxCJieMG7r5Vl2BeHK1__3s3/view?usp=drive_link
+https://drive.google.com/file/d/1wFUJQROsrTJt64YRuIeExhFjr2wnK5uu/view?usp=drive_link
+https://drive.google.com/file/d/1KzL3Tt0Le7jVl58XVRUcmigmXjyiuhbK/view?usp=drive_link
+https://drive.google.com/file/d/1qy_YBladeHtianSSGtgAPSHtMin7msvf/view?usp=drive_link
+https://drive.google.com/file/d/1rA_F0V_qL_nyuC_0aBKCisF4-0TIkF2Y/view?usp=drive_link
+https://drive.google.com/file/d/1hw-8qMpz9VgSt62XoASqNRuPECpCwJQP/view?usp=drive_link
+https://drive.google.com/file/d/1BpHOl9rKMzdvNGka6js7C0s40hH6vnDA/view?usp=drive_link
+https://drive.google.com/file/d/1PazhkhiDnJ-OUMyDVDFxEZNKQQqHiNWS/view?usp=drive_link
+https://drive.google.com/file/d/1lZ665R6ATl57dypxH4dGJ2NSt6XYnbuz/view?usp=drive_link
+https://drive.google.com/file/d/1V9HzLaf-tlG15wUzT7KrTDCS_z1vi5NV/view?usp=drive_link
+https://drive.google.com/file/d/1aKauWiXoKqbNwn_2xs4MrmLlaNYlVNmO/view?usp=drive_link
+https://drive.google.com/file/d/1WVD5DFhriO1YmmOgiVHhacR6HWoTPxav/view?usp=drive_link
+https://drive.google.com/file/d/1_X43WgeBAsfkhH9EmpyPki8U9joMeAGC/view?usp=drive_link
+https://drive.google.com/file/d/1t8x0GqWoNKWtnBsB7_D40Z34nL9ak4kf/view?usp=drive_link
+https://drive.google.com/file/d/15V_f26WaKOXjKnq2T3HRWAmtQUi4lbu2/view?usp=drive_link
+https://drive.google.com/file/d/11VFIAsiSDsMOBANgrOcZBpKB9AFWnLy7/view?usp=drive_link
+https://drive.google.com/file/d/1M0NS7vVaxJv3FHnuRYtdwTFYF7We4LxP/view?usp=drive_link
+https://drive.google.com/file/d/1mR0OItTNqFnVLoczcyKYlm6drAy778lO/view?usp=drive_link
+https://drive.google.com/file/d/1NbVFWDQAh-z4JJ4D-Zw6Lps9kdvpqh2j/view?usp=drive_link
+https://drive.google.com/file/d/1JQoZGBzl4W3QG26-n39tefcGN0fDRMbB/view?usp=drive_link
+https://drive.google.com/file/d/1VBjHl-TvZpncopvasIP5G9gecbB2a5f6/view?usp=drive_link
+https://drive.google.com/file/d/1VzSf6zaB21nahm7MsPwroXbJ84NIwq0b/view?usp=drive_link
+https://drive.google.com/file/d/1OtNnfMEydNtZOcivs4k6E_uJSpf8PkGy/view?usp=drive_link
+https://drive.google.com/file/d/14nVvpvsrFr_03Pa_N7MKzwnRwibOUYM6/view?usp=drive_link
+https://drive.google.com/file/d/1M8li6duiO2r3lv_9HhF_XJn0oZUIEK5F/view?usp=drive_link
+https://drive.google.com/file/d/1Cpzea6fO14lxAaNfSBifqoa4ekhCiLD1/view?usp=drive_link
+https://drive.google.com/file/d/1mbxRTm5vlbsY9UJ0jfjM6j9D7kPJjBpG/view?usp=drive_link
+https://drive.google.com/file/d/1RXD1i6IfWsHRlCxVmG04h2h5Ycm_WwZN/view?usp=drive_link
+https://drive.google.com/file/d/1QFqFSwDGOk1BkgGmqgCcc2BRWnJ6R3MA/view?usp=drive_link
+https://drive.google.com/file/d/1bFqWR8DQM0ZUxxtS2bl-RANQvukeFLzp/view?usp=drive_link
+https://drive.google.com/file/d/1pR-rH3yNGoyPdD4hJ6-3lXQ-PstBx9du/view?usp=drive_link
+https://drive.google.com/file/d/107OAwLY-hva9HeQLIK7VCh-ytdDabVjr/view?usp=drive_link
+https://drive.google.com/file/d/1Tpl08QOaSZ37GTO4awFWSdD8wBR9xdlT/view?usp=drive_link
+https://drive.google.com/file/d/1MR164AOM-0S1T6RX8xKTV2IHyaCvpqAW/view?usp=drive_link
+https://drive.google.com/file/d/1_wknJfVnStIhJ82lU_QtcrwahsqYIsr8/view?usp=drive_link
+https://drive.google.com/file/d/1ZuEktWrbYkTx0l5pj3WiZ2CJrfbDOHNo/view?usp=drive_link
+https://drive.google.com/file/d/15G_10hkkkq6yxvyI5NGZirlF-RzduR2F/view?usp=drive_link
+https://drive.google.com/file/d/1DBKxg3ONqh7dhLuX6oh1Yyo2x383V1Hp/view?usp=drive_link
+https://drive.google.com/file/d/1B5iDBkTUr5vopDddV_fHud18SqAHhauS/view?usp=drive_link
+https://drive.google.com/file/d/1acwFV0eenRkki1QcjSKH5xqOtys-P3Pr/view?usp=drive_link
+https://drive.google.com/file/d/1S47BI83xyrh-FKXsvAQqer98Biu_p8XK/view?usp=drive_link
+https://drive.google.com/file/d/1JL6DmBZl3uyq9dyLfgSqtGF06e7E9JwM/view?usp=drive_link
+https://drive.google.com/file/d/16WvRS4Kjog8Pxgr0E3sGGnI01YwL9Uql/view?usp=drive_link
+https://drive.google.com/file/d/12ttGqL33IPWg0-s1SD44rr22M6LiSQBr/view?usp=drive_link
+https://drive.google.com/file/d/1OyZqqnldTU_DliRbr6x0C4a_iWPwIN7j/view?usp=drive_link
+https://drive.google.com/file/d/1oYk00IpLnR9fesLfD15Ebe7nVBffEbcS/view?usp=drive_link
+https://drive.google.com/file/d/1eyE2-MQduCEqCd-5_kl5zsoOEERAzpZD/view?usp=drive_link
+https://drive.google.com/file/d/1ir1Ya-vO0d97pfvbePlUeuKTTRc0qIMU/view?usp=drive_link
+https://drive.google.com/file/d/1hOi-JnqlMt47gVnLZHMTqeojyYVErohl/view?usp=drive_link
+https://drive.google.com/file/d/1NFFw5_PqigQ7xGqsL-MNq2B1r5yAscCf/view?usp=drive_link
+https://drive.google.com/file/d/1uftq1-Zlh8d2sNLWrlVcKYQUwZTD7o24/view?usp=drive_link
+https://drive.google.com/file/d/1-ax19dSLPacVgk000T-m3l4flPcg07pM/view?usp=drive_link
+https://drive.google.com/file/d/126y-lgn86-ZmCz8hooF1THKJGGObw3OB/view?usp=drive_link
+https://drive.google.com/file/d/1JiDniK0VmDIkk92AbBILb8J2Ba59PWML/view?usp=drive_link
+https://drive.google.com/file/d/1kr8nPIRljiU0R4J9SMgj80o1FPQxzu9z/view?usp=drive_link
+https://drive.google.com/file/d/1bbThWRij1pKBh_kFgV8FwK0sXtTHBoLX/view?usp=drive_link
+https://drive.google.com/file/d/1WenzDW6lxk1xkOFm-OiGFfc0ROskAuKU/view?usp=drive_link
+https://drive.google.com/file/d/1MiKRzuzUn1yN-k_6kPJJzIGy7dT-nnsD/view?usp=drive_link
+https://drive.google.com/file/d/17rRg2tcmB-gNhQ0KoZJQmNfyFeoij1jH/view?usp=drive_link
+https://drive.google.com/file/d/11mokBpvrY3ld6sY5WztREtJ1jgqfQV70/view?usp=drive_link
+https://drive.google.com/file/d/1Il_6IOx9NDp1bX_KHizJfBwzTufTmn86/view?usp=drive_link
+https://drive.google.com/file/d/1KswtJGsxJ7eeBDAmNA_aeLjOxcH6MIxa/view?usp=drive_link
+https://drive.google.com/file/d/1gzMhi5uWu4C3Y6WbQ3L-08V96GxTZrRR/view?usp=drive_link
+https://drive.google.com/file/d/1nRQFtaBxfUCYc2W90Qibh0kHCt6YQCfc/view?usp=drive_link
+https://drive.google.com/file/d/1vs-gyW-KheqHbUATwAhA2mmR9GOGw7f_/view?usp=drive_link
+https://drive.google.com/file/d/1MuxzGOA2fgLaHryq82KkQumtuRJGcUOC/view?usp=drive_link
+https://drive.google.com/file/d/1IIwxZnGlqrXLUXqG6yMO0r7uhCvhpk9e/view?usp=drive_link
+https://drive.google.com/file/d/1vE7XPyaFcXP4DtTY5Y9WKIt7zWgmX-Cr/view?usp=drive_link
+https://drive.google.com/file/d/1j-bIV09gr21RC3-x1N_pK4RPLV3fmWKz/view?usp=drive_link
+https://drive.google.com/file/d/1t3nW1rD3S-EL0Oymb5U7ZAj5UMkydkln/view?usp=drive_link
+https://drive.google.com/file/d/14hbfHCdMKtJZ41F9CQReMec2jeRFTOqR/view?usp=drive_link
+https://drive.google.com/file/d/1x-hUyOSne5BW0AzQ3W6_Pf4g5yXQWi9M/view?usp=drive_link
+https://drive.google.com/file/d/1sw9JqRg6E-3P84I3ZhzTrJMu0vuiaMmP/view?usp=drive_link
+https://drive.google.com/file/d/1LuqhQlL4MGZhB_6THmkovRxrlP26BbdC/view?usp=drive_link
+https://drive.google.com/file/d/15C5K6v_lkjnMSmUvVyqHQKwh2N166e7K/view?usp=drive_link
+https://drive.google.com/file/d/1ns_9eSsQeeoZ10nlbkLy8tu0GmJFSnkt/view?usp=drive_link
+https://drive.google.com/file/d/1NpzWJeK6CqjxzjIMYe6aYdX8xGsQwD4o/view?usp=drive_link
+https://drive.google.com/file/d/1NMLezwufKJ9_8xTc9KQThSzVVD71B9Ui/view?usp=drive_link
+https://drive.google.com/file/d/1aa71DCUqs6oXlIxX35jgsmsgm-NlDxPV/view?usp=drive_link
+https://drive.google.com/file/d/1UJzkIZzAL0j-D5YQBnoq7mHvttASy12O/view?usp=drive_link
+https://drive.google.com/file/d/1nPgx36HIJFb7oI94VbRzWjpPP2GANxzG/view?usp=drive_link
+https://drive.google.com/file/d/1NovAP-KVJjqcuvWy3d6G4ptGGAIDqcCx/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_chair.txt

@@ -0,0 +1,55 @@
+https://drive.google.com/file/d/11M3Ye0r5agMaaicPbVGD0q2Hb3rGklbb/view?usp=drive_link
+https://drive.google.com/file/d/1-tx7SvYYgSvXCvnf_EI2OVdwK-CkFY6S/view?usp=drive_link
+https://drive.google.com/file/d/1EWJunmOpMHaU1hE106wwpbkGYcjQXYAF/view?usp=drive_link
+https://drive.google.com/file/d/1IDn95Z7FSiCckrSENtGV4u3RyFHNQSDY/view?usp=drive_link
+https://drive.google.com/file/d/1CwzvWj1i7QOtqrZvsCZ6BdZaKNDfpN32/view?usp=drive_link
+https://drive.google.com/file/d/1HvAvlhm77nAD3Td24QPSeq8lw-Rl_aOh/view?usp=drive_link
+https://drive.google.com/file/d/1t-suKYOPhXH666RpAYNRp2QU_DOy3AeM/view?usp=drive_link
+https://drive.google.com/file/d/18xpKgWh7RWyjMN5PkLTOo-AxsAadAuRw/view?usp=drive_link
+https://drive.google.com/file/d/1oci5Eto-ztv-AQNz8EnwZveBIhxvk-xJ/view?usp=drive_link
+https://drive.google.com/file/d/1Y-t_4vxdE6NpHO0DLJR8f3mD0Q-Wj5-c/view?usp=drive_link
+https://drive.google.com/file/d/1lylRqbbbB8bgtpsBWMPACmHJreuKmllv/view?usp=drive_link
+https://drive.google.com/file/d/1yliSyMig_NXShWfQx6qyW7Ijf2Y5lFK6/view?usp=drive_link
+https://drive.google.com/file/d/1XXhwJsJbeb7KXAooGvJapnm9bjnGUmxS/view?usp=drive_link
+https://drive.google.com/file/d/1_xs1f3hW2JArKyvfF7UWubWjyROGTLs6/view?usp=drive_link
+https://drive.google.com/file/d/1WVEHpr6EqKCZbkHapQSTXJq4xE4SWFT-/view?usp=drive_link
+https://drive.google.com/file/d/1RqOHv9pEQGvW8NUA7ynffFmG999TL_Az/view?usp=drive_link
+https://drive.google.com/file/d/1cu5AgD2gh-uA3PFJmzxxzNaF3qOSlYY1/view?usp=drive_link
+https://drive.google.com/file/d/1SsrXqiPclNrnYToPZ9Uq-k3y0C4qdHT1/view?usp=drive_link
+https://drive.google.com/file/d/1-J7EXf0vjkLIfSqT8ICEsP6CTjzSLBop/view?usp=drive_link
+https://drive.google.com/file/d/11O7ewUmoZXfyyKjy_6B5RW4DpjICxqBT/view?usp=drive_link
+https://drive.google.com/file/d/1iic44kZoCsjNsfAz2cMstZ9-WQvAhblF/view?usp=drive_link
+https://drive.google.com/file/d/1yLV1lVX-2WnWQldGlnQZ0x7QBuDiVkL3/view?usp=drive_link
+https://drive.google.com/file/d/1Tybp9ru98TTbGn4eyROpUQwDFuALWXmk/view?usp=drive_link
+https://drive.google.com/file/d/13E9OTMiipVJByDs5-J19oWwAz7l94LTN/view?usp=drive_link
+https://drive.google.com/file/d/1EeTpJQdMSliw4JzSMtJ6CyTvVdexjM4M/view?usp=drive_link
+https://drive.google.com/file/d/1NHyNwoFqzeAu-1_PSpq5JfxaiD_xbpn9/view?usp=drive_link
+https://drive.google.com/file/d/1fJcS0phDp4xm_FyGaJ5wr9Pe4KqtHaxD/view?usp=drive_link
+https://drive.google.com/file/d/12AqrLUaewDPEcFRqPZeZFb_TQ0Lfi3At/view?usp=drive_link
+https://drive.google.com/file/d/1x_hd4Qsq1oJS-aj2t3qM7WbbV7KZj05b/view?usp=drive_link
+https://drive.google.com/file/d/14OUSUArmsB068hs6BuEIXQhI1Cyz8Sf0/view?usp=drive_link
+https://drive.google.com/file/d/16zlzh1T5zeUJQnFf382NXkFEKEnDub4O/view?usp=drive_link
+https://drive.google.com/file/d/1IbDltmN-NEFCNtr1TO4ILxEgQ94rtjWv/view?usp=drive_link
+https://drive.google.com/file/d/15gmlf8Gx9455pZ1AlqcCSwh3nDPxMzSr/view?usp=drive_link
+https://drive.google.com/file/d/1qHpRL1oZfIMo_vxnm8qfwQ-7l0BZIVva/view?usp=drive_link
+https://drive.google.com/file/d/1H1xskIgiFZivkYn23rMzH3xePGOh3VTC/view?usp=drive_link
+https://drive.google.com/file/d/1avls6Pv0kYiCMNVknbc1zQsgy64MUDMM/view?usp=drive_link
+https://drive.google.com/file/d/1MmWVgCj5khc8KMIifmt3EzF1o-CtPyyn/view?usp=drive_link
+https://drive.google.com/file/d/1U0kCc_xqW0WNppf4sbnK14euWKdPZtzB/view?usp=drive_link
+https://drive.google.com/file/d/16CaEyQscOuhLj23PEGDTL9DeyNkohkMn/view?usp=drive_link
+https://drive.google.com/file/d/1Iu8uM6UUJ0zW8tvN-9UiOe_4oSNzEutg/view?usp=drive_link
+https://drive.google.com/file/d/1UImqiBaIxCR-1DNJaZhHqeHhaySOtVIr/view?usp=drive_link
+https://drive.google.com/file/d/1VpU2V_leIoRIyv_lAvE7eLHBG8DxCTnp/view?usp=drive_link
+https://drive.google.com/file/d/1_Q8J27OT3Xby7QY6yHvIJauFRWEMxkRm/view?usp=drive_link
+https://drive.google.com/file/d/1bantmVo1L9Xz4tbiNw_a1UC2Z_HPO1wT/view?usp=drive_link
+https://drive.google.com/file/d/1IRIXMJMCBDkBjbaHvAlEiBogSvZ1jK_3/view?usp=drive_link
+https://drive.google.com/file/d/1mAHXKjiFbjwydypW2t5Lv8_H5x6nHegl/view?usp=drive_link
+https://drive.google.com/file/d/1SfyY796fLrBCMY39OcyuxZafqSCRZPZk/view?usp=drive_link
+https://drive.google.com/file/d/1X-44sZ8CcfzIskc0dvSx882o1yFhHaZB/view?usp=drive_link
+https://drive.google.com/file/d/1BOIWCCCk6DLD4Bmvc75ZbbLi9AQm-1ao/view?usp=drive_link
+https://drive.google.com/file/d/1RuyDtRE1kk76sw-wP8vx5SgLoPF3PA_H/view?usp=drive_link
+https://drive.google.com/file/d/1c4eoQiBbGuy3CTAQDUSkd84Ponh1roAQ/view?usp=drive_link
+https://drive.google.com/file/d/19PXB9z4Ljq6dsbf9TqcOrrP5SRbw2Tc_/view?usp=drive_link
+https://drive.google.com/file/d/1nn1VVZVoIXWdYDozR7XHXE4mPLQG80PQ/view?usp=drive_link
+https://drive.google.com/file/d/1MBdFGOKPV8GUhwoSsJ_Ky3qAMLM2Bv3K/view?usp=drive_link
+https://drive.google.com/file/d/1of3k_M-7Nh3I1TndcWedxK4ca9dn8Sc5/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_elevator.txt

@@ -0,0 +1,20 @@
+https://drive.google.com/file/d/12ctkOAdkCNGN1JLbZb5ww3XTBn2LFpGI/view?usp=drive_link
+https://drive.google.com/file/d/1G_Vd46_4fq6O64gHHjUbJX5Ld44ZZx0y/view?usp=drive_link
+https://drive.google.com/file/d/1uKgUy73B3xBogQAOUhfZjO0X5qZGsi2c/view?usp=drive_link
+https://drive.google.com/file/d/1fu9cIrfI-fE2LhdGUxbx7-8Ci_PF8Ypm/view?usp=drive_link
+https://drive.google.com/file/d/1Ygk9ZPJzx8xw2A9JF3NHbJ44TqnvSTQR/view?usp=drive_link
+https://drive.google.com/file/d/18m5xPuccNsEB20WPshm3zhxmXc6k63ED/view?usp=drive_link
+https://drive.google.com/file/d/1DiqqxC44rriviRQpqogcv0-EB-Y6nr9g/view?usp=drive_link
+https://drive.google.com/file/d/1qPdaoTVDizJXkfXLioWU7iJ8hqCXSyOQ/view?usp=drive_link
+https://drive.google.com/file/d/1Fj9kIA_mG7f67WFfACJEaZ7izcHG7vUm/view?usp=drive_link
+https://drive.google.com/file/d/1WpYehZnI2P7dUdJPfkE-ij1rqCnjZEbB/view?usp=drive_link
+https://drive.google.com/file/d/1_zwWkT4jPyzB38STWb6whlzsPzXmfA9r/view?usp=drive_link
+https://drive.google.com/file/d/1U6-J4I_fPlSFFGfhZPxS5_YzKXwXIZYp/view?usp=drive_link
+https://drive.google.com/file/d/1pRhxxcTfZp5tQo_EScvJUwfc3amiS6Vk/view?usp=drive_link
+https://drive.google.com/file/d/1lWLntqra83RlYU_gN7Vostnfydf6gutd/view?usp=drive_link
+https://drive.google.com/file/d/1vIBKo0x-NYEHV1FvRpco1lQMpRdAWAIL/view?usp=drive_link
+https://drive.google.com/file/d/1pdrLV3JTQou_XH0Aap61Ssf60iVKm1jJ/view?usp=drive_link
+https://drive.google.com/file/d/1QTsLoQ7SwmKdQHjBGVDaR2uTwfFwtrOf/view?usp=drive_link
+https://drive.google.com/file/d/1Gytai8M_12J36GY6L_TulEcOC-035jwS/view?usp=drive_link
+https://drive.google.com/file/d/14LJudNc629NT-i8xreXtzl27ce_DxOFJ/view?usp=drive_link
+https://drive.google.com/file/d/1sBvPCODbzxGAI0S3lgN5cSG9Go3lRi00/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_shrimp.txt

@@ -0,0 +1,18 @@
+https://drive.google.com/file/d/1MJn9GbC8p9lN4gC9KDMLEkTkP_gGpXj0/view?usp=drive_link
+https://drive.google.com/file/d/1-4LXgjl7ZCOgp-8GCJmFRD8OeqN5Jf7-/view?usp=drive_link
+https://drive.google.com/file/d/1Ho06Ce0SPbqU3juaMxNUwAt3zCRLGC8W/view?usp=drive_link
+https://drive.google.com/file/d/1ivHoj7_7olBSxH-Y8kqXEW7ttITK-45j/view?usp=drive_link
+https://drive.google.com/file/d/1qjY4hM_IvZ8cq2II_n9MeJbvyeuN4oBP/view?usp=drive_link
+https://drive.google.com/file/d/1rKVhO_f92-7sw13T8hTVrza3B9oAVgoy/view?usp=drive_link
+https://drive.google.com/file/d/1pcLPHO8fBkc1-CRa88tyQtEueE4xiXNi/view?usp=drive_link
+https://drive.google.com/file/d/1Vev_chCsIeEdvQ8poEYNsOJFGy_QU8kZ/view?usp=drive_link
+https://drive.google.com/file/d/1l5G4zpRkxSLCQjvGPYSN4zfCvVRQuzMz/view?usp=drive_link
+https://drive.google.com/file/d/14vgthE1eoakXkr2-DRw50E6lAqYOiUuE/view?usp=drive_link
+https://drive.google.com/file/d/17nPSmKKmgQ2B7zkzWrZYiLM3RBuFod82/view?usp=drive_link
+https://drive.google.com/file/d/1QcDsxplVvb_ID9BVrihl5FvlC-j7waXi/view?usp=drive_link
+https://drive.google.com/file/d/18pEejBpI-eEVaWAAjBCyC0vgbX3T1Esj/view?usp=drive_link
+https://drive.google.com/file/d/1H8eH6_IRODtEFT6WoM77ltR5OoOrqXmI/view?usp=drive_link
+https://drive.google.com/file/d/1IWlpFRZhoxyG4nS13CWK4leZVk5wbNx4/view?usp=drive_link
+https://drive.google.com/file/d/1PbZA8_OCGmMLxNP9xbkLRSChniL4uGxl/view?usp=drive_link
+https://drive.google.com/file/d/1p9XAdmG2f_WeflNO4DIJ_tr1rK6M9B4B/view?usp=drive_link
+https://drive.google.com/file/d/1nS59Et1cNAvKo3Y4SeSGRuZD5TvBbCF3/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_wash_pan.txt

@@ -0,0 +1 @@
+https://drive.google.com/drive/folders/1S8eFg98IaGAIKVZ8QFWG1bx4mHa-O204

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/mobile_wipe_wine.txt

@@ -0,0 +1,4 @@
+https://drive.google.com/drive/folders/1tC_g1AJ8lglBLY-fjsQrG6DMBa3Ucp-0
+https://drive.google.com/file/d/1fG_Yi2MJrFjiUVN3XoiWXLtTxHlwwaDv/view?usp=drive_link
+https://drive.google.com/file/d/1WX32VWfzzX3Blmd06DRxLwFbMJfVe7P4/view?usp=drive_link
+https://drive.google.com/file/d/18onsX3vXg3xkFwP5bVUCjdV4n9TRn0C9/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/sim_insertion_human.txt

@@ -0,0 +1,3 @@
+https://drive.google.com/drive/folders/1RgyD0JgTX30H4IM5XZn8I3zSV_mr8pyF
+https://drive.google.com/file/d/18Cudl6nikDtgRolea7je8iF_gGKzynOP/view?usp=drive_link
+https://drive.google.com/file/d/1C1kZYyROzs-PrLc0SkDgUgMi4-L3lauE/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/sim_insertion_scripted.txt

@@ -0,0 +1,3 @@
+https://drive.google.com/drive/folders/1TsojQQSXtHEoGnqgJ3gmpPQR2DPLtS2N
+https://drive.google.com/file/d/1wfMSZ24oOh5KR_0aaP3Cnu_c4ZCveduB/view?usp=drive_link
+https://drive.google.com/file/d/17EuCUWS6uCCr6yyNzpXdcdE-_TTNCKtf/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/sim_transfer_cube_human.txt

@@ -0,0 +1,3 @@
+https://drive.google.com/drive/folders/1sc-E4QYW7A0o23m1u2VWNGVq5smAsfCo
+https://drive.google.com/file/d/18smMymtr8tIxaNUQ61gW6dG50pt3MvGq/view?usp=drive_link
+https://drive.google.com/file/d/1Nk7l53d9sJoGDBKAOnNrExX5nLacATc6/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/sim_transfer_cube_scripted.txt

@@ -0,0 +1,3 @@
+https://drive.google.com/drive/folders/1aRyoOhQwxhyt1J8XgEig4s6kzaw__LXj
+https://drive.google.com/file/d/1pnGIOd-E4-rhz2P3VxpknMKRZCoKt6eI/view?usp=drive_link
+https://drive.google.com/file/d/1GKReZHrXU73NMiC5zKCq_UtqPVtYq8eo/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_battery.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/19qS_n7vKgDcPeTMnvDHQ5-n73xEbJz5D
+https://drive.google.com/file/d/1oC31By0A2bsBeHyUwBdQw1z4ng6yi9Za/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_candy.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1m5rQ6UVH8Q9RQp_6c0CxkQ88-L-ScO7q
+https://drive.google.com/file/d/1wHz2qcmwcVG0C0CZ9MjQDQcmj4OY9_a3/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_coffee.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1seQGay470nGQ-knBI5TjsTr8iL9Qws5q
+https://drive.google.com/file/d/1T89hSX5U99wLGvGTE7yUBaQPOpyj6Sai/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_coffee_new.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1t3eDc5Rg0DveyRe8oTm6Dia_FYU5mXyf
+https://drive.google.com/file/d/1TXFaduTakvS0ZWJqKCX-HIvYglum_5CY/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_cups_open.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1Z9X3DNzd6LS0FFjQemNUMoMA5yk5VQOh
+https://drive.google.com/file/d/1Wlyc0vTkjXuWB6zbaVOWhEfD7BmPgUV_/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_fork_pick_up.txt

@@ -0,0 +1,53 @@
+https://drive.google.com/drive/folders/1DYgB4ifX4uIid9m9jnC0Zdz8Nf7ZC0fc
+https://drive.google.com/file/d/1Eb-NRNk_FmVleCbU_Ng5Y4dfcjTKN7Rv/view?usp=drive_link
+https://drive.google.com/file/d/1dkhjEADakT-44l9jf-nK4x89kr4yG_qb/view?usp=drive_link
+https://drive.google.com/file/d/14hDhgcZkVqNExGb4tIXpSjMshhqZETch/view?usp=drive_link
+https://drive.google.com/file/d/1zVMEHpHbuNyP5A_lYU7RPSLB-4V0yfZw/view?usp=drive_link
+https://drive.google.com/file/d/1JtgDjBvy7FnRpFzrx_foC3quorYQFAR-/view?usp=drive_link
+https://drive.google.com/file/d/1EHdneB6F-PP0dQlX8qPaXbxmKoBy_YwO/view?usp=drive_link
+https://drive.google.com/file/d/17Z0jjVBy1OPKREPu77_n_rQzorDiapji/view?usp=drive_link
+https://drive.google.com/file/d/1F4i23qPJ_qTf5jWjfLo4ARGJChznYWt3/view?usp=drive_link
+https://drive.google.com/file/d/1kZtXWM3uS0-rLblydBfJ0mMcVnMMXw9w/view?usp=drive_link
+https://drive.google.com/file/d/1mNODox87xFfY5Z_o5mcLsr8SHb39jDik/view?usp=drive_link
+https://drive.google.com/file/d/1Ob44VdmEUA93FKDECiRb5Ogz2xQg5IWp/view?usp=drive_link
+https://drive.google.com/file/d/1fdQLdjj3Cwv33R1wZhfrLz9Del8mqgHb/view?usp=drive_link
+https://drive.google.com/file/d/1Yu3L3ft21zP__XL8pCfhb788ZleuW1n5/view?usp=drive_link
+https://drive.google.com/file/d/1ozBBWXVZ9hXDh9ooHUNroHdYm8UDqnhJ/view?usp=drive_link
+https://drive.google.com/file/d/1o0TGqvfWw_Lunxb5ubKDS21Lr_WC0h75/view?usp=drive_link
+https://drive.google.com/file/d/1jZnd5eP5L6BH5l98BPN6OnoQx3fu8e9n/view?usp=drive_link
+https://drive.google.com/file/d/1S5sYbz8wcLYp0V67v13i4PRcBxodn4Hg/view?usp=drive_link
+https://drive.google.com/file/d/1rFeg_x6ftJYwPtBv34D3h2L2cpDLeR4G/view?usp=drive_link
+https://drive.google.com/file/d/1GvS3lcm4o6nm_scUk0XxKeVFNmzjucDZ/view?usp=drive_link
+https://drive.google.com/file/d/1-9i0riphC7NhhDahcQfD1QoBXP5gF90A/view?usp=drive_link
+https://drive.google.com/file/d/15p_IqGsMbKuvzMS872THAZr-3SBtb1Fr/view?usp=drive_link
+https://drive.google.com/file/d/1ToyYcBfJL8gbQn0q_59zPLsFmm7dmMJo/view?usp=drive_link
+https://drive.google.com/file/d/1e_7PNH7CYafE4pAebP7ZdI7XFbmEcy_i/view?usp=drive_link
+https://drive.google.com/file/d/1JoabvGVsIQdug2xOhUIhetEIyDM91y_Y/view?usp=drive_link
+https://drive.google.com/file/d/1kOMw1y0lmnVaCjwZICfzCsx6e0Z8MNGR/view?usp=drive_link
+https://drive.google.com/file/d/16it_wd1JOevUQTK2_CvF_pBACTgpIPgM/view?usp=drive_link
+https://drive.google.com/file/d/1IRcCj9HnJSfbyMgr5XEERGlEnWeZQwOc/view?usp=drive_link
+https://drive.google.com/file/d/1Z2dIJfq_S3liGmPN9Rphvkmucnmw7tlb/view?usp=drive_link
+https://drive.google.com/file/d/1J3NoAjzndGx9yNyaBOJHdNny1epzUoBt/view?usp=drive_link
+https://drive.google.com/file/d/18nOvxV1k8FSmBrhT4TPo2sKKSZXougyx/view?usp=drive_link
+https://drive.google.com/file/d/1CT8FxclafFMjSd7gCWVw3VSeryeiF04i/view?usp=drive_link
+https://drive.google.com/file/d/16M9KVqQMFfSsXfypK0bocFft8Nz3j2Rt/view?usp=drive_link
+https://drive.google.com/file/d/18QPVkw6bj6HW8LTPrQLWrrUX4R6RcF42/view?usp=drive_link
+https://drive.google.com/file/d/1hQTVtA5hBTE_StXpJafTZJ3tgt2VQQ_t/view?usp=drive_link
+https://drive.google.com/file/d/1Dn-d5g69H6EgAWgsFdrcbJKtz7ySsCQ8/view?usp=drive_link
+https://drive.google.com/file/d/13hMr16483P7ALYv73yMRUN37fJdVQM62/view?usp=drive_link
+https://drive.google.com/file/d/1848yN3XMN5zJMEgApt6KzrWgfRPfimtv/view?usp=drive_link
+https://drive.google.com/file/d/1oAD9kSnS0fTgj-CjD4u9VdZ5X67IOIMa/view?usp=drive_link
+https://drive.google.com/file/d/1ilzIWLCCG5b_KgF5s0wdN2I5-lFNpwC1/view?usp=drive_link
+https://drive.google.com/file/d/1rjsT2YBjnidxod1s9s-myAYz8boHr-WB/view?usp=drive_link
+https://drive.google.com/file/d/18Gg48HTub15bd8qzbhiCUufbVy0fbN5G/view?usp=drive_link
+https://drive.google.com/file/d/1WsSnQSqmMTVSRwrhT1Y-v782My2zcjLm/view?usp=drive_link
+https://drive.google.com/file/d/1ea9ZCvoyc-xqiFXgeDcA_mOWsw7VUuoi/view?usp=drive_link
+https://drive.google.com/file/d/1wv1v3-XhPgbNzp62BXbJTDzMPu2tlDUc/view?usp=drive_link
+https://drive.google.com/file/d/18-ikzt8LoZ83Gi3goKCELs4U4z8hrRoF/view?usp=drive_link
+https://drive.google.com/file/d/16Bjhp7JNCXkGuLvyNcZowAx3W-Y-15DV/view?usp=drive_link
+https://drive.google.com/file/d/1Gc-KRI-xwcp1fMR55ugbrLg_5y3SPde-/view?usp=drive_link
+https://drive.google.com/file/d/1oP72Q386Z4Sy5MMm-t5yNogIe5Van_9k/view?usp=drive_link
+https://drive.google.com/file/d/112T90eDUDVH-SyOV7UnZl5bscAH2hcfq/view?usp=drive_link
+https://drive.google.com/file/d/1y-uKOesRRhjgDtFbG_j65f4SGg0v8XDg/view?usp=drive_link
+https://drive.google.com/file/d/1LOP05OagoI3km-ZKQBrS204A85UVk7Ok/view?usp=drive_link
+https://drive.google.com/file/d/1QkHQKgasVzWsmdPvkXgGhWyQ84d93_Az/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_pingpong_test.txt

@@ -0,0 +1 @@
+https://drive.google.com/drive/folders/1Ut2cv6o6Pkfgg46DgwVUM7Z5PkNG8eJ-

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_pro_pencil.txt

@@ -0,0 +1 @@
+https://drive.google.com/drive/folders/1FqxPV0PgvgIu8XFjtvZSPSExuNcxVVAY

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_screw_driver.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1SKtG0ct9q0nVdYssJNMWSOjikcXliT58
+https://drive.google.com/file/d/1nchD21O30B3i3LDoqramo1zgW5YvpJIN/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_tape.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1_4DHf2cma0xsChLQFghwigX6Ukti5-zQ
+https://drive.google.com/file/d/1_8vS4hDNDgUQY-SmekrNaa7dF67QJYU-/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_thread_velcro.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1_4DHf2cma0xsChLQFghwigX6Ukti5-zQ
+https://drive.google.com/file/d/1_8vS4hDNDgUQY-SmekrNaa7dF67QJYU-/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_towel.txt

@@ -0,0 +1,2 @@
+https://drive.google.com/drive/folders/1fAD7vkyTGTFB_nGXIKofCU1U05oE3MFv
+https://drive.google.com/file/d/1XzyQ2B6LLvcurIonOpEu4nij2qwNWshH/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_vinh_cup.txt

@@ -0,0 +1,53 @@
+https://drive.google.com/drive/folders/13EQsVsnxT86K20QAoyE_YpsFbQ7fZQdu
+https://drive.google.com/file/d/1-W_JHghZG65FNTVhw1SXhtQrazdLL3Ue/view?usp=drive_link
+https://drive.google.com/file/d/1VwRJgdWUo-2nQaNM7Bs77-fsm8iwUxEo/view?usp=drive_link
+https://drive.google.com/file/d/1wFzGRo5iYA13WLi6IV1ry64RyahQBFio/view?usp=drive_link
+https://drive.google.com/file/d/1IKtQzQ-n-UTv64hYpReu2R4cqUvmNQqD/view?usp=drive_link
+https://drive.google.com/file/d/1GicVci9OiuuZZH79i5Mg7AtWod94MzwT/view?usp=drive_link
+https://drive.google.com/file/d/1JVnIoR7EIQp70T4eAf9RX65JcTrzsjQc/view?usp=drive_link
+https://drive.google.com/file/d/1W2xr4h23ucjPrc-mBEeqnACsfaImpc0p/view?usp=drive_link
+https://drive.google.com/file/d/10xj_0V7A07o3uCa7v5omUrTC0YlPW8H3/view?usp=drive_link
+https://drive.google.com/file/d/1FOc3EMaCy8Mb0_a7PuXLAwKwvxkbKmwU/view?usp=drive_link
+https://drive.google.com/file/d/143PgDXBcf2GQ0Q07ZPMVMfBgZDd5sLJG/view?usp=drive_link
+https://drive.google.com/file/d/1pE5Tyj0LlGbGWvUzuhixp86Ibu55Ez3I/view?usp=drive_link
+https://drive.google.com/file/d/141668b1VzX80ncrVJPzhkoAeIFB4MEK9/view?usp=drive_link
+https://drive.google.com/file/d/1bw12lo37p1ZvRvErHsll7cEYi2OxscvZ/view?usp=drive_link
+https://drive.google.com/file/d/1zfnMFvbgBjl6SzYhksbaOzfbwLrCN6tb/view?usp=drive_link
+https://drive.google.com/file/d/1-GIszA6mUJMaNB-tdh9r9skc77SWA0VX/view?usp=drive_link
+https://drive.google.com/file/d/1fTB0zWFYU6zh4IIUFT2zX_OkwYqmElwY/view?usp=drive_link
+https://drive.google.com/file/d/1gPIPNKGmrO9c7gKF7SP0SuUYbIBBq8z1/view?usp=drive_link
+https://drive.google.com/file/d/12JeJ-dQd5lYyn6PlDOGdE-ChVeiZ-Uv0/view?usp=drive_link
+https://drive.google.com/file/d/100_20cgCqerU6qoh3TfTbwLy9mlDAFEG/view?usp=drive_link
+https://drive.google.com/file/d/111oAGJ76ku_pYgbBoIdZAC1_XEQcPI__/view?usp=drive_link
+https://drive.google.com/file/d/1UhC8L-354ZQ2gblPFGI35EMsVwfpuKa0/view?usp=drive_link
+https://drive.google.com/file/d/1sIXQSgUR_xdrNtGrL6QGBnkLMKErsIp1/view?usp=drive_link
+https://drive.google.com/file/d/16Ax77bDSIXnsn4GFL8XYKKT1P6bPpfMd/view?usp=drive_link
+https://drive.google.com/file/d/1pgRVYwwVIsWq_qsWqZpe1UBzZfF5Fa9D/view?usp=drive_link
+https://drive.google.com/file/d/1jtimaZkWsY1P5gC2bbS64H_WCUU7HXN2/view?usp=drive_link
+https://drive.google.com/file/d/1N6Bh02P-RiTEgtx1YH1Db_X3TGpP-X_r/view?usp=drive_link
+https://drive.google.com/file/d/14Fy8EwJ8d9Vh97Yt1VOvUChSCrfIjBij/view?usp=drive_link
+https://drive.google.com/file/d/1IRuv42dvIMPuKhcMZmuXaBjJ-lPFOmQd/view?usp=drive_link
+https://drive.google.com/file/d/16XWzNY2D8ucVVn5geBgsVdhm3ppO4que/view?usp=drive_link
+https://drive.google.com/file/d/1xsVOoQgthK_L_SDrmq_JvQgUpAvPEAY8/view?usp=drive_link
+https://drive.google.com/file/d/1bZbw66DyEMvnJnzkdUUNbKjvNKg8KFYM/view?usp=drive_link
+https://drive.google.com/file/d/1CyTVkdrNGGpouCXr4CfhKbMzE6Ah3oo3/view?usp=drive_link
+https://drive.google.com/file/d/1hDRyeM-XEDpHXpptbT8LvNnlQUR3PWOh/view?usp=drive_link
+https://drive.google.com/file/d/1XhHWxbra8Iy5irQZ83IvxwaJqHq9x4s1/view?usp=drive_link
+https://drive.google.com/file/d/1haZcn6aM1o4JlmP9tJj3x2enrxiPaDSD/view?usp=drive_link
+https://drive.google.com/file/d/1ypDyuUTbljaBZ34f-t7lj3O_0bRmyX2n/view?usp=drive_link
+https://drive.google.com/file/d/1ILEEZo_tA9_ChIAprr2mPaNVKZi5vXsO/view?usp=drive_link
+https://drive.google.com/file/d/1U7nVYFaGE8vVTfLCW33D74xOjDcqfgyJ/view?usp=drive_link
+https://drive.google.com/file/d/1rZ93_rmCov5SMDxPkfM3qthcRELZrQX6/view?usp=drive_link
+https://drive.google.com/file/d/1mYO1b_csddtyE3qT6cwLiw-m2w2_1Lxh/view?usp=drive_link
+https://drive.google.com/file/d/1xz7Q5x2jikY8wJQjMRQpRws6AnfWlHm5/view?usp=drive_link
+https://drive.google.com/file/d/1OO8GaO-0FrSZRd1kxMYwBmubyiLOWnbl/view?usp=drive_link
+https://drive.google.com/file/d/1EXn4NVDmf-4_HCy34mYwT-vwK2CFI9ev/view?usp=drive_link
+https://drive.google.com/file/d/10hH70XhXRL9C5SnAG4toHtfHqfJUJo4H/view?usp=drive_link
+https://drive.google.com/file/d/18tiBcxea0guUai4lwsXQvt0q2LZ8ZnnJ/view?usp=drive_link
+https://drive.google.com/file/d/1Q8R8qv37vk5PQ5kQ2ibx6BFLOySD0VpX/view?usp=drive_link
+https://drive.google.com/file/d/17aNriHzjhdibCyuUjQoMFZqjybJZtggG/view?usp=drive_link
+https://drive.google.com/file/d/1LVjEYHSdeKm6CotU1QguIeNEPaIaFl_1/view?usp=drive_link
+https://drive.google.com/file/d/1ufAhE_EkgJ85slg2EW8aW_grOzE_Lmxd/view?usp=drive_link
+https://drive.google.com/file/d/1wtzLtXrkw9eXRGESTPIOlpl1tInu-b2m/view?usp=drive_link
+https://drive.google.com/file/d/1Mk5qvVtD_QHwGOUApRq76TUw2T5THu6f/view?usp=drive_link
+https://drive.google.com/file/d/1y1WQ3hboWVJ68KEYQQ3OhreGuaUpSgwc/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_vinh_cup_left.txt

@@ -0,0 +1,52 @@
+https://drive.google.com/drive/folders/1dxWh6YFZUDt6qXIoxgD9bla3CiFjZ11C
+https://drive.google.com/file/d/1hNBJN00SCAlOl0ZEgm7RRGbAGDjyBs0p/view?usp=drive_link
+https://drive.google.com/file/d/17He0CVwXGeoMmXg4SHKo-osNn7YPKVL7/view?usp=drive_link
+https://drive.google.com/file/d/1laNKUVID1x2CV6a2O2WQjwFewKu4lidL/view?usp=drive_link
+https://drive.google.com/file/d/1pNf36xbZJGRArYLmNAvRj5y6CoqdC6kB/view?usp=drive_link
+https://drive.google.com/file/d/1_4E1-y3JXk5I0ebycLYM70YDPK9g52gZ/view?usp=drive_link
+https://drive.google.com/file/d/1PHfzhGPdbolKyOpS3FnR2w7Q8zUlJXSk/view?usp=drive_link
+https://drive.google.com/file/d/17ls2PPN-Pi3tEuK059cwV2_iDT8aGhOO/view?usp=drive_link
+https://drive.google.com/file/d/1LWsg6PmCT00Kv_N_slrmcwKmQPGoBT3k/view?usp=drive_link
+https://drive.google.com/file/d/12LckrchoHTUVH7rxi8J7zD9dA19GXvoW/view?usp=drive_link
+https://drive.google.com/file/d/1VqrJKjAIkj5gtFXL69grdSeu9CyaqnSw/view?usp=drive_link
+https://drive.google.com/file/d/1g5rQYDBZvW-kUtYPeyF3qmd53v6k7kXu/view?usp=drive_link
+https://drive.google.com/file/d/10kUgaSJ0TS7teaG83G3Rf_DG4XGrBt6A/view?usp=drive_link
+https://drive.google.com/file/d/1je9XmneZQZvTma5adMJICUPDovW3ppei/view?usp=drive_link
+https://drive.google.com/file/d/1v28r6bedwZGbUPVVTVImXhK-42XdtGfj/view?usp=drive_link
+https://drive.google.com/file/d/1-TEEx9sGVvzMMaNXYfQMtY2JJ6cvl0dT/view?usp=drive_link
+https://drive.google.com/file/d/1YdBKdJFP9rJWBUX7qrOYL_gfUA8o6J9M/view?usp=drive_link
+https://drive.google.com/file/d/1X9vffwQHNUSKLXr2RlYNtbWDIFCIDfdF/view?usp=drive_link
+https://drive.google.com/file/d/11hqesqa5kvEe5FABUnZRcvmOhR373cYM/view?usp=drive_link
+https://drive.google.com/file/d/1ltTTECjEcbQPgS3UPRgMzaE2x9n6H7dC/view?usp=drive_link
+https://drive.google.com/file/d/1Zxqfa29JdwT-bfMpivi6IG2vz34d21dD/view?usp=drive_link
+https://drive.google.com/file/d/11LQlVxS5hz494dYUJ_PNRPx2NHIJbQns/view?usp=drive_link
+https://drive.google.com/file/d/1i1JhNtnZpO_E8rAv8gxBP3ZTZRvcvsZi/view?usp=drive_link
+https://drive.google.com/file/d/11jOXAr2EULUO4Qkm748634lg4UUFho5U/view?usp=drive_link
+https://drive.google.com/file/d/1rj67wur8DdB_Pipwx24bY43xu4X1eQ5e/view?usp=drive_link
+https://drive.google.com/file/d/15ZTm6lO6f_JQy_4SNfrOu3iPYn1Ro8mh/view?usp=drive_link
+https://drive.google.com/file/d/1q4gBtqWPJtCwXEvknGgN0WHGp7Vfn1b9/view?usp=drive_link
+https://drive.google.com/file/d/1t17keyre47AYqm8GgXiQ7EcvcUkeSiDQ/view?usp=drive_link
+https://drive.google.com/file/d/1OYUPGxtZgOF86Ng_BEOTXm_XOYpuQPsO/view?usp=drive_link
+https://drive.google.com/file/d/1cBjbGHi3dwWHtx6r9EQJi0JT_CE3LuHt/view?usp=drive_link
+https://drive.google.com/file/d/14qaMyF0mcbCB-fCYKNyo5_2NahSC6D5u/view?usp=drive_link
+https://drive.google.com/file/d/12FgX86eA7Y5co9ULBVK80XMsiKQSs-Ri/view?usp=drive_link
+https://drive.google.com/file/d/1yvoHWidf-jdBVw6qCCXOFfkVwKj_2hPk/view?usp=drive_link
+https://drive.google.com/file/d/1a2SugsSDlC8UtUrFzp-_KAwyZckQOvdQ/view?usp=drive_link
+https://drive.google.com/file/d/1l8pILBFSAosypWJMza2K09Vm7rug9axm/view?usp=drive_link
+https://drive.google.com/file/d/1hfPQ8dBCk97PnOhq6_MIISm3IEzcOxJG/view?usp=drive_link
+https://drive.google.com/file/d/1PPAUwlJCFKpms8cqF_k1v2_fCgDBOc3S/view?usp=drive_link
+https://drive.google.com/file/d/1lVKQZeqFfK3amEmLuFhYLUFQ2eyE8rOW/view?usp=drive_link
+https://drive.google.com/file/d/1K9iPMLfDowcIFoyzpvgn88dQ6x6kVwNG/view?usp=drive_link
+https://drive.google.com/file/d/1PNvMqG9tL7QxeLaYBGHiWYR6SYb5iIct/view?usp=drive_link
+https://drive.google.com/file/d/1xkRtzbvIkUsylx9hrFLGQsJn0h1EYu-5/view?usp=drive_link
+https://drive.google.com/file/d/1nxMRrJlSayjDIfr5CmHO1NzAw3COhsLi/view?usp=drive_link
+https://drive.google.com/file/d/1Qs3WEyMGrmagiHIkkFEueWNnJhkUeR1s/view?usp=drive_link
+https://drive.google.com/file/d/1D-G2_Q0SS3M8zyJbg_XzkF2ANPw1HTuX/view?usp=drive_link
+https://drive.google.com/file/d/1mdmJsDGO-YtJAOF_yPKl6lq4PJOIbQhT/view?usp=drive_link
+https://drive.google.com/file/d/11m9bwfop_sPmnQr_8amB6EEsrbAeG_z5/view?usp=drive_link
+https://drive.google.com/file/d/19tyYt5FMn5kru0g9o2nMJhKPnsDqkIZv/view?usp=drive_link
+https://drive.google.com/file/d/1XvTpUdsVTZ-vydvdYYmynbma--HfUGSl/view?usp=drive_link
+https://drive.google.com/file/d/1MO3hFu68J6NohTzr9aB_fY02VA6QSOqj/view?usp=drive_link
+https://drive.google.com/file/d/1Lh-UjwAk__04YOTWINF_QGVU8SjetVaY/view?usp=drive_link
+https://drive.google.com/file/d/1jkSOUwZV5GJ7rZlVeErjcu0DBQs8Np0d/view?usp=drive_link
+https://drive.google.com/file/d/1VIN1eLI-93WrVQwCjsv6XQr353DqqBYA/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_aloha_raw_urls/static_ziploc_slide.txt

@@ -0,0 +1,8 @@
+https://drive.google.com/drive/folders/1EgKar7rWBmTIRmeJYZciSwjZx3uP2mHO
+https://drive.google.com/file/d/12eYWQO15atK2hBjXhynPJd9MKAj_42pz/view?usp=drive_link
+https://drive.google.com/file/d/1Ul4oEeICJDjgfYTl4H1uaisTzVYIM6wd/view?usp=drive_link
+https://drive.google.com/file/d/1WSF-OG8lKSe2wVYCv5D1aJNipxpgddk-/view?usp=drive_link
+https://drive.google.com/file/d/1_ppD5j5sFh26aWW0JmhLzJMeNB-lCArk/view?usp=drive_link
+https://drive.google.com/file/d/1WUp846dgWXYhu4oJfhHxiU6YL_7N6s4W/view?usp=drive_link
+https://drive.google.com/file/d/1HRZNAIoAQw_uYiPwnBvtBioQoqiqoXdA/view?usp=drive_link
+https://drive.google.com/file/d/1hedGq-QDMnIn8GlXXBC3GiEJ_Y-LTxyt/view?usp=drive_link

lerobot/common/datasets/push_dataset_to_hub/_diffusion_policy_replay_buffer.py

@@ -1,3 +1,23 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Helper code for loading PushT dataset from Diffusion Policy (https://diffusion-policy.cs.columbia.edu/)
+
+Copied from the original Diffusion Policy repository and used in our `download_and_upload_dataset.py` script.
+"""
+
 from __future__ import annotations
 
 import math

lerobot/common/datasets/push_dataset_to_hub/_download_raw.py

@@ -0,0 +1,202 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+This file contains download scripts for raw datasets.
+
+Example of usage:
+```
+python lerobot/common/datasets/push_dataset_to_hub/_download_raw.py \
+--raw-dir data/lerobot-raw/pusht_raw \
+--repo-id lerobot-raw/pusht_raw
+```
+"""
+
+import argparse
+import logging
+import warnings
+from pathlib import Path
+
+from huggingface_hub import snapshot_download
+
+from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
+
+# {raw_repo_id: raw_format}
+AVAILABLE_RAW_REPO_IDS = {
+    "lerobot-raw/aloha_mobile_cabinet_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_chair_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_elevator_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_shrimp_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_wash_pan_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_mobile_wipe_wine_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_sim_insertion_human_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_sim_insertion_scripted_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_sim_transfer_cube_human_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_sim_transfer_cube_scripted_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_battery_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_candy_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_coffee_new_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_coffee_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_cups_open_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_fork_pick_up_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_pingpong_test_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_pro_pencil_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_screw_driver_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_tape_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_thread_velcro_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_towel_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
+    "lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
+    "lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
+    "lerobot-raw/pusht_raw": "pusht_zarr",
+    "lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
+    "lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
+    "lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
+    "lerobot-raw/unitreeh1_warehouse_raw": "aloha_hdf5",
+    "lerobot-raw/xarm_lift_medium_raw": "xarm_pkl",
+    "lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
+    "lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
+    "lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
+    "lerobot-raw/fractal20220817_data_raw": "openx_rlds.fractal20220817_data",
+    "lerobot-raw/kuka_raw": "openx_rlds.kuka",
+    "lerobot-raw/bridge_openx_raw": "openx_rlds.bridge_openx",
+    "lerobot-raw/taco_play_raw": "openx_rlds.taco_play",
+    "lerobot-raw/jaco_play_raw": "openx_rlds.jaco_play",
+    "lerobot-raw/berkeley_cable_routing_raw": "openx_rlds.berkeley_cable_routing",
+    "lerobot-raw/roboturk_raw": "openx_rlds.roboturk",
+    "lerobot-raw/nyu_door_opening_surprising_effectiveness_raw": "openx_rlds.nyu_door_opening_surprising_effectiveness",
+    "lerobot-raw/viola_raw": "openx_rlds.viola",
+    "lerobot-raw/berkeley_autolab_ur5_raw": "openx_rlds.berkeley_autolab_ur5",
+    "lerobot-raw/toto_raw": "openx_rlds.toto",
+    "lerobot-raw/language_table_raw": "openx_rlds.language_table",
+    "lerobot-raw/columbia_cairlab_pusht_real_raw": "openx_rlds.columbia_cairlab_pusht_real",
+    "lerobot-raw/stanford_kuka_multimodal_dataset_raw": "openx_rlds.stanford_kuka_multimodal_dataset",
+    "lerobot-raw/nyu_rot_dataset_raw": "openx_rlds.nyu_rot_dataset",
+    "lerobot-raw/io_ai_tech_raw": "openx_rlds.io_ai_tech",
+    "lerobot-raw/stanford_hydra_dataset_raw": "openx_rlds.stanford_hydra_dataset",
+    "lerobot-raw/austin_buds_dataset_raw": "openx_rlds.austin_buds_dataset",
+    "lerobot-raw/nyu_franka_play_dataset_raw": "openx_rlds.nyu_franka_play_dataset",
+    "lerobot-raw/maniskill_dataset_raw": "openx_rlds.maniskill_dataset",
+    "lerobot-raw/furniture_bench_dataset_raw": "openx_rlds.furniture_bench_dataset",
+    "lerobot-raw/cmu_franka_exploration_dataset_raw": "openx_rlds.cmu_franka_exploration_dataset",
+    "lerobot-raw/ucsd_kitchen_dataset_raw": "openx_rlds.ucsd_kitchen_dataset",
+    "lerobot-raw/ucsd_pick_and_place_dataset_raw": "openx_rlds.ucsd_pick_and_place_dataset",
+    "lerobot-raw/spoc_raw": "openx_rlds.spoc",
+    "lerobot-raw/austin_sailor_dataset_raw": "openx_rlds.austin_sailor_dataset",
+    "lerobot-raw/austin_sirius_dataset_raw": "openx_rlds.austin_sirius_dataset",
+    "lerobot-raw/bc_z_raw": "openx_rlds.bc_z",
+    "lerobot-raw/utokyo_pr2_opening_fridge_raw": "openx_rlds.utokyo_pr2_opening_fridge",
+    "lerobot-raw/utokyo_pr2_tabletop_manipulation_raw": "openx_rlds.utokyo_pr2_tabletop_manipulation",
+    "lerobot-raw/utokyo_xarm_pick_and_place_raw": "openx_rlds.utokyo_xarm_pick_and_place",
+    "lerobot-raw/utokyo_xarm_bimanual_raw": "openx_rlds.utokyo_xarm_bimanual",
+    "lerobot-raw/utokyo_saytap_raw": "openx_rlds.utokyo_saytap",
+    "lerobot-raw/robo_net_raw": "openx_rlds.robo_net",
+    "lerobot-raw/robo_set_raw": "openx_rlds.robo_set",
+    "lerobot-raw/berkeley_mvp_raw": "openx_rlds.berkeley_mvp",
+    "lerobot-raw/berkeley_rpt_raw": "openx_rlds.berkeley_rpt",
+    "lerobot-raw/kaist_nonprehensile_raw": "openx_rlds.kaist_nonprehensile",
+    "lerobot-raw/stanford_mask_vit_raw": "openx_rlds.stanford_mask_vit",
+    "lerobot-raw/tokyo_u_lsmo_raw": "openx_rlds.tokyo_u_lsmo",
+    "lerobot-raw/dlr_sara_pour_raw": "openx_rlds.dlr_sara_pour",
+    "lerobot-raw/dlr_sara_grid_clamp_raw": "openx_rlds.dlr_sara_grid_clamp",
+    "lerobot-raw/dlr_edan_shared_control_raw": "openx_rlds.dlr_edan_shared_control",
+    "lerobot-raw/asu_table_top_raw": "openx_rlds.asu_table_top",
+    "lerobot-raw/stanford_robocook_raw": "openx_rlds.stanford_robocook",
+    "lerobot-raw/imperialcollege_sawyer_wrist_cam_raw": "openx_rlds.imperialcollege_sawyer_wrist_cam",
+    "lerobot-raw/iamlab_cmu_pickup_insert_raw": "openx_rlds.iamlab_cmu_pickup_insert",
+    "lerobot-raw/uiuc_d3field_raw": "openx_rlds.uiuc_d3field",
+    "lerobot-raw/utaustin_mutex_raw": "openx_rlds.utaustin_mutex",
+    "lerobot-raw/berkeley_fanuc_manipulation_raw": "openx_rlds.berkeley_fanuc_manipulation",
+    "lerobot-raw/cmu_playing_with_food_raw": "openx_rlds.cmu_playing_with_food",
+    "lerobot-raw/cmu_play_fusion_raw": "openx_rlds.cmu_play_fusion",
+    "lerobot-raw/cmu_stretch_raw": "openx_rlds.cmu_stretch",
+    "lerobot-raw/berkeley_gnm_recon_raw": "openx_rlds.berkeley_gnm_recon",
+    "lerobot-raw/berkeley_gnm_cory_hall_raw": "openx_rlds.berkeley_gnm_cory_hall",
+    "lerobot-raw/berkeley_gnm_sac_son_raw": "openx_rlds.berkeley_gnm_sac_son",
+    "lerobot-raw/droid_raw": "openx_rlds.droid",
+    "lerobot-raw/droid_100_raw": "openx_rlds.droid100",
+    "lerobot-raw/fmb_raw": "openx_rlds.fmb",
+    "lerobot-raw/dobbe_raw": "openx_rlds.dobbe",
+    "lerobot-raw/usc_cloth_sim_raw": "openx_rlds.usc_cloth_sim",
+    "lerobot-raw/plex_robosuite_raw": "openx_rlds.plex_robosuite",
+    "lerobot-raw/conq_hose_manipulation_raw": "openx_rlds.conq_hose_manipulation",
+    "lerobot-raw/vima_raw": "openx_rlds.vima",
+    "lerobot-raw/robot_vqa_raw": "openx_rlds.robot_vqa",
+    "lerobot-raw/mimic_play_raw": "openx_rlds.mimic_play",
+    "lerobot-raw/tidybot_raw": "openx_rlds.tidybot",
+    "lerobot-raw/eth_agent_affordances_raw": "openx_rlds.eth_agent_affordances",
+}
+
+
+def download_raw(raw_dir: Path, repo_id: str):
+    check_repo_id(repo_id)
+    user_id, dataset_id = repo_id.split("/")
+
+    if not dataset_id.endswith("_raw"):
+        warnings.warn(
+            f"""`dataset_id` ({dataset_id}) doesn't end with '_raw' (e.g. 'lerobot/pusht_raw'). Following this
+             naming convention by renaming your repository is advised, but not mandatory.""",
+            stacklevel=1,
+        )
+
+    # Send warning if raw_dir isn't well formated
+    if raw_dir.parts[-2] != user_id or raw_dir.parts[-1] != dataset_id:
+        warnings.warn(
+            f"""`raw_dir` ({raw_dir}) doesn't contain a community or user id `/` the name of the dataset that
+             match the `repo_id` (e.g. 'data/lerobot/pusht_raw'). Following this naming convention is advised,
+             but not mandatory.""",
+            stacklevel=1,
+        )
+    raw_dir.mkdir(parents=True, exist_ok=True)
+
+    logging.info(f"Start downloading from huggingface.co/{user_id} for {dataset_id}")
+    snapshot_download(repo_id, repo_type="dataset", local_dir=raw_dir)
+    logging.info(f"Finish downloading from huggingface.co/{user_id} for {dataset_id}")
+
+
+def download_all_raw_datasets(data_dir: Path | None = None):
+    if data_dir is None:
+        data_dir = Path("data")
+    for repo_id in AVAILABLE_RAW_REPO_IDS:
+        raw_dir = data_dir / repo_id
+        download_raw(raw_dir, repo_id)
+
+
+def main():
+    parser = argparse.ArgumentParser(
+        description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
+            non exhaustive list of available repositories to use in `--repo-id`: {list(AVAILABLE_RAW_REPO_IDS.keys())}""",
+    )
+
+    parser.add_argument(
+        "--raw-dir",
+        type=Path,
+        required=True,
+        help="Directory containing input raw datasets (e.g. `data/aloha_mobile_chair_raw` or `data/pusht_raw).",
+    )
+    parser.add_argument(
+        "--repo-id",
+        type=str,
+        required=True,
+        help="""Repositery identifier on Hugging Face: a community or a user name `/` the name of
+        the dataset (e.g. `lerobot/pusht_raw`, `cadene/aloha_sim_insertion_human_raw`).""",
+    )
+    args = parser.parse_args()
+    download_raw(**vars(args))
+
+
+if __name__ == "__main__":
+    main()

lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py

@@ -0,0 +1,184 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Use this script to batch encode lerobot dataset from their raw format to LeRobotDataset and push their updated
+version to the hub. Under the hood, this script reuses 'push_dataset_to_hub.py'. It assumes that you already
+downloaded raw datasets, which you can do with the related '_download_raw.py' script.
+
+For instance, for codebase_version = 'v1.6', the following command was run, assuming raw datasets from
+lerobot-raw were downloaded in 'raw/datasets/directory':
+```bash
+python lerobot/common/datasets/push_dataset_to_hub/_encode_datasets.py \
+  --raw-dir raw/datasets/directory \
+  --raw-repo-ids lerobot-raw \
+  --local-dir push/datasets/directory \
+  --tests-data-dir tests/data \
+  --push-repo lerobot \
+  --vcodec libsvtav1 \
+  --pix-fmt yuv420p \
+  --g 2 \
+  --crf 30
+```
+"""
+
+import argparse
+from pathlib import Path
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub._download_raw import AVAILABLE_RAW_REPO_IDS
+from lerobot.common.datasets.push_dataset_to_hub.utils import check_repo_id
+from lerobot.scripts.push_dataset_to_hub import push_dataset_to_hub
+
+
+def get_push_repo_id_from_raw(raw_repo_id: str, push_repo: str) -> str:
+    dataset_id_raw = raw_repo_id.split("/")[1]
+    dataset_id = dataset_id_raw.removesuffix("_raw")
+    return f"{push_repo}/{dataset_id}"
+
+
+def encode_datasets(
+    raw_dir: Path,
+    raw_repo_ids: list[str],
+    push_repo: str,
+    vcodec: str,
+    pix_fmt: str,
+    g: int,
+    crf: int,
+    local_dir: Path | None = None,
+    tests_data_dir: Path | None = None,
+    raw_format: str | None = None,
+    dry_run: bool = False,
+) -> None:
+    if len(raw_repo_ids) == 1 and raw_repo_ids[0].lower() == "lerobot-raw":
+        raw_repo_ids_format = AVAILABLE_RAW_REPO_IDS
+    else:
+        if raw_format is None:
+            raise ValueError(raw_format)
+        raw_repo_ids_format = {id_: raw_format for id_ in raw_repo_ids}
+
+    for raw_repo_id, repo_raw_format in raw_repo_ids_format.items():
+        check_repo_id(raw_repo_id)
+        dataset_repo_id_push = get_push_repo_id_from_raw(raw_repo_id, push_repo)
+        dataset_raw_dir = raw_dir / raw_repo_id
+        dataset_dir = local_dir / dataset_repo_id_push if local_dir is not None else None
+        encoding = {
+            "vcodec": vcodec,
+            "pix_fmt": pix_fmt,
+            "g": g,
+            "crf": crf,
+        }
+
+        if not (dataset_raw_dir).is_dir():
+            raise NotADirectoryError(dataset_raw_dir)
+
+        if not dry_run:
+            push_dataset_to_hub(
+                dataset_raw_dir,
+                raw_format=repo_raw_format,
+                repo_id=dataset_repo_id_push,
+                local_dir=dataset_dir,
+                resume=True,
+                encoding=encoding,
+                tests_data_dir=tests_data_dir,
+            )
+        else:
+            print(
+                f"DRY RUN: {dataset_raw_dir}  -->  {dataset_dir}  -->  {dataset_repo_id_push}@{CODEBASE_VERSION}"
+            )
+
+
+def main():
+    parser = argparse.ArgumentParser()
+    parser.add_argument(
+        "--raw-dir",
+        type=Path,
+        default=Path("data"),
+        help="Directory where raw datasets are located.",
+    )
+    parser.add_argument(
+        "--raw-repo-ids",
+        type=str,
+        nargs="*",
+        default=["lerobot-raw"],
+        help="""Raw dataset repo ids. if 'lerobot-raw', the keys from `AVAILABLE_RAW_REPO_IDS` will be
+            used and raw datasets will be fetched from the 'lerobot-raw/' repo and pushed with their
+            associated format. It is assumed that each dataset is located at `raw_dir / raw_repo_id` """,
+    )
+    parser.add_argument(
+        "--raw-format",
+        type=str,
+        default=None,
+        help="""Raw format to use for the raw repo-ids. Must be specified if --raw-repo-ids is not
+            'lerobot-raw'""",
+    )
+    parser.add_argument(
+        "--local-dir",
+        type=Path,
+        default=None,
+        help="""When provided, writes the dataset converted to LeRobotDataset format in this directory
+        (e.g. `data/lerobot/aloha_mobile_chair`).""",
+    )
+    parser.add_argument(
+        "--push-repo",
+        type=str,
+        default="lerobot",
+        help="Repo to upload datasets to",
+    )
+    parser.add_argument(
+        "--vcodec",
+        type=str,
+        default="libsvtav1",
+        help="Codec to use for encoding videos",
+    )
+    parser.add_argument(
+        "--pix-fmt",
+        type=str,
+        default="yuv420p",
+        help="Pixel formats (chroma subsampling) to be used for encoding",
+    )
+    parser.add_argument(
+        "--g",
+        type=int,
+        default=2,
+        help="Group of pictures sizes to be used for encoding.",
+    )
+    parser.add_argument(
+        "--crf",
+        type=int,
+        default=30,
+        help="Constant rate factors to be used for encoding.",
+    )
+    parser.add_argument(
+        "--tests-data-dir",
+        type=Path,
+        default=None,
+        help=(
+            "When provided, save tests artifacts into the given directory "
+            "(e.g. `--tests-data-dir tests/data` will save to tests/data/{--repo-id})."
+        ),
+    )
+    parser.add_argument(
+        "--dry-run",
+        type=int,
+        default=0,
+        help="If not set to 0, this script won't download or upload anything.",
+    )
+    args = parser.parse_args()
+    encode_datasets(**vars(args))
+
+
+if __name__ == "__main__":
+    main()

lerobot/common/datasets/push_dataset_to_hub/_umi_imagecodecs_numcodecs.py

@@ -0,0 +1,326 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+# imagecodecs/numcodecs.py
+
+# Copyright (c) 2021-2022, Christoph Gohlke
+# All rights reserved.
+#
+# Redistribution and use in source and binary forms, with or without
+# modification, are permitted provided that the following conditions are met:
+#
+# 1. Redistributions of source code must retain the above copyright notice,
+#    this list of conditions and the following disclaimer.
+#
+# 2. Redistributions in binary form must reproduce the above copyright notice,
+#    this list of conditions and the following disclaimer in the documentation
+#    and/or other materials provided with the distribution.
+#
+# 3. Neither the name of the copyright holder nor the names of its
+#    contributors may be used to endorse or promote products derived from
+#    this software without specific prior written permission.
+#
+# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+# ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE
+# LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+# CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+# SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
+# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+# ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+# POSSIBILITY OF SUCH DAMAGE.
+
+# Copied from: https://github.com/real-stanford/universal_manipulation_interface/blob/298776ce251f33b6b3185a98d6e7d1f9ad49168b/diffusion_policy/codecs/imagecodecs_numcodecs.py#L1
+"""Additional numcodecs implemented using imagecodecs."""
+
+__version__ = "2022.9.26"
+
+__all__ = ("register_codecs",)
+
+import imagecodecs
+import numpy
+from numcodecs.abc import Codec
+from numcodecs.registry import get_codec, register_codec
+
+# TODO (azouitine): Remove useless codecs
+
+
+def protective_squeeze(x: numpy.ndarray):
+    """
+    Squeeze dim only if it's not the last dim.
+    Image dim expected to be *, H, W, C
+    """
+    img_shape = x.shape[-3:]
+    if len(x.shape) > 3:
+        n_imgs = numpy.prod(x.shape[:-3])
+        if n_imgs > 1:
+            img_shape = (-1,) + img_shape
+    return x.reshape(img_shape)
+
+
+def get_default_image_compressor(**kwargs):
+    if imagecodecs.JPEGXL:
+        # has JPEGXL
+        this_kwargs = {
+            "effort": 3,
+            "distance": 0.3,
+            # bug in libjxl, invalid codestream for non-lossless
+            # when decoding speed > 1
+            "decodingspeed": 1,
+        }
+        this_kwargs.update(kwargs)
+        return JpegXl(**this_kwargs)
+    else:
+        this_kwargs = {"level": 50}
+        this_kwargs.update(kwargs)
+        return Jpeg2k(**this_kwargs)
+
+
+class Jpeg2k(Codec):
+    """JPEG 2000 codec for numcodecs."""
+
+    codec_id = "imagecodecs_jpeg2k"
+
+    def __init__(
+        self,
+        level=None,
+        codecformat=None,
+        colorspace=None,
+        tile=None,
+        reversible=None,
+        bitspersample=None,
+        resolutions=None,
+        numthreads=None,
+        verbose=0,
+    ):
+        self.level = level
+        self.codecformat = codecformat
+        self.colorspace = colorspace
+        self.tile = None if tile is None else tuple(tile)
+        self.reversible = reversible
+        self.bitspersample = bitspersample
+        self.resolutions = resolutions
+        self.numthreads = numthreads
+        self.verbose = verbose
+
+    def encode(self, buf):
+        buf = protective_squeeze(numpy.asarray(buf))
+        return imagecodecs.jpeg2k_encode(
+            buf,
+            level=self.level,
+            codecformat=self.codecformat,
+            colorspace=self.colorspace,
+            tile=self.tile,
+            reversible=self.reversible,
+            bitspersample=self.bitspersample,
+            resolutions=self.resolutions,
+            numthreads=self.numthreads,
+            verbose=self.verbose,
+        )
+
+    def decode(self, buf, out=None):
+        return imagecodecs.jpeg2k_decode(buf, verbose=self.verbose, numthreads=self.numthreads, out=out)
+
+
+class JpegXl(Codec):
+    """JPEG XL codec for numcodecs."""
+
+    codec_id = "imagecodecs_jpegxl"
+
+    def __init__(
+        self,
+        # encode
+        level=None,
+        effort=None,
+        distance=None,
+        lossless=None,
+        decodingspeed=None,
+        photometric=None,
+        planar=None,
+        usecontainer=None,
+        # decode
+        index=None,
+        keeporientation=None,
+        # both
+        numthreads=None,
+    ):
+        """
+        Return JPEG XL image from numpy array.
+        Float must be in nominal range 0..1.
+
+        Currently L, LA, RGB, RGBA images are supported in contig mode.
+        Extra channels are only supported for grayscale images in planar mode.
+
+        Parameters
+        ----------
+        level : Default to None, i.e. not overwriting lossess and decodingspeed options.
+            When < 0: Use lossless compression
+            When in [0,1,2,3,4]: Sets the decoding speed tier for the provided options.
+                Minimum is 0 (slowest to decode, best quality/density), and maximum
+                is 4 (fastest to decode, at the cost of some quality/density).
+        effort : Default to 3.
+            Sets encoder effort/speed level without affecting decoding speed.
+            Valid values are, from faster to slower speed: 1:lightning 2:thunder
+                3:falcon 4:cheetah 5:hare 6:wombat 7:squirrel 8:kitten 9:tortoise.
+            Speed: lightning, thunder, falcon, cheetah, hare, wombat, squirrel, kitten, tortoise
+            control the encoder effort in ascending order.
+            This also affects memory usage: using lower effort will typically reduce memory
+            consumption during encoding.
+            lightning and thunder are fast modes useful for lossless mode (modular).
+            falcon disables all of the following tools.
+            cheetah enables coefficient reordering, context clustering, and heuristics for selecting DCT sizes and quantization steps.
+            hare enables Gaborish filtering, chroma from luma, and an initial estimate of quantization steps.
+            wombat enables error diffusion quantization and full DCT size selection heuristics.
+            squirrel (default) enables dots, patches, and spline detection, and full context clustering.
+            kitten optimizes the adaptive quantization for a psychovisual metric.
+            tortoise enables a more thorough adaptive quantization search.
+        distance : Default to 1.0
+            Sets the distance level for lossy compression: target max butteraugli distance,
+            lower = higher quality. Range: 0 .. 15. 0.0 = mathematically lossless
+            (however, use JxlEncoderSetFrameLossless instead to use true lossless,
+            as setting distance to 0 alone is not the only requirement).
+            1.0 = visually lossless. Recommended range: 0.5 .. 3.0.
+        lossess : Default to False.
+            Use lossess encoding.
+        decodingspeed : Default to 0.
+            Duplicate to level. [0,4]
+        photometric : Return JxlColorSpace value.
+            Default logic is quite complicated but works most of the time.
+            Accepted value:
+                int: [-1,3]
+                str: ['RGB',
+                    'WHITEISZERO', 'MINISWHITE',
+                    'BLACKISZERO', 'MINISBLACK', 'GRAY',
+                    'XYB', 'KNOWN']
+        planar : Enable multi-channel mode.
+            Default to false.
+        usecontainer :
+            Forces the encoder to use the box-based container format (BMFF)
+            even when not necessary.
+            When using JxlEncoderUseBoxes, JxlEncoderStoreJPEGMetadata or
+            JxlEncoderSetCodestreamLevel with level 10, the encoder will
+            automatically also use the container format, it is not necessary
+            to use JxlEncoderUseContainer for those use cases.
+            By default this setting is disabled.
+        index : Selectively decode frames for animation.
+            Default to 0, decode all frames.
+            When set to > 0, decode that frame index only.
+        keeporientation :
+            Enables or disables preserving of as-in-bitstream pixeldata orientation.
+            Some images are encoded with an Orientation tag indicating that the
+            decoder must perform a rotation and/or mirroring to the encoded image data.
+
+            If skip_reorientation is JXL_FALSE (the default): the decoder will apply
+            the transformation from the orientation setting, hence rendering the image
+            according to its specified intent. When producing a JxlBasicInfo, the decoder
+            will always set the orientation field to JXL_ORIENT_IDENTITY (matching the
+            returned pixel data) and also align xsize and ysize so that they correspond
+            to the width and the height of the returned pixel data.
+
+            If skip_reorientation is JXL_TRUE: the decoder will skip applying the
+            transformation from the orientation setting, returning the image in
+            the as-in-bitstream pixeldata orientation. This may be faster to decode
+            since the decoder doesnt have to apply the transformation, but can
+            cause wrong display of the image if the orientation tag is not correctly
+            taken into account by the user.
+
+            By default, this option is disabled, and the returned pixel data is
+            re-oriented according to the images Orientation setting.
+        threads : Default to 1.
+            If <= 0, use all cores.
+            If > 32, clipped to 32.
+        """
+
+        self.level = level
+        self.effort = effort
+        self.distance = distance
+        self.lossless = bool(lossless)
+        self.decodingspeed = decodingspeed
+        self.photometric = photometric
+        self.planar = planar
+        self.usecontainer = usecontainer
+        self.index = index
+        self.keeporientation = keeporientation
+        self.numthreads = numthreads
+
+    def encode(self, buf):
+        # TODO: only squeeze all but last dim
+        buf = protective_squeeze(numpy.asarray(buf))
+        return imagecodecs.jpegxl_encode(
+            buf,
+            level=self.level,
+            effort=self.effort,
+            distance=self.distance,
+            lossless=self.lossless,
+            decodingspeed=self.decodingspeed,
+            photometric=self.photometric,
+            planar=self.planar,
+            usecontainer=self.usecontainer,
+            numthreads=self.numthreads,
+        )
+
+    def decode(self, buf, out=None):
+        return imagecodecs.jpegxl_decode(
+            buf,
+            index=self.index,
+            keeporientation=self.keeporientation,
+            numthreads=self.numthreads,
+            out=out,
+        )
+
+
+def _flat(out):
+    """Return numpy array as contiguous view of bytes if possible."""
+    if out is None:
+        return None
+    view = memoryview(out)
+    if view.readonly or not view.contiguous:
+        return None
+    return view.cast("B")
+
+
+def register_codecs(codecs=None, force=False, verbose=True):
+    """Register codecs in this module with numcodecs."""
+    for name, cls in globals().items():
+        if not hasattr(cls, "codec_id") or name == "Codec":
+            continue
+        if codecs is not None and cls.codec_id not in codecs:
+            continue
+        try:
+            try:  # noqa: SIM105
+                get_codec({"id": cls.codec_id})
+            except TypeError:
+                # registered, but failed
+                pass
+        except ValueError:
+            # not registered yet
+            pass
+        else:
+            if not force:
+                if verbose:
+                    log_warning(f"numcodec {cls.codec_id!r} already registered")
+                continue
+            if verbose:
+                log_warning(f"replacing registered numcodec {cls.codec_id!r}")
+        register_codec(cls)
+
+
+def log_warning(msg, *args, **kwargs):
+    """Log message with level WARNING."""
+    import logging
+
+    logging.getLogger(__name__).warning(msg, *args, **kwargs)

lerobot/common/datasets/push_dataset_to_hub/aloha_hdf5_format.py

@@ -0,0 +1,233 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Contains utilities to process raw data format of HDF5 files like in: https://github.com/tonyzhaozh/act
+"""
+
+import gc
+import shutil
+from pathlib import Path
+
+import h5py
+import numpy as np
+import torch
+import tqdm
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    calculate_episode_data_index,
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+
+def get_cameras(hdf5_data):
+    # ignore depth channel, not currently handled
+    # TODO(rcadene): add depth
+    rgb_cameras = [key for key in hdf5_data["/observations/images"].keys() if "depth" not in key]  # noqa: SIM118
+    return rgb_cameras
+
+
+def check_format(raw_dir) -> bool:
+    # only frames from simulation are uncompressed
+    compressed_images = "sim" not in raw_dir.name
+
+    hdf5_paths = list(raw_dir.glob("episode_*.hdf5"))
+    assert len(hdf5_paths) != 0
+    for hdf5_path in hdf5_paths:
+        with h5py.File(hdf5_path, "r") as data:
+            assert "/action" in data
+            assert "/observations/qpos" in data
+
+            assert data["/action"].ndim == 2
+            assert data["/observations/qpos"].ndim == 2
+
+            num_frames = data["/action"].shape[0]
+            assert num_frames == data["/observations/qpos"].shape[0]
+
+            for camera in get_cameras(data):
+                assert num_frames == data[f"/observations/images/{camera}"].shape[0]
+
+                if compressed_images:
+                    assert data[f"/observations/images/{camera}"].ndim == 2
+                else:
+                    assert data[f"/observations/images/{camera}"].ndim == 4
+                    b, h, w, c = data[f"/observations/images/{camera}"].shape
+                    assert c < h and c < w, f"Expect (h,w,c) image format but ({h=},{w=},{c=}) provided."
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # only frames from simulation are uncompressed
+    compressed_images = "sim" not in raw_dir.name
+
+    hdf5_files = sorted(raw_dir.glob("episode_*.hdf5"))
+    num_episodes = len(hdf5_files)
+
+    ep_dicts = []
+    ep_ids = episodes if episodes else range(num_episodes)
+    for ep_idx in tqdm.tqdm(ep_ids):
+        ep_path = hdf5_files[ep_idx]
+        with h5py.File(ep_path, "r") as ep:
+            num_frames = ep["/action"].shape[0]
+
+            # last step of demonstration is considered done
+            done = torch.zeros(num_frames, dtype=torch.bool)
+            done[-1] = True
+
+            state = torch.from_numpy(ep["/observations/qpos"][:])
+            action = torch.from_numpy(ep["/action"][:])
+            if "/observations/qvel" in ep:
+                velocity = torch.from_numpy(ep["/observations/qvel"][:])
+            if "/observations/effort" in ep:
+                effort = torch.from_numpy(ep["/observations/effort"][:])
+
+            ep_dict = {}
+
+            for camera in get_cameras(ep):
+                img_key = f"observation.images.{camera}"
+
+                if compressed_images:
+                    import cv2
+
+                    # load one compressed image after the other in RAM and uncompress
+                    imgs_array = []
+                    for data in ep[f"/observations/images/{camera}"]:
+                        imgs_array.append(cv2.imdecode(data, 1))
+                    imgs_array = np.array(imgs_array)
+
+                else:
+                    # load all images in RAM
+                    imgs_array = ep[f"/observations/images/{camera}"][:]
+
+                if video:
+                    # save png images in temporary directory
+                    tmp_imgs_dir = videos_dir / "tmp_images"
+                    save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                    # encode images to a mp4 video
+                    fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                    video_path = videos_dir / fname
+                    encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                    # clean temporary images directory
+                    shutil.rmtree(tmp_imgs_dir)
+
+                    # store the reference to the video frame
+                    ep_dict[img_key] = [
+                        {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                    ]
+                else:
+                    ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+            ep_dict["observation.state"] = state
+            if "/observations/velocity" in ep:
+                ep_dict["observation.velocity"] = velocity
+            if "/observations/effort" in ep:
+                ep_dict["observation.effort"] = effort
+            ep_dict["action"] = action
+            ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
+            ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+            ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+            ep_dict["next.done"] = done
+            # TODO(rcadene): add reward and success by computing them in sim
+
+            assert isinstance(ep_idx, int)
+            ep_dicts.append(ep_dict)
+
+        gc.collect()
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+
+    keys = [key for key in data_dict if "observation.images." in key]
+    for key in keys:
+        if video:
+            features[key] = VideoFrame()
+        else:
+            features[key] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    if "observation.velocity" in data_dict:
+        features["observation.velocity"] = Sequence(
+            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    if "observation.effort" in data_dict:
+        features["observation.effort"] = Sequence(
+            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 50
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/cam_png_format.py

@@ -0,0 +1,104 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Contains utilities to process raw data format of png images files recorded with capture_camera_feed.py
+"""
+
+from pathlib import Path
+
+import torch
+from datasets import Dataset, Features, Image, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import concatenate_episodes
+from lerobot.common.datasets.utils import calculate_episode_data_index, hf_transform_to_torch
+from lerobot.common.datasets.video_utils import VideoFrame
+
+
+def check_format(raw_dir: Path) -> bool:
+    image_paths = list(raw_dir.glob("frame_*.png"))
+    if len(image_paths) == 0:
+        raise ValueError
+
+
+def load_from_raw(raw_dir: Path, fps: int, episodes: list[int] | None = None):
+    if episodes is not None:
+        # TODO(aliberts): add support for multi-episodes.
+        raise NotImplementedError()
+
+    ep_dict = {}
+    ep_idx = 0
+
+    image_paths = sorted(raw_dir.glob("frame_*.png"))
+    num_frames = len(image_paths)
+
+    ep_dict["observation.image"] = [PILImage.open(x) for x in image_paths]
+    ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
+    ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+    ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+
+    ep_dicts = [ep_dict]
+    data_dict = concatenate_episodes(ep_dicts)
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+    if video:
+        features["observation.image"] = VideoFrame()
+    else:
+        features["observation.image"] = Image()
+
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    if video or episodes or encoding is not None:
+        # TODO(aliberts): support this
+        raise NotImplementedError
+
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 30
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/dora_parquet_format.py

@@ -0,0 +1,233 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Contains utilities to process raw data format from dora-record
+"""
+
+import re
+import warnings
+from pathlib import Path
+
+import pandas as pd
+import torch
+from datasets import Dataset, Features, Image, Sequence, Value
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.utils import (
+    calculate_episode_data_index,
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame
+
+
+def check_format(raw_dir) -> bool:
+    assert raw_dir.exists()
+
+    leader_file = list(raw_dir.glob("*.parquet"))
+    if len(leader_file) == 0:
+        raise ValueError(f"Missing parquet files in '{raw_dir}'")
+    return True
+
+
+def load_from_raw(raw_dir: Path, videos_dir: Path, fps: int, video: bool, episodes: list[int] | None = None):
+    # Load data stream that will be used as reference for the timestamps synchronization
+    reference_files = list(raw_dir.glob("observation.images.cam_*.parquet"))
+    if len(reference_files) == 0:
+        raise ValueError(f"Missing reference files for camera, starting with  in '{raw_dir}'")
+    # select first camera in alphanumeric order
+    reference_key = sorted(reference_files)[0].stem
+    reference_df = pd.read_parquet(raw_dir / f"{reference_key}.parquet")
+    reference_df = reference_df[["timestamp_utc", reference_key]]
+
+    # Merge all data stream using nearest backward strategy
+    df = reference_df
+    for path in raw_dir.glob("*.parquet"):
+        key = path.stem  # action or observation.state or ...
+        if key == reference_key:
+            continue
+        if "failed_episode_index" in key:
+            # TODO(rcadene): add support for removing episodes that are tagged as "failed"
+            continue
+        modality_df = pd.read_parquet(path)
+        modality_df = modality_df[["timestamp_utc", key]]
+        df = pd.merge_asof(
+            df,
+            modality_df,
+            on="timestamp_utc",
+            # "nearest" is the best option over "backward", since the latter can desynchronizes camera timestamps by
+            # matching timestamps that are too far appart, in order to fit the backward constraints. It's not the case for "nearest".
+            # However, note that "nearest" might synchronize the reference camera with other cameras on slightly future timestamps.
+            # are too far appart.
+            direction="nearest",
+            tolerance=pd.Timedelta(f"{1/fps} seconds"),
+        )
+    # Remove rows with episode_index -1 which indicates data that correspond to in-between episodes
+    df = df[df["episode_index"] != -1]
+
+    image_keys = [key for key in df if "observation.images." in key]
+
+    def get_episode_index(row):
+        episode_index_per_cam = {}
+        for key in image_keys:
+            path = row[key][0]["path"]
+            match = re.search(r"_(\d{6}).mp4", path)
+            if not match:
+                raise ValueError(path)
+            episode_index = int(match.group(1))
+            episode_index_per_cam[key] = episode_index
+        if len(set(episode_index_per_cam.values())) != 1:
+            raise ValueError(
+                f"All cameras are expected to belong to the same episode, but getting {episode_index_per_cam}"
+            )
+        return episode_index
+
+    df["episode_index"] = df.apply(get_episode_index, axis=1)
+
+    # dora only use arrays, so single values are encapsulated into a list
+    df["frame_index"] = df.groupby("episode_index").cumcount()
+    df = df.reset_index()
+    df["index"] = df.index
+
+    # set 'next.done' to True for the last frame of each episode
+    df["next.done"] = False
+    df.loc[df.groupby("episode_index").tail(1).index, "next.done"] = True
+
+    df["timestamp"] = df["timestamp_utc"].map(lambda x: x.timestamp())
+    # each episode starts with timestamp 0 to match the ones from the video
+    df["timestamp"] = df.groupby("episode_index")["timestamp"].transform(lambda x: x - x.iloc[0])
+
+    del df["timestamp_utc"]
+
+    # sanity check
+    has_nan = df.isna().any().any()
+    if has_nan:
+        raise ValueError("Dataset contains Nan values.")
+
+    # sanity check episode indices go from 0 to n-1
+    ep_ids = [ep_idx for ep_idx, _ in df.groupby("episode_index")]
+    expected_ep_ids = list(range(df["episode_index"].max() + 1))
+    if ep_ids != expected_ep_ids:
+        raise ValueError(f"Episodes indices go from {ep_ids} instead of {expected_ep_ids}")
+
+    # Create symlink to raw videos directory (that needs to be absolute not relative)
+    videos_dir.parent.mkdir(parents=True, exist_ok=True)
+    videos_dir.symlink_to((raw_dir / "videos").absolute())
+
+    # sanity check the video paths are well formated
+    for key in df:
+        if "observation.images." not in key:
+            continue
+        for ep_idx in ep_ids:
+            video_path = videos_dir / f"{key}_episode_{ep_idx:06d}.mp4"
+            if not video_path.exists():
+                raise ValueError(f"Video file not found in {video_path}")
+
+    data_dict = {}
+    for key in df:
+        # is video frame
+        if "observation.images." in key:
+            # we need `[0] because dora only use arrays, so single values are encapsulated into a list.
+            # it is the case for video_frame dictionary = [{"path": ..., "timestamp": ...}]
+            data_dict[key] = [video_frame[0] for video_frame in df[key].values]
+
+            # sanity check the video path is well formated
+            video_path = videos_dir.parent / data_dict[key][0]["path"]
+            if not video_path.exists():
+                raise ValueError(f"Video file not found in {video_path}")
+        # is number
+        elif df[key].iloc[0].ndim == 0 or df[key].iloc[0].shape[0] == 1:
+            data_dict[key] = torch.from_numpy(df[key].values)
+        # is vector
+        elif df[key].iloc[0].shape[0] > 1:
+            data_dict[key] = torch.stack([torch.from_numpy(x.copy()) for x in df[key].values])
+        else:
+            raise ValueError(key)
+
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+
+    keys = [key for key in data_dict if "observation.images." in key]
+    for key in keys:
+        if video:
+            features[key] = VideoFrame()
+        else:
+            features[key] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    if "observation.velocity" in data_dict:
+        features["observation.velocity"] = Sequence(
+            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    if "observation.effort" in data_dict:
+        features["observation.effort"] = Sequence(
+            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 30
+    else:
+        raise NotImplementedError()
+
+    if not video:
+        raise NotImplementedError()
+
+    if encoding is not None:
+        warnings.warn(
+            "Video encoding is currently done outside of LeRobot for the dora_parquet format.",
+            stacklevel=1,
+        )
+
+    data_df = load_from_raw(raw_dir, videos_dir, fps, episodes)
+    hf_dataset = to_hf_dataset(data_df, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = "unknown"
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml

@@ -0,0 +1,639 @@
+OPENX_DATASET_CONFIGS:
+  fractal20220817_data:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - base_pose_tool_reached
+      - gripper_closed
+    fps: 3
+
+  kuka:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - clip_function_input/base_pose_tool_reached
+      - gripper_closed
+    fps: 10
+
+  bridge_openx:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - EEF_state
+      - gripper_state
+    fps: 5
+
+  taco_play:
+    image_obs_keys:
+      - rgb_static
+      - rgb_gripper
+    depth_obs_keys:
+      - depth_static
+      - depth_gripper
+    state_obs_keys:
+      - state_eef
+      - state_gripper
+    fps: 15
+
+  jaco_play:
+    image_obs_keys:
+      - image
+      - image_wrist
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state_eef
+      - state_gripper
+    fps: 10
+
+  berkeley_cable_routing:
+    image_obs_keys:
+      - image
+      - top_image
+      - wrist45_image
+      - wrist225_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - robot_state
+    fps: 10
+
+  roboturk:
+    image_obs_keys:
+      - front_rgb
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 10
+
+  nyu_door_opening_surprising_effectiveness:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 3
+
+  viola:
+    image_obs_keys:
+      - agentview_rgb
+      - eye_in_hand_rgb
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_states
+      - gripper_states
+    fps: 20
+
+  berkeley_autolab_ur5:
+    image_obs_keys:
+      - image
+      - hand_image
+    depth_obs_keys:
+      - image_with_depth
+    state_obs_keys:
+      - state
+    fps: 5
+
+  toto:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 30
+
+  language_table:
+    image_obs_keys:
+      - rgb
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - effector_translation
+    fps: 10
+
+  columbia_cairlab_pusht_real:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - robot_state
+    fps: 10
+
+  stanford_kuka_multimodal_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - depth_image
+    state_obs_keys:
+      - ee_position
+      - ee_orientation
+    fps: 20
+
+  nyu_rot_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 3
+
+  io_ai_tech:
+    image_obs_keys:
+      - image
+      - image_fisheye
+      - image_left_side
+      - image_right_side
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 3
+
+  stanford_hydra_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+
+  austin_buds_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+
+  nyu_franka_play_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - image_additional_view
+    depth_obs_keys:
+      - depth
+      - depth_additional_view
+    state_obs_keys:
+      - eef_state
+    fps: 3
+
+  maniskill_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - depth
+      - wrist_depth
+    state_obs_keys:
+      - tcp_pose
+      - gripper_state
+    fps: 20
+
+  furniture_bench_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+
+  cmu_franka_exploration_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - highres_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 10
+
+  ucsd_kitchen_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_state
+    fps: 2
+
+  ucsd_pick_and_place_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 3
+
+  spoc:
+    image_obs_keys:
+      - image
+      - image_manipulation
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 3
+
+  austin_sailor_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+
+  austin_sirius_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+
+  bc_z:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - present/xyz
+      - present/axis_angle
+      - present/sensed_close
+    fps: 10
+
+  utokyo_pr2_opening_fridge_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+
+  utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+
+  utokyo_xarm_pick_and_place_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - image2
+      - hand_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - end_effector_pose
+    fps: 10
+
+  utokyo_xarm_bimanual_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - pose_r
+    fps: 10
+
+  robo_net:
+    image_obs_keys:
+      - image
+      - image1
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 1
+
+  robo_set:
+    image_obs_keys:
+      - image_left
+      - image_right
+      - image_wrist
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+      - state_velocity
+    fps: 5
+
+  berkeley_mvp_converted_externally_to_rlds:
+    image_obs_keys:
+      - hand_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - gripper
+      - pose
+      - joint_pos
+    fps: 5
+
+  berkeley_rpt_converted_externally_to_rlds:
+    image_obs_keys:
+      - hand_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_pos
+      - gripper
+    fps: 30
+
+  kaist_nonprehensile_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+
+  stanford_mask_vit_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+
+  tokyo_u_lsmo_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+
+  dlr_sara_pour_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+
+  dlr_sara_grid_clamp_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+
+  dlr_edan_shared_control_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 5
+
+  asu_table_top_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 12.5
+
+  stanford_robocook_converted_externally_to_rlds:
+    image_obs_keys:
+      - image_1
+      - image_2
+    depth_obs_keys:
+      - depth_1
+      - depth_2
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 5
+
+  imperialcollege_sawyer_wrist_cam:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+
+  iamlab_cmu_pickup_insert_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_state
+      - gripper_state
+    fps: 20
+
+  uiuc_d3field:
+    image_obs_keys:
+      - image_1
+      - image_2
+    depth_obs_keys:
+      - depth_1
+      - depth_2
+    state_obs_keys:
+      - null
+    fps: 1
+
+  utaustin_mutex:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+
+  berkeley_fanuc_manipulation:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_state
+      - gripper_state
+    fps: 10
+
+  cmu_playing_with_food:
+    image_obs_keys:
+      - image
+      - finger_vision_1
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+
+  cmu_play_fusion:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 5
+
+  cmu_stretch:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+
+  berkeley_gnm_recon:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+      - position
+      - yaw
+    fps: 3
+
+  berkeley_gnm_cory_hall:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+      - position
+      - yaw
+    fps: 5
+
+  berkeley_gnm_sac_son:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+      - position
+      - yaw
+    fps: 10
+
+  droid:
+    image_obs_keys:
+      - exterior_image_1_left
+      - exterior_image_2_left
+      - wrist_image_left
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - proprio
+    fps: 15
+
+  droid_100:
+    image_obs_keys:
+      - exterior_image_1_left
+      - exterior_image_2_left
+      - wrist_image_left
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - proprio
+    fps: 15
+
+  fmb:
+    image_obs_keys:
+      - image_side_1
+      - image_side_2
+      - image_wrist_1
+      - image_wrist_2
+    depth_obs_keys:
+      - image_side_1_depth
+      - image_side_2_depth
+      - image_wrist_1_depth
+      - image_wrist_2_depth
+    state_obs_keys:
+      - proprio
+    fps: 10
+
+  dobbe:
+    image_obs_keys:
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - proprio
+    fps: 3.75
+
+  usc_cloth_sim_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 10
+
+  plex_robosuite:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+
+  conq_hose_manipulation:
+    image_obs_keys:
+      - frontleft_fisheye_image
+      - frontright_fisheye_image
+      - hand_color_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 30

lerobot/common/datasets/push_dataset_to_hub/openx/data_utils.py

@@ -0,0 +1,106 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the Licens    e.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+NOTE(YL): Adapted from:
+    Octo: https://github.com/octo-models/octo/blob/main/octo/data/utils/data_utils.py
+
+data_utils.py
+
+Additional utils for data processing.
+"""
+
+from typing import Any, Dict, List
+
+import tensorflow as tf
+
+
+def binarize_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
+    """
+    Converts gripper actions from continuous to binary values (0 and 1).
+
+    We exploit that fact that most of the time, the gripper is fully open (near 1.0) or fully closed (near 0.0). As it
+    transitions between the two, it sometimes passes through a few intermediate values. We relabel those intermediate
+    values based on the state that is reached _after_ those intermediate values.
+
+    In the edge case that the trajectory ends with an intermediate value, we give up on binarizing and relabel that
+    chunk of intermediate values as the last action in the trajectory.
+
+    The `scan_fn` implements the following logic:
+        new_actions = np.empty_like(actions)
+        carry = actions[-1]
+        for i in reversed(range(actions.shape[0])):
+            if in_between_mask[i]:
+                carry = carry
+            else:
+                carry = float(open_mask[i])
+            new_actions[i] = carry
+    """
+    open_mask, closed_mask = actions > 0.95, actions < 0.05
+    in_between_mask = tf.logical_not(tf.logical_or(open_mask, closed_mask))
+    is_open_float = tf.cast(open_mask, tf.float32)
+
+    def scan_fn(carry, i):
+        return tf.cond(in_between_mask[i], lambda: tf.cast(carry, tf.float32), lambda: is_open_float[i])
+
+    return tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), actions[-1], reverse=True)
+
+
+def invert_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
+    return 1 - actions
+
+
+def rel2abs_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
+    """
+    Converts relative gripper actions (+1 for closing, -1 for opening) to absolute actions (0 = closed; 1 = open).
+
+    Assumes that the first relative gripper is not redundant (i.e. close when already closed)!
+    """
+    # Note =>> -1 for closing, 1 for opening, 0 for no change
+    opening_mask, closing_mask = actions < -0.1, actions > 0.1
+    thresholded_actions = tf.where(opening_mask, 1, tf.where(closing_mask, -1, 0))
+
+    def scan_fn(carry, i):
+        return tf.cond(thresholded_actions[i] == 0, lambda: carry, lambda: thresholded_actions[i])
+
+    # If no relative grasp, assumes open for whole trajectory
+    start = -1 * thresholded_actions[tf.argmax(thresholded_actions != 0, axis=0)]
+    start = tf.cond(start == 0, lambda: 1, lambda: start)
+
+    # Note =>> -1 for closed, 1 for open
+    new_actions = tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), start)
+    new_actions = tf.cast(new_actions, tf.float32) / 2 + 0.5
+
+    return new_actions
+
+
+# === Bridge-V2 =>> Dataset-Specific Transform ===
+def relabel_bridge_actions(traj: Dict[str, Any]) -> Dict[str, Any]:
+    """Relabels actions to use reached proprioceptive state; discards last timestep (no-action)."""
+    movement_actions = traj["observation"]["state"][1:, :6] - traj["observation"]["state"][:-1, :6]
+    traj_truncated = tf.nest.map_structure(lambda x: x[:-1], traj)
+    traj_truncated["action"] = tf.concat([movement_actions, traj["action"][:-1, -1:]], axis=1)
+
+    return traj_truncated
+
+
+# === RLDS Dataset Initialization Utilities ===
+def pprint_data_mixture(dataset_kwargs_list: List[Dict[str, Any]], dataset_weights: List[int]) -> None:
+    print("\n######################################################################################")
+    print(f"# Loading the following {len(dataset_kwargs_list)} datasets (incl. sampling weight):{'': >24} #")
+    for dataset_kwargs, weight in zip(dataset_kwargs_list, dataset_weights, strict=False):
+        pad = 80 - len(dataset_kwargs["name"])
+        print(f"# {dataset_kwargs['name']}: {weight:=>{pad}f} #")
+    print("######################################################################################\n")

lerobot/common/datasets/push_dataset_to_hub/openx/droid_utils.py

@@ -0,0 +1,200 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+NOTE(YL): Adapted from:
+    OpenVLA: https://github.com/openvla/openvla
+
+Episode transforms for DROID dataset.
+"""
+
+from typing import Any, Dict
+
+import tensorflow as tf
+import tensorflow_graphics.geometry.transformation as tfg
+
+
+def rmat_to_euler(rot_mat):
+    return tfg.euler.from_rotation_matrix(rot_mat)
+
+
+def euler_to_rmat(euler):
+    return tfg.rotation_matrix_3d.from_euler(euler)
+
+
+def invert_rmat(rot_mat):
+    return tfg.rotation_matrix_3d.inverse(rot_mat)
+
+
+def rotmat_to_rot6d(mat):
+    """
+    Converts rotation matrix to R6 rotation representation (first two rows in rotation matrix).
+    Args:
+        mat: rotation matrix
+
+    Returns: 6d vector (first two rows of rotation matrix)
+
+    """
+    r6 = mat[..., :2, :]
+    r6_0, r6_1 = r6[..., 0, :], r6[..., 1, :]
+    r6_flat = tf.concat([r6_0, r6_1], axis=-1)
+    return r6_flat
+
+
+def velocity_act_to_wrist_frame(velocity, wrist_in_robot_frame):
+    """
+    Translates velocity actions (translation + rotation) from base frame of the robot to wrist frame.
+    Args:
+        velocity: 6d velocity action (3 x translation, 3 x rotation)
+        wrist_in_robot_frame: 6d pose of the end-effector in robot base frame
+
+    Returns: 9d velocity action in robot wrist frame (3 x translation, 6 x rotation as R6)
+
+    """
+    r_frame = euler_to_rmat(wrist_in_robot_frame[:, 3:6])
+    r_frame_inv = invert_rmat(r_frame)
+
+    # world to wrist: dT_pi = R^-1 dT_rbt
+    vel_t = (r_frame_inv @ velocity[:, :3][..., None])[..., 0]
+
+    # world to wrist: dR_pi = R^-1 dR_rbt R
+    dr_ = euler_to_rmat(velocity[:, 3:6])
+    dr_ = r_frame_inv @ (dr_ @ r_frame)
+    dr_r6 = rotmat_to_rot6d(dr_)
+    return tf.concat([vel_t, dr_r6], axis=-1)
+
+
+def rand_swap_exterior_images(img1, img2):
+    """
+    Randomly swaps the two exterior images (for training with single exterior input).
+    """
+    return tf.cond(tf.random.uniform(shape=[]) > 0.5, lambda: (img1, img2), lambda: (img2, img1))
+
+
+def droid_baseact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    DROID dataset transformation for actions expressed in *base* frame of the robot.
+    """
+    dt = trajectory["action_dict"]["cartesian_velocity"][:, :3]
+    dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6]
+
+    trajectory["action"] = tf.concat(
+        (
+            dt,
+            dr_,
+            1 - trajectory["action_dict"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = (
+        rand_swap_exterior_images(
+            trajectory["observation"]["exterior_image_1_left"],
+            trajectory["observation"]["exterior_image_2_left"],
+        )
+    )
+    trajectory["observation"]["proprio"] = tf.concat(
+        (
+            trajectory["observation"]["cartesian_position"],
+            trajectory["observation"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def droid_wristact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    DROID dataset transformation for actions expressed in *wrist* frame of the robot.
+    """
+    wrist_act = velocity_act_to_wrist_frame(
+        trajectory["action_dict"]["cartesian_velocity"], trajectory["observation"]["cartesian_position"]
+    )
+    trajectory["action"] = tf.concat(
+        (
+            wrist_act,
+            trajectory["action_dict"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = (
+        rand_swap_exterior_images(
+            trajectory["observation"]["exterior_image_1_left"],
+            trajectory["observation"]["exterior_image_2_left"],
+        )
+    )
+    trajectory["observation"]["proprio"] = tf.concat(
+        (
+            trajectory["observation"]["cartesian_position"],
+            trajectory["observation"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def droid_finetuning_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    DROID dataset transformation for actions expressed in *base* frame of the robot.
+    """
+    dt = trajectory["action_dict"]["cartesian_velocity"][:, :3]
+    dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6]
+    trajectory["action"] = tf.concat(
+        (
+            dt,
+            dr_,
+            1 - trajectory["action_dict"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["proprio"] = tf.concat(
+        (
+            trajectory["observation"]["cartesian_position"],
+            trajectory["observation"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def zero_action_filter(traj: Dict) -> bool:
+    """
+    Filters transitions whose actions are all-0 (only relative actions, no gripper action).
+    Note: this filter is applied *after* action normalization, so need to compare to "normalized 0".
+    """
+    droid_q01 = tf.convert_to_tensor(
+        [
+            -0.7776297926902771,
+            -0.5803514122962952,
+            -0.5795090794563293,
+            -0.6464047729969025,
+            -0.7041108310222626,
+            -0.8895104378461838,
+        ]
+    )
+    droid_q99 = tf.convert_to_tensor(
+        [
+            0.7597932070493698,
+            0.5726242214441299,
+            0.7351000607013702,
+            0.6705610305070877,
+            0.6464948207139969,
+            0.8897542208433151,
+        ]
+    )
+    droid_norm_0_act = (
+        2 * (tf.zeros_like(traj["action"][:, :6]) - droid_q01) / (droid_q99 - droid_q01 + 1e-8) - 1
+    )
+
+    return tf.reduce_any(tf.math.abs(traj["action"][:, :6] - droid_norm_0_act) > 1e-5)

lerobot/common/datasets/push_dataset_to_hub/openx/transforms.py

@@ -0,0 +1,859 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+NOTE(YL): Adapted from:
+    OpenVLA: https://github.com/openvla/openvla
+    Octo: https://github.com/octo-models/octo
+
+transforms.py
+
+Defines a registry of per-dataset standardization transforms for each dataset in Open-X Embodiment.
+
+Transforms adopt the following structure:
+    Input: Dictionary of *batched* features (i.e., has leading time dimension)
+    Output: Dictionary `step` =>> {
+        "observation": {
+            <image_keys, depth_image_keys>
+            State (in chosen state representation)
+        },
+        "action": Action (in chosen action representation),
+        "language_instruction": str
+    }
+"""
+
+from typing import Any, Dict
+
+import tensorflow as tf
+
+from lerobot.common.datasets.push_dataset_to_hub.openx.data_utils import (
+    binarize_gripper_actions,
+    invert_gripper_actions,
+    rel2abs_gripper_actions,
+    relabel_bridge_actions,
+)
+
+
+def droid_baseact_transform_fn():
+    from lerobot.common.datasets.push_dataset_to_hub.openx.droid_utils import droid_baseact_transform
+
+    return droid_baseact_transform
+
+
+def bridge_openx_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    Applies to version of Bridge V2 in Open X-Embodiment mixture.
+
+    Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it!
+    """
+    for key in trajectory:
+        if key == "traj_metadata":
+            continue
+        elif key in ["observation", "action"]:
+            for key2 in trajectory[key]:
+                trajectory[key][key2] = trajectory[key][key2][1:]
+        else:
+            trajectory[key] = trajectory[key][1:]
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32),
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    trajectory = relabel_bridge_actions(trajectory)
+    trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def bridge_orig_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    Applies to original version of Bridge V2 from the official project website.
+
+    Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it!
+    """
+    for key in trajectory:
+        if key == "traj_metadata":
+            continue
+        elif key == "observation":
+            for key2 in trajectory[key]:
+                trajectory[key][key2] = trajectory[key][key2][1:]
+        else:
+            trajectory[key] = trajectory[key][1:]
+
+    trajectory["action"] = tf.concat(
+        [
+            trajectory["action"][:, :6],
+            binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
+        ],
+        axis=1,
+    )
+    trajectory = relabel_bridge_actions(trajectory)
+    trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def ppgm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        [
+            trajectory["action"][:, :6],
+            binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
+        ],
+        axis=1,
+    )
+    trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"][:, -1:]
+    return trajectory
+
+
+def rt1_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def kuka_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    # decode compressed state
+    eef_value = tf.io.decode_compressed(
+        trajectory["observation"]["clip_function_input/base_pose_tool_reached"],
+        compression_type="ZLIB",
+    )
+    eef_value = tf.io.decode_raw(eef_value, tf.float32)
+    trajectory["observation"]["clip_function_input/base_pose_tool_reached"] = tf.reshape(eef_value, (-1, 7))
+    gripper_value = tf.io.decode_compressed(
+        trajectory["observation"]["gripper_closed"], compression_type="ZLIB"
+    )
+    gripper_value = tf.io.decode_raw(gripper_value, tf.float32)
+    trajectory["observation"]["gripper_closed"] = tf.reshape(gripper_value, (-1, 1))
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def taco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state_eef"] = trajectory["observation"]["robot_obs"][:, :6]
+    trajectory["observation"]["state_gripper"] = trajectory["observation"]["robot_obs"][:, 7:8]
+    trajectory["action"] = trajectory["action"]["rel_actions_world"]
+
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            tf.clip_by_value(trajectory["action"][:, -1:], 0, 1),
+        ),
+        axis=-1,
+    )
+
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def jaco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state_eef"] = trajectory["observation"]["end_effector_cartesian_pos"][:, :6]
+    trajectory["observation"]["state_gripper"] = trajectory["observation"]["end_effector_cartesian_pos"][
+        :, -1:
+    ]
+
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            tf.zeros_like(trajectory["action"]["world_vector"]),
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def berkeley_cable_routing_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            tf.zeros_like(trajectory["action"]["world_vector"][:, :1]),
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def roboturk_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert absolute gripper action, +1 = open, 0 = close
+    gripper_action = invert_gripper_actions(
+        tf.clip_by_value(trajectory["action"]["gripper_closedness_action"], 0, 1)
+    )
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action,
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    trajectory["language_embedding"] = trajectory["observation"]["natural_language_embedding"]
+    return trajectory
+
+
+def nyu_door_opening_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def viola_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # make gripper action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, None]
+    gripper_action = tf.clip_by_value(gripper_action, 0, 1)
+    gripper_action = invert_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action,
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def berkeley_autolab_ur5_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = trajectory["observation"]["robot_state"][:, 6:14]
+
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def toto_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32),
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def language_table_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # default to "open" gripper
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"],
+            tf.zeros_like(trajectory["action"]),
+            tf.zeros_like(trajectory["action"]),
+            tf.ones_like(trajectory["action"][:, :1]),
+        ),
+        axis=-1,
+    )
+
+    # decode language instruction
+    instruction_bytes = trajectory["observation"]["instruction"]
+    instruction_encoded = tf.strings.unicode_encode(instruction_bytes, output_encoding="UTF-8")
+    # Remove trailing padding --> convert RaggedTensor to regular Tensor.
+    trajectory["language_instruction"] = tf.strings.split(instruction_encoded, "\x00")[:, :1].to_tensor()[
+        :, 0
+    ]
+    return trajectory
+
+
+def pusht_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            trajectory["action"]["gripper_closedness_action"][:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def stanford_kuka_multimodal_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["depth_image"] = trajectory["observation"]["depth_image"][..., 0]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tf.zeros_like(trajectory["action"][:, :3]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def nyu_rot_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][..., :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., -1:]
+    trajectory["action"] = trajectory["action"][..., :7]
+    return trajectory
+
+
+def stanford_hydra_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(trajectory["action"][:, -1:]),
+        ),
+        axis=-1,
+    )
+
+    trajectory["observation"]["eef_state"] = tf.concat(
+        (
+            trajectory["observation"]["state"][:, :3],
+            trajectory["observation"]["state"][:, 7:10],
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -3:-2]
+    return trajectory
+
+
+def austin_buds_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+
+    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8]
+    return trajectory
+
+
+def nyu_franka_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["depth"] = tf.cast(trajectory["observation"]["depth"][..., 0], tf.float32)
+    trajectory["observation"]["depth_additional_view"] = tf.cast(
+        trajectory["observation"]["depth_additional_view"][..., 0], tf.float32
+    )
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, -6:]
+
+    # clip gripper action, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, -8:-2],
+            tf.clip_by_value(trajectory["action"][:, -2:-1], 0, 1),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def maniskill_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., 7:8]
+    return trajectory
+
+
+def furniture_bench_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    import tensorflow_graphics.geometry.transformation as tft
+
+    trajectory["observation"]["state"] = tf.concat(
+        (
+            trajectory["observation"]["state"][:, :7],
+            trajectory["observation"]["state"][:, -1:],
+        ),
+        axis=-1,
+    )
+
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def cmu_franka_exploration_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def ucsd_kitchen_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7]
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def ucsd_pick_place_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tf.zeros_like(trajectory["action"][:, :3]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def austin_sailor_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def austin_sirius_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def bc_z_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["future/xyz_residual"][:, :3],
+            trajectory["action"]["future/axis_angle_residual"][:, :3],
+            invert_gripper_actions(tf.cast(trajectory["action"]["future/target_close"][:, :1], tf.float32)),
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def tokyo_pr2_opening_fridge_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def tokyo_pr2_tabletop_manipulation_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def utokyo_xarm_bimanual_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = trajectory["action"][..., -7:]
+    return trajectory
+
+
+def robo_net_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = tf.concat(
+        (
+            trajectory["observation"]["state"][:, :4],
+            tf.zeros_like(trajectory["observation"]["state"][:, :2]),
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :4],
+            tf.zeros_like(trajectory["action"][:, :2]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def berkeley_mvp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    trajectory["observation"]["state"] = tf.concat((
+        tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32),
+                        trajectory["observation"]["pose"],
+                        trajectory["observation"]["joint_pos"],),
+                        axis=-1,)
+    """
+    trajectory["observation"]["gripper"] = tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32)
+    return trajectory
+
+
+def berkeley_rpt_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["gripper"] = tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32)
+    return trajectory
+
+
+def kaist_nonprehensible_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, -7:]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            tf.zeros_like(trajectory["action"][:, :1]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def stanford_mask_vit_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = tf.concat(
+        (
+            trajectory["observation"]["end_effector_pose"][:, :4],
+            tf.zeros_like(trajectory["observation"]["end_effector_pose"][:, :2]),
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["end_effector_pose"][:, -1:]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :4],
+            tf.zeros_like(trajectory["action"][:, :2]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def tokyo_lsmo_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def dlr_sara_grid_clamp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :6]
+    return trajectory
+
+
+def dlr_edan_shared_control_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(trajectory["action"][:, -1:]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def asu_table_top_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["ground_truth_states"]["EE"]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def robocook_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def imperial_wristcam_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def iamlab_pick_insert_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    import tensorflow_graphics.geometry.transformation as tft
+
+    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 7:8]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
+            trajectory["action"][:, 7:8],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def uiuc_d3field_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"],
+            tf.zeros_like(trajectory["action"]),
+            tf.zeros_like(trajectory["action"][:, :1]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def utaustin_mutex_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8]
+
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def berkeley_fanuc_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 6:7]
+
+    # dataset does not store gripper actions, so use gripper state info, invert so +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"],
+            invert_gripper_actions(trajectory["observation"]["gripper_state"]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def cmu_playing_with_food_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    import tensorflow_graphics.geometry.transformation as tft
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def playfusion_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            trajectory["action"][:, -4:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def cmu_stretch_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = tf.concat(
+        (
+            trajectory["observation"]["state"][:, :3],
+            tf.zeros_like(trajectory["observation"]["state"][:, :3]),
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def gnm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = tf.concat(
+        (
+            trajectory["observation"]["position"],
+            tf.zeros_like(trajectory["observation"]["state"][:, :3]),
+            trajectory["observation"]["yaw"],
+        ),
+        axis=-1,
+    )
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"],
+            tf.zeros_like(trajectory["action"]),
+            tf.zeros_like(trajectory["action"]),
+            tf.zeros_like(trajectory["action"][:, :1]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def fmb_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # every input feature is batched, ie has leading batch dimension
+    trajectory["observation"]["proprio"] = tf.concat(
+        (
+            trajectory["observation"]["eef_pose"],
+            trajectory["observation"]["state_gripper_pose"][..., None],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def dobbe_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # every input feature is batched, ie has leading batch dimension
+    trajectory["observation"]["proprio"] = trajectory["observation"]["state"]
+    return trajectory
+
+
+def robo_set_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # gripper action is in -1...1 --> clip to 0...1, flip
+    gripper_action = trajectory["action"][:, -1:]
+    gripper_action = invert_gripper_actions(tf.clip_by_value(gripper_action, 0, 1))
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :7],
+            gripper_action,
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def identity_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    return trajectory
+
+
+# === Registry ===
+OPENX_STANDARDIZATION_TRANSFORMS = {
+    "bridge_openx": bridge_openx_dataset_transform,
+    "bridge_orig": bridge_orig_dataset_transform,
+    "bridge_dataset": bridge_orig_dataset_transform,
+    "ppgm": ppgm_dataset_transform,
+    "ppgm_static": ppgm_dataset_transform,
+    "ppgm_wrist": ppgm_dataset_transform,
+    "fractal20220817_data": rt1_dataset_transform,
+    "kuka": kuka_dataset_transform,
+    "taco_play": taco_play_dataset_transform,
+    "jaco_play": jaco_play_dataset_transform,
+    "berkeley_cable_routing": berkeley_cable_routing_dataset_transform,
+    "roboturk": roboturk_dataset_transform,
+    "nyu_door_opening_surprising_effectiveness": nyu_door_opening_dataset_transform,
+    "viola": viola_dataset_transform,
+    "berkeley_autolab_ur5": berkeley_autolab_ur5_dataset_transform,
+    "toto": toto_dataset_transform,
+    "language_table": language_table_dataset_transform,
+    "columbia_cairlab_pusht_real": pusht_dataset_transform,
+    "stanford_kuka_multimodal_dataset_converted_externally_to_rlds": stanford_kuka_multimodal_dataset_transform,
+    "nyu_rot_dataset_converted_externally_to_rlds": nyu_rot_dataset_transform,
+    "stanford_hydra_dataset_converted_externally_to_rlds": stanford_hydra_dataset_transform,
+    "austin_buds_dataset_converted_externally_to_rlds": austin_buds_dataset_transform,
+    "nyu_franka_play_dataset_converted_externally_to_rlds": nyu_franka_play_dataset_transform,
+    "maniskill_dataset_converted_externally_to_rlds": maniskill_dataset_transform,
+    "furniture_bench_dataset_converted_externally_to_rlds": furniture_bench_dataset_transform,
+    "cmu_franka_exploration_dataset_converted_externally_to_rlds": cmu_franka_exploration_dataset_transform,
+    "ucsd_kitchen_dataset_converted_externally_to_rlds": ucsd_kitchen_dataset_transform,
+    "ucsd_pick_and_place_dataset_converted_externally_to_rlds": ucsd_pick_place_dataset_transform,
+    "austin_sailor_dataset_converted_externally_to_rlds": austin_sailor_dataset_transform,
+    "austin_sirius_dataset_converted_externally_to_rlds": austin_sirius_dataset_transform,
+    "bc_z": bc_z_dataset_transform,
+    "utokyo_pr2_opening_fridge_converted_externally_to_rlds": tokyo_pr2_opening_fridge_dataset_transform,
+    "utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds": tokyo_pr2_tabletop_manipulation_dataset_transform,
+    "utokyo_xarm_pick_and_place_converted_externally_to_rlds": identity_transform,
+    "utokyo_xarm_bimanual_converted_externally_to_rlds": utokyo_xarm_bimanual_dataset_transform,
+    "robo_net": robo_net_dataset_transform,
+    "berkeley_mvp_converted_externally_to_rlds": berkeley_mvp_dataset_transform,
+    "berkeley_rpt_converted_externally_to_rlds": berkeley_rpt_dataset_transform,
+    "kaist_nonprehensile_converted_externally_to_rlds": kaist_nonprehensible_dataset_transform,
+    "stanford_mask_vit_converted_externally_to_rlds": stanford_mask_vit_dataset_transform,
+    "tokyo_u_lsmo_converted_externally_to_rlds": tokyo_lsmo_dataset_transform,
+    "dlr_sara_pour_converted_externally_to_rlds": identity_transform,
+    "dlr_sara_grid_clamp_converted_externally_to_rlds": dlr_sara_grid_clamp_dataset_transform,
+    "dlr_edan_shared_control_converted_externally_to_rlds": dlr_edan_shared_control_dataset_transform,
+    "asu_table_top_converted_externally_to_rlds": asu_table_top_dataset_transform,
+    "stanford_robocook_converted_externally_to_rlds": robocook_dataset_transform,
+    "imperialcollege_sawyer_wrist_cam": imperial_wristcam_dataset_transform,
+    "iamlab_cmu_pickup_insert_converted_externally_to_rlds": iamlab_pick_insert_dataset_transform,
+    "uiuc_d3field": uiuc_d3field_dataset_transform,
+    "utaustin_mutex": utaustin_mutex_dataset_transform,
+    "berkeley_fanuc_manipulation": berkeley_fanuc_dataset_transform,
+    "cmu_playing_with_food": cmu_playing_with_food_dataset_transform,
+    "cmu_play_fusion": playfusion_dataset_transform,
+    "cmu_stretch": cmu_stretch_dataset_transform,
+    "berkeley_gnm_recon": gnm_dataset_transform,
+    "berkeley_gnm_cory_hall": gnm_dataset_transform,
+    "berkeley_gnm_sac_son": gnm_dataset_transform,
+    "droid": droid_baseact_transform_fn(),
+    "droid_100": droid_baseact_transform_fn(),  # first 100 episodes of droid
+    "fmb": fmb_transform,
+    "dobbe": dobbe_dataset_transform,
+    "robo_set": robo_set_dataset_transform,
+    "usc_cloth_sim_converted_externally_to_rlds": identity_transform,
+    "plex_robosuite": identity_transform,
+    "conq_hose_manipulation": identity_transform,
+    "io_ai_tech": identity_transform,
+    "spoc": identity_transform,
+}

lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py

@@ -0,0 +1,359 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets.
+
+Example:
+    python lerobot/scripts/push_dataset_to_hub.py \
+        --raw-dir /hdd/tensorflow_datasets/bridge_dataset/1.0.0/ \
+        --repo-id youliangtan/sampled_bridge_data_v2 \
+        --raw-format openx_rlds.bridge_orig \
+        --episodes 3 4 5 8 9
+
+Exact dataset fps defined in openx/config.py, obtained from:
+    https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R
+"""
+
+import shutil
+from pathlib import Path
+
+import numpy as np
+import tensorflow as tf
+import tensorflow_datasets as tfds
+import torch
+import tqdm
+import yaml
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.openx.transforms import OPENX_STANDARDIZATION_TRANSFORMS
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    calculate_episode_data_index,
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+with open("lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml") as f:
+    _openx_list = yaml.safe_load(f)
+
+OPENX_DATASET_CONFIGS = _openx_list["OPENX_DATASET_CONFIGS"]
+
+np.set_printoptions(precision=2)
+
+
+def tf_to_torch(data):
+    return torch.from_numpy(data.numpy())
+
+
+def tf_img_convert(img):
+    if img.dtype == tf.string:
+        img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8)
+    elif img.dtype != tf.uint8:
+        raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}")
+    return img.numpy()
+
+
+def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict:
+    """
+    In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps"
+    entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the
+    trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`.
+
+    NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/
+    """
+    steps = traj.pop("steps")
+
+    traj_len = tf.shape(tf.nest.flatten(steps)[0])[0]
+
+    # broadcast metadata to the length of the trajectory
+    metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj)
+
+    # put steps back in
+    assert "traj_metadata" not in steps
+    traj = {**steps, "traj_metadata": metadata}
+
+    assert "_len" not in traj
+    assert "_traj_index" not in traj
+    assert "_frame_index" not in traj
+    traj["_len"] = tf.repeat(traj_len, traj_len)
+    traj["_traj_index"] = tf.repeat(i, traj_len)
+    traj["_frame_index"] = tf.range(traj_len)
+
+    return traj
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+    openx_dataset_name: str | None = None,
+):
+    """
+    Args:
+        raw_dir (Path): _description_
+        videos_dir (Path): _description_
+        fps (int): _description_
+        video (bool): _description_
+        episodes (list[int] | None, optional): _description_. Defaults to None.
+    """
+    ds_builder = tfds.builder_from_directory(str(raw_dir))
+    dataset = ds_builder.as_dataset(
+        split="all",
+        decoders={"steps": tfds.decode.SkipDecoding()},
+    )
+
+    dataset_info = ds_builder.info
+    print("dataset_info: ", dataset_info)
+
+    ds_length = len(dataset)
+    dataset = dataset.take(ds_length)
+    # "flatten" the dataset as such we can apply trajectory level map() easily
+    # each [obs][key] has a shape of (frame_size, ...)
+    dataset = dataset.enumerate().map(_broadcast_metadata_rlds)
+
+    # we will apply the standardization transform if the dataset_name is provided
+    # if the dataset name is not provided and the goal is to convert any rlds formatted dataset
+    # search for 'image' keys in the observations
+    if openx_dataset_name is not None:
+        print(" - applying standardization transform for dataset: ", openx_dataset_name)
+        assert openx_dataset_name in OPENX_STANDARDIZATION_TRANSFORMS
+        transform_fn = OPENX_STANDARDIZATION_TRANSFORMS[openx_dataset_name]
+        dataset = dataset.map(transform_fn)
+
+        image_keys = OPENX_DATASET_CONFIGS[openx_dataset_name]["image_obs_keys"]
+    else:
+        obs_keys = dataset_info.features["steps"]["observation"].keys()
+        image_keys = [key for key in obs_keys if "image" in key]
+
+    lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None
+
+    print(" - image_keys: ", image_keys)
+    print(" - lang_key: ", lang_key)
+
+    it = iter(dataset)
+
+    ep_dicts = []
+    # Init temp path to save ep_dicts in case of crash
+    tmp_ep_dicts_dir = videos_dir.parent.joinpath("ep_dicts")
+    tmp_ep_dicts_dir.mkdir(parents=True, exist_ok=True)
+
+    # check if ep_dicts have already been saved in /tmp
+    starting_ep_idx = 0
+    saved_ep_dicts = [ep.__str__() for ep in tmp_ep_dicts_dir.iterdir()]
+    if len(saved_ep_dicts) > 0:
+        saved_ep_dicts.sort()
+        # get last ep_idx number
+        starting_ep_idx = int(saved_ep_dicts[-1][-13:-3]) + 1
+        for i in range(starting_ep_idx):
+            episode = next(it)
+            ep_dicts.append(torch.load(saved_ep_dicts[i]))
+
+    # if we user specified episodes, skip the ones not in the list
+    if episodes is not None:
+        if ds_length == 0:
+            raise ValueError("No episodes found.")
+        # convert episodes index to sorted list
+        episodes = sorted(episodes)
+
+    for ep_idx in tqdm.tqdm(range(starting_ep_idx, ds_length)):
+        episode = next(it)
+
+        # if user specified episodes, skip the ones not in the list
+        if episodes is not None:
+            if len(episodes) == 0:
+                break
+            if ep_idx == episodes[0]:
+                # process this episode
+                print(" selecting episode idx: ", ep_idx)
+                episodes.pop(0)
+            else:
+                continue  # skip
+
+        num_frames = episode["action"].shape[0]
+
+        ###########################################################
+        # Handle the episodic data
+
+        # last step of demonstration is considered done
+        done = torch.zeros(num_frames, dtype=torch.bool)
+        done[-1] = True
+        ep_dict = {}
+        langs = []  # TODO: might be located in "observation"
+
+        image_array_dict = {key: [] for key in image_keys}
+
+        # We will create the state observation tensor by stacking the state
+        # obs keys defined in the openx/configs.py
+        if openx_dataset_name is not None:
+            state_obs_keys = OPENX_DATASET_CONFIGS[openx_dataset_name]["state_obs_keys"]
+            # stack the state observations, if is None, pad with zeros
+            states = []
+            for key in state_obs_keys:
+                if key in episode["observation"]:
+                    states.append(tf_to_torch(episode["observation"][key]))
+                else:
+                    states.append(torch.zeros(num_frames, 1))  # pad with zeros
+            states = torch.cat(states, dim=1)
+            # assert states.shape == (num_frames, 8), f"states shape: {states.shape}"
+        else:
+            states = tf_to_torch(episode["observation"]["state"])
+
+        actions = tf_to_torch(episode["action"])
+        rewards = tf_to_torch(episode["reward"]).float()
+
+        # If lang_key is present, convert the entire tensor at once
+        if lang_key is not None:
+            langs = [str(x) for x in episode[lang_key]]
+
+        for im_key in image_keys:
+            imgs = episode["observation"][im_key]
+            image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
+
+        # simple assertions
+        for item in [states, actions, rewards, done]:
+            assert len(item) == num_frames
+
+        ###########################################################
+
+        # loop through all cameras
+        for im_key in image_keys:
+            img_key = f"observation.images.{im_key}"
+            imgs_array = image_array_dict[im_key]
+            imgs_array = np.array(imgs_array)
+            if video:
+                # save png images in temporary directory
+                tmp_imgs_dir = videos_dir / "tmp_images"
+                save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                # encode images to a mp4 video
+                fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                video_path = videos_dir / fname
+                encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                # clean temporary images directory
+                shutil.rmtree(tmp_imgs_dir)
+
+                # store the reference to the video frame
+                ep_dict[img_key] = [
+                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                ]
+            else:
+                ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+        if lang_key is not None:
+            ep_dict["language_instruction"] = langs
+
+        ep_dict["observation.state"] = states
+        ep_dict["action"] = actions
+        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
+        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+        ep_dict["next.reward"] = rewards
+        ep_dict["next.done"] = done
+
+        path_ep_dict = tmp_ep_dicts_dir.joinpath(
+            "ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt"
+        )
+        torch.save(ep_dict, path_ep_dict)
+
+        ep_dicts.append(ep_dict)
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+
+    keys = [key for key in data_dict if "observation.images." in key]
+    for key in keys:
+        if video:
+            features[key] = VideoFrame()
+        else:
+            features[key] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    if "observation.velocity" in data_dict:
+        features["observation.velocity"] = Sequence(
+            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    if "observation.effort" in data_dict:
+        features["observation.effort"] = Sequence(
+            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    if "language_instruction" in data_dict:
+        features["language_instruction"] = Value(dtype="string", id=None)
+
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.reward"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+    openx_dataset_name: str | None = None,
+):
+    """This is a test impl for rlds conversion"""
+    if openx_dataset_name is None:
+        # set a default rlds frame rate if the dataset is not from openx
+        fps = 30
+    elif "fps" not in OPENX_DATASET_CONFIGS[openx_dataset_name]:
+        raise ValueError(
+            "fps for this dataset is not specified in openx/configs.py yet," "means it is not yet tested"
+        )
+    fps = OPENX_DATASET_CONFIGS[openx_dataset_name]["fps"]
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding, openx_dataset_name)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/pusht_zarr_format.py

@@ -0,0 +1,275 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Process zarr files formatted like in: https://github.com/real-stanford/diffusion_policy"""
+
+import shutil
+from pathlib import Path
+
+import numpy as np
+import torch
+import tqdm
+import zarr
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    calculate_episode_data_index,
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+
+def check_format(raw_dir):
+    zarr_path = raw_dir / "pusht_cchi_v7_replay.zarr"
+    zarr_data = zarr.open(zarr_path, mode="r")
+
+    required_datasets = {
+        "data/action",
+        "data/img",
+        "data/keypoint",
+        "data/n_contacts",
+        "data/state",
+        "meta/episode_ends",
+    }
+    for dataset in required_datasets:
+        assert dataset in zarr_data
+    nb_frames = zarr_data["data/img"].shape[0]
+
+    required_datasets.remove("meta/episode_ends")
+
+    assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    keypoints_instead_of_image: bool = False,
+    encoding: dict | None = None,
+):
+    try:
+        import pymunk
+        from gym_pusht.envs.pusht import PushTEnv, pymunk_to_shapely
+
+        from lerobot.common.datasets.push_dataset_to_hub._diffusion_policy_replay_buffer import (
+            ReplayBuffer as DiffusionPolicyReplayBuffer,
+        )
+    except ModuleNotFoundError as e:
+        print("`gym_pusht` is not installed. Please install it with `pip install 'lerobot[gym_pusht]'`")
+        raise e
+    # as define in gmy-pusht env: https://github.com/huggingface/gym-pusht/blob/e0684ff988d223808c0a9dcfaba9dc4991791370/gym_pusht/envs/pusht.py#L174
+    success_threshold = 0.95  # 95% coverage,
+
+    zarr_path = raw_dir / "pusht_cchi_v7_replay.zarr"
+    zarr_data = DiffusionPolicyReplayBuffer.copy_from_path(zarr_path)
+
+    episode_ids = torch.from_numpy(zarr_data.get_episode_idxs())
+    assert len(
+        {zarr_data[key].shape[0] for key in zarr_data.keys()}  # noqa: SIM118
+    ), "Some data type dont have the same number of total frames."
+
+    # TODO(rcadene): verify that goal pose is expected to be fixed
+    goal_pos_angle = np.array([256, 256, np.pi / 4])  # x, y, theta (in radians)
+    goal_body = PushTEnv.get_goal_pose_body(goal_pos_angle)
+
+    imgs = torch.from_numpy(zarr_data["img"])  # b h w c
+    states = torch.from_numpy(zarr_data["state"])
+    actions = torch.from_numpy(zarr_data["action"])
+
+    # load data indices from which each episode starts and ends
+    from_ids, to_ids = [], []
+    from_idx = 0
+    for to_idx in zarr_data.meta["episode_ends"]:
+        from_ids.append(from_idx)
+        to_ids.append(to_idx)
+        from_idx = to_idx
+
+    num_episodes = len(from_ids)
+
+    ep_dicts = []
+    ep_ids = episodes if episodes else range(num_episodes)
+    for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
+        from_idx = from_ids[selected_ep_idx]
+        to_idx = to_ids[selected_ep_idx]
+        num_frames = to_idx - from_idx
+
+        # sanity check
+        assert (episode_ids[from_idx:to_idx] == ep_idx).all()
+
+        # get image
+        if not keypoints_instead_of_image:
+            image = imgs[from_idx:to_idx]
+            assert image.min() >= 0.0
+            assert image.max() <= 255.0
+            image = image.type(torch.uint8)
+
+        # get state
+        state = states[from_idx:to_idx]
+        agent_pos = state[:, :2]
+        block_pos = state[:, 2:4]
+        block_angle = state[:, 4]
+
+        # get reward, success, done, and (maybe) keypoints
+        reward = torch.zeros(num_frames)
+        success = torch.zeros(num_frames, dtype=torch.bool)
+        if keypoints_instead_of_image:
+            keypoints = torch.zeros(num_frames, 16)  # 8 keypoints each with 2 coords
+        done = torch.zeros(num_frames, dtype=torch.bool)
+        for i in range(num_frames):
+            space = pymunk.Space()
+            space.gravity = 0, 0
+            space.damping = 0
+
+            # Add walls.
+            walls = [
+                PushTEnv.add_segment(space, (5, 506), (5, 5), 2),
+                PushTEnv.add_segment(space, (5, 5), (506, 5), 2),
+                PushTEnv.add_segment(space, (506, 5), (506, 506), 2),
+                PushTEnv.add_segment(space, (5, 506), (506, 506), 2),
+            ]
+            space.add(*walls)
+
+            block_body, block_shapes = PushTEnv.add_tee(space, block_pos[i].tolist(), block_angle[i].item())
+            goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
+            block_geom = pymunk_to_shapely(block_body, block_body.shapes)
+            intersection_area = goal_geom.intersection(block_geom).area
+            goal_area = goal_geom.area
+            coverage = intersection_area / goal_area
+            reward[i] = np.clip(coverage / success_threshold, 0, 1)
+            success[i] = coverage > success_threshold
+            if keypoints_instead_of_image:
+                keypoints[i] = torch.from_numpy(PushTEnv.get_keypoints(block_shapes).flatten())
+
+        # last step of demonstration is considered done
+        done[-1] = True
+
+        ep_dict = {}
+
+        if not keypoints_instead_of_image:
+            imgs_array = [x.numpy() for x in image]
+            img_key = "observation.image"
+            if video:
+                # save png images in temporary directory
+                tmp_imgs_dir = videos_dir / "tmp_images"
+                save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                # encode images to a mp4 video
+                fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                video_path = videos_dir / fname
+                encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                # clean temporary images directory
+                shutil.rmtree(tmp_imgs_dir)
+
+                # store the reference to the video frame
+                ep_dict[img_key] = [
+                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                ]
+            else:
+                ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+        ep_dict["observation.state"] = agent_pos
+        if keypoints_instead_of_image:
+            ep_dict["observation.environment_state"] = keypoints
+        ep_dict["action"] = actions[from_idx:to_idx]
+        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+        # ep_dict["next.observation.image"] = image[1:],
+        # ep_dict["next.observation.state"] = agent_pos[1:],
+        # TODO(rcadene)] = verify that reward and done are aligned with image and agent_pos
+        ep_dict["next.reward"] = torch.cat([reward[1:], reward[[-1]]])
+        ep_dict["next.done"] = torch.cat([done[1:], done[[-1]]])
+        ep_dict["next.success"] = torch.cat([success[1:], success[[-1]]])
+        ep_dicts.append(ep_dict)
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video, keypoints_instead_of_image: bool = False):
+    features = {}
+
+    if not keypoints_instead_of_image:
+        if video:
+            features["observation.image"] = VideoFrame()
+        else:
+            features["observation.image"] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    if keypoints_instead_of_image:
+        features["observation.environment_state"] = Sequence(
+            length=data_dict["observation.environment_state"].shape[1],
+            feature=Value(dtype="float32", id=None),
+        )
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.reward"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["next.success"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # Manually change this to True to use keypoints of the T instead of an image observation (but don't merge
+    # with True). Also make sure to use video = 0 in the `push_dataset_to_hub.py` script.
+    keypoints_instead_of_image = False
+
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 10
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, keypoints_instead_of_image, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video, keypoints_instead_of_image)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video if not keypoints_instead_of_image else 0,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/umi_zarr_format.py

@@ -0,0 +1,234 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Process UMI (Universal Manipulation Interface) data stored in Zarr format like in: https://github.com/real-stanford/universal_manipulation_interface"""
+
+import logging
+import shutil
+from pathlib import Path
+
+import torch
+import tqdm
+import zarr
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub._umi_imagecodecs_numcodecs import register_codecs
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    calculate_episode_data_index,
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+
+def check_format(raw_dir) -> bool:
+    zarr_path = raw_dir / "cup_in_the_wild.zarr"
+    zarr_data = zarr.open(zarr_path, mode="r")
+
+    required_datasets = {
+        "data/robot0_demo_end_pose",
+        "data/robot0_demo_start_pose",
+        "data/robot0_eef_pos",
+        "data/robot0_eef_rot_axis_angle",
+        "data/robot0_gripper_width",
+        "meta/episode_ends",
+        "data/camera0_rgb",
+    }
+    for dataset in required_datasets:
+        if dataset not in zarr_data:
+            return False
+
+    # mandatory to access zarr_data
+    register_codecs()
+    nb_frames = zarr_data["data/camera0_rgb"].shape[0]
+
+    required_datasets.remove("meta/episode_ends")
+    assert all(nb_frames == zarr_data[dataset].shape[0] for dataset in required_datasets)
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    zarr_path = raw_dir / "cup_in_the_wild.zarr"
+    zarr_data = zarr.open(zarr_path, mode="r")
+
+    # We process the image data separately because it is too large to fit in memory
+    end_pose = torch.from_numpy(zarr_data["data/robot0_demo_end_pose"][:])
+    start_pos = torch.from_numpy(zarr_data["data/robot0_demo_start_pose"][:])
+    eff_pos = torch.from_numpy(zarr_data["data/robot0_eef_pos"][:])
+    eff_rot_axis_angle = torch.from_numpy(zarr_data["data/robot0_eef_rot_axis_angle"][:])
+    gripper_width = torch.from_numpy(zarr_data["data/robot0_gripper_width"][:])
+
+    states_pos = torch.cat([eff_pos, eff_rot_axis_angle], dim=1)
+    states = torch.cat([states_pos, gripper_width], dim=1)
+
+    episode_ends = zarr_data["meta/episode_ends"][:]
+    num_episodes = episode_ends.shape[0]
+
+    # We convert it in torch tensor later because the jit function does not support torch tensors
+    episode_ends = torch.from_numpy(episode_ends)
+
+    # load data indices from which each episode starts and ends
+    from_ids, to_ids = [], []
+    from_idx = 0
+    for to_idx in episode_ends:
+        from_ids.append(from_idx)
+        to_ids.append(to_idx)
+        from_idx = to_idx
+
+    ep_dicts_dir = videos_dir / "ep_dicts"
+    ep_dicts_dir.mkdir(exist_ok=True, parents=True)
+    ep_dicts = []
+
+    ep_ids = episodes if episodes else range(num_episodes)
+    for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
+        ep_dict_path = ep_dicts_dir / f"{ep_idx}"
+        if not ep_dict_path.is_file():
+            from_idx = from_ids[selected_ep_idx]
+            to_idx = to_ids[selected_ep_idx]
+            num_frames = to_idx - from_idx
+
+            # TODO(rcadene): save temporary images of the episode?
+
+            state = states[from_idx:to_idx]
+
+            ep_dict = {}
+
+            # load 57MB of images in RAM (400x224x224x3 uint8)
+            imgs_array = zarr_data["data/camera0_rgb"][from_idx:to_idx]
+            img_key = "observation.image"
+            if video:
+                fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                video_path = videos_dir / fname
+                if not video_path.is_file():
+                    # save png images in temporary directory
+                    tmp_imgs_dir = videos_dir / "tmp_images"
+                    save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                    # encode images to a mp4 video
+                    encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                    # clean temporary images directory
+                    shutil.rmtree(tmp_imgs_dir)
+
+                # store the reference to the video frame
+                ep_dict[img_key] = [
+                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                ]
+            else:
+                ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+            ep_dict["observation.state"] = state
+            ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+            ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+            ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+            ep_dict["episode_data_index_from"] = torch.tensor([from_idx] * num_frames)
+            ep_dict["episode_data_index_to"] = torch.tensor([from_idx + num_frames] * num_frames)
+            ep_dict["end_pose"] = end_pose[from_idx:to_idx]
+            ep_dict["start_pos"] = start_pos[from_idx:to_idx]
+            ep_dict["gripper_width"] = gripper_width[from_idx:to_idx]
+            torch.save(ep_dict, ep_dict_path)
+        else:
+            ep_dict = torch.load(ep_dict_path)
+
+        ep_dicts.append(ep_dict)
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video):
+    features = {}
+
+    if video:
+        features["observation.image"] = VideoFrame()
+    else:
+        features["observation.image"] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+    features["episode_data_index_from"] = Value(dtype="int64", id=None)
+    features["episode_data_index_to"] = Value(dtype="int64", id=None)
+    # `start_pos` and `end_pos` respectively represent the positions of the end-effector
+    # at the beginning and the end of the episode.
+    # `gripper_width` indicates the distance between the grippers, and this value is included
+    # in the state vector, which comprises the concatenation of the end-effector position
+    # and gripper width.
+    features["end_pose"] = Sequence(
+        length=data_dict["end_pose"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["start_pos"] = Sequence(
+        length=data_dict["start_pos"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["gripper_width"] = Sequence(
+        length=data_dict["gripper_width"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        # For umi cup in the wild: https://arxiv.org/pdf/2402.10329#table.caption.16
+        fps = 10
+
+    if not video:
+        logging.warning(
+            "Generating UMI dataset without `video=True` creates ~150GB on disk and requires ~80GB in RAM."
+        )
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/push_dataset_to_hub/utils.py

@@ -0,0 +1,74 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+import inspect
+from concurrent.futures import ThreadPoolExecutor
+from pathlib import Path
+
+import numpy
+import PIL
+import torch
+
+from lerobot.common.datasets.video_utils import encode_video_frames
+
+
+def concatenate_episodes(ep_dicts):
+    data_dict = {}
+
+    keys = ep_dicts[0].keys()
+    for key in keys:
+        if torch.is_tensor(ep_dicts[0][key][0]):
+            data_dict[key] = torch.cat([ep_dict[key] for ep_dict in ep_dicts])
+        else:
+            if key not in data_dict:
+                data_dict[key] = []
+            for ep_dict in ep_dicts:
+                for x in ep_dict[key]:
+                    data_dict[key].append(x)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def save_images_concurrently(imgs_array: numpy.array, out_dir: Path, max_workers: int = 4):
+    out_dir = Path(out_dir)
+    out_dir.mkdir(parents=True, exist_ok=True)
+
+    def save_image(img_array, i, out_dir):
+        img = PIL.Image.fromarray(img_array)
+        img.save(str(out_dir / f"frame_{i:06d}.png"), quality=100)
+
+    num_images = len(imgs_array)
+    with ThreadPoolExecutor(max_workers=max_workers) as executor:
+        [executor.submit(save_image, imgs_array[i], i, out_dir) for i in range(num_images)]
+
+
+def get_default_encoding() -> dict:
+    """Returns the default ffmpeg encoding parameters used by `encode_video_frames`."""
+    signature = inspect.signature(encode_video_frames)
+    return {
+        k: v.default
+        for k, v in signature.parameters.items()
+        if v.default is not inspect.Parameter.empty and k in ["vcodec", "pix_fmt", "g", "crf"]
+    }
+
+
+def check_repo_id(repo_id: str) -> None:
+    if len(repo_id.split("/")) != 2:
+        raise ValueError(
+            f"""`repo_id` is expected to contain a community or user id `/` the name of the dataset
+            (e.g. 'lerobot/pusht'), but contains '{repo_id}'."""
+        )

lerobot/common/datasets/push_dataset_to_hub/xarm_pkl_format.py

@@ -0,0 +1,200 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""Process pickle files formatted like in: https://github.com/fyhMer/fowm"""
+
+import pickle
+import shutil
+from pathlib import Path
+
+import einops
+import torch
+import tqdm
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    calculate_episode_data_index,
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+
+def check_format(raw_dir):
+    keys = {"actions", "rewards", "dones"}
+    nested_keys = {"observations": {"rgb", "state"}, "next_observations": {"rgb", "state"}}
+
+    xarm_files = list(raw_dir.glob("*.pkl"))
+    assert len(xarm_files) > 0
+
+    with open(xarm_files[0], "rb") as f:
+        dataset_dict = pickle.load(f)
+
+    assert isinstance(dataset_dict, dict)
+    assert all(k in dataset_dict for k in keys)
+
+    # Check for consistent lengths in nested keys
+    expected_len = len(dataset_dict["actions"])
+    assert all(len(dataset_dict[key]) == expected_len for key in keys if key in dataset_dict)
+
+    for key, subkeys in nested_keys.items():
+        nested_dict = dataset_dict.get(key, {})
+        assert all(len(nested_dict[subkey]) == expected_len for subkey in subkeys if subkey in nested_dict)
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    pkl_path = raw_dir / "buffer.pkl"
+
+    with open(pkl_path, "rb") as f:
+        pkl_data = pickle.load(f)
+
+    # load data indices from which each episode starts and ends
+    from_ids, to_ids = [], []
+    from_idx, to_idx = 0, 0
+    for done in pkl_data["dones"]:
+        to_idx += 1
+        if not done:
+            continue
+        from_ids.append(from_idx)
+        to_ids.append(to_idx)
+        from_idx = to_idx
+
+    num_episodes = len(from_ids)
+
+    ep_dicts = []
+    ep_ids = episodes if episodes else range(num_episodes)
+    for ep_idx, selected_ep_idx in tqdm.tqdm(enumerate(ep_ids)):
+        from_idx = from_ids[selected_ep_idx]
+        to_idx = to_ids[selected_ep_idx]
+        num_frames = to_idx - from_idx
+
+        image = torch.tensor(pkl_data["observations"]["rgb"][from_idx:to_idx])
+        image = einops.rearrange(image, "b c h w -> b h w c")
+        state = torch.tensor(pkl_data["observations"]["state"][from_idx:to_idx])
+        action = torch.tensor(pkl_data["actions"][from_idx:to_idx])
+        # TODO(rcadene): we have a missing last frame which is the observation when the env is done
+        # it is critical to have this frame for tdmpc to predict a "done observation/state"
+        # next_image = torch.tensor(pkl_data["next_observations"]["rgb"][from_idx:to_idx])
+        # next_state = torch.tensor(pkl_data["next_observations"]["state"][from_idx:to_idx])
+        next_reward = torch.tensor(pkl_data["rewards"][from_idx:to_idx])
+        next_done = torch.tensor(pkl_data["dones"][from_idx:to_idx])
+
+        ep_dict = {}
+
+        imgs_array = [x.numpy() for x in image]
+        img_key = "observation.image"
+        if video:
+            # save png images in temporary directory
+            tmp_imgs_dir = videos_dir / "tmp_images"
+            save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+            # encode images to a mp4 video
+            fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+            video_path = videos_dir / fname
+            encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+            # clean temporary images directory
+            shutil.rmtree(tmp_imgs_dir)
+
+            # store the reference to the video frame
+            ep_dict[img_key] = [{"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)]
+        else:
+            ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+        ep_dict["observation.state"] = state
+        ep_dict["action"] = action
+        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames, dtype=torch.int64)
+        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+        # ep_dict["next.observation.image"] = next_image
+        # ep_dict["next.observation.state"] = next_state
+        ep_dict["next.reward"] = next_reward
+        ep_dict["next.done"] = next_done
+        ep_dicts.append(ep_dict)
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video):
+    features = {}
+
+    if video:
+        features["observation.image"] = VideoFrame()
+    else:
+        features["observation.image"] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.reward"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+    # TODO(rcadene): add success
+    # features["next.success"] = Value(dtype='bool', id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+):
+    # sanity check
+    check_format(raw_dir)
+
+    if fps is None:
+        fps = 15
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/pusht.py

@@ -1,219 +0,0 @@
-from pathlib import Path
-from typing import Callable
-
-import einops
-import numpy as np
-import pygame
-import pymunk
-import torch
-import torchrl
-import tqdm
-from tensordict import TensorDict
-from torchrl.data.replay_buffers.samplers import SliceSampler
-from torchrl.data.replay_buffers.storages import TensorStorage
-from torchrl.data.replay_buffers.writers import Writer
-
-from lerobot.common.datasets.abstract import AbstractExperienceReplay
-from lerobot.common.datasets.utils import download_and_extract_zip
-from lerobot.common.envs.pusht.pusht_env import pymunk_to_shapely
-from lerobot.common.policies.diffusion.replay_buffer import ReplayBuffer as DiffusionPolicyReplayBuffer
-
-# as define in env
-SUCCESS_THRESHOLD = 0.95  # 95% coverage,
-
-PUSHT_URL = "https://diffusion-policy.cs.columbia.edu/data/training/pusht.zip"
-PUSHT_ZARR = Path("pusht/pusht_cchi_v7_replay.zarr")
-
-
-def get_goal_pose_body(pose):
-    mass = 1
-    inertia = pymunk.moment_for_box(mass, (50, 100))
-    body = pymunk.Body(mass, inertia)
-    # preserving the legacy assignment order for compatibility
-    # the order here doesn't matter somehow, maybe because CoM is aligned with body origin
-    body.position = pose[:2].tolist()
-    body.angle = pose[2]
-    return body
-
-
-def add_segment(space, a, b, radius):
-    shape = pymunk.Segment(space.static_body, a, b, radius)
-    shape.color = pygame.Color("LightGray")  # https://htmlcolorcodes.com/color-names
-    return shape
-
-
-def add_tee(
-    space,
-    position,
-    angle,
-    scale=30,
-    color="LightSlateGray",
-    mask=None,
-):
-    if mask is None:
-        mask = pymunk.ShapeFilter.ALL_MASKS()
-    mass = 1
-    length = 4
-    vertices1 = [
-        (-length * scale / 2, scale),
-        (length * scale / 2, scale),
-        (length * scale / 2, 0),
-        (-length * scale / 2, 0),
-    ]
-    inertia1 = pymunk.moment_for_poly(mass, vertices=vertices1)
-    vertices2 = [
-        (-scale / 2, scale),
-        (-scale / 2, length * scale),
-        (scale / 2, length * scale),
-        (scale / 2, scale),
-    ]
-    inertia2 = pymunk.moment_for_poly(mass, vertices=vertices1)
-    body = pymunk.Body(mass, inertia1 + inertia2)
-    shape1 = pymunk.Poly(body, vertices1)
-    shape2 = pymunk.Poly(body, vertices2)
-    shape1.color = pygame.Color(color)
-    shape2.color = pygame.Color(color)
-    shape1.filter = pymunk.ShapeFilter(mask=mask)
-    shape2.filter = pymunk.ShapeFilter(mask=mask)
-    body.center_of_gravity = (shape1.center_of_gravity + shape2.center_of_gravity) / 2
-    body.position = position
-    body.angle = angle
-    body.friction = 1
-    space.add(body, shape1, shape2)
-    return body
-
-
-class PushtExperienceReplay(AbstractExperienceReplay):
-    def __init__(
-        self,
-        dataset_id: str,
-        batch_size: int = None,
-        *,
-        shuffle: bool = True,
-        root: Path | None = None,
-        pin_memory: bool = False,
-        prefetch: int = None,
-        sampler: SliceSampler = None,
-        collate_fn: Callable = None,
-        writer: Writer = None,
-        transform: "torchrl.envs.Transform" = None,
-    ):
-        super().__init__(
-            dataset_id,
-            batch_size,
-            shuffle=shuffle,
-            root=root,
-            pin_memory=pin_memory,
-            prefetch=prefetch,
-            sampler=sampler,
-            collate_fn=collate_fn,
-            writer=writer,
-            transform=transform,
-        )
-
-    def _download_and_preproc_obsolete(self):
-        assert self.root is not None
-        raw_dir = self.root / f"{self.dataset_id}_raw"
-        zarr_path = (raw_dir / PUSHT_ZARR).resolve()
-        if not zarr_path.is_dir():
-            raw_dir.mkdir(parents=True, exist_ok=True)
-            download_and_extract_zip(PUSHT_URL, raw_dir)
-
-        # load
-        dataset_dict = DiffusionPolicyReplayBuffer.copy_from_path(
-            zarr_path
-        )  # , keys=['img', 'state', 'action'])
-
-        episode_ids = torch.from_numpy(dataset_dict.get_episode_idxs())
-        num_episodes = dataset_dict.meta["episode_ends"].shape[0]
-        total_frames = dataset_dict["action"].shape[0]
-        # to create test artifact
-        # num_episodes = 1
-        # total_frames = 50
-        assert len(
-            {dataset_dict[key].shape[0] for key in dataset_dict.keys()}  # noqa: SIM118
-        ), "Some data type dont have the same number of total frames."
-
-        # TODO: verify that goal pose is expected to be fixed
-        goal_pos_angle = np.array([256, 256, np.pi / 4])  # x, y, theta (in radians)
-        goal_body = get_goal_pose_body(goal_pos_angle)
-
-        imgs = torch.from_numpy(dataset_dict["img"])
-        imgs = einops.rearrange(imgs, "b h w c -> b c h w")
-        states = torch.from_numpy(dataset_dict["state"])
-        actions = torch.from_numpy(dataset_dict["action"])
-
-        idx0 = 0
-        idxtd = 0
-        for episode_id in tqdm.tqdm(range(num_episodes)):
-            idx1 = dataset_dict.meta["episode_ends"][episode_id]
-            # to create test artifact
-            # idx1 = 51
-
-            num_frames = idx1 - idx0
-
-            assert (episode_ids[idx0:idx1] == episode_id).all()
-
-            image = imgs[idx0:idx1]
-
-            state = states[idx0:idx1]
-            agent_pos = state[:, :2]
-            block_pos = state[:, 2:4]
-            block_angle = state[:, 4]
-
-            reward = torch.zeros(num_frames, 1)
-            success = torch.zeros(num_frames, 1, dtype=torch.bool)
-            done = torch.zeros(num_frames, 1, dtype=torch.bool)
-            for i in range(num_frames):
-                space = pymunk.Space()
-                space.gravity = 0, 0
-                space.damping = 0
-
-                # Add walls.
-                walls = [
-                    add_segment(space, (5, 506), (5, 5), 2),
-                    add_segment(space, (5, 5), (506, 5), 2),
-                    add_segment(space, (506, 5), (506, 506), 2),
-                    add_segment(space, (5, 506), (506, 506), 2),
-                ]
-                space.add(*walls)
-
-                block_body = add_tee(space, block_pos[i].tolist(), block_angle[i].item())
-                goal_geom = pymunk_to_shapely(goal_body, block_body.shapes)
-                block_geom = pymunk_to_shapely(block_body, block_body.shapes)
-                intersection_area = goal_geom.intersection(block_geom).area
-                goal_area = goal_geom.area
-                coverage = intersection_area / goal_area
-                reward[i] = np.clip(coverage / SUCCESS_THRESHOLD, 0, 1)
-                success[i] = coverage > SUCCESS_THRESHOLD
-
-            # last step of demonstration is considered done
-            done[-1] = True
-
-            ep_td = TensorDict(
-                {
-                    ("observation", "image"): image[:-1],
-                    ("observation", "state"): agent_pos[:-1],
-                    "action": actions[idx0:idx1][:-1],
-                    "episode": episode_ids[idx0:idx1][:-1],
-                    "frame_id": torch.arange(0, num_frames - 1, 1),
-                    ("next", "observation", "image"): image[1:],
-                    ("next", "observation", "state"): agent_pos[1:],
-                    # TODO: verify that reward and done are aligned with image and agent_pos
-                    ("next", "reward"): reward[1:],
-                    ("next", "done"): done[1:],
-                    ("next", "success"): success[1:],
-                },
-                batch_size=num_frames - 1,
-            )
-
-            if episode_id == 0:
-                # hack to initialize tensordict data structure to store episodes
-                td_data = ep_td[0].expand(total_frames).memmap_like(self.root / f"{self.dataset_id}")
-
-            td_data[idxtd : idxtd + len(ep_td)] = ep_td
-
-            idx0 = idx1
-            idxtd = idxtd + len(ep_td)
-
-        return TensorStorage(td_data.lock_())

lerobot/common/datasets/sampler.py

@@ -0,0 +1,61 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+from typing import Iterator, Union
+
+import torch
+
+
+class EpisodeAwareSampler:
+    def __init__(
+        self,
+        episode_data_index: dict,
+        episode_indices_to_use: Union[list, None] = None,
+        drop_n_first_frames: int = 0,
+        drop_n_last_frames: int = 0,
+        shuffle: bool = False,
+    ):
+        """Sampler that optionally incorporates episode boundary information.
+
+        Args:
+            episode_data_index: Dictionary with keys 'from' and 'to' containing the start and end indices of each episode.
+            episode_indices_to_use: List of episode indices to use. If None, all episodes are used.
+                                    Assumes that episodes are indexed from 0 to N-1.
+            drop_n_first_frames: Number of frames to drop from the start of each episode.
+            drop_n_last_frames: Number of frames to drop from the end of each episode.
+            shuffle: Whether to shuffle the indices.
+        """
+        indices = []
+        for episode_idx, (start_index, end_index) in enumerate(
+            zip(episode_data_index["from"], episode_data_index["to"], strict=True)
+        ):
+            if episode_indices_to_use is None or episode_idx in episode_indices_to_use:
+                indices.extend(
+                    range(start_index.item() + drop_n_first_frames, end_index.item() - drop_n_last_frames)
+                )
+
+        self.indices = indices
+        self.shuffle = shuffle
+
+    def __iter__(self) -> Iterator[int]:
+        if self.shuffle:
+            for i in torch.randperm(len(self.indices)):
+                yield self.indices[i]
+        else:
+            for i in self.indices:
+                yield i
+
+    def __len__(self) -> int:
+        return len(self.indices)